Greasy Fork

来自缓存

Greasy Fork is available in English.

免Flash文件上传

北京交通大学课程平台功能增强脚本,实现信息聚合,附件上传,让你高效处理课程信息。

您需要先安装一款用户脚本管理器扩展,例如 Tampermonkey 篡改猴Greasemonkey 油猴子Violentmonkey 暴力猴,才能安装此脚本。

您需要先安装一款用户脚本管理器扩展,例如 Tampermonkey 篡改猴,才能安装此脚本。

您需要先安装一款用户脚本管理器扩展,例如 Tampermonkey 篡改猴Violentmonkey 暴力猴,才能安装此脚本。

您需要先安装一款用户脚本管理器扩展,例如 Tampermonkey 篡改猴Userscripts ,才能安装此脚本。

您需要先安装一款用户脚本管理器扩展,例如 Tampermonkey 篡改猴,才能安装此脚本。

您需要先安装一款用户脚本管理器扩展后才能安装此脚本。

(我已经安装了用户脚本管理器,让我安装!)

您需要先安装一款用户样式管理器扩展,比如 Stylus,才能安装此样式。

您需要先安装一款用户样式管理器扩展,比如 Stylus,才能安装此样式。

您需要先安装一款用户样式管理器扩展,比如 Stylus,才能安装此样式。

您需要先安装一款用户样式管理器扩展后才能安装此样式。

您需要先安装一款用户样式管理器扩展后才能安装此样式。

您需要先安装一款用户样式管理器扩展后才能安装此样式。

(我已经安装了用户样式管理器,让我安装!)

// ==UserScript==
// @name             免Flash文件上传
// @name:en          NO-FLASH-Upload
// @description      北京交通大学课程平台功能增强脚本,实现信息聚合,附件上传,让你高效处理课程信息。
// @description:en   Beijing Jiaotong University curriculum platform function enhancements, information aggregation, accessories uploading, allowing you to efficient course information.
// @version          1.9.10
// @author           ZiuChen
// @source           https://github.com/ZiuChen/NO-FLASH-Upload
// @license          MIT
// @match            *://cc.bjtu.edu.cn:81/meol*
// @namespace        http://greasyfork.icu/zh-CN/users/605474
// @require          https://fastly.jsdelivr.net/npm/[email protected]/dist/wangEditor.min.js
// @require          https://fastly.jsdelivr.net/npm/[email protected]/dist/gbk.min.js
// @require          https://fastly.jsdelivr.net/npm/[email protected]/dist/js/mdui.min.js
// @connect          raw.githubusercontent.com
// @connect          github.com
// @connect          fastly.jsdelivr.net
// @icon             https://gitee.com/ziuc/utool-filebed/raw/master/20210514-231824-0795.png
// ==/UserScript==


/******/ (() => { // webpackBootstrap
/******/ 	var __webpack_modules__ = ({

/***/ "./node_modules/css-loader/dist/runtime/api.js":
/***/ ((module) => {

"use strict";

/*
  MIT License http://www.opensource.org/licenses/mit-license.php
  Author Tobias Koppers @sokra
*/

module.exports = function (cssWithMappingToString) {
  var list = []; // return the list of modules as css string

  list.toString = function toString() {
    return this.map(function (item) {
      var content = "";
      var needLayer = typeof item[5] !== "undefined";

      if (item[4]) {
        content += "@supports (".concat(item[4], ") {");
      }

      if (item[2]) {
        content += "@media ".concat(item[2], " {");
      }

      if (needLayer) {
        content += "@layer".concat(item[5].length > 0 ? " ".concat(item[5]) : "", " {");
      }

      content += cssWithMappingToString(item);

      if (needLayer) {
        content += "}";
      }

      if (item[2]) {
        content += "}";
      }

      if (item[4]) {
        content += "}";
      }

      return content;
    }).join("");
  }; // import a list of modules into the list


  list.i = function i(modules, media, dedupe, supports, layer) {
    if (typeof modules === "string") {
      modules = [[null, modules, undefined]];
    }

    var alreadyImportedModules = {};

    if (dedupe) {
      for (var k = 0; k < this.length; k++) {
        var id = this[k][0];

        if (id != null) {
          alreadyImportedModules[id] = true;
        }
      }
    }

    for (var _k = 0; _k < modules.length; _k++) {
      var item = [].concat(modules[_k]);

      if (dedupe && alreadyImportedModules[item[0]]) {
        continue;
      }

      if (typeof layer !== "undefined") {
        if (typeof item[5] === "undefined") {
          item[5] = layer;
        } else {
          item[1] = "@layer".concat(item[5].length > 0 ? " ".concat(item[5]) : "", " {").concat(item[1], "}");
          item[5] = layer;
        }
      }

      if (media) {
        if (!item[2]) {
          item[2] = media;
        } else {
          item[1] = "@media ".concat(item[2], " {").concat(item[1], "}");
          item[2] = media;
        }
      }

      if (supports) {
        if (!item[4]) {
          item[4] = "".concat(supports);
        } else {
          item[1] = "@supports (".concat(item[4], ") {").concat(item[1], "}");
          item[4] = supports;
        }
      }

      list.push(item);
    }
  };

  return list;
};

/***/ }),

/***/ "./node_modules/css-loader/dist/runtime/noSourceMaps.js":
/***/ ((module) => {

"use strict";


module.exports = function (i) {
  return i[1];
};

/***/ }),

/***/ "./node_modules/dayjs/dayjs.min.js":
/***/ (function(module) {

!function (t, e) {
   true ? module.exports = e() : 0;
}(this, function () {
  "use strict";

  var t = 1e3,
      e = 6e4,
      n = 36e5,
      r = "millisecond",
      i = "second",
      s = "minute",
      u = "hour",
      a = "day",
      o = "week",
      f = "month",
      h = "quarter",
      c = "year",
      d = "date",
      $ = "Invalid Date",
      l = /^(\d{4})[-/]?(\d{1,2})?[-/]?(\d{0,2})[Tt\s]*(\d{1,2})?:?(\d{1,2})?:?(\d{1,2})?[.:]?(\d+)?$/,
      y = /\[([^\]]+)]|Y{1,4}|M{1,4}|D{1,2}|d{1,4}|H{1,2}|h{1,2}|a|A|m{1,2}|s{1,2}|Z{1,2}|SSS/g,
      M = {
    name: "en",
    weekdays: "Sunday_Monday_Tuesday_Wednesday_Thursday_Friday_Saturday".split("_"),
    months: "January_February_March_April_May_June_July_August_September_October_November_December".split("_")
  },
      m = function (t, e, n) {
    var r = String(t);
    return !r || r.length >= e ? t : "" + Array(e + 1 - r.length).join(n) + t;
  },
      g = {
    s: m,
    z: function (t) {
      var e = -t.utcOffset(),
          n = Math.abs(e),
          r = Math.floor(n / 60),
          i = n % 60;
      return (e <= 0 ? "+" : "-") + m(r, 2, "0") + ":" + m(i, 2, "0");
    },
    m: function t(e, n) {
      if (e.date() < n.date()) return -t(n, e);
      var r = 12 * (n.year() - e.year()) + (n.month() - e.month()),
          i = e.clone().add(r, f),
          s = n - i < 0,
          u = e.clone().add(r + (s ? -1 : 1), f);
      return +(-(r + (n - i) / (s ? i - u : u - i)) || 0);
    },
    a: function (t) {
      return t < 0 ? Math.ceil(t) || 0 : Math.floor(t);
    },
    p: function (t) {
      return {
        M: f,
        y: c,
        w: o,
        d: a,
        D: d,
        h: u,
        m: s,
        s: i,
        ms: r,
        Q: h
      }[t] || String(t || "").toLowerCase().replace(/s$/, "");
    },
    u: function (t) {
      return void 0 === t;
    }
  },
      D = "en",
      v = {};

  v[D] = M;

  var p = function (t) {
    return t instanceof _;
  },
      S = function (t, e, n) {
    var r;
    if (!t) return D;
    if ("string" == typeof t) v[t] && (r = t), e && (v[t] = e, r = t);else {
      var i = t.name;
      v[i] = t, r = i;
    }
    return !n && r && (D = r), r || !n && D;
  },
      w = function (t, e) {
    if (p(t)) return t.clone();
    var n = "object" == typeof e ? e : {};
    return n.date = t, n.args = arguments, new _(n);
  },
      O = g;

  O.l = S, O.i = p, O.w = function (t, e) {
    return w(t, {
      locale: e.$L,
      utc: e.$u,
      x: e.$x,
      $offset: e.$offset
    });
  };

  var _ = function () {
    function M(t) {
      this.$L = S(t.locale, null, !0), this.parse(t);
    }

    var m = M.prototype;
    return m.parse = function (t) {
      this.$d = function (t) {
        var e = t.date,
            n = t.utc;
        if (null === e) return new Date(NaN);
        if (O.u(e)) return new Date();
        if (e instanceof Date) return new Date(e);

        if ("string" == typeof e && !/Z$/i.test(e)) {
          var r = e.match(l);

          if (r) {
            var i = r[2] - 1 || 0,
                s = (r[7] || "0").substring(0, 3);
            return n ? new Date(Date.UTC(r[1], i, r[3] || 1, r[4] || 0, r[5] || 0, r[6] || 0, s)) : new Date(r[1], i, r[3] || 1, r[4] || 0, r[5] || 0, r[6] || 0, s);
          }
        }

        return new Date(e);
      }(t), this.$x = t.x || {}, this.init();
    }, m.init = function () {
      var t = this.$d;
      this.$y = t.getFullYear(), this.$M = t.getMonth(), this.$D = t.getDate(), this.$W = t.getDay(), this.$H = t.getHours(), this.$m = t.getMinutes(), this.$s = t.getSeconds(), this.$ms = t.getMilliseconds();
    }, m.$utils = function () {
      return O;
    }, m.isValid = function () {
      return !(this.$d.toString() === $);
    }, m.isSame = function (t, e) {
      var n = w(t);
      return this.startOf(e) <= n && n <= this.endOf(e);
    }, m.isAfter = function (t, e) {
      return w(t) < this.startOf(e);
    }, m.isBefore = function (t, e) {
      return this.endOf(e) < w(t);
    }, m.$g = function (t, e, n) {
      return O.u(t) ? this[e] : this.set(n, t);
    }, m.unix = function () {
      return Math.floor(this.valueOf() / 1e3);
    }, m.valueOf = function () {
      return this.$d.getTime();
    }, m.startOf = function (t, e) {
      var n = this,
          r = !!O.u(e) || e,
          h = O.p(t),
          $ = function (t, e) {
        var i = O.w(n.$u ? Date.UTC(n.$y, e, t) : new Date(n.$y, e, t), n);
        return r ? i : i.endOf(a);
      },
          l = function (t, e) {
        return O.w(n.toDate()[t].apply(n.toDate("s"), (r ? [0, 0, 0, 0] : [23, 59, 59, 999]).slice(e)), n);
      },
          y = this.$W,
          M = this.$M,
          m = this.$D,
          g = "set" + (this.$u ? "UTC" : "");

      switch (h) {
        case c:
          return r ? $(1, 0) : $(31, 11);

        case f:
          return r ? $(1, M) : $(0, M + 1);

        case o:
          var D = this.$locale().weekStart || 0,
              v = (y < D ? y + 7 : y) - D;
          return $(r ? m - v : m + (6 - v), M);

        case a:
        case d:
          return l(g + "Hours", 0);

        case u:
          return l(g + "Minutes", 1);

        case s:
          return l(g + "Seconds", 2);

        case i:
          return l(g + "Milliseconds", 3);

        default:
          return this.clone();
      }
    }, m.endOf = function (t) {
      return this.startOf(t, !1);
    }, m.$set = function (t, e) {
      var n,
          o = O.p(t),
          h = "set" + (this.$u ? "UTC" : ""),
          $ = (n = {}, n[a] = h + "Date", n[d] = h + "Date", n[f] = h + "Month", n[c] = h + "FullYear", n[u] = h + "Hours", n[s] = h + "Minutes", n[i] = h + "Seconds", n[r] = h + "Milliseconds", n)[o],
          l = o === a ? this.$D + (e - this.$W) : e;

      if (o === f || o === c) {
        var y = this.clone().set(d, 1);
        y.$d[$](l), y.init(), this.$d = y.set(d, Math.min(this.$D, y.daysInMonth())).$d;
      } else $ && this.$d[$](l);

      return this.init(), this;
    }, m.set = function (t, e) {
      return this.clone().$set(t, e);
    }, m.get = function (t) {
      return this[O.p(t)]();
    }, m.add = function (r, h) {
      var d,
          $ = this;
      r = Number(r);

      var l = O.p(h),
          y = function (t) {
        var e = w($);
        return O.w(e.date(e.date() + Math.round(t * r)), $);
      };

      if (l === f) return this.set(f, this.$M + r);
      if (l === c) return this.set(c, this.$y + r);
      if (l === a) return y(1);
      if (l === o) return y(7);
      var M = (d = {}, d[s] = e, d[u] = n, d[i] = t, d)[l] || 1,
          m = this.$d.getTime() + r * M;
      return O.w(m, this);
    }, m.subtract = function (t, e) {
      return this.add(-1 * t, e);
    }, m.format = function (t) {
      var e = this,
          n = this.$locale();
      if (!this.isValid()) return n.invalidDate || $;

      var r = t || "YYYY-MM-DDTHH:mm:ssZ",
          i = O.z(this),
          s = this.$H,
          u = this.$m,
          a = this.$M,
          o = n.weekdays,
          f = n.months,
          h = function (t, n, i, s) {
        return t && (t[n] || t(e, r)) || i[n].substr(0, s);
      },
          c = function (t) {
        return O.s(s % 12 || 12, t, "0");
      },
          d = n.meridiem || function (t, e, n) {
        var r = t < 12 ? "AM" : "PM";
        return n ? r.toLowerCase() : r;
      },
          l = {
        YY: String(this.$y).slice(-2),
        YYYY: this.$y,
        M: a + 1,
        MM: O.s(a + 1, 2, "0"),
        MMM: h(n.monthsShort, a, f, 3),
        MMMM: h(f, a),
        D: this.$D,
        DD: O.s(this.$D, 2, "0"),
        d: String(this.$W),
        dd: h(n.weekdaysMin, this.$W, o, 2),
        ddd: h(n.weekdaysShort, this.$W, o, 3),
        dddd: o[this.$W],
        H: String(s),
        HH: O.s(s, 2, "0"),
        h: c(1),
        hh: c(2),
        a: d(s, u, !0),
        A: d(s, u, !1),
        m: String(u),
        mm: O.s(u, 2, "0"),
        s: String(this.$s),
        ss: O.s(this.$s, 2, "0"),
        SSS: O.s(this.$ms, 3, "0"),
        Z: i
      };

      return r.replace(y, function (t, e) {
        return e || l[t] || i.replace(":", "");
      });
    }, m.utcOffset = function () {
      return 15 * -Math.round(this.$d.getTimezoneOffset() / 15);
    }, m.diff = function (r, d, $) {
      var l,
          y = O.p(d),
          M = w(r),
          m = (M.utcOffset() - this.utcOffset()) * e,
          g = this - M,
          D = O.m(this, M);
      return D = (l = {}, l[c] = D / 12, l[f] = D, l[h] = D / 3, l[o] = (g - m) / 6048e5, l[a] = (g - m) / 864e5, l[u] = g / n, l[s] = g / e, l[i] = g / t, l)[y] || g, $ ? D : O.a(D);
    }, m.daysInMonth = function () {
      return this.endOf(f).$D;
    }, m.$locale = function () {
      return v[this.$L];
    }, m.locale = function (t, e) {
      if (!t) return this.$L;
      var n = this.clone(),
          r = S(t, e, !0);
      return r && (n.$L = r), n;
    }, m.clone = function () {
      return O.w(this.$d, this);
    }, m.toDate = function () {
      return new Date(this.valueOf());
    }, m.toJSON = function () {
      return this.isValid() ? this.toISOString() : null;
    }, m.toISOString = function () {
      return this.$d.toISOString();
    }, m.toString = function () {
      return this.$d.toUTCString();
    }, M;
  }(),
      b = _.prototype;

  return w.prototype = b, [["$ms", r], ["$s", i], ["$m", s], ["$H", u], ["$W", a], ["$M", f], ["$y", c], ["$D", d]].forEach(function (t) {
    b[t[1]] = function (e) {
      return this.$g(e, t[0], t[1]);
    };
  }), w.extend = function (t, e) {
    return t.$i || (t(e, _, w), t.$i = !0), w;
  }, w.locale = S, w.isDayjs = p, w.unix = function (t) {
    return w(1e3 * t);
  }, w.en = v[D], w.Ls = v, w.p = {}, w;
});

/***/ }),

/***/ "./node_modules/dayjs/plugin/localeData.js":
/***/ (function(module) {

!function (n, e) {
   true ? module.exports = e() : 0;
}(this, function () {
  "use strict";

  return function (n, e, t) {
    var r = e.prototype,
        o = function (n) {
      return n && (n.indexOf ? n : n.s);
    },
        u = function (n, e, t, r, u) {
      var i = n.name ? n : n.$locale(),
          a = o(i[e]),
          s = o(i[t]),
          f = a || s.map(function (n) {
        return n.substr(0, r);
      });
      if (!u) return f;
      var d = i.weekStart;
      return f.map(function (n, e) {
        return f[(e + (d || 0)) % 7];
      });
    },
        i = function () {
      return t.Ls[t.locale()];
    },
        a = function (n, e) {
      return n.formats[e] || function (n) {
        return n.replace(/(\[[^\]]+])|(MMMM|MM|DD|dddd)/g, function (n, e, t) {
          return e || t.slice(1);
        });
      }(n.formats[e.toUpperCase()]);
    },
        s = function () {
      var n = this;
      return {
        months: function (e) {
          return e ? e.format("MMMM") : u(n, "months");
        },
        monthsShort: function (e) {
          return e ? e.format("MMM") : u(n, "monthsShort", "months", 3);
        },
        firstDayOfWeek: function () {
          return n.$locale().weekStart || 0;
        },
        weekdays: function (e) {
          return e ? e.format("dddd") : u(n, "weekdays");
        },
        weekdaysMin: function (e) {
          return e ? e.format("dd") : u(n, "weekdaysMin", "weekdays", 2);
        },
        weekdaysShort: function (e) {
          return e ? e.format("ddd") : u(n, "weekdaysShort", "weekdays", 3);
        },
        longDateFormat: function (e) {
          return a(n.$locale(), e);
        },
        meridiem: this.$locale().meridiem,
        ordinal: this.$locale().ordinal
      };
    };

    r.localeData = function () {
      return s.bind(this)();
    }, t.localeData = function () {
      var n = i();
      return {
        firstDayOfWeek: function () {
          return n.weekStart || 0;
        },
        weekdays: function () {
          return t.weekdays();
        },
        weekdaysShort: function () {
          return t.weekdaysShort();
        },
        weekdaysMin: function () {
          return t.weekdaysMin();
        },
        months: function () {
          return t.months();
        },
        monthsShort: function () {
          return t.monthsShort();
        },
        longDateFormat: function (e) {
          return a(n, e);
        },
        meridiem: n.meridiem,
        ordinal: n.ordinal
      };
    }, t.months = function () {
      return u(i(), "months");
    }, t.monthsShort = function () {
      return u(i(), "monthsShort", "months", 3);
    }, t.weekdays = function (n) {
      return u(i(), "weekdays", null, null, n);
    }, t.weekdaysShort = function (n) {
      return u(i(), "weekdaysShort", "weekdays", 3, n);
    }, t.weekdaysMin = function (n) {
      return u(i(), "weekdaysMin", "weekdays", 2, n);
    };
  };
});

/***/ }),

/***/ "./node_modules/lodash/_DataView.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getNative = __webpack_require__("./node_modules/lodash/_getNative.js"),
    root = __webpack_require__("./node_modules/lodash/_root.js");
/* Built-in method references that are verified to be native. */


var DataView = getNative(root, 'DataView');
module.exports = DataView;

/***/ }),

/***/ "./node_modules/lodash/_Hash.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var hashClear = __webpack_require__("./node_modules/lodash/_hashClear.js"),
    hashDelete = __webpack_require__("./node_modules/lodash/_hashDelete.js"),
    hashGet = __webpack_require__("./node_modules/lodash/_hashGet.js"),
    hashHas = __webpack_require__("./node_modules/lodash/_hashHas.js"),
    hashSet = __webpack_require__("./node_modules/lodash/_hashSet.js");
/**
 * Creates a hash object.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */


function Hash(entries) {
  var index = -1,
      length = entries == null ? 0 : entries.length;
  this.clear();

  while (++index < length) {
    var entry = entries[index];
    this.set(entry[0], entry[1]);
  }
} // Add methods to `Hash`.


Hash.prototype.clear = hashClear;
Hash.prototype['delete'] = hashDelete;
Hash.prototype.get = hashGet;
Hash.prototype.has = hashHas;
Hash.prototype.set = hashSet;
module.exports = Hash;

/***/ }),

/***/ "./node_modules/lodash/_ListCache.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var listCacheClear = __webpack_require__("./node_modules/lodash/_listCacheClear.js"),
    listCacheDelete = __webpack_require__("./node_modules/lodash/_listCacheDelete.js"),
    listCacheGet = __webpack_require__("./node_modules/lodash/_listCacheGet.js"),
    listCacheHas = __webpack_require__("./node_modules/lodash/_listCacheHas.js"),
    listCacheSet = __webpack_require__("./node_modules/lodash/_listCacheSet.js");
/**
 * Creates an list cache object.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */


function ListCache(entries) {
  var index = -1,
      length = entries == null ? 0 : entries.length;
  this.clear();

  while (++index < length) {
    var entry = entries[index];
    this.set(entry[0], entry[1]);
  }
} // Add methods to `ListCache`.


ListCache.prototype.clear = listCacheClear;
ListCache.prototype['delete'] = listCacheDelete;
ListCache.prototype.get = listCacheGet;
ListCache.prototype.has = listCacheHas;
ListCache.prototype.set = listCacheSet;
module.exports = ListCache;

/***/ }),

/***/ "./node_modules/lodash/_Map.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getNative = __webpack_require__("./node_modules/lodash/_getNative.js"),
    root = __webpack_require__("./node_modules/lodash/_root.js");
/* Built-in method references that are verified to be native. */


var Map = getNative(root, 'Map');
module.exports = Map;

/***/ }),

/***/ "./node_modules/lodash/_MapCache.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var mapCacheClear = __webpack_require__("./node_modules/lodash/_mapCacheClear.js"),
    mapCacheDelete = __webpack_require__("./node_modules/lodash/_mapCacheDelete.js"),
    mapCacheGet = __webpack_require__("./node_modules/lodash/_mapCacheGet.js"),
    mapCacheHas = __webpack_require__("./node_modules/lodash/_mapCacheHas.js"),
    mapCacheSet = __webpack_require__("./node_modules/lodash/_mapCacheSet.js");
/**
 * Creates a map cache object to store key-value pairs.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */


function MapCache(entries) {
  var index = -1,
      length = entries == null ? 0 : entries.length;
  this.clear();

  while (++index < length) {
    var entry = entries[index];
    this.set(entry[0], entry[1]);
  }
} // Add methods to `MapCache`.


MapCache.prototype.clear = mapCacheClear;
MapCache.prototype['delete'] = mapCacheDelete;
MapCache.prototype.get = mapCacheGet;
MapCache.prototype.has = mapCacheHas;
MapCache.prototype.set = mapCacheSet;
module.exports = MapCache;

/***/ }),

/***/ "./node_modules/lodash/_Promise.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getNative = __webpack_require__("./node_modules/lodash/_getNative.js"),
    root = __webpack_require__("./node_modules/lodash/_root.js");
/* Built-in method references that are verified to be native. */


var Promise = getNative(root, 'Promise');
module.exports = Promise;

/***/ }),

/***/ "./node_modules/lodash/_Set.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getNative = __webpack_require__("./node_modules/lodash/_getNative.js"),
    root = __webpack_require__("./node_modules/lodash/_root.js");
/* Built-in method references that are verified to be native. */


var Set = getNative(root, 'Set');
module.exports = Set;

/***/ }),

/***/ "./node_modules/lodash/_SetCache.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var MapCache = __webpack_require__("./node_modules/lodash/_MapCache.js"),
    setCacheAdd = __webpack_require__("./node_modules/lodash/_setCacheAdd.js"),
    setCacheHas = __webpack_require__("./node_modules/lodash/_setCacheHas.js");
/**
 *
 * Creates an array cache object to store unique values.
 *
 * @private
 * @constructor
 * @param {Array} [values] The values to cache.
 */


function SetCache(values) {
  var index = -1,
      length = values == null ? 0 : values.length;
  this.__data__ = new MapCache();

  while (++index < length) {
    this.add(values[index]);
  }
} // Add methods to `SetCache`.


SetCache.prototype.add = SetCache.prototype.push = setCacheAdd;
SetCache.prototype.has = setCacheHas;
module.exports = SetCache;

/***/ }),

/***/ "./node_modules/lodash/_Stack.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var ListCache = __webpack_require__("./node_modules/lodash/_ListCache.js"),
    stackClear = __webpack_require__("./node_modules/lodash/_stackClear.js"),
    stackDelete = __webpack_require__("./node_modules/lodash/_stackDelete.js"),
    stackGet = __webpack_require__("./node_modules/lodash/_stackGet.js"),
    stackHas = __webpack_require__("./node_modules/lodash/_stackHas.js"),
    stackSet = __webpack_require__("./node_modules/lodash/_stackSet.js");
/**
 * Creates a stack cache object to store key-value pairs.
 *
 * @private
 * @constructor
 * @param {Array} [entries] The key-value pairs to cache.
 */


function Stack(entries) {
  var data = this.__data__ = new ListCache(entries);
  this.size = data.size;
} // Add methods to `Stack`.


Stack.prototype.clear = stackClear;
Stack.prototype['delete'] = stackDelete;
Stack.prototype.get = stackGet;
Stack.prototype.has = stackHas;
Stack.prototype.set = stackSet;
module.exports = Stack;

/***/ }),

/***/ "./node_modules/lodash/_Symbol.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var root = __webpack_require__("./node_modules/lodash/_root.js");
/** Built-in value references. */


var Symbol = root.Symbol;
module.exports = Symbol;

/***/ }),

/***/ "./node_modules/lodash/_Uint8Array.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var root = __webpack_require__("./node_modules/lodash/_root.js");
/** Built-in value references. */


var Uint8Array = root.Uint8Array;
module.exports = Uint8Array;

/***/ }),

/***/ "./node_modules/lodash/_WeakMap.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getNative = __webpack_require__("./node_modules/lodash/_getNative.js"),
    root = __webpack_require__("./node_modules/lodash/_root.js");
/* Built-in method references that are verified to be native. */


var WeakMap = getNative(root, 'WeakMap');
module.exports = WeakMap;

/***/ }),

/***/ "./node_modules/lodash/_arrayEach.js":
/***/ ((module) => {

/**
 * A specialized version of `_.forEach` for arrays without support for
 * iteratee shorthands.
 *
 * @private
 * @param {Array} [array] The array to iterate over.
 * @param {Function} iteratee The function invoked per iteration.
 * @returns {Array} Returns `array`.
 */
function arrayEach(array, iteratee) {
  var index = -1,
      length = array == null ? 0 : array.length;

  while (++index < length) {
    if (iteratee(array[index], index, array) === false) {
      break;
    }
  }

  return array;
}

module.exports = arrayEach;

/***/ }),

/***/ "./node_modules/lodash/_arrayFilter.js":
/***/ ((module) => {

/**
 * A specialized version of `_.filter` for arrays without support for
 * iteratee shorthands.
 *
 * @private
 * @param {Array} [array] The array to iterate over.
 * @param {Function} predicate The function invoked per iteration.
 * @returns {Array} Returns the new filtered array.
 */
function arrayFilter(array, predicate) {
  var index = -1,
      length = array == null ? 0 : array.length,
      resIndex = 0,
      result = [];

  while (++index < length) {
    var value = array[index];

    if (predicate(value, index, array)) {
      result[resIndex++] = value;
    }
  }

  return result;
}

module.exports = arrayFilter;

/***/ }),

/***/ "./node_modules/lodash/_arrayLikeKeys.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseTimes = __webpack_require__("./node_modules/lodash/_baseTimes.js"),
    isArguments = __webpack_require__("./node_modules/lodash/isArguments.js"),
    isArray = __webpack_require__("./node_modules/lodash/isArray.js"),
    isBuffer = __webpack_require__("./node_modules/lodash/isBuffer.js"),
    isIndex = __webpack_require__("./node_modules/lodash/_isIndex.js"),
    isTypedArray = __webpack_require__("./node_modules/lodash/isTypedArray.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * Creates an array of the enumerable property names of the array-like `value`.
 *
 * @private
 * @param {*} value The value to query.
 * @param {boolean} inherited Specify returning inherited property names.
 * @returns {Array} Returns the array of property names.
 */

function arrayLikeKeys(value, inherited) {
  var isArr = isArray(value),
      isArg = !isArr && isArguments(value),
      isBuff = !isArr && !isArg && isBuffer(value),
      isType = !isArr && !isArg && !isBuff && isTypedArray(value),
      skipIndexes = isArr || isArg || isBuff || isType,
      result = skipIndexes ? baseTimes(value.length, String) : [],
      length = result.length;

  for (var key in value) {
    if ((inherited || hasOwnProperty.call(value, key)) && !(skipIndexes && ( // Safari 9 has enumerable `arguments.length` in strict mode.
    key == 'length' || // Node.js 0.10 has enumerable non-index properties on buffers.
    isBuff && (key == 'offset' || key == 'parent') || // PhantomJS 2 has enumerable non-index properties on typed arrays.
    isType && (key == 'buffer' || key == 'byteLength' || key == 'byteOffset') || // Skip index properties.
    isIndex(key, length)))) {
      result.push(key);
    }
  }

  return result;
}

module.exports = arrayLikeKeys;

/***/ }),

/***/ "./node_modules/lodash/_arrayMap.js":
/***/ ((module) => {

/**
 * A specialized version of `_.map` for arrays without support for iteratee
 * shorthands.
 *
 * @private
 * @param {Array} [array] The array to iterate over.
 * @param {Function} iteratee The function invoked per iteration.
 * @returns {Array} Returns the new mapped array.
 */
function arrayMap(array, iteratee) {
  var index = -1,
      length = array == null ? 0 : array.length,
      result = Array(length);

  while (++index < length) {
    result[index] = iteratee(array[index], index, array);
  }

  return result;
}

module.exports = arrayMap;

/***/ }),

/***/ "./node_modules/lodash/_arrayPush.js":
/***/ ((module) => {

/**
 * Appends the elements of `values` to `array`.
 *
 * @private
 * @param {Array} array The array to modify.
 * @param {Array} values The values to append.
 * @returns {Array} Returns `array`.
 */
function arrayPush(array, values) {
  var index = -1,
      length = values.length,
      offset = array.length;

  while (++index < length) {
    array[offset + index] = values[index];
  }

  return array;
}

module.exports = arrayPush;

/***/ }),

/***/ "./node_modules/lodash/_arraySome.js":
/***/ ((module) => {

/**
 * A specialized version of `_.some` for arrays without support for iteratee
 * shorthands.
 *
 * @private
 * @param {Array} [array] The array to iterate over.
 * @param {Function} predicate The function invoked per iteration.
 * @returns {boolean} Returns `true` if any element passes the predicate check,
 *  else `false`.
 */
function arraySome(array, predicate) {
  var index = -1,
      length = array == null ? 0 : array.length;

  while (++index < length) {
    if (predicate(array[index], index, array)) {
      return true;
    }
  }

  return false;
}

module.exports = arraySome;

/***/ }),

/***/ "./node_modules/lodash/_assignValue.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseAssignValue = __webpack_require__("./node_modules/lodash/_baseAssignValue.js"),
    eq = __webpack_require__("./node_modules/lodash/eq.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * Assigns `value` to `key` of `object` if the existing value is not equivalent
 * using [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
 * for equality comparisons.
 *
 * @private
 * @param {Object} object The object to modify.
 * @param {string} key The key of the property to assign.
 * @param {*} value The value to assign.
 */

function assignValue(object, key, value) {
  var objValue = object[key];

  if (!(hasOwnProperty.call(object, key) && eq(objValue, value)) || value === undefined && !(key in object)) {
    baseAssignValue(object, key, value);
  }
}

module.exports = assignValue;

/***/ }),

/***/ "./node_modules/lodash/_assocIndexOf.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var eq = __webpack_require__("./node_modules/lodash/eq.js");
/**
 * Gets the index at which the `key` is found in `array` of key-value pairs.
 *
 * @private
 * @param {Array} array The array to inspect.
 * @param {*} key The key to search for.
 * @returns {number} Returns the index of the matched value, else `-1`.
 */


function assocIndexOf(array, key) {
  var length = array.length;

  while (length--) {
    if (eq(array[length][0], key)) {
      return length;
    }
  }

  return -1;
}

module.exports = assocIndexOf;

/***/ }),

/***/ "./node_modules/lodash/_baseAssign.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var copyObject = __webpack_require__("./node_modules/lodash/_copyObject.js"),
    keys = __webpack_require__("./node_modules/lodash/keys.js");
/**
 * The base implementation of `_.assign` without support for multiple sources
 * or `customizer` functions.
 *
 * @private
 * @param {Object} object The destination object.
 * @param {Object} source The source object.
 * @returns {Object} Returns `object`.
 */


function baseAssign(object, source) {
  return object && copyObject(source, keys(source), object);
}

module.exports = baseAssign;

/***/ }),

/***/ "./node_modules/lodash/_baseAssignIn.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var copyObject = __webpack_require__("./node_modules/lodash/_copyObject.js"),
    keysIn = __webpack_require__("./node_modules/lodash/keysIn.js");
/**
 * The base implementation of `_.assignIn` without support for multiple sources
 * or `customizer` functions.
 *
 * @private
 * @param {Object} object The destination object.
 * @param {Object} source The source object.
 * @returns {Object} Returns `object`.
 */


function baseAssignIn(object, source) {
  return object && copyObject(source, keysIn(source), object);
}

module.exports = baseAssignIn;

/***/ }),

/***/ "./node_modules/lodash/_baseAssignValue.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var defineProperty = __webpack_require__("./node_modules/lodash/_defineProperty.js");
/**
 * The base implementation of `assignValue` and `assignMergeValue` without
 * value checks.
 *
 * @private
 * @param {Object} object The object to modify.
 * @param {string} key The key of the property to assign.
 * @param {*} value The value to assign.
 */


function baseAssignValue(object, key, value) {
  if (key == '__proto__' && defineProperty) {
    defineProperty(object, key, {
      'configurable': true,
      'enumerable': true,
      'value': value,
      'writable': true
    });
  } else {
    object[key] = value;
  }
}

module.exports = baseAssignValue;

/***/ }),

/***/ "./node_modules/lodash/_baseClone.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Stack = __webpack_require__("./node_modules/lodash/_Stack.js"),
    arrayEach = __webpack_require__("./node_modules/lodash/_arrayEach.js"),
    assignValue = __webpack_require__("./node_modules/lodash/_assignValue.js"),
    baseAssign = __webpack_require__("./node_modules/lodash/_baseAssign.js"),
    baseAssignIn = __webpack_require__("./node_modules/lodash/_baseAssignIn.js"),
    cloneBuffer = __webpack_require__("./node_modules/lodash/_cloneBuffer.js"),
    copyArray = __webpack_require__("./node_modules/lodash/_copyArray.js"),
    copySymbols = __webpack_require__("./node_modules/lodash/_copySymbols.js"),
    copySymbolsIn = __webpack_require__("./node_modules/lodash/_copySymbolsIn.js"),
    getAllKeys = __webpack_require__("./node_modules/lodash/_getAllKeys.js"),
    getAllKeysIn = __webpack_require__("./node_modules/lodash/_getAllKeysIn.js"),
    getTag = __webpack_require__("./node_modules/lodash/_getTag.js"),
    initCloneArray = __webpack_require__("./node_modules/lodash/_initCloneArray.js"),
    initCloneByTag = __webpack_require__("./node_modules/lodash/_initCloneByTag.js"),
    initCloneObject = __webpack_require__("./node_modules/lodash/_initCloneObject.js"),
    isArray = __webpack_require__("./node_modules/lodash/isArray.js"),
    isBuffer = __webpack_require__("./node_modules/lodash/isBuffer.js"),
    isMap = __webpack_require__("./node_modules/lodash/isMap.js"),
    isObject = __webpack_require__("./node_modules/lodash/isObject.js"),
    isSet = __webpack_require__("./node_modules/lodash/isSet.js"),
    keys = __webpack_require__("./node_modules/lodash/keys.js"),
    keysIn = __webpack_require__("./node_modules/lodash/keysIn.js");
/** Used to compose bitmasks for cloning. */


var CLONE_DEEP_FLAG = 1,
    CLONE_FLAT_FLAG = 2,
    CLONE_SYMBOLS_FLAG = 4;
/** `Object#toString` result references. */

var argsTag = '[object Arguments]',
    arrayTag = '[object Array]',
    boolTag = '[object Boolean]',
    dateTag = '[object Date]',
    errorTag = '[object Error]',
    funcTag = '[object Function]',
    genTag = '[object GeneratorFunction]',
    mapTag = '[object Map]',
    numberTag = '[object Number]',
    objectTag = '[object Object]',
    regexpTag = '[object RegExp]',
    setTag = '[object Set]',
    stringTag = '[object String]',
    symbolTag = '[object Symbol]',
    weakMapTag = '[object WeakMap]';
var arrayBufferTag = '[object ArrayBuffer]',
    dataViewTag = '[object DataView]',
    float32Tag = '[object Float32Array]',
    float64Tag = '[object Float64Array]',
    int8Tag = '[object Int8Array]',
    int16Tag = '[object Int16Array]',
    int32Tag = '[object Int32Array]',
    uint8Tag = '[object Uint8Array]',
    uint8ClampedTag = '[object Uint8ClampedArray]',
    uint16Tag = '[object Uint16Array]',
    uint32Tag = '[object Uint32Array]';
/** Used to identify `toStringTag` values supported by `_.clone`. */

var cloneableTags = {};
cloneableTags[argsTag] = cloneableTags[arrayTag] = cloneableTags[arrayBufferTag] = cloneableTags[dataViewTag] = cloneableTags[boolTag] = cloneableTags[dateTag] = cloneableTags[float32Tag] = cloneableTags[float64Tag] = cloneableTags[int8Tag] = cloneableTags[int16Tag] = cloneableTags[int32Tag] = cloneableTags[mapTag] = cloneableTags[numberTag] = cloneableTags[objectTag] = cloneableTags[regexpTag] = cloneableTags[setTag] = cloneableTags[stringTag] = cloneableTags[symbolTag] = cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true;
cloneableTags[errorTag] = cloneableTags[funcTag] = cloneableTags[weakMapTag] = false;
/**
 * The base implementation of `_.clone` and `_.cloneDeep` which tracks
 * traversed objects.
 *
 * @private
 * @param {*} value The value to clone.
 * @param {boolean} bitmask The bitmask flags.
 *  1 - Deep clone
 *  2 - Flatten inherited properties
 *  4 - Clone symbols
 * @param {Function} [customizer] The function to customize cloning.
 * @param {string} [key] The key of `value`.
 * @param {Object} [object] The parent object of `value`.
 * @param {Object} [stack] Tracks traversed objects and their clone counterparts.
 * @returns {*} Returns the cloned value.
 */

function baseClone(value, bitmask, customizer, key, object, stack) {
  var result,
      isDeep = bitmask & CLONE_DEEP_FLAG,
      isFlat = bitmask & CLONE_FLAT_FLAG,
      isFull = bitmask & CLONE_SYMBOLS_FLAG;

  if (customizer) {
    result = object ? customizer(value, key, object, stack) : customizer(value);
  }

  if (result !== undefined) {
    return result;
  }

  if (!isObject(value)) {
    return value;
  }

  var isArr = isArray(value);

  if (isArr) {
    result = initCloneArray(value);

    if (!isDeep) {
      return copyArray(value, result);
    }
  } else {
    var tag = getTag(value),
        isFunc = tag == funcTag || tag == genTag;

    if (isBuffer(value)) {
      return cloneBuffer(value, isDeep);
    }

    if (tag == objectTag || tag == argsTag || isFunc && !object) {
      result = isFlat || isFunc ? {} : initCloneObject(value);

      if (!isDeep) {
        return isFlat ? copySymbolsIn(value, baseAssignIn(result, value)) : copySymbols(value, baseAssign(result, value));
      }
    } else {
      if (!cloneableTags[tag]) {
        return object ? value : {};
      }

      result = initCloneByTag(value, tag, isDeep);
    }
  } // Check for circular references and return its corresponding clone.


  stack || (stack = new Stack());
  var stacked = stack.get(value);

  if (stacked) {
    return stacked;
  }

  stack.set(value, result);

  if (isSet(value)) {
    value.forEach(function (subValue) {
      result.add(baseClone(subValue, bitmask, customizer, subValue, value, stack));
    });
  } else if (isMap(value)) {
    value.forEach(function (subValue, key) {
      result.set(key, baseClone(subValue, bitmask, customizer, key, value, stack));
    });
  }

  var keysFunc = isFull ? isFlat ? getAllKeysIn : getAllKeys : isFlat ? keysIn : keys;
  var props = isArr ? undefined : keysFunc(value);
  arrayEach(props || value, function (subValue, key) {
    if (props) {
      key = subValue;
      subValue = value[key];
    } // Recursively populate clone (susceptible to call stack limits).


    assignValue(result, key, baseClone(subValue, bitmask, customizer, key, value, stack));
  });
  return result;
}

module.exports = baseClone;

/***/ }),

/***/ "./node_modules/lodash/_baseCreate.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isObject = __webpack_require__("./node_modules/lodash/isObject.js");
/** Built-in value references. */


var objectCreate = Object.create;
/**
 * The base implementation of `_.create` without support for assigning
 * properties to the created object.
 *
 * @private
 * @param {Object} proto The object to inherit from.
 * @returns {Object} Returns the new object.
 */

var baseCreate = function () {
  function object() {}

  return function (proto) {
    if (!isObject(proto)) {
      return {};
    }

    if (objectCreate) {
      return objectCreate(proto);
    }

    object.prototype = proto;
    var result = new object();
    object.prototype = undefined;
    return result;
  };
}();

module.exports = baseCreate;

/***/ }),

/***/ "./node_modules/lodash/_baseGet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var castPath = __webpack_require__("./node_modules/lodash/_castPath.js"),
    toKey = __webpack_require__("./node_modules/lodash/_toKey.js");
/**
 * The base implementation of `_.get` without support for default values.
 *
 * @private
 * @param {Object} object The object to query.
 * @param {Array|string} path The path of the property to get.
 * @returns {*} Returns the resolved value.
 */


function baseGet(object, path) {
  path = castPath(path, object);
  var index = 0,
      length = path.length;

  while (object != null && index < length) {
    object = object[toKey(path[index++])];
  }

  return index && index == length ? object : undefined;
}

module.exports = baseGet;

/***/ }),

/***/ "./node_modules/lodash/_baseGetAllKeys.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var arrayPush = __webpack_require__("./node_modules/lodash/_arrayPush.js"),
    isArray = __webpack_require__("./node_modules/lodash/isArray.js");
/**
 * The base implementation of `getAllKeys` and `getAllKeysIn` which uses
 * `keysFunc` and `symbolsFunc` to get the enumerable property names and
 * symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @param {Function} keysFunc The function to get the keys of `object`.
 * @param {Function} symbolsFunc The function to get the symbols of `object`.
 * @returns {Array} Returns the array of property names and symbols.
 */


function baseGetAllKeys(object, keysFunc, symbolsFunc) {
  var result = keysFunc(object);
  return isArray(object) ? result : arrayPush(result, symbolsFunc(object));
}

module.exports = baseGetAllKeys;

/***/ }),

/***/ "./node_modules/lodash/_baseGetTag.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Symbol = __webpack_require__("./node_modules/lodash/_Symbol.js"),
    getRawTag = __webpack_require__("./node_modules/lodash/_getRawTag.js"),
    objectToString = __webpack_require__("./node_modules/lodash/_objectToString.js");
/** `Object#toString` result references. */


var nullTag = '[object Null]',
    undefinedTag = '[object Undefined]';
/** Built-in value references. */

var symToStringTag = Symbol ? Symbol.toStringTag : undefined;
/**
 * The base implementation of `getTag` without fallbacks for buggy environments.
 *
 * @private
 * @param {*} value The value to query.
 * @returns {string} Returns the `toStringTag`.
 */

function baseGetTag(value) {
  if (value == null) {
    return value === undefined ? undefinedTag : nullTag;
  }

  return symToStringTag && symToStringTag in Object(value) ? getRawTag(value) : objectToString(value);
}

module.exports = baseGetTag;

/***/ }),

/***/ "./node_modules/lodash/_baseIsArguments.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseGetTag = __webpack_require__("./node_modules/lodash/_baseGetTag.js"),
    isObjectLike = __webpack_require__("./node_modules/lodash/isObjectLike.js");
/** `Object#toString` result references. */


var argsTag = '[object Arguments]';
/**
 * The base implementation of `_.isArguments`.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an `arguments` object,
 */

function baseIsArguments(value) {
  return isObjectLike(value) && baseGetTag(value) == argsTag;
}

module.exports = baseIsArguments;

/***/ }),

/***/ "./node_modules/lodash/_baseIsEqual.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseIsEqualDeep = __webpack_require__("./node_modules/lodash/_baseIsEqualDeep.js"),
    isObjectLike = __webpack_require__("./node_modules/lodash/isObjectLike.js");
/**
 * The base implementation of `_.isEqual` which supports partial comparisons
 * and tracks traversed objects.
 *
 * @private
 * @param {*} value The value to compare.
 * @param {*} other The other value to compare.
 * @param {boolean} bitmask The bitmask flags.
 *  1 - Unordered comparison
 *  2 - Partial comparison
 * @param {Function} [customizer] The function to customize comparisons.
 * @param {Object} [stack] Tracks traversed `value` and `other` objects.
 * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
 */


function baseIsEqual(value, other, bitmask, customizer, stack) {
  if (value === other) {
    return true;
  }

  if (value == null || other == null || !isObjectLike(value) && !isObjectLike(other)) {
    return value !== value && other !== other;
  }

  return baseIsEqualDeep(value, other, bitmask, customizer, baseIsEqual, stack);
}

module.exports = baseIsEqual;

/***/ }),

/***/ "./node_modules/lodash/_baseIsEqualDeep.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Stack = __webpack_require__("./node_modules/lodash/_Stack.js"),
    equalArrays = __webpack_require__("./node_modules/lodash/_equalArrays.js"),
    equalByTag = __webpack_require__("./node_modules/lodash/_equalByTag.js"),
    equalObjects = __webpack_require__("./node_modules/lodash/_equalObjects.js"),
    getTag = __webpack_require__("./node_modules/lodash/_getTag.js"),
    isArray = __webpack_require__("./node_modules/lodash/isArray.js"),
    isBuffer = __webpack_require__("./node_modules/lodash/isBuffer.js"),
    isTypedArray = __webpack_require__("./node_modules/lodash/isTypedArray.js");
/** Used to compose bitmasks for value comparisons. */


var COMPARE_PARTIAL_FLAG = 1;
/** `Object#toString` result references. */

var argsTag = '[object Arguments]',
    arrayTag = '[object Array]',
    objectTag = '[object Object]';
/** Used for built-in method references. */

var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * A specialized version of `baseIsEqual` for arrays and objects which performs
 * deep comparisons and tracks traversed objects enabling objects with circular
 * references to be compared.
 *
 * @private
 * @param {Object} object The object to compare.
 * @param {Object} other The other object to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} [stack] Tracks traversed `object` and `other` objects.
 * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
 */

function baseIsEqualDeep(object, other, bitmask, customizer, equalFunc, stack) {
  var objIsArr = isArray(object),
      othIsArr = isArray(other),
      objTag = objIsArr ? arrayTag : getTag(object),
      othTag = othIsArr ? arrayTag : getTag(other);
  objTag = objTag == argsTag ? objectTag : objTag;
  othTag = othTag == argsTag ? objectTag : othTag;
  var objIsObj = objTag == objectTag,
      othIsObj = othTag == objectTag,
      isSameTag = objTag == othTag;

  if (isSameTag && isBuffer(object)) {
    if (!isBuffer(other)) {
      return false;
    }

    objIsArr = true;
    objIsObj = false;
  }

  if (isSameTag && !objIsObj) {
    stack || (stack = new Stack());
    return objIsArr || isTypedArray(object) ? equalArrays(object, other, bitmask, customizer, equalFunc, stack) : equalByTag(object, other, objTag, bitmask, customizer, equalFunc, stack);
  }

  if (!(bitmask & COMPARE_PARTIAL_FLAG)) {
    var objIsWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'),
        othIsWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__');

    if (objIsWrapped || othIsWrapped) {
      var objUnwrapped = objIsWrapped ? object.value() : object,
          othUnwrapped = othIsWrapped ? other.value() : other;
      stack || (stack = new Stack());
      return equalFunc(objUnwrapped, othUnwrapped, bitmask, customizer, stack);
    }
  }

  if (!isSameTag) {
    return false;
  }

  stack || (stack = new Stack());
  return equalObjects(object, other, bitmask, customizer, equalFunc, stack);
}

module.exports = baseIsEqualDeep;

/***/ }),

/***/ "./node_modules/lodash/_baseIsMap.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getTag = __webpack_require__("./node_modules/lodash/_getTag.js"),
    isObjectLike = __webpack_require__("./node_modules/lodash/isObjectLike.js");
/** `Object#toString` result references. */


var mapTag = '[object Map]';
/**
 * The base implementation of `_.isMap` without Node.js optimizations.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a map, else `false`.
 */

function baseIsMap(value) {
  return isObjectLike(value) && getTag(value) == mapTag;
}

module.exports = baseIsMap;

/***/ }),

/***/ "./node_modules/lodash/_baseIsNative.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isFunction = __webpack_require__("./node_modules/lodash/isFunction.js"),
    isMasked = __webpack_require__("./node_modules/lodash/_isMasked.js"),
    isObject = __webpack_require__("./node_modules/lodash/isObject.js"),
    toSource = __webpack_require__("./node_modules/lodash/_toSource.js");
/**
 * Used to match `RegExp`
 * [syntax characters](http://ecma-international.org/ecma-262/7.0/#sec-patterns).
 */


var reRegExpChar = /[\\^$.*+?()[\]{}|]/g;
/** Used to detect host constructors (Safari). */

var reIsHostCtor = /^\[object .+?Constructor\]$/;
/** Used for built-in method references. */

var funcProto = Function.prototype,
    objectProto = Object.prototype;
/** Used to resolve the decompiled source of functions. */

var funcToString = funcProto.toString;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/** Used to detect if a method is native. */

var reIsNative = RegExp('^' + funcToString.call(hasOwnProperty).replace(reRegExpChar, '\\$&').replace(/hasOwnProperty|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$');
/**
 * The base implementation of `_.isNative` without bad shim checks.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a native function,
 *  else `false`.
 */

function baseIsNative(value) {
  if (!isObject(value) || isMasked(value)) {
    return false;
  }

  var pattern = isFunction(value) ? reIsNative : reIsHostCtor;
  return pattern.test(toSource(value));
}

module.exports = baseIsNative;

/***/ }),

/***/ "./node_modules/lodash/_baseIsSet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getTag = __webpack_require__("./node_modules/lodash/_getTag.js"),
    isObjectLike = __webpack_require__("./node_modules/lodash/isObjectLike.js");
/** `Object#toString` result references. */


var setTag = '[object Set]';
/**
 * The base implementation of `_.isSet` without Node.js optimizations.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a set, else `false`.
 */

function baseIsSet(value) {
  return isObjectLike(value) && getTag(value) == setTag;
}

module.exports = baseIsSet;

/***/ }),

/***/ "./node_modules/lodash/_baseIsTypedArray.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseGetTag = __webpack_require__("./node_modules/lodash/_baseGetTag.js"),
    isLength = __webpack_require__("./node_modules/lodash/isLength.js"),
    isObjectLike = __webpack_require__("./node_modules/lodash/isObjectLike.js");
/** `Object#toString` result references. */


var argsTag = '[object Arguments]',
    arrayTag = '[object Array]',
    boolTag = '[object Boolean]',
    dateTag = '[object Date]',
    errorTag = '[object Error]',
    funcTag = '[object Function]',
    mapTag = '[object Map]',
    numberTag = '[object Number]',
    objectTag = '[object Object]',
    regexpTag = '[object RegExp]',
    setTag = '[object Set]',
    stringTag = '[object String]',
    weakMapTag = '[object WeakMap]';
var arrayBufferTag = '[object ArrayBuffer]',
    dataViewTag = '[object DataView]',
    float32Tag = '[object Float32Array]',
    float64Tag = '[object Float64Array]',
    int8Tag = '[object Int8Array]',
    int16Tag = '[object Int16Array]',
    int32Tag = '[object Int32Array]',
    uint8Tag = '[object Uint8Array]',
    uint8ClampedTag = '[object Uint8ClampedArray]',
    uint16Tag = '[object Uint16Array]',
    uint32Tag = '[object Uint32Array]';
/** Used to identify `toStringTag` values of typed arrays. */

var typedArrayTags = {};
typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = typedArrayTags[uint32Tag] = true;
typedArrayTags[argsTag] = typedArrayTags[arrayTag] = typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = typedArrayTags[dataViewTag] = typedArrayTags[dateTag] = typedArrayTags[errorTag] = typedArrayTags[funcTag] = typedArrayTags[mapTag] = typedArrayTags[numberTag] = typedArrayTags[objectTag] = typedArrayTags[regexpTag] = typedArrayTags[setTag] = typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false;
/**
 * The base implementation of `_.isTypedArray` without Node.js optimizations.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
 */

function baseIsTypedArray(value) {
  return isObjectLike(value) && isLength(value.length) && !!typedArrayTags[baseGetTag(value)];
}

module.exports = baseIsTypedArray;

/***/ }),

/***/ "./node_modules/lodash/_baseKeys.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isPrototype = __webpack_require__("./node_modules/lodash/_isPrototype.js"),
    nativeKeys = __webpack_require__("./node_modules/lodash/_nativeKeys.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * The base implementation of `_.keys` which doesn't treat sparse arrays as dense.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names.
 */

function baseKeys(object) {
  if (!isPrototype(object)) {
    return nativeKeys(object);
  }

  var result = [];

  for (var key in Object(object)) {
    if (hasOwnProperty.call(object, key) && key != 'constructor') {
      result.push(key);
    }
  }

  return result;
}

module.exports = baseKeys;

/***/ }),

/***/ "./node_modules/lodash/_baseKeysIn.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isObject = __webpack_require__("./node_modules/lodash/isObject.js"),
    isPrototype = __webpack_require__("./node_modules/lodash/_isPrototype.js"),
    nativeKeysIn = __webpack_require__("./node_modules/lodash/_nativeKeysIn.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * The base implementation of `_.keysIn` which doesn't treat sparse arrays as dense.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names.
 */

function baseKeysIn(object) {
  if (!isObject(object)) {
    return nativeKeysIn(object);
  }

  var isProto = isPrototype(object),
      result = [];

  for (var key in object) {
    if (!(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) {
      result.push(key);
    }
  }

  return result;
}

module.exports = baseKeysIn;

/***/ }),

/***/ "./node_modules/lodash/_baseTimes.js":
/***/ ((module) => {

/**
 * The base implementation of `_.times` without support for iteratee shorthands
 * or max array length checks.
 *
 * @private
 * @param {number} n The number of times to invoke `iteratee`.
 * @param {Function} iteratee The function invoked per iteration.
 * @returns {Array} Returns the array of results.
 */
function baseTimes(n, iteratee) {
  var index = -1,
      result = Array(n);

  while (++index < n) {
    result[index] = iteratee(index);
  }

  return result;
}

module.exports = baseTimes;

/***/ }),

/***/ "./node_modules/lodash/_baseToString.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Symbol = __webpack_require__("./node_modules/lodash/_Symbol.js"),
    arrayMap = __webpack_require__("./node_modules/lodash/_arrayMap.js"),
    isArray = __webpack_require__("./node_modules/lodash/isArray.js"),
    isSymbol = __webpack_require__("./node_modules/lodash/isSymbol.js");
/** Used as references for various `Number` constants. */


var INFINITY = 1 / 0;
/** Used to convert symbols to primitives and strings. */

var symbolProto = Symbol ? Symbol.prototype : undefined,
    symbolToString = symbolProto ? symbolProto.toString : undefined;
/**
 * The base implementation of `_.toString` which doesn't convert nullish
 * values to empty strings.
 *
 * @private
 * @param {*} value The value to process.
 * @returns {string} Returns the string.
 */

function baseToString(value) {
  // Exit early for strings to avoid a performance hit in some environments.
  if (typeof value == 'string') {
    return value;
  }

  if (isArray(value)) {
    // Recursively convert values (susceptible to call stack limits).
    return arrayMap(value, baseToString) + '';
  }

  if (isSymbol(value)) {
    return symbolToString ? symbolToString.call(value) : '';
  }

  var result = value + '';
  return result == '0' && 1 / value == -INFINITY ? '-0' : result;
}

module.exports = baseToString;

/***/ }),

/***/ "./node_modules/lodash/_baseTrim.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var trimmedEndIndex = __webpack_require__("./node_modules/lodash/_trimmedEndIndex.js");
/** Used to match leading whitespace. */


var reTrimStart = /^\s+/;
/**
 * The base implementation of `_.trim`.
 *
 * @private
 * @param {string} string The string to trim.
 * @returns {string} Returns the trimmed string.
 */

function baseTrim(string) {
  return string ? string.slice(0, trimmedEndIndex(string) + 1).replace(reTrimStart, '') : string;
}

module.exports = baseTrim;

/***/ }),

/***/ "./node_modules/lodash/_baseUnary.js":
/***/ ((module) => {

/**
 * The base implementation of `_.unary` without support for storing metadata.
 *
 * @private
 * @param {Function} func The function to cap arguments for.
 * @returns {Function} Returns the new capped function.
 */
function baseUnary(func) {
  return function (value) {
    return func(value);
  };
}

module.exports = baseUnary;

/***/ }),

/***/ "./node_modules/lodash/_cacheHas.js":
/***/ ((module) => {

/**
 * Checks if a `cache` value for `key` exists.
 *
 * @private
 * @param {Object} cache The cache to query.
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */
function cacheHas(cache, key) {
  return cache.has(key);
}

module.exports = cacheHas;

/***/ }),

/***/ "./node_modules/lodash/_castPath.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isArray = __webpack_require__("./node_modules/lodash/isArray.js"),
    isKey = __webpack_require__("./node_modules/lodash/_isKey.js"),
    stringToPath = __webpack_require__("./node_modules/lodash/_stringToPath.js"),
    toString = __webpack_require__("./node_modules/lodash/toString.js");
/**
 * Casts `value` to a path array if it's not one.
 *
 * @private
 * @param {*} value The value to inspect.
 * @param {Object} [object] The object to query keys on.
 * @returns {Array} Returns the cast property path array.
 */


function castPath(value, object) {
  if (isArray(value)) {
    return value;
  }

  return isKey(value, object) ? [value] : stringToPath(toString(value));
}

module.exports = castPath;

/***/ }),

/***/ "./node_modules/lodash/_cloneArrayBuffer.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Uint8Array = __webpack_require__("./node_modules/lodash/_Uint8Array.js");
/**
 * Creates a clone of `arrayBuffer`.
 *
 * @private
 * @param {ArrayBuffer} arrayBuffer The array buffer to clone.
 * @returns {ArrayBuffer} Returns the cloned array buffer.
 */


function cloneArrayBuffer(arrayBuffer) {
  var result = new arrayBuffer.constructor(arrayBuffer.byteLength);
  new Uint8Array(result).set(new Uint8Array(arrayBuffer));
  return result;
}

module.exports = cloneArrayBuffer;

/***/ }),

/***/ "./node_modules/lodash/_cloneBuffer.js":
/***/ ((module, exports, __webpack_require__) => {

/* module decorator */ module = __webpack_require__.nmd(module);
var root = __webpack_require__("./node_modules/lodash/_root.js");
/** Detect free variable `exports`. */


var freeExports =  true && exports && !exports.nodeType && exports;
/** Detect free variable `module`. */

var freeModule = freeExports && "object" == 'object' && module && !module.nodeType && module;
/** Detect the popular CommonJS extension `module.exports`. */

var moduleExports = freeModule && freeModule.exports === freeExports;
/** Built-in value references. */

var Buffer = moduleExports ? root.Buffer : undefined,
    allocUnsafe = Buffer ? Buffer.allocUnsafe : undefined;
/**
 * Creates a clone of  `buffer`.
 *
 * @private
 * @param {Buffer} buffer The buffer to clone.
 * @param {boolean} [isDeep] Specify a deep clone.
 * @returns {Buffer} Returns the cloned buffer.
 */

function cloneBuffer(buffer, isDeep) {
  if (isDeep) {
    return buffer.slice();
  }

  var length = buffer.length,
      result = allocUnsafe ? allocUnsafe(length) : new buffer.constructor(length);
  buffer.copy(result);
  return result;
}

module.exports = cloneBuffer;

/***/ }),

/***/ "./node_modules/lodash/_cloneDataView.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var cloneArrayBuffer = __webpack_require__("./node_modules/lodash/_cloneArrayBuffer.js");
/**
 * Creates a clone of `dataView`.
 *
 * @private
 * @param {Object} dataView The data view to clone.
 * @param {boolean} [isDeep] Specify a deep clone.
 * @returns {Object} Returns the cloned data view.
 */


function cloneDataView(dataView, isDeep) {
  var buffer = isDeep ? cloneArrayBuffer(dataView.buffer) : dataView.buffer;
  return new dataView.constructor(buffer, dataView.byteOffset, dataView.byteLength);
}

module.exports = cloneDataView;

/***/ }),

/***/ "./node_modules/lodash/_cloneRegExp.js":
/***/ ((module) => {

/** Used to match `RegExp` flags from their coerced string values. */
var reFlags = /\w*$/;
/**
 * Creates a clone of `regexp`.
 *
 * @private
 * @param {Object} regexp The regexp to clone.
 * @returns {Object} Returns the cloned regexp.
 */

function cloneRegExp(regexp) {
  var result = new regexp.constructor(regexp.source, reFlags.exec(regexp));
  result.lastIndex = regexp.lastIndex;
  return result;
}

module.exports = cloneRegExp;

/***/ }),

/***/ "./node_modules/lodash/_cloneSymbol.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Symbol = __webpack_require__("./node_modules/lodash/_Symbol.js");
/** Used to convert symbols to primitives and strings. */


var symbolProto = Symbol ? Symbol.prototype : undefined,
    symbolValueOf = symbolProto ? symbolProto.valueOf : undefined;
/**
 * Creates a clone of the `symbol` object.
 *
 * @private
 * @param {Object} symbol The symbol object to clone.
 * @returns {Object} Returns the cloned symbol object.
 */

function cloneSymbol(symbol) {
  return symbolValueOf ? Object(symbolValueOf.call(symbol)) : {};
}

module.exports = cloneSymbol;

/***/ }),

/***/ "./node_modules/lodash/_cloneTypedArray.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var cloneArrayBuffer = __webpack_require__("./node_modules/lodash/_cloneArrayBuffer.js");
/**
 * Creates a clone of `typedArray`.
 *
 * @private
 * @param {Object} typedArray The typed array to clone.
 * @param {boolean} [isDeep] Specify a deep clone.
 * @returns {Object} Returns the cloned typed array.
 */


function cloneTypedArray(typedArray, isDeep) {
  var buffer = isDeep ? cloneArrayBuffer(typedArray.buffer) : typedArray.buffer;
  return new typedArray.constructor(buffer, typedArray.byteOffset, typedArray.length);
}

module.exports = cloneTypedArray;

/***/ }),

/***/ "./node_modules/lodash/_copyArray.js":
/***/ ((module) => {

/**
 * Copies the values of `source` to `array`.
 *
 * @private
 * @param {Array} source The array to copy values from.
 * @param {Array} [array=[]] The array to copy values to.
 * @returns {Array} Returns `array`.
 */
function copyArray(source, array) {
  var index = -1,
      length = source.length;
  array || (array = Array(length));

  while (++index < length) {
    array[index] = source[index];
  }

  return array;
}

module.exports = copyArray;

/***/ }),

/***/ "./node_modules/lodash/_copyObject.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var assignValue = __webpack_require__("./node_modules/lodash/_assignValue.js"),
    baseAssignValue = __webpack_require__("./node_modules/lodash/_baseAssignValue.js");
/**
 * Copies properties of `source` to `object`.
 *
 * @private
 * @param {Object} source The object to copy properties from.
 * @param {Array} props The property identifiers to copy.
 * @param {Object} [object={}] The object to copy properties to.
 * @param {Function} [customizer] The function to customize copied values.
 * @returns {Object} Returns `object`.
 */


function copyObject(source, props, object, customizer) {
  var isNew = !object;
  object || (object = {});
  var index = -1,
      length = props.length;

  while (++index < length) {
    var key = props[index];
    var newValue = customizer ? customizer(object[key], source[key], key, object, source) : undefined;

    if (newValue === undefined) {
      newValue = source[key];
    }

    if (isNew) {
      baseAssignValue(object, key, newValue);
    } else {
      assignValue(object, key, newValue);
    }
  }

  return object;
}

module.exports = copyObject;

/***/ }),

/***/ "./node_modules/lodash/_copySymbols.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var copyObject = __webpack_require__("./node_modules/lodash/_copyObject.js"),
    getSymbols = __webpack_require__("./node_modules/lodash/_getSymbols.js");
/**
 * Copies own symbols of `source` to `object`.
 *
 * @private
 * @param {Object} source The object to copy symbols from.
 * @param {Object} [object={}] The object to copy symbols to.
 * @returns {Object} Returns `object`.
 */


function copySymbols(source, object) {
  return copyObject(source, getSymbols(source), object);
}

module.exports = copySymbols;

/***/ }),

/***/ "./node_modules/lodash/_copySymbolsIn.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var copyObject = __webpack_require__("./node_modules/lodash/_copyObject.js"),
    getSymbolsIn = __webpack_require__("./node_modules/lodash/_getSymbolsIn.js");
/**
 * Copies own and inherited symbols of `source` to `object`.
 *
 * @private
 * @param {Object} source The object to copy symbols from.
 * @param {Object} [object={}] The object to copy symbols to.
 * @returns {Object} Returns `object`.
 */


function copySymbolsIn(source, object) {
  return copyObject(source, getSymbolsIn(source), object);
}

module.exports = copySymbolsIn;

/***/ }),

/***/ "./node_modules/lodash/_coreJsData.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var root = __webpack_require__("./node_modules/lodash/_root.js");
/** Used to detect overreaching core-js shims. */


var coreJsData = root['__core-js_shared__'];
module.exports = coreJsData;

/***/ }),

/***/ "./node_modules/lodash/_defineProperty.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getNative = __webpack_require__("./node_modules/lodash/_getNative.js");

var defineProperty = function () {
  try {
    var func = getNative(Object, 'defineProperty');
    func({}, '', {});
    return func;
  } catch (e) {}
}();

module.exports = defineProperty;

/***/ }),

/***/ "./node_modules/lodash/_equalArrays.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var SetCache = __webpack_require__("./node_modules/lodash/_SetCache.js"),
    arraySome = __webpack_require__("./node_modules/lodash/_arraySome.js"),
    cacheHas = __webpack_require__("./node_modules/lodash/_cacheHas.js");
/** Used to compose bitmasks for value comparisons. */


var COMPARE_PARTIAL_FLAG = 1,
    COMPARE_UNORDERED_FLAG = 2;
/**
 * A specialized version of `baseIsEqualDeep` for arrays with support for
 * partial deep comparisons.
 *
 * @private
 * @param {Array} array The array to compare.
 * @param {Array} other The other array to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} stack Tracks traversed `array` and `other` objects.
 * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`.
 */

function equalArrays(array, other, bitmask, customizer, equalFunc, stack) {
  var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
      arrLength = array.length,
      othLength = other.length;

  if (arrLength != othLength && !(isPartial && othLength > arrLength)) {
    return false;
  } // Check that cyclic values are equal.


  var arrStacked = stack.get(array);
  var othStacked = stack.get(other);

  if (arrStacked && othStacked) {
    return arrStacked == other && othStacked == array;
  }

  var index = -1,
      result = true,
      seen = bitmask & COMPARE_UNORDERED_FLAG ? new SetCache() : undefined;
  stack.set(array, other);
  stack.set(other, array); // Ignore non-index properties.

  while (++index < arrLength) {
    var arrValue = array[index],
        othValue = other[index];

    if (customizer) {
      var compared = isPartial ? customizer(othValue, arrValue, index, other, array, stack) : customizer(arrValue, othValue, index, array, other, stack);
    }

    if (compared !== undefined) {
      if (compared) {
        continue;
      }

      result = false;
      break;
    } // Recursively compare arrays (susceptible to call stack limits).


    if (seen) {
      if (!arraySome(other, function (othValue, othIndex) {
        if (!cacheHas(seen, othIndex) && (arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
          return seen.push(othIndex);
        }
      })) {
        result = false;
        break;
      }
    } else if (!(arrValue === othValue || equalFunc(arrValue, othValue, bitmask, customizer, stack))) {
      result = false;
      break;
    }
  }

  stack['delete'](array);
  stack['delete'](other);
  return result;
}

module.exports = equalArrays;

/***/ }),

/***/ "./node_modules/lodash/_equalByTag.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Symbol = __webpack_require__("./node_modules/lodash/_Symbol.js"),
    Uint8Array = __webpack_require__("./node_modules/lodash/_Uint8Array.js"),
    eq = __webpack_require__("./node_modules/lodash/eq.js"),
    equalArrays = __webpack_require__("./node_modules/lodash/_equalArrays.js"),
    mapToArray = __webpack_require__("./node_modules/lodash/_mapToArray.js"),
    setToArray = __webpack_require__("./node_modules/lodash/_setToArray.js");
/** Used to compose bitmasks for value comparisons. */


var COMPARE_PARTIAL_FLAG = 1,
    COMPARE_UNORDERED_FLAG = 2;
/** `Object#toString` result references. */

var boolTag = '[object Boolean]',
    dateTag = '[object Date]',
    errorTag = '[object Error]',
    mapTag = '[object Map]',
    numberTag = '[object Number]',
    regexpTag = '[object RegExp]',
    setTag = '[object Set]',
    stringTag = '[object String]',
    symbolTag = '[object Symbol]';
var arrayBufferTag = '[object ArrayBuffer]',
    dataViewTag = '[object DataView]';
/** Used to convert symbols to primitives and strings. */

var symbolProto = Symbol ? Symbol.prototype : undefined,
    symbolValueOf = symbolProto ? symbolProto.valueOf : undefined;
/**
 * A specialized version of `baseIsEqualDeep` for comparing objects of
 * the same `toStringTag`.
 *
 * **Note:** This function only supports comparing values with tags of
 * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`.
 *
 * @private
 * @param {Object} object The object to compare.
 * @param {Object} other The other object to compare.
 * @param {string} tag The `toStringTag` of the objects to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} stack Tracks traversed `object` and `other` objects.
 * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
 */

function equalByTag(object, other, tag, bitmask, customizer, equalFunc, stack) {
  switch (tag) {
    case dataViewTag:
      if (object.byteLength != other.byteLength || object.byteOffset != other.byteOffset) {
        return false;
      }

      object = object.buffer;
      other = other.buffer;

    case arrayBufferTag:
      if (object.byteLength != other.byteLength || !equalFunc(new Uint8Array(object), new Uint8Array(other))) {
        return false;
      }

      return true;

    case boolTag:
    case dateTag:
    case numberTag:
      // Coerce booleans to `1` or `0` and dates to milliseconds.
      // Invalid dates are coerced to `NaN`.
      return eq(+object, +other);

    case errorTag:
      return object.name == other.name && object.message == other.message;

    case regexpTag:
    case stringTag:
      // Coerce regexes to strings and treat strings, primitives and objects,
      // as equal. See http://www.ecma-international.org/ecma-262/7.0/#sec-regexp.prototype.tostring
      // for more details.
      return object == other + '';

    case mapTag:
      var convert = mapToArray;

    case setTag:
      var isPartial = bitmask & COMPARE_PARTIAL_FLAG;
      convert || (convert = setToArray);

      if (object.size != other.size && !isPartial) {
        return false;
      } // Assume cyclic values are equal.


      var stacked = stack.get(object);

      if (stacked) {
        return stacked == other;
      }

      bitmask |= COMPARE_UNORDERED_FLAG; // Recursively compare objects (susceptible to call stack limits).

      stack.set(object, other);
      var result = equalArrays(convert(object), convert(other), bitmask, customizer, equalFunc, stack);
      stack['delete'](object);
      return result;

    case symbolTag:
      if (symbolValueOf) {
        return symbolValueOf.call(object) == symbolValueOf.call(other);
      }

  }

  return false;
}

module.exports = equalByTag;

/***/ }),

/***/ "./node_modules/lodash/_equalObjects.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getAllKeys = __webpack_require__("./node_modules/lodash/_getAllKeys.js");
/** Used to compose bitmasks for value comparisons. */


var COMPARE_PARTIAL_FLAG = 1;
/** Used for built-in method references. */

var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * A specialized version of `baseIsEqualDeep` for objects with support for
 * partial deep comparisons.
 *
 * @private
 * @param {Object} object The object to compare.
 * @param {Object} other The other object to compare.
 * @param {number} bitmask The bitmask flags. See `baseIsEqual` for more details.
 * @param {Function} customizer The function to customize comparisons.
 * @param {Function} equalFunc The function to determine equivalents of values.
 * @param {Object} stack Tracks traversed `object` and `other` objects.
 * @returns {boolean} Returns `true` if the objects are equivalent, else `false`.
 */

function equalObjects(object, other, bitmask, customizer, equalFunc, stack) {
  var isPartial = bitmask & COMPARE_PARTIAL_FLAG,
      objProps = getAllKeys(object),
      objLength = objProps.length,
      othProps = getAllKeys(other),
      othLength = othProps.length;

  if (objLength != othLength && !isPartial) {
    return false;
  }

  var index = objLength;

  while (index--) {
    var key = objProps[index];

    if (!(isPartial ? key in other : hasOwnProperty.call(other, key))) {
      return false;
    }
  } // Check that cyclic values are equal.


  var objStacked = stack.get(object);
  var othStacked = stack.get(other);

  if (objStacked && othStacked) {
    return objStacked == other && othStacked == object;
  }

  var result = true;
  stack.set(object, other);
  stack.set(other, object);
  var skipCtor = isPartial;

  while (++index < objLength) {
    key = objProps[index];
    var objValue = object[key],
        othValue = other[key];

    if (customizer) {
      var compared = isPartial ? customizer(othValue, objValue, key, other, object, stack) : customizer(objValue, othValue, key, object, other, stack);
    } // Recursively compare objects (susceptible to call stack limits).


    if (!(compared === undefined ? objValue === othValue || equalFunc(objValue, othValue, bitmask, customizer, stack) : compared)) {
      result = false;
      break;
    }

    skipCtor || (skipCtor = key == 'constructor');
  }

  if (result && !skipCtor) {
    var objCtor = object.constructor,
        othCtor = other.constructor; // Non `Object` object instances with different constructors are not equal.

    if (objCtor != othCtor && 'constructor' in object && 'constructor' in other && !(typeof objCtor == 'function' && objCtor instanceof objCtor && typeof othCtor == 'function' && othCtor instanceof othCtor)) {
      result = false;
    }
  }

  stack['delete'](object);
  stack['delete'](other);
  return result;
}

module.exports = equalObjects;

/***/ }),

/***/ "./node_modules/lodash/_freeGlobal.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

/** Detect free variable `global` from Node.js. */
var freeGlobal = typeof __webpack_require__.g == 'object' && __webpack_require__.g && __webpack_require__.g.Object === Object && __webpack_require__.g;
module.exports = freeGlobal;

/***/ }),

/***/ "./node_modules/lodash/_getAllKeys.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseGetAllKeys = __webpack_require__("./node_modules/lodash/_baseGetAllKeys.js"),
    getSymbols = __webpack_require__("./node_modules/lodash/_getSymbols.js"),
    keys = __webpack_require__("./node_modules/lodash/keys.js");
/**
 * Creates an array of own enumerable property names and symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names and symbols.
 */


function getAllKeys(object) {
  return baseGetAllKeys(object, keys, getSymbols);
}

module.exports = getAllKeys;

/***/ }),

/***/ "./node_modules/lodash/_getAllKeysIn.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseGetAllKeys = __webpack_require__("./node_modules/lodash/_baseGetAllKeys.js"),
    getSymbolsIn = __webpack_require__("./node_modules/lodash/_getSymbolsIn.js"),
    keysIn = __webpack_require__("./node_modules/lodash/keysIn.js");
/**
 * Creates an array of own and inherited enumerable property names and
 * symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names and symbols.
 */


function getAllKeysIn(object) {
  return baseGetAllKeys(object, keysIn, getSymbolsIn);
}

module.exports = getAllKeysIn;

/***/ }),

/***/ "./node_modules/lodash/_getMapData.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isKeyable = __webpack_require__("./node_modules/lodash/_isKeyable.js");
/**
 * Gets the data for `map`.
 *
 * @private
 * @param {Object} map The map to query.
 * @param {string} key The reference key.
 * @returns {*} Returns the map data.
 */


function getMapData(map, key) {
  var data = map.__data__;
  return isKeyable(key) ? data[typeof key == 'string' ? 'string' : 'hash'] : data.map;
}

module.exports = getMapData;

/***/ }),

/***/ "./node_modules/lodash/_getNative.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseIsNative = __webpack_require__("./node_modules/lodash/_baseIsNative.js"),
    getValue = __webpack_require__("./node_modules/lodash/_getValue.js");
/**
 * Gets the native function at `key` of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @param {string} key The key of the method to get.
 * @returns {*} Returns the function if it's native, else `undefined`.
 */


function getNative(object, key) {
  var value = getValue(object, key);
  return baseIsNative(value) ? value : undefined;
}

module.exports = getNative;

/***/ }),

/***/ "./node_modules/lodash/_getPrototype.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var overArg = __webpack_require__("./node_modules/lodash/_overArg.js");
/** Built-in value references. */


var getPrototype = overArg(Object.getPrototypeOf, Object);
module.exports = getPrototype;

/***/ }),

/***/ "./node_modules/lodash/_getRawTag.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Symbol = __webpack_require__("./node_modules/lodash/_Symbol.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * Used to resolve the
 * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
 * of values.
 */

var nativeObjectToString = objectProto.toString;
/** Built-in value references. */

var symToStringTag = Symbol ? Symbol.toStringTag : undefined;
/**
 * A specialized version of `baseGetTag` which ignores `Symbol.toStringTag` values.
 *
 * @private
 * @param {*} value The value to query.
 * @returns {string} Returns the raw `toStringTag`.
 */

function getRawTag(value) {
  var isOwn = hasOwnProperty.call(value, symToStringTag),
      tag = value[symToStringTag];

  try {
    value[symToStringTag] = undefined;
    var unmasked = true;
  } catch (e) {}

  var result = nativeObjectToString.call(value);

  if (unmasked) {
    if (isOwn) {
      value[symToStringTag] = tag;
    } else {
      delete value[symToStringTag];
    }
  }

  return result;
}

module.exports = getRawTag;

/***/ }),

/***/ "./node_modules/lodash/_getSymbols.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var arrayFilter = __webpack_require__("./node_modules/lodash/_arrayFilter.js"),
    stubArray = __webpack_require__("./node_modules/lodash/stubArray.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Built-in value references. */

var propertyIsEnumerable = objectProto.propertyIsEnumerable;
/* Built-in method references for those with the same name as other `lodash` methods. */

var nativeGetSymbols = Object.getOwnPropertySymbols;
/**
 * Creates an array of the own enumerable symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of symbols.
 */

var getSymbols = !nativeGetSymbols ? stubArray : function (object) {
  if (object == null) {
    return [];
  }

  object = Object(object);
  return arrayFilter(nativeGetSymbols(object), function (symbol) {
    return propertyIsEnumerable.call(object, symbol);
  });
};
module.exports = getSymbols;

/***/ }),

/***/ "./node_modules/lodash/_getSymbolsIn.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var arrayPush = __webpack_require__("./node_modules/lodash/_arrayPush.js"),
    getPrototype = __webpack_require__("./node_modules/lodash/_getPrototype.js"),
    getSymbols = __webpack_require__("./node_modules/lodash/_getSymbols.js"),
    stubArray = __webpack_require__("./node_modules/lodash/stubArray.js");
/* Built-in method references for those with the same name as other `lodash` methods. */


var nativeGetSymbols = Object.getOwnPropertySymbols;
/**
 * Creates an array of the own and inherited enumerable symbols of `object`.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of symbols.
 */

var getSymbolsIn = !nativeGetSymbols ? stubArray : function (object) {
  var result = [];

  while (object) {
    arrayPush(result, getSymbols(object));
    object = getPrototype(object);
  }

  return result;
};
module.exports = getSymbolsIn;

/***/ }),

/***/ "./node_modules/lodash/_getTag.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var DataView = __webpack_require__("./node_modules/lodash/_DataView.js"),
    Map = __webpack_require__("./node_modules/lodash/_Map.js"),
    Promise = __webpack_require__("./node_modules/lodash/_Promise.js"),
    Set = __webpack_require__("./node_modules/lodash/_Set.js"),
    WeakMap = __webpack_require__("./node_modules/lodash/_WeakMap.js"),
    baseGetTag = __webpack_require__("./node_modules/lodash/_baseGetTag.js"),
    toSource = __webpack_require__("./node_modules/lodash/_toSource.js");
/** `Object#toString` result references. */


var mapTag = '[object Map]',
    objectTag = '[object Object]',
    promiseTag = '[object Promise]',
    setTag = '[object Set]',
    weakMapTag = '[object WeakMap]';
var dataViewTag = '[object DataView]';
/** Used to detect maps, sets, and weakmaps. */

var dataViewCtorString = toSource(DataView),
    mapCtorString = toSource(Map),
    promiseCtorString = toSource(Promise),
    setCtorString = toSource(Set),
    weakMapCtorString = toSource(WeakMap);
/**
 * Gets the `toStringTag` of `value`.
 *
 * @private
 * @param {*} value The value to query.
 * @returns {string} Returns the `toStringTag`.
 */

var getTag = baseGetTag; // Fallback for data views, maps, sets, and weak maps in IE 11 and promises in Node.js < 6.

if (DataView && getTag(new DataView(new ArrayBuffer(1))) != dataViewTag || Map && getTag(new Map()) != mapTag || Promise && getTag(Promise.resolve()) != promiseTag || Set && getTag(new Set()) != setTag || WeakMap && getTag(new WeakMap()) != weakMapTag) {
  getTag = function (value) {
    var result = baseGetTag(value),
        Ctor = result == objectTag ? value.constructor : undefined,
        ctorString = Ctor ? toSource(Ctor) : '';

    if (ctorString) {
      switch (ctorString) {
        case dataViewCtorString:
          return dataViewTag;

        case mapCtorString:
          return mapTag;

        case promiseCtorString:
          return promiseTag;

        case setCtorString:
          return setTag;

        case weakMapCtorString:
          return weakMapTag;
      }
    }

    return result;
  };
}

module.exports = getTag;

/***/ }),

/***/ "./node_modules/lodash/_getValue.js":
/***/ ((module) => {

/**
 * Gets the value at `key` of `object`.
 *
 * @private
 * @param {Object} [object] The object to query.
 * @param {string} key The key of the property to get.
 * @returns {*} Returns the property value.
 */
function getValue(object, key) {
  return object == null ? undefined : object[key];
}

module.exports = getValue;

/***/ }),

/***/ "./node_modules/lodash/_hashClear.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var nativeCreate = __webpack_require__("./node_modules/lodash/_nativeCreate.js");
/**
 * Removes all key-value entries from the hash.
 *
 * @private
 * @name clear
 * @memberOf Hash
 */


function hashClear() {
  this.__data__ = nativeCreate ? nativeCreate(null) : {};
  this.size = 0;
}

module.exports = hashClear;

/***/ }),

/***/ "./node_modules/lodash/_hashDelete.js":
/***/ ((module) => {

/**
 * Removes `key` and its value from the hash.
 *
 * @private
 * @name delete
 * @memberOf Hash
 * @param {Object} hash The hash to modify.
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */
function hashDelete(key) {
  var result = this.has(key) && delete this.__data__[key];
  this.size -= result ? 1 : 0;
  return result;
}

module.exports = hashDelete;

/***/ }),

/***/ "./node_modules/lodash/_hashGet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var nativeCreate = __webpack_require__("./node_modules/lodash/_nativeCreate.js");
/** Used to stand-in for `undefined` hash values. */


var HASH_UNDEFINED = '__lodash_hash_undefined__';
/** Used for built-in method references. */

var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * Gets the hash value for `key`.
 *
 * @private
 * @name get
 * @memberOf Hash
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */

function hashGet(key) {
  var data = this.__data__;

  if (nativeCreate) {
    var result = data[key];
    return result === HASH_UNDEFINED ? undefined : result;
  }

  return hasOwnProperty.call(data, key) ? data[key] : undefined;
}

module.exports = hashGet;

/***/ }),

/***/ "./node_modules/lodash/_hashHas.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var nativeCreate = __webpack_require__("./node_modules/lodash/_nativeCreate.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * Checks if a hash value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf Hash
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */

function hashHas(key) {
  var data = this.__data__;
  return nativeCreate ? data[key] !== undefined : hasOwnProperty.call(data, key);
}

module.exports = hashHas;

/***/ }),

/***/ "./node_modules/lodash/_hashSet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var nativeCreate = __webpack_require__("./node_modules/lodash/_nativeCreate.js");
/** Used to stand-in for `undefined` hash values. */


var HASH_UNDEFINED = '__lodash_hash_undefined__';
/**
 * Sets the hash `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf Hash
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the hash instance.
 */

function hashSet(key, value) {
  var data = this.__data__;
  this.size += this.has(key) ? 0 : 1;
  data[key] = nativeCreate && value === undefined ? HASH_UNDEFINED : value;
  return this;
}

module.exports = hashSet;

/***/ }),

/***/ "./node_modules/lodash/_initCloneArray.js":
/***/ ((module) => {

/** Used for built-in method references. */
var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/**
 * Initializes an array clone.
 *
 * @private
 * @param {Array} array The array to clone.
 * @returns {Array} Returns the initialized clone.
 */

function initCloneArray(array) {
  var length = array.length,
      result = new array.constructor(length); // Add properties assigned by `RegExp#exec`.

  if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) {
    result.index = array.index;
    result.input = array.input;
  }

  return result;
}

module.exports = initCloneArray;

/***/ }),

/***/ "./node_modules/lodash/_initCloneByTag.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var cloneArrayBuffer = __webpack_require__("./node_modules/lodash/_cloneArrayBuffer.js"),
    cloneDataView = __webpack_require__("./node_modules/lodash/_cloneDataView.js"),
    cloneRegExp = __webpack_require__("./node_modules/lodash/_cloneRegExp.js"),
    cloneSymbol = __webpack_require__("./node_modules/lodash/_cloneSymbol.js"),
    cloneTypedArray = __webpack_require__("./node_modules/lodash/_cloneTypedArray.js");
/** `Object#toString` result references. */


var boolTag = '[object Boolean]',
    dateTag = '[object Date]',
    mapTag = '[object Map]',
    numberTag = '[object Number]',
    regexpTag = '[object RegExp]',
    setTag = '[object Set]',
    stringTag = '[object String]',
    symbolTag = '[object Symbol]';
var arrayBufferTag = '[object ArrayBuffer]',
    dataViewTag = '[object DataView]',
    float32Tag = '[object Float32Array]',
    float64Tag = '[object Float64Array]',
    int8Tag = '[object Int8Array]',
    int16Tag = '[object Int16Array]',
    int32Tag = '[object Int32Array]',
    uint8Tag = '[object Uint8Array]',
    uint8ClampedTag = '[object Uint8ClampedArray]',
    uint16Tag = '[object Uint16Array]',
    uint32Tag = '[object Uint32Array]';
/**
 * Initializes an object clone based on its `toStringTag`.
 *
 * **Note:** This function only supports cloning values with tags of
 * `Boolean`, `Date`, `Error`, `Map`, `Number`, `RegExp`, `Set`, or `String`.
 *
 * @private
 * @param {Object} object The object to clone.
 * @param {string} tag The `toStringTag` of the object to clone.
 * @param {boolean} [isDeep] Specify a deep clone.
 * @returns {Object} Returns the initialized clone.
 */

function initCloneByTag(object, tag, isDeep) {
  var Ctor = object.constructor;

  switch (tag) {
    case arrayBufferTag:
      return cloneArrayBuffer(object);

    case boolTag:
    case dateTag:
      return new Ctor(+object);

    case dataViewTag:
      return cloneDataView(object, isDeep);

    case float32Tag:
    case float64Tag:
    case int8Tag:
    case int16Tag:
    case int32Tag:
    case uint8Tag:
    case uint8ClampedTag:
    case uint16Tag:
    case uint32Tag:
      return cloneTypedArray(object, isDeep);

    case mapTag:
      return new Ctor();

    case numberTag:
    case stringTag:
      return new Ctor(object);

    case regexpTag:
      return cloneRegExp(object);

    case setTag:
      return new Ctor();

    case symbolTag:
      return cloneSymbol(object);
  }
}

module.exports = initCloneByTag;

/***/ }),

/***/ "./node_modules/lodash/_initCloneObject.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseCreate = __webpack_require__("./node_modules/lodash/_baseCreate.js"),
    getPrototype = __webpack_require__("./node_modules/lodash/_getPrototype.js"),
    isPrototype = __webpack_require__("./node_modules/lodash/_isPrototype.js");
/**
 * Initializes an object clone.
 *
 * @private
 * @param {Object} object The object to clone.
 * @returns {Object} Returns the initialized clone.
 */


function initCloneObject(object) {
  return typeof object.constructor == 'function' && !isPrototype(object) ? baseCreate(getPrototype(object)) : {};
}

module.exports = initCloneObject;

/***/ }),

/***/ "./node_modules/lodash/_isIndex.js":
/***/ ((module) => {

/** Used as references for various `Number` constants. */
var MAX_SAFE_INTEGER = 9007199254740991;
/** Used to detect unsigned integer values. */

var reIsUint = /^(?:0|[1-9]\d*)$/;
/**
 * Checks if `value` is a valid array-like index.
 *
 * @private
 * @param {*} value The value to check.
 * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index.
 * @returns {boolean} Returns `true` if `value` is a valid index, else `false`.
 */

function isIndex(value, length) {
  var type = typeof value;
  length = length == null ? MAX_SAFE_INTEGER : length;
  return !!length && (type == 'number' || type != 'symbol' && reIsUint.test(value)) && value > -1 && value % 1 == 0 && value < length;
}

module.exports = isIndex;

/***/ }),

/***/ "./node_modules/lodash/_isKey.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isArray = __webpack_require__("./node_modules/lodash/isArray.js"),
    isSymbol = __webpack_require__("./node_modules/lodash/isSymbol.js");
/** Used to match property names within property paths. */


var reIsDeepProp = /\.|\[(?:[^[\]]*|(["'])(?:(?!\1)[^\\]|\\.)*?\1)\]/,
    reIsPlainProp = /^\w*$/;
/**
 * Checks if `value` is a property name and not a property path.
 *
 * @private
 * @param {*} value The value to check.
 * @param {Object} [object] The object to query keys on.
 * @returns {boolean} Returns `true` if `value` is a property name, else `false`.
 */

function isKey(value, object) {
  if (isArray(value)) {
    return false;
  }

  var type = typeof value;

  if (type == 'number' || type == 'symbol' || type == 'boolean' || value == null || isSymbol(value)) {
    return true;
  }

  return reIsPlainProp.test(value) || !reIsDeepProp.test(value) || object != null && value in Object(object);
}

module.exports = isKey;

/***/ }),

/***/ "./node_modules/lodash/_isKeyable.js":
/***/ ((module) => {

/**
 * Checks if `value` is suitable for use as unique object key.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is suitable, else `false`.
 */
function isKeyable(value) {
  var type = typeof value;
  return type == 'string' || type == 'number' || type == 'symbol' || type == 'boolean' ? value !== '__proto__' : value === null;
}

module.exports = isKeyable;

/***/ }),

/***/ "./node_modules/lodash/_isMasked.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var coreJsData = __webpack_require__("./node_modules/lodash/_coreJsData.js");
/** Used to detect methods masquerading as native. */


var maskSrcKey = function () {
  var uid = /[^.]+$/.exec(coreJsData && coreJsData.keys && coreJsData.keys.IE_PROTO || '');
  return uid ? 'Symbol(src)_1.' + uid : '';
}();
/**
 * Checks if `func` has its source masked.
 *
 * @private
 * @param {Function} func The function to check.
 * @returns {boolean} Returns `true` if `func` is masked, else `false`.
 */


function isMasked(func) {
  return !!maskSrcKey && maskSrcKey in func;
}

module.exports = isMasked;

/***/ }),

/***/ "./node_modules/lodash/_isPrototype.js":
/***/ ((module) => {

/** Used for built-in method references. */
var objectProto = Object.prototype;
/**
 * Checks if `value` is likely a prototype object.
 *
 * @private
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a prototype, else `false`.
 */

function isPrototype(value) {
  var Ctor = value && value.constructor,
      proto = typeof Ctor == 'function' && Ctor.prototype || objectProto;
  return value === proto;
}

module.exports = isPrototype;

/***/ }),

/***/ "./node_modules/lodash/_listCacheClear.js":
/***/ ((module) => {

/**
 * Removes all key-value entries from the list cache.
 *
 * @private
 * @name clear
 * @memberOf ListCache
 */
function listCacheClear() {
  this.__data__ = [];
  this.size = 0;
}

module.exports = listCacheClear;

/***/ }),

/***/ "./node_modules/lodash/_listCacheDelete.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var assocIndexOf = __webpack_require__("./node_modules/lodash/_assocIndexOf.js");
/** Used for built-in method references. */


var arrayProto = Array.prototype;
/** Built-in value references. */

var splice = arrayProto.splice;
/**
 * Removes `key` and its value from the list cache.
 *
 * @private
 * @name delete
 * @memberOf ListCache
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */

function listCacheDelete(key) {
  var data = this.__data__,
      index = assocIndexOf(data, key);

  if (index < 0) {
    return false;
  }

  var lastIndex = data.length - 1;

  if (index == lastIndex) {
    data.pop();
  } else {
    splice.call(data, index, 1);
  }

  --this.size;
  return true;
}

module.exports = listCacheDelete;

/***/ }),

/***/ "./node_modules/lodash/_listCacheGet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var assocIndexOf = __webpack_require__("./node_modules/lodash/_assocIndexOf.js");
/**
 * Gets the list cache value for `key`.
 *
 * @private
 * @name get
 * @memberOf ListCache
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */


function listCacheGet(key) {
  var data = this.__data__,
      index = assocIndexOf(data, key);
  return index < 0 ? undefined : data[index][1];
}

module.exports = listCacheGet;

/***/ }),

/***/ "./node_modules/lodash/_listCacheHas.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var assocIndexOf = __webpack_require__("./node_modules/lodash/_assocIndexOf.js");
/**
 * Checks if a list cache value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf ListCache
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */


function listCacheHas(key) {
  return assocIndexOf(this.__data__, key) > -1;
}

module.exports = listCacheHas;

/***/ }),

/***/ "./node_modules/lodash/_listCacheSet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var assocIndexOf = __webpack_require__("./node_modules/lodash/_assocIndexOf.js");
/**
 * Sets the list cache `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf ListCache
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the list cache instance.
 */


function listCacheSet(key, value) {
  var data = this.__data__,
      index = assocIndexOf(data, key);

  if (index < 0) {
    ++this.size;
    data.push([key, value]);
  } else {
    data[index][1] = value;
  }

  return this;
}

module.exports = listCacheSet;

/***/ }),

/***/ "./node_modules/lodash/_mapCacheClear.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var Hash = __webpack_require__("./node_modules/lodash/_Hash.js"),
    ListCache = __webpack_require__("./node_modules/lodash/_ListCache.js"),
    Map = __webpack_require__("./node_modules/lodash/_Map.js");
/**
 * Removes all key-value entries from the map.
 *
 * @private
 * @name clear
 * @memberOf MapCache
 */


function mapCacheClear() {
  this.size = 0;
  this.__data__ = {
    'hash': new Hash(),
    'map': new (Map || ListCache)(),
    'string': new Hash()
  };
}

module.exports = mapCacheClear;

/***/ }),

/***/ "./node_modules/lodash/_mapCacheDelete.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getMapData = __webpack_require__("./node_modules/lodash/_getMapData.js");
/**
 * Removes `key` and its value from the map.
 *
 * @private
 * @name delete
 * @memberOf MapCache
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */


function mapCacheDelete(key) {
  var result = getMapData(this, key)['delete'](key);
  this.size -= result ? 1 : 0;
  return result;
}

module.exports = mapCacheDelete;

/***/ }),

/***/ "./node_modules/lodash/_mapCacheGet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getMapData = __webpack_require__("./node_modules/lodash/_getMapData.js");
/**
 * Gets the map value for `key`.
 *
 * @private
 * @name get
 * @memberOf MapCache
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */


function mapCacheGet(key) {
  return getMapData(this, key).get(key);
}

module.exports = mapCacheGet;

/***/ }),

/***/ "./node_modules/lodash/_mapCacheHas.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getMapData = __webpack_require__("./node_modules/lodash/_getMapData.js");
/**
 * Checks if a map value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf MapCache
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */


function mapCacheHas(key) {
  return getMapData(this, key).has(key);
}

module.exports = mapCacheHas;

/***/ }),

/***/ "./node_modules/lodash/_mapCacheSet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getMapData = __webpack_require__("./node_modules/lodash/_getMapData.js");
/**
 * Sets the map `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf MapCache
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the map cache instance.
 */


function mapCacheSet(key, value) {
  var data = getMapData(this, key),
      size = data.size;
  data.set(key, value);
  this.size += data.size == size ? 0 : 1;
  return this;
}

module.exports = mapCacheSet;

/***/ }),

/***/ "./node_modules/lodash/_mapToArray.js":
/***/ ((module) => {

/**
 * Converts `map` to its key-value pairs.
 *
 * @private
 * @param {Object} map The map to convert.
 * @returns {Array} Returns the key-value pairs.
 */
function mapToArray(map) {
  var index = -1,
      result = Array(map.size);
  map.forEach(function (value, key) {
    result[++index] = [key, value];
  });
  return result;
}

module.exports = mapToArray;

/***/ }),

/***/ "./node_modules/lodash/_memoizeCapped.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var memoize = __webpack_require__("./node_modules/lodash/memoize.js");
/** Used as the maximum memoize cache size. */


var MAX_MEMOIZE_SIZE = 500;
/**
 * A specialized version of `_.memoize` which clears the memoized function's
 * cache when it exceeds `MAX_MEMOIZE_SIZE`.
 *
 * @private
 * @param {Function} func The function to have its output memoized.
 * @returns {Function} Returns the new memoized function.
 */

function memoizeCapped(func) {
  var result = memoize(func, function (key) {
    if (cache.size === MAX_MEMOIZE_SIZE) {
      cache.clear();
    }

    return key;
  });
  var cache = result.cache;
  return result;
}

module.exports = memoizeCapped;

/***/ }),

/***/ "./node_modules/lodash/_nativeCreate.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var getNative = __webpack_require__("./node_modules/lodash/_getNative.js");
/* Built-in method references that are verified to be native. */


var nativeCreate = getNative(Object, 'create');
module.exports = nativeCreate;

/***/ }),

/***/ "./node_modules/lodash/_nativeKeys.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var overArg = __webpack_require__("./node_modules/lodash/_overArg.js");
/* Built-in method references for those with the same name as other `lodash` methods. */


var nativeKeys = overArg(Object.keys, Object);
module.exports = nativeKeys;

/***/ }),

/***/ "./node_modules/lodash/_nativeKeysIn.js":
/***/ ((module) => {

/**
 * This function is like
 * [`Object.keys`](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
 * except that it includes inherited enumerable properties.
 *
 * @private
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names.
 */
function nativeKeysIn(object) {
  var result = [];

  if (object != null) {
    for (var key in Object(object)) {
      result.push(key);
    }
  }

  return result;
}

module.exports = nativeKeysIn;

/***/ }),

/***/ "./node_modules/lodash/_nodeUtil.js":
/***/ ((module, exports, __webpack_require__) => {

/* module decorator */ module = __webpack_require__.nmd(module);
var freeGlobal = __webpack_require__("./node_modules/lodash/_freeGlobal.js");
/** Detect free variable `exports`. */


var freeExports =  true && exports && !exports.nodeType && exports;
/** Detect free variable `module`. */

var freeModule = freeExports && "object" == 'object' && module && !module.nodeType && module;
/** Detect the popular CommonJS extension `module.exports`. */

var moduleExports = freeModule && freeModule.exports === freeExports;
/** Detect free variable `process` from Node.js. */

var freeProcess = moduleExports && freeGlobal.process;
/** Used to access faster Node.js helpers. */

var nodeUtil = function () {
  try {
    // Use `util.types` for Node.js 10+.
    var types = freeModule && freeModule.require && freeModule.require('util').types;

    if (types) {
      return types;
    } // Legacy `process.binding('util')` for Node.js < 10.


    return freeProcess && freeProcess.binding && freeProcess.binding('util');
  } catch (e) {}
}();

module.exports = nodeUtil;

/***/ }),

/***/ "./node_modules/lodash/_objectToString.js":
/***/ ((module) => {

/** Used for built-in method references. */
var objectProto = Object.prototype;
/**
 * Used to resolve the
 * [`toStringTag`](http://ecma-international.org/ecma-262/7.0/#sec-object.prototype.tostring)
 * of values.
 */

var nativeObjectToString = objectProto.toString;
/**
 * Converts `value` to a string using `Object.prototype.toString`.
 *
 * @private
 * @param {*} value The value to convert.
 * @returns {string} Returns the converted string.
 */

function objectToString(value) {
  return nativeObjectToString.call(value);
}

module.exports = objectToString;

/***/ }),

/***/ "./node_modules/lodash/_overArg.js":
/***/ ((module) => {

/**
 * Creates a unary function that invokes `func` with its argument transformed.
 *
 * @private
 * @param {Function} func The function to wrap.
 * @param {Function} transform The argument transform.
 * @returns {Function} Returns the new function.
 */
function overArg(func, transform) {
  return function (arg) {
    return func(transform(arg));
  };
}

module.exports = overArg;

/***/ }),

/***/ "./node_modules/lodash/_root.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var freeGlobal = __webpack_require__("./node_modules/lodash/_freeGlobal.js");
/** Detect free variable `self`. */


var freeSelf = typeof self == 'object' && self && self.Object === Object && self;
/** Used as a reference to the global object. */

var root = freeGlobal || freeSelf || Function('return this')();
module.exports = root;

/***/ }),

/***/ "./node_modules/lodash/_setCacheAdd.js":
/***/ ((module) => {

/** Used to stand-in for `undefined` hash values. */
var HASH_UNDEFINED = '__lodash_hash_undefined__';
/**
 * Adds `value` to the array cache.
 *
 * @private
 * @name add
 * @memberOf SetCache
 * @alias push
 * @param {*} value The value to cache.
 * @returns {Object} Returns the cache instance.
 */

function setCacheAdd(value) {
  this.__data__.set(value, HASH_UNDEFINED);

  return this;
}

module.exports = setCacheAdd;

/***/ }),

/***/ "./node_modules/lodash/_setCacheHas.js":
/***/ ((module) => {

/**
 * Checks if `value` is in the array cache.
 *
 * @private
 * @name has
 * @memberOf SetCache
 * @param {*} value The value to search for.
 * @returns {number} Returns `true` if `value` is found, else `false`.
 */
function setCacheHas(value) {
  return this.__data__.has(value);
}

module.exports = setCacheHas;

/***/ }),

/***/ "./node_modules/lodash/_setToArray.js":
/***/ ((module) => {

/**
 * Converts `set` to an array of its values.
 *
 * @private
 * @param {Object} set The set to convert.
 * @returns {Array} Returns the values.
 */
function setToArray(set) {
  var index = -1,
      result = Array(set.size);
  set.forEach(function (value) {
    result[++index] = value;
  });
  return result;
}

module.exports = setToArray;

/***/ }),

/***/ "./node_modules/lodash/_stackClear.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var ListCache = __webpack_require__("./node_modules/lodash/_ListCache.js");
/**
 * Removes all key-value entries from the stack.
 *
 * @private
 * @name clear
 * @memberOf Stack
 */


function stackClear() {
  this.__data__ = new ListCache();
  this.size = 0;
}

module.exports = stackClear;

/***/ }),

/***/ "./node_modules/lodash/_stackDelete.js":
/***/ ((module) => {

/**
 * Removes `key` and its value from the stack.
 *
 * @private
 * @name delete
 * @memberOf Stack
 * @param {string} key The key of the value to remove.
 * @returns {boolean} Returns `true` if the entry was removed, else `false`.
 */
function stackDelete(key) {
  var data = this.__data__,
      result = data['delete'](key);
  this.size = data.size;
  return result;
}

module.exports = stackDelete;

/***/ }),

/***/ "./node_modules/lodash/_stackGet.js":
/***/ ((module) => {

/**
 * Gets the stack value for `key`.
 *
 * @private
 * @name get
 * @memberOf Stack
 * @param {string} key The key of the value to get.
 * @returns {*} Returns the entry value.
 */
function stackGet(key) {
  return this.__data__.get(key);
}

module.exports = stackGet;

/***/ }),

/***/ "./node_modules/lodash/_stackHas.js":
/***/ ((module) => {

/**
 * Checks if a stack value for `key` exists.
 *
 * @private
 * @name has
 * @memberOf Stack
 * @param {string} key The key of the entry to check.
 * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`.
 */
function stackHas(key) {
  return this.__data__.has(key);
}

module.exports = stackHas;

/***/ }),

/***/ "./node_modules/lodash/_stackSet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var ListCache = __webpack_require__("./node_modules/lodash/_ListCache.js"),
    Map = __webpack_require__("./node_modules/lodash/_Map.js"),
    MapCache = __webpack_require__("./node_modules/lodash/_MapCache.js");
/** Used as the size to enable large array optimizations. */


var LARGE_ARRAY_SIZE = 200;
/**
 * Sets the stack `key` to `value`.
 *
 * @private
 * @name set
 * @memberOf Stack
 * @param {string} key The key of the value to set.
 * @param {*} value The value to set.
 * @returns {Object} Returns the stack cache instance.
 */

function stackSet(key, value) {
  var data = this.__data__;

  if (data instanceof ListCache) {
    var pairs = data.__data__;

    if (!Map || pairs.length < LARGE_ARRAY_SIZE - 1) {
      pairs.push([key, value]);
      this.size = ++data.size;
      return this;
    }

    data = this.__data__ = new MapCache(pairs);
  }

  data.set(key, value);
  this.size = data.size;
  return this;
}

module.exports = stackSet;

/***/ }),

/***/ "./node_modules/lodash/_stringToPath.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var memoizeCapped = __webpack_require__("./node_modules/lodash/_memoizeCapped.js");
/** Used to match property names within property paths. */


var rePropName = /[^.[\]]+|\[(?:(-?\d+(?:\.\d+)?)|(["'])((?:(?!\2)[^\\]|\\.)*?)\2)\]|(?=(?:\.|\[\])(?:\.|\[\]|$))/g;
/** Used to match backslashes in property paths. */

var reEscapeChar = /\\(\\)?/g;
/**
 * Converts `string` to a property path array.
 *
 * @private
 * @param {string} string The string to convert.
 * @returns {Array} Returns the property path array.
 */

var stringToPath = memoizeCapped(function (string) {
  var result = [];

  if (string.charCodeAt(0) === 46
  /* . */
  ) {
    result.push('');
  }

  string.replace(rePropName, function (match, number, quote, subString) {
    result.push(quote ? subString.replace(reEscapeChar, '$1') : number || match);
  });
  return result;
});
module.exports = stringToPath;

/***/ }),

/***/ "./node_modules/lodash/_toKey.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isSymbol = __webpack_require__("./node_modules/lodash/isSymbol.js");
/** Used as references for various `Number` constants. */


var INFINITY = 1 / 0;
/**
 * Converts `value` to a string key if it's not a string or symbol.
 *
 * @private
 * @param {*} value The value to inspect.
 * @returns {string|symbol} Returns the key.
 */

function toKey(value) {
  if (typeof value == 'string' || isSymbol(value)) {
    return value;
  }

  var result = value + '';
  return result == '0' && 1 / value == -INFINITY ? '-0' : result;
}

module.exports = toKey;

/***/ }),

/***/ "./node_modules/lodash/_toSource.js":
/***/ ((module) => {

/** Used for built-in method references. */
var funcProto = Function.prototype;
/** Used to resolve the decompiled source of functions. */

var funcToString = funcProto.toString;
/**
 * Converts `func` to its source code.
 *
 * @private
 * @param {Function} func The function to convert.
 * @returns {string} Returns the source code.
 */

function toSource(func) {
  if (func != null) {
    try {
      return funcToString.call(func);
    } catch (e) {}

    try {
      return func + '';
    } catch (e) {}
  }

  return '';
}

module.exports = toSource;

/***/ }),

/***/ "./node_modules/lodash/_trimmedEndIndex.js":
/***/ ((module) => {

/** Used to match a single whitespace character. */
var reWhitespace = /\s/;
/**
 * Used by `_.trim` and `_.trimEnd` to get the index of the last non-whitespace
 * character of `string`.
 *
 * @private
 * @param {string} string The string to inspect.
 * @returns {number} Returns the index of the last non-whitespace character.
 */

function trimmedEndIndex(string) {
  var index = string.length;

  while (index-- && reWhitespace.test(string.charAt(index))) {}

  return index;
}

module.exports = trimmedEndIndex;

/***/ }),

/***/ "./node_modules/lodash/cloneDeep.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseClone = __webpack_require__("./node_modules/lodash/_baseClone.js");
/** Used to compose bitmasks for cloning. */


var CLONE_DEEP_FLAG = 1,
    CLONE_SYMBOLS_FLAG = 4;
/**
 * This method is like `_.clone` except that it recursively clones `value`.
 *
 * @static
 * @memberOf _
 * @since 1.0.0
 * @category Lang
 * @param {*} value The value to recursively clone.
 * @returns {*} Returns the deep cloned value.
 * @see _.clone
 * @example
 *
 * var objects = [{ 'a': 1 }, { 'b': 2 }];
 *
 * var deep = _.cloneDeep(objects);
 * console.log(deep[0] === objects[0]);
 * // => false
 */

function cloneDeep(value) {
  return baseClone(value, CLONE_DEEP_FLAG | CLONE_SYMBOLS_FLAG);
}

module.exports = cloneDeep;

/***/ }),

/***/ "./node_modules/lodash/debounce.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isObject = __webpack_require__("./node_modules/lodash/isObject.js"),
    now = __webpack_require__("./node_modules/lodash/now.js"),
    toNumber = __webpack_require__("./node_modules/lodash/toNumber.js");
/** Error message constants. */


var FUNC_ERROR_TEXT = 'Expected a function';
/* Built-in method references for those with the same name as other `lodash` methods. */

var nativeMax = Math.max,
    nativeMin = Math.min;
/**
 * Creates a debounced function that delays invoking `func` until after `wait`
 * milliseconds have elapsed since the last time the debounced function was
 * invoked. The debounced function comes with a `cancel` method to cancel
 * delayed `func` invocations and a `flush` method to immediately invoke them.
 * Provide `options` to indicate whether `func` should be invoked on the
 * leading and/or trailing edge of the `wait` timeout. The `func` is invoked
 * with the last arguments provided to the debounced function. Subsequent
 * calls to the debounced function return the result of the last `func`
 * invocation.
 *
 * **Note:** If `leading` and `trailing` options are `true`, `func` is
 * invoked on the trailing edge of the timeout only if the debounced function
 * is invoked more than once during the `wait` timeout.
 *
 * If `wait` is `0` and `leading` is `false`, `func` invocation is deferred
 * until to the next tick, similar to `setTimeout` with a timeout of `0`.
 *
 * See [David Corbacho's article](https://css-tricks.com/debouncing-throttling-explained-examples/)
 * for details over the differences between `_.debounce` and `_.throttle`.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Function
 * @param {Function} func The function to debounce.
 * @param {number} [wait=0] The number of milliseconds to delay.
 * @param {Object} [options={}] The options object.
 * @param {boolean} [options.leading=false]
 *  Specify invoking on the leading edge of the timeout.
 * @param {number} [options.maxWait]
 *  The maximum time `func` is allowed to be delayed before it's invoked.
 * @param {boolean} [options.trailing=true]
 *  Specify invoking on the trailing edge of the timeout.
 * @returns {Function} Returns the new debounced function.
 * @example
 *
 * // Avoid costly calculations while the window size is in flux.
 * jQuery(window).on('resize', _.debounce(calculateLayout, 150));
 *
 * // Invoke `sendMail` when clicked, debouncing subsequent calls.
 * jQuery(element).on('click', _.debounce(sendMail, 300, {
 *   'leading': true,
 *   'trailing': false
 * }));
 *
 * // Ensure `batchLog` is invoked once after 1 second of debounced calls.
 * var debounced = _.debounce(batchLog, 250, { 'maxWait': 1000 });
 * var source = new EventSource('/stream');
 * jQuery(source).on('message', debounced);
 *
 * // Cancel the trailing debounced invocation.
 * jQuery(window).on('popstate', debounced.cancel);
 */

function debounce(func, wait, options) {
  var lastArgs,
      lastThis,
      maxWait,
      result,
      timerId,
      lastCallTime,
      lastInvokeTime = 0,
      leading = false,
      maxing = false,
      trailing = true;

  if (typeof func != 'function') {
    throw new TypeError(FUNC_ERROR_TEXT);
  }

  wait = toNumber(wait) || 0;

  if (isObject(options)) {
    leading = !!options.leading;
    maxing = 'maxWait' in options;
    maxWait = maxing ? nativeMax(toNumber(options.maxWait) || 0, wait) : maxWait;
    trailing = 'trailing' in options ? !!options.trailing : trailing;
  }

  function invokeFunc(time) {
    var args = lastArgs,
        thisArg = lastThis;
    lastArgs = lastThis = undefined;
    lastInvokeTime = time;
    result = func.apply(thisArg, args);
    return result;
  }

  function leadingEdge(time) {
    // Reset any `maxWait` timer.
    lastInvokeTime = time; // Start the timer for the trailing edge.

    timerId = setTimeout(timerExpired, wait); // Invoke the leading edge.

    return leading ? invokeFunc(time) : result;
  }

  function remainingWait(time) {
    var timeSinceLastCall = time - lastCallTime,
        timeSinceLastInvoke = time - lastInvokeTime,
        timeWaiting = wait - timeSinceLastCall;
    return maxing ? nativeMin(timeWaiting, maxWait - timeSinceLastInvoke) : timeWaiting;
  }

  function shouldInvoke(time) {
    var timeSinceLastCall = time - lastCallTime,
        timeSinceLastInvoke = time - lastInvokeTime; // Either this is the first call, activity has stopped and we're at the
    // trailing edge, the system time has gone backwards and we're treating
    // it as the trailing edge, or we've hit the `maxWait` limit.

    return lastCallTime === undefined || timeSinceLastCall >= wait || timeSinceLastCall < 0 || maxing && timeSinceLastInvoke >= maxWait;
  }

  function timerExpired() {
    var time = now();

    if (shouldInvoke(time)) {
      return trailingEdge(time);
    } // Restart the timer.


    timerId = setTimeout(timerExpired, remainingWait(time));
  }

  function trailingEdge(time) {
    timerId = undefined; // Only invoke if we have `lastArgs` which means `func` has been
    // debounced at least once.

    if (trailing && lastArgs) {
      return invokeFunc(time);
    }

    lastArgs = lastThis = undefined;
    return result;
  }

  function cancel() {
    if (timerId !== undefined) {
      clearTimeout(timerId);
    }

    lastInvokeTime = 0;
    lastArgs = lastCallTime = lastThis = timerId = undefined;
  }

  function flush() {
    return timerId === undefined ? result : trailingEdge(now());
  }

  function debounced() {
    var time = now(),
        isInvoking = shouldInvoke(time);
    lastArgs = arguments;
    lastThis = this;
    lastCallTime = time;

    if (isInvoking) {
      if (timerId === undefined) {
        return leadingEdge(lastCallTime);
      }

      if (maxing) {
        // Handle invocations in a tight loop.
        clearTimeout(timerId);
        timerId = setTimeout(timerExpired, wait);
        return invokeFunc(lastCallTime);
      }
    }

    if (timerId === undefined) {
      timerId = setTimeout(timerExpired, wait);
    }

    return result;
  }

  debounced.cancel = cancel;
  debounced.flush = flush;
  return debounced;
}

module.exports = debounce;

/***/ }),

/***/ "./node_modules/lodash/eq.js":
/***/ ((module) => {

/**
 * Performs a
 * [`SameValueZero`](http://ecma-international.org/ecma-262/7.0/#sec-samevaluezero)
 * comparison between two values to determine if they are equivalent.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to compare.
 * @param {*} other The other value to compare.
 * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
 * @example
 *
 * var object = { 'a': 1 };
 * var other = { 'a': 1 };
 *
 * _.eq(object, object);
 * // => true
 *
 * _.eq(object, other);
 * // => false
 *
 * _.eq('a', 'a');
 * // => true
 *
 * _.eq('a', Object('a'));
 * // => false
 *
 * _.eq(NaN, NaN);
 * // => true
 */
function eq(value, other) {
  return value === other || value !== value && other !== other;
}

module.exports = eq;

/***/ }),

/***/ "./node_modules/lodash/fromPairs.js":
/***/ ((module) => {

/**
 * The inverse of `_.toPairs`; this method returns an object composed
 * from key-value `pairs`.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Array
 * @param {Array} pairs The key-value pairs.
 * @returns {Object} Returns the new object.
 * @example
 *
 * _.fromPairs([['a', 1], ['b', 2]]);
 * // => { 'a': 1, 'b': 2 }
 */
function fromPairs(pairs) {
  var index = -1,
      length = pairs == null ? 0 : pairs.length,
      result = {};

  while (++index < length) {
    var pair = pairs[index];
    result[pair[0]] = pair[1];
  }

  return result;
}

module.exports = fromPairs;

/***/ }),

/***/ "./node_modules/lodash/get.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseGet = __webpack_require__("./node_modules/lodash/_baseGet.js");
/**
 * Gets the value at `path` of `object`. If the resolved value is
 * `undefined`, the `defaultValue` is returned in its place.
 *
 * @static
 * @memberOf _
 * @since 3.7.0
 * @category Object
 * @param {Object} object The object to query.
 * @param {Array|string} path The path of the property to get.
 * @param {*} [defaultValue] The value returned for `undefined` resolved values.
 * @returns {*} Returns the resolved value.
 * @example
 *
 * var object = { 'a': [{ 'b': { 'c': 3 } }] };
 *
 * _.get(object, 'a[0].b.c');
 * // => 3
 *
 * _.get(object, ['a', '0', 'b', 'c']);
 * // => 3
 *
 * _.get(object, 'a.b.c', 'default');
 * // => 'default'
 */


function get(object, path, defaultValue) {
  var result = object == null ? undefined : baseGet(object, path);
  return result === undefined ? defaultValue : result;
}

module.exports = get;

/***/ }),

/***/ "./node_modules/lodash/isArguments.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseIsArguments = __webpack_require__("./node_modules/lodash/_baseIsArguments.js"),
    isObjectLike = __webpack_require__("./node_modules/lodash/isObjectLike.js");
/** Used for built-in method references. */


var objectProto = Object.prototype;
/** Used to check objects for own properties. */

var hasOwnProperty = objectProto.hasOwnProperty;
/** Built-in value references. */

var propertyIsEnumerable = objectProto.propertyIsEnumerable;
/**
 * Checks if `value` is likely an `arguments` object.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an `arguments` object,
 *  else `false`.
 * @example
 *
 * _.isArguments(function() { return arguments; }());
 * // => true
 *
 * _.isArguments([1, 2, 3]);
 * // => false
 */

var isArguments = baseIsArguments(function () {
  return arguments;
}()) ? baseIsArguments : function (value) {
  return isObjectLike(value) && hasOwnProperty.call(value, 'callee') && !propertyIsEnumerable.call(value, 'callee');
};
module.exports = isArguments;

/***/ }),

/***/ "./node_modules/lodash/isArray.js":
/***/ ((module) => {

/**
 * Checks if `value` is classified as an `Array` object.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an array, else `false`.
 * @example
 *
 * _.isArray([1, 2, 3]);
 * // => true
 *
 * _.isArray(document.body.children);
 * // => false
 *
 * _.isArray('abc');
 * // => false
 *
 * _.isArray(_.noop);
 * // => false
 */
var isArray = Array.isArray;
module.exports = isArray;

/***/ }),

/***/ "./node_modules/lodash/isArrayLike.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var isFunction = __webpack_require__("./node_modules/lodash/isFunction.js"),
    isLength = __webpack_require__("./node_modules/lodash/isLength.js");
/**
 * Checks if `value` is array-like. A value is considered array-like if it's
 * not a function and has a `value.length` that's an integer greater than or
 * equal to `0` and less than or equal to `Number.MAX_SAFE_INTEGER`.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is array-like, else `false`.
 * @example
 *
 * _.isArrayLike([1, 2, 3]);
 * // => true
 *
 * _.isArrayLike(document.body.children);
 * // => true
 *
 * _.isArrayLike('abc');
 * // => true
 *
 * _.isArrayLike(_.noop);
 * // => false
 */


function isArrayLike(value) {
  return value != null && isLength(value.length) && !isFunction(value);
}

module.exports = isArrayLike;

/***/ }),

/***/ "./node_modules/lodash/isBuffer.js":
/***/ ((module, exports, __webpack_require__) => {

/* module decorator */ module = __webpack_require__.nmd(module);
var root = __webpack_require__("./node_modules/lodash/_root.js"),
    stubFalse = __webpack_require__("./node_modules/lodash/stubFalse.js");
/** Detect free variable `exports`. */


var freeExports =  true && exports && !exports.nodeType && exports;
/** Detect free variable `module`. */

var freeModule = freeExports && "object" == 'object' && module && !module.nodeType && module;
/** Detect the popular CommonJS extension `module.exports`. */

var moduleExports = freeModule && freeModule.exports === freeExports;
/** Built-in value references. */

var Buffer = moduleExports ? root.Buffer : undefined;
/* Built-in method references for those with the same name as other `lodash` methods. */

var nativeIsBuffer = Buffer ? Buffer.isBuffer : undefined;
/**
 * Checks if `value` is a buffer.
 *
 * @static
 * @memberOf _
 * @since 4.3.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a buffer, else `false`.
 * @example
 *
 * _.isBuffer(new Buffer(2));
 * // => true
 *
 * _.isBuffer(new Uint8Array(2));
 * // => false
 */

var isBuffer = nativeIsBuffer || stubFalse;
module.exports = isBuffer;

/***/ }),

/***/ "./node_modules/lodash/isEqualWith.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseIsEqual = __webpack_require__("./node_modules/lodash/_baseIsEqual.js");
/**
 * This method is like `_.isEqual` except that it accepts `customizer` which
 * is invoked to compare values. If `customizer` returns `undefined`, comparisons
 * are handled by the method instead. The `customizer` is invoked with up to
 * six arguments: (objValue, othValue [, index|key, object, other, stack]).
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to compare.
 * @param {*} other The other value to compare.
 * @param {Function} [customizer] The function to customize comparisons.
 * @returns {boolean} Returns `true` if the values are equivalent, else `false`.
 * @example
 *
 * function isGreeting(value) {
 *   return /^h(?:i|ello)$/.test(value);
 * }
 *
 * function customizer(objValue, othValue) {
 *   if (isGreeting(objValue) && isGreeting(othValue)) {
 *     return true;
 *   }
 * }
 *
 * var array = ['hello', 'goodbye'];
 * var other = ['hi', 'goodbye'];
 *
 * _.isEqualWith(array, other, customizer);
 * // => true
 */


function isEqualWith(value, other, customizer) {
  customizer = typeof customizer == 'function' ? customizer : undefined;
  var result = customizer ? customizer(value, other) : undefined;
  return result === undefined ? baseIsEqual(value, other, undefined, customizer) : !!result;
}

module.exports = isEqualWith;

/***/ }),

/***/ "./node_modules/lodash/isFunction.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseGetTag = __webpack_require__("./node_modules/lodash/_baseGetTag.js"),
    isObject = __webpack_require__("./node_modules/lodash/isObject.js");
/** `Object#toString` result references. */


var asyncTag = '[object AsyncFunction]',
    funcTag = '[object Function]',
    genTag = '[object GeneratorFunction]',
    proxyTag = '[object Proxy]';
/**
 * Checks if `value` is classified as a `Function` object.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a function, else `false`.
 * @example
 *
 * _.isFunction(_);
 * // => true
 *
 * _.isFunction(/abc/);
 * // => false
 */

function isFunction(value) {
  if (!isObject(value)) {
    return false;
  } // The use of `Object#toString` avoids issues with the `typeof` operator
  // in Safari 9 which returns 'object' for typed arrays and other constructors.


  var tag = baseGetTag(value);
  return tag == funcTag || tag == genTag || tag == asyncTag || tag == proxyTag;
}

module.exports = isFunction;

/***/ }),

/***/ "./node_modules/lodash/isLength.js":
/***/ ((module) => {

/** Used as references for various `Number` constants. */
var MAX_SAFE_INTEGER = 9007199254740991;
/**
 * Checks if `value` is a valid array-like length.
 *
 * **Note:** This method is loosely based on
 * [`ToLength`](http://ecma-international.org/ecma-262/7.0/#sec-tolength).
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a valid length, else `false`.
 * @example
 *
 * _.isLength(3);
 * // => true
 *
 * _.isLength(Number.MIN_VALUE);
 * // => false
 *
 * _.isLength(Infinity);
 * // => false
 *
 * _.isLength('3');
 * // => false
 */

function isLength(value) {
  return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER;
}

module.exports = isLength;

/***/ }),

/***/ "./node_modules/lodash/isMap.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseIsMap = __webpack_require__("./node_modules/lodash/_baseIsMap.js"),
    baseUnary = __webpack_require__("./node_modules/lodash/_baseUnary.js"),
    nodeUtil = __webpack_require__("./node_modules/lodash/_nodeUtil.js");
/* Node.js helper references. */


var nodeIsMap = nodeUtil && nodeUtil.isMap;
/**
 * Checks if `value` is classified as a `Map` object.
 *
 * @static
 * @memberOf _
 * @since 4.3.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a map, else `false`.
 * @example
 *
 * _.isMap(new Map);
 * // => true
 *
 * _.isMap(new WeakMap);
 * // => false
 */

var isMap = nodeIsMap ? baseUnary(nodeIsMap) : baseIsMap;
module.exports = isMap;

/***/ }),

/***/ "./node_modules/lodash/isObject.js":
/***/ ((module) => {

/**
 * Checks if `value` is the
 * [language type](http://www.ecma-international.org/ecma-262/7.0/#sec-ecmascript-language-types)
 * of `Object`. (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`)
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is an object, else `false`.
 * @example
 *
 * _.isObject({});
 * // => true
 *
 * _.isObject([1, 2, 3]);
 * // => true
 *
 * _.isObject(_.noop);
 * // => true
 *
 * _.isObject(null);
 * // => false
 */
function isObject(value) {
  var type = typeof value;
  return value != null && (type == 'object' || type == 'function');
}

module.exports = isObject;

/***/ }),

/***/ "./node_modules/lodash/isObjectLike.js":
/***/ ((module) => {

/**
 * Checks if `value` is object-like. A value is object-like if it's not `null`
 * and has a `typeof` result of "object".
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is object-like, else `false`.
 * @example
 *
 * _.isObjectLike({});
 * // => true
 *
 * _.isObjectLike([1, 2, 3]);
 * // => true
 *
 * _.isObjectLike(_.noop);
 * // => false
 *
 * _.isObjectLike(null);
 * // => false
 */
function isObjectLike(value) {
  return value != null && typeof value == 'object';
}

module.exports = isObjectLike;

/***/ }),

/***/ "./node_modules/lodash/isSet.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseIsSet = __webpack_require__("./node_modules/lodash/_baseIsSet.js"),
    baseUnary = __webpack_require__("./node_modules/lodash/_baseUnary.js"),
    nodeUtil = __webpack_require__("./node_modules/lodash/_nodeUtil.js");
/* Node.js helper references. */


var nodeIsSet = nodeUtil && nodeUtil.isSet;
/**
 * Checks if `value` is classified as a `Set` object.
 *
 * @static
 * @memberOf _
 * @since 4.3.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a set, else `false`.
 * @example
 *
 * _.isSet(new Set);
 * // => true
 *
 * _.isSet(new WeakSet);
 * // => false
 */

var isSet = nodeIsSet ? baseUnary(nodeIsSet) : baseIsSet;
module.exports = isSet;

/***/ }),

/***/ "./node_modules/lodash/isSymbol.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseGetTag = __webpack_require__("./node_modules/lodash/_baseGetTag.js"),
    isObjectLike = __webpack_require__("./node_modules/lodash/isObjectLike.js");
/** `Object#toString` result references. */


var symbolTag = '[object Symbol]';
/**
 * Checks if `value` is classified as a `Symbol` primitive or object.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a symbol, else `false`.
 * @example
 *
 * _.isSymbol(Symbol.iterator);
 * // => true
 *
 * _.isSymbol('abc');
 * // => false
 */

function isSymbol(value) {
  return typeof value == 'symbol' || isObjectLike(value) && baseGetTag(value) == symbolTag;
}

module.exports = isSymbol;

/***/ }),

/***/ "./node_modules/lodash/isTypedArray.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseIsTypedArray = __webpack_require__("./node_modules/lodash/_baseIsTypedArray.js"),
    baseUnary = __webpack_require__("./node_modules/lodash/_baseUnary.js"),
    nodeUtil = __webpack_require__("./node_modules/lodash/_nodeUtil.js");
/* Node.js helper references. */


var nodeIsTypedArray = nodeUtil && nodeUtil.isTypedArray;
/**
 * Checks if `value` is classified as a typed array.
 *
 * @static
 * @memberOf _
 * @since 3.0.0
 * @category Lang
 * @param {*} value The value to check.
 * @returns {boolean} Returns `true` if `value` is a typed array, else `false`.
 * @example
 *
 * _.isTypedArray(new Uint8Array);
 * // => true
 *
 * _.isTypedArray([]);
 * // => false
 */

var isTypedArray = nodeIsTypedArray ? baseUnary(nodeIsTypedArray) : baseIsTypedArray;
module.exports = isTypedArray;

/***/ }),

/***/ "./node_modules/lodash/keys.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var arrayLikeKeys = __webpack_require__("./node_modules/lodash/_arrayLikeKeys.js"),
    baseKeys = __webpack_require__("./node_modules/lodash/_baseKeys.js"),
    isArrayLike = __webpack_require__("./node_modules/lodash/isArrayLike.js");
/**
 * Creates an array of the own enumerable property names of `object`.
 *
 * **Note:** Non-object values are coerced to objects. See the
 * [ES spec](http://ecma-international.org/ecma-262/7.0/#sec-object.keys)
 * for more details.
 *
 * @static
 * @since 0.1.0
 * @memberOf _
 * @category Object
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names.
 * @example
 *
 * function Foo() {
 *   this.a = 1;
 *   this.b = 2;
 * }
 *
 * Foo.prototype.c = 3;
 *
 * _.keys(new Foo);
 * // => ['a', 'b'] (iteration order is not guaranteed)
 *
 * _.keys('hi');
 * // => ['0', '1']
 */


function keys(object) {
  return isArrayLike(object) ? arrayLikeKeys(object) : baseKeys(object);
}

module.exports = keys;

/***/ }),

/***/ "./node_modules/lodash/keysIn.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var arrayLikeKeys = __webpack_require__("./node_modules/lodash/_arrayLikeKeys.js"),
    baseKeysIn = __webpack_require__("./node_modules/lodash/_baseKeysIn.js"),
    isArrayLike = __webpack_require__("./node_modules/lodash/isArrayLike.js");
/**
 * Creates an array of the own and inherited enumerable property names of `object`.
 *
 * **Note:** Non-object values are coerced to objects.
 *
 * @static
 * @memberOf _
 * @since 3.0.0
 * @category Object
 * @param {Object} object The object to query.
 * @returns {Array} Returns the array of property names.
 * @example
 *
 * function Foo() {
 *   this.a = 1;
 *   this.b = 2;
 * }
 *
 * Foo.prototype.c = 3;
 *
 * _.keysIn(new Foo);
 * // => ['a', 'b', 'c'] (iteration order is not guaranteed)
 */


function keysIn(object) {
  return isArrayLike(object) ? arrayLikeKeys(object, true) : baseKeysIn(object);
}

module.exports = keysIn;

/***/ }),

/***/ "./node_modules/lodash/memoize.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var MapCache = __webpack_require__("./node_modules/lodash/_MapCache.js");
/** Error message constants. */


var FUNC_ERROR_TEXT = 'Expected a function';
/**
 * Creates a function that memoizes the result of `func`. If `resolver` is
 * provided, it determines the cache key for storing the result based on the
 * arguments provided to the memoized function. By default, the first argument
 * provided to the memoized function is used as the map cache key. The `func`
 * is invoked with the `this` binding of the memoized function.
 *
 * **Note:** The cache is exposed as the `cache` property on the memoized
 * function. Its creation may be customized by replacing the `_.memoize.Cache`
 * constructor with one whose instances implement the
 * [`Map`](http://ecma-international.org/ecma-262/7.0/#sec-properties-of-the-map-prototype-object)
 * method interface of `clear`, `delete`, `get`, `has`, and `set`.
 *
 * @static
 * @memberOf _
 * @since 0.1.0
 * @category Function
 * @param {Function} func The function to have its output memoized.
 * @param {Function} [resolver] The function to resolve the cache key.
 * @returns {Function} Returns the new memoized function.
 * @example
 *
 * var object = { 'a': 1, 'b': 2 };
 * var other = { 'c': 3, 'd': 4 };
 *
 * var values = _.memoize(_.values);
 * values(object);
 * // => [1, 2]
 *
 * values(other);
 * // => [3, 4]
 *
 * object.a = 2;
 * values(object);
 * // => [1, 2]
 *
 * // Modify the result cache.
 * values.cache.set(object, ['a', 'b']);
 * values(object);
 * // => ['a', 'b']
 *
 * // Replace `_.memoize.Cache`.
 * _.memoize.Cache = WeakMap;
 */

function memoize(func, resolver) {
  if (typeof func != 'function' || resolver != null && typeof resolver != 'function') {
    throw new TypeError(FUNC_ERROR_TEXT);
  }

  var memoized = function () {
    var args = arguments,
        key = resolver ? resolver.apply(this, args) : args[0],
        cache = memoized.cache;

    if (cache.has(key)) {
      return cache.get(key);
    }

    var result = func.apply(this, args);
    memoized.cache = cache.set(key, result) || cache;
    return result;
  };

  memoized.cache = new (memoize.Cache || MapCache)();
  return memoized;
} // Expose `MapCache`.


memoize.Cache = MapCache;
module.exports = memoize;

/***/ }),

/***/ "./node_modules/lodash/now.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var root = __webpack_require__("./node_modules/lodash/_root.js");
/**
 * Gets the timestamp of the number of milliseconds that have elapsed since
 * the Unix epoch (1 January 1970 00:00:00 UTC).
 *
 * @static
 * @memberOf _
 * @since 2.4.0
 * @category Date
 * @returns {number} Returns the timestamp.
 * @example
 *
 * _.defer(function(stamp) {
 *   console.log(_.now() - stamp);
 * }, _.now());
 * // => Logs the number of milliseconds it took for the deferred invocation.
 */


var now = function () {
  return root.Date.now();
};

module.exports = now;

/***/ }),

/***/ "./node_modules/lodash/stubArray.js":
/***/ ((module) => {

/**
 * This method returns a new empty array.
 *
 * @static
 * @memberOf _
 * @since 4.13.0
 * @category Util
 * @returns {Array} Returns the new empty array.
 * @example
 *
 * var arrays = _.times(2, _.stubArray);
 *
 * console.log(arrays);
 * // => [[], []]
 *
 * console.log(arrays[0] === arrays[1]);
 * // => false
 */
function stubArray() {
  return [];
}

module.exports = stubArray;

/***/ }),

/***/ "./node_modules/lodash/stubFalse.js":
/***/ ((module) => {

/**
 * This method returns `false`.
 *
 * @static
 * @memberOf _
 * @since 4.13.0
 * @category Util
 * @returns {boolean} Returns `false`.
 * @example
 *
 * _.times(2, _.stubFalse);
 * // => [false, false]
 */
function stubFalse() {
  return false;
}

module.exports = stubFalse;

/***/ }),

/***/ "./node_modules/lodash/toNumber.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseTrim = __webpack_require__("./node_modules/lodash/_baseTrim.js"),
    isObject = __webpack_require__("./node_modules/lodash/isObject.js"),
    isSymbol = __webpack_require__("./node_modules/lodash/isSymbol.js");
/** Used as references for various `Number` constants. */


var NAN = 0 / 0;
/** Used to detect bad signed hexadecimal string values. */

var reIsBadHex = /^[-+]0x[0-9a-f]+$/i;
/** Used to detect binary string values. */

var reIsBinary = /^0b[01]+$/i;
/** Used to detect octal string values. */

var reIsOctal = /^0o[0-7]+$/i;
/** Built-in method references without a dependency on `root`. */

var freeParseInt = parseInt;
/**
 * Converts `value` to a number.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to process.
 * @returns {number} Returns the number.
 * @example
 *
 * _.toNumber(3.2);
 * // => 3.2
 *
 * _.toNumber(Number.MIN_VALUE);
 * // => 5e-324
 *
 * _.toNumber(Infinity);
 * // => Infinity
 *
 * _.toNumber('3.2');
 * // => 3.2
 */

function toNumber(value) {
  if (typeof value == 'number') {
    return value;
  }

  if (isSymbol(value)) {
    return NAN;
  }

  if (isObject(value)) {
    var other = typeof value.valueOf == 'function' ? value.valueOf() : value;
    value = isObject(other) ? other + '' : other;
  }

  if (typeof value != 'string') {
    return value === 0 ? value : +value;
  }

  value = baseTrim(value);
  var isBinary = reIsBinary.test(value);
  return isBinary || reIsOctal.test(value) ? freeParseInt(value.slice(2), isBinary ? 2 : 8) : reIsBadHex.test(value) ? NAN : +value;
}

module.exports = toNumber;

/***/ }),

/***/ "./node_modules/lodash/toString.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

var baseToString = __webpack_require__("./node_modules/lodash/_baseToString.js");
/**
 * Converts `value` to a string. An empty string is returned for `null`
 * and `undefined` values. The sign of `-0` is preserved.
 *
 * @static
 * @memberOf _
 * @since 4.0.0
 * @category Lang
 * @param {*} value The value to convert.
 * @returns {string} Returns the converted string.
 * @example
 *
 * _.toString(null);
 * // => ''
 *
 * _.toString(-0);
 * // => '-0'
 *
 * _.toString([1, 2, 3]);
 * // => '1,2,3'
 */


function toString(value) {
  return value == null ? '' : baseToString(value);
}

module.exports = toString;

/***/ }),

/***/ "./node_modules/vue-loader/dist/exportHelper.js":
/***/ ((__unused_webpack_module, exports) => {

"use strict";
var __webpack_unused_export__;


__webpack_unused_export__ = ({
  value: true
}); // runtime helper for setting properties on components
// in a tree-shakable way

exports.Z = (sfc, props) => {
  const target = sfc.__vccOpts || sfc;

  for (const [key, val] of props) {
    target[key] = val;
  }

  return target;
};

/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/base.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ":root{--el-color-white:#ffffff;--el-color-black:#000000;--el-color-primary:#409eff;--el-color-primary-light-1:#53a8ff;--el-color-primary-light-2:#66b1ff;--el-color-primary-light-3:#79bbff;--el-color-primary-light-4:#8cc5ff;--el-color-primary-light-5:#a0cfff;--el-color-primary-light-6:#b3d8ff;--el-color-primary-light-7:#c6e2ff;--el-color-primary-light-8:#d9ecff;--el-color-primary-light-9:#ecf5ff;--el-color-success:#67c23a;--el-color-success-light:#e1f3d8;--el-color-success-lighter:#f0f9eb;--el-color-warning:#e6a23c;--el-color-warning-light:#faecd8;--el-color-warning-lighter:#fdf6ec;--el-color-danger:#f56c6c;--el-color-danger-light:#fde2e2;--el-color-danger-lighter:#fef0f0;--el-color-error:#f56c6c;--el-color-error-light:#fde2e2;--el-color-error-lighter:#fef0f0;--el-color-info:#909399;--el-color-info-light:#e9e9eb;--el-color-info-lighter:#f4f4f5;--el-bg-color:#f5f7fa;--el-border-width-base:1px;--el-border-style-base:solid;--el-border-color-hover:var(--el-text-color-placeholder);--el-border-base:var(--el-border-width-base) var(--el-border-style-base) var(--el-border-color-base);--el-svg-monochrome-grey:#dcdde0;--el-fill-base:var(--el-color-white);--el-font-size-extra-large:20px;--el-font-size-large:18px;--el-font-size-medium:16px;--el-font-size-base:14px;--el-font-size-small:13px;--el-font-size-extra-small:12px;--el-font-weight-primary:500;--el-font-line-height-primary:24px;--el-text-color-disabled-base:#bbb;--el-index-normal:1;--el-index-top:1000;--el-index-popper:2000;--el-text-color-primary:#303133;--el-text-color-regular:#606266;--el-text-color-secondary:#909399;--el-text-color-placeholder:#c0c4cc;--el-border-color-base:#dcdfe6;--el-border-color-light:#e4e7ed;--el-border-color-lighter:#ebeef5;--el-border-color-extra-light:#f2f6fc;--el-border-radius-base:4px;--el-border-radius-small:2px;--el-border-radius-round:20px;--el-border-radius-circle:100%;--el-box-shadow-base:0 2px 4px rgba(0, 0, 0, 0.12),0 0 6px rgba(0, 0, 0, 0.04);--el-box-shadow-light:0 2px 12px 0 rgba(0, 0, 0, 0.1);--el-disabled-bg-color:var(--el-bg-color);--el-disabled-text-color:var(--el-text-color-placeholder);--el-disabled-border-color:var(--el-border-color-light);--el-transition-duration:0.3s;--el-transition-duration-fast:0.2s;--el-transition-function-ease-in-out-bezier:cubic-bezier(0.645, 0.045, 0.355, 1);--el-transition-function-fast-bezier:cubic-bezier(0.23, 1, 0.32, 1);--el-transition-all:all var(--el-transition-duration) var(--el-transition-function-ease-in-out-bezier);--el-transition-fade:opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-md-fade:transform var(--el-transition-duration) var(--el-transition-function-fast-bezier),opacity var(--el-transition-duration) var(--el-transition-function-fast-bezier);--el-transition-fade-linear:opacity var(--el-transition-duration-fast) linear;--el-transition-border:border-color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier);--el-transition-color:color var(--el-transition-duration-fast) var(--el-transition-function-ease-in-out-bezier)}.fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center top}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center bottom}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1,1);transition:var(--el-transition-md-fade);transform-origin:top left}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45,.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-active{opacity:0;transform:translateY(-30px)}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotateZ(0)}100%{transform:rotateZ(360deg)}}.el-icon{--color:inherit;height:1em;width:1em;line-height:1em;display:inline-flex;justify-content:center;align-items:center;position:relative;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-aside.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-aside{--el-aside-width:300px;overflow:auto;box-sizing:border-box;flex-shrink:0;width:var(--el-aside-width)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-badge.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-badge{--el-badge-bg-color:var(--el-color-danger);--el-badge-radius:10px;--el-badge-font-size:12px;--el-badge-padding:6px;--el-badge-size:18px;position:relative;vertical-align:middle;display:inline-block}.el-badge__content{background-color:var(--el-badge-bg-color);border-radius:var(--el-badge-radius);color:var(--el-color-white);display:inline-block;font-size:var(--el-badge-font-size);height:var(--el-badge-size);line-height:var(--el-badge-size);padding:0 var(--el-badge-padding);text-align:center;white-space:nowrap;border:1px solid var(--el-color-white)}.el-badge__content.is-fixed{position:absolute;top:0;right:calc(1px + var(--el-badge-size)/ 2);transform:translateY(-50%) translateX(100%)}.el-badge__content.is-fixed.is-dot{right:5px}.el-badge__content.is-dot{height:8px;width:8px;padding:0;right:0;border-radius:50%}.el-badge__content--primary{background-color:var(--el-color-primary)}.el-badge__content--success{background-color:var(--el-color-success)}.el-badge__content--warning{background-color:var(--el-color-warning)}.el-badge__content--info{background-color:var(--el-color-info)}.el-badge__content--danger{background-color:var(--el-color-danger)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-button-group.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-button-group{display:inline-block;vertical-align:middle}.el-button-group::after,.el-button-group::before{display:table;content:\"\"}.el-button-group::after{clear:both}.el-button-group>.el-button{float:left;position:relative}.el-button-group>.el-button+.el-button{margin-left:0}.el-button-group>.el-button:first-child{border-top-right-radius:0;border-bottom-right-radius:0}.el-button-group>.el-button:last-child{border-top-left-radius:0;border-bottom-left-radius:0}.el-button-group>.el-button:first-child:last-child{border-top-right-radius:var(--el-border-radius-base);border-bottom-right-radius:var(--el-border-radius-base);border-top-left-radius:var(--el-border-radius-base);border-bottom-left-radius:var(--el-border-radius-base)}.el-button-group>.el-button:first-child:last-child.is-round{border-radius:var(--el-border-radius-round)}.el-button-group>.el-button:first-child:last-child.is-circle{border-radius:50%}.el-button-group>.el-button:not(:first-child):not(:last-child){border-radius:0}.el-button-group>.el-button:not(:last-child){margin-right:-1px}.el-button-group>.el-button:active,.el-button-group>.el-button:focus,.el-button-group>.el-button:hover{z-index:1}.el-button-group>.el-button.is-active{z-index:1}.el-button-group>.el-dropdown>.el-button{border-top-left-radius:0;border-bottom-left-radius:0;border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--primary:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--primary:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--primary:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--success:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--success:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--success:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--warning:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--warning:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--warning:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--danger:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--danger:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--danger:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--info:first-child{border-right-color:var(--el-button-divide-border-color)}.el-button-group .el-button--info:last-child{border-left-color:var(--el-button-divide-border-color)}.el-button-group .el-button--info:not(:first-child):not(:last-child){border-left-color:var(--el-button-divide-border-color);border-right-color:var(--el-button-divide-border-color)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-button.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-button{--el-button-font-weight:var(--el-font-weight-primary);--el-button-border-color:var(--el-border-color-base);--el-button-bg-color:var(--el-color-white);--el-button-text-color:var(--el-text-color-regular);--el-button-disabled-text-color:var(--el-disabled-text-color);--el-button-disabled-bg-color:var(--el-color-white);--el-button-disabled-border-color:var(--el-border-color-light);--el-button-divide-border-color:rgba(255, 255, 255, 0.5);--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-primary-light-9);--el-button-hover-border-color:var(--el-color-primary-light-7);--el-button-active-text-color:var(--el-button-hover-text-color);--el-button-active-border-color:var(--el-color-primary);--el-button-active-bg-color:var(--el-button-hover-bg-color)}.el-button{display:inline-flex;justify-content:center;align-items:center;line-height:1;height:32px;white-space:nowrap;cursor:pointer;background-color:var(--el-button-bg-color,var(--el-color-white));border:var(--el-border-base);border-color:var(--el-button-border-color,var(--el-border-color-base));color:var(--el-button-text-color,var(--el-text-color-regular));-webkit-appearance:none;text-align:center;box-sizing:border-box;outline:0;margin:0;transition:.1s;font-weight:var(--el-button-font-weight);-webkit-user-select:none;user-select:none;vertical-align:middle;padding:8px 15px;font-size:var(--el-font-size-base,14px);border-radius:var(--el-border-radius-base)}.el-button>span{display:inline-flex;align-items:center}.el-button+.el-button{margin-left:12px}.el-button.is-round{padding:8px 15px}.el-button:focus,.el-button:hover{color:var(--el-button-hover-text-color);border-color:var(--el-button-hover-border-color,var(--el-button-hover-bg-color));background-color:var(--el-button-hover-bg-color);outline:0}.el-button:active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color,var(--el-button-active-bg-color));background-color:var(--el-button-active-bg-color,var(--el-button-bg-color));outline:0}.el-button::-moz-focus-inner{border:0}.el-button [class*=el-icon]+span{margin-left:6px}.el-button [class*=el-icon] svg{vertical-align:bottom}.el-button.is-plain{--el-button-active-text-color:#3a8ee6;--el-button-active-border-color:#3a8ee6;--el-button-hover-text-color:var(--el-color-primary);--el-button-hover-bg-color:var(--el-color-white);--el-button-hover-border-color:var(--el-color-primary)}.el-button.is-active{color:var(--el-button-active-text-color);border-color:var(--el-button-active-border-color,--el-button-active-bg-color);background-color:var(--el-button-active-bg-color);outline:0}.el-button.is-disabled,.el-button.is-disabled:focus,.el-button.is-disabled:hover{color:var(--el-button-disabled-text-color);cursor:not-allowed;background-image:none;background-color:var(--el-button-disabled-bg-color);border-color:var(--el-button-disabled-border-color)}.el-button.is-disabled.el-button--text{background-color:transparent}.el-button.is-disabled.is-plain,.el-button.is-disabled.is-plain:focus,.el-button.is-disabled.is-plain:hover{background-color:var(--el-color-white);border-color:var(--el-button-disabled-border-color);color:var(--el-button-disabled-text-color)}.el-button.is-loading{position:relative;pointer-events:none}.el-button.is-loading:before{pointer-events:none;content:\"\";position:absolute;left:-1px;top:-1px;right:-1px;bottom:-1px;border-radius:inherit;background-color:rgba(255,255,255,.35)}.el-button.is-round{border-radius:var(--el-border-radius-round)}.el-button.is-circle{border-radius:50%;padding:8px}.el-button__text--expand{letter-spacing:.3em;margin-right:-.3em}.el-button--default{--el-button-text-color:var(--el-text-color-regular);--el-button-hover-text-color:var(--el-color-primary);--el-button-disabled-text-color:var(--el-text-color-placeholder)}.el-button--primary{--el-button-text-color:var(--el-color-white);--el-button-hover-text-color:var(--el-color-white);--el-button-disabled-text-color:var(--el-color-white)}.el-button--primary.is-plain{--el-button-text-color:var(--el-color-primary);--el-button-bg-color:#ecf5ff;--el-button-border-color:#b3d8ff;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-primary);--el-button-hover-border-color:var(--el-color-primary);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-primary)}.el-button--primary.is-plain.is-disabled,.el-button--primary.is-plain.is-disabled:active,.el-button--primary.is-plain.is-disabled:focus,.el-button--primary.is-plain.is-disabled:hover{color:#8cc5ff;background-color:#ecf5ff;border-color:#d9ecff}.el-button--success{--el-button-text-color:var(--el-color-white);--el-button-hover-text-color:var(--el-color-white);--el-button-disabled-text-color:var(--el-color-white)}.el-button--success.is-plain{--el-button-text-color:var(--el-color-success);--el-button-bg-color:#f0f9eb;--el-button-border-color:#c2e7b0;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-success);--el-button-hover-border-color:var(--el-color-success);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-success)}.el-button--success.is-plain.is-disabled,.el-button--success.is-plain.is-disabled:active,.el-button--success.is-plain.is-disabled:focus,.el-button--success.is-plain.is-disabled:hover{color:#a4da89;background-color:#f0f9eb;border-color:#e1f3d8}.el-button--warning{--el-button-text-color:var(--el-color-white);--el-button-hover-text-color:var(--el-color-white);--el-button-disabled-text-color:var(--el-color-white)}.el-button--warning.is-plain{--el-button-text-color:var(--el-color-warning);--el-button-bg-color:#fdf6ec;--el-button-border-color:#f5dab1;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-warning);--el-button-hover-border-color:var(--el-color-warning);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-warning)}.el-button--warning.is-plain.is-disabled,.el-button--warning.is-plain.is-disabled:active,.el-button--warning.is-plain.is-disabled:focus,.el-button--warning.is-plain.is-disabled:hover{color:#f0c78a;background-color:#fdf6ec;border-color:#faecd8}.el-button--danger{--el-button-text-color:var(--el-color-white);--el-button-hover-text-color:var(--el-color-white);--el-button-disabled-text-color:var(--el-color-white)}.el-button--danger.is-plain{--el-button-text-color:var(--el-color-danger);--el-button-bg-color:#fef0f0;--el-button-border-color:#fbc4c4;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-danger);--el-button-hover-border-color:var(--el-color-danger);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-danger)}.el-button--danger.is-plain.is-disabled,.el-button--danger.is-plain.is-disabled:active,.el-button--danger.is-plain.is-disabled:focus,.el-button--danger.is-plain.is-disabled:hover{color:#f9a7a7;background-color:#fef0f0;border-color:#fde2e2}.el-button--info{--el-button-text-color:var(--el-color-white);--el-button-hover-text-color:var(--el-color-white);--el-button-disabled-text-color:var(--el-color-white)}.el-button--info.is-plain{--el-button-text-color:var(--el-color-info);--el-button-bg-color:#f4f4f5;--el-button-border-color:#d3d4d6;--el-button-hover-text-color:var(--el-color-white);--el-button-hover-bg-color:var(--el-color-info);--el-button-hover-border-color:var(--el-color-info);--el-button-active-text-color:var(--el-color-white);--el-button-active-border-color:var(--el-color-info)}.el-button--info.is-plain.is-disabled,.el-button--info.is-plain.is-disabled:active,.el-button--info.is-plain.is-disabled:focus,.el-button--info.is-plain.is-disabled:hover{color:#bcbec2;background-color:#f4f4f5;border-color:#e9e9eb}.el-button--large{--el-button-size:40px;height:var(--el-button-size);padding:12px 19px;font-size:var(--el-font-size-base,14px);border-radius:var(--el-border-radius-base)}.el-button--large [class*=el-icon]+span{margin-left:8px}.el-button--large.is-round{padding:12px 19px}.el-button--large.is-circle{width:var(--el-button-size);padding:12px}.el-button--small{--el-button-size:24px;height:var(--el-button-size);padding:5px 11px;font-size:12px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-button--small [class*=el-icon]+span{margin-left:4px}.el-button--small.is-round{padding:5px 11px}.el-button--small.is-circle{width:var(--el-button-size);padding:5px}.el-button--text{border-color:transparent;color:var(--el-color-primary);background:0 0;padding-left:0;padding-right:0}.el-button--text:focus,.el-button--text:hover{color:var(--el-color-primary-light-2);border-color:transparent;background-color:transparent}.el-button--text:active{color:#3a8ee6;border-color:transparent;background-color:transparent}.el-button--text.is-disabled,.el-button--text.is-disabled:focus,.el-button--text.is-disabled:hover{border-color:transparent}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-calendar.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-calendar{--el-calendar-border:var(--el-table-border, 1px solid var(--el-border-color-lighter));--el-calendar-header-border-bottom:var(--el-calendar-border);--el-calendar-selected-bg-color:#f2f8fe;--el-calendar-cell-width:85px;background-color:#fff}.el-calendar__header{display:flex;justify-content:space-between;padding:12px 20px;border-bottom:var(--el-calendar-header-border-bottom)}.el-calendar__title{color:#000;align-self:center}.el-calendar__body{padding:12px 20px 35px}.el-calendar-table{table-layout:fixed;width:100%}.el-calendar-table thead th{padding:12px 0;color:var(--el-text-color-regular);font-weight:400}.el-calendar-table:not(.is-range) td.next,.el-calendar-table:not(.is-range) td.prev{color:var(--el-text-color-placeholder)}.el-calendar-table td{border-bottom:var(--el-calendar-border);border-right:var(--el-calendar-border);vertical-align:top;transition:background-color var(--el-transition-duration-fast) ease}.el-calendar-table td.is-selected{background-color:var(--el-calendar-selected-bg-color)}.el-calendar-table td.is-today{color:var(--el-color-primary)}.el-calendar-table tr:first-child td{border-top:var(--el-calendar-border)}.el-calendar-table tr td:first-child{border-left:var(--el-calendar-border)}.el-calendar-table tr.el-calendar-table__row--hide-border td{border-top:none}.el-calendar-table .el-calendar-day{box-sizing:border-box;padding:8px;height:var(--el-calendar-cell-width)}.el-calendar-table .el-calendar-day:hover{cursor:pointer;background-color:var(--el-calendar-selected-bg-color)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-card.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-card{--el-card-border-color:var(--el-border-color-light, #ebeef5);--el-card-border-radius:4px;--el-card-padding:20px;--el-card-bg-color:var(--el-color-white)}.dark .el-card{--el-card-bg-color:var(--el-color-black)}.el-card{border-radius:var(--el-card-border-radius);border:1px solid var(--el-card-border-color);background-color:var(--el-card-bg-color);overflow:hidden;color:var(--el-text-color-primary);transition:var(--el-transition-duration)}.el-card.is-always-shadow{box-shadow:var(--el-box-shadow-light)}.el-card.is-hover-shadow:focus,.el-card.is-hover-shadow:hover{box-shadow:var(--el-box-shadow-light)}.el-card__header{padding:calc(var(--el-card-padding) - 2px) var(--el-card-padding);border-bottom:1px solid var(--el-card-border-color);box-sizing:border-box}.el-card__body{padding:var(--el-card-padding)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-checkbox.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-checkbox{--el-checkbox-font-size:14px;--el-checkbox-font-weight:var(--el-font-weight-primary);--el-checkbox-text-color:var(--el-text-color-regular);--el-checkbox-input-height:14px;--el-checkbox-input-width:14px;--el-checkbox-border-radius:var(--el-border-radius-small);--el-checkbox-bg-color:var(--el-color-white);--el-checkbox-input-border:var(--el-border-base);--el-checkbox-disabled-border-color:var(--el-border-color-base);--el-checkbox-disabled-input-fill:#edf2fc;--el-checkbox-disabled-icon-color:var(--el-text-color-placeholder);--el-checkbox-disabled-checked-input-fill:var(--el-border-color-extra-light);--el-checkbox-disabled-checked-input-border-color:var(--el-border-color-base);--el-checkbox-disabled-checked-icon-color:var(--el-text-color-placeholder);--el-checkbox-checked-text-color:var(--el-color-primary);--el-checkbox-checked-input-border-color:var(--el-color-primary);--el-checkbox-checked-bg-color:var(--el-color-primary);--el-checkbox-checked-icon-color:var(--el-fill-base);--el-checkbox-input-border-color-hover:var(--el-color-primary)}.el-checkbox{color:var(--el-checkbox-text-color);font-weight:var(--el-checkbox-font-weight);font-size:var(--el-font-size-base);position:relative;cursor:pointer;display:inline-flex;align-items:center;white-space:nowrap;-webkit-user-select:none;user-select:none;margin-right:30px;height:32px}.el-checkbox.is-bordered{padding:0 15px 0 9px;border-radius:var(--el-border-radius-base);border:var(--el-border-base);box-sizing:border-box}.el-checkbox.is-bordered.is-checked{border-color:var(--el-color-primary)}.el-checkbox.is-bordered.is-disabled{border-color:var(--el-border-color-lighter);cursor:not-allowed}.el-checkbox.is-bordered.el-checkbox--large{padding:0 19px 0 11px;border-radius:var(--el-border-radius-base)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__label{font-size:var(--el-font-size-base,14px)}.el-checkbox.is-bordered.el-checkbox--large .el-checkbox__inner{height:14px;width:14px}.el-checkbox.is-bordered.el-checkbox--small{padding:0 11px 0 7px;border-radius:calc(var(--el-border-radius-base) - 1px)}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner{height:12px;width:12px}.el-checkbox.is-bordered.el-checkbox--small .el-checkbox__inner::after{height:6px;width:2px}.el-checkbox__input{white-space:nowrap;cursor:pointer;outline:0;display:inline-flex;position:relative}.el-checkbox__input.is-disabled .el-checkbox__inner{background-color:var(--el-checkbox-disabled-input-fill);border-color:var(--el-checkbox-disabled-border-color);cursor:not-allowed}.el-checkbox__input.is-disabled .el-checkbox__inner::after{cursor:not-allowed;border-color:var(--el-checkbox-disabled-icon-color)}.el-checkbox__input.is-disabled .el-checkbox__inner+.el-checkbox__label{cursor:not-allowed}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-checked .el-checkbox__inner::after{border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-disabled-checked-input-fill);border-color:var(--el-checkbox-disabled-checked-input-border-color)}.el-checkbox__input.is-disabled.is-indeterminate .el-checkbox__inner::before{background-color:var(--el-checkbox-disabled-checked-icon-color);border-color:var(--el-checkbox-disabled-checked-icon-color)}.el-checkbox__input.is-disabled+span.el-checkbox__label{color:var(--el-disabled-text-color);cursor:not-allowed}.el-checkbox__input.is-checked .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-checked .el-checkbox__inner::after{transform:rotate(45deg) scaleY(1)}.el-checkbox__input.is-checked+.el-checkbox__label{color:var(--el-checkbox-checked-text-color)}.el-checkbox__input.is-focus .el-checkbox__inner{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__input.is-indeterminate .el-checkbox__inner{background-color:var(--el-checkbox-checked-bg-color);border-color:var(--el-checkbox-checked-input-border-color)}.el-checkbox__input.is-indeterminate .el-checkbox__inner::before{content:\"\";position:absolute;display:block;background-color:var(--el-checkbox-checked-icon-color);height:2px;transform:scale(.5);left:0;right:0;top:5px}.el-checkbox__input.is-indeterminate .el-checkbox__inner::after{display:none}.el-checkbox__inner{display:inline-block;position:relative;border:var(--el-checkbox-input-border);border-radius:var(--el-checkbox-border-radius);box-sizing:border-box;width:var(--el-checkbox-input-width);height:var(--el-checkbox-input-height);background-color:var(--el-checkbox-bg-color);z-index:var(--el-index-normal);transition:border-color .25s cubic-bezier(.71,-.46,.29,1.46),background-color .25s cubic-bezier(.71,-.46,.29,1.46)}.el-checkbox__inner:hover{border-color:var(--el-checkbox-input-border-color-hover)}.el-checkbox__inner::after{box-sizing:content-box;content:\"\";border:1px solid var(--el-checkbox-checked-icon-color);border-left:0;border-top:0;height:7px;left:4px;position:absolute;top:1px;transform:rotate(45deg) scaleY(0);width:3px;transition:transform .15s ease-in 50ms;transform-origin:center}.el-checkbox__original{opacity:0;outline:0;position:absolute;margin:0;width:0;height:0;z-index:-1}.el-checkbox__label{display:inline-block;padding-left:8px;line-height:1;font-size:var(--el-checkbox-font-size)}.el-checkbox.el-checkbox--large{height:40px}.el-checkbox.el-checkbox--large .el-checkbox__label{font-size:14px}.el-checkbox.el-checkbox--large .el-checkbox__inner{width:14px;height:14px}.el-checkbox.el-checkbox--small{height:24px}.el-checkbox.el-checkbox--small .el-checkbox__label{font-size:12px}.el-checkbox.el-checkbox--small .el-checkbox__inner{width:12px;height:12px}.el-checkbox.el-checkbox--small .el-checkbox__input.is-indeterminate .el-checkbox__inner::before{top:4px}.el-checkbox.el-checkbox--small .el-checkbox__inner::after{width:2px;height:6px}.el-checkbox:last-of-type{margin-right:0}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-col.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "[class*=el-col-]{float:left;box-sizing:border-box}[class*=el-col-].is-guttered{display:block;min-height:1px}.el-col-0{display:none}.el-col-0.is-guttered{display:none}.el-col-0{max-width:0%;flex:0 0 0%}.el-col-offset-0{margin-left:0}.el-col-pull-0{position:relative;right:0}.el-col-push-0{position:relative;left:0}.el-col-1{max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-offset-1{margin-left:4.1666666667%}.el-col-pull-1{position:relative;right:4.1666666667%}.el-col-push-1{position:relative;left:4.1666666667%}.el-col-2{max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-offset-2{margin-left:8.3333333333%}.el-col-pull-2{position:relative;right:8.3333333333%}.el-col-push-2{position:relative;left:8.3333333333%}.el-col-3{max-width:12.5%;flex:0 0 12.5%}.el-col-offset-3{margin-left:12.5%}.el-col-pull-3{position:relative;right:12.5%}.el-col-push-3{position:relative;left:12.5%}.el-col-4{max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-offset-4{margin-left:16.6666666667%}.el-col-pull-4{position:relative;right:16.6666666667%}.el-col-push-4{position:relative;left:16.6666666667%}.el-col-5{max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-offset-5{margin-left:20.8333333333%}.el-col-pull-5{position:relative;right:20.8333333333%}.el-col-push-5{position:relative;left:20.8333333333%}.el-col-6{max-width:25%;flex:0 0 25%}.el-col-offset-6{margin-left:25%}.el-col-pull-6{position:relative;right:25%}.el-col-push-6{position:relative;left:25%}.el-col-7{max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-offset-7{margin-left:29.1666666667%}.el-col-pull-7{position:relative;right:29.1666666667%}.el-col-push-7{position:relative;left:29.1666666667%}.el-col-8{max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-offset-8{margin-left:33.3333333333%}.el-col-pull-8{position:relative;right:33.3333333333%}.el-col-push-8{position:relative;left:33.3333333333%}.el-col-9{max-width:37.5%;flex:0 0 37.5%}.el-col-offset-9{margin-left:37.5%}.el-col-pull-9{position:relative;right:37.5%}.el-col-push-9{position:relative;left:37.5%}.el-col-10{max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-offset-10{margin-left:41.6666666667%}.el-col-pull-10{position:relative;right:41.6666666667%}.el-col-push-10{position:relative;left:41.6666666667%}.el-col-11{max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-offset-11{margin-left:45.8333333333%}.el-col-pull-11{position:relative;right:45.8333333333%}.el-col-push-11{position:relative;left:45.8333333333%}.el-col-12{max-width:50%;flex:0 0 50%}.el-col-offset-12{margin-left:50%}.el-col-pull-12{position:relative;right:50%}.el-col-push-12{position:relative;left:50%}.el-col-13{max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-offset-13{margin-left:54.1666666667%}.el-col-pull-13{position:relative;right:54.1666666667%}.el-col-push-13{position:relative;left:54.1666666667%}.el-col-14{max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-offset-14{margin-left:58.3333333333%}.el-col-pull-14{position:relative;right:58.3333333333%}.el-col-push-14{position:relative;left:58.3333333333%}.el-col-15{max-width:62.5%;flex:0 0 62.5%}.el-col-offset-15{margin-left:62.5%}.el-col-pull-15{position:relative;right:62.5%}.el-col-push-15{position:relative;left:62.5%}.el-col-16{max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-offset-16{margin-left:66.6666666667%}.el-col-pull-16{position:relative;right:66.6666666667%}.el-col-push-16{position:relative;left:66.6666666667%}.el-col-17{max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-offset-17{margin-left:70.8333333333%}.el-col-pull-17{position:relative;right:70.8333333333%}.el-col-push-17{position:relative;left:70.8333333333%}.el-col-18{max-width:75%;flex:0 0 75%}.el-col-offset-18{margin-left:75%}.el-col-pull-18{position:relative;right:75%}.el-col-push-18{position:relative;left:75%}.el-col-19{max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-offset-19{margin-left:79.1666666667%}.el-col-pull-19{position:relative;right:79.1666666667%}.el-col-push-19{position:relative;left:79.1666666667%}.el-col-20{max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-offset-20{margin-left:83.3333333333%}.el-col-pull-20{position:relative;right:83.3333333333%}.el-col-push-20{position:relative;left:83.3333333333%}.el-col-21{max-width:87.5%;flex:0 0 87.5%}.el-col-offset-21{margin-left:87.5%}.el-col-pull-21{position:relative;right:87.5%}.el-col-push-21{position:relative;left:87.5%}.el-col-22{max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-offset-22{margin-left:91.6666666667%}.el-col-pull-22{position:relative;right:91.6666666667%}.el-col-push-22{position:relative;left:91.6666666667%}.el-col-23{max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-offset-23{margin-left:95.8333333333%}.el-col-pull-23{position:relative;right:95.8333333333%}.el-col-push-23{position:relative;left:95.8333333333%}.el-col-24{max-width:100%;flex:0 0 100%}.el-col-offset-24{margin-left:100%}.el-col-pull-24{position:relative;right:100%}.el-col-push-24{position:relative;left:100%}@media only screen and (max-width:768px){.el-col-xs-0{display:none}.el-col-xs-0.is-guttered{display:none}.el-col-xs-0{max-width:0%;flex:0 0 0%}.el-col-xs-offset-0{margin-left:0}.el-col-xs-pull-0{position:relative;right:0}.el-col-xs-push-0{position:relative;left:0}.el-col-xs-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-xs-offset-1{margin-left:4.1666666667%}.el-col-xs-pull-1{position:relative;right:4.1666666667%}.el-col-xs-push-1{position:relative;left:4.1666666667%}.el-col-xs-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-xs-offset-2{margin-left:8.3333333333%}.el-col-xs-pull-2{position:relative;right:8.3333333333%}.el-col-xs-push-2{position:relative;left:8.3333333333%}.el-col-xs-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-xs-offset-3{margin-left:12.5%}.el-col-xs-pull-3{position:relative;right:12.5%}.el-col-xs-push-3{position:relative;left:12.5%}.el-col-xs-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-xs-offset-4{margin-left:16.6666666667%}.el-col-xs-pull-4{position:relative;right:16.6666666667%}.el-col-xs-push-4{position:relative;left:16.6666666667%}.el-col-xs-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-xs-offset-5{margin-left:20.8333333333%}.el-col-xs-pull-5{position:relative;right:20.8333333333%}.el-col-xs-push-5{position:relative;left:20.8333333333%}.el-col-xs-6{display:block;max-width:25%;flex:0 0 25%}.el-col-xs-offset-6{margin-left:25%}.el-col-xs-pull-6{position:relative;right:25%}.el-col-xs-push-6{position:relative;left:25%}.el-col-xs-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-xs-offset-7{margin-left:29.1666666667%}.el-col-xs-pull-7{position:relative;right:29.1666666667%}.el-col-xs-push-7{position:relative;left:29.1666666667%}.el-col-xs-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-xs-offset-8{margin-left:33.3333333333%}.el-col-xs-pull-8{position:relative;right:33.3333333333%}.el-col-xs-push-8{position:relative;left:33.3333333333%}.el-col-xs-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-xs-offset-9{margin-left:37.5%}.el-col-xs-pull-9{position:relative;right:37.5%}.el-col-xs-push-9{position:relative;left:37.5%}.el-col-xs-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-xs-offset-10{margin-left:41.6666666667%}.el-col-xs-pull-10{position:relative;right:41.6666666667%}.el-col-xs-push-10{position:relative;left:41.6666666667%}.el-col-xs-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-xs-offset-11{margin-left:45.8333333333%}.el-col-xs-pull-11{position:relative;right:45.8333333333%}.el-col-xs-push-11{position:relative;left:45.8333333333%}.el-col-xs-12{display:block;max-width:50%;flex:0 0 50%}.el-col-xs-offset-12{margin-left:50%}.el-col-xs-pull-12{position:relative;right:50%}.el-col-xs-push-12{position:relative;left:50%}.el-col-xs-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-xs-offset-13{margin-left:54.1666666667%}.el-col-xs-pull-13{position:relative;right:54.1666666667%}.el-col-xs-push-13{position:relative;left:54.1666666667%}.el-col-xs-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-xs-offset-14{margin-left:58.3333333333%}.el-col-xs-pull-14{position:relative;right:58.3333333333%}.el-col-xs-push-14{position:relative;left:58.3333333333%}.el-col-xs-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-xs-offset-15{margin-left:62.5%}.el-col-xs-pull-15{position:relative;right:62.5%}.el-col-xs-push-15{position:relative;left:62.5%}.el-col-xs-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-xs-offset-16{margin-left:66.6666666667%}.el-col-xs-pull-16{position:relative;right:66.6666666667%}.el-col-xs-push-16{position:relative;left:66.6666666667%}.el-col-xs-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-xs-offset-17{margin-left:70.8333333333%}.el-col-xs-pull-17{position:relative;right:70.8333333333%}.el-col-xs-push-17{position:relative;left:70.8333333333%}.el-col-xs-18{display:block;max-width:75%;flex:0 0 75%}.el-col-xs-offset-18{margin-left:75%}.el-col-xs-pull-18{position:relative;right:75%}.el-col-xs-push-18{position:relative;left:75%}.el-col-xs-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-xs-offset-19{margin-left:79.1666666667%}.el-col-xs-pull-19{position:relative;right:79.1666666667%}.el-col-xs-push-19{position:relative;left:79.1666666667%}.el-col-xs-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-xs-offset-20{margin-left:83.3333333333%}.el-col-xs-pull-20{position:relative;right:83.3333333333%}.el-col-xs-push-20{position:relative;left:83.3333333333%}.el-col-xs-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-xs-offset-21{margin-left:87.5%}.el-col-xs-pull-21{position:relative;right:87.5%}.el-col-xs-push-21{position:relative;left:87.5%}.el-col-xs-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-xs-offset-22{margin-left:91.6666666667%}.el-col-xs-pull-22{position:relative;right:91.6666666667%}.el-col-xs-push-22{position:relative;left:91.6666666667%}.el-col-xs-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-xs-offset-23{margin-left:95.8333333333%}.el-col-xs-pull-23{position:relative;right:95.8333333333%}.el-col-xs-push-23{position:relative;left:95.8333333333%}.el-col-xs-24{display:block;max-width:100%;flex:0 0 100%}.el-col-xs-offset-24{margin-left:100%}.el-col-xs-pull-24{position:relative;right:100%}.el-col-xs-push-24{position:relative;left:100%}}@media only screen and (min-width:768px){.el-col-sm-0{display:none}.el-col-sm-0.is-guttered{display:none}.el-col-sm-0{max-width:0%;flex:0 0 0%}.el-col-sm-offset-0{margin-left:0}.el-col-sm-pull-0{position:relative;right:0}.el-col-sm-push-0{position:relative;left:0}.el-col-sm-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-sm-offset-1{margin-left:4.1666666667%}.el-col-sm-pull-1{position:relative;right:4.1666666667%}.el-col-sm-push-1{position:relative;left:4.1666666667%}.el-col-sm-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-sm-offset-2{margin-left:8.3333333333%}.el-col-sm-pull-2{position:relative;right:8.3333333333%}.el-col-sm-push-2{position:relative;left:8.3333333333%}.el-col-sm-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-sm-offset-3{margin-left:12.5%}.el-col-sm-pull-3{position:relative;right:12.5%}.el-col-sm-push-3{position:relative;left:12.5%}.el-col-sm-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-sm-offset-4{margin-left:16.6666666667%}.el-col-sm-pull-4{position:relative;right:16.6666666667%}.el-col-sm-push-4{position:relative;left:16.6666666667%}.el-col-sm-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-sm-offset-5{margin-left:20.8333333333%}.el-col-sm-pull-5{position:relative;right:20.8333333333%}.el-col-sm-push-5{position:relative;left:20.8333333333%}.el-col-sm-6{display:block;max-width:25%;flex:0 0 25%}.el-col-sm-offset-6{margin-left:25%}.el-col-sm-pull-6{position:relative;right:25%}.el-col-sm-push-6{position:relative;left:25%}.el-col-sm-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-sm-offset-7{margin-left:29.1666666667%}.el-col-sm-pull-7{position:relative;right:29.1666666667%}.el-col-sm-push-7{position:relative;left:29.1666666667%}.el-col-sm-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-sm-offset-8{margin-left:33.3333333333%}.el-col-sm-pull-8{position:relative;right:33.3333333333%}.el-col-sm-push-8{position:relative;left:33.3333333333%}.el-col-sm-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-sm-offset-9{margin-left:37.5%}.el-col-sm-pull-9{position:relative;right:37.5%}.el-col-sm-push-9{position:relative;left:37.5%}.el-col-sm-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-sm-offset-10{margin-left:41.6666666667%}.el-col-sm-pull-10{position:relative;right:41.6666666667%}.el-col-sm-push-10{position:relative;left:41.6666666667%}.el-col-sm-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-sm-offset-11{margin-left:45.8333333333%}.el-col-sm-pull-11{position:relative;right:45.8333333333%}.el-col-sm-push-11{position:relative;left:45.8333333333%}.el-col-sm-12{display:block;max-width:50%;flex:0 0 50%}.el-col-sm-offset-12{margin-left:50%}.el-col-sm-pull-12{position:relative;right:50%}.el-col-sm-push-12{position:relative;left:50%}.el-col-sm-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-sm-offset-13{margin-left:54.1666666667%}.el-col-sm-pull-13{position:relative;right:54.1666666667%}.el-col-sm-push-13{position:relative;left:54.1666666667%}.el-col-sm-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-sm-offset-14{margin-left:58.3333333333%}.el-col-sm-pull-14{position:relative;right:58.3333333333%}.el-col-sm-push-14{position:relative;left:58.3333333333%}.el-col-sm-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-sm-offset-15{margin-left:62.5%}.el-col-sm-pull-15{position:relative;right:62.5%}.el-col-sm-push-15{position:relative;left:62.5%}.el-col-sm-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-sm-offset-16{margin-left:66.6666666667%}.el-col-sm-pull-16{position:relative;right:66.6666666667%}.el-col-sm-push-16{position:relative;left:66.6666666667%}.el-col-sm-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-sm-offset-17{margin-left:70.8333333333%}.el-col-sm-pull-17{position:relative;right:70.8333333333%}.el-col-sm-push-17{position:relative;left:70.8333333333%}.el-col-sm-18{display:block;max-width:75%;flex:0 0 75%}.el-col-sm-offset-18{margin-left:75%}.el-col-sm-pull-18{position:relative;right:75%}.el-col-sm-push-18{position:relative;left:75%}.el-col-sm-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-sm-offset-19{margin-left:79.1666666667%}.el-col-sm-pull-19{position:relative;right:79.1666666667%}.el-col-sm-push-19{position:relative;left:79.1666666667%}.el-col-sm-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-sm-offset-20{margin-left:83.3333333333%}.el-col-sm-pull-20{position:relative;right:83.3333333333%}.el-col-sm-push-20{position:relative;left:83.3333333333%}.el-col-sm-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-sm-offset-21{margin-left:87.5%}.el-col-sm-pull-21{position:relative;right:87.5%}.el-col-sm-push-21{position:relative;left:87.5%}.el-col-sm-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-sm-offset-22{margin-left:91.6666666667%}.el-col-sm-pull-22{position:relative;right:91.6666666667%}.el-col-sm-push-22{position:relative;left:91.6666666667%}.el-col-sm-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-sm-offset-23{margin-left:95.8333333333%}.el-col-sm-pull-23{position:relative;right:95.8333333333%}.el-col-sm-push-23{position:relative;left:95.8333333333%}.el-col-sm-24{display:block;max-width:100%;flex:0 0 100%}.el-col-sm-offset-24{margin-left:100%}.el-col-sm-pull-24{position:relative;right:100%}.el-col-sm-push-24{position:relative;left:100%}}@media only screen and (min-width:992px){.el-col-md-0{display:none}.el-col-md-0.is-guttered{display:none}.el-col-md-0{max-width:0%;flex:0 0 0%}.el-col-md-offset-0{margin-left:0}.el-col-md-pull-0{position:relative;right:0}.el-col-md-push-0{position:relative;left:0}.el-col-md-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-md-offset-1{margin-left:4.1666666667%}.el-col-md-pull-1{position:relative;right:4.1666666667%}.el-col-md-push-1{position:relative;left:4.1666666667%}.el-col-md-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-md-offset-2{margin-left:8.3333333333%}.el-col-md-pull-2{position:relative;right:8.3333333333%}.el-col-md-push-2{position:relative;left:8.3333333333%}.el-col-md-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-md-offset-3{margin-left:12.5%}.el-col-md-pull-3{position:relative;right:12.5%}.el-col-md-push-3{position:relative;left:12.5%}.el-col-md-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-md-offset-4{margin-left:16.6666666667%}.el-col-md-pull-4{position:relative;right:16.6666666667%}.el-col-md-push-4{position:relative;left:16.6666666667%}.el-col-md-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-md-offset-5{margin-left:20.8333333333%}.el-col-md-pull-5{position:relative;right:20.8333333333%}.el-col-md-push-5{position:relative;left:20.8333333333%}.el-col-md-6{display:block;max-width:25%;flex:0 0 25%}.el-col-md-offset-6{margin-left:25%}.el-col-md-pull-6{position:relative;right:25%}.el-col-md-push-6{position:relative;left:25%}.el-col-md-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-md-offset-7{margin-left:29.1666666667%}.el-col-md-pull-7{position:relative;right:29.1666666667%}.el-col-md-push-7{position:relative;left:29.1666666667%}.el-col-md-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-md-offset-8{margin-left:33.3333333333%}.el-col-md-pull-8{position:relative;right:33.3333333333%}.el-col-md-push-8{position:relative;left:33.3333333333%}.el-col-md-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-md-offset-9{margin-left:37.5%}.el-col-md-pull-9{position:relative;right:37.5%}.el-col-md-push-9{position:relative;left:37.5%}.el-col-md-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-md-offset-10{margin-left:41.6666666667%}.el-col-md-pull-10{position:relative;right:41.6666666667%}.el-col-md-push-10{position:relative;left:41.6666666667%}.el-col-md-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-md-offset-11{margin-left:45.8333333333%}.el-col-md-pull-11{position:relative;right:45.8333333333%}.el-col-md-push-11{position:relative;left:45.8333333333%}.el-col-md-12{display:block;max-width:50%;flex:0 0 50%}.el-col-md-offset-12{margin-left:50%}.el-col-md-pull-12{position:relative;right:50%}.el-col-md-push-12{position:relative;left:50%}.el-col-md-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-md-offset-13{margin-left:54.1666666667%}.el-col-md-pull-13{position:relative;right:54.1666666667%}.el-col-md-push-13{position:relative;left:54.1666666667%}.el-col-md-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-md-offset-14{margin-left:58.3333333333%}.el-col-md-pull-14{position:relative;right:58.3333333333%}.el-col-md-push-14{position:relative;left:58.3333333333%}.el-col-md-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-md-offset-15{margin-left:62.5%}.el-col-md-pull-15{position:relative;right:62.5%}.el-col-md-push-15{position:relative;left:62.5%}.el-col-md-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-md-offset-16{margin-left:66.6666666667%}.el-col-md-pull-16{position:relative;right:66.6666666667%}.el-col-md-push-16{position:relative;left:66.6666666667%}.el-col-md-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-md-offset-17{margin-left:70.8333333333%}.el-col-md-pull-17{position:relative;right:70.8333333333%}.el-col-md-push-17{position:relative;left:70.8333333333%}.el-col-md-18{display:block;max-width:75%;flex:0 0 75%}.el-col-md-offset-18{margin-left:75%}.el-col-md-pull-18{position:relative;right:75%}.el-col-md-push-18{position:relative;left:75%}.el-col-md-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-md-offset-19{margin-left:79.1666666667%}.el-col-md-pull-19{position:relative;right:79.1666666667%}.el-col-md-push-19{position:relative;left:79.1666666667%}.el-col-md-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-md-offset-20{margin-left:83.3333333333%}.el-col-md-pull-20{position:relative;right:83.3333333333%}.el-col-md-push-20{position:relative;left:83.3333333333%}.el-col-md-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-md-offset-21{margin-left:87.5%}.el-col-md-pull-21{position:relative;right:87.5%}.el-col-md-push-21{position:relative;left:87.5%}.el-col-md-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-md-offset-22{margin-left:91.6666666667%}.el-col-md-pull-22{position:relative;right:91.6666666667%}.el-col-md-push-22{position:relative;left:91.6666666667%}.el-col-md-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-md-offset-23{margin-left:95.8333333333%}.el-col-md-pull-23{position:relative;right:95.8333333333%}.el-col-md-push-23{position:relative;left:95.8333333333%}.el-col-md-24{display:block;max-width:100%;flex:0 0 100%}.el-col-md-offset-24{margin-left:100%}.el-col-md-pull-24{position:relative;right:100%}.el-col-md-push-24{position:relative;left:100%}}@media only screen and (min-width:1200px){.el-col-lg-0{display:none}.el-col-lg-0.is-guttered{display:none}.el-col-lg-0{max-width:0%;flex:0 0 0%}.el-col-lg-offset-0{margin-left:0}.el-col-lg-pull-0{position:relative;right:0}.el-col-lg-push-0{position:relative;left:0}.el-col-lg-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-lg-offset-1{margin-left:4.1666666667%}.el-col-lg-pull-1{position:relative;right:4.1666666667%}.el-col-lg-push-1{position:relative;left:4.1666666667%}.el-col-lg-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-lg-offset-2{margin-left:8.3333333333%}.el-col-lg-pull-2{position:relative;right:8.3333333333%}.el-col-lg-push-2{position:relative;left:8.3333333333%}.el-col-lg-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-lg-offset-3{margin-left:12.5%}.el-col-lg-pull-3{position:relative;right:12.5%}.el-col-lg-push-3{position:relative;left:12.5%}.el-col-lg-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-lg-offset-4{margin-left:16.6666666667%}.el-col-lg-pull-4{position:relative;right:16.6666666667%}.el-col-lg-push-4{position:relative;left:16.6666666667%}.el-col-lg-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-lg-offset-5{margin-left:20.8333333333%}.el-col-lg-pull-5{position:relative;right:20.8333333333%}.el-col-lg-push-5{position:relative;left:20.8333333333%}.el-col-lg-6{display:block;max-width:25%;flex:0 0 25%}.el-col-lg-offset-6{margin-left:25%}.el-col-lg-pull-6{position:relative;right:25%}.el-col-lg-push-6{position:relative;left:25%}.el-col-lg-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-lg-offset-7{margin-left:29.1666666667%}.el-col-lg-pull-7{position:relative;right:29.1666666667%}.el-col-lg-push-7{position:relative;left:29.1666666667%}.el-col-lg-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-lg-offset-8{margin-left:33.3333333333%}.el-col-lg-pull-8{position:relative;right:33.3333333333%}.el-col-lg-push-8{position:relative;left:33.3333333333%}.el-col-lg-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-lg-offset-9{margin-left:37.5%}.el-col-lg-pull-9{position:relative;right:37.5%}.el-col-lg-push-9{position:relative;left:37.5%}.el-col-lg-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-lg-offset-10{margin-left:41.6666666667%}.el-col-lg-pull-10{position:relative;right:41.6666666667%}.el-col-lg-push-10{position:relative;left:41.6666666667%}.el-col-lg-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-lg-offset-11{margin-left:45.8333333333%}.el-col-lg-pull-11{position:relative;right:45.8333333333%}.el-col-lg-push-11{position:relative;left:45.8333333333%}.el-col-lg-12{display:block;max-width:50%;flex:0 0 50%}.el-col-lg-offset-12{margin-left:50%}.el-col-lg-pull-12{position:relative;right:50%}.el-col-lg-push-12{position:relative;left:50%}.el-col-lg-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-lg-offset-13{margin-left:54.1666666667%}.el-col-lg-pull-13{position:relative;right:54.1666666667%}.el-col-lg-push-13{position:relative;left:54.1666666667%}.el-col-lg-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-lg-offset-14{margin-left:58.3333333333%}.el-col-lg-pull-14{position:relative;right:58.3333333333%}.el-col-lg-push-14{position:relative;left:58.3333333333%}.el-col-lg-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-lg-offset-15{margin-left:62.5%}.el-col-lg-pull-15{position:relative;right:62.5%}.el-col-lg-push-15{position:relative;left:62.5%}.el-col-lg-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-lg-offset-16{margin-left:66.6666666667%}.el-col-lg-pull-16{position:relative;right:66.6666666667%}.el-col-lg-push-16{position:relative;left:66.6666666667%}.el-col-lg-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-lg-offset-17{margin-left:70.8333333333%}.el-col-lg-pull-17{position:relative;right:70.8333333333%}.el-col-lg-push-17{position:relative;left:70.8333333333%}.el-col-lg-18{display:block;max-width:75%;flex:0 0 75%}.el-col-lg-offset-18{margin-left:75%}.el-col-lg-pull-18{position:relative;right:75%}.el-col-lg-push-18{position:relative;left:75%}.el-col-lg-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-lg-offset-19{margin-left:79.1666666667%}.el-col-lg-pull-19{position:relative;right:79.1666666667%}.el-col-lg-push-19{position:relative;left:79.1666666667%}.el-col-lg-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-lg-offset-20{margin-left:83.3333333333%}.el-col-lg-pull-20{position:relative;right:83.3333333333%}.el-col-lg-push-20{position:relative;left:83.3333333333%}.el-col-lg-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-lg-offset-21{margin-left:87.5%}.el-col-lg-pull-21{position:relative;right:87.5%}.el-col-lg-push-21{position:relative;left:87.5%}.el-col-lg-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-lg-offset-22{margin-left:91.6666666667%}.el-col-lg-pull-22{position:relative;right:91.6666666667%}.el-col-lg-push-22{position:relative;left:91.6666666667%}.el-col-lg-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-lg-offset-23{margin-left:95.8333333333%}.el-col-lg-pull-23{position:relative;right:95.8333333333%}.el-col-lg-push-23{position:relative;left:95.8333333333%}.el-col-lg-24{display:block;max-width:100%;flex:0 0 100%}.el-col-lg-offset-24{margin-left:100%}.el-col-lg-pull-24{position:relative;right:100%}.el-col-lg-push-24{position:relative;left:100%}}@media only screen and (min-width:1920px){.el-col-xl-0{display:none}.el-col-xl-0.is-guttered{display:none}.el-col-xl-0{max-width:0%;flex:0 0 0%}.el-col-xl-offset-0{margin-left:0}.el-col-xl-pull-0{position:relative;right:0}.el-col-xl-push-0{position:relative;left:0}.el-col-xl-1{display:block;max-width:4.1666666667%;flex:0 0 4.1666666667%}.el-col-xl-offset-1{margin-left:4.1666666667%}.el-col-xl-pull-1{position:relative;right:4.1666666667%}.el-col-xl-push-1{position:relative;left:4.1666666667%}.el-col-xl-2{display:block;max-width:8.3333333333%;flex:0 0 8.3333333333%}.el-col-xl-offset-2{margin-left:8.3333333333%}.el-col-xl-pull-2{position:relative;right:8.3333333333%}.el-col-xl-push-2{position:relative;left:8.3333333333%}.el-col-xl-3{display:block;max-width:12.5%;flex:0 0 12.5%}.el-col-xl-offset-3{margin-left:12.5%}.el-col-xl-pull-3{position:relative;right:12.5%}.el-col-xl-push-3{position:relative;left:12.5%}.el-col-xl-4{display:block;max-width:16.6666666667%;flex:0 0 16.6666666667%}.el-col-xl-offset-4{margin-left:16.6666666667%}.el-col-xl-pull-4{position:relative;right:16.6666666667%}.el-col-xl-push-4{position:relative;left:16.6666666667%}.el-col-xl-5{display:block;max-width:20.8333333333%;flex:0 0 20.8333333333%}.el-col-xl-offset-5{margin-left:20.8333333333%}.el-col-xl-pull-5{position:relative;right:20.8333333333%}.el-col-xl-push-5{position:relative;left:20.8333333333%}.el-col-xl-6{display:block;max-width:25%;flex:0 0 25%}.el-col-xl-offset-6{margin-left:25%}.el-col-xl-pull-6{position:relative;right:25%}.el-col-xl-push-6{position:relative;left:25%}.el-col-xl-7{display:block;max-width:29.1666666667%;flex:0 0 29.1666666667%}.el-col-xl-offset-7{margin-left:29.1666666667%}.el-col-xl-pull-7{position:relative;right:29.1666666667%}.el-col-xl-push-7{position:relative;left:29.1666666667%}.el-col-xl-8{display:block;max-width:33.3333333333%;flex:0 0 33.3333333333%}.el-col-xl-offset-8{margin-left:33.3333333333%}.el-col-xl-pull-8{position:relative;right:33.3333333333%}.el-col-xl-push-8{position:relative;left:33.3333333333%}.el-col-xl-9{display:block;max-width:37.5%;flex:0 0 37.5%}.el-col-xl-offset-9{margin-left:37.5%}.el-col-xl-pull-9{position:relative;right:37.5%}.el-col-xl-push-9{position:relative;left:37.5%}.el-col-xl-10{display:block;max-width:41.6666666667%;flex:0 0 41.6666666667%}.el-col-xl-offset-10{margin-left:41.6666666667%}.el-col-xl-pull-10{position:relative;right:41.6666666667%}.el-col-xl-push-10{position:relative;left:41.6666666667%}.el-col-xl-11{display:block;max-width:45.8333333333%;flex:0 0 45.8333333333%}.el-col-xl-offset-11{margin-left:45.8333333333%}.el-col-xl-pull-11{position:relative;right:45.8333333333%}.el-col-xl-push-11{position:relative;left:45.8333333333%}.el-col-xl-12{display:block;max-width:50%;flex:0 0 50%}.el-col-xl-offset-12{margin-left:50%}.el-col-xl-pull-12{position:relative;right:50%}.el-col-xl-push-12{position:relative;left:50%}.el-col-xl-13{display:block;max-width:54.1666666667%;flex:0 0 54.1666666667%}.el-col-xl-offset-13{margin-left:54.1666666667%}.el-col-xl-pull-13{position:relative;right:54.1666666667%}.el-col-xl-push-13{position:relative;left:54.1666666667%}.el-col-xl-14{display:block;max-width:58.3333333333%;flex:0 0 58.3333333333%}.el-col-xl-offset-14{margin-left:58.3333333333%}.el-col-xl-pull-14{position:relative;right:58.3333333333%}.el-col-xl-push-14{position:relative;left:58.3333333333%}.el-col-xl-15{display:block;max-width:62.5%;flex:0 0 62.5%}.el-col-xl-offset-15{margin-left:62.5%}.el-col-xl-pull-15{position:relative;right:62.5%}.el-col-xl-push-15{position:relative;left:62.5%}.el-col-xl-16{display:block;max-width:66.6666666667%;flex:0 0 66.6666666667%}.el-col-xl-offset-16{margin-left:66.6666666667%}.el-col-xl-pull-16{position:relative;right:66.6666666667%}.el-col-xl-push-16{position:relative;left:66.6666666667%}.el-col-xl-17{display:block;max-width:70.8333333333%;flex:0 0 70.8333333333%}.el-col-xl-offset-17{margin-left:70.8333333333%}.el-col-xl-pull-17{position:relative;right:70.8333333333%}.el-col-xl-push-17{position:relative;left:70.8333333333%}.el-col-xl-18{display:block;max-width:75%;flex:0 0 75%}.el-col-xl-offset-18{margin-left:75%}.el-col-xl-pull-18{position:relative;right:75%}.el-col-xl-push-18{position:relative;left:75%}.el-col-xl-19{display:block;max-width:79.1666666667%;flex:0 0 79.1666666667%}.el-col-xl-offset-19{margin-left:79.1666666667%}.el-col-xl-pull-19{position:relative;right:79.1666666667%}.el-col-xl-push-19{position:relative;left:79.1666666667%}.el-col-xl-20{display:block;max-width:83.3333333333%;flex:0 0 83.3333333333%}.el-col-xl-offset-20{margin-left:83.3333333333%}.el-col-xl-pull-20{position:relative;right:83.3333333333%}.el-col-xl-push-20{position:relative;left:83.3333333333%}.el-col-xl-21{display:block;max-width:87.5%;flex:0 0 87.5%}.el-col-xl-offset-21{margin-left:87.5%}.el-col-xl-pull-21{position:relative;right:87.5%}.el-col-xl-push-21{position:relative;left:87.5%}.el-col-xl-22{display:block;max-width:91.6666666667%;flex:0 0 91.6666666667%}.el-col-xl-offset-22{margin-left:91.6666666667%}.el-col-xl-pull-22{position:relative;right:91.6666666667%}.el-col-xl-push-22{position:relative;left:91.6666666667%}.el-col-xl-23{display:block;max-width:95.8333333333%;flex:0 0 95.8333333333%}.el-col-xl-offset-23{margin-left:95.8333333333%}.el-col-xl-pull-23{position:relative;right:95.8333333333%}.el-col-xl-push-23{position:relative;left:95.8333333333%}.el-col-xl-24{display:block;max-width:100%;flex:0 0 100%}.el-col-xl-offset-24{margin-left:100%}.el-col-xl-pull-24{position:relative;right:100%}.el-col-xl-push-24{position:relative;left:100%}}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-container.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-container{display:flex;flex-direction:row;flex:1;flex-basis:auto;box-sizing:border-box;min-width:0}.el-container.is-vertical{flex-direction:column}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-descriptions-item.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-descriptions__label.el-descriptions__cell.is-bordered-label{font-weight:700;color:var(--el-text-color-regular);background:var(--el-descriptions-item-bordered-label-background)}.el-descriptions__label:not(.is-bordered-label){color:var(--el-text-color-primary);margin-right:16px}.el-descriptions__label.el-descriptions__cell:not(.is-bordered-label).is-vertical-label{padding-bottom:6px}.el-descriptions__content.el-descriptions__cell.is-bordered-content{color:var(--el-text-color-primary)}.el-descriptions__content:not(.is-bordered-label){color:var(--el-text-color-regular)}.el-descriptions--large .el-descriptions__label:not(.is-bordered-label){margin-right:16px}.el-descriptions--large .el-descriptions__label.el-descriptions__cell:not(.is-bordered-label).is-vertical-label{padding-bottom:8px}.el-descriptions--small .el-descriptions__label:not(.is-bordered-label){margin-right:12px}.el-descriptions--small .el-descriptions__label.el-descriptions__cell:not(.is-bordered-label).is-vertical-label{padding-bottom:4px}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-descriptions.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-descriptions{--el-descriptions-table-border:1px solid var(--el-border-color-lighter);--el-descriptions-item-bordered-label-background:#f5f7fa;box-sizing:border-box;font-size:var(--el-font-size-base);color:var(--el-text-color-primary)}.el-descriptions__header{display:flex;justify-content:space-between;align-items:center;margin-bottom:16px}.el-descriptions__title{color:var(--el-text-color-primary);font-size:16px;font-weight:700}.el-descriptions__body{background-color:#fff}.el-descriptions__body .el-descriptions__table{border-collapse:collapse;width:100%}.el-descriptions__body .el-descriptions__table .el-descriptions__cell{box-sizing:border-box;text-align:left;font-weight:400;line-height:23px;font-size:14px}.el-descriptions__body .el-descriptions__table .el-descriptions__cell.is-left{text-align:left}.el-descriptions__body .el-descriptions__table .el-descriptions__cell.is-center{text-align:center}.el-descriptions__body .el-descriptions__table .el-descriptions__cell.is-right{text-align:right}.el-descriptions__body .el-descriptions__table.is-bordered .el-descriptions__cell{border:var(--el-descriptions-table-border);padding:8px 11px}.el-descriptions__body .el-descriptions__table:not(.is-bordered) .el-descriptions__cell{padding-bottom:12px}.el-descriptions--large{font-size:14px}.el-descriptions--large .el-descriptions__header{margin-bottom:20px}.el-descriptions--large .el-descriptions__header .el-descriptions__title{font-size:16px}.el-descriptions--large .el-descriptions__body .el-descriptions__table .el-descriptions__cell{font-size:14px}.el-descriptions--large .el-descriptions__body .el-descriptions__table.is-bordered .el-descriptions__cell{padding:12px 15px}.el-descriptions--large .el-descriptions__body .el-descriptions__table:not(.is-bordered) .el-descriptions__cell{padding-bottom:16px}.el-descriptions--small{font-size:12px}.el-descriptions--small .el-descriptions__header{margin-bottom:12px}.el-descriptions--small .el-descriptions__header .el-descriptions__title{font-size:14px}.el-descriptions--small .el-descriptions__body .el-descriptions__table .el-descriptions__cell{font-size:12px}.el-descriptions--small .el-descriptions__body .el-descriptions__table.is-bordered .el-descriptions__cell{padding:4px 7px}.el-descriptions--small .el-descriptions__body .el-descriptions__table:not(.is-bordered) .el-descriptions__cell{padding-bottom:8px}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown-item.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown-menu.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-dropdown{--el-dropdown-menu-box-shadow:var(--el-box-shadow-light);--el-dropdown-menuItem-hover-fill:var(--el-color-primary-light-9);--el-dropdown-menuItem-hover-color:var(--el-color-primary-light-2);--el-dropdown-menu-index:10;display:inline-flex;position:relative;color:var(--el-text-color-regular);font-size:var(--el-font-size-base);line-height:1;vertical-align:top}.el-dropdown__popper{--el-dropdown-menu-box-shadow:var(--el-box-shadow-light);--el-dropdown-menuItem-hover-fill:var(--el-color-primary-light-9);--el-dropdown-menuItem-hover-color:var(--el-color-primary-light-2);--el-dropdown-menu-index:10}.el-dropdown__popper.el-popper[role=tooltip]{background:#fff;border:1px solid var(--el-border-color-light);box-shadow:var(--el-dropdown-menu-box-shadow)}.el-dropdown__popper.el-popper[role=tooltip] .el-popper__arrow::before{border:1px solid var(--el-border-color-light)}.el-dropdown__popper.el-popper[role=tooltip][data-popper-placement^=top] .el-popper__arrow::before{border-top-color:transparent;border-left-color:transparent}.el-dropdown__popper.el-popper[role=tooltip][data-popper-placement^=bottom] .el-popper__arrow::before{border-bottom-color:transparent;border-right-color:transparent}.el-dropdown__popper.el-popper[role=tooltip][data-popper-placement^=left] .el-popper__arrow::before{border-left-color:transparent;border-bottom-color:transparent}.el-dropdown__popper.el-popper[role=tooltip][data-popper-placement^=right] .el-popper__arrow::before{border-right-color:transparent;border-top-color:transparent}.el-dropdown__popper .el-dropdown-menu{border:none}.el-dropdown__popper .el-dropdown__popper-selfdefine{outline:0}.el-dropdown__popper .el-scrollbar__bar{z-index:calc(var(--el-dropdown-menu-index) + 1)}.el-dropdown__popper .el-dropdown__list{list-style:none;padding:0;margin:0;box-sizing:border-box}.el-dropdown .el-dropdown__caret-button{padding-left:0;padding-right:0;display:inline-flex;justify-content:center;align-items:center;width:32px;border-left:none}.el-dropdown .el-dropdown__caret-button>span{display:inline-flex}.el-dropdown .el-dropdown__caret-button::before{content:\"\";position:absolute;display:block;width:1px;top:5px;bottom:5px;left:0;background:rgba(0,0,0,.5)}.el-dropdown .el-dropdown__caret-button.el-button::before{background:var(--el-border-color-base);opacity:.5}.el-dropdown .el-dropdown__caret-button:hover::before{top:0;bottom:0}.el-dropdown .el-dropdown__caret-button .el-dropdown__icon{font-size:inherit;padding-left:0}.el-dropdown__list__icon{font-size:12px;margin:0 3px}.el-dropdown .el-dropdown-selfdefine{outline:0}.el-dropdown--large .el-dropdown__caret-button{width:40px}.el-dropdown--small .el-dropdown__caret-button{width:24px}.el-dropdown-menu{position:relative;top:0;left:0;z-index:var(--el-dropdown-menu-index);padding:5px 0;margin:0;background-color:#fff;border:none;border-radius:var(--el-border-radius-base);box-shadow:none}.el-dropdown-menu__item{display:flex;align-items:center;white-space:nowrap;list-style:none;line-height:22px;padding:5px 16px;margin:0;font-size:var(--el-font-size-base);color:var(--el-text-color-regular);cursor:pointer;outline:0}.el-dropdown-menu__item:not(.is-disabled):focus{background-color:var(--el-dropdown-menuItem-hover-fill);color:var(--el-dropdown-menuItem-hover-color)}.el-dropdown-menu__item i{margin-right:5px}.el-dropdown-menu__item--divided{margin:6px 0;border-top:1px solid var(--el-border-color-lighter)}.el-dropdown-menu__item.is-disabled{cursor:not-allowed;color:var(--el-text-color-disabled-base)}.el-dropdown-menu--large{padding:7px 0}.el-dropdown-menu--large .el-dropdown-menu__item{padding:7px 20px;line-height:22px;font-size:14px}.el-dropdown-menu--large .el-dropdown-menu__item--divided{margin:8px 0}.el-dropdown-menu--small{padding:3px 0}.el-dropdown-menu--small .el-dropdown-menu__item{padding:2px 12px;line-height:20px;font-size:12px}.el-dropdown-menu--small .el-dropdown-menu__item--divided{margin:4px 0}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-empty.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-empty{--el-empty-padding:40px 0;--el-empty-image-width:160px;--el-empty-description-margin-top:20px;--el-empty-bottom-margin-top:20px;--el-empty-fill-color-0:var(--el-color-white);--el-empty-fill-color-1:#fcfcfd;--el-empty-fill-color-2:#f8f9fb;--el-empty-fill-color-3:#f7f8fc;--el-empty-fill-color-4:#eeeff3;--el-empty-fill-color-5:#edeef2;--el-empty-fill-color-6:#e9ebef;--el-empty-fill-color-7:#e5e7e9;--el-empty-fill-color-8:#e0e3e9;--el-empty-fill-color-9:#d5d7de;display:flex;justify-content:center;align-items:center;flex-direction:column;text-align:center;box-sizing:border-box;padding:var(--el-empty-padding)}.el-empty__image{width:var(--el-empty-image-width)}.el-empty__image img{-webkit-user-select:none;user-select:none;width:100%;height:100%;vertical-align:top;object-fit:contain}.el-empty__image svg{fill:var(--el-svg-monochrome-grey);width:100%;height:100%;vertical-align:top}.el-empty__description{margin-top:var(--el-empty-description-margin-top)}.el-empty__description p{margin:0;font-size:var(--el-font-size-base);color:var(--el-text-color-secondary)}.el-empty__bottom{margin-top:var(--el-empty-bottom-margin-top)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-footer.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-footer{--el-footer-padding:0 20px;--el-footer-height:60px;padding:var(--el-footer-padding);box-sizing:border-box;flex-shrink:0;height:var(--el-footer-height)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-header.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-header{--el-header-padding:0 20px;--el-header-height:60px;padding:var(--el-header-padding);box-sizing:border-box;flex-shrink:0;height:var(--el-header-height)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-icon.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-icon-loading{animation:rotating 2s linear infinite}.el-icon--right{margin-left:5px}.el-icon--left{margin-right:5px}@keyframes rotating{0%{transform:rotateZ(0)}100%{transform:rotateZ(360deg)}}.el-icon{--color:inherit;height:1em;width:1em;line-height:1em;display:inline-flex;justify-content:center;align-items:center;position:relative;fill:currentColor;color:var(--color);font-size:inherit}.el-icon.is-loading{animation:rotating 2s linear infinite}.el-icon svg{height:1em;width:1em}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-input-number.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-input-number{position:relative;display:inline-block;width:150px;line-height:30px}.el-input-number .el-input{display:block}.el-input-number .el-input__inner{-webkit-appearance:none;-moz-appearance:textfield;padding-left:42px;padding-right:42px;text-align:center}.el-input-number .el-input__inner::-webkit-inner-spin-button,.el-input-number .el-input__inner::-webkit-outer-spin-button{margin:0;-webkit-appearance:none}.el-input-number__decrease,.el-input-number__increase{display:flex;justify-content:center;align-items:center;height:auto;position:absolute;z-index:1;top:1px;bottom:1px;width:32px;background:var(--el-bg-color);color:var(--el-text-color-regular);cursor:pointer;font-size:13px;-webkit-user-select:none;user-select:none}.el-input-number__decrease:hover,.el-input-number__increase:hover{color:var(--el-color-primary)}.el-input-number__decrease:hover~.el-input:not(.is-disabled) .el-input__inner,.el-input-number__increase:hover~.el-input:not(.is-disabled) .el-input__inner{border-color:var(--el-input-focus-border,var(--el-color-primary))}.el-input-number__decrease.is-disabled,.el-input-number__increase.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-input-number__increase{right:1px;border-radius:0 var(--el-border-radius-base) var(--el-border-radius-base) 0;border-left:var(--el-border-base)}.el-input-number__decrease{left:1px;border-radius:var(--el-border-radius-base) 0 0 var(--el-border-radius-base);border-right:var(--el-border-base)}.el-input-number.is-disabled .el-input-number__decrease,.el-input-number.is-disabled .el-input-number__increase{border-color:var(--el-disabled-border-color);color:var(--el-disabled-border-color)}.el-input-number.is-disabled .el-input-number__decrease:hover,.el-input-number.is-disabled .el-input-number__increase:hover{color:var(--el-disabled-border-color);cursor:not-allowed}.el-input-number--large{width:180px;line-height:38px}.el-input-number--large .el-input-number__decrease,.el-input-number--large .el-input-number__increase{width:40px;font-size:14px}.el-input-number--large .el-input__inner{padding-left:47px;padding-right:47px}.el-input-number--small{width:120px;line-height:22px}.el-input-number--small .el-input-number__decrease,.el-input-number--small .el-input-number__increase{width:24px;font-size:12px}.el-input-number--small .el-input__inner{padding-left:31px;padding-right:31px}.el-input-number--small .el-input-number__decrease [class*=el-icon],.el-input-number--small .el-input-number__increase [class*=el-icon]{transform:scale(.9)}.el-input-number.is-without-controls .el-input__inner{padding-left:15px;padding-right:15px}.el-input-number.is-controls-right .el-input__inner{padding-left:15px;padding-right:42px}.el-input-number.is-controls-right .el-input-number__decrease,.el-input-number.is-controls-right .el-input-number__increase{--el-input-number-controls-height:15px;height:var(--el-input-number-controls-height);line-height:var(--el-input-number-controls-height)}.el-input-number.is-controls-right .el-input-number__decrease [class*=el-icon],.el-input-number.is-controls-right .el-input-number__increase [class*=el-icon]{transform:scale(.8)}.el-input-number.is-controls-right .el-input-number__increase{bottom:auto;left:auto;border-radius:0 var(--el-border-radius-base) 0 0;border-bottom:var(--el-border-base)}.el-input-number.is-controls-right .el-input-number__decrease{right:1px;top:auto;left:auto;border-right:none;border-left:var(--el-border-base);border-radius:0 0 var(--el-border-radius-base) 0}.el-input-number.is-controls-right[class*=large] [class*=decrease],.el-input-number.is-controls-right[class*=large] [class*=increase]{--el-input-number-controls-height:19px}.el-input-number.is-controls-right[class*=small] [class*=decrease],.el-input-number.is-controls-right[class*=small] [class*=increase]{--el-input-number-controls-height:11px}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-input.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-textarea{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border-base);--el-input-border-color:var(--el-border-color-base);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-color-white);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border:var(--el-color-primary)}.el-textarea{position:relative;display:inline-block;width:100%;vertical-align:bottom;font-size:var(--el-font-size-base)}.el-textarea__inner{display:block;resize:vertical;padding:5px 15px;line-height:1.5;box-sizing:border-box;width:100%;font-size:inherit;font-family:inherit;color:var(--el-input-text-color,var(--el-text-color-regular));background-color:var(--el-input-bg-color,var(--el-color-white));background-image:none;border:var(--el-input-border,var(--el-border-base));border-radius:var(--el-input-border-radius,var(--el-border-radius-base));transition:var(--el-transition-border)}.el-textarea__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-textarea__inner:hover{border-color:var(--el-input-hover-border,var(--el-border-color-hover))}.el-textarea__inner:focus{outline:0;border-color:var(--el-input-focus-border,var(--el-color-primary))}.el-textarea .el-input__count{color:var(--el-color-info);background:var(--el-color-white);position:absolute;font-size:12px;line-height:14px;bottom:5px;right:10px}.el-textarea.is-disabled .el-textarea__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-textarea.is-disabled .el-textarea__inner::placeholder{color:var(--el-text-color-placeholder)}.el-textarea.is-exceed .el-textarea__inner{border-color:var(--el-color-danger)}.el-textarea.is-exceed .el-input__count{color:var(--el-color-danger)}.el-input{--el-input-text-color:var(--el-text-color-regular);--el-input-border:var(--el-border-base);--el-input-border-color:var(--el-border-color-base);--el-input-border-radius:var(--el-border-radius-base);--el-input-bg-color:var(--el-color-white);--el-input-icon-color:var(--el-text-color-placeholder);--el-input-placeholder-color:var(--el-text-color-placeholder);--el-input-hover-border:var(--el-border-color-hover);--el-input-clear-hover-color:var(--el-text-color-secondary);--el-input-focus-border:var(--el-color-primary);position:relative;font-size:var(--el-font-size-base);display:inline-flex;width:100%;line-height:32px}.el-input::-webkit-scrollbar{z-index:11;width:6px}.el-input::-webkit-scrollbar:horizontal{height:6px}.el-input::-webkit-scrollbar-thumb{border-radius:5px;width:6px;background:#b4bccc}.el-input::-webkit-scrollbar-corner{background:#fff}.el-input::-webkit-scrollbar-track{background:#fff}.el-input::-webkit-scrollbar-track-piece{background:#fff;width:6px}.el-input .el-input__clear{color:var(--el-input-icon-color);font-size:14px;cursor:pointer;transition:var(--el-transition-color)}.el-input .el-input__clear:hover{color:var(--el-input-clear-hover-color)}.el-input .el-input__count{height:100%;display:inline-flex;align-items:center;color:var(--el-color-info);font-size:12px}.el-input .el-input__count .el-input__count-inner{background:#fff;line-height:initial;display:inline-block;padding:0 5px}.el-input__inner{-webkit-appearance:none;background-color:var(--el-input-bg-color,var(--el-color-white));background-image:none;border-radius:var(--el-input-border-radius,var(--el-border-radius-base));border:var(--el-input-border,var(--el-border-base));box-sizing:border-box;color:var(--el-input-text-color,var(--el-text-color-regular));display:inline-block;font-size:inherit;height:32px;line-height:32px;outline:0;padding:0 11px;transition:var(--el-transition-border);width:100%}.el-input__inner::placeholder{color:var(--el-input-placeholder-color,var(--el-text-color-placeholder))}.el-input__inner:hover{border-color:var(--el-input-hover-border,var(--el-border-color-hover))}.el-input__inner:focus{outline:0;border-color:var(--el-input-focus-border,var(--el-color-primary))}.el-input__suffix{display:inline-flex;position:absolute;height:100%;right:12px;top:0;text-align:center;color:var(--el-input-icon-color,var(--el-text-color-placeholder));transition:all var(--el-transition-duration);pointer-events:none}.el-input__suffix-inner{pointer-events:all;display:inline-flex}.el-input__prefix{display:inline-flex;position:absolute;height:100%;left:12px;top:0;text-align:center;color:var(--el-input-icon-color,var(--el-text-color-placeholder));transition:all var(--el-transition-duration)}.el-input__prefix-inner{pointer-events:all;display:inline-flex}.el-input__icon{height:inherit;display:flex;justify-content:center;align-items:center;transition:all var(--el-transition-duration)}.el-input__icon.el-icon{display:flex}.el-input__validateIcon{pointer-events:none}.el-input.is-active .el-input__inner{outline:0;border-color:var(--el-input-focus-border,)}.el-input.is-disabled .el-input__inner{background-color:var(--el-disabled-bg-color);border-color:var(--el-disabled-border-color);color:var(--el-disabled-text-color);cursor:not-allowed}.el-input.is-disabled .el-input__inner::placeholder{color:var(--el-text-color-placeholder)}.el-input.is-disabled .el-input__icon{cursor:not-allowed}.el-input.is-exceed .el-input__inner{border-color:var(--el-color-danger)}.el-input.is-exceed .el-input__suffix .el-input__count{color:var(--el-color-danger)}.el-input--suffix--password-clear .el-input__inner{padding-right:55px}.el-input--suffix .el-input__inner{padding-right:31px}.el-input--prefix .el-input__inner{padding-left:31px}.el-input--large{font-size:14px;line-height:38px}.el-input--large .el-input__inner{height:40px;line-height:40px;padding:0 15px}.el-input--large .el-input__icon{line-height:40px}.el-input--large.el-input--prefix .el-input__inner{padding-left:35px}.el-input--large.el-input--suffix .el-input__inner{padding-right:35px}.el-input--large .el-input__prefix{left:16px}.el-input--large .el-input__suffix{right:16px}.el-input--small{font-size:12px;line-height:22px}.el-input--small .el-input__inner{height:24px;line-height:24px;padding:0 7px}.el-input--small .el-input__icon{line-height:24px}.el-input--small.el-input--prefix .el-input__inner{padding-left:25px}.el-input--small.el-input--suffix .el-input__inner{padding-right:25px}.el-input--small .el-input__prefix{left:8px}.el-input--small .el-input__suffix{right:8px}.el-input-group{line-height:normal;display:inline-table;width:100%;border-collapse:separate;border-spacing:0}.el-input-group>.el-input__inner{vertical-align:middle;display:table-cell}.el-input-group__append,.el-input-group__prepend{background-color:var(--el-bg-color);color:var(--el-color-info);vertical-align:middle;display:table-cell;position:relative;border:1px solid #dcdfe6;border-radius:var(--el-input-border-radius);padding:0 20px;width:1px;white-space:nowrap}.el-input-group__append:focus,.el-input-group__prepend:focus{outline:0}.el-input-group__append .el-button,.el-input-group__append .el-select,.el-input-group__prepend .el-button,.el-input-group__prepend .el-select{display:inline-block;margin:-10px -20px}.el-input-group__append button.el-button,.el-input-group__append button.el-button:hover,.el-input-group__append div.el-select .el-input__inner,.el-input-group__append div.el-select:hover .el-input__inner,.el-input-group__prepend button.el-button,.el-input-group__prepend button.el-button:hover,.el-input-group__prepend div.el-select .el-input__inner,.el-input-group__prepend div.el-select:hover .el-input__inner{border-color:transparent;background-color:transparent;color:inherit;border-top:0;border-bottom:0}.el-input-group__append .el-button,.el-input-group__append .el-input,.el-input-group__prepend .el-button,.el-input-group__prepend .el-input{font-size:inherit}.el-input-group__prepend{border-right:0;border-top-right-radius:0;border-bottom-right-radius:0}.el-input-group__append{border-left:0;border-top-left-radius:0;border-bottom-left-radius:0}.el-input-group--prepend .el-input__inner{border-top-left-radius:0;border-bottom-left-radius:0}.el-input-group--prepend .el-select .el-input.is-focus .el-input__inner{border-color:transparent}.el-input-group--append .el-input__inner{border-top-right-radius:0;border-bottom-right-radius:0}.el-input-group--append .el-select .el-input.is-focus .el-input__inner{border-color:transparent}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-link.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-link{--el-link-font-size:var(--el-font-size-base);--el-link-font-weight:var(--el-font-weight-primary);--el-link-default-text-color:var(--el-text-color-regular);--el-link-default-active-color:var(--el-color-primary);--el-link-disabled-text-color:var(--el-text-color-placeholder)}.el-link{display:inline-flex;flex-direction:row;align-items:center;justify-content:center;vertical-align:middle;position:relative;text-decoration:none;outline:0;cursor:pointer;padding:0;font-size:var(--el-link-font-size);font-weight:var(--el-link-font-weight)}.el-link.is-underline:hover:after{content:\"\";position:absolute;left:0;right:0;height:0;bottom:0;border-bottom:1px solid var(--el-link-default-active-color)}.el-link.is-disabled{cursor:not-allowed}.el-link [class*=el-icon-]+span{margin-left:5px}.el-link.el-link--default{color:var(--el-link-default-text-color)}.el-link.el-link--default:hover{color:var(--el-link-default-active-color)}.el-link.el-link--default:after{border-color:var(--el-link-default-active-color)}.el-link.el-link--default.is-disabled{color:var(--el-link-disabled-text-color)}.el-link.el-link--primary{--el-link-text-color:var(--el-color-primary);color:var(--el-link-text-color)}.el-link.el-link--primary:hover{color:#66b1ff}.el-link.el-link--primary:after{border-color:var(--el-link-text-color)}.el-link.el-link--primary.is-disabled{color:#a0cfff}.el-link.el-link--primary.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--success{--el-link-text-color:var(--el-color-success);color:var(--el-link-text-color)}.el-link.el-link--success:hover{color:#85ce61}.el-link.el-link--success:after{border-color:var(--el-link-text-color)}.el-link.el-link--success.is-disabled{color:#b3e19d}.el-link.el-link--success.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--warning{--el-link-text-color:var(--el-color-warning);color:var(--el-link-text-color)}.el-link.el-link--warning:hover{color:#ebb563}.el-link.el-link--warning:after{border-color:var(--el-link-text-color)}.el-link.el-link--warning.is-disabled{color:#f3d19e}.el-link.el-link--warning.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--danger{--el-link-text-color:var(--el-color-danger);color:var(--el-link-text-color)}.el-link.el-link--danger:hover{color:#f78989}.el-link.el-link--danger:after{border-color:var(--el-link-text-color)}.el-link.el-link--danger.is-disabled{color:#fab6b6}.el-link.el-link--danger.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--error{--el-link-text-color:var(--el-color-error);color:var(--el-link-text-color)}.el-link.el-link--error:hover{color:#f78989}.el-link.el-link--error:after{border-color:var(--el-link-text-color)}.el-link.el-link--error.is-disabled{color:#fab6b6}.el-link.el-link--error.is-underline:hover:after{border-color:var(--el-link-text-color)}.el-link.el-link--info{--el-link-text-color:var(--el-color-info);color:var(--el-link-text-color)}.el-link.el-link--info:hover{color:#a6a9ad}.el-link.el-link--info:after{border-color:var(--el-link-text-color)}.el-link.el-link--info.is-disabled{color:#c8c9cc}.el-link.el-link--info.is-underline:hover:after{border-color:var(--el-link-text-color)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-main.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-main{--el-main-padding:20px;display:block;flex:1;flex-basis:auto;overflow:auto;box-sizing:border-box;padding:var(--el-main-padding)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-menu.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".fade-in-linear-enter-active,.fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.fade-in-linear-enter-from,.fade-in-linear-leave-to{opacity:0}.el-fade-in-linear-enter-active,.el-fade-in-linear-leave-active{transition:var(--el-transition-fade-linear)}.el-fade-in-linear-enter-from,.el-fade-in-linear-leave-to{opacity:0}.el-fade-in-enter-active,.el-fade-in-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-fade-in-enter-from,.el-fade-in-leave-active{opacity:0}.el-zoom-in-center-enter-active,.el-zoom-in-center-leave-active{transition:all var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-zoom-in-center-enter-from,.el-zoom-in-center-leave-active{opacity:0;transform:scaleX(0)}.el-zoom-in-top-enter-active,.el-zoom-in-top-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center top}.el-zoom-in-top-enter-active[data-popper-placement^=top],.el-zoom-in-top-leave-active[data-popper-placement^=top]{transform-origin:center bottom}.el-zoom-in-top-enter-from,.el-zoom-in-top-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-bottom-enter-active,.el-zoom-in-bottom-leave-active{opacity:1;transform:scaleY(1);transition:var(--el-transition-md-fade);transform-origin:center bottom}.el-zoom-in-bottom-enter-from,.el-zoom-in-bottom-leave-active{opacity:0;transform:scaleY(0)}.el-zoom-in-left-enter-active,.el-zoom-in-left-leave-active{opacity:1;transform:scale(1,1);transition:var(--el-transition-md-fade);transform-origin:top left}.el-zoom-in-left-enter-from,.el-zoom-in-left-leave-active{opacity:0;transform:scale(.45,.45)}.collapse-transition{transition:var(--el-transition-duration) height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.el-collapse-transition-enter-active,.el-collapse-transition-leave-active{transition:var(--el-transition-duration) max-height ease-in-out,var(--el-transition-duration) padding-top ease-in-out,var(--el-transition-duration) padding-bottom ease-in-out}.horizontal-collapse-transition{transition:var(--el-transition-duration) width ease-in-out,var(--el-transition-duration) padding-left ease-in-out,var(--el-transition-duration) padding-right ease-in-out}.el-list-enter-active,.el-list-leave-active{transition:all 1s}.el-list-enter-from,.el-list-leave-active{opacity:0;transform:translateY(-30px)}.el-opacity-transition{transition:opacity var(--el-transition-duration) cubic-bezier(.55,0,.1,1)}.el-menu{--el-menu-active-color:var(--el-color-primary);--el-menu-text-color:var(--el-text-color-primary);--el-menu-hover-text-color:var(--el-text-color-primary);--el-menu-bg-color:var(--el-color-white);--el-menu-hover-bg-color:var(--el-color-primary-light-9);--el-menu-item-height:56px;--el-menu-item-font-size:var(--el-font-size-base);--el-menu-item-hover-fill:var(--el-color-primary-light-9);--el-menu-border-color:#e6e6e6;border-right:solid 1px var(--el-menu-border-color);list-style:none;position:relative;margin:0;padding-left:0;background-color:var(--el-menu-bg-color);box-sizing:border-box}.el-menu--horizontal{display:flex;flex-wrap:nowrap;border-bottom:solid 1px var(--el-menu-border-color);border-right:none}.el-menu--horizontal>.el-menu-item{display:inline-flex;justify-content:center;align-items:center;height:100%;margin:0;border-bottom:2px solid transparent;color:var(--el-menu-text-color)}.el-menu--horizontal>.el-menu-item a,.el-menu--horizontal>.el-menu-item a:hover{color:inherit}.el-menu--horizontal>.el-menu-item:not(.is-disabled):focus,.el-menu--horizontal>.el-menu-item:not(.is-disabled):hover{background-color:#fff}.el-menu--horizontal>.el-sub-menu:focus,.el-menu--horizontal>.el-sub-menu:hover{outline:0}.el-menu--horizontal>.el-sub-menu:hover .el-sub-menu__title{color:var(--el-menu-hover-text-color)}.el-menu--horizontal>.el-sub-menu.is-active .el-sub-menu__title{border-bottom:2px solid var(--el-menu-active-color);color:var(--el-menu-active-color)}.el-menu--horizontal>.el-sub-menu .el-sub-menu__title{height:100%;border-bottom:2px solid transparent;color:var(--el-menu-text-color)}.el-menu--horizontal>.el-sub-menu .el-sub-menu__title:hover{background-color:#fff}.el-menu--horizontal>.el-sub-menu .el-sub-menu__icon-arrow{position:static;vertical-align:middle;margin-left:8px;margin-top:-3px}.el-menu--horizontal .el-menu .el-menu-item,.el-menu--horizontal .el-menu .el-sub-menu__title{background-color:var(--el-menu-bg-color);display:flex;align-items:center;height:36px;padding:0 10px;color:var(--el-menu-text-color)}.el-menu--horizontal .el-menu .el-menu-item.is-active,.el-menu--horizontal .el-menu .el-sub-menu.is-active>.el-sub-menu__title{color:var(--el-menu-active-color)}.el-menu--horizontal .el-menu-item:not(.is-disabled):focus,.el-menu--horizontal .el-menu-item:not(.is-disabled):hover{outline:0;color:var(--el-menu-hover-text-color);background-color:var(--el-menu-hover-bg-color)}.el-menu--horizontal>.el-menu-item.is-active{border-bottom:2px solid var(--el-menu-active-color);color:var(--el-menu-active-color)!important}.el-menu--collapse{width:64px}.el-menu--collapse>.el-menu-item [class^=el-icon],.el-menu--collapse>.el-sub-menu>.el-sub-menu__title [class^=el-icon]{margin:0;vertical-align:middle;width:24px;text-align:center}.el-menu--collapse>.el-menu-item .el-sub-menu__icon-arrow,.el-menu--collapse>.el-sub-menu>.el-sub-menu__title .el-sub-menu__icon-arrow{display:none}.el-menu--collapse>.el-menu-item>span,.el-menu--collapse>.el-sub-menu>.el-sub-menu__title>span{height:0;width:0;overflow:hidden;visibility:hidden;display:inline-block}.el-menu--collapse>.el-menu-item.is-active i{color:inherit}.el-menu--collapse .el-menu .el-sub-menu{min-width:200px}.el-menu--collapse .el-sub-menu{position:relative}.el-menu--collapse .el-sub-menu .el-menu{position:absolute;margin-left:5px;top:0;left:100%;z-index:10;border:1px solid var(--el-border-color-light);border-radius:var(--el-border-radius-small);box-shadow:var(--el-box-shadow-light)}.el-menu--collapse .el-sub-menu.is-opened>.el-sub-menu__title .el-sub-menu__icon-arrow{transform:none}.el-menu--collapse .el-sub-menu.is-active i{color:inherit}.el-menu--popup{z-index:100;min-width:200px;border:none;padding:5px 0;border-radius:var(--el-border-radius-small);box-shadow:var(--el-box-shadow-light)}.el-menu-item{display:flex;align-items:center;height:var(--el-menu-item-height);line-height:var(--el-menu-item-height);font-size:var(--el-menu-item-font-size);color:var(--el-menu-text-color);padding:0 20px;list-style:none;cursor:pointer;position:relative;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration),color var(--el-transition-duration);box-sizing:border-box;white-space:nowrap}.el-menu-item *{vertical-align:bottom}.el-menu-item i{color:inherit}.el-menu-item:focus,.el-menu-item:hover{outline:0}.el-menu-item:hover{background-color:var(--el-menu-hover-bg-color)}.el-menu-item.is-disabled{opacity:.25;cursor:not-allowed;background:0 0!important}.el-menu-item [class^=el-icon]{margin-right:5px;width:24px;text-align:center;font-size:18px;vertical-align:middle}.el-menu-item.is-active{color:var(--el-menu-active-color)}.el-menu-item.is-active i{color:inherit}.el-sub-menu{list-style:none;margin:0;padding-left:0}.el-sub-menu__title{display:flex;align-items:center;height:var(--el-menu-item-height);line-height:var(--el-menu-item-height);font-size:var(--el-menu-item-font-size);color:var(--el-menu-text-color);padding:0 20px;list-style:none;cursor:pointer;position:relative;transition:border-color var(--el-transition-duration),background-color var(--el-transition-duration),color var(--el-transition-duration);box-sizing:border-box;white-space:nowrap}.el-sub-menu__title *{vertical-align:bottom}.el-sub-menu__title i{color:inherit}.el-sub-menu__title:focus,.el-sub-menu__title:hover{outline:0}.el-sub-menu__title:hover{background-color:var(--el-menu-hover-bg-color)}.el-sub-menu__title.is-disabled{opacity:.25;cursor:not-allowed;background:0 0!important}.el-sub-menu__title:hover{background-color:var(--el-menu-hover-bg-color)}.el-sub-menu .el-menu{border:none}.el-sub-menu .el-menu-item{height:50px;line-height:50px;padding:0 45px;min-width:200px}.el-sub-menu__hide-arrow .el-sub-menu__icon-arrow{display:none!important}.el-sub-menu.is-active .el-sub-menu__title{border-bottom-color:var(--el-menu-active-color)}.el-sub-menu.is-opened>.el-sub-menu__title .el-sub-menu__icon-arrow{transform:rotateZ(180deg)}.el-sub-menu.is-disabled .el-menu-item,.el-sub-menu.is-disabled .el-sub-menu__title{opacity:.25;cursor:not-allowed;background:0 0!important}.el-sub-menu .el-icon{vertical-align:middle;margin-right:5px;width:24px;text-align:center;font-size:18px}.el-sub-menu .el-icon.el-sub-menu__icon-more{margin-right:0!important}.el-sub-menu .el-sub-menu__icon-arrow{position:absolute;top:50%;right:20px;margin-top:-7px;transition:transform var(--el-transition-duration);font-size:12px;margin-right:0;width:inherit}.el-menu-item-group>ul{padding:0}.el-menu-item-group__title{padding:7px 0 7px 20px;line-height:normal;font-size:12px;color:var(--el-text-color-secondary)}.horizontal-collapse-transition .el-sub-menu__title .el-sub-menu__icon-arrow{transition:var(--el-transition-duration-fast);opacity:0}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-message-box.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ":root{--el-popup-modal-bg-color:var(--el-color-black);--el-popup-modal-opacity:0.5}.v-modal-enter{animation:v-modal-in var(--el-transition-duration-fast) ease}.v-modal-leave{animation:v-modal-out var(--el-transition-duration-fast) ease forwards}@keyframes v-modal-in{0%{opacity:0}}@keyframes v-modal-out{100%{opacity:0}}.v-modal{position:fixed;left:0;top:0;width:100%;height:100%;opacity:var(--el-popup-modal-opacity);background:var(--el-popup-modal-bg-color)}.el-popup-parent--hidden{overflow:hidden}.el-message-box{--el-messagebox-title-color:var(--el-text-color-primary);--el-messagebox-width:420px;--el-messagebox-border-radius:4px;--el-messagebox-font-size:var(--el-font-size-large);--el-messagebox-content-font-size:var(--el-font-size-base);--el-messagebox-content-color:var(--el-text-color-regular);--el-messagebox-error-font-size:12px;--el-messagebox-padding-primary:15px}.el-message-box{display:inline-block;width:var(--el-messagebox-width);padding-bottom:10px;vertical-align:middle;background-color:var(--el-color-white);border-radius:var(--el-messagebox-border-radius);border:1px solid var(--el-border-color-lighter);font-size:var(--el-messagebox-font-size);box-shadow:var(--el-box-shadow-light);text-align:left;overflow:hidden;-webkit-backface-visibility:hidden;backface-visibility:hidden}.el-overlay.is-message-box .el-overlay-message-box{text-align:center;position:fixed;top:0;right:0;bottom:0;left:0;overflow:auto}.el-overlay.is-message-box .el-overlay-message-box::after{content:\"\";display:inline-block;height:100%;width:0;vertical-align:middle}.el-message-box.is-draggable .el-message-box__header{cursor:move;-webkit-user-select:none;user-select:none}.el-message-box__header{position:relative;padding:var(--el-messagebox-padding-primary);padding-bottom:10px}.el-message-box__title{padding-left:0;margin-bottom:0;font-size:var(--el-messagebox-font-size);line-height:1;color:var(--el-messagebox-title-color)}.el-message-box__headerbtn{position:absolute;top:var(--el-messagebox-padding-primary);right:var(--el-messagebox-padding-primary);padding:0;border:none;outline:0;background:0 0;font-size:var(--el-message-close-size,16px);cursor:pointer}.el-message-box__headerbtn .el-message-box__close{color:var(--el-color-info);font-size:inherit}.el-message-box__headerbtn:focus .el-message-box__close,.el-message-box__headerbtn:hover .el-message-box__close{color:var(--el-color-primary)}.el-message-box__content{padding:10px var(--el-messagebox-padding-primary);color:var(--el-messagebox-content-color);font-size:var(--el-messagebox-content-font-size)}.el-message-box__container{position:relative}.el-message-box__input{padding-top:15px}.el-message-box__input div.invalid>input{border-color:var(--el-color-error)}.el-message-box__input div.invalid>input:focus{border-color:var(--el-color-error)}.el-message-box__status{position:absolute;top:50%;transform:translateY(-50%);font-size:24px!important}.el-message-box__status::before{padding-left:1px}.el-message-box__status+.el-message-box__message{padding-left:36px;padding-right:12px;word-break:break-word}.el-message-box__status.el-message-box-icon--success{--el-messagebox-color:var(--el-color-success);color:var(--el-messagebox-color)}.el-message-box__status.el-message-box-icon--info{--el-messagebox-color:var(--el-color-info);color:var(--el-messagebox-color)}.el-message-box__status.el-message-box-icon--warning{--el-messagebox-color:var(--el-color-warning);color:var(--el-messagebox-color)}.el-message-box__status.el-message-box-icon--error{--el-messagebox-color:var(--el-color-error);color:var(--el-messagebox-color)}.el-message-box__message{margin:0}.el-message-box__message p{margin:0;line-height:24px}.el-message-box__errormsg{color:var(--el-color-error);font-size:var(--el-messagebox-error-font-size);min-height:18px;margin-top:2px}.el-message-box__btns{padding:5px 15px 0;display:flex;flex-wrap:wrap;justify-content:flex-end;align-items:center}.el-message-box__btns button:nth-child(2){margin-left:10px}.el-message-box__btns-reverse{flex-direction:row-reverse}.el-message-box--center .el-message-box__title{position:relative;display:flex;align-items:center;justify-content:center}.el-message-box--center .el-message-box__status{position:relative;top:auto;padding-right:5px;text-align:center;transform:translateY(-1px)}.el-message-box--center .el-message-box__message{margin-left:0}.el-message-box--center .el-message-box__btns,.el-message-box--center .el-message-box__content{text-align:center}.el-message-box--center .el-message-box__content{padding-left:calc(var(--el-messagebox-padding-primary) + 12px);padding-right:calc(var(--el-messagebox-padding-primary) + 12px)}.fade-in-linear-enter-active .el-overlay-message-box{animation:msgbox-fade-in var(--el-transition-duration)}.fade-in-linear-leave-active .el-overlay-message-box{animation:msgbox-fade-in var(--el-transition-duration) reverse}@keyframes msgbox-fade-in{0%{transform:translate3d(0,-20px,0);opacity:0}100%{transform:translate3d(0,0,0);opacity:1}}@keyframes msgbox-fade-out{0%{transform:translate3d(0,0,0);opacity:1}100%{transform:translate3d(0,-20px,0);opacity:0}}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-notification.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-notification{--el-notification-width:330px;--el-notification-padding:14px 26px 14px 13px;--el-notification-radius:8px;--el-notification-shadow:var(--el-box-shadow-light);--el-notification-border-color:var(--el-border-color-lighter);--el-notification-icon-size:24px;--el-notification-close-font-size:var(--el-message-close-size, 16px);--el-notification-group-margin-left:13px;--el-notification-group-margin-right:8px;--el-notification-content-font-size:var(--el-font-size-base);--el-notification-content-color:var(--el-text-color-regular);--el-notification-title-font-size:16px;--el-notification-title-color:var(--el-text-color-primary);--el-notification-close-color:var(--el-text-color-secondary);--el-notification-close-hover-color:var(--el-text-color-regular)}.el-notification{display:flex;width:var(--el-notification-width);padding:var(--el-notification-padding);border-radius:var(--el-notification-radius);box-sizing:border-box;border:1px solid var(--el-notification-border-color);position:fixed;background-color:var(--el-color-white);box-shadow:var(--el-notification-shadow);transition:opacity var(--el-transition-duration),transform var(--el-transition-duration),left var(--el-transition-duration),right var(--el-transition-duration),top .4s,bottom var(--el-transition-duration);overflow-wrap:anywhere;overflow:hidden;z-index:9999}.el-notification.right{right:16px}.el-notification.left{left:16px}.el-notification__group{margin-left:var(--el-notification-group-margin-left);margin-right:var(--el-notification-group-margin-right)}.el-notification__title{font-weight:700;font-size:var(--el-notification-title-font-size);line-height:var(--el-notification-icon-size);color:var(--el-notification-title-color);margin:0}.el-notification__content{font-size:var(--el-notification-content-font-size);line-height:24px;margin:6px 0 0 0;color:var(--el-notification-content-color);text-align:justify}.el-notification__content p{margin:0}.el-notification__icon{height:var(--el-notification-icon-size);width:var(--el-notification-icon-size);font-size:var(--el-notification-icon-size)}.el-notification__closeBtn{position:absolute;top:18px;right:15px;cursor:pointer;color:var(--el-notification-close-color);font-size:var(--el-notification-close-font-size)}.el-notification__closeBtn:hover{color:var(--el-notification-close-hover-color)}.el-notification--success{--el-notification-icon-color:var(--el-color-success);color:var(--el-notification-icon-color)}.el-notification--info{--el-notification-icon-color:var(--el-color-info);color:var(--el-notification-icon-color)}.el-notification--warning{--el-notification-icon-color:var(--el-color-warning);color:var(--el-notification-icon-color)}.el-notification--error{--el-notification-icon-color:var(--el-color-error);color:var(--el-notification-icon-color)}.el-notification-fade-enter-from.right{right:0;transform:translateX(100%)}.el-notification-fade-enter-from.left{left:0;transform:translateX(-100%)}.el-notification-fade-leave-to{opacity:0}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-overlay.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-overlay{position:fixed;top:0;right:0;bottom:0;left:0;z-index:2000;height:100%;background-color:rgba(0,0,0,.5);overflow:auto}.el-overlay .el-overlay-root{height:0}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-popper.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-popper{--el-popper-border-radius:var(--el-popover-border-radius, 4px)}.el-popper{position:absolute;border-radius:var(--el-popper-border-radius);padding:5px 11px;z-index:2000;font-size:12px;line-height:20px;min-width:10px;word-wrap:break-word;visibility:visible}.el-popper.is-dark{color:var(--el-color-white);background:var(--el-text-color-primary);border:1px solid var(--el-text-color-primary)}.el-popper.is-dark .el-popper__arrow::before{border:1px solid var(--el-text-color-primary);background:var(--el-text-color-primary);right:0}.el-popper.is-light{background:var(--el-color-white);border:1px solid var(--el-border-color-light)}.el-popper.is-light .el-popper__arrow::before{border:1px solid var(--el-border-color-light);background:var(--el-color-white);right:0}.el-popper.is-pure{padding:0}.el-popper__arrow{position:absolute;width:10px;height:10px;z-index:-1}.el-popper__arrow::before{position:absolute;width:10px;height:10px;z-index:-1;content:\" \";transform:rotate(45deg);background:var(--el-text-color-primary);box-sizing:border-box}.el-popper[data-popper-placement^=top]>.el-popper__arrow{bottom:-5px}.el-popper[data-popper-placement^=top]>.el-popper__arrow::before{border-bottom-right-radius:2px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow{top:-5px}.el-popper[data-popper-placement^=bottom]>.el-popper__arrow::before{border-top-left-radius:2px}.el-popper[data-popper-placement^=left]>.el-popper__arrow{right:-5px}.el-popper[data-popper-placement^=left]>.el-popper__arrow::before{border-top-right-radius:2px}.el-popper[data-popper-placement^=right]>.el-popper__arrow{left:-5px}.el-popper[data-popper-placement^=right]>.el-popper__arrow::before{border-bottom-left-radius:2px}.el-popper[data-popper-placement^=top] .el-popper__arrow::before{border-top-color:transparent!important;border-left-color:transparent!important}.el-popper[data-popper-placement^=bottom] .el-popper__arrow::before{border-bottom-color:transparent!important;border-right-color:transparent!important}.el-popper[data-popper-placement^=left] .el-popper__arrow::before{border-left-color:transparent!important;border-bottom-color:transparent!important}.el-popper[data-popper-placement^=right] .el-popper__arrow::before{border-right-color:transparent!important;border-top-color:transparent!important}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-progress.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-progress{position:relative;line-height:1;display:flex;align-items:center}.el-progress__text{font-size:14px;color:var(--el-text-color-regular);margin-left:5px;min-width:50px;line-height:1}.el-progress__text i{vertical-align:middle;display:block}.el-progress--circle,.el-progress--dashboard{display:inline-block}.el-progress--circle .el-progress__text,.el-progress--dashboard .el-progress__text{position:absolute;top:50%;left:0;width:100%;text-align:center;margin:0;transform:translate(0,-50%)}.el-progress--circle .el-progress__text i,.el-progress--dashboard .el-progress__text i{vertical-align:middle;display:inline-block}.el-progress--without-text .el-progress__text{display:none}.el-progress--without-text .el-progress-bar{padding-right:0;margin-right:0;display:block}.el-progress--text-inside .el-progress-bar{padding-right:0;margin-right:0}.el-progress.is-success .el-progress-bar__inner{background-color:var(--el-color-success)}.el-progress.is-success .el-progress__text{color:var(--el-color-success)}.el-progress.is-warning .el-progress-bar__inner{background-color:var(--el-color-warning)}.el-progress.is-warning .el-progress__text{color:var(--el-color-warning)}.el-progress.is-exception .el-progress-bar__inner{background-color:var(--el-color-danger)}.el-progress.is-exception .el-progress__text{color:var(--el-color-danger)}.el-progress-bar{flex-grow:1;box-sizing:border-box}.el-progress-bar__outer{height:6px;border-radius:100px;background-color:var(--el-border-color-lighter);overflow:hidden;position:relative;vertical-align:middle}.el-progress-bar__inner{position:absolute;left:0;top:0;height:100%;background-color:var(--el-color-primary);text-align:right;border-radius:100px;line-height:1;white-space:nowrap;transition:width .6s ease}.el-progress-bar__inner::after{display:inline-block;content:\"\";height:100%;vertical-align:middle}.el-progress-bar__inner--indeterminate{transform:translateZ(0);animation:indeterminate 3s infinite}.el-progress-bar__innerText{display:inline-block;vertical-align:middle;color:#fff;font-size:12px;margin:0 5px}@keyframes progress{0%{background-position:0 0}100%{background-position:32px 0}}@keyframes indeterminate{0%{left:-100%}100%{left:100%}}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-row.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-row{display:flex;flex-wrap:wrap;position:relative;box-sizing:border-box}.el-row.is-justify-center{justify-content:center}.el-row.is-justify-end{justify-content:flex-end}.el-row.is-justify-space-between{justify-content:space-between}.el-row.is-justify-space-around{justify-content:space-around}.el-row.is-align-middle{align-items:center}.el-row.is-align-bottom{align-items:flex-end}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-scrollbar.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-scrollbar{--el-scrollbar-opacity:0.3;--el-scrollbar-bg-color:var(--el-text-color-secondary);--el-scrollbar-hover-opacity:0.5;--el-scrollbar-hover-bg-color:var(--el-text-color-secondary)}.el-scrollbar{overflow:hidden;position:relative;height:100%}.el-scrollbar__wrap{overflow:auto;height:100%}.el-scrollbar__wrap--hidden-default{scrollbar-width:none}.el-scrollbar__wrap--hidden-default::-webkit-scrollbar{display:none}.el-scrollbar__thumb{position:relative;display:block;width:0;height:0;cursor:pointer;border-radius:inherit;background-color:var(--el-scrollbar-bg-color,var(--el-text-color-secondary));transition:var(--el-transition-duration) background-color;opacity:var(--el-scrollbar-opacity,.3)}.el-scrollbar__thumb:hover{background-color:var(--el-scrollbar-hover-bg-color,var(--el-text-color-secondary));opacity:var(--el-scrollbar-hover-opacity,.5)}.el-scrollbar__bar{position:absolute;right:2px;bottom:2px;z-index:1;border-radius:4px}.el-scrollbar__bar.is-vertical{width:6px;top:2px}.el-scrollbar__bar.is-vertical>div{width:100%}.el-scrollbar__bar.is-horizontal{height:6px;left:2px}.el-scrollbar__bar.is-horizontal>div{height:100%}.el-scrollbar-fade-enter-active{transition:opacity 340ms ease-out}.el-scrollbar-fade-leave-active{transition:opacity 120ms ease-out}.el-scrollbar-fade-enter-from,.el-scrollbar-fade-leave-active{opacity:0}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-slider.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-slider{--el-slider-main-bg-color:var(--el-color-primary);--el-slider-runway-bg-color:var(--el-border-color-light);--el-slider-stop-bg-color:var(--el-color-white);--el-slider-disable-color:var(--el-text-color-placeholder);--el-slider-border-radius:3px;--el-slider-height:6px;--el-slider-button-size:20px;--el-slider-button-wrapper-size:36px;--el-slider-button-wrapper-offset:-15px}.el-slider{width:100%;height:32px;display:flex;align-items:center}.el-slider__runway{flex:1;height:var(--el-slider-height);background-color:var(--el-slider-runway-bg-color);border-radius:var(--el-slider-border-radius);position:relative;cursor:pointer}.el-slider__runway.show-input{margin-right:30px;width:auto}.el-slider__runway.disabled{cursor:default}.el-slider__runway.disabled .el-slider__bar{background-color:var(--el-slider-disable-color)}.el-slider__runway.disabled .el-slider__button{border-color:var(--el-slider-disable-color)}.el-slider__runway.disabled .el-slider__button-wrapper.hover,.el-slider__runway.disabled .el-slider__button-wrapper:hover{cursor:not-allowed}.el-slider__runway.disabled .el-slider__button-wrapper.dragging{cursor:not-allowed}.el-slider__runway.disabled .el-slider__button.dragging,.el-slider__runway.disabled .el-slider__button.hover,.el-slider__runway.disabled .el-slider__button:hover{transform:scale(1)}.el-slider__runway.disabled .el-slider__button.hover,.el-slider__runway.disabled .el-slider__button:hover{cursor:not-allowed}.el-slider__runway.disabled .el-slider__button.dragging{cursor:not-allowed}.el-slider__input{flex-shrink:0;width:130px}.el-slider__bar{height:var(--el-slider-height);background-color:var(--el-slider-main-bg-color);border-top-left-radius:var(--el-slider-border-radius);border-bottom-left-radius:var(--el-slider-border-radius);position:absolute}.el-slider__button-wrapper{height:var(--el-slider-button-wrapper-size);width:var(--el-slider-button-wrapper-size);position:absolute;z-index:1;top:var(--el-slider-button-wrapper-offset);transform:translateX(-50%);background-color:transparent;text-align:center;-webkit-user-select:none;user-select:none;line-height:normal;outline:0}.el-slider__button-wrapper::after{display:inline-block;content:\"\";height:100%;vertical-align:middle}.el-slider__button-wrapper.hover,.el-slider__button-wrapper:hover{cursor:grab}.el-slider__button-wrapper.dragging{cursor:grabbing}.el-slider__button{display:inline-block;width:var(--el-slider-button-size);height:var(--el-slider-button-size);vertical-align:middle;border:solid 2px var(--el-slider-main-bg-color);background-color:var(--el-color-white);border-radius:50%;box-sizing:border-box;transition:var(--el-transition-duration-fast);-webkit-user-select:none;user-select:none}.el-slider__button.dragging,.el-slider__button.hover,.el-slider__button:hover{transform:scale(1.2)}.el-slider__button.hover,.el-slider__button:hover{cursor:grab}.el-slider__button.dragging{cursor:grabbing}.el-slider__stop{position:absolute;height:var(--el-slider-height);width:var(--el-slider-height);border-radius:var(--el-border-radius-circle);background-color:var(--el-slider-stop-bg-color);transform:translateX(-50%)}.el-slider__marks{top:0;left:12px;width:18px;height:100%}.el-slider__marks-text{position:absolute;transform:translateX(-50%);font-size:14px;color:var(--el-color-info);margin-top:15px}.el-slider.is-vertical{position:relative;height:100%;flex:0}.el-slider.is-vertical .el-slider__runway{width:var(--el-slider-height);height:100%;margin:0 16px}.el-slider.is-vertical .el-slider__bar{width:var(--el-slider-height);height:auto;border-radius:0 0 3px 3px}.el-slider.is-vertical .el-slider__button-wrapper{top:auto;left:var(--el-slider-button-wrapper-offset);transform:translateY(50%)}.el-slider.is-vertical .el-slider__stop{transform:translateY(50%)}.el-slider.is-vertical .el-slider__marks-text{margin-top:0;left:15px;transform:translateY(50%)}.el-slider--large{height:40px}.el-slider--small{height:24px}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-table-column.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-table-column--selection .cell{padding-left:14px;padding-right:14px}.el-table-filter{border:solid 1px var(--el-border-color-lighter);border-radius:2px;background-color:#fff;box-shadow:var(--el-box-shadow-light);box-sizing:border-box}.el-table-filter__list{padding:5px 0;margin:0;list-style:none;min-width:100px}.el-table-filter__list-item{line-height:36px;padding:0 10px;cursor:pointer;font-size:var(--el-font-size-base)}.el-table-filter__list-item:hover{background-color:var(--el-color-primary-light-9);color:var(--el-color-primary-light-2)}.el-table-filter__list-item.is-active{background-color:var(--el-color-primary);color:#fff}.el-table-filter__content{min-width:100px}.el-table-filter__bottom{border-top:1px solid var(--el-border-color-lighter);padding:8px}.el-table-filter__bottom button{background:0 0;border:none;color:var(--el-text-color-regular);cursor:pointer;font-size:var(--el-font-size-small);padding:0 3px}.el-table-filter__bottom button:hover{color:var(--el-color-primary)}.el-table-filter__bottom button:focus{outline:0}.el-table-filter__bottom button.is-disabled{color:var(--el-disabled-text-color);cursor:not-allowed}.el-table-filter__wrap{max-height:280px}.el-table-filter__checkbox-group{padding:10px}.el-table-filter__checkbox-group label.el-checkbox{display:flex;align-items:center;margin-right:5px;margin-bottom:12px;margin-left:5px;height:unset}.el-table-filter__checkbox-group .el-checkbox:last-child{margin-bottom:0}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-table.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-table{--el-table-border-color:var(--el-border-color-lighter);--el-table-border:1px solid var(--el-table-border-color);--el-table-text-color:var(--el-text-color-regular);--el-table-header-text-color:var(--el-text-color-secondary);--el-table-row-hover-bg-color:var(--el-bg-color);--el-table-current-row-bg-color:var(--el-color-primary-light-9);--el-table-header-bg-color:var(--el-color-white);--el-table-fixed-box-shadow:0 0 10px rgba(0, 0, 0, 0.12);--el-table-bg-color:var(--el-color-white);--el-table-tr-bg-color:var(--el-color-white);--el-table-expanded-cell-bg-color:var(--el-color-white)}.el-table{position:relative;overflow:hidden;box-sizing:border-box;height:-moz-fit-content;height:fit-content;width:100%;max-width:100%;background-color:var(--el-table-bg-color);font-size:14px;color:var(--el-table-text-color)}.el-table__inner-wrapper{position:relative}.el-table__inner-wrapper::before{left:0;bottom:0;width:100%;height:1px;z-index:3}.el-table.has-footer .el-table__inner-wrapper::before{bottom:1px}.el-table__empty-block{min-height:60px;text-align:center;width:100%;display:flex;justify-content:center;align-items:center}.el-table__empty-text{line-height:60px;width:50%;color:var(--el-text-color-secondary)}.el-table__expand-column .cell{padding:0;text-align:center}.el-table__expand-icon{position:relative;cursor:pointer;color:var(--el-text-color-regular);font-size:12px;transition:transform var(--el-transition-duration-fast) ease-in-out;height:20px}.el-table__expand-icon--expanded{transform:rotate(90deg)}.el-table__expand-icon>.el-icon{font-size:12px}.el-table__expanded-cell{background-color:var(--el-table-expanded-cell-bg-color)}.el-table__expanded-cell[class*=cell]{padding:20px 50px}.el-table__expanded-cell:hover{background-color:transparent!important}.el-table__placeholder{display:inline-block;width:20px}.el-table__append-wrapper{overflow:hidden}.el-table--fit{border-right:0;border-bottom:0}.el-table--fit .el-table__cell.gutter{border-right-width:1px}.el-table thead{color:var(--el-table-header-text-color);font-weight:500}.el-table thead.is-group th.el-table__cell{background:var(--el-bg-color)}.el-table .el-table__cell{padding:8px 0;min-width:0;box-sizing:border-box;text-overflow:ellipsis;vertical-align:middle;position:relative;text-align:left;z-index:1}.el-table .el-table__cell.is-center{text-align:center}.el-table .el-table__cell.is-right{text-align:right}.el-table .el-table__cell.gutter{width:15px;border-right-width:0;border-bottom-width:0;padding:0}.el-table .el-table__cell.is-hidden>*{visibility:hidden}.el-table .cell{box-sizing:border-box;overflow:hidden;text-overflow:ellipsis;white-space:normal;word-break:break-all;line-height:23px;padding:0 12px}.el-table .cell.el-tooltip{white-space:nowrap;min-width:50px}.el-table--large{font-size:var(--el-font-size-base,14px)}.el-table--large .el-table__cell{padding:12px 0}.el-table--large .cell{padding:0 16px}.el-table--small{font-size:12px}.el-table--small .el-table__cell{padding:4px 0}.el-table--small .cell{padding:0 8px}.el-table tr{background-color:var(--el-table-tr-bg-color)}.el-table tr input[type=checkbox]{margin:0}.el-table td.el-table__cell,.el-table th.el-table__cell.is-leaf{border-bottom:var(--el-table-border)}.el-table th.el-table__cell.is-sortable{cursor:pointer}.el-table th.el-table__cell{-webkit-user-select:none;user-select:none;background-color:var(--el-table-header-bg-color)}.el-table th.el-table__cell>.cell{display:inline-block;box-sizing:border-box;position:relative;vertical-align:middle;width:100%}.el-table th.el-table__cell>.cell.highlight{color:var(--el-color-primary)}.el-table th.el-table__cell.required>div::before{display:inline-block;content:\"\";width:8px;height:8px;border-radius:50%;background:#ff4d51;margin-right:5px;vertical-align:middle}.el-table td.el-table__cell div{box-sizing:border-box}.el-table td.el-table__cell.gutter{width:0}.el-table--border .el-table__footer-wrapper tr:first-child td:first-child,.el-table--border .el-table__footer-wrapper tr:first-child th:first-child,.el-table--border .el-table__inner-wrapper tr:first-child td:first-child,.el-table--border .el-table__inner-wrapper tr:first-child th:first-child,.el-table--group .el-table__footer-wrapper tr:first-child td:first-child,.el-table--group .el-table__footer-wrapper tr:first-child th:first-child,.el-table--group .el-table__inner-wrapper tr:first-child td:first-child,.el-table--group .el-table__inner-wrapper tr:first-child th:first-child{border-left:var(--el-table-border)}.el-table--border .el-table__footer-wrapper,.el-table--group .el-table__footer-wrapper{border-top:var(--el-table-border)}.el-table--border .el-table__inner-wrapper::after,.el-table--border::after,.el-table--border::before,.el-table__inner-wrapper::before{content:\"\";position:absolute;background-color:var(--el-table-border-color);z-index:3}.el-table--border .el-table__inner-wrapper::after{left:0;top:0;width:100%;height:1px;z-index:3}.el-table--border::before{top:-1px;left:0;width:1px;height:100%;z-index:3}.el-table--border::after{top:-1px;right:0;width:1px;height:100%;z-index:3}.el-table--border .el-table__inner-wrapper{border-right:none;border-bottom:none}.el-table--border .el-table__footer-wrapper{position:relative}.el-table--border .el-table__footer-wrapper{margin-top:-2px}.el-table--border .el-table__cell{border-right:var(--el-table-border)}.el-table--border .el-table__cell:first-child .cell{padding-left:10px}.el-table--border th.el-table__cell.gutter:last-of-type{border-bottom:var(--el-table-border);border-bottom-width:1px}.el-table--border th.el-table__cell{border-bottom:var(--el-table-border)}.el-table--hidden{visibility:hidden}.el-table__body-wrapper,.el-table__footer-wrapper,.el-table__header-wrapper{width:100%}.el-table__body-wrapper tr td.el-table-fixed-column--left,.el-table__body-wrapper tr td.el-table-fixed-column--right,.el-table__body-wrapper tr th.el-table-fixed-column--left,.el-table__body-wrapper tr th.el-table-fixed-column--right,.el-table__footer-wrapper tr td.el-table-fixed-column--left,.el-table__footer-wrapper tr td.el-table-fixed-column--right,.el-table__footer-wrapper tr th.el-table-fixed-column--left,.el-table__footer-wrapper tr th.el-table-fixed-column--right,.el-table__header-wrapper tr td.el-table-fixed-column--left,.el-table__header-wrapper tr td.el-table-fixed-column--right,.el-table__header-wrapper tr th.el-table-fixed-column--left,.el-table__header-wrapper tr th.el-table-fixed-column--right{position:sticky!important;z-index:2;background:#fff}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column::before,.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column::before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column::before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column::before{content:\"\";position:absolute;top:0;width:10px;bottom:-1px;overflow-x:hidden;overflow-y:hidden;box-shadow:inset -10px 0 10px -10px rgba(0,0,0,.15);touch-action:none;pointer-events:none}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-first-column::before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-first-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-first-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-first-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-first-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-first-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-first-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-first-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-first-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-first-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-first-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-first-column::before{left:-10px}.el-table__body-wrapper tr td.el-table-fixed-column--left.is-last-column::before,.el-table__body-wrapper tr td.el-table-fixed-column--right.is-last-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--left.is-last-column::before,.el-table__body-wrapper tr th.el-table-fixed-column--right.is-last-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--left.is-last-column::before,.el-table__footer-wrapper tr td.el-table-fixed-column--right.is-last-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--left.is-last-column::before,.el-table__footer-wrapper tr th.el-table-fixed-column--right.is-last-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--left.is-last-column::before,.el-table__header-wrapper tr td.el-table-fixed-column--right.is-last-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--left.is-last-column::before,.el-table__header-wrapper tr th.el-table-fixed-column--right.is-last-column::before{right:-10px;box-shadow:inset 10px 0 10px -10px rgba(0,0,0,.15)}.el-table__body-wrapper tr td.el-table__fixed-right-patch,.el-table__body-wrapper tr th.el-table__fixed-right-patch,.el-table__footer-wrapper tr td.el-table__fixed-right-patch,.el-table__footer-wrapper tr th.el-table__fixed-right-patch,.el-table__header-wrapper tr td.el-table__fixed-right-patch,.el-table__header-wrapper tr th.el-table__fixed-right-patch{position:sticky!important;z-index:2;background:#fff;right:0}.el-table__body,.el-table__footer,.el-table__header{table-layout:fixed;border-collapse:separate}.el-table__footer-wrapper,.el-table__header-wrapper{overflow:hidden}.el-table__footer-wrapper tbody td.el-table__cell,.el-table__header-wrapper tbody td.el-table__cell{background-color:var(--el-table-row-hover-bg-color);color:var(--el-table-text-color)}.el-table__body-wrapper .el-table-column--selection .el-checkbox,.el-table__header-wrapper .el-table-column--selection .el-checkbox{height:unset}.el-table.is-scrolling-left .el-table-fixed-column--left.is-last-column::before{box-shadow:none}.el-table.is-scrolling-left.el-table--border .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:var(--el-table-border)}.el-table.is-scrolling-right .el-table-fixed-column--right.is-first-column::before{box-shadow:none}.el-table.is-scrolling-right .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-middle .el-table-fixed-column--left.is-last-column.el-table__cell{border-right:none}.el-table.is-scrolling-none .el-table-fixed-column--left.is-first-column::before,.el-table.is-scrolling-none .el-table-fixed-column--left.is-last-column::before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-first-column::before,.el-table.is-scrolling-none .el-table-fixed-column--right.is-last-column::before{box-shadow:none}.el-table__body-wrapper{overflow:hidden;position:relative}.el-table__body-wrapper .el-scrollbar__bar{z-index:2}.el-table .caret-wrapper{display:inline-flex;flex-direction:column;align-items:center;height:14px;width:24px;vertical-align:middle;cursor:pointer;overflow:initial;position:relative}.el-table .sort-caret{width:0;height:0;border:solid 5px transparent;position:absolute;left:7px}.el-table .sort-caret.ascending{border-bottom-color:var(--el-text-color-placeholder);top:-5px}.el-table .sort-caret.descending{border-top-color:var(--el-text-color-placeholder);bottom:-3px}.el-table .ascending .sort-caret.ascending{border-bottom-color:var(--el-color-primary)}.el-table .descending .sort-caret.descending{border-top-color:var(--el-color-primary)}.el-table .hidden-columns{visibility:hidden;position:absolute;z-index:-1}.el-table--striped .el-table__body tr.el-table__row--striped td.el-table__cell{background:#fafafa}.el-table--striped .el-table__body tr.el-table__row--striped.current-row td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table__body tr.hover-row.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped.current-row>td.el-table__cell,.el-table__body tr.hover-row.el-table__row--striped>td.el-table__cell,.el-table__body tr.hover-row>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table__body tr.current-row>td.el-table__cell{background-color:var(--el-table-current-row-bg-color)}.el-table__column-resize-proxy{position:absolute;left:200px;top:0;bottom:0;width:0;border-left:var(--el-table-border);z-index:10}.el-table__column-filter-trigger{display:inline-block;cursor:pointer}.el-table__column-filter-trigger i{color:var(--el-color-info);font-size:14px;vertical-align:middle}.el-table__border-left-patch{top:0;left:0;width:1px;height:100%;z-index:3;position:absolute;background-color:var(--el-table-border-color)}.el-table__border-bottom-patch{left:0;height:1px;z-index:3;position:absolute;background-color:var(--el-table-border-color)}.el-table__border-right-patch{top:0;height:100%;width:1px;z-index:3;position:absolute;background-color:var(--el-table-border-color)}.el-table--enable-row-transition .el-table__body td.el-table__cell{transition:background-color .25s ease}.el-table--enable-row-hover .el-table__body tr:hover>td.el-table__cell{background-color:var(--el-table-row-hover-bg-color)}.el-table [class*=el-table__row--level] .el-table__expand-icon{display:inline-block;width:12px;line-height:12px;height:12px;text-align:center;margin-right:8px}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-tag.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, ".el-tag{--el-tag-font-size:12px;--el-tag-border-radius:4px}.el-tag{--el-tag-bg-color:#ecf5ff;--el-tag-border-color:#d9ecff;--el-tag-text-color:#409eff;--el-tag-hover-color:#409eff;background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);color:var(--el-tag-text-color);display:inline-flex;justify-content:center;align-items:center;height:24px;padding:0 9px;font-size:var(--el-tag-font-size);line-height:1;border-width:1px;border-style:solid;border-radius:var(--el-tag-border-radius);box-sizing:border-box;white-space:nowrap;--el-icon-size:14px}.el-tag.is-hit{border-color:#409eff}.el-tag .el-tag__close{color:var(--el-tag-text-color)}.el-tag .el-tag__close:hover{color:var(--el-color-white);background-color:var(--el-tag-hover-color)}.el-tag.el-tag--primary{--el-tag-bg-color:#ecf5ff;--el-tag-border-color:#d9ecff;--el-tag-text-color:#409eff;--el-tag-hover-color:#409eff}.el-tag.el-tag--primary.is-hit{border-color:#409eff}.el-tag.el-tag--success{--el-tag-bg-color:#f0f9eb;--el-tag-border-color:#e1f3d8;--el-tag-text-color:#67c23a;--el-tag-hover-color:#67c23a}.el-tag.el-tag--success.is-hit{border-color:#67c23a}.el-tag.el-tag--warning{--el-tag-bg-color:#fdf6ec;--el-tag-border-color:#faecd8;--el-tag-text-color:#e6a23c;--el-tag-hover-color:#e6a23c}.el-tag.el-tag--warning.is-hit{border-color:#e6a23c}.el-tag.el-tag--danger{--el-tag-bg-color:#fef0f0;--el-tag-border-color:#fde2e2;--el-tag-text-color:#f56c6c;--el-tag-hover-color:#f56c6c}.el-tag.el-tag--danger.is-hit{border-color:#f56c6c}.el-tag.el-tag--error{--el-tag-bg-color:#fef0f0;--el-tag-border-color:#fde2e2;--el-tag-text-color:#f56c6c;--el-tag-hover-color:#f56c6c}.el-tag.el-tag--error.is-hit{border-color:#f56c6c}.el-tag.el-tag--info{--el-tag-bg-color:#f4f4f5;--el-tag-border-color:#e9e9eb;--el-tag-text-color:#909399;--el-tag-hover-color:#909399}.el-tag.el-tag--info.is-hit{border-color:#909399}.el-tag .el-icon{border-radius:50%;text-align:center;position:relative;cursor:pointer;font-size:calc(var(--el-icon-size) - 1px);height:var(--el-icon-size);width:var(--el-icon-size);line-height:var(--el-icon-size)}.el-tag .el-icon svg{margin:1px}.el-tag .el-tag__close{margin-left:6px}.el-tag--dark{--el-tag-bg-color:#409eff;--el-tag-border-color:#409eff;--el-tag-text-color:white;--el-tag-hover-color:#66b1ff;background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);color:var(--el-tag-text-color)}.el-tag--dark.is-hit{border-color:#409eff}.el-tag--dark .el-tag__close{color:var(--el-tag-text-color)}.el-tag--dark .el-tag__close:hover{color:var(--el-color-white);background-color:var(--el-tag-hover-color)}.el-tag--dark.el-tag--primary{--el-tag-bg-color:#409eff;--el-tag-border-color:#409eff;--el-tag-text-color:white;--el-tag-hover-color:#66b1ff}.el-tag--dark.el-tag--primary.is-hit{border-color:#409eff}.el-tag--dark.el-tag--success{--el-tag-bg-color:#67c23a;--el-tag-border-color:#67c23a;--el-tag-text-color:white;--el-tag-hover-color:#85ce61}.el-tag--dark.el-tag--success.is-hit{border-color:#67c23a}.el-tag--dark.el-tag--warning{--el-tag-bg-color:#e6a23c;--el-tag-border-color:#e6a23c;--el-tag-text-color:white;--el-tag-hover-color:#ebb563}.el-tag--dark.el-tag--warning.is-hit{border-color:#e6a23c}.el-tag--dark.el-tag--danger{--el-tag-bg-color:#f56c6c;--el-tag-border-color:#f56c6c;--el-tag-text-color:white;--el-tag-hover-color:#f78989}.el-tag--dark.el-tag--danger.is-hit{border-color:#f56c6c}.el-tag--dark.el-tag--error{--el-tag-bg-color:#f56c6c;--el-tag-border-color:#f56c6c;--el-tag-text-color:white;--el-tag-hover-color:#f78989}.el-tag--dark.el-tag--error.is-hit{border-color:#f56c6c}.el-tag--dark.el-tag--info{--el-tag-bg-color:#909399;--el-tag-border-color:#909399;--el-tag-text-color:white;--el-tag-hover-color:#a6a9ad}.el-tag--dark.el-tag--info.is-hit{border-color:#909399}.el-tag--plain{--el-tag-bg-color:white;--el-tag-border-color:#b3d8ff;--el-tag-text-color:#409eff;--el-tag-hover-color:#409eff;background-color:var(--el-tag-bg-color);border-color:var(--el-tag-border-color);color:var(--el-tag-text-color)}.el-tag--plain.is-hit{border-color:#409eff}.el-tag--plain .el-tag__close{color:var(--el-tag-text-color)}.el-tag--plain .el-tag__close:hover{color:var(--el-color-white);background-color:var(--el-tag-hover-color)}.el-tag--plain.el-tag--primary{--el-tag-bg-color:white;--el-tag-border-color:#b3d8ff;--el-tag-text-color:#409eff;--el-tag-hover-color:#409eff}.el-tag--plain.el-tag--primary.is-hit{border-color:#409eff}.el-tag--plain.el-tag--success{--el-tag-bg-color:white;--el-tag-border-color:#c2e7b0;--el-tag-text-color:#67c23a;--el-tag-hover-color:#67c23a}.el-tag--plain.el-tag--success.is-hit{border-color:#67c23a}.el-tag--plain.el-tag--warning{--el-tag-bg-color:white;--el-tag-border-color:#f5dab1;--el-tag-text-color:#e6a23c;--el-tag-hover-color:#e6a23c}.el-tag--plain.el-tag--warning.is-hit{border-color:#e6a23c}.el-tag--plain.el-tag--danger{--el-tag-bg-color:white;--el-tag-border-color:#fbc4c4;--el-tag-text-color:#f56c6c;--el-tag-hover-color:#f56c6c}.el-tag--plain.el-tag--danger.is-hit{border-color:#f56c6c}.el-tag--plain.el-tag--error{--el-tag-bg-color:white;--el-tag-border-color:#fbc4c4;--el-tag-text-color:#f56c6c;--el-tag-hover-color:#f56c6c}.el-tag--plain.el-tag--error.is-hit{border-color:#f56c6c}.el-tag--plain.el-tag--info{--el-tag-bg-color:white;--el-tag-border-color:#d3d4d6;--el-tag-text-color:#909399;--el-tag-hover-color:#909399}.el-tag--plain.el-tag--info.is-hit{border-color:#909399}.el-tag.is-closable{padding-right:5px}.el-tag--large{padding:0 11px;height:32px;--el-icon-size:16px}.el-tag--large .el-tag__close{margin-left:8px}.el-tag--large.is-closable{padding-right:7px}.el-tag--default{padding:0 9px;height:24px;--el-icon-size:14px}.el-tag--default .el-tag__close{margin-left:6px}.el-tag--default.is-closable{padding-right:5px}.el-tag--small{padding:0 7px;height:20px;--el-icon-size:12px}.el-tag--small .el-tag__close{margin-left:4px}.el-tag--small.is-closable{padding-right:3px}.el-tag--small .el-icon-close{transform:scale(.8)}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-tooltip.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-upload.css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "@charset \"UTF-8\";.el-upload{display:inline-block;text-align:center;cursor:pointer;outline:0}.el-upload__input{display:none}.el-upload__tip{font-size:12px;color:var(--el-text-color-regular);margin-top:7px}.el-upload iframe{position:absolute;z-index:-1;top:0;left:0;opacity:0}.el-upload--picture-card{background-color:#fbfdff;border:1px dashed #c0ccda;border-radius:6px;box-sizing:border-box;width:148px;height:148px;cursor:pointer;vertical-align:top}.el-upload--picture-card i{margin-top:59px;font-size:28px;color:#8c939d}.el-upload--picture-card:hover{border-color:var(--el-color-primary);color:var(--el-color-primary)}.el-upload:focus{border-color:var(--el-color-primary);color:var(--el-color-primary)}.el-upload:focus .el-upload-dragger{border-color:var(--el-color-primary)}.el-upload-dragger{background-color:#fff;border:1px dashed #d9d9d9;border-radius:6px;box-sizing:border-box;width:360px;height:180px;text-align:center;cursor:pointer;position:relative;overflow:hidden}.el-upload-dragger .el-icon--upload{font-size:67px;color:var(--el-text-color-placeholder);margin:40px 0 16px;line-height:50px}.el-upload-dragger+.el-upload__tip{text-align:center}.el-upload-dragger~.el-upload__files{border-top:1px solid #dcdfe6;margin-top:7px;padding-top:5px}.el-upload-dragger .el-upload__text{color:var(--el-text-color-regular);font-size:14px;text-align:center}.el-upload-dragger .el-upload__text em{color:var(--el-color-primary);font-style:normal}.el-upload-dragger:hover{border-color:var(--el-color-primary)}.el-upload-dragger.is-dragover{background-color:rgba(32,159,255,.06);border:2px dashed var(--el-color-primary)}.el-upload-list{margin:0;padding:0;list-style:none}.el-upload-list__item{transition:all .5s cubic-bezier(.55,0,.1,1);font-size:14px;color:var(--el-text-color-regular);line-height:1.8;margin-top:5px;position:relative;box-sizing:border-box;border-radius:4px;width:100%}.el-upload-list__item .el-progress{position:absolute;top:20px;width:100%}.el-upload-list__item .el-progress__text{position:absolute;right:0;top:-13px}.el-upload-list__item .el-progress-bar{margin-right:0;padding-right:0}.el-upload-list__item:first-child{margin-top:10px}.el-upload-list__item .el-icon--upload-success{color:var(--el-color-success)}.el-upload-list__item .el-icon--close{display:none;position:absolute;top:5px;right:5px;cursor:pointer;opacity:.75;color:var(--el-text-color-regular)}.el-upload-list__item .el-icon--close:hover{opacity:1}.el-upload-list__item .el-icon--close-tip{display:none;position:absolute;top:5px;right:5px;font-size:12px;cursor:pointer;opacity:1;color:var(--el-color-primary)}.el-upload-list__item:hover{background-color:var(--el-bg-color)}.el-upload-list__item:hover .el-icon--close{display:inline-block}.el-upload-list__item:hover .el-progress__text{display:none}.el-upload-list__item.is-success .el-upload-list__item-status-label{display:block}.el-upload-list__item.is-success .el-upload-list__item-name:focus,.el-upload-list__item.is-success .el-upload-list__item-name:hover{color:var(--el-color-primary);cursor:pointer}.el-upload-list__item.is-success:focus:not(:hover) .el-icon-close-tip{display:inline-block}.el-upload-list__item.is-success:active,.el-upload-list__item.is-success:not(.focusing):focus{outline-width:0}.el-upload-list__item.is-success:active .el-icon--close-tip,.el-upload-list__item.is-success:not(.focusing):focus .el-icon--close-tip{display:none}.el-upload-list__item.is-success:focus .el-upload-list__item-status-label,.el-upload-list__item.is-success:hover .el-upload-list__item-status-label{display:none}.el-upload-list.is-disabled .el-upload-list__item:hover .el-upload-list__item-status-label{display:block}.el-upload-list__item-name{color:var(--el-text-color-regular);display:block;margin-right:40px;overflow:hidden;padding-left:4px;text-overflow:ellipsis;transition:color var(--el-transition-duration);white-space:nowrap}.el-upload-list__item-name .el-icon{margin-right:7px;color:var(--el-text-color-secondary)}.el-upload-list__item-name .el-icon svg{vertical-align:text-bottom}.el-upload-list__item-status-label{position:absolute;right:5px;top:0;line-height:inherit;display:none}.el-upload-list__item-delete{position:absolute;right:10px;top:0;font-size:12px;color:var(--el-text-color-regular);display:none}.el-upload-list__item-delete:hover{color:var(--el-color-primary)}.el-upload-list--picture-card{margin:0;display:inline;vertical-align:top}.el-upload-list--picture-card .el-upload-list__item{overflow:hidden;background-color:#fff;border:1px solid #c0ccda;border-radius:6px;box-sizing:border-box;width:148px;height:148px;margin:0 8px 8px 0;display:inline-block}.el-upload-list--picture-card .el-upload-list__item .el-icon--check,.el-upload-list--picture-card .el-upload-list__item .el-icon--circle-check{color:#fff}.el-upload-list--picture-card .el-upload-list__item .el-icon--close{display:none}.el-upload-list--picture-card .el-upload-list__item:hover .el-upload-list__item-status-label{display:none}.el-upload-list--picture-card .el-upload-list__item:hover .el-progress__text{display:block}.el-upload-list--picture-card .el-upload-list__item-name{display:none}.el-upload-list--picture-card .el-upload-list__item-thumbnail{width:100%;height:100%;object-fit:contain}.el-upload-list--picture-card .el-upload-list__item-status-label{position:absolute;right:-15px;top:-6px;width:40px;height:24px;background:#13ce66;text-align:center;transform:rotate(45deg);box-shadow:0 0 1pc 1px rgba(0,0,0,.2)}.el-upload-list--picture-card .el-upload-list__item-status-label i{font-size:12px;margin-top:11px;transform:rotate(-45deg)}.el-upload-list--picture-card .el-upload-list__item-actions{position:absolute;width:100%;height:100%;left:0;top:0;cursor:default;text-align:center;color:#fff;opacity:0;font-size:20px;background-color:rgba(0,0,0,.5);transition:opacity var(--el-transition-duration)}.el-upload-list--picture-card .el-upload-list__item-actions::after{display:inline-block;content:\"\";height:100%;vertical-align:middle}.el-upload-list--picture-card .el-upload-list__item-actions span{display:none;cursor:pointer}.el-upload-list--picture-card .el-upload-list__item-actions span+span{margin-left:15px}.el-upload-list--picture-card .el-upload-list__item-actions .el-upload-list__item-delete{position:static;font-size:inherit;color:inherit}.el-upload-list--picture-card .el-upload-list__item-actions:hover{opacity:1}.el-upload-list--picture-card .el-upload-list__item-actions:hover span{display:inline-block}.el-upload-list--picture-card .el-progress{top:50%;left:50%;transform:translate(-50%,-50%);bottom:auto;width:126px}.el-upload-list--picture-card .el-progress .el-progress__text{top:50%}.el-upload-list--picture .el-upload-list__item{overflow:hidden;z-index:0;background-color:#fff;border:1px solid #c0ccda;border-radius:6px;box-sizing:border-box;margin-top:10px;padding:10px 10px 10px 90px;height:92px}.el-upload-list--picture .el-upload-list__item .el-icon--check,.el-upload-list--picture .el-upload-list__item .el-icon--circle-check{color:#fff}.el-upload-list--picture .el-upload-list__item:hover .el-upload-list__item-status-label{background:0 0;box-shadow:none;top:-2px;right:-12px}.el-upload-list--picture .el-upload-list__item:hover .el-progress__text{display:block}.el-upload-list--picture .el-upload-list__item.is-success .el-upload-list__item-name{line-height:70px;margin-top:0}.el-upload-list--picture .el-upload-list__item.is-success .el-upload-list__item-name i{display:none}.el-upload-list--picture .el-upload-list__item-thumbnail{vertical-align:middle;display:inline-block;width:70px;height:70px;float:left;position:relative;z-index:1;margin-left:-80px;background-color:#fff}.el-upload-list--picture .el-upload-list__item-name{display:block;margin-top:20px}.el-upload-list--picture .el-upload-list__item-name i{font-size:70px;line-height:1;position:absolute;left:9px;top:10px}.el-upload-list--picture .el-upload-list__item-status-label{position:absolute;right:-17px;top:-7px;width:46px;height:26px;background:#13ce66;text-align:center;transform:rotate(45deg);box-shadow:0 1px 1px #ccc}.el-upload-list--picture .el-upload-list__item-status-label i{font-size:12px;margin-top:12px;transform:rotate(-45deg)}.el-upload-list--picture .el-progress{position:relative;top:-7px}.el-upload-cover{position:absolute;left:0;top:0;width:100%;height:100%;overflow:hidden;z-index:10;cursor:default}.el-upload-cover::after{display:inline-block;content:\"\";height:100%;vertical-align:middle}.el-upload-cover img{display:block;width:100%;height:100%}.el-upload-cover__label{position:absolute;right:-15px;top:-6px;width:40px;height:24px;background:#13ce66;text-align:center;transform:rotate(45deg);box-shadow:0 0 1pc 1px rgba(0,0,0,.2)}.el-upload-cover__label i{font-size:12px;margin-top:11px;transform:rotate(-45deg);color:#fff}.el-upload-cover__progress{display:inline-block;vertical-align:middle;position:static;width:243px}.el-upload-cover__progress+.el-upload__inner{opacity:0}.el-upload-cover__content{position:absolute;top:0;left:0;width:100%;height:100%}.el-upload-cover__interact{position:absolute;bottom:0;left:0;width:100%;height:100%;background-color:rgba(0,0,0,.72);text-align:center}.el-upload-cover__interact .btn{display:inline-block;color:#fff;font-size:14px;cursor:pointer;vertical-align:middle;transition:var(--el-transition-md-fade);margin-top:60px}.el-upload-cover__interact .btn i{margin-top:0}.el-upload-cover__interact .btn span{opacity:0;transition:opacity .15s linear}.el-upload-cover__interact .btn:not(:first-child){margin-left:35px}.el-upload-cover__interact .btn:hover{transform:translateY(-13px)}.el-upload-cover__interact .btn:hover span{opacity:1}.el-upload-cover__interact .btn i{color:#fff;display:block;font-size:24px;line-height:inherit;margin:0 auto 5px}.el-upload-cover__title{position:absolute;bottom:0;left:0;background-color:#fff;height:36px;width:100%;overflow:hidden;text-overflow:ellipsis;white-space:nowrap;font-weight:400;text-align:left;padding:0 10px;margin:0;line-height:36px;font-size:14px;color:var(--el-text-color-primary)}.el-upload-cover+.el-upload__inner{opacity:0;position:relative;z-index:1}", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/About/AboutIndex.vue?vue&type=style&index=0&id=4feba1a2&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.title[data-v-4feba1a2] {\r\n  display: inline;\n}\n.description[data-v-4feba1a2] {\r\n  color: #909399;\r\n  padding-bottom: 10px;\n}\n.badges[data-v-4feba1a2] {\r\n  display: flex;\r\n  justify-content: center;\r\n  align-items: baseline;\n}\n.badges img[data-v-4feba1a2] {\r\n  padding-top: 10px;\r\n  padding-right: 5px;\n}\n.el-icon[data-v-4feba1a2] {\r\n  margin-right: 5px;\n}\n.button-block[data-v-4feba1a2] {\r\n  margin-top: 10px;\r\n  margin-bottom: 10px;\n}\n.el-card[data-v-4feba1a2] {\r\n  display: flex;\r\n  height: calc(50vh);\r\n  align-items: center;\r\n  justify-content: center;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/HeadBar.vue?vue&type=style&index=0&id=7638b672&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.el-row[data-v-7638b672] {\r\n  background-color: #005bac;\n}\n.el-row img[data-v-7638b672] {\r\n  object-fit: contain;\n}\n.el-col[data-v-7638b672] {\r\n  display: flex;\r\n  justify-content: center;\r\n  align-items: center;\r\n  margin: 15px 0px 15px 0px;\n}\n.title[data-v-7638b672] {\r\n  display: flex;\n}\n.title h2[data-v-7638b672] {\r\n  margin-left: 25px;\r\n  color: #ffffff;\r\n  cursor: default;\n}\n.welcome-info[data-v-7638b672] {\r\n  margin-right: 10px;\n}\n.welcome-info span[data-v-7638b672] {\r\n  color: #ffffff;\r\n  cursor: default;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/SideBar.vue?vue&type=style&index=0&id=2df32d5e&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.el-menu-item span[data-v-2df32d5e],\r\n.el-sub-menu span[data-v-2df32d5e] {\r\n  font-weight: bold;\n}\n.el-icon[data-v-2df32d5e] {\r\n  zoom: 150%;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=style&index=0&id=8515f78e&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.el-card[data-v-8515f78e] {\r\n  margin: 2px 10px 2px 10px;\n}\n.card-header[data-v-8515f78e] {\r\n  height: 1.3em;\r\n  font-size: 1.1em;\r\n  cursor: default;\r\n  display: flex;\r\n  align-items: center;\r\n  justify-content: space-between;\r\n  color: #005bac;\r\n  font-weight: bold;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=style&index=0&id=2d5a5eff&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n#editor[data-v-2d5a5eff] {\r\n  margin-top: 25px;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=style&index=0&id=3203cb20&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.hwt-list .el-table[data-v-3203cb20] {\r\n  height: 100%;\n}\n.el-card[data-v-3203cb20] {\r\n  min-height: 100%;\r\n  height: 100%;\n}\n.operation[data-v-3203cb20] {\r\n  display: flex;\r\n  justify-content: center;\r\n  margin-top: 25px;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Main.vue?vue&type=style&index=0&id=b1b87b0a&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.el-scrollbar[data-v-b1b87b0a] {\r\n  width: 100%;\n}\n.el-header[data-v-b1b87b0a] {\r\n  padding: 0;\r\n  height: auto;\n}\n.el-aside[data-v-b1b87b0a] {\r\n  padding: 0;\r\n  height: auto;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Profile/ProfileIndex.vue?vue&type=style&index=0&id=496da70e&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.slider-demo-block[data-v-496da70e] {\r\n  display: flex;\r\n  align-items: center;\n}\n.slider-demo-block .el-slider[data-v-496da70e] {\r\n  margin-top: 0;\r\n  margin-left: 12px;\n}\n.slider-demo-block .demonstration[data-v-496da70e] {\r\n  font-size: 14px;\r\n  color: var(--el-text-color-secondary);\r\n  line-height: 44px;\r\n  flex: 1;\r\n  overflow: hidden;\r\n  text-overflow: ellipsis;\r\n  white-space: nowrap;\r\n  margin-bottom: 0;\n}\n.slider-demo-block .demonstration + .el-slider[data-v-496da70e] {\r\n  flex: 0 0 70%;\n}\n.button-div[data-v-496da70e] {\r\n  padding-top: 25px;\r\n  text-align: center;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/Calender.vue?vue&type=style&index=0&id=3a928dc6&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.el-calendar-table .el-calendar-day {\r\n  height: 38px;\r\n  width: 38px;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/HwtList.vue?vue&type=style&index=0&id=3a6bf793&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.lesson-tag {\r\n  cursor: pointer;\n}\n.el-table .danger-row {\r\n  --el-table-tr-bg-color: var(--el-color-danger-light);\n}\n.el-table .success-row {\r\n  --el-table-tr-bg-color: var(--el-color-success-light);\n}\n.el-table .warning-row {\r\n  --el-table-tr-bg-color: var(--el-color-warning-light);\n}\n.el-table .info-row {\r\n  --el-table-tr-bg-color: var(--el-color-info-light);\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/LessonList.vue?vue&type=style&index=0&id=8151661c&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.table-header-check-tag[data-v-8151661c] {\r\n  zoom: 15%;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/NotifyList.vue?vue&type=style&index=0&id=43ad0fc2&scoped=true&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.el-collapse-item[data-v-43ad0fc2] {\r\n  font-size: 1.2em;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/WelcomeIndex.vue?vue&type=style&index=0&id=0ae504a8&lang=css":
/***/ ((module, __webpack_exports__, __webpack_require__) => {

"use strict";
/* harmony export */ __webpack_require__.d(__webpack_exports__, {
/* harmony export */   "Z": () => (__WEBPACK_DEFAULT_EXPORT__)
/* harmony export */ });
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__ = __webpack_require__("./node_modules/css-loader/dist/runtime/noSourceMaps.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0__);
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__ = __webpack_require__("./node_modules/css-loader/dist/runtime/api.js");
/* harmony import */ var _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default = /*#__PURE__*/__webpack_require__.n(_node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1__);
// Imports


var ___CSS_LOADER_EXPORT___ = _node_modules_css_loader_dist_runtime_api_js__WEBPACK_IMPORTED_MODULE_1___default()((_node_modules_css_loader_dist_runtime_noSourceMaps_js__WEBPACK_IMPORTED_MODULE_0___default()));
// Module
___CSS_LOADER_EXPORT___.push([module.id, "\n.el-card {\r\n  margin: 10px 10px 10px 10px;\r\n  /* max-height: 1000px; */\n}\n.card-header {\r\n  height: 1.3em;\r\n  font-size: 1.1em;\r\n  cursor: default;\r\n  display: flex;\r\n  align-items: center;\r\n  justify-content: space-between;\r\n  color: #005bac;\r\n  font-weight: bold;\n}\r\n", ""]);
// Exports
/* harmony default export */ const __WEBPACK_DEFAULT_EXPORT__ = (___CSS_LOADER_EXPORT___);


/***/ }),

/***/ "./node_modules/style-loader/dist/runtime/injectStylesIntoStyleTag.js":
/***/ ((module) => {

"use strict";


var stylesInDOM = [];

function getIndexByIdentifier(identifier) {
  var result = -1;

  for (var i = 0; i < stylesInDOM.length; i++) {
    if (stylesInDOM[i].identifier === identifier) {
      result = i;
      break;
    }
  }

  return result;
}

function modulesToDom(list, options) {
  var idCountMap = {};
  var identifiers = [];

  for (var i = 0; i < list.length; i++) {
    var item = list[i];
    var id = options.base ? item[0] + options.base : item[0];
    var count = idCountMap[id] || 0;
    var identifier = "".concat(id, " ").concat(count);
    idCountMap[id] = count + 1;
    var indexByIdentifier = getIndexByIdentifier(identifier);
    var obj = {
      css: item[1],
      media: item[2],
      sourceMap: item[3],
      supports: item[4],
      layer: item[5]
    };

    if (indexByIdentifier !== -1) {
      stylesInDOM[indexByIdentifier].references++;
      stylesInDOM[indexByIdentifier].updater(obj);
    } else {
      var updater = addElementStyle(obj, options);
      options.byIndex = i;
      stylesInDOM.splice(i, 0, {
        identifier: identifier,
        updater: updater,
        references: 1
      });
    }

    identifiers.push(identifier);
  }

  return identifiers;
}

function addElementStyle(obj, options) {
  var api = options.domAPI(options);
  api.update(obj);

  var updater = function updater(newObj) {
    if (newObj) {
      if (newObj.css === obj.css && newObj.media === obj.media && newObj.sourceMap === obj.sourceMap && newObj.supports === obj.supports && newObj.layer === obj.layer) {
        return;
      }

      api.update(obj = newObj);
    } else {
      api.remove();
    }
  };

  return updater;
}

module.exports = function (list, options) {
  options = options || {};
  list = list || [];
  var lastIdentifiers = modulesToDom(list, options);
  return function update(newList) {
    newList = newList || [];

    for (var i = 0; i < lastIdentifiers.length; i++) {
      var identifier = lastIdentifiers[i];
      var index = getIndexByIdentifier(identifier);
      stylesInDOM[index].references--;
    }

    var newLastIdentifiers = modulesToDom(newList, options);

    for (var _i = 0; _i < lastIdentifiers.length; _i++) {
      var _identifier = lastIdentifiers[_i];

      var _index = getIndexByIdentifier(_identifier);

      if (stylesInDOM[_index].references === 0) {
        stylesInDOM[_index].updater();

        stylesInDOM.splice(_index, 1);
      }
    }

    lastIdentifiers = newLastIdentifiers;
  };
};

/***/ }),

/***/ "./node_modules/style-loader/dist/runtime/insertBySelector.js":
/***/ ((module) => {

"use strict";


var memo = {};
/* istanbul ignore next  */

function getTarget(target) {
  if (typeof memo[target] === "undefined") {
    var styleTarget = document.querySelector(target); // Special case to return head of iframe instead of iframe itself

    if (window.HTMLIFrameElement && styleTarget instanceof window.HTMLIFrameElement) {
      try {
        // This will throw an exception if access to iframe is blocked
        // due to cross-origin restrictions
        styleTarget = styleTarget.contentDocument.head;
      } catch (e) {
        // istanbul ignore next
        styleTarget = null;
      }
    }

    memo[target] = styleTarget;
  }

  return memo[target];
}
/* istanbul ignore next  */


function insertBySelector(insert, style) {
  var target = getTarget(insert);

  if (!target) {
    throw new Error("Couldn't find a style target. This probably means that the value for the 'insert' parameter is invalid.");
  }

  target.appendChild(style);
}

module.exports = insertBySelector;

/***/ }),

/***/ "./node_modules/style-loader/dist/runtime/insertStyleElement.js":
/***/ ((module) => {

"use strict";


/* istanbul ignore next  */
function insertStyleElement(options) {
  var element = document.createElement("style");
  options.setAttributes(element, options.attributes);
  options.insert(element, options.options);
  return element;
}

module.exports = insertStyleElement;

/***/ }),

/***/ "./node_modules/style-loader/dist/runtime/setAttributesWithoutAttributes.js":
/***/ ((module, __unused_webpack_exports, __webpack_require__) => {

"use strict";


/* istanbul ignore next  */
function setAttributesWithoutAttributes(styleElement) {
  var nonce =  true ? __webpack_require__.nc : 0;

  if (nonce) {
    styleElement.setAttribute("nonce", nonce);
  }
}

module.exports = setAttributesWithoutAttributes;

/***/ }),

/***/ "./node_modules/style-loader/dist/runtime/styleDomAPI.js":
/***/ ((module) => {

"use strict";


/* istanbul ignore next  */
function apply(styleElement, options, obj) {
  var css = "";

  if (obj.supports) {
    css += "@supports (".concat(obj.supports, ") {");
  }

  if (obj.media) {
    css += "@media ".concat(obj.media, " {");
  }

  var needLayer = typeof obj.layer !== "undefined";

  if (needLayer) {
    css += "@layer".concat(obj.layer.length > 0 ? " ".concat(obj.layer) : "", " {");
  }

  css += obj.css;

  if (needLayer) {
    css += "}";
  }

  if (obj.media) {
    css += "}";
  }

  if (obj.supports) {
    css += "}";
  }

  var sourceMap = obj.sourceMap;

  if (sourceMap && typeof btoa !== "undefined") {
    css += "\n/*# sourceMappingURL=data:application/json;base64,".concat(btoa(unescape(encodeURIComponent(JSON.stringify(sourceMap)))), " */");
  } // For old IE

  /* istanbul ignore if  */


  options.styleTagTransform(css, styleElement, options.options);
}

function removeStyleElement(styleElement) {
  // istanbul ignore if
  if (styleElement.parentNode === null) {
    return false;
  }

  styleElement.parentNode.removeChild(styleElement);
}
/* istanbul ignore next  */


function domAPI(options) {
  var styleElement = options.insertStyleElement(options);
  return {
    update: function update(obj) {
      apply(styleElement, options, obj);
    },
    remove: function remove() {
      removeStyleElement(styleElement);
    }
  };
}

module.exports = domAPI;

/***/ }),

/***/ "./node_modules/style-loader/dist/runtime/styleTagTransform.js":
/***/ ((module) => {

"use strict";


/* istanbul ignore next  */
function styleTagTransform(css, styleElement) {
  if (styleElement.styleSheet) {
    styleElement.styleSheet.cssText = css;
  } else {
    while (styleElement.firstChild) {
      styleElement.removeChild(styleElement.firstChild);
    }

    styleElement.appendChild(document.createTextNode(css));
  }
}

module.exports = styleTagTransform;

/***/ }),

/***/ "./package.json":
/***/ ((module) => {

"use strict";
module.exports = JSON.parse('{"name":"no-flash-upload","version":"1.9.10","description":"北京交通大学课程平台功能增强脚本,实现信息聚合,附件上传,让你高效处理课程信息。","main":"userscript.js","scripts":{"dev":"webpack --mode development --config config/webpack.config.dev.js","build":"webpack --mode production --config config/webpack.config.prod.js"},"repository":{"type":"git","url":"https://github.com/ZiuChen/NO-FLASH-Upload"},"author":"ZiuChen","license":"MIT","bugs":{"url":"https://github.com/ZiuChen/NO-FLASH-Upload/issues"},"homepage":"https://github.com/ZiuChen/NO-FLASH-Upload#readme","devDependencies":{"@babel/core":"^7.16.7","babel-loader":"^8.2.3","css-loader":"^6.5.1","style-loader":"^3.3.1","terser-webpack-plugin":"^5.3.1","ts-loader":"^9.2.6","typescript":"^4.5.5","unplugin-auto-import":"^0.5.11","unplugin-vue-components":"^0.17.14","userscript-metadata-webpack-plugin":"^0.1.1","vue":"^3.2.28","vue-loader":"^17.0.0","vue-loader-plugin":"^1.3.0","vue-template-compiler":"^2.6.14","webpack":"^5.65.0","webpack-cli":"^4.9.1","webpack-livereload-plugin":"^3.0.2","webpack-merge":"^5.8.0"},"dependencies":{"element-plus":"^2.0.0","vue-router":"^4.0.12"}}');

/***/ })

/******/ 	});
/************************************************************************/
/******/ 	// The module cache
/******/ 	var __webpack_module_cache__ = {};
/******/ 	
/******/ 	// The require function
/******/ 	function __webpack_require__(moduleId) {
/******/ 		// Check if module is in cache
/******/ 		var cachedModule = __webpack_module_cache__[moduleId];
/******/ 		if (cachedModule !== undefined) {
/******/ 			return cachedModule.exports;
/******/ 		}
/******/ 		// Create a new module (and put it into the cache)
/******/ 		var module = __webpack_module_cache__[moduleId] = {
/******/ 			id: moduleId,
/******/ 			loaded: false,
/******/ 			exports: {}
/******/ 		};
/******/ 	
/******/ 		// Execute the module function
/******/ 		__webpack_modules__[moduleId].call(module.exports, module, module.exports, __webpack_require__);
/******/ 	
/******/ 		// Flag the module as loaded
/******/ 		module.loaded = true;
/******/ 	
/******/ 		// Return the exports of the module
/******/ 		return module.exports;
/******/ 	}
/******/ 	
/************************************************************************/
/******/ 	/* webpack/runtime/compat get default export */
/******/ 	(() => {
/******/ 		// getDefaultExport function for compatibility with non-harmony modules
/******/ 		__webpack_require__.n = (module) => {
/******/ 			var getter = module && module.__esModule ?
/******/ 				() => (module['default']) :
/******/ 				() => (module);
/******/ 			__webpack_require__.d(getter, { a: getter });
/******/ 			return getter;
/******/ 		};
/******/ 	})();
/******/ 	
/******/ 	/* webpack/runtime/define property getters */
/******/ 	(() => {
/******/ 		// define getter functions for harmony exports
/******/ 		__webpack_require__.d = (exports, definition) => {
/******/ 			for(var key in definition) {
/******/ 				if(__webpack_require__.o(definition, key) && !__webpack_require__.o(exports, key)) {
/******/ 					Object.defineProperty(exports, key, { enumerable: true, get: definition[key] });
/******/ 				}
/******/ 			}
/******/ 		};
/******/ 	})();
/******/ 	
/******/ 	/* webpack/runtime/global */
/******/ 	(() => {
/******/ 		__webpack_require__.g = (function() {
/******/ 			if (typeof globalThis === 'object') return globalThis;
/******/ 			try {
/******/ 				return this || new Function('return this')();
/******/ 			} catch (e) {
/******/ 				if (typeof window === 'object') return window;
/******/ 			}
/******/ 		})();
/******/ 	})();
/******/ 	
/******/ 	/* webpack/runtime/hasOwnProperty shorthand */
/******/ 	(() => {
/******/ 		__webpack_require__.o = (obj, prop) => (Object.prototype.hasOwnProperty.call(obj, prop))
/******/ 	})();
/******/ 	
/******/ 	/* webpack/runtime/node module decorator */
/******/ 	(() => {
/******/ 		__webpack_require__.nmd = (module) => {
/******/ 			module.paths = [];
/******/ 			if (!module.children) module.children = [];
/******/ 			return module;
/******/ 		};
/******/ 	})();
/******/ 	
/************************************************************************/
var __webpack_exports__ = {};
// This entry need to be wrapped in an IIFE because it need to be in strict mode.
(() => {
"use strict";

;// CONCATENATED MODULE: ./node_modules/@vue/shared/dist/shared.esm-bundler.js
/**
 * Make a map and return a function for checking if a key
 * is in that map.
 * IMPORTANT: all calls of this function must be prefixed with
 * \/\*#\_\_PURE\_\_\*\/
 * So that rollup can tree-shake them if necessary.
 */
function shared_esm_bundler_makeMap(str, expectsLowerCase) {
  const map = Object.create(null);
  const list = str.split(',');

  for (let i = 0; i < list.length; i++) {
    map[list[i]] = true;
  }

  return expectsLowerCase ? val => !!map[val.toLowerCase()] : val => !!map[val];
}
/**
 * dev only flag -> name mapping
 */


const PatchFlagNames = {
  [1
  /* TEXT */
  ]: `TEXT`,
  [2
  /* CLASS */
  ]: `CLASS`,
  [4
  /* STYLE */
  ]: `STYLE`,
  [8
  /* PROPS */
  ]: `PROPS`,
  [16
  /* FULL_PROPS */
  ]: `FULL_PROPS`,
  [32
  /* HYDRATE_EVENTS */
  ]: `HYDRATE_EVENTS`,
  [64
  /* STABLE_FRAGMENT */
  ]: `STABLE_FRAGMENT`,
  [128
  /* KEYED_FRAGMENT */
  ]: `KEYED_FRAGMENT`,
  [256
  /* UNKEYED_FRAGMENT */
  ]: `UNKEYED_FRAGMENT`,
  [512
  /* NEED_PATCH */
  ]: `NEED_PATCH`,
  [1024
  /* DYNAMIC_SLOTS */
  ]: `DYNAMIC_SLOTS`,
  [2048
  /* DEV_ROOT_FRAGMENT */
  ]: `DEV_ROOT_FRAGMENT`,
  [-1
  /* HOISTED */
  ]: `HOISTED`,
  [-2
  /* BAIL */
  ]: `BAIL`
};
/**
 * Dev only
 */

const slotFlagsText = {
  [1
  /* STABLE */
  ]: 'STABLE',
  [2
  /* DYNAMIC */
  ]: 'DYNAMIC',
  [3
  /* FORWARDED */
  ]: 'FORWARDED'
};
const GLOBALS_WHITE_LISTED = 'Infinity,undefined,NaN,isFinite,isNaN,parseFloat,parseInt,decodeURI,' + 'decodeURIComponent,encodeURI,encodeURIComponent,Math,Number,Date,Array,' + 'Object,Boolean,String,RegExp,Map,Set,JSON,Intl,BigInt';
const isGloballyWhitelisted = /*#__PURE__*/shared_esm_bundler_makeMap(GLOBALS_WHITE_LISTED);
const range = 2;

function generateCodeFrame(source, start = 0, end = source.length) {
  // Split the content into individual lines but capture the newline sequence
  // that separated each line. This is important because the actual sequence is
  // needed to properly take into account the full line length for offset
  // comparison
  let lines = source.split(/(\r?\n)/); // Separate the lines and newline sequences into separate arrays for easier referencing

  const newlineSequences = lines.filter((_, idx) => idx % 2 === 1);
  lines = lines.filter((_, idx) => idx % 2 === 0);
  let count = 0;
  const res = [];

  for (let i = 0; i < lines.length; i++) {
    count += lines[i].length + (newlineSequences[i] && newlineSequences[i].length || 0);

    if (count >= start) {
      for (let j = i - range; j <= i + range || end > count; j++) {
        if (j < 0 || j >= lines.length) continue;
        const line = j + 1;
        res.push(`${line}${' '.repeat(Math.max(3 - String(line).length, 0))}|  ${lines[j]}`);
        const lineLength = lines[j].length;
        const newLineSeqLength = newlineSequences[j] && newlineSequences[j].length || 0;

        if (j === i) {
          // push underline
          const pad = start - (count - (lineLength + newLineSeqLength));
          const length = Math.max(1, end > count ? lineLength - pad : end - start);
          res.push(`   |  ` + ' '.repeat(pad) + '^'.repeat(length));
        } else if (j > i) {
          if (end > count) {
            const length = Math.max(Math.min(end - count, lineLength), 1);
            res.push(`   |  ` + '^'.repeat(length));
          }

          count += lineLength + newLineSeqLength;
        }
      }

      break;
    }
  }

  return res.join('\n');
}
/**
 * On the client we only need to offer special cases for boolean attributes that
 * have different names from their corresponding dom properties:
 * - itemscope -> N/A
 * - allowfullscreen -> allowFullscreen
 * - formnovalidate -> formNoValidate
 * - ismap -> isMap
 * - nomodule -> noModule
 * - novalidate -> noValidate
 * - readonly -> readOnly
 */


const specialBooleanAttrs = `itemscope,allowfullscreen,formnovalidate,ismap,nomodule,novalidate,readonly`;
const isSpecialBooleanAttr = /*#__PURE__*/shared_esm_bundler_makeMap(specialBooleanAttrs);
/**
 * The full list is needed during SSR to produce the correct initial markup.
 */

const isBooleanAttr = /*#__PURE__*/shared_esm_bundler_makeMap(specialBooleanAttrs + `,async,autofocus,autoplay,controls,default,defer,disabled,hidden,` + `loop,open,required,reversed,scoped,seamless,` + `checked,muted,multiple,selected`);
/**
 * Boolean attributes should be included if the value is truthy or ''.
 * e.g. `<select multiple>` compiles to `{ multiple: '' }`
 */

function includeBooleanAttr(value) {
  return !!value || value === '';
}

const unsafeAttrCharRE = /[>/="'\u0009\u000a\u000c\u0020]/;
const attrValidationCache = {};

function isSSRSafeAttrName(name) {
  if (attrValidationCache.hasOwnProperty(name)) {
    return attrValidationCache[name];
  }

  const isUnsafe = unsafeAttrCharRE.test(name);

  if (isUnsafe) {
    console.error(`unsafe attribute name: ${name}`);
  }

  return attrValidationCache[name] = !isUnsafe;
}

const propsToAttrMap = {
  acceptCharset: 'accept-charset',
  className: 'class',
  htmlFor: 'for',
  httpEquiv: 'http-equiv'
};
/**
 * CSS properties that accept plain numbers
 */

const isNoUnitNumericStyleProp = /*#__PURE__*/(/* unused pure expression or super */ null && (shared_esm_bundler_makeMap(`animation-iteration-count,border-image-outset,border-image-slice,` + `border-image-width,box-flex,box-flex-group,box-ordinal-group,column-count,` + `columns,flex,flex-grow,flex-positive,flex-shrink,flex-negative,flex-order,` + `grid-row,grid-row-end,grid-row-span,grid-row-start,grid-column,` + `grid-column-end,grid-column-span,grid-column-start,font-weight,line-clamp,` + `line-height,opacity,order,orphans,tab-size,widows,z-index,zoom,` + // SVG
`fill-opacity,flood-opacity,stop-opacity,stroke-dasharray,stroke-dashoffset,` + `stroke-miterlimit,stroke-opacity,stroke-width`)));
/**
 * Known attributes, this is used for stringification of runtime static nodes
 * so that we don't stringify bindings that cannot be set from HTML.
 * Don't also forget to allow `data-*` and `aria-*`!
 * Generated from https://developer.mozilla.org/en-US/docs/Web/HTML/Attributes
 */

const isKnownHtmlAttr = /*#__PURE__*/(/* unused pure expression or super */ null && (shared_esm_bundler_makeMap(`accept,accept-charset,accesskey,action,align,allow,alt,async,` + `autocapitalize,autocomplete,autofocus,autoplay,background,bgcolor,` + `border,buffered,capture,challenge,charset,checked,cite,class,code,` + `codebase,color,cols,colspan,content,contenteditable,contextmenu,controls,` + `coords,crossorigin,csp,data,datetime,decoding,default,defer,dir,dirname,` + `disabled,download,draggable,dropzone,enctype,enterkeyhint,for,form,` + `formaction,formenctype,formmethod,formnovalidate,formtarget,headers,` + `height,hidden,high,href,hreflang,http-equiv,icon,id,importance,integrity,` + `ismap,itemprop,keytype,kind,label,lang,language,loading,list,loop,low,` + `manifest,max,maxlength,minlength,media,min,multiple,muted,name,novalidate,` + `open,optimum,pattern,ping,placeholder,poster,preload,radiogroup,readonly,` + `referrerpolicy,rel,required,reversed,rows,rowspan,sandbox,scope,scoped,` + `selected,shape,size,sizes,slot,span,spellcheck,src,srcdoc,srclang,srcset,` + `start,step,style,summary,tabindex,target,title,translate,type,usemap,` + `value,width,wrap`)));
/**
 * Generated from https://developer.mozilla.org/en-US/docs/Web/SVG/Attribute
 */

const isKnownSvgAttr = /*#__PURE__*/(/* unused pure expression or super */ null && (shared_esm_bundler_makeMap(`xmlns,accent-height,accumulate,additive,alignment-baseline,alphabetic,amplitude,` + `arabic-form,ascent,attributeName,attributeType,azimuth,baseFrequency,` + `baseline-shift,baseProfile,bbox,begin,bias,by,calcMode,cap-height,class,` + `clip,clipPathUnits,clip-path,clip-rule,color,color-interpolation,` + `color-interpolation-filters,color-profile,color-rendering,` + `contentScriptType,contentStyleType,crossorigin,cursor,cx,cy,d,decelerate,` + `descent,diffuseConstant,direction,display,divisor,dominant-baseline,dur,dx,` + `dy,edgeMode,elevation,enable-background,end,exponent,fill,fill-opacity,` + `fill-rule,filter,filterRes,filterUnits,flood-color,flood-opacity,` + `font-family,font-size,font-size-adjust,font-stretch,font-style,` + `font-variant,font-weight,format,from,fr,fx,fy,g1,g2,glyph-name,` + `glyph-orientation-horizontal,glyph-orientation-vertical,glyphRef,` + `gradientTransform,gradientUnits,hanging,height,href,hreflang,horiz-adv-x,` + `horiz-origin-x,id,ideographic,image-rendering,in,in2,intercept,k,k1,k2,k3,` + `k4,kernelMatrix,kernelUnitLength,kerning,keyPoints,keySplines,keyTimes,` + `lang,lengthAdjust,letter-spacing,lighting-color,limitingConeAngle,local,` + `marker-end,marker-mid,marker-start,markerHeight,markerUnits,markerWidth,` + `mask,maskContentUnits,maskUnits,mathematical,max,media,method,min,mode,` + `name,numOctaves,offset,opacity,operator,order,orient,orientation,origin,` + `overflow,overline-position,overline-thickness,panose-1,paint-order,path,` + `pathLength,patternContentUnits,patternTransform,patternUnits,ping,` + `pointer-events,points,pointsAtX,pointsAtY,pointsAtZ,preserveAlpha,` + `preserveAspectRatio,primitiveUnits,r,radius,referrerPolicy,refX,refY,rel,` + `rendering-intent,repeatCount,repeatDur,requiredExtensions,requiredFeatures,` + `restart,result,rotate,rx,ry,scale,seed,shape-rendering,slope,spacing,` + `specularConstant,specularExponent,speed,spreadMethod,startOffset,` + `stdDeviation,stemh,stemv,stitchTiles,stop-color,stop-opacity,` + `strikethrough-position,strikethrough-thickness,string,stroke,` + `stroke-dasharray,stroke-dashoffset,stroke-linecap,stroke-linejoin,` + `stroke-miterlimit,stroke-opacity,stroke-width,style,surfaceScale,` + `systemLanguage,tabindex,tableValues,target,targetX,targetY,text-anchor,` + `text-decoration,text-rendering,textLength,to,transform,transform-origin,` + `type,u1,u2,underline-position,underline-thickness,unicode,unicode-bidi,` + `unicode-range,units-per-em,v-alphabetic,v-hanging,v-ideographic,` + `v-mathematical,values,vector-effect,version,vert-adv-y,vert-origin-x,` + `vert-origin-y,viewBox,viewTarget,visibility,width,widths,word-spacing,` + `writing-mode,x,x-height,x1,x2,xChannelSelector,xlink:actuate,xlink:arcrole,` + `xlink:href,xlink:role,xlink:show,xlink:title,xlink:type,xml:base,xml:lang,` + `xml:space,y,y1,y2,yChannelSelector,z,zoomAndPan`)));

function normalizeStyle(value) {
  if (shared_esm_bundler_isArray(value)) {
    const res = {};

    for (let i = 0; i < value.length; i++) {
      const item = value[i];
      const normalized = shared_esm_bundler_isString(item) ? parseStringStyle(item) : normalizeStyle(item);

      if (normalized) {
        for (const key in normalized) {
          res[key] = normalized[key];
        }
      }
    }

    return res;
  } else if (shared_esm_bundler_isString(value)) {
    return value;
  } else if (shared_esm_bundler_isObject(value)) {
    return value;
  }
}

const listDelimiterRE = /;(?![^(]*\))/g;
const propertyDelimiterRE = /:(.+)/;

function parseStringStyle(cssText) {
  const ret = {};
  cssText.split(listDelimiterRE).forEach(item => {
    if (item) {
      const tmp = item.split(propertyDelimiterRE);
      tmp.length > 1 && (ret[tmp[0].trim()] = tmp[1].trim());
    }
  });
  return ret;
}

function stringifyStyle(styles) {
  let ret = '';

  if (!styles || shared_esm_bundler_isString(styles)) {
    return ret;
  }

  for (const key in styles) {
    const value = styles[key];
    const normalizedKey = key.startsWith(`--`) ? key : shared_esm_bundler_hyphenate(key);

    if (shared_esm_bundler_isString(value) || typeof value === 'number' && isNoUnitNumericStyleProp(normalizedKey)) {
      // only render valid values
      ret += `${normalizedKey}:${value};`;
    }
  }

  return ret;
}

function normalizeClass(value) {
  let res = '';

  if (shared_esm_bundler_isString(value)) {
    res = value;
  } else if (shared_esm_bundler_isArray(value)) {
    for (let i = 0; i < value.length; i++) {
      const normalized = normalizeClass(value[i]);

      if (normalized) {
        res += normalized + ' ';
      }
    }
  } else if (shared_esm_bundler_isObject(value)) {
    for (const name in value) {
      if (value[name]) {
        res += name + ' ';
      }
    }
  }

  return res.trim();
}

function normalizeProps(props) {
  if (!props) return null;
  let {
    class: klass,
    style
  } = props;

  if (klass && !shared_esm_bundler_isString(klass)) {
    props.class = normalizeClass(klass);
  }

  if (style) {
    props.style = normalizeStyle(style);
  }

  return props;
} // These tag configs are shared between compiler-dom and runtime-dom, so they
// https://developer.mozilla.org/en-US/docs/Web/HTML/Element


const HTML_TAGS = (/* unused pure expression or super */ null && ('html,body,base,head,link,meta,style,title,address,article,aside,footer,' + 'header,h1,h2,h3,h4,h5,h6,nav,section,div,dd,dl,dt,figcaption,' + 'figure,picture,hr,img,li,main,ol,p,pre,ul,a,b,abbr,bdi,bdo,br,cite,code,' + 'data,dfn,em,i,kbd,mark,q,rp,rt,ruby,s,samp,small,span,strong,sub,sup,' + 'time,u,var,wbr,area,audio,map,track,video,embed,object,param,source,' + 'canvas,script,noscript,del,ins,caption,col,colgroup,table,thead,tbody,td,' + 'th,tr,button,datalist,fieldset,form,input,label,legend,meter,optgroup,' + 'option,output,progress,select,textarea,details,dialog,menu,' + 'summary,template,blockquote,iframe,tfoot')); // https://developer.mozilla.org/en-US/docs/Web/SVG/Element

const SVG_TAGS = (/* unused pure expression or super */ null && ('svg,animate,animateMotion,animateTransform,circle,clipPath,color-profile,' + 'defs,desc,discard,ellipse,feBlend,feColorMatrix,feComponentTransfer,' + 'feComposite,feConvolveMatrix,feDiffuseLighting,feDisplacementMap,' + 'feDistanceLight,feDropShadow,feFlood,feFuncA,feFuncB,feFuncG,feFuncR,' + 'feGaussianBlur,feImage,feMerge,feMergeNode,feMorphology,feOffset,' + 'fePointLight,feSpecularLighting,feSpotLight,feTile,feTurbulence,filter,' + 'foreignObject,g,hatch,hatchpath,image,line,linearGradient,marker,mask,' + 'mesh,meshgradient,meshpatch,meshrow,metadata,mpath,path,pattern,' + 'polygon,polyline,radialGradient,rect,set,solidcolor,stop,switch,symbol,' + 'text,textPath,title,tspan,unknown,use,view'));
const VOID_TAGS = 'area,base,br,col,embed,hr,img,input,link,meta,param,source,track,wbr';
/**
 * Compiler only.
 * Do NOT use in runtime code paths unless behind `(process.env.NODE_ENV !== 'production')` flag.
 */

const shared_esm_bundler_isHTMLTag = /*#__PURE__*/(/* unused pure expression or super */ null && (shared_esm_bundler_makeMap(HTML_TAGS)));
/**
 * Compiler only.
 * Do NOT use in runtime code paths unless behind `(process.env.NODE_ENV !== 'production')` flag.
 */

const shared_esm_bundler_isSVGTag = /*#__PURE__*/(/* unused pure expression or super */ null && (shared_esm_bundler_makeMap(SVG_TAGS)));
/**
 * Compiler only.
 * Do NOT use in runtime code paths unless behind `(process.env.NODE_ENV !== 'production')` flag.
 */

const isVoidTag = /*#__PURE__*/(/* unused pure expression or super */ null && (shared_esm_bundler_makeMap(VOID_TAGS)));
const escapeRE = /["'&<>]/;

function escapeHtml(string) {
  const str = '' + string;
  const match = escapeRE.exec(str);

  if (!match) {
    return str;
  }

  let html = '';
  let escaped;
  let index;
  let lastIndex = 0;

  for (index = match.index; index < str.length; index++) {
    switch (str.charCodeAt(index)) {
      case 34:
        // "
        escaped = '&quot;';
        break;

      case 38:
        // &
        escaped = '&amp;';
        break;

      case 39:
        // '
        escaped = '&#39;';
        break;

      case 60:
        // <
        escaped = '&lt;';
        break;

      case 62:
        // >
        escaped = '&gt;';
        break;

      default:
        continue;
    }

    if (lastIndex !== index) {
      html += str.slice(lastIndex, index);
    }

    lastIndex = index + 1;
    html += escaped;
  }

  return lastIndex !== index ? html + str.slice(lastIndex, index) : html;
} // https://www.w3.org/TR/html52/syntax.html#comments


const commentStripRE = /^-?>|<!--|-->|--!>|<!-$/g;

function escapeHtmlComment(src) {
  return src.replace(commentStripRE, '');
}

function looseCompareArrays(a, b) {
  if (a.length !== b.length) return false;
  let equal = true;

  for (let i = 0; equal && i < a.length; i++) {
    equal = shared_esm_bundler_looseEqual(a[i], b[i]);
  }

  return equal;
}

function shared_esm_bundler_looseEqual(a, b) {
  if (a === b) return true;
  let aValidType = isDate(a);
  let bValidType = isDate(b);

  if (aValidType || bValidType) {
    return aValidType && bValidType ? a.getTime() === b.getTime() : false;
  }

  aValidType = shared_esm_bundler_isArray(a);
  bValidType = shared_esm_bundler_isArray(b);

  if (aValidType || bValidType) {
    return aValidType && bValidType ? looseCompareArrays(a, b) : false;
  }

  aValidType = shared_esm_bundler_isObject(a);
  bValidType = shared_esm_bundler_isObject(b);

  if (aValidType || bValidType) {
    /* istanbul ignore if: this if will probably never be called */
    if (!aValidType || !bValidType) {
      return false;
    }

    const aKeysCount = Object.keys(a).length;
    const bKeysCount = Object.keys(b).length;

    if (aKeysCount !== bKeysCount) {
      return false;
    }

    for (const key in a) {
      const aHasKey = a.hasOwnProperty(key);
      const bHasKey = b.hasOwnProperty(key);

      if (aHasKey && !bHasKey || !aHasKey && bHasKey || !shared_esm_bundler_looseEqual(a[key], b[key])) {
        return false;
      }
    }
  }

  return String(a) === String(b);
}

function shared_esm_bundler_looseIndexOf(arr, val) {
  return arr.findIndex(item => shared_esm_bundler_looseEqual(item, val));
}
/**
 * For converting {{ interpolation }} values to displayed strings.
 * @private
 */


const toDisplayString = val => {
  return val == null ? '' : shared_esm_bundler_isArray(val) || shared_esm_bundler_isObject(val) && (val.toString === objectToString || !shared_esm_bundler_isFunction(val.toString)) ? JSON.stringify(val, replacer, 2) : String(val);
};

const replacer = (_key, val) => {
  // can't use isRef here since @vue/shared has no deps
  if (val && val.__v_isRef) {
    return replacer(_key, val.value);
  } else if (isMap(val)) {
    return {
      [`Map(${val.size})`]: [...val.entries()].reduce((entries, [key, val]) => {
        entries[`${key} =>`] = val;
        return entries;
      }, {})
    };
  } else if (shared_esm_bundler_isSet(val)) {
    return {
      [`Set(${val.size})`]: [...val.values()]
    };
  } else if (shared_esm_bundler_isObject(val) && !shared_esm_bundler_isArray(val) && !isPlainObject(val)) {
    return String(val);
  }

  return val;
};

const shared_esm_bundler_EMPTY_OBJ =  false ? 0 : {};
const EMPTY_ARR =  false ? 0 : [];

const shared_esm_bundler_NOOP = () => {};
/**
 * Always return false.
 */


const shared_esm_bundler_NO = () => false;

const onRE = /^on[^a-z]/;

const shared_esm_bundler_isOn = key => onRE.test(key);

const isModelListener = key => key.startsWith('onUpdate:');

const shared_esm_bundler_extend = Object.assign;

const remove = (arr, el) => {
  const i = arr.indexOf(el);

  if (i > -1) {
    arr.splice(i, 1);
  }
};

const shared_esm_bundler_hasOwnProperty = Object.prototype.hasOwnProperty;

const shared_esm_bundler_hasOwn = (val, key) => shared_esm_bundler_hasOwnProperty.call(val, key);

const shared_esm_bundler_isArray = Array.isArray;

const isMap = val => toTypeString(val) === '[object Map]';

const shared_esm_bundler_isSet = val => toTypeString(val) === '[object Set]';

const isDate = val => val instanceof Date;

const shared_esm_bundler_isFunction = val => typeof val === 'function';

const shared_esm_bundler_isString = val => typeof val === 'string';

const isSymbol = val => typeof val === 'symbol';

const shared_esm_bundler_isObject = val => val !== null && typeof val === 'object';

const shared_esm_bundler_isPromise = val => {
  return shared_esm_bundler_isObject(val) && shared_esm_bundler_isFunction(val.then) && shared_esm_bundler_isFunction(val.catch);
};

const objectToString = Object.prototype.toString;

const toTypeString = value => objectToString.call(value);

const shared_esm_bundler_toRawType = value => {
  // extract "RawType" from strings like "[object RawType]"
  return toTypeString(value).slice(8, -1);
};

const isPlainObject = val => toTypeString(val) === '[object Object]';

const isIntegerKey = key => shared_esm_bundler_isString(key) && key !== 'NaN' && key[0] !== '-' && '' + parseInt(key, 10) === key;

const shared_esm_bundler_isReservedProp = /*#__PURE__*/shared_esm_bundler_makeMap( // the leading comma is intentional so empty string "" is also included
',key,ref,ref_for,ref_key,' + 'onVnodeBeforeMount,onVnodeMounted,' + 'onVnodeBeforeUpdate,onVnodeUpdated,' + 'onVnodeBeforeUnmount,onVnodeUnmounted');

const cacheStringFunction = fn => {
  const cache = Object.create(null);
  return str => {
    const hit = cache[str];
    return hit || (cache[str] = fn(str));
  };
};

const camelizeRE = /-(\w)/g;
/**
 * @private
 */

const shared_esm_bundler_camelize = cacheStringFunction(str => {
  return str.replace(camelizeRE, (_, c) => c ? c.toUpperCase() : '');
});
const hyphenateRE = /\B([A-Z])/g;
/**
 * @private
 */

const shared_esm_bundler_hyphenate = cacheStringFunction(str => str.replace(hyphenateRE, '-$1').toLowerCase());
/**
 * @private
 */

const shared_esm_bundler_capitalize = cacheStringFunction(str => str.charAt(0).toUpperCase() + str.slice(1));
/**
 * @private
 */

const toHandlerKey = cacheStringFunction(str => str ? `on${shared_esm_bundler_capitalize(str)}` : ``); // compare whether a value has changed, accounting for NaN.

const hasChanged = (value, oldValue) => !Object.is(value, oldValue);

const invokeArrayFns = (fns, arg) => {
  for (let i = 0; i < fns.length; i++) {
    fns[i](arg);
  }
};

const def = (obj, key, value) => {
  Object.defineProperty(obj, key, {
    configurable: true,
    enumerable: false,
    value
  });
};

const shared_esm_bundler_toNumber = val => {
  const n = parseFloat(val);
  return isNaN(n) ? val : n;
};

let _globalThis;

const getGlobalThis = () => {
  return _globalThis || (_globalThis = typeof globalThis !== 'undefined' ? globalThis : typeof self !== 'undefined' ? self : typeof window !== 'undefined' ? window : typeof __webpack_require__.g !== 'undefined' ? __webpack_require__.g : {});
};


;// CONCATENATED MODULE: ./node_modules/@vue/reactivity/dist/reactivity.esm-bundler.js


function reactivity_esm_bundler_warn(msg, ...args) {
  console.warn(`[Vue warn] ${msg}`, ...args);
}

let activeEffectScope;
const effectScopeStack = [];

class EffectScope {
  constructor(detached = false) {
    this.active = true;
    this.effects = [];
    this.cleanups = [];

    if (!detached && activeEffectScope) {
      this.parent = activeEffectScope;
      this.index = (activeEffectScope.scopes || (activeEffectScope.scopes = [])).push(this) - 1;
    }
  }

  run(fn) {
    if (this.active) {
      try {
        this.on();
        return fn();
      } finally {
        this.off();
      }
    } else if (false) {}
  }

  on() {
    if (this.active) {
      effectScopeStack.push(this);
      activeEffectScope = this;
    }
  }

  off() {
    if (this.active) {
      effectScopeStack.pop();
      activeEffectScope = effectScopeStack[effectScopeStack.length - 1];
    }
  }

  stop(fromParent) {
    if (this.active) {
      this.effects.forEach(e => e.stop());
      this.cleanups.forEach(cleanup => cleanup());

      if (this.scopes) {
        this.scopes.forEach(e => e.stop(true));
      } // nested scope, dereference from parent to avoid memory leaks


      if (this.parent && !fromParent) {
        // optimized O(1) removal
        const last = this.parent.scopes.pop();

        if (last && last !== this) {
          this.parent.scopes[this.index] = last;
          last.index = this.index;
        }
      }

      this.active = false;
    }
  }

}

function reactivity_esm_bundler_effectScope(detached) {
  return new EffectScope(detached);
}

function recordEffectScope(effect, scope) {
  scope = scope || activeEffectScope;

  if (scope && scope.active) {
    scope.effects.push(effect);
  }
}

function reactivity_esm_bundler_getCurrentScope() {
  return activeEffectScope;
}

function onScopeDispose(fn) {
  if (activeEffectScope) {
    activeEffectScope.cleanups.push(fn);
  } else if (false) {}
}

const createDep = effects => {
  const dep = new Set(effects);
  dep.w = 0;
  dep.n = 0;
  return dep;
};

const wasTracked = dep => (dep.w & trackOpBit) > 0;

const newTracked = dep => (dep.n & trackOpBit) > 0;

const initDepMarkers = ({
  deps
}) => {
  if (deps.length) {
    for (let i = 0; i < deps.length; i++) {
      deps[i].w |= trackOpBit; // set was tracked
    }
  }
};

const finalizeDepMarkers = effect => {
  const {
    deps
  } = effect;

  if (deps.length) {
    let ptr = 0;

    for (let i = 0; i < deps.length; i++) {
      const dep = deps[i];

      if (wasTracked(dep) && !newTracked(dep)) {
        dep.delete(effect);
      } else {
        deps[ptr++] = dep;
      } // clear bits


      dep.w &= ~trackOpBit;
      dep.n &= ~trackOpBit;
    }

    deps.length = ptr;
  }
};

const targetMap = new WeakMap(); // The number of effects currently being tracked recursively.

let effectTrackDepth = 0;
let trackOpBit = 1;
/**
 * The bitwise track markers support at most 30 levels of recursion.
 * This value is chosen to enable modern JS engines to use a SMI on all platforms.
 * When recursion depth is greater, fall back to using a full cleanup.
 */

const maxMarkerBits = 30;
const effectStack = [];
let activeEffect;
const ITERATE_KEY = Symbol( false ? 0 : '');
const MAP_KEY_ITERATE_KEY = Symbol( false ? 0 : '');

class ReactiveEffect {
  constructor(fn, scheduler = null, scope) {
    this.fn = fn;
    this.scheduler = scheduler;
    this.active = true;
    this.deps = [];
    recordEffectScope(this, scope);
  }

  run() {
    if (!this.active) {
      return this.fn();
    }

    if (!effectStack.length || !effectStack.includes(this)) {
      try {
        effectStack.push(activeEffect = this);
        enableTracking();
        trackOpBit = 1 << ++effectTrackDepth;

        if (effectTrackDepth <= maxMarkerBits) {
          initDepMarkers(this);
        } else {
          cleanupEffect(this);
        }

        return this.fn();
      } finally {
        if (effectTrackDepth <= maxMarkerBits) {
          finalizeDepMarkers(this);
        }

        trackOpBit = 1 << --effectTrackDepth;
        resetTracking();
        effectStack.pop();
        const n = effectStack.length;
        activeEffect = n > 0 ? effectStack[n - 1] : undefined;
      }
    }
  }

  stop() {
    if (this.active) {
      cleanupEffect(this);

      if (this.onStop) {
        this.onStop();
      }

      this.active = false;
    }
  }

}

function cleanupEffect(effect) {
  const {
    deps
  } = effect;

  if (deps.length) {
    for (let i = 0; i < deps.length; i++) {
      deps[i].delete(effect);
    }

    deps.length = 0;
  }
}

function effect(fn, options) {
  if (fn.effect) {
    fn = fn.effect.fn;
  }

  const _effect = new ReactiveEffect(fn);

  if (options) {
    extend(_effect, options);
    if (options.scope) recordEffectScope(_effect, options.scope);
  }

  if (!options || !options.lazy) {
    _effect.run();
  }

  const runner = _effect.run.bind(_effect);

  runner.effect = _effect;
  return runner;
}

function stop(runner) {
  runner.effect.stop();
}

let shouldTrack = true;
const trackStack = [];

function pauseTracking() {
  trackStack.push(shouldTrack);
  shouldTrack = false;
}

function enableTracking() {
  trackStack.push(shouldTrack);
  shouldTrack = true;
}

function resetTracking() {
  const last = trackStack.pop();
  shouldTrack = last === undefined ? true : last;
}

function track(target, type, key) {
  if (!isTracking()) {
    return;
  }

  let depsMap = targetMap.get(target);

  if (!depsMap) {
    targetMap.set(target, depsMap = new Map());
  }

  let dep = depsMap.get(key);

  if (!dep) {
    depsMap.set(key, dep = createDep());
  }

  const eventInfo =  false ? 0 : undefined;
  trackEffects(dep, eventInfo);
}

function isTracking() {
  return shouldTrack && activeEffect !== undefined;
}

function trackEffects(dep, debuggerEventExtraInfo) {
  let shouldTrack = false;

  if (effectTrackDepth <= maxMarkerBits) {
    if (!newTracked(dep)) {
      dep.n |= trackOpBit; // set newly tracked

      shouldTrack = !wasTracked(dep);
    }
  } else {
    // Full cleanup mode.
    shouldTrack = !dep.has(activeEffect);
  }

  if (shouldTrack) {
    dep.add(activeEffect);
    activeEffect.deps.push(dep);

    if (false) {}
  }
}

function trigger(target, type, key, newValue, oldValue, oldTarget) {
  const depsMap = targetMap.get(target);

  if (!depsMap) {
    // never been tracked
    return;
  }

  let deps = [];

  if (type === "clear"
  /* CLEAR */
  ) {
    // collection being cleared
    // trigger all effects for target
    deps = [...depsMap.values()];
  } else if (key === 'length' && shared_esm_bundler_isArray(target)) {
    depsMap.forEach((dep, key) => {
      if (key === 'length' || key >= newValue) {
        deps.push(dep);
      }
    });
  } else {
    // schedule runs for SET | ADD | DELETE
    if (key !== void 0) {
      deps.push(depsMap.get(key));
    } // also run for iteration key on ADD | DELETE | Map.SET


    switch (type) {
      case "add"
      /* ADD */
      :
        if (!shared_esm_bundler_isArray(target)) {
          deps.push(depsMap.get(ITERATE_KEY));

          if (isMap(target)) {
            deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
          }
        } else if (isIntegerKey(key)) {
          // new index added to array -> length changes
          deps.push(depsMap.get('length'));
        }

        break;

      case "delete"
      /* DELETE */
      :
        if (!shared_esm_bundler_isArray(target)) {
          deps.push(depsMap.get(ITERATE_KEY));

          if (isMap(target)) {
            deps.push(depsMap.get(MAP_KEY_ITERATE_KEY));
          }
        }

        break;

      case "set"
      /* SET */
      :
        if (isMap(target)) {
          deps.push(depsMap.get(ITERATE_KEY));
        }

        break;
    }
  }

  const eventInfo =  false ? 0 : undefined;

  if (deps.length === 1) {
    if (deps[0]) {
      if (false) {} else {
        triggerEffects(deps[0]);
      }
    }
  } else {
    const effects = [];

    for (const dep of deps) {
      if (dep) {
        effects.push(...dep);
      }
    }

    if (false) {} else {
      triggerEffects(createDep(effects));
    }
  }
}

function triggerEffects(dep, debuggerEventExtraInfo) {
  // spread into array for stabilization
  for (const effect of shared_esm_bundler_isArray(dep) ? dep : [...dep]) {
    if (effect !== activeEffect || effect.allowRecurse) {
      if (false) {}

      if (effect.scheduler) {
        effect.scheduler();
      } else {
        effect.run();
      }
    }
  }
}

const isNonTrackableKeys = /*#__PURE__*/shared_esm_bundler_makeMap(`__proto__,__v_isRef,__isVue`);
const builtInSymbols = new Set(Object.getOwnPropertyNames(Symbol).map(key => Symbol[key]).filter(isSymbol));
const get = /*#__PURE__*/createGetter();
const shallowGet = /*#__PURE__*/createGetter(false, true);
const readonlyGet = /*#__PURE__*/createGetter(true);
const shallowReadonlyGet = /*#__PURE__*/createGetter(true, true);
const arrayInstrumentations = /*#__PURE__*/createArrayInstrumentations();

function createArrayInstrumentations() {
  const instrumentations = {};
  ['includes', 'indexOf', 'lastIndexOf'].forEach(key => {
    instrumentations[key] = function (...args) {
      const arr = reactivity_esm_bundler_toRaw(this);

      for (let i = 0, l = this.length; i < l; i++) {
        track(arr, "get"
        /* GET */
        , i + '');
      } // we run the method using the original args first (which may be reactive)


      const res = arr[key](...args);

      if (res === -1 || res === false) {
        // if that didn't work, run it again using raw values.
        return arr[key](...args.map(reactivity_esm_bundler_toRaw));
      } else {
        return res;
      }
    };
  });
  ['push', 'pop', 'shift', 'unshift', 'splice'].forEach(key => {
    instrumentations[key] = function (...args) {
      pauseTracking();
      const res = reactivity_esm_bundler_toRaw(this)[key].apply(this, args);
      resetTracking();
      return res;
    };
  });
  return instrumentations;
}

function createGetter(isReadonly = false, shallow = false) {
  return function get(target, key, receiver) {
    if (key === "__v_isReactive"
    /* IS_REACTIVE */
    ) {
      return !isReadonly;
    } else if (key === "__v_isReadonly"
    /* IS_READONLY */
    ) {
      return isReadonly;
    } else if (key === "__v_isShallow"
    /* IS_SHALLOW */
    ) {
      return shallow;
    } else if (key === "__v_raw"
    /* RAW */
    && receiver === (isReadonly ? shallow ? shallowReadonlyMap : readonlyMap : shallow ? shallowReactiveMap : reactiveMap).get(target)) {
      return target;
    }

    const targetIsArray = shared_esm_bundler_isArray(target);

    if (!isReadonly && targetIsArray && shared_esm_bundler_hasOwn(arrayInstrumentations, key)) {
      return Reflect.get(arrayInstrumentations, key, receiver);
    }

    const res = Reflect.get(target, key, receiver);

    if (isSymbol(key) ? builtInSymbols.has(key) : isNonTrackableKeys(key)) {
      return res;
    }

    if (!isReadonly) {
      track(target, "get"
      /* GET */
      , key);
    }

    if (shallow) {
      return res;
    }

    if (reactivity_esm_bundler_isRef(res)) {
      // ref unwrapping - does not apply for Array + integer key.
      const shouldUnwrap = !targetIsArray || !isIntegerKey(key);
      return shouldUnwrap ? res.value : res;
    }

    if (shared_esm_bundler_isObject(res)) {
      // Convert returned value into a proxy as well. we do the isObject check
      // here to avoid invalid value warning. Also need to lazy access readonly
      // and reactive here to avoid circular dependency.
      return isReadonly ? reactivity_esm_bundler_readonly(res) : reactivity_esm_bundler_reactive(res);
    }

    return res;
  };
}

const reactivity_esm_bundler_set = /*#__PURE__*/createSetter();
const shallowSet = /*#__PURE__*/createSetter(true);

function createSetter(shallow = false) {
  return function set(target, key, value, receiver) {
    let oldValue = target[key];

    if (reactivity_esm_bundler_isReadonly(oldValue) && reactivity_esm_bundler_isRef(oldValue)) {
      return false;
    }

    if (!shallow && !reactivity_esm_bundler_isReadonly(value)) {
      if (!isShallow(value)) {
        value = reactivity_esm_bundler_toRaw(value);
        oldValue = reactivity_esm_bundler_toRaw(oldValue);
      }

      if (!shared_esm_bundler_isArray(target) && reactivity_esm_bundler_isRef(oldValue) && !reactivity_esm_bundler_isRef(value)) {
        oldValue.value = value;
        return true;
      }
    }

    const hadKey = shared_esm_bundler_isArray(target) && isIntegerKey(key) ? Number(key) < target.length : shared_esm_bundler_hasOwn(target, key);
    const result = Reflect.set(target, key, value, receiver); // don't trigger if target is something up in the prototype chain of original

    if (target === reactivity_esm_bundler_toRaw(receiver)) {
      if (!hadKey) {
        trigger(target, "add"
        /* ADD */
        , key, value);
      } else if (hasChanged(value, oldValue)) {
        trigger(target, "set"
        /* SET */
        , key, value, oldValue);
      }
    }

    return result;
  };
}

function deleteProperty(target, key) {
  const hadKey = shared_esm_bundler_hasOwn(target, key);
  const oldValue = target[key];
  const result = Reflect.deleteProperty(target, key);

  if (result && hadKey) {
    trigger(target, "delete"
    /* DELETE */
    , key, undefined, oldValue);
  }

  return result;
}

function has(target, key) {
  const result = Reflect.has(target, key);

  if (!isSymbol(key) || !builtInSymbols.has(key)) {
    track(target, "has"
    /* HAS */
    , key);
  }

  return result;
}

function ownKeys(target) {
  track(target, "iterate"
  /* ITERATE */
  , shared_esm_bundler_isArray(target) ? 'length' : ITERATE_KEY);
  return Reflect.ownKeys(target);
}

const mutableHandlers = {
  get,
  set: reactivity_esm_bundler_set,
  deleteProperty,
  has,
  ownKeys
};
const readonlyHandlers = {
  get: readonlyGet,

  set(target, key) {
    if (false) {}

    return true;
  },

  deleteProperty(target, key) {
    if (false) {}

    return true;
  }

};
const shallowReactiveHandlers = /*#__PURE__*/shared_esm_bundler_extend({}, mutableHandlers, {
  get: shallowGet,
  set: shallowSet
}); // Props handlers are special in the sense that it should not unwrap top-level
// refs (in order to allow refs to be explicitly passed down), but should
// retain the reactivity of the normal readonly object.

const shallowReadonlyHandlers = /*#__PURE__*/shared_esm_bundler_extend({}, readonlyHandlers, {
  get: shallowReadonlyGet
});

const toShallow = value => value;

const getProto = v => Reflect.getPrototypeOf(v);

function get$1(target, key, isReadonly = false, isShallow = false) {
  // #1772: readonly(reactive(Map)) should return readonly + reactive version
  // of the value
  target = target["__v_raw"
  /* RAW */
  ];
  const rawTarget = reactivity_esm_bundler_toRaw(target);
  const rawKey = reactivity_esm_bundler_toRaw(key);

  if (key !== rawKey) {
    !isReadonly && track(rawTarget, "get"
    /* GET */
    , key);
  }

  !isReadonly && track(rawTarget, "get"
  /* GET */
  , rawKey);
  const {
    has
  } = getProto(rawTarget);
  const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;

  if (has.call(rawTarget, key)) {
    return wrap(target.get(key));
  } else if (has.call(rawTarget, rawKey)) {
    return wrap(target.get(rawKey));
  } else if (target !== rawTarget) {
    // #3602 readonly(reactive(Map))
    // ensure that the nested reactive `Map` can do tracking for itself
    target.get(key);
  }
}

function has$1(key, isReadonly = false) {
  const target = this["__v_raw"
  /* RAW */
  ];
  const rawTarget = reactivity_esm_bundler_toRaw(target);
  const rawKey = reactivity_esm_bundler_toRaw(key);

  if (key !== rawKey) {
    !isReadonly && track(rawTarget, "has"
    /* HAS */
    , key);
  }

  !isReadonly && track(rawTarget, "has"
  /* HAS */
  , rawKey);
  return key === rawKey ? target.has(key) : target.has(key) || target.has(rawKey);
}

function size(target, isReadonly = false) {
  target = target["__v_raw"
  /* RAW */
  ];
  !isReadonly && track(reactivity_esm_bundler_toRaw(target), "iterate"
  /* ITERATE */
  , ITERATE_KEY);
  return Reflect.get(target, 'size', target);
}

function add(value) {
  value = reactivity_esm_bundler_toRaw(value);
  const target = reactivity_esm_bundler_toRaw(this);
  const proto = getProto(target);
  const hadKey = proto.has.call(target, value);

  if (!hadKey) {
    target.add(value);
    trigger(target, "add"
    /* ADD */
    , value, value);
  }

  return this;
}

function reactivity_esm_bundler_set$1(key, value) {
  value = reactivity_esm_bundler_toRaw(value);
  const target = reactivity_esm_bundler_toRaw(this);
  const {
    has,
    get
  } = getProto(target);
  let hadKey = has.call(target, key);

  if (!hadKey) {
    key = reactivity_esm_bundler_toRaw(key);
    hadKey = has.call(target, key);
  } else if (false) {}

  const oldValue = get.call(target, key);
  target.set(key, value);

  if (!hadKey) {
    trigger(target, "add"
    /* ADD */
    , key, value);
  } else if (hasChanged(value, oldValue)) {
    trigger(target, "set"
    /* SET */
    , key, value, oldValue);
  }

  return this;
}

function deleteEntry(key) {
  const target = reactivity_esm_bundler_toRaw(this);
  const {
    has,
    get
  } = getProto(target);
  let hadKey = has.call(target, key);

  if (!hadKey) {
    key = reactivity_esm_bundler_toRaw(key);
    hadKey = has.call(target, key);
  } else if (false) {}

  const oldValue = get ? get.call(target, key) : undefined; // forward the operation before queueing reactions

  const result = target.delete(key);

  if (hadKey) {
    trigger(target, "delete"
    /* DELETE */
    , key, undefined, oldValue);
  }

  return result;
}

function clear() {
  const target = reactivity_esm_bundler_toRaw(this);
  const hadItems = target.size !== 0;
  const oldTarget =  false ? 0 : undefined; // forward the operation before queueing reactions

  const result = target.clear();

  if (hadItems) {
    trigger(target, "clear"
    /* CLEAR */
    , undefined, undefined, oldTarget);
  }

  return result;
}

function createForEach(isReadonly, isShallow) {
  return function forEach(callback, thisArg) {
    const observed = this;
    const target = observed["__v_raw"
    /* RAW */
    ];
    const rawTarget = reactivity_esm_bundler_toRaw(target);
    const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;
    !isReadonly && track(rawTarget, "iterate"
    /* ITERATE */
    , ITERATE_KEY);
    return target.forEach((value, key) => {
      // important: make sure the callback is
      // 1. invoked with the reactive map as `this` and 3rd arg
      // 2. the value received should be a corresponding reactive/readonly.
      return callback.call(thisArg, wrap(value), wrap(key), observed);
    });
  };
}

function createIterableMethod(method, isReadonly, isShallow) {
  return function (...args) {
    const target = this["__v_raw"
    /* RAW */
    ];
    const rawTarget = reactivity_esm_bundler_toRaw(target);
    const targetIsMap = isMap(rawTarget);
    const isPair = method === 'entries' || method === Symbol.iterator && targetIsMap;
    const isKeyOnly = method === 'keys' && targetIsMap;
    const innerIterator = target[method](...args);
    const wrap = isShallow ? toShallow : isReadonly ? toReadonly : toReactive;
    !isReadonly && track(rawTarget, "iterate"
    /* ITERATE */
    , isKeyOnly ? MAP_KEY_ITERATE_KEY : ITERATE_KEY); // return a wrapped iterator which returns observed versions of the
    // values emitted from the real iterator

    return {
      // iterator protocol
      next() {
        const {
          value,
          done
        } = innerIterator.next();
        return done ? {
          value,
          done
        } : {
          value: isPair ? [wrap(value[0]), wrap(value[1])] : wrap(value),
          done
        };
      },

      // iterable protocol
      [Symbol.iterator]() {
        return this;
      }

    };
  };
}

function createReadonlyMethod(type) {
  return function (...args) {
    if (false) {}

    return type === "delete"
    /* DELETE */
    ? false : this;
  };
}

function createInstrumentations() {
  const mutableInstrumentations = {
    get(key) {
      return get$1(this, key);
    },

    get size() {
      return size(this);
    },

    has: has$1,
    add,
    set: reactivity_esm_bundler_set$1,
    delete: deleteEntry,
    clear,
    forEach: createForEach(false, false)
  };
  const shallowInstrumentations = {
    get(key) {
      return get$1(this, key, false, true);
    },

    get size() {
      return size(this);
    },

    has: has$1,
    add,
    set: reactivity_esm_bundler_set$1,
    delete: deleteEntry,
    clear,
    forEach: createForEach(false, true)
  };
  const readonlyInstrumentations = {
    get(key) {
      return get$1(this, key, true);
    },

    get size() {
      return size(this, true);
    },

    has(key) {
      return has$1.call(this, key, true);
    },

    add: createReadonlyMethod("add"
    /* ADD */
    ),
    set: createReadonlyMethod("set"
    /* SET */
    ),
    delete: createReadonlyMethod("delete"
    /* DELETE */
    ),
    clear: createReadonlyMethod("clear"
    /* CLEAR */
    ),
    forEach: createForEach(true, false)
  };
  const shallowReadonlyInstrumentations = {
    get(key) {
      return get$1(this, key, true, true);
    },

    get size() {
      return size(this, true);
    },

    has(key) {
      return has$1.call(this, key, true);
    },

    add: createReadonlyMethod("add"
    /* ADD */
    ),
    set: createReadonlyMethod("set"
    /* SET */
    ),
    delete: createReadonlyMethod("delete"
    /* DELETE */
    ),
    clear: createReadonlyMethod("clear"
    /* CLEAR */
    ),
    forEach: createForEach(true, true)
  };
  const iteratorMethods = ['keys', 'values', 'entries', Symbol.iterator];
  iteratorMethods.forEach(method => {
    mutableInstrumentations[method] = createIterableMethod(method, false, false);
    readonlyInstrumentations[method] = createIterableMethod(method, true, false);
    shallowInstrumentations[method] = createIterableMethod(method, false, true);
    shallowReadonlyInstrumentations[method] = createIterableMethod(method, true, true);
  });
  return [mutableInstrumentations, readonlyInstrumentations, shallowInstrumentations, shallowReadonlyInstrumentations];
}

const [mutableInstrumentations, readonlyInstrumentations, shallowInstrumentations, shallowReadonlyInstrumentations] = /* #__PURE__*/createInstrumentations();

function createInstrumentationGetter(isReadonly, shallow) {
  const instrumentations = shallow ? isReadonly ? shallowReadonlyInstrumentations : shallowInstrumentations : isReadonly ? readonlyInstrumentations : mutableInstrumentations;
  return (target, key, receiver) => {
    if (key === "__v_isReactive"
    /* IS_REACTIVE */
    ) {
      return !isReadonly;
    } else if (key === "__v_isReadonly"
    /* IS_READONLY */
    ) {
      return isReadonly;
    } else if (key === "__v_raw"
    /* RAW */
    ) {
      return target;
    }

    return Reflect.get(shared_esm_bundler_hasOwn(instrumentations, key) && key in target ? instrumentations : target, key, receiver);
  };
}

const mutableCollectionHandlers = {
  get: /*#__PURE__*/createInstrumentationGetter(false, false)
};
const shallowCollectionHandlers = {
  get: /*#__PURE__*/createInstrumentationGetter(false, true)
};
const readonlyCollectionHandlers = {
  get: /*#__PURE__*/createInstrumentationGetter(true, false)
};
const shallowReadonlyCollectionHandlers = {
  get: /*#__PURE__*/createInstrumentationGetter(true, true)
};

function checkIdentityKeys(target, has, key) {
  const rawKey = reactivity_esm_bundler_toRaw(key);

  if (rawKey !== key && has.call(target, rawKey)) {
    const type = toRawType(target);
    console.warn(`Reactive ${type} contains both the raw and reactive ` + `versions of the same object${type === `Map` ? ` as keys` : ``}, ` + `which can lead to inconsistencies. ` + `Avoid differentiating between the raw and reactive versions ` + `of an object and only use the reactive version if possible.`);
  }
}

const reactiveMap = new WeakMap();
const shallowReactiveMap = new WeakMap();
const readonlyMap = new WeakMap();
const shallowReadonlyMap = new WeakMap();

function targetTypeMap(rawType) {
  switch (rawType) {
    case 'Object':
    case 'Array':
      return 1
      /* COMMON */
      ;

    case 'Map':
    case 'Set':
    case 'WeakMap':
    case 'WeakSet':
      return 2
      /* COLLECTION */
      ;

    default:
      return 0
      /* INVALID */
      ;
  }
}

function getTargetType(value) {
  return value["__v_skip"
  /* SKIP */
  ] || !Object.isExtensible(value) ? 0
  /* INVALID */
  : targetTypeMap(shared_esm_bundler_toRawType(value));
}

function reactivity_esm_bundler_reactive(target) {
  // if trying to observe a readonly proxy, return the readonly version.
  if (reactivity_esm_bundler_isReadonly(target)) {
    return target;
  }

  return createReactiveObject(target, false, mutableHandlers, mutableCollectionHandlers, reactiveMap);
}
/**
 * Return a shallowly-reactive copy of the original object, where only the root
 * level properties are reactive. It also does not auto-unwrap refs (even at the
 * root level).
 */


function shallowReactive(target) {
  return createReactiveObject(target, false, shallowReactiveHandlers, shallowCollectionHandlers, shallowReactiveMap);
}
/**
 * Creates a readonly copy of the original object. Note the returned copy is not
 * made reactive, but `readonly` can be called on an already reactive object.
 */


function reactivity_esm_bundler_readonly(target) {
  return createReactiveObject(target, true, readonlyHandlers, readonlyCollectionHandlers, readonlyMap);
}
/**
 * Returns a reactive-copy of the original object, where only the root level
 * properties are readonly, and does NOT unwrap refs nor recursively convert
 * returned properties.
 * This is used for creating the props proxy object for stateful components.
 */


function shallowReadonly(target) {
  return createReactiveObject(target, true, shallowReadonlyHandlers, shallowReadonlyCollectionHandlers, shallowReadonlyMap);
}

function createReactiveObject(target, isReadonly, baseHandlers, collectionHandlers, proxyMap) {
  if (!shared_esm_bundler_isObject(target)) {
    if (false) {}

    return target;
  } // target is already a Proxy, return it.
  // exception: calling readonly() on a reactive object


  if (target["__v_raw"
  /* RAW */
  ] && !(isReadonly && target["__v_isReactive"
  /* IS_REACTIVE */
  ])) {
    return target;
  } // target already has corresponding Proxy


  const existingProxy = proxyMap.get(target);

  if (existingProxy) {
    return existingProxy;
  } // only a whitelist of value types can be observed.


  const targetType = getTargetType(target);

  if (targetType === 0
  /* INVALID */
  ) {
    return target;
  }

  const proxy = new Proxy(target, targetType === 2
  /* COLLECTION */
  ? collectionHandlers : baseHandlers);
  proxyMap.set(target, proxy);
  return proxy;
}

function reactivity_esm_bundler_isReactive(value) {
  if (reactivity_esm_bundler_isReadonly(value)) {
    return reactivity_esm_bundler_isReactive(value["__v_raw"
    /* RAW */
    ]);
  }

  return !!(value && value["__v_isReactive"
  /* IS_REACTIVE */
  ]);
}

function reactivity_esm_bundler_isReadonly(value) {
  return !!(value && value["__v_isReadonly"
  /* IS_READONLY */
  ]);
}

function isShallow(value) {
  return !!(value && value["__v_isShallow"
  /* IS_SHALLOW */
  ]);
}

function isProxy(value) {
  return reactivity_esm_bundler_isReactive(value) || reactivity_esm_bundler_isReadonly(value);
}

function reactivity_esm_bundler_toRaw(observed) {
  const raw = observed && observed["__v_raw"
  /* RAW */
  ];
  return raw ? reactivity_esm_bundler_toRaw(raw) : observed;
}

function reactivity_esm_bundler_markRaw(value) {
  def(value, "__v_skip"
  /* SKIP */
  , true);
  return value;
}

const toReactive = value => shared_esm_bundler_isObject(value) ? reactivity_esm_bundler_reactive(value) : value;

const toReadonly = value => shared_esm_bundler_isObject(value) ? reactivity_esm_bundler_readonly(value) : value;

function trackRefValue(ref) {
  if (isTracking()) {
    ref = reactivity_esm_bundler_toRaw(ref);

    if (!ref.dep) {
      ref.dep = createDep();
    }

    if (false) {} else {
      trackEffects(ref.dep);
    }
  }
}

function triggerRefValue(ref, newVal) {
  ref = reactivity_esm_bundler_toRaw(ref);

  if (ref.dep) {
    if (false) {} else {
      triggerEffects(ref.dep);
    }
  }
}

function reactivity_esm_bundler_isRef(r) {
  return Boolean(r && r.__v_isRef === true);
}

function reactivity_esm_bundler_ref(value) {
  return createRef(value, false);
}

function reactivity_esm_bundler_shallowRef(value) {
  return createRef(value, true);
}

function createRef(rawValue, shallow) {
  if (reactivity_esm_bundler_isRef(rawValue)) {
    return rawValue;
  }

  return new RefImpl(rawValue, shallow);
}

class RefImpl {
  constructor(value, __v_isShallow) {
    this.__v_isShallow = __v_isShallow;
    this.dep = undefined;
    this.__v_isRef = true;
    this._rawValue = __v_isShallow ? value : reactivity_esm_bundler_toRaw(value);
    this._value = __v_isShallow ? value : toReactive(value);
  }

  get value() {
    trackRefValue(this);
    return this._value;
  }

  set value(newVal) {
    newVal = this.__v_isShallow ? newVal : reactivity_esm_bundler_toRaw(newVal);

    if (hasChanged(newVal, this._rawValue)) {
      this._rawValue = newVal;
      this._value = this.__v_isShallow ? newVal : toReactive(newVal);
      triggerRefValue(this, newVal);
    }
  }

}

function triggerRef(ref) {
  triggerRefValue(ref,  false ? 0 : void 0);
}

function reactivity_esm_bundler_unref(ref) {
  return reactivity_esm_bundler_isRef(ref) ? ref.value : ref;
}

const shallowUnwrapHandlers = {
  get: (target, key, receiver) => reactivity_esm_bundler_unref(Reflect.get(target, key, receiver)),
  set: (target, key, value, receiver) => {
    const oldValue = target[key];

    if (reactivity_esm_bundler_isRef(oldValue) && !reactivity_esm_bundler_isRef(value)) {
      oldValue.value = value;
      return true;
    } else {
      return Reflect.set(target, key, value, receiver);
    }
  }
};

function proxyRefs(objectWithRefs) {
  return reactivity_esm_bundler_isReactive(objectWithRefs) ? objectWithRefs : new Proxy(objectWithRefs, shallowUnwrapHandlers);
}

class CustomRefImpl {
  constructor(factory) {
    this.dep = undefined;
    this.__v_isRef = true;
    const {
      get,
      set
    } = factory(() => trackRefValue(this), () => triggerRefValue(this));
    this._get = get;
    this._set = set;
  }

  get value() {
    return this._get();
  }

  set value(newVal) {
    this._set(newVal);
  }

}

function reactivity_esm_bundler_customRef(factory) {
  return new CustomRefImpl(factory);
}

function reactivity_esm_bundler_toRefs(object) {
  if (false) {}

  const ret = shared_esm_bundler_isArray(object) ? new Array(object.length) : {};

  for (const key in object) {
    ret[key] = reactivity_esm_bundler_toRef(object, key);
  }

  return ret;
}

class ObjectRefImpl {
  constructor(_object, _key, _defaultValue) {
    this._object = _object;
    this._key = _key;
    this._defaultValue = _defaultValue;
    this.__v_isRef = true;
  }

  get value() {
    const val = this._object[this._key];
    return val === undefined ? this._defaultValue : val;
  }

  set value(newVal) {
    this._object[this._key] = newVal;
  }

}

function reactivity_esm_bundler_toRef(object, key, defaultValue) {
  const val = object[key];
  return reactivity_esm_bundler_isRef(val) ? val : new ObjectRefImpl(object, key, defaultValue);
}

class ComputedRefImpl {
  constructor(getter, _setter, isReadonly, isSSR) {
    this._setter = _setter;
    this.dep = undefined;
    this.__v_isRef = true;
    this._dirty = true;
    this.effect = new ReactiveEffect(getter, () => {
      if (!this._dirty) {
        this._dirty = true;
        triggerRefValue(this);
      }
    });
    this.effect.computed = this;
    this.effect.active = this._cacheable = !isSSR;
    this["__v_isReadonly"
    /* IS_READONLY */
    ] = isReadonly;
  }

  get value() {
    // the computed ref may get wrapped by other proxies e.g. readonly() #3376
    const self = reactivity_esm_bundler_toRaw(this);
    trackRefValue(self);

    if (self._dirty || !self._cacheable) {
      self._dirty = false;
      self._value = self.effect.run();
    }

    return self._value;
  }

  set value(newValue) {
    this._setter(newValue);
  }

}

function reactivity_esm_bundler_computed(getterOrOptions, debugOptions, isSSR = false) {
  let getter;
  let setter;
  const onlyGetter = shared_esm_bundler_isFunction(getterOrOptions);

  if (onlyGetter) {
    getter = getterOrOptions;
    setter =  false ? 0 : shared_esm_bundler_NOOP;
  } else {
    getter = getterOrOptions.get;
    setter = getterOrOptions.set;
  }

  const cRef = new ComputedRefImpl(getter, setter, onlyGetter || !setter, isSSR);

  if (false) {}

  return cRef;
}

var _a;

const tick = Promise.resolve();
const queue = (/* unused pure expression or super */ null && ([]));
let queued = false;

const scheduler = fn => {
  queue.push(fn);

  if (!queued) {
    queued = true;
    tick.then(flush);
  }
};

const flush = () => {
  for (let i = 0; i < queue.length; i++) {
    queue[i]();
  }

  queue.length = 0;
  queued = false;
};

class DeferredComputedRefImpl {
  constructor(getter) {
    this.dep = undefined;
    this._dirty = true;
    this.__v_isRef = true;
    this[_a] = true;
    let compareTarget;
    let hasCompareTarget = false;
    let scheduled = false;
    this.effect = new ReactiveEffect(getter, computedTrigger => {
      if (this.dep) {
        if (computedTrigger) {
          compareTarget = this._value;
          hasCompareTarget = true;
        } else if (!scheduled) {
          const valueToCompare = hasCompareTarget ? compareTarget : this._value;
          scheduled = true;
          hasCompareTarget = false;
          scheduler(() => {
            if (this.effect.active && this._get() !== valueToCompare) {
              triggerRefValue(this);
            }

            scheduled = false;
          });
        } // chained upstream computeds are notified synchronously to ensure
        // value invalidation in case of sync access; normal effects are
        // deferred to be triggered in scheduler.


        for (const e of this.dep) {
          if (e.computed instanceof DeferredComputedRefImpl) {
            e.scheduler(true
            /* computedTrigger */
            );
          }
        }
      }

      this._dirty = true;
    });
    this.effect.computed = this;
  }

  _get() {
    if (this._dirty) {
      this._dirty = false;
      return this._value = this.effect.run();
    }

    return this._value;
  }

  get value() {
    trackRefValue(this); // the computed ref may get wrapped by other proxies e.g. readonly() #3376

    return reactivity_esm_bundler_toRaw(this)._get();
  }

}

_a = "__v_isReadonly"
/* IS_READONLY */
;

function deferredComputed(getter) {
  return new DeferredComputedRefImpl(getter);
}


;// CONCATENATED MODULE: ./node_modules/@vue/runtime-core/dist/runtime-core.esm-bundler.js




const stack = [];

function pushWarningContext(vnode) {
  stack.push(vnode);
}

function popWarningContext() {
  stack.pop();
}

function runtime_core_esm_bundler_warn(msg, ...args) {
  // avoid props formatting or warn handler tracking deps that might be mutated
  // during patch, leading to infinite recursion.
  pauseTracking();
  const instance = stack.length ? stack[stack.length - 1].component : null;
  const appWarnHandler = instance && instance.appContext.config.warnHandler;
  const trace = getComponentTrace();

  if (appWarnHandler) {
    callWithErrorHandling(appWarnHandler, instance, 11
    /* APP_WARN_HANDLER */
    , [msg + args.join(''), instance && instance.proxy, trace.map(({
      vnode
    }) => `at <${formatComponentName(instance, vnode.type)}>`).join('\n'), trace]);
  } else {
    const warnArgs = [`[Vue warn]: ${msg}`, ...args];
    /* istanbul ignore if */

    if (trace.length && // avoid spamming console during tests
    !false) {
      warnArgs.push(`\n`, ...formatTrace(trace));
    }

    console.warn(...warnArgs);
  }

  resetTracking();
}

function getComponentTrace() {
  let currentVNode = stack[stack.length - 1];

  if (!currentVNode) {
    return [];
  } // we can't just use the stack because it will be incomplete during updates
  // that did not start from the root. Re-construct the parent chain using
  // instance parent pointers.


  const normalizedStack = [];

  while (currentVNode) {
    const last = normalizedStack[0];

    if (last && last.vnode === currentVNode) {
      last.recurseCount++;
    } else {
      normalizedStack.push({
        vnode: currentVNode,
        recurseCount: 0
      });
    }

    const parentInstance = currentVNode.component && currentVNode.component.parent;
    currentVNode = parentInstance && parentInstance.vnode;
  }

  return normalizedStack;
}
/* istanbul ignore next */


function formatTrace(trace) {
  const logs = [];
  trace.forEach((entry, i) => {
    logs.push(...(i === 0 ? [] : [`\n`]), ...formatTraceEntry(entry));
  });
  return logs;
}

function formatTraceEntry({
  vnode,
  recurseCount
}) {
  const postfix = recurseCount > 0 ? `... (${recurseCount} recursive calls)` : ``;
  const isRoot = vnode.component ? vnode.component.parent == null : false;
  const open = ` at <${formatComponentName(vnode.component, vnode.type, isRoot)}`;
  const close = `>` + postfix;
  return vnode.props ? [open, ...formatProps(vnode.props), close] : [open + close];
}
/* istanbul ignore next */


function formatProps(props) {
  const res = [];
  const keys = Object.keys(props);
  keys.slice(0, 3).forEach(key => {
    res.push(...formatProp(key, props[key]));
  });

  if (keys.length > 3) {
    res.push(` ...`);
  }

  return res;
}
/* istanbul ignore next */


function formatProp(key, value, raw) {
  if (shared_esm_bundler_isString(value)) {
    value = JSON.stringify(value);
    return raw ? value : [`${key}=${value}`];
  } else if (typeof value === 'number' || typeof value === 'boolean' || value == null) {
    return raw ? value : [`${key}=${value}`];
  } else if (reactivity_esm_bundler_isRef(value)) {
    value = formatProp(key, reactivity_esm_bundler_toRaw(value.value), true);
    return raw ? value : [`${key}=Ref<`, value, `>`];
  } else if (shared_esm_bundler_isFunction(value)) {
    return [`${key}=fn${value.name ? `<${value.name}>` : ``}`];
  } else {
    value = reactivity_esm_bundler_toRaw(value);
    return raw ? value : [`${key}=`, value];
  }
}

const ErrorTypeStrings = {
  ["sp"
  /* SERVER_PREFETCH */
  ]: 'serverPrefetch hook',
  ["bc"
  /* BEFORE_CREATE */
  ]: 'beforeCreate hook',
  ["c"
  /* CREATED */
  ]: 'created hook',
  ["bm"
  /* BEFORE_MOUNT */
  ]: 'beforeMount hook',
  ["m"
  /* MOUNTED */
  ]: 'mounted hook',
  ["bu"
  /* BEFORE_UPDATE */
  ]: 'beforeUpdate hook',
  ["u"
  /* UPDATED */
  ]: 'updated',
  ["bum"
  /* BEFORE_UNMOUNT */
  ]: 'beforeUnmount hook',
  ["um"
  /* UNMOUNTED */
  ]: 'unmounted hook',
  ["a"
  /* ACTIVATED */
  ]: 'activated hook',
  ["da"
  /* DEACTIVATED */
  ]: 'deactivated hook',
  ["ec"
  /* ERROR_CAPTURED */
  ]: 'errorCaptured hook',
  ["rtc"
  /* RENDER_TRACKED */
  ]: 'renderTracked hook',
  ["rtg"
  /* RENDER_TRIGGERED */
  ]: 'renderTriggered hook',
  [0
  /* SETUP_FUNCTION */
  ]: 'setup function',
  [1
  /* RENDER_FUNCTION */
  ]: 'render function',
  [2
  /* WATCH_GETTER */
  ]: 'watcher getter',
  [3
  /* WATCH_CALLBACK */
  ]: 'watcher callback',
  [4
  /* WATCH_CLEANUP */
  ]: 'watcher cleanup function',
  [5
  /* NATIVE_EVENT_HANDLER */
  ]: 'native event handler',
  [6
  /* COMPONENT_EVENT_HANDLER */
  ]: 'component event handler',
  [7
  /* VNODE_HOOK */
  ]: 'vnode hook',
  [8
  /* DIRECTIVE_HOOK */
  ]: 'directive hook',
  [9
  /* TRANSITION_HOOK */
  ]: 'transition hook',
  [10
  /* APP_ERROR_HANDLER */
  ]: 'app errorHandler',
  [11
  /* APP_WARN_HANDLER */
  ]: 'app warnHandler',
  [12
  /* FUNCTION_REF */
  ]: 'ref function',
  [13
  /* ASYNC_COMPONENT_LOADER */
  ]: 'async component loader',
  [14
  /* SCHEDULER */
  ]: 'scheduler flush. This is likely a Vue internals bug. ' + 'Please open an issue at https://new-issue.vuejs.org/?repo=vuejs/core'
};

function callWithErrorHandling(fn, instance, type, args) {
  let res;

  try {
    res = args ? fn(...args) : fn();
  } catch (err) {
    handleError(err, instance, type);
  }

  return res;
}

function callWithAsyncErrorHandling(fn, instance, type, args) {
  if (shared_esm_bundler_isFunction(fn)) {
    const res = callWithErrorHandling(fn, instance, type, args);

    if (res && shared_esm_bundler_isPromise(res)) {
      res.catch(err => {
        handleError(err, instance, type);
      });
    }

    return res;
  }

  const values = [];

  for (let i = 0; i < fn.length; i++) {
    values.push(callWithAsyncErrorHandling(fn[i], instance, type, args));
  }

  return values;
}

function handleError(err, instance, type, throwInDev = true) {
  const contextVNode = instance ? instance.vnode : null;

  if (instance) {
    let cur = instance.parent; // the exposed instance is the render proxy to keep it consistent with 2.x

    const exposedInstance = instance.proxy; // in production the hook receives only the error code

    const errorInfo =  false ? 0 : type;

    while (cur) {
      const errorCapturedHooks = cur.ec;

      if (errorCapturedHooks) {
        for (let i = 0; i < errorCapturedHooks.length; i++) {
          if (errorCapturedHooks[i](err, exposedInstance, errorInfo) === false) {
            return;
          }
        }
      }

      cur = cur.parent;
    } // app-level handling


    const appErrorHandler = instance.appContext.config.errorHandler;

    if (appErrorHandler) {
      callWithErrorHandling(appErrorHandler, null, 10
      /* APP_ERROR_HANDLER */
      , [err, exposedInstance, errorInfo]);
      return;
    }
  }

  logError(err, type, contextVNode, throwInDev);
}

function logError(err, type, contextVNode, throwInDev = true) {
  if (false) {} else {
    // recover in prod to reduce the impact on end-user
    console.error(err);
  }
}

let isFlushing = false;
let isFlushPending = false;
const runtime_core_esm_bundler_queue = [];
let flushIndex = 0;
const pendingPreFlushCbs = [];
let activePreFlushCbs = null;
let preFlushIndex = 0;
const pendingPostFlushCbs = [];
let activePostFlushCbs = null;
let postFlushIndex = 0;
const resolvedPromise = Promise.resolve();
let currentFlushPromise = null;
let currentPreFlushParentJob = null;
const RECURSION_LIMIT = 100;

function runtime_core_esm_bundler_nextTick(fn) {
  const p = currentFlushPromise || resolvedPromise;
  return fn ? p.then(this ? fn.bind(this) : fn) : p;
} // #2768
// Use binary-search to find a suitable position in the queue,
// so that the queue maintains the increasing order of job's id,
// which can prevent the job from being skipped and also can avoid repeated patching.


function findInsertionIndex(id) {
  // the start index should be `flushIndex + 1`
  let start = flushIndex + 1;
  let end = runtime_core_esm_bundler_queue.length;

  while (start < end) {
    const middle = start + end >>> 1;
    const middleJobId = getId(runtime_core_esm_bundler_queue[middle]);
    middleJobId < id ? start = middle + 1 : end = middle;
  }

  return start;
}

function queueJob(job) {
  // the dedupe search uses the startIndex argument of Array.includes()
  // by default the search index includes the current job that is being run
  // so it cannot recursively trigger itself again.
  // if the job is a watch() callback, the search will start with a +1 index to
  // allow it recursively trigger itself - it is the user's responsibility to
  // ensure it doesn't end up in an infinite loop.
  if ((!runtime_core_esm_bundler_queue.length || !runtime_core_esm_bundler_queue.includes(job, isFlushing && job.allowRecurse ? flushIndex + 1 : flushIndex)) && job !== currentPreFlushParentJob) {
    if (job.id == null) {
      runtime_core_esm_bundler_queue.push(job);
    } else {
      runtime_core_esm_bundler_queue.splice(findInsertionIndex(job.id), 0, job);
    }

    queueFlush();
  }
}

function queueFlush() {
  if (!isFlushing && !isFlushPending) {
    isFlushPending = true;
    currentFlushPromise = resolvedPromise.then(flushJobs);
  }
}

function invalidateJob(job) {
  const i = runtime_core_esm_bundler_queue.indexOf(job);

  if (i > flushIndex) {
    runtime_core_esm_bundler_queue.splice(i, 1);
  }
}

function queueCb(cb, activeQueue, pendingQueue, index) {
  if (!shared_esm_bundler_isArray(cb)) {
    if (!activeQueue || !activeQueue.includes(cb, cb.allowRecurse ? index + 1 : index)) {
      pendingQueue.push(cb);
    }
  } else {
    // if cb is an array, it is a component lifecycle hook which can only be
    // triggered by a job, which is already deduped in the main queue, so
    // we can skip duplicate check here to improve perf
    pendingQueue.push(...cb);
  }

  queueFlush();
}

function queuePreFlushCb(cb) {
  queueCb(cb, activePreFlushCbs, pendingPreFlushCbs, preFlushIndex);
}

function queuePostFlushCb(cb) {
  queueCb(cb, activePostFlushCbs, pendingPostFlushCbs, postFlushIndex);
}

function flushPreFlushCbs(seen, parentJob = null) {
  if (pendingPreFlushCbs.length) {
    currentPreFlushParentJob = parentJob;
    activePreFlushCbs = [...new Set(pendingPreFlushCbs)];
    pendingPreFlushCbs.length = 0;

    if (false) {}

    for (preFlushIndex = 0; preFlushIndex < activePreFlushCbs.length; preFlushIndex++) {
      if (false) {}

      activePreFlushCbs[preFlushIndex]();
    }

    activePreFlushCbs = null;
    preFlushIndex = 0;
    currentPreFlushParentJob = null; // recursively flush until it drains

    flushPreFlushCbs(seen, parentJob);
  }
}

function flushPostFlushCbs(seen) {
  if (pendingPostFlushCbs.length) {
    const deduped = [...new Set(pendingPostFlushCbs)];
    pendingPostFlushCbs.length = 0; // #1947 already has active queue, nested flushPostFlushCbs call

    if (activePostFlushCbs) {
      activePostFlushCbs.push(...deduped);
      return;
    }

    activePostFlushCbs = deduped;

    if (false) {}

    activePostFlushCbs.sort((a, b) => getId(a) - getId(b));

    for (postFlushIndex = 0; postFlushIndex < activePostFlushCbs.length; postFlushIndex++) {
      if (false) {}

      activePostFlushCbs[postFlushIndex]();
    }

    activePostFlushCbs = null;
    postFlushIndex = 0;
  }
}

const getId = job => job.id == null ? Infinity : job.id;

function flushJobs(seen) {
  isFlushPending = false;
  isFlushing = true;

  if (false) {}

  flushPreFlushCbs(seen); // Sort queue before flush.
  // This ensures that:
  // 1. Components are updated from parent to child. (because parent is always
  //    created before the child so its render effect will have smaller
  //    priority number)
  // 2. If a component is unmounted during a parent component's update,
  //    its update can be skipped.

  runtime_core_esm_bundler_queue.sort((a, b) => getId(a) - getId(b)); // conditional usage of checkRecursiveUpdate must be determined out of
  // try ... catch block since Rollup by default de-optimizes treeshaking
  // inside try-catch. This can leave all warning code unshaked. Although
  // they would get eventually shaken by a minifier like terser, some minifiers
  // would fail to do that (e.g. https://github.com/evanw/esbuild/issues/1610)

  const check =  false ? 0 : shared_esm_bundler_NOOP;

  try {
    for (flushIndex = 0; flushIndex < runtime_core_esm_bundler_queue.length; flushIndex++) {
      const job = runtime_core_esm_bundler_queue[flushIndex];

      if (job && job.active !== false) {
        if (false) {} // console.log(`running:`, job.id)


        callWithErrorHandling(job, null, 14
        /* SCHEDULER */
        );
      }
    }
  } finally {
    flushIndex = 0;
    runtime_core_esm_bundler_queue.length = 0;
    flushPostFlushCbs(seen);
    isFlushing = false;
    currentFlushPromise = null; // some postFlushCb queued jobs!
    // keep flushing until it drains.

    if (runtime_core_esm_bundler_queue.length || pendingPreFlushCbs.length || pendingPostFlushCbs.length) {
      flushJobs(seen);
    }
  }
}

function checkRecursiveUpdates(seen, fn) {
  if (!seen.has(fn)) {
    seen.set(fn, 1);
  } else {
    const count = seen.get(fn);

    if (count > RECURSION_LIMIT) {
      const instance = fn.ownerInstance;
      const componentName = instance && getComponentName(instance.type);
      runtime_core_esm_bundler_warn(`Maximum recursive updates exceeded${componentName ? ` in component <${componentName}>` : ``}. ` + `This means you have a reactive effect that is mutating its own ` + `dependencies and thus recursively triggering itself. Possible sources ` + `include component template, render function, updated hook or ` + `watcher source function.`);
      return true;
    } else {
      seen.set(fn, count + 1);
    }
  }
}
/* eslint-disable no-restricted-globals */


let isHmrUpdating = false;
const hmrDirtyComponents = new Set(); // Expose the HMR runtime on the global object
// This makes it entirely tree-shakable without polluting the exports and makes
// it easier to be used in toolings like vue-loader
// Note: for a component to be eligible for HMR it also needs the __hmrId option
// to be set so that its instances can be registered / removed.

if (false) {}

const map = new Map();

function registerHMR(instance) {
  const id = instance.type.__hmrId;
  let record = map.get(id);

  if (!record) {
    createRecord(id, instance.type);
    record = map.get(id);
  }

  record.instances.add(instance);
}

function unregisterHMR(instance) {
  map.get(instance.type.__hmrId).instances.delete(instance);
}

function createRecord(id, initialDef) {
  if (map.has(id)) {
    return false;
  }

  map.set(id, {
    initialDef: normalizeClassComponent(initialDef),
    instances: new Set()
  });
  return true;
}

function normalizeClassComponent(component) {
  return isClassComponent(component) ? component.__vccOpts : component;
}

function rerender(id, newRender) {
  const record = map.get(id);

  if (!record) {
    return;
  } // update initial record (for not-yet-rendered component)


  record.initialDef.render = newRender;
  [...record.instances].forEach(instance => {
    if (newRender) {
      instance.render = newRender;
      normalizeClassComponent(instance.type).render = newRender;
    }

    instance.renderCache = []; // this flag forces child components with slot content to update

    isHmrUpdating = true;
    instance.update();
    isHmrUpdating = false;
  });
}

function reload(id, newComp) {
  const record = map.get(id);
  if (!record) return;
  newComp = normalizeClassComponent(newComp); // update initial def (for not-yet-rendered components)

  updateComponentDef(record.initialDef, newComp); // create a snapshot which avoids the set being mutated during updates

  const instances = [...record.instances];

  for (const instance of instances) {
    const oldComp = normalizeClassComponent(instance.type);

    if (!hmrDirtyComponents.has(oldComp)) {
      // 1. Update existing comp definition to match new one
      if (oldComp !== record.initialDef) {
        updateComponentDef(oldComp, newComp);
      } // 2. mark definition dirty. This forces the renderer to replace the
      // component on patch.


      hmrDirtyComponents.add(oldComp);
    } // 3. invalidate options resolution cache


    instance.appContext.optionsCache.delete(instance.type); // 4. actually update

    if (instance.ceReload) {
      // custom element
      hmrDirtyComponents.add(oldComp);
      instance.ceReload(newComp.styles);
      hmrDirtyComponents.delete(oldComp);
    } else if (instance.parent) {
      // 4. Force the parent instance to re-render. This will cause all updated
      // components to be unmounted and re-mounted. Queue the update so that we
      // don't end up forcing the same parent to re-render multiple times.
      queueJob(instance.parent.update); // instance is the inner component of an async custom element
      // invoke to reset styles

      if (instance.parent.type.__asyncLoader && instance.parent.ceReload) {
        instance.parent.ceReload(newComp.styles);
      }
    } else if (instance.appContext.reload) {
      // root instance mounted via createApp() has a reload method
      instance.appContext.reload();
    } else if (typeof window !== 'undefined') {
      // root instance inside tree created via raw render(). Force reload.
      window.location.reload();
    } else {
      console.warn('[HMR] Root or manually mounted instance modified. Full reload required.');
    }
  } // 5. make sure to cleanup dirty hmr components after update


  queuePostFlushCb(() => {
    for (const instance of instances) {
      hmrDirtyComponents.delete(normalizeClassComponent(instance.type));
    }
  });
}

function updateComponentDef(oldComp, newComp) {
  extend(oldComp, newComp);

  for (const key in oldComp) {
    if (key !== '__file' && !(key in newComp)) {
      delete oldComp[key];
    }
  }
}

function tryWrap(fn) {
  return (id, arg) => {
    try {
      return fn(id, arg);
    } catch (e) {
      console.error(e);
      console.warn(`[HMR] Something went wrong during Vue component hot-reload. ` + `Full reload required.`);
    }
  };
}

let devtools;
let buffer = [];
let devtoolsNotInstalled = false;

function emit(event, ...args) {
  if (devtools) {
    devtools.emit(event, ...args);
  } else if (!devtoolsNotInstalled) {
    buffer.push({
      event,
      args
    });
  }
}

function setDevtoolsHook(hook, target) {
  var _a, _b;

  devtools = hook;

  if (devtools) {
    devtools.enabled = true;
    buffer.forEach(({
      event,
      args
    }) => devtools.emit(event, ...args));
    buffer = [];
  } else if ( // handle late devtools injection - only do this if we are in an actual
  // browser environment to avoid the timer handle stalling test runner exit
  // (#4815)
  // eslint-disable-next-line no-restricted-globals
  typeof window !== 'undefined' && // some envs mock window but not fully
  window.HTMLElement && // also exclude jsdom
  !((_b = (_a = window.navigator) === null || _a === void 0 ? void 0 : _a.userAgent) === null || _b === void 0 ? void 0 : _b.includes('jsdom'))) {
    const replay = target.__VUE_DEVTOOLS_HOOK_REPLAY__ = target.__VUE_DEVTOOLS_HOOK_REPLAY__ || [];
    replay.push(newHook => {
      setDevtoolsHook(newHook, target);
    }); // clear buffer after 3s - the user probably doesn't have devtools installed
    // at all, and keeping the buffer will cause memory leaks (#4738)

    setTimeout(() => {
      if (!devtools) {
        target.__VUE_DEVTOOLS_HOOK_REPLAY__ = null;
        devtoolsNotInstalled = true;
        buffer = [];
      }
    }, 3000);
  } else {
    // non-browser env, assume not installed
    devtoolsNotInstalled = true;
    buffer = [];
  }
}

function devtoolsInitApp(app, version) {
  emit("app:init"
  /* APP_INIT */
  , app, version, {
    Fragment: runtime_core_esm_bundler_Fragment,
    Text: runtime_core_esm_bundler_Text,
    Comment: runtime_core_esm_bundler_Comment,
    Static: runtime_core_esm_bundler_Static
  });
}

function devtoolsUnmountApp(app) {
  emit("app:unmount"
  /* APP_UNMOUNT */
  , app);
}

const devtoolsComponentAdded = /*#__PURE__*/createDevtoolsComponentHook("component:added"
/* COMPONENT_ADDED */
);
const devtoolsComponentUpdated = /*#__PURE__*/createDevtoolsComponentHook("component:updated"
/* COMPONENT_UPDATED */
);
const devtoolsComponentRemoved = /*#__PURE__*/createDevtoolsComponentHook("component:removed"
/* COMPONENT_REMOVED */
);

function createDevtoolsComponentHook(hook) {
  return component => {
    emit(hook, component.appContext.app, component.uid, component.parent ? component.parent.uid : undefined, component);
  };
}

const devtoolsPerfStart = /*#__PURE__*/(/* unused pure expression or super */ null && (createDevtoolsPerformanceHook("perf:start"
/* PERFORMANCE_START */
)));
const devtoolsPerfEnd = /*#__PURE__*/(/* unused pure expression or super */ null && (createDevtoolsPerformanceHook("perf:end"
/* PERFORMANCE_END */
)));

function createDevtoolsPerformanceHook(hook) {
  return (component, type, time) => {
    emit(hook, component.appContext.app, component.uid, component, type, time);
  };
}

function devtoolsComponentEmit(component, event, params) {
  emit("component:emit"
  /* COMPONENT_EMIT */
  , component.appContext.app, component, event, params);
}

function emit$1(instance, event, ...rawArgs) {
  const props = instance.vnode.props || shared_esm_bundler_EMPTY_OBJ;

  if (false) {}

  let args = rawArgs;
  const isModelListener = event.startsWith('update:'); // for v-model update:xxx events, apply modifiers on args

  const modelArg = isModelListener && event.slice(7);

  if (modelArg && modelArg in props) {
    const modifiersKey = `${modelArg === 'modelValue' ? 'model' : modelArg}Modifiers`;
    const {
      number,
      trim
    } = props[modifiersKey] || shared_esm_bundler_EMPTY_OBJ;

    if (trim) {
      args = rawArgs.map(a => a.trim());
    } else if (number) {
      args = rawArgs.map(shared_esm_bundler_toNumber);
    }
  }

  if ( false || __VUE_PROD_DEVTOOLS__) {
    devtoolsComponentEmit(instance, event, args);
  }

  if (false) {}

  let handlerName;
  let handler = props[handlerName = toHandlerKey(event)] || // also try camelCase event handler (#2249)
  props[handlerName = toHandlerKey(shared_esm_bundler_camelize(event))]; // for v-model update:xxx events, also trigger kebab-case equivalent
  // for props passed via kebab-case

  if (!handler && isModelListener) {
    handler = props[handlerName = toHandlerKey(shared_esm_bundler_hyphenate(event))];
  }

  if (handler) {
    callWithAsyncErrorHandling(handler, instance, 6
    /* COMPONENT_EVENT_HANDLER */
    , args);
  }

  const onceHandler = props[handlerName + `Once`];

  if (onceHandler) {
    if (!instance.emitted) {
      instance.emitted = {};
    } else if (instance.emitted[handlerName]) {
      return;
    }

    instance.emitted[handlerName] = true;
    callWithAsyncErrorHandling(onceHandler, instance, 6
    /* COMPONENT_EVENT_HANDLER */
    , args);
  }
}

function normalizeEmitsOptions(comp, appContext, asMixin = false) {
  const cache = appContext.emitsCache;
  const cached = cache.get(comp);

  if (cached !== undefined) {
    return cached;
  }

  const raw = comp.emits;
  let normalized = {}; // apply mixin/extends props

  let hasExtends = false;

  if (__VUE_OPTIONS_API__ && !shared_esm_bundler_isFunction(comp)) {
    const extendEmits = raw => {
      const normalizedFromExtend = normalizeEmitsOptions(raw, appContext, true);

      if (normalizedFromExtend) {
        hasExtends = true;
        shared_esm_bundler_extend(normalized, normalizedFromExtend);
      }
    };

    if (!asMixin && appContext.mixins.length) {
      appContext.mixins.forEach(extendEmits);
    }

    if (comp.extends) {
      extendEmits(comp.extends);
    }

    if (comp.mixins) {
      comp.mixins.forEach(extendEmits);
    }
  }

  if (!raw && !hasExtends) {
    cache.set(comp, null);
    return null;
  }

  if (shared_esm_bundler_isArray(raw)) {
    raw.forEach(key => normalized[key] = null);
  } else {
    shared_esm_bundler_extend(normalized, raw);
  }

  cache.set(comp, normalized);
  return normalized;
} // Check if an incoming prop key is a declared emit event listener.
// e.g. With `emits: { click: null }`, props named `onClick` and `onclick` are
// both considered matched listeners.


function isEmitListener(options, key) {
  if (!options || !shared_esm_bundler_isOn(key)) {
    return false;
  }

  key = key.slice(2).replace(/Once$/, '');
  return shared_esm_bundler_hasOwn(options, key[0].toLowerCase() + key.slice(1)) || shared_esm_bundler_hasOwn(options, shared_esm_bundler_hyphenate(key)) || shared_esm_bundler_hasOwn(options, key);
}
/**
 * mark the current rendering instance for asset resolution (e.g.
 * resolveComponent, resolveDirective) during render
 */


let currentRenderingInstance = null;
let currentScopeId = null;
/**
 * Note: rendering calls maybe nested. The function returns the parent rendering
 * instance if present, which should be restored after the render is done:
 *
 * ```js
 * const prev = setCurrentRenderingInstance(i)
 * // ...render
 * setCurrentRenderingInstance(prev)
 * ```
 */

function setCurrentRenderingInstance(instance) {
  const prev = currentRenderingInstance;
  currentRenderingInstance = instance;
  currentScopeId = instance && instance.type.__scopeId || null;
  return prev;
}
/**
 * Set scope id when creating hoisted vnodes.
 * @private compiler helper
 */


function pushScopeId(id) {
  currentScopeId = id;
}
/**
 * Technically we no longer need this after 3.0.8 but we need to keep the same
 * API for backwards compat w/ code generated by compilers.
 * @private
 */


function popScopeId() {
  currentScopeId = null;
}
/**
 * Only for backwards compat
 * @private
 */


const withScopeId = _id => withCtx;
/**
 * Wrap a slot function to memoize current rendering instance
 * @private compiler helper
 */


function withCtx(fn, ctx = currentRenderingInstance, isNonScopedSlot // false only
) {
  if (!ctx) return fn; // already normalized

  if (fn._n) {
    return fn;
  }

  const renderFnWithContext = (...args) => {
    // If a user calls a compiled slot inside a template expression (#1745), it
    // can mess up block tracking, so by default we disable block tracking and
    // force bail out when invoking a compiled slot (indicated by the ._d flag).
    // This isn't necessary if rendering a compiled `<slot>`, so we flip the
    // ._d flag off when invoking the wrapped fn inside `renderSlot`.
    if (renderFnWithContext._d) {
      setBlockTracking(-1);
    }

    const prevInstance = setCurrentRenderingInstance(ctx);
    const res = fn(...args);
    setCurrentRenderingInstance(prevInstance);

    if (renderFnWithContext._d) {
      setBlockTracking(1);
    }

    if ( false || __VUE_PROD_DEVTOOLS__) {
      devtoolsComponentUpdated(ctx);
    }

    return res;
  }; // mark normalized to avoid duplicated wrapping


  renderFnWithContext._n = true; // mark this as compiled by default
  // this is used in vnode.ts -> normalizeChildren() to set the slot
  // rendering flag.

  renderFnWithContext._c = true; // disable block tracking by default

  renderFnWithContext._d = true;
  return renderFnWithContext;
}
/**
 * dev only flag to track whether $attrs was used during render.
 * If $attrs was used during render then the warning for failed attrs
 * fallthrough can be suppressed.
 */


let accessedAttrs = false;

function markAttrsAccessed() {
  accessedAttrs = true;
}

function renderComponentRoot(instance) {
  const {
    type: Component,
    vnode,
    proxy,
    withProxy,
    props,
    propsOptions: [propsOptions],
    slots,
    attrs,
    emit,
    render,
    renderCache,
    data,
    setupState,
    ctx,
    inheritAttrs
  } = instance;
  let result;
  let fallthroughAttrs;
  const prev = setCurrentRenderingInstance(instance);

  if (false) {}

  try {
    if (vnode.shapeFlag & 4
    /* STATEFUL_COMPONENT */
    ) {
      // withProxy is a proxy with a different `has` trap only for
      // runtime-compiled render functions using `with` block.
      const proxyToUse = withProxy || proxy;
      result = normalizeVNode(render.call(proxyToUse, proxyToUse, renderCache, props, setupState, data, ctx));
      fallthroughAttrs = attrs;
    } else {
      // functional
      const render = Component; // in dev, mark attrs accessed if optional props (attrs === props)

      if (false) {}

      result = normalizeVNode(render.length > 1 ? render(props,  false ? 0 : {
        attrs,
        slots,
        emit
      }) : render(props, null
      /* we know it doesn't need it */
      ));
      fallthroughAttrs = Component.props ? attrs : getFunctionalFallthrough(attrs);
    }
  } catch (err) {
    blockStack.length = 0;
    handleError(err, instance, 1
    /* RENDER_FUNCTION */
    );
    result = runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Comment);
  } // attr merging
  // in dev mode, comments are preserved, and it's possible for a template
  // to have comments along side the root element which makes it a fragment


  let root = result;
  let setRoot = undefined;

  if (false
  /* DEV_ROOT_FRAGMENT */
  ) {}

  if (fallthroughAttrs && inheritAttrs !== false) {
    const keys = Object.keys(fallthroughAttrs);
    const {
      shapeFlag
    } = root;

    if (keys.length) {
      if (shapeFlag & (1
      /* ELEMENT */
      | 6
      /* COMPONENT */
      )) {
        if (propsOptions && keys.some(isModelListener)) {
          // If a v-model listener (onUpdate:xxx) has a corresponding declared
          // prop, it indicates this component expects to handle v-model and
          // it should not fallthrough.
          // related: #1543, #1643, #1989
          fallthroughAttrs = filterModelListeners(fallthroughAttrs, propsOptions);
        }

        root = cloneVNode(root, fallthroughAttrs);
      } else if (false) {}
    }
  } // inherit directives


  if (vnode.dirs) {
    if (false) {}

    root.dirs = root.dirs ? root.dirs.concat(vnode.dirs) : vnode.dirs;
  } // inherit transition data


  if (vnode.transition) {
    if (false) {}

    root.transition = vnode.transition;
  }

  if (false) {} else {
    result = root;
  }

  setCurrentRenderingInstance(prev);
  return result;
}
/**
 * dev only
 * In dev mode, template root level comments are rendered, which turns the
 * template into a fragment root, but we need to locate the single element
 * root for attrs and scope id processing.
 */


const getChildRoot = vnode => {
  const rawChildren = vnode.children;
  const dynamicChildren = vnode.dynamicChildren;
  const childRoot = filterSingleRoot(rawChildren);

  if (!childRoot) {
    return [vnode, undefined];
  }

  const index = rawChildren.indexOf(childRoot);
  const dynamicIndex = dynamicChildren ? dynamicChildren.indexOf(childRoot) : -1;

  const setRoot = updatedRoot => {
    rawChildren[index] = updatedRoot;

    if (dynamicChildren) {
      if (dynamicIndex > -1) {
        dynamicChildren[dynamicIndex] = updatedRoot;
      } else if (updatedRoot.patchFlag > 0) {
        vnode.dynamicChildren = [...dynamicChildren, updatedRoot];
      }
    }
  };

  return [normalizeVNode(childRoot), setRoot];
};

function filterSingleRoot(children) {
  let singleRoot;

  for (let i = 0; i < children.length; i++) {
    const child = children[i];

    if (runtime_core_esm_bundler_isVNode(child)) {
      // ignore user comment
      if (child.type !== runtime_core_esm_bundler_Comment || child.children === 'v-if') {
        if (singleRoot) {
          // has more than 1 non-comment child, return now
          return;
        } else {
          singleRoot = child;
        }
      }
    } else {
      return;
    }
  }

  return singleRoot;
}

const getFunctionalFallthrough = attrs => {
  let res;

  for (const key in attrs) {
    if (key === 'class' || key === 'style' || shared_esm_bundler_isOn(key)) {
      (res || (res = {}))[key] = attrs[key];
    }
  }

  return res;
};

const filterModelListeners = (attrs, props) => {
  const res = {};

  for (const key in attrs) {
    if (!isModelListener(key) || !(key.slice(9) in props)) {
      res[key] = attrs[key];
    }
  }

  return res;
};

const isElementRoot = vnode => {
  return vnode.shapeFlag & (6
  /* COMPONENT */
  | 1
  /* ELEMENT */
  ) || vnode.type === runtime_core_esm_bundler_Comment // potential v-if branch switch
  ;
};

function shouldUpdateComponent(prevVNode, nextVNode, optimized) {
  const {
    props: prevProps,
    children: prevChildren,
    component
  } = prevVNode;
  const {
    props: nextProps,
    children: nextChildren,
    patchFlag
  } = nextVNode;
  const emits = component.emitsOptions; // Parent component's render function was hot-updated. Since this may have
  // caused the child component's slots content to have changed, we need to
  // force the child to update as well.

  if (false) {} // force child update for runtime directive or transition on component vnode.


  if (nextVNode.dirs || nextVNode.transition) {
    return true;
  }

  if (optimized && patchFlag >= 0) {
    if (patchFlag & 1024
    /* DYNAMIC_SLOTS */
    ) {
      // slot content that references values that might have changed,
      // e.g. in a v-for
      return true;
    }

    if (patchFlag & 16
    /* FULL_PROPS */
    ) {
      if (!prevProps) {
        return !!nextProps;
      } // presence of this flag indicates props are always non-null


      return hasPropsChanged(prevProps, nextProps, emits);
    } else if (patchFlag & 8
    /* PROPS */
    ) {
      const dynamicProps = nextVNode.dynamicProps;

      for (let i = 0; i < dynamicProps.length; i++) {
        const key = dynamicProps[i];

        if (nextProps[key] !== prevProps[key] && !isEmitListener(emits, key)) {
          return true;
        }
      }
    }
  } else {
    // this path is only taken by manually written render functions
    // so presence of any children leads to a forced update
    if (prevChildren || nextChildren) {
      if (!nextChildren || !nextChildren.$stable) {
        return true;
      }
    }

    if (prevProps === nextProps) {
      return false;
    }

    if (!prevProps) {
      return !!nextProps;
    }

    if (!nextProps) {
      return true;
    }

    return hasPropsChanged(prevProps, nextProps, emits);
  }

  return false;
}

function hasPropsChanged(prevProps, nextProps, emitsOptions) {
  const nextKeys = Object.keys(nextProps);

  if (nextKeys.length !== Object.keys(prevProps).length) {
    return true;
  }

  for (let i = 0; i < nextKeys.length; i++) {
    const key = nextKeys[i];

    if (nextProps[key] !== prevProps[key] && !isEmitListener(emitsOptions, key)) {
      return true;
    }
  }

  return false;
}

function updateHOCHostEl({
  vnode,
  parent
}, el // HostNode
) {
  while (parent && parent.subTree === vnode) {
    (vnode = parent.vnode).el = el;
    parent = parent.parent;
  }
}

const isSuspense = type => type.__isSuspense; // Suspense exposes a component-like API, and is treated like a component
// in the compiler, but internally it's a special built-in type that hooks
// directly into the renderer.


const SuspenseImpl = {
  name: 'Suspense',
  // In order to make Suspense tree-shakable, we need to avoid importing it
  // directly in the renderer. The renderer checks for the __isSuspense flag
  // on a vnode's type and calls the `process` method, passing in renderer
  // internals.
  __isSuspense: true,

  process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, // platform-specific impl passed from renderer
  rendererInternals) {
    if (n1 == null) {
      mountSuspense(n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals);
    } else {
      patchSuspense(n1, n2, container, anchor, parentComponent, isSVG, slotScopeIds, optimized, rendererInternals);
    }
  },

  hydrate: hydrateSuspense,
  create: createSuspenseBoundary,
  normalize: normalizeSuspenseChildren
}; // Force-casted public typing for h and TSX props inference

const Suspense = (/* unused pure expression or super */ null && (SuspenseImpl));

function triggerEvent(vnode, name) {
  const eventListener = vnode.props && vnode.props[name];

  if (shared_esm_bundler_isFunction(eventListener)) {
    eventListener();
  }
}

function mountSuspense(vnode, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals) {
  const {
    p: patch,
    o: {
      createElement
    }
  } = rendererInternals;
  const hiddenContainer = createElement('div');
  const suspense = vnode.suspense = createSuspenseBoundary(vnode, parentSuspense, parentComponent, container, hiddenContainer, anchor, isSVG, slotScopeIds, optimized, rendererInternals); // start mounting the content subtree in an off-dom container

  patch(null, suspense.pendingBranch = vnode.ssContent, hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds); // now check if we have encountered any async deps

  if (suspense.deps > 0) {
    // has async
    // invoke @fallback event
    triggerEvent(vnode, 'onPending');
    triggerEvent(vnode, 'onFallback'); // mount the fallback tree

    patch(null, vnode.ssFallback, container, anchor, parentComponent, null, // fallback tree will not have suspense context
    isSVG, slotScopeIds);
    setActiveBranch(suspense, vnode.ssFallback);
  } else {
    // Suspense has no async deps. Just resolve.
    suspense.resolve();
  }
}

function patchSuspense(n1, n2, container, anchor, parentComponent, isSVG, slotScopeIds, optimized, {
  p: patch,
  um: unmount,
  o: {
    createElement
  }
}) {
  const suspense = n2.suspense = n1.suspense;
  suspense.vnode = n2;
  n2.el = n1.el;
  const newBranch = n2.ssContent;
  const newFallback = n2.ssFallback;
  const {
    activeBranch,
    pendingBranch,
    isInFallback,
    isHydrating
  } = suspense;

  if (pendingBranch) {
    suspense.pendingBranch = newBranch;

    if (isSameVNodeType(newBranch, pendingBranch)) {
      // same root type but content may have changed.
      patch(pendingBranch, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);

      if (suspense.deps <= 0) {
        suspense.resolve();
      } else if (isInFallback) {
        patch(activeBranch, newFallback, container, anchor, parentComponent, null, // fallback tree will not have suspense context
        isSVG, slotScopeIds, optimized);
        setActiveBranch(suspense, newFallback);
      }
    } else {
      // toggled before pending tree is resolved
      suspense.pendingId++;

      if (isHydrating) {
        // if toggled before hydration is finished, the current DOM tree is
        // no longer valid. set it as the active branch so it will be unmounted
        // when resolved
        suspense.isHydrating = false;
        suspense.activeBranch = pendingBranch;
      } else {
        unmount(pendingBranch, parentComponent, suspense);
      } // increment pending ID. this is used to invalidate async callbacks
      // reset suspense state


      suspense.deps = 0; // discard effects from pending branch

      suspense.effects.length = 0; // discard previous container

      suspense.hiddenContainer = createElement('div');

      if (isInFallback) {
        // already in fallback state
        patch(null, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);

        if (suspense.deps <= 0) {
          suspense.resolve();
        } else {
          patch(activeBranch, newFallback, container, anchor, parentComponent, null, // fallback tree will not have suspense context
          isSVG, slotScopeIds, optimized);
          setActiveBranch(suspense, newFallback);
        }
      } else if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {
        // toggled "back" to current active branch
        patch(activeBranch, newBranch, container, anchor, parentComponent, suspense, isSVG, slotScopeIds, optimized); // force resolve

        suspense.resolve(true);
      } else {
        // switched to a 3rd branch
        patch(null, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);

        if (suspense.deps <= 0) {
          suspense.resolve();
        }
      }
    }
  } else {
    if (activeBranch && isSameVNodeType(newBranch, activeBranch)) {
      // root did not change, just normal patch
      patch(activeBranch, newBranch, container, anchor, parentComponent, suspense, isSVG, slotScopeIds, optimized);
      setActiveBranch(suspense, newBranch);
    } else {
      // root node toggled
      // invoke @pending event
      triggerEvent(n2, 'onPending'); // mount pending branch in off-dom container

      suspense.pendingBranch = newBranch;
      suspense.pendingId++;
      patch(null, newBranch, suspense.hiddenContainer, null, parentComponent, suspense, isSVG, slotScopeIds, optimized);

      if (suspense.deps <= 0) {
        // incoming branch has no async deps, resolve now.
        suspense.resolve();
      } else {
        const {
          timeout,
          pendingId
        } = suspense;

        if (timeout > 0) {
          setTimeout(() => {
            if (suspense.pendingId === pendingId) {
              suspense.fallback(newFallback);
            }
          }, timeout);
        } else if (timeout === 0) {
          suspense.fallback(newFallback);
        }
      }
    }
  }
}

let hasWarned = false;

function createSuspenseBoundary(vnode, parent, parentComponent, container, hiddenContainer, anchor, isSVG, slotScopeIds, optimized, rendererInternals, isHydrating = false) {
  /* istanbul ignore if */
  if (false) {}

  const {
    p: patch,
    m: move,
    um: unmount,
    n: next,
    o: {
      parentNode,
      remove
    }
  } = rendererInternals;
  const timeout = shared_esm_bundler_toNumber(vnode.props && vnode.props.timeout);
  const suspense = {
    vnode,
    parent,
    parentComponent,
    isSVG,
    container,
    hiddenContainer,
    anchor,
    deps: 0,
    pendingId: 0,
    timeout: typeof timeout === 'number' ? timeout : -1,
    activeBranch: null,
    pendingBranch: null,
    isInFallback: true,
    isHydrating,
    isUnmounted: false,
    effects: [],

    resolve(resume = false) {
      if (false) {}

      const {
        vnode,
        activeBranch,
        pendingBranch,
        pendingId,
        effects,
        parentComponent,
        container
      } = suspense;

      if (suspense.isHydrating) {
        suspense.isHydrating = false;
      } else if (!resume) {
        const delayEnter = activeBranch && pendingBranch.transition && pendingBranch.transition.mode === 'out-in';

        if (delayEnter) {
          activeBranch.transition.afterLeave = () => {
            if (pendingId === suspense.pendingId) {
              move(pendingBranch, container, anchor, 0
              /* ENTER */
              );
            }
          };
        } // this is initial anchor on mount


        let {
          anchor
        } = suspense; // unmount current active tree

        if (activeBranch) {
          // if the fallback tree was mounted, it may have been moved
          // as part of a parent suspense. get the latest anchor for insertion
          anchor = next(activeBranch);
          unmount(activeBranch, parentComponent, suspense, true);
        }

        if (!delayEnter) {
          // move content from off-dom container to actual container
          move(pendingBranch, container, anchor, 0
          /* ENTER */
          );
        }
      }

      setActiveBranch(suspense, pendingBranch);
      suspense.pendingBranch = null;
      suspense.isInFallback = false; // flush buffered effects
      // check if there is a pending parent suspense

      let parent = suspense.parent;
      let hasUnresolvedAncestor = false;

      while (parent) {
        if (parent.pendingBranch) {
          // found a pending parent suspense, merge buffered post jobs
          // into that parent
          parent.effects.push(...effects);
          hasUnresolvedAncestor = true;
          break;
        }

        parent = parent.parent;
      } // no pending parent suspense, flush all jobs


      if (!hasUnresolvedAncestor) {
        queuePostFlushCb(effects);
      }

      suspense.effects = []; // invoke @resolve event

      triggerEvent(vnode, 'onResolve');
    },

    fallback(fallbackVNode) {
      if (!suspense.pendingBranch) {
        return;
      }

      const {
        vnode,
        activeBranch,
        parentComponent,
        container,
        isSVG
      } = suspense; // invoke @fallback event

      triggerEvent(vnode, 'onFallback');
      const anchor = next(activeBranch);

      const mountFallback = () => {
        if (!suspense.isInFallback) {
          return;
        } // mount the fallback tree


        patch(null, fallbackVNode, container, anchor, parentComponent, null, // fallback tree will not have suspense context
        isSVG, slotScopeIds, optimized);
        setActiveBranch(suspense, fallbackVNode);
      };

      const delayEnter = fallbackVNode.transition && fallbackVNode.transition.mode === 'out-in';

      if (delayEnter) {
        activeBranch.transition.afterLeave = mountFallback;
      }

      suspense.isInFallback = true; // unmount current active branch

      unmount(activeBranch, parentComponent, null, // no suspense so unmount hooks fire now
      true // shouldRemove
      );

      if (!delayEnter) {
        mountFallback();
      }
    },

    move(container, anchor, type) {
      suspense.activeBranch && move(suspense.activeBranch, container, anchor, type);
      suspense.container = container;
    },

    next() {
      return suspense.activeBranch && next(suspense.activeBranch);
    },

    registerDep(instance, setupRenderEffect) {
      const isInPendingSuspense = !!suspense.pendingBranch;

      if (isInPendingSuspense) {
        suspense.deps++;
      }

      const hydratedEl = instance.vnode.el;
      instance.asyncDep.catch(err => {
        handleError(err, instance, 0
        /* SETUP_FUNCTION */
        );
      }).then(asyncSetupResult => {
        // retry when the setup() promise resolves.
        // component may have been unmounted before resolve.
        if (instance.isUnmounted || suspense.isUnmounted || suspense.pendingId !== instance.suspenseId) {
          return;
        } // retry from this component


        instance.asyncResolved = true;
        const {
          vnode
        } = instance;

        if (false) {}

        handleSetupResult(instance, asyncSetupResult, false);

        if (hydratedEl) {
          // vnode may have been replaced if an update happened before the
          // async dep is resolved.
          vnode.el = hydratedEl;
        }

        const placeholder = !hydratedEl && instance.subTree.el;
        setupRenderEffect(instance, vnode, // component may have been moved before resolve.
        // if this is not a hydration, instance.subTree will be the comment
        // placeholder.
        parentNode(hydratedEl || instance.subTree.el), // anchor will not be used if this is hydration, so only need to
        // consider the comment placeholder case.
        hydratedEl ? null : next(instance.subTree), suspense, isSVG, optimized);

        if (placeholder) {
          remove(placeholder);
        }

        updateHOCHostEl(instance, vnode.el);

        if (false) {} // only decrease deps count if suspense is not already resolved


        if (isInPendingSuspense && --suspense.deps === 0) {
          suspense.resolve();
        }
      });
    },

    unmount(parentSuspense, doRemove) {
      suspense.isUnmounted = true;

      if (suspense.activeBranch) {
        unmount(suspense.activeBranch, parentComponent, parentSuspense, doRemove);
      }

      if (suspense.pendingBranch) {
        unmount(suspense.pendingBranch, parentComponent, parentSuspense, doRemove);
      }
    }

  };
  return suspense;
}

function hydrateSuspense(node, vnode, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, rendererInternals, hydrateNode) {
  /* eslint-disable no-restricted-globals */
  const suspense = vnode.suspense = createSuspenseBoundary(vnode, parentSuspense, parentComponent, node.parentNode, document.createElement('div'), null, isSVG, slotScopeIds, optimized, rendererInternals, true
  /* hydrating */
  ); // there are two possible scenarios for server-rendered suspense:
  // - success: ssr content should be fully resolved
  // - failure: ssr content should be the fallback branch.
  // however, on the client we don't really know if it has failed or not
  // attempt to hydrate the DOM assuming it has succeeded, but we still
  // need to construct a suspense boundary first

  const result = hydrateNode(node, suspense.pendingBranch = vnode.ssContent, parentComponent, suspense, slotScopeIds, optimized);

  if (suspense.deps === 0) {
    suspense.resolve();
  }

  return result;
  /* eslint-enable no-restricted-globals */
}

function normalizeSuspenseChildren(vnode) {
  const {
    shapeFlag,
    children
  } = vnode;
  const isSlotChildren = shapeFlag & 32
  /* SLOTS_CHILDREN */
  ;
  vnode.ssContent = normalizeSuspenseSlot(isSlotChildren ? children.default : children);
  vnode.ssFallback = isSlotChildren ? normalizeSuspenseSlot(children.fallback) : runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Comment);
}

function normalizeSuspenseSlot(s) {
  let block;

  if (shared_esm_bundler_isFunction(s)) {
    const trackBlock = isBlockTreeEnabled && s._c;

    if (trackBlock) {
      // disableTracking: false
      // allow block tracking for compiled slots
      // (see ./componentRenderContext.ts)
      s._d = false;
      runtime_core_esm_bundler_openBlock();
    }

    s = s();

    if (trackBlock) {
      s._d = true;
      block = currentBlock;
      closeBlock();
    }
  }

  if (shared_esm_bundler_isArray(s)) {
    const singleChild = filterSingleRoot(s);

    if (false) {}

    s = singleChild;
  }

  s = normalizeVNode(s);

  if (block && !s.dynamicChildren) {
    s.dynamicChildren = block.filter(c => c !== s);
  }

  return s;
}

function queueEffectWithSuspense(fn, suspense) {
  if (suspense && suspense.pendingBranch) {
    if (shared_esm_bundler_isArray(fn)) {
      suspense.effects.push(...fn);
    } else {
      suspense.effects.push(fn);
    }
  } else {
    queuePostFlushCb(fn);
  }
}

function setActiveBranch(suspense, branch) {
  suspense.activeBranch = branch;
  const {
    vnode,
    parentComponent
  } = suspense;
  const el = vnode.el = branch.el; // in case suspense is the root node of a component,
  // recursively update the HOC el

  if (parentComponent && parentComponent.subTree === vnode) {
    parentComponent.vnode.el = el;
    updateHOCHostEl(parentComponent, el);
  }
}

function runtime_core_esm_bundler_provide(key, value) {
  if (!currentInstance) {
    if (false) {}
  } else {
    let provides = currentInstance.provides; // by default an instance inherits its parent's provides object
    // but when it needs to provide values of its own, it creates its
    // own provides object using parent provides object as prototype.
    // this way in `inject` we can simply look up injections from direct
    // parent and let the prototype chain do the work.

    const parentProvides = currentInstance.parent && currentInstance.parent.provides;

    if (parentProvides === provides) {
      provides = currentInstance.provides = Object.create(parentProvides);
    } // TS doesn't allow symbol as index type


    provides[key] = value;
  }
}

function runtime_core_esm_bundler_inject(key, defaultValue, treatDefaultAsFactory = false) {
  // fallback to `currentRenderingInstance` so that this can be called in
  // a functional component
  const instance = currentInstance || currentRenderingInstance;

  if (instance) {
    // #2400
    // to support `app.use` plugins,
    // fallback to appContext's `provides` if the instance is at root
    const provides = instance.parent == null ? instance.vnode.appContext && instance.vnode.appContext.provides : instance.parent.provides;

    if (provides && key in provides) {
      // TS doesn't allow symbol as index type
      return provides[key];
    } else if (arguments.length > 1) {
      return treatDefaultAsFactory && shared_esm_bundler_isFunction(defaultValue) ? defaultValue.call(instance.proxy) : defaultValue;
    } else if (false) {}
  } else if (false) {}
} // Simple effect.


function runtime_core_esm_bundler_watchEffect(effect, options) {
  return doWatch(effect, null, options);
}

function runtime_core_esm_bundler_watchPostEffect(effect, options) {
  return doWatch(effect, null,  false ? 0 : {
    flush: 'post'
  });
}

function watchSyncEffect(effect, options) {
  return doWatch(effect, null,  false ? 0 : {
    flush: 'sync'
  });
} // initial value for watchers to trigger on undefined initial values


const INITIAL_WATCHER_VALUE = {}; // implementation

function runtime_core_esm_bundler_watch(source, cb, options) {
  if (false) {}

  return doWatch(source, cb, options);
}

function doWatch(source, cb, {
  immediate,
  deep,
  flush,
  onTrack,
  onTrigger
} = shared_esm_bundler_EMPTY_OBJ) {
  if (false) {}

  const warnInvalidSource = s => {
    runtime_core_esm_bundler_warn(`Invalid watch source: `, s, `A watch source can only be a getter/effect function, a ref, ` + `a reactive object, or an array of these types.`);
  };

  const instance = currentInstance;
  let getter;
  let forceTrigger = false;
  let isMultiSource = false;

  if (reactivity_esm_bundler_isRef(source)) {
    getter = () => source.value;

    forceTrigger = isShallow(source);
  } else if (reactivity_esm_bundler_isReactive(source)) {
    getter = () => source;

    deep = true;
  } else if (shared_esm_bundler_isArray(source)) {
    isMultiSource = true;
    forceTrigger = source.some(reactivity_esm_bundler_isReactive);

    getter = () => source.map(s => {
      if (reactivity_esm_bundler_isRef(s)) {
        return s.value;
      } else if (reactivity_esm_bundler_isReactive(s)) {
        return traverse(s);
      } else if (shared_esm_bundler_isFunction(s)) {
        return callWithErrorHandling(s, instance, 2
        /* WATCH_GETTER */
        );
      } else {
         false && 0;
      }
    });
  } else if (shared_esm_bundler_isFunction(source)) {
    if (cb) {
      // getter with cb
      getter = () => callWithErrorHandling(source, instance, 2
      /* WATCH_GETTER */
      );
    } else {
      // no cb -> simple effect
      getter = () => {
        if (instance && instance.isUnmounted) {
          return;
        }

        if (cleanup) {
          cleanup();
        }

        return callWithAsyncErrorHandling(source, instance, 3
        /* WATCH_CALLBACK */
        , [onCleanup]);
      };
    }
  } else {
    getter = shared_esm_bundler_NOOP;
     false && 0;
  }

  if (cb && deep) {
    const baseGetter = getter;

    getter = () => traverse(baseGetter());
  }

  let cleanup;

  let onCleanup = fn => {
    cleanup = effect.onStop = () => {
      callWithErrorHandling(fn, instance, 4
      /* WATCH_CLEANUP */
      );
    };
  }; // in SSR there is no need to setup an actual effect, and it should be noop
  // unless it's eager


  if (isInSSRComponentSetup) {
    // we will also not call the invalidate callback (+ runner is not set up)
    onCleanup = shared_esm_bundler_NOOP;

    if (!cb) {
      getter();
    } else if (immediate) {
      callWithAsyncErrorHandling(cb, instance, 3
      /* WATCH_CALLBACK */
      , [getter(), isMultiSource ? [] : undefined, onCleanup]);
    }

    return shared_esm_bundler_NOOP;
  }

  let oldValue = isMultiSource ? [] : INITIAL_WATCHER_VALUE;

  const job = () => {
    if (!effect.active) {
      return;
    }

    if (cb) {
      // watch(source, cb)
      const newValue = effect.run();

      if (deep || forceTrigger || (isMultiSource ? newValue.some((v, i) => hasChanged(v, oldValue[i])) : hasChanged(newValue, oldValue)) || false) {
        // cleanup before running cb again
        if (cleanup) {
          cleanup();
        }

        callWithAsyncErrorHandling(cb, instance, 3
        /* WATCH_CALLBACK */
        , [newValue, // pass undefined as the old value when it's changed for the first time
        oldValue === INITIAL_WATCHER_VALUE ? undefined : oldValue, onCleanup]);
        oldValue = newValue;
      }
    } else {
      // watchEffect
      effect.run();
    }
  }; // important: mark the job as a watcher callback so that scheduler knows
  // it is allowed to self-trigger (#1727)


  job.allowRecurse = !!cb;
  let scheduler;

  if (flush === 'sync') {
    scheduler = job; // the scheduler function gets called directly
  } else if (flush === 'post') {
    scheduler = () => queuePostRenderEffect(job, instance && instance.suspense);
  } else {
    // default: 'pre'
    scheduler = () => {
      if (!instance || instance.isMounted) {
        queuePreFlushCb(job);
      } else {
        // with 'pre' option, the first call must happen before
        // the component is mounted so it is called synchronously.
        job();
      }
    };
  }

  const effect = new ReactiveEffect(getter, scheduler);

  if (false) {} // initial run


  if (cb) {
    if (immediate) {
      job();
    } else {
      oldValue = effect.run();
    }
  } else if (flush === 'post') {
    queuePostRenderEffect(effect.run.bind(effect), instance && instance.suspense);
  } else {
    effect.run();
  }

  return () => {
    effect.stop();

    if (instance && instance.scope) {
      remove(instance.scope.effects, effect);
    }
  };
} // this.$watch


function instanceWatch(source, value, options) {
  const publicThis = this.proxy;
  const getter = shared_esm_bundler_isString(source) ? source.includes('.') ? createPathGetter(publicThis, source) : () => publicThis[source] : source.bind(publicThis, publicThis);
  let cb;

  if (shared_esm_bundler_isFunction(value)) {
    cb = value;
  } else {
    cb = value.handler;
    options = value;
  }

  const cur = currentInstance;
  setCurrentInstance(this);
  const res = doWatch(getter, cb.bind(publicThis), options);

  if (cur) {
    setCurrentInstance(cur);
  } else {
    unsetCurrentInstance();
  }

  return res;
}

function createPathGetter(ctx, path) {
  const segments = path.split('.');
  return () => {
    let cur = ctx;

    for (let i = 0; i < segments.length && cur; i++) {
      cur = cur[segments[i]];
    }

    return cur;
  };
}

function traverse(value, seen) {
  if (!shared_esm_bundler_isObject(value) || value["__v_skip"
  /* SKIP */
  ]) {
    return value;
  }

  seen = seen || new Set();

  if (seen.has(value)) {
    return value;
  }

  seen.add(value);

  if (reactivity_esm_bundler_isRef(value)) {
    traverse(value.value, seen);
  } else if (shared_esm_bundler_isArray(value)) {
    for (let i = 0; i < value.length; i++) {
      traverse(value[i], seen);
    }
  } else if (shared_esm_bundler_isSet(value) || isMap(value)) {
    value.forEach(v => {
      traverse(v, seen);
    });
  } else if (isPlainObject(value)) {
    for (const key in value) {
      traverse(value[key], seen);
    }
  }

  return value;
}

function useTransitionState() {
  const state = {
    isMounted: false,
    isLeaving: false,
    isUnmounting: false,
    leavingVNodes: new Map()
  };
  runtime_core_esm_bundler_onMounted(() => {
    state.isMounted = true;
  });
  runtime_core_esm_bundler_onBeforeUnmount(() => {
    state.isUnmounting = true;
  });
  return state;
}

const TransitionHookValidator = [Function, Array];
const BaseTransitionImpl = {
  name: `BaseTransition`,
  props: {
    mode: String,
    appear: Boolean,
    persisted: Boolean,
    // enter
    onBeforeEnter: TransitionHookValidator,
    onEnter: TransitionHookValidator,
    onAfterEnter: TransitionHookValidator,
    onEnterCancelled: TransitionHookValidator,
    // leave
    onBeforeLeave: TransitionHookValidator,
    onLeave: TransitionHookValidator,
    onAfterLeave: TransitionHookValidator,
    onLeaveCancelled: TransitionHookValidator,
    // appear
    onBeforeAppear: TransitionHookValidator,
    onAppear: TransitionHookValidator,
    onAfterAppear: TransitionHookValidator,
    onAppearCancelled: TransitionHookValidator
  },

  setup(props, {
    slots
  }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const state = useTransitionState();
    let prevTransitionKey;
    return () => {
      const children = slots.default && getTransitionRawChildren(slots.default(), true);

      if (!children || !children.length) {
        return;
      } // warn multiple elements


      if (false) {} // there's no need to track reactivity for these props so use the raw
      // props for a bit better perf


      const rawProps = reactivity_esm_bundler_toRaw(props);
      const {
        mode
      } = rawProps; // check mode

      if (false) {} // at this point children has a guaranteed length of 1.


      const child = children[0];

      if (state.isLeaving) {
        return emptyPlaceholder(child);
      } // in the case of <transition><keep-alive/></transition>, we need to
      // compare the type of the kept-alive children.


      const innerChild = getKeepAliveChild(child);

      if (!innerChild) {
        return emptyPlaceholder(child);
      }

      const enterHooks = resolveTransitionHooks(innerChild, rawProps, state, instance);
      setTransitionHooks(innerChild, enterHooks);
      const oldChild = instance.subTree;
      const oldInnerChild = oldChild && getKeepAliveChild(oldChild);
      let transitionKeyChanged = false;
      const {
        getTransitionKey
      } = innerChild.type;

      if (getTransitionKey) {
        const key = getTransitionKey();

        if (prevTransitionKey === undefined) {
          prevTransitionKey = key;
        } else if (key !== prevTransitionKey) {
          prevTransitionKey = key;
          transitionKeyChanged = true;
        }
      } // handle mode


      if (oldInnerChild && oldInnerChild.type !== runtime_core_esm_bundler_Comment && (!isSameVNodeType(innerChild, oldInnerChild) || transitionKeyChanged)) {
        const leavingHooks = resolveTransitionHooks(oldInnerChild, rawProps, state, instance); // update old tree's hooks in case of dynamic transition

        setTransitionHooks(oldInnerChild, leavingHooks); // switching between different views

        if (mode === 'out-in') {
          state.isLeaving = true; // return placeholder node and queue update when leave finishes

          leavingHooks.afterLeave = () => {
            state.isLeaving = false;
            instance.update();
          };

          return emptyPlaceholder(child);
        } else if (mode === 'in-out' && innerChild.type !== runtime_core_esm_bundler_Comment) {
          leavingHooks.delayLeave = (el, earlyRemove, delayedLeave) => {
            const leavingVNodesCache = getLeavingNodesForType(state, oldInnerChild);
            leavingVNodesCache[String(oldInnerChild.key)] = oldInnerChild; // early removal callback

            el._leaveCb = () => {
              earlyRemove();
              el._leaveCb = undefined;
              delete enterHooks.delayedLeave;
            };

            enterHooks.delayedLeave = delayedLeave;
          };
        }
      }

      return child;
    };
  }

}; // export the public type for h/tsx inference
// also to avoid inline import() in generated d.ts files

const BaseTransition = BaseTransitionImpl;

function getLeavingNodesForType(state, vnode) {
  const {
    leavingVNodes
  } = state;
  let leavingVNodesCache = leavingVNodes.get(vnode.type);

  if (!leavingVNodesCache) {
    leavingVNodesCache = Object.create(null);
    leavingVNodes.set(vnode.type, leavingVNodesCache);
  }

  return leavingVNodesCache;
} // The transition hooks are attached to the vnode as vnode.transition
// and will be called at appropriate timing in the renderer.


function resolveTransitionHooks(vnode, props, state, instance) {
  const {
    appear,
    mode,
    persisted = false,
    onBeforeEnter,
    onEnter,
    onAfterEnter,
    onEnterCancelled,
    onBeforeLeave,
    onLeave,
    onAfterLeave,
    onLeaveCancelled,
    onBeforeAppear,
    onAppear,
    onAfterAppear,
    onAppearCancelled
  } = props;
  const key = String(vnode.key);
  const leavingVNodesCache = getLeavingNodesForType(state, vnode);

  const callHook = (hook, args) => {
    hook && callWithAsyncErrorHandling(hook, instance, 9
    /* TRANSITION_HOOK */
    , args);
  };

  const hooks = {
    mode,
    persisted,

    beforeEnter(el) {
      let hook = onBeforeEnter;

      if (!state.isMounted) {
        if (appear) {
          hook = onBeforeAppear || onBeforeEnter;
        } else {
          return;
        }
      } // for same element (v-show)


      if (el._leaveCb) {
        el._leaveCb(true
        /* cancelled */
        );
      } // for toggled element with same key (v-if)


      const leavingVNode = leavingVNodesCache[key];

      if (leavingVNode && isSameVNodeType(vnode, leavingVNode) && leavingVNode.el._leaveCb) {
        // force early removal (not cancelled)
        leavingVNode.el._leaveCb();
      }

      callHook(hook, [el]);
    },

    enter(el) {
      let hook = onEnter;
      let afterHook = onAfterEnter;
      let cancelHook = onEnterCancelled;

      if (!state.isMounted) {
        if (appear) {
          hook = onAppear || onEnter;
          afterHook = onAfterAppear || onAfterEnter;
          cancelHook = onAppearCancelled || onEnterCancelled;
        } else {
          return;
        }
      }

      let called = false;

      const done = el._enterCb = cancelled => {
        if (called) return;
        called = true;

        if (cancelled) {
          callHook(cancelHook, [el]);
        } else {
          callHook(afterHook, [el]);
        }

        if (hooks.delayedLeave) {
          hooks.delayedLeave();
        }

        el._enterCb = undefined;
      };

      if (hook) {
        hook(el, done);

        if (hook.length <= 1) {
          done();
        }
      } else {
        done();
      }
    },

    leave(el, remove) {
      const key = String(vnode.key);

      if (el._enterCb) {
        el._enterCb(true
        /* cancelled */
        );
      }

      if (state.isUnmounting) {
        return remove();
      }

      callHook(onBeforeLeave, [el]);
      let called = false;

      const done = el._leaveCb = cancelled => {
        if (called) return;
        called = true;
        remove();

        if (cancelled) {
          callHook(onLeaveCancelled, [el]);
        } else {
          callHook(onAfterLeave, [el]);
        }

        el._leaveCb = undefined;

        if (leavingVNodesCache[key] === vnode) {
          delete leavingVNodesCache[key];
        }
      };

      leavingVNodesCache[key] = vnode;

      if (onLeave) {
        onLeave(el, done);

        if (onLeave.length <= 1) {
          done();
        }
      } else {
        done();
      }
    },

    clone(vnode) {
      return resolveTransitionHooks(vnode, props, state, instance);
    }

  };
  return hooks;
} // the placeholder really only handles one special case: KeepAlive
// in the case of a KeepAlive in a leave phase we need to return a KeepAlive
// placeholder with empty content to avoid the KeepAlive instance from being
// unmounted.


function emptyPlaceholder(vnode) {
  if (isKeepAlive(vnode)) {
    vnode = cloneVNode(vnode);
    vnode.children = null;
    return vnode;
  }
}

function getKeepAliveChild(vnode) {
  return isKeepAlive(vnode) ? vnode.children ? vnode.children[0] : undefined : vnode;
}

function setTransitionHooks(vnode, hooks) {
  if (vnode.shapeFlag & 6
  /* COMPONENT */
  && vnode.component) {
    setTransitionHooks(vnode.component.subTree, hooks);
  } else if (vnode.shapeFlag & 128
  /* SUSPENSE */
  ) {
    vnode.ssContent.transition = hooks.clone(vnode.ssContent);
    vnode.ssFallback.transition = hooks.clone(vnode.ssFallback);
  } else {
    vnode.transition = hooks;
  }
}

function getTransitionRawChildren(children, keepComment = false) {
  let ret = [];
  let keyedFragmentCount = 0;

  for (let i = 0; i < children.length; i++) {
    const child = children[i]; // handle fragment children case, e.g. v-for

    if (child.type === runtime_core_esm_bundler_Fragment) {
      if (child.patchFlag & 128
      /* KEYED_FRAGMENT */
      ) keyedFragmentCount++;
      ret = ret.concat(getTransitionRawChildren(child.children, keepComment));
    } // comment placeholders should be skipped, e.g. v-if
    else if (keepComment || child.type !== runtime_core_esm_bundler_Comment) {
      ret.push(child);
    }
  } // #1126 if a transition children list contains multiple sub fragments, these
  // fragments will be merged into a flat children array. Since each v-for
  // fragment may contain different static bindings inside, we need to de-op
  // these children to force full diffs to ensure correct behavior.


  if (keyedFragmentCount > 1) {
    for (let i = 0; i < ret.length; i++) {
      ret[i].patchFlag = -2
      /* BAIL */
      ;
    }
  }

  return ret;
} // implementation, close to no-op


function runtime_core_esm_bundler_defineComponent(options) {
  return shared_esm_bundler_isFunction(options) ? {
    setup: options,
    name: options.name
  } : options;
}

const isAsyncWrapper = i => !!i.type.__asyncLoader;

function defineAsyncComponent(source) {
  if (isFunction(source)) {
    source = {
      loader: source
    };
  }

  const {
    loader,
    loadingComponent,
    errorComponent,
    delay = 200,
    timeout,
    // undefined = never times out
    suspensible = true,
    onError: userOnError
  } = source;
  let pendingRequest = null;
  let resolvedComp;
  let retries = 0;

  const retry = () => {
    retries++;
    pendingRequest = null;
    return load();
  };

  const load = () => {
    let thisRequest;
    return pendingRequest || (thisRequest = pendingRequest = loader().catch(err => {
      err = err instanceof Error ? err : new Error(String(err));

      if (userOnError) {
        return new Promise((resolve, reject) => {
          const userRetry = () => resolve(retry());

          const userFail = () => reject(err);

          userOnError(err, userRetry, userFail, retries + 1);
        });
      } else {
        throw err;
      }
    }).then(comp => {
      if (thisRequest !== pendingRequest && pendingRequest) {
        return pendingRequest;
      }

      if (false) {} // interop module default


      if (comp && (comp.__esModule || comp[Symbol.toStringTag] === 'Module')) {
        comp = comp.default;
      }

      if (false) {}

      resolvedComp = comp;
      return comp;
    }));
  };

  return runtime_core_esm_bundler_defineComponent({
    name: 'AsyncComponentWrapper',
    __asyncLoader: load,

    get __asyncResolved() {
      return resolvedComp;
    },

    setup() {
      const instance = currentInstance; // already resolved

      if (resolvedComp) {
        return () => createInnerComp(resolvedComp, instance);
      }

      const onError = err => {
        pendingRequest = null;
        handleError(err, instance, 13
        /* ASYNC_COMPONENT_LOADER */
        , !errorComponent
        /* do not throw in dev if user provided error component */
        );
      }; // suspense-controlled or SSR.


      if (suspensible && instance.suspense || isInSSRComponentSetup) {
        return load().then(comp => {
          return () => createInnerComp(comp, instance);
        }).catch(err => {
          onError(err);
          return () => errorComponent ? runtime_core_esm_bundler_createVNode(errorComponent, {
            error: err
          }) : null;
        });
      }

      const loaded = ref(false);
      const error = ref();
      const delayed = ref(!!delay);

      if (delay) {
        setTimeout(() => {
          delayed.value = false;
        }, delay);
      }

      if (timeout != null) {
        setTimeout(() => {
          if (!loaded.value && !error.value) {
            const err = new Error(`Async component timed out after ${timeout}ms.`);
            onError(err);
            error.value = err;
          }
        }, timeout);
      }

      load().then(() => {
        loaded.value = true;

        if (instance.parent && isKeepAlive(instance.parent.vnode)) {
          // parent is keep-alive, force update so the loaded component's
          // name is taken into account
          queueJob(instance.parent.update);
        }
      }).catch(err => {
        onError(err);
        error.value = err;
      });
      return () => {
        if (loaded.value && resolvedComp) {
          return createInnerComp(resolvedComp, instance);
        } else if (error.value && errorComponent) {
          return runtime_core_esm_bundler_createVNode(errorComponent, {
            error: error.value
          });
        } else if (loadingComponent && !delayed.value) {
          return runtime_core_esm_bundler_createVNode(loadingComponent);
        }
      };
    }

  });
}

function createInnerComp(comp, {
  vnode: {
    ref,
    props,
    children
  }
}) {
  const vnode = runtime_core_esm_bundler_createVNode(comp, props, children); // ensure inner component inherits the async wrapper's ref owner

  vnode.ref = ref;
  return vnode;
}

const isKeepAlive = vnode => vnode.type.__isKeepAlive;

const KeepAliveImpl = {
  name: `KeepAlive`,
  // Marker for special handling inside the renderer. We are not using a ===
  // check directly on KeepAlive in the renderer, because importing it directly
  // would prevent it from being tree-shaken.
  __isKeepAlive: true,
  props: {
    include: [String, RegExp, Array],
    exclude: [String, RegExp, Array],
    max: [String, Number]
  },

  setup(props, {
    slots
  }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance(); // KeepAlive communicates with the instantiated renderer via the
    // ctx where the renderer passes in its internals,
    // and the KeepAlive instance exposes activate/deactivate implementations.
    // The whole point of this is to avoid importing KeepAlive directly in the
    // renderer to facilitate tree-shaking.

    const sharedContext = instance.ctx; // if the internal renderer is not registered, it indicates that this is server-side rendering,
    // for KeepAlive, we just need to render its children

    if (!sharedContext.renderer) {
      return slots.default;
    }

    const cache = new Map();
    const keys = new Set();
    let current = null;

    if ( false || __VUE_PROD_DEVTOOLS__) {
      instance.__v_cache = cache;
    }

    const parentSuspense = instance.suspense;
    const {
      renderer: {
        p: patch,
        m: move,
        um: _unmount,
        o: {
          createElement
        }
      }
    } = sharedContext;
    const storageContainer = createElement('div');

    sharedContext.activate = (vnode, container, anchor, isSVG, optimized) => {
      const instance = vnode.component;
      move(vnode, container, anchor, 0
      /* ENTER */
      , parentSuspense); // in case props have changed

      patch(instance.vnode, vnode, container, anchor, instance, parentSuspense, isSVG, vnode.slotScopeIds, optimized);
      queuePostRenderEffect(() => {
        instance.isDeactivated = false;

        if (instance.a) {
          invokeArrayFns(instance.a);
        }

        const vnodeHook = vnode.props && vnode.props.onVnodeMounted;

        if (vnodeHook) {
          invokeVNodeHook(vnodeHook, instance.parent, vnode);
        }
      }, parentSuspense);

      if ( false || __VUE_PROD_DEVTOOLS__) {
        // Update components tree
        devtoolsComponentAdded(instance);
      }
    };

    sharedContext.deactivate = vnode => {
      const instance = vnode.component;
      move(vnode, storageContainer, null, 1
      /* LEAVE */
      , parentSuspense);
      queuePostRenderEffect(() => {
        if (instance.da) {
          invokeArrayFns(instance.da);
        }

        const vnodeHook = vnode.props && vnode.props.onVnodeUnmounted;

        if (vnodeHook) {
          invokeVNodeHook(vnodeHook, instance.parent, vnode);
        }

        instance.isDeactivated = true;
      }, parentSuspense);

      if ( false || __VUE_PROD_DEVTOOLS__) {
        // Update components tree
        devtoolsComponentAdded(instance);
      }
    };

    function unmount(vnode) {
      // reset the shapeFlag so it can be properly unmounted
      resetShapeFlag(vnode);

      _unmount(vnode, instance, parentSuspense, true);
    }

    function pruneCache(filter) {
      cache.forEach((vnode, key) => {
        const name = getComponentName(vnode.type);

        if (name && (!filter || !filter(name))) {
          pruneCacheEntry(key);
        }
      });
    }

    function pruneCacheEntry(key) {
      const cached = cache.get(key);

      if (!current || cached.type !== current.type) {
        unmount(cached);
      } else if (current) {
        // current active instance should no longer be kept-alive.
        // we can't unmount it now but it might be later, so reset its flag now.
        resetShapeFlag(current);
      }

      cache.delete(key);
      keys.delete(key);
    } // prune cache on include/exclude prop change


    runtime_core_esm_bundler_watch(() => [props.include, props.exclude], ([include, exclude]) => {
      include && pruneCache(name => matches(include, name));
      exclude && pruneCache(name => !matches(exclude, name));
    }, // prune post-render after `current` has been updated
    {
      flush: 'post',
      deep: true
    }); // cache sub tree after render

    let pendingCacheKey = null;

    const cacheSubtree = () => {
      // fix #1621, the pendingCacheKey could be 0
      if (pendingCacheKey != null) {
        cache.set(pendingCacheKey, getInnerChild(instance.subTree));
      }
    };

    runtime_core_esm_bundler_onMounted(cacheSubtree);
    runtime_core_esm_bundler_onUpdated(cacheSubtree);
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      cache.forEach(cached => {
        const {
          subTree,
          suspense
        } = instance;
        const vnode = getInnerChild(subTree);

        if (cached.type === vnode.type) {
          // current instance will be unmounted as part of keep-alive's unmount
          resetShapeFlag(vnode); // but invoke its deactivated hook here

          const da = vnode.component.da;
          da && queuePostRenderEffect(da, suspense);
          return;
        }

        unmount(cached);
      });
    });
    return () => {
      pendingCacheKey = null;

      if (!slots.default) {
        return null;
      }

      const children = slots.default();
      const rawVNode = children[0];

      if (children.length > 1) {
        if (false) {}

        current = null;
        return children;
      } else if (!runtime_core_esm_bundler_isVNode(rawVNode) || !(rawVNode.shapeFlag & 4
      /* STATEFUL_COMPONENT */
      ) && !(rawVNode.shapeFlag & 128
      /* SUSPENSE */
      )) {
        current = null;
        return rawVNode;
      }

      let vnode = getInnerChild(rawVNode);
      const comp = vnode.type; // for async components, name check should be based in its loaded
      // inner component if available

      const name = getComponentName(isAsyncWrapper(vnode) ? vnode.type.__asyncResolved || {} : comp);
      const {
        include,
        exclude,
        max
      } = props;

      if (include && (!name || !matches(include, name)) || exclude && name && matches(exclude, name)) {
        current = vnode;
        return rawVNode;
      }

      const key = vnode.key == null ? comp : vnode.key;
      const cachedVNode = cache.get(key); // clone vnode if it's reused because we are going to mutate it

      if (vnode.el) {
        vnode = cloneVNode(vnode);

        if (rawVNode.shapeFlag & 128
        /* SUSPENSE */
        ) {
          rawVNode.ssContent = vnode;
        }
      } // #1513 it's possible for the returned vnode to be cloned due to attr
      // fallthrough or scopeId, so the vnode here may not be the final vnode
      // that is mounted. Instead of caching it directly, we store the pending
      // key and cache `instance.subTree` (the normalized vnode) in
      // beforeMount/beforeUpdate hooks.


      pendingCacheKey = key;

      if (cachedVNode) {
        // copy over mounted state
        vnode.el = cachedVNode.el;
        vnode.component = cachedVNode.component;

        if (vnode.transition) {
          // recursively update transition hooks on subTree
          setTransitionHooks(vnode, vnode.transition);
        } // avoid vnode being mounted as fresh


        vnode.shapeFlag |= 512
        /* COMPONENT_KEPT_ALIVE */
        ; // make this key the freshest

        keys.delete(key);
        keys.add(key);
      } else {
        keys.add(key); // prune oldest entry

        if (max && keys.size > parseInt(max, 10)) {
          pruneCacheEntry(keys.values().next().value);
        }
      } // avoid vnode being unmounted


      vnode.shapeFlag |= 256
      /* COMPONENT_SHOULD_KEEP_ALIVE */
      ;
      current = vnode;
      return rawVNode;
    };
  }

}; // export the public type for h/tsx inference
// also to avoid inline import() in generated d.ts files

const KeepAlive = (/* unused pure expression or super */ null && (KeepAliveImpl));

function matches(pattern, name) {
  if (shared_esm_bundler_isArray(pattern)) {
    return pattern.some(p => matches(p, name));
  } else if (shared_esm_bundler_isString(pattern)) {
    return pattern.split(',').includes(name);
  } else if (pattern.test) {
    return pattern.test(name);
  }
  /* istanbul ignore next */


  return false;
}

function runtime_core_esm_bundler_onActivated(hook, target) {
  registerKeepAliveHook(hook, "a"
  /* ACTIVATED */
  , target);
}

function runtime_core_esm_bundler_onDeactivated(hook, target) {
  registerKeepAliveHook(hook, "da"
  /* DEACTIVATED */
  , target);
}

function registerKeepAliveHook(hook, type, target = currentInstance) {
  // cache the deactivate branch check wrapper for injected hooks so the same
  // hook can be properly deduped by the scheduler. "__wdc" stands for "with
  // deactivation check".
  const wrappedHook = hook.__wdc || (hook.__wdc = () => {
    // only fire the hook if the target instance is NOT in a deactivated branch.
    let current = target;

    while (current) {
      if (current.isDeactivated) {
        return;
      }

      current = current.parent;
    }

    return hook();
  });

  injectHook(type, wrappedHook, target); // In addition to registering it on the target instance, we walk up the parent
  // chain and register it on all ancestor instances that are keep-alive roots.
  // This avoids the need to walk the entire component tree when invoking these
  // hooks, and more importantly, avoids the need to track child components in
  // arrays.

  if (target) {
    let current = target.parent;

    while (current && current.parent) {
      if (isKeepAlive(current.parent.vnode)) {
        injectToKeepAliveRoot(wrappedHook, type, target, current);
      }

      current = current.parent;
    }
  }
}

function injectToKeepAliveRoot(hook, type, target, keepAliveRoot) {
  // injectHook wraps the original for error handling, so make sure to remove
  // the wrapped version.
  const injected = injectHook(type, hook, keepAliveRoot, true
  /* prepend */
  );
  runtime_core_esm_bundler_onUnmounted(() => {
    remove(keepAliveRoot[type], injected);
  }, target);
}

function resetShapeFlag(vnode) {
  let shapeFlag = vnode.shapeFlag;

  if (shapeFlag & 256
  /* COMPONENT_SHOULD_KEEP_ALIVE */
  ) {
    shapeFlag -= 256
    /* COMPONENT_SHOULD_KEEP_ALIVE */
    ;
  }

  if (shapeFlag & 512
  /* COMPONENT_KEPT_ALIVE */
  ) {
    shapeFlag -= 512
    /* COMPONENT_KEPT_ALIVE */
    ;
  }

  vnode.shapeFlag = shapeFlag;
}

function getInnerChild(vnode) {
  return vnode.shapeFlag & 128
  /* SUSPENSE */
  ? vnode.ssContent : vnode;
}

function injectHook(type, hook, target = currentInstance, prepend = false) {
  if (target) {
    const hooks = target[type] || (target[type] = []); // cache the error handling wrapper for injected hooks so the same hook
    // can be properly deduped by the scheduler. "__weh" stands for "with error
    // handling".

    const wrappedHook = hook.__weh || (hook.__weh = (...args) => {
      if (target.isUnmounted) {
        return;
      } // disable tracking inside all lifecycle hooks
      // since they can potentially be called inside effects.


      pauseTracking(); // Set currentInstance during hook invocation.
      // This assumes the hook does not synchronously trigger other hooks, which
      // can only be false when the user does something really funky.

      setCurrentInstance(target);
      const res = callWithAsyncErrorHandling(hook, target, type, args);
      unsetCurrentInstance();
      resetTracking();
      return res;
    });

    if (prepend) {
      hooks.unshift(wrappedHook);
    } else {
      hooks.push(wrappedHook);
    }

    return wrappedHook;
  } else if (false) {}
}

const createHook = lifecycle => (hook, target = currentInstance) => // post-create lifecycle registrations are noops during SSR (except for serverPrefetch)
(!isInSSRComponentSetup || lifecycle === "sp"
/* SERVER_PREFETCH */
) && injectHook(lifecycle, hook, target);

const onBeforeMount = createHook("bm"
/* BEFORE_MOUNT */
);
const runtime_core_esm_bundler_onMounted = createHook("m"
/* MOUNTED */
);
const runtime_core_esm_bundler_onBeforeUpdate = createHook("bu"
/* BEFORE_UPDATE */
);
const runtime_core_esm_bundler_onUpdated = createHook("u"
/* UPDATED */
);
const runtime_core_esm_bundler_onBeforeUnmount = createHook("bum"
/* BEFORE_UNMOUNT */
);
const runtime_core_esm_bundler_onUnmounted = createHook("um"
/* UNMOUNTED */
);
const onServerPrefetch = createHook("sp"
/* SERVER_PREFETCH */
);
const onRenderTriggered = createHook("rtg"
/* RENDER_TRIGGERED */
);
const onRenderTracked = createHook("rtc"
/* RENDER_TRACKED */
);

function onErrorCaptured(hook, target = currentInstance) {
  injectHook("ec"
  /* ERROR_CAPTURED */
  , hook, target);
}

function createDuplicateChecker() {
  const cache = Object.create(null);
  return (type, key) => {
    if (cache[key]) {
      runtime_core_esm_bundler_warn(`${type} property "${key}" is already defined in ${cache[key]}.`);
    } else {
      cache[key] = type;
    }
  };
}

let shouldCacheAccess = true;

function applyOptions(instance) {
  const options = resolveMergedOptions(instance);
  const publicThis = instance.proxy;
  const ctx = instance.ctx; // do not cache property access on public proxy during state initialization

  shouldCacheAccess = false; // call beforeCreate first before accessing other options since
  // the hook may mutate resolved options (#2791)

  if (options.beforeCreate) {
    callHook(options.beforeCreate, instance, "bc"
    /* BEFORE_CREATE */
    );
  }

  const {
    // state
    data: dataOptions,
    computed: computedOptions,
    methods,
    watch: watchOptions,
    provide: provideOptions,
    inject: injectOptions,
    // lifecycle
    created,
    beforeMount,
    mounted,
    beforeUpdate,
    updated,
    activated,
    deactivated,
    beforeDestroy,
    beforeUnmount,
    destroyed,
    unmounted,
    render,
    renderTracked,
    renderTriggered,
    errorCaptured,
    serverPrefetch,
    // public API
    expose,
    inheritAttrs,
    // assets
    components,
    directives,
    filters
  } = options;
  const checkDuplicateProperties =  false ? 0 : null;

  if (false) {} // options initialization order (to be consistent with Vue 2):
  // - props (already done outside of this function)
  // - inject
  // - methods
  // - data (deferred since it relies on `this` access)
  // - computed
  // - watch (deferred since it relies on `this` access)


  if (injectOptions) {
    resolveInjections(injectOptions, ctx, checkDuplicateProperties, instance.appContext.config.unwrapInjectedRef);
  }

  if (methods) {
    for (const key in methods) {
      const methodHandler = methods[key];

      if (shared_esm_bundler_isFunction(methodHandler)) {
        // In dev mode, we use the `createRenderContext` function to define
        // methods to the proxy target, and those are read-only but
        // reconfigurable, so it needs to be redefined here
        if (false) {} else {
          ctx[key] = methodHandler.bind(publicThis);
        }

        if (false) {}
      } else if (false) {}
    }
  }

  if (dataOptions) {
    if (false) {}

    const data = dataOptions.call(publicThis, publicThis);

    if (false) {}

    if (!shared_esm_bundler_isObject(data)) {
       false && 0;
    } else {
      instance.data = reactivity_esm_bundler_reactive(data);

      if (false) {}
    }
  } // state initialization complete at this point - start caching access


  shouldCacheAccess = true;

  if (computedOptions) {
    for (const key in computedOptions) {
      const opt = computedOptions[key];
      const get = shared_esm_bundler_isFunction(opt) ? opt.bind(publicThis, publicThis) : shared_esm_bundler_isFunction(opt.get) ? opt.get.bind(publicThis, publicThis) : shared_esm_bundler_NOOP;

      if (false) {}

      const set = !shared_esm_bundler_isFunction(opt) && shared_esm_bundler_isFunction(opt.set) ? opt.set.bind(publicThis) :  false ? 0 : shared_esm_bundler_NOOP;
      const c = runtime_core_esm_bundler_computed({
        get,
        set
      });
      Object.defineProperty(ctx, key, {
        enumerable: true,
        configurable: true,
        get: () => c.value,
        set: v => c.value = v
      });

      if (false) {}
    }
  }

  if (watchOptions) {
    for (const key in watchOptions) {
      createWatcher(watchOptions[key], ctx, publicThis, key);
    }
  }

  if (provideOptions) {
    const provides = shared_esm_bundler_isFunction(provideOptions) ? provideOptions.call(publicThis) : provideOptions;
    Reflect.ownKeys(provides).forEach(key => {
      runtime_core_esm_bundler_provide(key, provides[key]);
    });
  }

  if (created) {
    callHook(created, instance, "c"
    /* CREATED */
    );
  }

  function registerLifecycleHook(register, hook) {
    if (shared_esm_bundler_isArray(hook)) {
      hook.forEach(_hook => register(_hook.bind(publicThis)));
    } else if (hook) {
      register(hook.bind(publicThis));
    }
  }

  registerLifecycleHook(onBeforeMount, beforeMount);
  registerLifecycleHook(runtime_core_esm_bundler_onMounted, mounted);
  registerLifecycleHook(runtime_core_esm_bundler_onBeforeUpdate, beforeUpdate);
  registerLifecycleHook(runtime_core_esm_bundler_onUpdated, updated);
  registerLifecycleHook(runtime_core_esm_bundler_onActivated, activated);
  registerLifecycleHook(runtime_core_esm_bundler_onDeactivated, deactivated);
  registerLifecycleHook(onErrorCaptured, errorCaptured);
  registerLifecycleHook(onRenderTracked, renderTracked);
  registerLifecycleHook(onRenderTriggered, renderTriggered);
  registerLifecycleHook(runtime_core_esm_bundler_onBeforeUnmount, beforeUnmount);
  registerLifecycleHook(runtime_core_esm_bundler_onUnmounted, unmounted);
  registerLifecycleHook(onServerPrefetch, serverPrefetch);

  if (shared_esm_bundler_isArray(expose)) {
    if (expose.length) {
      const exposed = instance.exposed || (instance.exposed = {});
      expose.forEach(key => {
        Object.defineProperty(exposed, key, {
          get: () => publicThis[key],
          set: val => publicThis[key] = val
        });
      });
    } else if (!instance.exposed) {
      instance.exposed = {};
    }
  } // options that are handled when creating the instance but also need to be
  // applied from mixins


  if (render && instance.render === shared_esm_bundler_NOOP) {
    instance.render = render;
  }

  if (inheritAttrs != null) {
    instance.inheritAttrs = inheritAttrs;
  } // asset options.


  if (components) instance.components = components;
  if (directives) instance.directives = directives;
}

function resolveInjections(injectOptions, ctx, checkDuplicateProperties = shared_esm_bundler_NOOP, unwrapRef = false) {
  if (shared_esm_bundler_isArray(injectOptions)) {
    injectOptions = normalizeInject(injectOptions);
  }

  for (const key in injectOptions) {
    const opt = injectOptions[key];
    let injected;

    if (shared_esm_bundler_isObject(opt)) {
      if ('default' in opt) {
        injected = runtime_core_esm_bundler_inject(opt.from || key, opt.default, true
        /* treat default function as factory */
        );
      } else {
        injected = runtime_core_esm_bundler_inject(opt.from || key);
      }
    } else {
      injected = runtime_core_esm_bundler_inject(opt);
    }

    if (reactivity_esm_bundler_isRef(injected)) {
      // TODO remove the check in 3.3
      if (unwrapRef) {
        Object.defineProperty(ctx, key, {
          enumerable: true,
          configurable: true,
          get: () => injected.value,
          set: v => injected.value = v
        });
      } else {
        if (false) {}

        ctx[key] = injected;
      }
    } else {
      ctx[key] = injected;
    }

    if (false) {}
  }
}

function callHook(hook, instance, type) {
  callWithAsyncErrorHandling(shared_esm_bundler_isArray(hook) ? hook.map(h => h.bind(instance.proxy)) : hook.bind(instance.proxy), instance, type);
}

function createWatcher(raw, ctx, publicThis, key) {
  const getter = key.includes('.') ? createPathGetter(publicThis, key) : () => publicThis[key];

  if (shared_esm_bundler_isString(raw)) {
    const handler = ctx[raw];

    if (shared_esm_bundler_isFunction(handler)) {
      runtime_core_esm_bundler_watch(getter, handler);
    } else if (false) {}
  } else if (shared_esm_bundler_isFunction(raw)) {
    runtime_core_esm_bundler_watch(getter, raw.bind(publicThis));
  } else if (shared_esm_bundler_isObject(raw)) {
    if (shared_esm_bundler_isArray(raw)) {
      raw.forEach(r => createWatcher(r, ctx, publicThis, key));
    } else {
      const handler = shared_esm_bundler_isFunction(raw.handler) ? raw.handler.bind(publicThis) : ctx[raw.handler];

      if (shared_esm_bundler_isFunction(handler)) {
        runtime_core_esm_bundler_watch(getter, handler, raw);
      } else if (false) {}
    }
  } else if (false) {}
}
/**
 * Resolve merged options and cache it on the component.
 * This is done only once per-component since the merging does not involve
 * instances.
 */


function resolveMergedOptions(instance) {
  const base = instance.type;
  const {
    mixins,
    extends: extendsOptions
  } = base;
  const {
    mixins: globalMixins,
    optionsCache: cache,
    config: {
      optionMergeStrategies
    }
  } = instance.appContext;
  const cached = cache.get(base);
  let resolved;

  if (cached) {
    resolved = cached;
  } else if (!globalMixins.length && !mixins && !extendsOptions) {
    {
      resolved = base;
    }
  } else {
    resolved = {};

    if (globalMixins.length) {
      globalMixins.forEach(m => mergeOptions(resolved, m, optionMergeStrategies, true));
    }

    mergeOptions(resolved, base, optionMergeStrategies);
  }

  cache.set(base, resolved);
  return resolved;
}

function mergeOptions(to, from, strats, asMixin = false) {
  const {
    mixins,
    extends: extendsOptions
  } = from;

  if (extendsOptions) {
    mergeOptions(to, extendsOptions, strats, true);
  }

  if (mixins) {
    mixins.forEach(m => mergeOptions(to, m, strats, true));
  }

  for (const key in from) {
    if (asMixin && key === 'expose') {
       false && 0;
    } else {
      const strat = internalOptionMergeStrats[key] || strats && strats[key];
      to[key] = strat ? strat(to[key], from[key]) : from[key];
    }
  }

  return to;
}

const internalOptionMergeStrats = {
  data: mergeDataFn,
  props: mergeObjectOptions,
  emits: mergeObjectOptions,
  // objects
  methods: mergeObjectOptions,
  computed: mergeObjectOptions,
  // lifecycle
  beforeCreate: mergeAsArray,
  created: mergeAsArray,
  beforeMount: mergeAsArray,
  mounted: mergeAsArray,
  beforeUpdate: mergeAsArray,
  updated: mergeAsArray,
  beforeDestroy: mergeAsArray,
  beforeUnmount: mergeAsArray,
  destroyed: mergeAsArray,
  unmounted: mergeAsArray,
  activated: mergeAsArray,
  deactivated: mergeAsArray,
  errorCaptured: mergeAsArray,
  serverPrefetch: mergeAsArray,
  // assets
  components: mergeObjectOptions,
  directives: mergeObjectOptions,
  // watch
  watch: mergeWatchOptions,
  // provide / inject
  provide: mergeDataFn,
  inject: mergeInject
};

function mergeDataFn(to, from) {
  if (!from) {
    return to;
  }

  if (!to) {
    return from;
  }

  return function mergedDataFn() {
    return shared_esm_bundler_extend(shared_esm_bundler_isFunction(to) ? to.call(this, this) : to, shared_esm_bundler_isFunction(from) ? from.call(this, this) : from);
  };
}

function mergeInject(to, from) {
  return mergeObjectOptions(normalizeInject(to), normalizeInject(from));
}

function normalizeInject(raw) {
  if (shared_esm_bundler_isArray(raw)) {
    const res = {};

    for (let i = 0; i < raw.length; i++) {
      res[raw[i]] = raw[i];
    }

    return res;
  }

  return raw;
}

function mergeAsArray(to, from) {
  return to ? [...new Set([].concat(to, from))] : from;
}

function mergeObjectOptions(to, from) {
  return to ? shared_esm_bundler_extend(shared_esm_bundler_extend(Object.create(null), to), from) : from;
}

function mergeWatchOptions(to, from) {
  if (!to) return from;
  if (!from) return to;
  const merged = shared_esm_bundler_extend(Object.create(null), to);

  for (const key in from) {
    merged[key] = mergeAsArray(to[key], from[key]);
  }

  return merged;
}

function initProps(instance, rawProps, isStateful, // result of bitwise flag comparison
isSSR = false) {
  const props = {};
  const attrs = {};
  def(attrs, InternalObjectKey, 1);
  instance.propsDefaults = Object.create(null);
  setFullProps(instance, rawProps, props, attrs); // ensure all declared prop keys are present

  for (const key in instance.propsOptions[0]) {
    if (!(key in props)) {
      props[key] = undefined;
    }
  } // validation


  if (false) {}

  if (isStateful) {
    // stateful
    instance.props = isSSR ? props : shallowReactive(props);
  } else {
    if (!instance.type.props) {
      // functional w/ optional props, props === attrs
      instance.props = attrs;
    } else {
      // functional w/ declared props
      instance.props = props;
    }
  }

  instance.attrs = attrs;
}

function updateProps(instance, rawProps, rawPrevProps, optimized) {
  const {
    props,
    attrs,
    vnode: {
      patchFlag
    }
  } = instance;
  const rawCurrentProps = reactivity_esm_bundler_toRaw(props);
  const [options] = instance.propsOptions;
  let hasAttrsChanged = false;

  if ( // always force full diff in dev
  // - #1942 if hmr is enabled with sfc component
  // - vite#872 non-sfc component used by sfc component
   true && (optimized || patchFlag > 0) && !(patchFlag & 16
  /* FULL_PROPS */
  )) {
    if (patchFlag & 8
    /* PROPS */
    ) {
      // Compiler-generated props & no keys change, just set the updated
      // the props.
      const propsToUpdate = instance.vnode.dynamicProps;

      for (let i = 0; i < propsToUpdate.length; i++) {
        let key = propsToUpdate[i]; // PROPS flag guarantees rawProps to be non-null

        const value = rawProps[key];

        if (options) {
          // attr / props separation was done on init and will be consistent
          // in this code path, so just check if attrs have it.
          if (shared_esm_bundler_hasOwn(attrs, key)) {
            if (value !== attrs[key]) {
              attrs[key] = value;
              hasAttrsChanged = true;
            }
          } else {
            const camelizedKey = shared_esm_bundler_camelize(key);
            props[camelizedKey] = resolvePropValue(options, rawCurrentProps, camelizedKey, value, instance, false
            /* isAbsent */
            );
          }
        } else {
          if (value !== attrs[key]) {
            attrs[key] = value;
            hasAttrsChanged = true;
          }
        }
      }
    }
  } else {
    // full props update.
    if (setFullProps(instance, rawProps, props, attrs)) {
      hasAttrsChanged = true;
    } // in case of dynamic props, check if we need to delete keys from
    // the props object


    let kebabKey;

    for (const key in rawCurrentProps) {
      if (!rawProps || // for camelCase
      !shared_esm_bundler_hasOwn(rawProps, key) && ( // it's possible the original props was passed in as kebab-case
      // and converted to camelCase (#955)
      (kebabKey = shared_esm_bundler_hyphenate(key)) === key || !shared_esm_bundler_hasOwn(rawProps, kebabKey))) {
        if (options) {
          if (rawPrevProps && ( // for camelCase
          rawPrevProps[key] !== undefined || // for kebab-case
          rawPrevProps[kebabKey] !== undefined)) {
            props[key] = resolvePropValue(options, rawCurrentProps, key, undefined, instance, true
            /* isAbsent */
            );
          }
        } else {
          delete props[key];
        }
      }
    } // in the case of functional component w/o props declaration, props and
    // attrs point to the same object so it should already have been updated.


    if (attrs !== rawCurrentProps) {
      for (const key in attrs) {
        if (!rawProps || !shared_esm_bundler_hasOwn(rawProps, key) && !false) {
          delete attrs[key];
          hasAttrsChanged = true;
        }
      }
    }
  } // trigger updates for $attrs in case it's used in component slots


  if (hasAttrsChanged) {
    trigger(instance, "set"
    /* SET */
    , '$attrs');
  }

  if (false) {}
}

function setFullProps(instance, rawProps, props, attrs) {
  const [options, needCastKeys] = instance.propsOptions;
  let hasAttrsChanged = false;
  let rawCastValues;

  if (rawProps) {
    for (let key in rawProps) {
      // key, ref are reserved and never passed down
      if (shared_esm_bundler_isReservedProp(key)) {
        continue;
      }

      const value = rawProps[key]; // prop option names are camelized during normalization, so to support
      // kebab -> camel conversion here we need to camelize the key.

      let camelKey;

      if (options && shared_esm_bundler_hasOwn(options, camelKey = shared_esm_bundler_camelize(key))) {
        if (!needCastKeys || !needCastKeys.includes(camelKey)) {
          props[camelKey] = value;
        } else {
          (rawCastValues || (rawCastValues = {}))[camelKey] = value;
        }
      } else if (!isEmitListener(instance.emitsOptions, key)) {
        if (!(key in attrs) || value !== attrs[key]) {
          attrs[key] = value;
          hasAttrsChanged = true;
        }
      }
    }
  }

  if (needCastKeys) {
    const rawCurrentProps = reactivity_esm_bundler_toRaw(props);
    const castValues = rawCastValues || shared_esm_bundler_EMPTY_OBJ;

    for (let i = 0; i < needCastKeys.length; i++) {
      const key = needCastKeys[i];
      props[key] = resolvePropValue(options, rawCurrentProps, key, castValues[key], instance, !shared_esm_bundler_hasOwn(castValues, key));
    }
  }

  return hasAttrsChanged;
}

function resolvePropValue(options, props, key, value, instance, isAbsent) {
  const opt = options[key];

  if (opt != null) {
    const hasDefault = shared_esm_bundler_hasOwn(opt, 'default'); // default values

    if (hasDefault && value === undefined) {
      const defaultValue = opt.default;

      if (opt.type !== Function && shared_esm_bundler_isFunction(defaultValue)) {
        const {
          propsDefaults
        } = instance;

        if (key in propsDefaults) {
          value = propsDefaults[key];
        } else {
          setCurrentInstance(instance);
          value = propsDefaults[key] = defaultValue.call(null, props);
          unsetCurrentInstance();
        }
      } else {
        value = defaultValue;
      }
    } // boolean casting


    if (opt[0
    /* shouldCast */
    ]) {
      if (isAbsent && !hasDefault) {
        value = false;
      } else if (opt[1
      /* shouldCastTrue */
      ] && (value === '' || value === shared_esm_bundler_hyphenate(key))) {
        value = true;
      }
    }
  }

  return value;
}

function normalizePropsOptions(comp, appContext, asMixin = false) {
  const cache = appContext.propsCache;
  const cached = cache.get(comp);

  if (cached) {
    return cached;
  }

  const raw = comp.props;
  const normalized = {};
  const needCastKeys = []; // apply mixin/extends props

  let hasExtends = false;

  if (__VUE_OPTIONS_API__ && !shared_esm_bundler_isFunction(comp)) {
    const extendProps = raw => {
      hasExtends = true;
      const [props, keys] = normalizePropsOptions(raw, appContext, true);
      shared_esm_bundler_extend(normalized, props);
      if (keys) needCastKeys.push(...keys);
    };

    if (!asMixin && appContext.mixins.length) {
      appContext.mixins.forEach(extendProps);
    }

    if (comp.extends) {
      extendProps(comp.extends);
    }

    if (comp.mixins) {
      comp.mixins.forEach(extendProps);
    }
  }

  if (!raw && !hasExtends) {
    cache.set(comp, EMPTY_ARR);
    return EMPTY_ARR;
  }

  if (shared_esm_bundler_isArray(raw)) {
    for (let i = 0; i < raw.length; i++) {
      if (false) {}

      const normalizedKey = shared_esm_bundler_camelize(raw[i]);

      if (validatePropName(normalizedKey)) {
        normalized[normalizedKey] = shared_esm_bundler_EMPTY_OBJ;
      }
    }
  } else if (raw) {
    if (false) {}

    for (const key in raw) {
      const normalizedKey = shared_esm_bundler_camelize(key);

      if (validatePropName(normalizedKey)) {
        const opt = raw[key];
        const prop = normalized[normalizedKey] = shared_esm_bundler_isArray(opt) || shared_esm_bundler_isFunction(opt) ? {
          type: opt
        } : opt;

        if (prop) {
          const booleanIndex = getTypeIndex(Boolean, prop.type);
          const stringIndex = getTypeIndex(String, prop.type);
          prop[0
          /* shouldCast */
          ] = booleanIndex > -1;
          prop[1
          /* shouldCastTrue */
          ] = stringIndex < 0 || booleanIndex < stringIndex; // if the prop needs boolean casting or default value

          if (booleanIndex > -1 || shared_esm_bundler_hasOwn(prop, 'default')) {
            needCastKeys.push(normalizedKey);
          }
        }
      }
    }
  }

  const res = [normalized, needCastKeys];
  cache.set(comp, res);
  return res;
}

function validatePropName(key) {
  if (key[0] !== '$') {
    return true;
  } else if (false) {}

  return false;
} // use function string name to check type constructors
// so that it works across vms / iframes.


function getType(ctor) {
  const match = ctor && ctor.toString().match(/^\s*function (\w+)/);
  return match ? match[1] : ctor === null ? 'null' : '';
}

function isSameType(a, b) {
  return getType(a) === getType(b);
}

function getTypeIndex(type, expectedTypes) {
  if (shared_esm_bundler_isArray(expectedTypes)) {
    return expectedTypes.findIndex(t => isSameType(t, type));
  } else if (shared_esm_bundler_isFunction(expectedTypes)) {
    return isSameType(expectedTypes, type) ? 0 : -1;
  }

  return -1;
}
/**
 * dev only
 */


function validateProps(rawProps, props, instance) {
  const resolvedValues = toRaw(props);
  const options = instance.propsOptions[0];

  for (const key in options) {
    let opt = options[key];
    if (opt == null) continue;
    validateProp(key, resolvedValues[key], opt, !hasOwn(rawProps, key) && !hasOwn(rawProps, hyphenate(key)));
  }
}
/**
 * dev only
 */


function validateProp(name, value, prop, isAbsent) {
  const {
    type,
    required,
    validator
  } = prop; // required!

  if (required && isAbsent) {
    runtime_core_esm_bundler_warn('Missing required prop: "' + name + '"');
    return;
  } // missing but optional


  if (value == null && !prop.required) {
    return;
  } // type check


  if (type != null && type !== true) {
    let isValid = false;
    const types = isArray(type) ? type : [type];
    const expectedTypes = []; // value is valid as long as one of the specified types match

    for (let i = 0; i < types.length && !isValid; i++) {
      const {
        valid,
        expectedType
      } = assertType(value, types[i]);
      expectedTypes.push(expectedType || '');
      isValid = valid;
    }

    if (!isValid) {
      runtime_core_esm_bundler_warn(getInvalidTypeMessage(name, value, expectedTypes));
      return;
    }
  } // custom validator


  if (validator && !validator(value)) {
    runtime_core_esm_bundler_warn('Invalid prop: custom validator check failed for prop "' + name + '".');
  }
}

const isSimpleType = /*#__PURE__*/(/* unused pure expression or super */ null && (makeMap('String,Number,Boolean,Function,Symbol,BigInt')));
/**
 * dev only
 */

function assertType(value, type) {
  let valid;
  const expectedType = getType(type);

  if (isSimpleType(expectedType)) {
    const t = typeof value;
    valid = t === expectedType.toLowerCase(); // for primitive wrapper objects

    if (!valid && t === 'object') {
      valid = value instanceof type;
    }
  } else if (expectedType === 'Object') {
    valid = isObject(value);
  } else if (expectedType === 'Array') {
    valid = isArray(value);
  } else if (expectedType === 'null') {
    valid = value === null;
  } else {
    valid = value instanceof type;
  }

  return {
    valid,
    expectedType
  };
}
/**
 * dev only
 */


function getInvalidTypeMessage(name, value, expectedTypes) {
  let message = `Invalid prop: type check failed for prop "${name}".` + ` Expected ${expectedTypes.map(capitalize).join(' | ')}`;
  const expectedType = expectedTypes[0];
  const receivedType = toRawType(value);
  const expectedValue = styleValue(value, expectedType);
  const receivedValue = styleValue(value, receivedType); // check if we need to specify expected value

  if (expectedTypes.length === 1 && isExplicable(expectedType) && !isBoolean(expectedType, receivedType)) {
    message += ` with value ${expectedValue}`;
  }

  message += `, got ${receivedType} `; // check if we need to specify received value

  if (isExplicable(receivedType)) {
    message += `with value ${receivedValue}.`;
  }

  return message;
}
/**
 * dev only
 */


function styleValue(value, type) {
  if (type === 'String') {
    return `"${value}"`;
  } else if (type === 'Number') {
    return `${Number(value)}`;
  } else {
    return `${value}`;
  }
}
/**
 * dev only
 */


function isExplicable(type) {
  const explicitTypes = ['string', 'number', 'boolean'];
  return explicitTypes.some(elem => type.toLowerCase() === elem);
}
/**
 * dev only
 */


function isBoolean(...args) {
  return args.some(elem => elem.toLowerCase() === 'boolean');
}

const isInternalKey = key => key[0] === '_' || key === '$stable';

const normalizeSlotValue = value => shared_esm_bundler_isArray(value) ? value.map(normalizeVNode) : [normalizeVNode(value)];

const normalizeSlot = (key, rawSlot, ctx) => {
  const normalized = withCtx((...args) => {
    if (false) {}

    return normalizeSlotValue(rawSlot(...args));
  }, ctx);
  normalized._c = false;
  return normalized;
};

const normalizeObjectSlots = (rawSlots, slots, instance) => {
  const ctx = rawSlots._ctx;

  for (const key in rawSlots) {
    if (isInternalKey(key)) continue;
    const value = rawSlots[key];

    if (shared_esm_bundler_isFunction(value)) {
      slots[key] = normalizeSlot(key, value, ctx);
    } else if (value != null) {
      if (false) {}

      const normalized = normalizeSlotValue(value);

      slots[key] = () => normalized;
    }
  }
};

const normalizeVNodeSlots = (instance, children) => {
  if (false) {}

  const normalized = normalizeSlotValue(children);

  instance.slots.default = () => normalized;
};

const initSlots = (instance, children) => {
  if (instance.vnode.shapeFlag & 32
  /* SLOTS_CHILDREN */
  ) {
    const type = children._;

    if (type) {
      // users can get the shallow readonly version of the slots object through `this.$slots`,
      // we should avoid the proxy object polluting the slots of the internal instance
      instance.slots = reactivity_esm_bundler_toRaw(children); // make compiler marker non-enumerable

      def(children, '_', type);
    } else {
      normalizeObjectSlots(children, instance.slots = {});
    }
  } else {
    instance.slots = {};

    if (children) {
      normalizeVNodeSlots(instance, children);
    }
  }

  def(instance.slots, InternalObjectKey, 1);
};

const updateSlots = (instance, children, optimized) => {
  const {
    vnode,
    slots
  } = instance;
  let needDeletionCheck = true;
  let deletionComparisonTarget = shared_esm_bundler_EMPTY_OBJ;

  if (vnode.shapeFlag & 32
  /* SLOTS_CHILDREN */
  ) {
    const type = children._;

    if (type) {
      // compiled slots.
      if (false) {} else if (optimized && type === 1
      /* STABLE */
      ) {
        // compiled AND stable.
        // no need to update, and skip stale slots removal.
        needDeletionCheck = false;
      } else {
        // compiled but dynamic (v-if/v-for on slots) - update slots, but skip
        // normalization.
        shared_esm_bundler_extend(slots, children); // #2893
        // when rendering the optimized slots by manually written render function,
        // we need to delete the `slots._` flag if necessary to make subsequent updates reliable,
        // i.e. let the `renderSlot` create the bailed Fragment

        if (!optimized && type === 1
        /* STABLE */
        ) {
          delete slots._;
        }
      }
    } else {
      needDeletionCheck = !children.$stable;
      normalizeObjectSlots(children, slots);
    }

    deletionComparisonTarget = children;
  } else if (children) {
    // non slot object children (direct value) passed to a component
    normalizeVNodeSlots(instance, children);
    deletionComparisonTarget = {
      default: 1
    };
  } // delete stale slots


  if (needDeletionCheck) {
    for (const key in slots) {
      if (!isInternalKey(key) && !(key in deletionComparisonTarget)) {
        delete slots[key];
      }
    }
  }
};
/**
Runtime helper for applying directives to a vnode. Example usage:

const comp = resolveComponent('comp')
const foo = resolveDirective('foo')
const bar = resolveDirective('bar')

return withDirectives(h(comp), [
  [foo, this.x],
  [bar, this.y]
])
*/


const isBuiltInDirective = /*#__PURE__*/(/* unused pure expression or super */ null && (makeMap('bind,cloak,else-if,else,for,html,if,model,on,once,pre,show,slot,text,memo')));

function validateDirectiveName(name) {
  if (isBuiltInDirective(name)) {
    runtime_core_esm_bundler_warn('Do not use built-in directive ids as custom directive id: ' + name);
  }
}
/**
 * Adds directives to a VNode.
 */


function withDirectives(vnode, directives) {
  const internalInstance = currentRenderingInstance;

  if (internalInstance === null) {
     false && 0;
    return vnode;
  }

  const instance = internalInstance.proxy;
  const bindings = vnode.dirs || (vnode.dirs = []);

  for (let i = 0; i < directives.length; i++) {
    let [dir, value, arg, modifiers = shared_esm_bundler_EMPTY_OBJ] = directives[i];

    if (shared_esm_bundler_isFunction(dir)) {
      dir = {
        mounted: dir,
        updated: dir
      };
    }

    if (dir.deep) {
      traverse(value);
    }

    bindings.push({
      dir,
      instance,
      value,
      oldValue: void 0,
      arg,
      modifiers
    });
  }

  return vnode;
}

function invokeDirectiveHook(vnode, prevVNode, instance, name) {
  const bindings = vnode.dirs;
  const oldBindings = prevVNode && prevVNode.dirs;

  for (let i = 0; i < bindings.length; i++) {
    const binding = bindings[i];

    if (oldBindings) {
      binding.oldValue = oldBindings[i].value;
    }

    let hook = binding.dir[name];

    if (hook) {
      // disable tracking inside all lifecycle hooks
      // since they can potentially be called inside effects.
      pauseTracking();
      callWithAsyncErrorHandling(hook, instance, 8
      /* DIRECTIVE_HOOK */
      , [vnode.el, binding, vnode, prevVNode]);
      resetTracking();
    }
  }
}

function createAppContext() {
  return {
    app: null,
    config: {
      isNativeTag: shared_esm_bundler_NO,
      performance: false,
      globalProperties: {},
      optionMergeStrategies: {},
      errorHandler: undefined,
      warnHandler: undefined,
      compilerOptions: {}
    },
    mixins: [],
    components: {},
    directives: {},
    provides: Object.create(null),
    optionsCache: new WeakMap(),
    propsCache: new WeakMap(),
    emitsCache: new WeakMap()
  };
}

let uid = 0;

function createAppAPI(render, hydrate) {
  return function createApp(rootComponent, rootProps = null) {
    if (rootProps != null && !shared_esm_bundler_isObject(rootProps)) {
       false && 0;
      rootProps = null;
    }

    const context = createAppContext();
    const installedPlugins = new Set();
    let isMounted = false;
    const app = context.app = {
      _uid: uid++,
      _component: rootComponent,
      _props: rootProps,
      _container: null,
      _context: context,
      _instance: null,
      version,

      get config() {
        return context.config;
      },

      set config(v) {
        if (false) {}
      },

      use(plugin, ...options) {
        if (installedPlugins.has(plugin)) {
           false && 0;
        } else if (plugin && shared_esm_bundler_isFunction(plugin.install)) {
          installedPlugins.add(plugin);
          plugin.install(app, ...options);
        } else if (shared_esm_bundler_isFunction(plugin)) {
          installedPlugins.add(plugin);
          plugin(app, ...options);
        } else if (false) {}

        return app;
      },

      mixin(mixin) {
        if (__VUE_OPTIONS_API__) {
          if (!context.mixins.includes(mixin)) {
            context.mixins.push(mixin);
          } else if (false) {}
        } else if (false) {}

        return app;
      },

      component(name, component) {
        if (false) {}

        if (!component) {
          return context.components[name];
        }

        if (false) {}

        context.components[name] = component;
        return app;
      },

      directive(name, directive) {
        if (false) {}

        if (!directive) {
          return context.directives[name];
        }

        if (false) {}

        context.directives[name] = directive;
        return app;
      },

      mount(rootContainer, isHydrate, isSVG) {
        if (!isMounted) {
          const vnode = runtime_core_esm_bundler_createVNode(rootComponent, rootProps); // store app context on the root VNode.
          // this will be set on the root instance on initial mount.

          vnode.appContext = context; // HMR root reload

          if (false) {}

          if (isHydrate && hydrate) {
            hydrate(vnode, rootContainer);
          } else {
            render(vnode, rootContainer, isSVG);
          }

          isMounted = true;
          app._container = rootContainer;
          rootContainer.__vue_app__ = app;

          if ( false || __VUE_PROD_DEVTOOLS__) {
            app._instance = vnode.component;
            devtoolsInitApp(app, version);
          }

          return getExposeProxy(vnode.component) || vnode.component.proxy;
        } else if (false) {}
      },

      unmount() {
        if (isMounted) {
          render(null, app._container);

          if ( false || __VUE_PROD_DEVTOOLS__) {
            app._instance = null;
            devtoolsUnmountApp(app);
          }

          delete app._container.__vue_app__;
        } else if (false) {}
      },

      provide(key, value) {
        if (false) {} // TypeScript doesn't allow symbols as index type
        // https://github.com/Microsoft/TypeScript/issues/24587


        context.provides[key] = value;
        return app;
      }

    };
    return app;
  };
}
/**
 * Function for handling a template ref
 */


function setRef(rawRef, oldRawRef, parentSuspense, vnode, isUnmount = false) {
  if (shared_esm_bundler_isArray(rawRef)) {
    rawRef.forEach((r, i) => setRef(r, oldRawRef && (shared_esm_bundler_isArray(oldRawRef) ? oldRawRef[i] : oldRawRef), parentSuspense, vnode, isUnmount));
    return;
  }

  if (isAsyncWrapper(vnode) && !isUnmount) {
    // when mounting async components, nothing needs to be done,
    // because the template ref is forwarded to inner component
    return;
  }

  const refValue = vnode.shapeFlag & 4
  /* STATEFUL_COMPONENT */
  ? getExposeProxy(vnode.component) || vnode.component.proxy : vnode.el;
  const value = isUnmount ? null : refValue;
  const {
    i: owner,
    r: ref
  } = rawRef;

  if (false) {}

  const oldRef = oldRawRef && oldRawRef.r;
  const refs = owner.refs === shared_esm_bundler_EMPTY_OBJ ? owner.refs = {} : owner.refs;
  const setupState = owner.setupState; // dynamic ref changed. unset old ref

  if (oldRef != null && oldRef !== ref) {
    if (shared_esm_bundler_isString(oldRef)) {
      refs[oldRef] = null;

      if (shared_esm_bundler_hasOwn(setupState, oldRef)) {
        setupState[oldRef] = null;
      }
    } else if (reactivity_esm_bundler_isRef(oldRef)) {
      oldRef.value = null;
    }
  }

  if (shared_esm_bundler_isFunction(ref)) {
    callWithErrorHandling(ref, owner, 12
    /* FUNCTION_REF */
    , [value, refs]);
  } else {
    const _isString = shared_esm_bundler_isString(ref);

    const _isRef = reactivity_esm_bundler_isRef(ref);

    if (_isString || _isRef) {
      const doSet = () => {
        if (rawRef.f) {
          const existing = _isString ? refs[ref] : ref.value;

          if (isUnmount) {
            shared_esm_bundler_isArray(existing) && remove(existing, refValue);
          } else {
            if (!shared_esm_bundler_isArray(existing)) {
              if (_isString) {
                refs[ref] = [refValue];
              } else {
                ref.value = [refValue];
                if (rawRef.k) refs[rawRef.k] = ref.value;
              }
            } else if (!existing.includes(refValue)) {
              existing.push(refValue);
            }
          }
        } else if (_isString) {
          refs[ref] = value;

          if (shared_esm_bundler_hasOwn(setupState, ref)) {
            setupState[ref] = value;
          }
        } else if (reactivity_esm_bundler_isRef(ref)) {
          ref.value = value;
          if (rawRef.k) refs[rawRef.k] = value;
        } else if (false) {}
      };

      if (value) {
        doSet.id = -1;
        queuePostRenderEffect(doSet, parentSuspense);
      } else {
        doSet();
      }
    } else if (false) {}
  }
}

let hasMismatch = false;

const isSVGContainer = container => /svg/.test(container.namespaceURI) && container.tagName !== 'foreignObject';

const isComment = node => node.nodeType === 8
/* COMMENT */
; // Note: hydration is DOM-specific
// But we have to place it in core due to tight coupling with core - splitting
// it out creates a ton of unnecessary complexity.
// Hydration also depends on some renderer internal logic which needs to be
// passed in via arguments.


function createHydrationFunctions(rendererInternals) {
  const {
    mt: mountComponent,
    p: patch,
    o: {
      patchProp,
      nextSibling,
      parentNode,
      remove,
      insert,
      createComment
    }
  } = rendererInternals;

  const hydrate = (vnode, container) => {
    if (!container.hasChildNodes()) {
       false && 0;
      patch(null, vnode, container);
      flushPostFlushCbs();
      return;
    }

    hasMismatch = false;
    hydrateNode(container.firstChild, vnode, null, null, null);
    flushPostFlushCbs();

    if (hasMismatch && !false) {
      // this error should show up in production
      console.error(`Hydration completed but contains mismatches.`);
    }
  };

  const hydrateNode = (node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized = false) => {
    const isFragmentStart = isComment(node) && node.data === '[';

    const onMismatch = () => handleMismatch(node, vnode, parentComponent, parentSuspense, slotScopeIds, isFragmentStart);

    const {
      type,
      ref,
      shapeFlag
    } = vnode;
    const domType = node.nodeType;
    vnode.el = node;
    let nextNode = null;

    switch (type) {
      case runtime_core_esm_bundler_Text:
        if (domType !== 3
        /* TEXT */
        ) {
          nextNode = onMismatch();
        } else {
          if (node.data !== vnode.children) {
            hasMismatch = true;
             false && 0;
            node.data = vnode.children;
          }

          nextNode = nextSibling(node);
        }

        break;

      case runtime_core_esm_bundler_Comment:
        if (domType !== 8
        /* COMMENT */
        || isFragmentStart) {
          nextNode = onMismatch();
        } else {
          nextNode = nextSibling(node);
        }

        break;

      case runtime_core_esm_bundler_Static:
        if (domType !== 1
        /* ELEMENT */
        ) {
          nextNode = onMismatch();
        } else {
          // determine anchor, adopt content
          nextNode = node; // if the static vnode has its content stripped during build,
          // adopt it from the server-rendered HTML.

          const needToAdoptContent = !vnode.children.length;

          for (let i = 0; i < vnode.staticCount; i++) {
            if (needToAdoptContent) vnode.children += nextNode.outerHTML;

            if (i === vnode.staticCount - 1) {
              vnode.anchor = nextNode;
            }

            nextNode = nextSibling(nextNode);
          }

          return nextNode;
        }

        break;

      case runtime_core_esm_bundler_Fragment:
        if (!isFragmentStart) {
          nextNode = onMismatch();
        } else {
          nextNode = hydrateFragment(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized);
        }

        break;

      default:
        if (shapeFlag & 1
        /* ELEMENT */
        ) {
          if (domType !== 1
          /* ELEMENT */
          || vnode.type.toLowerCase() !== node.tagName.toLowerCase()) {
            nextNode = onMismatch();
          } else {
            nextNode = hydrateElement(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized);
          }
        } else if (shapeFlag & 6
        /* COMPONENT */
        ) {
          // when setting up the render effect, if the initial vnode already
          // has .el set, the component will perform hydration instead of mount
          // on its sub-tree.
          vnode.slotScopeIds = slotScopeIds;
          const container = parentNode(node);
          mountComponent(vnode, container, null, parentComponent, parentSuspense, isSVGContainer(container), optimized); // component may be async, so in the case of fragments we cannot rely
          // on component's rendered output to determine the end of the fragment
          // instead, we do a lookahead to find the end anchor node.

          nextNode = isFragmentStart ? locateClosingAsyncAnchor(node) : nextSibling(node); // #3787
          // if component is async, it may get moved / unmounted before its
          // inner component is loaded, so we need to give it a placeholder
          // vnode that matches its adopted DOM.

          if (isAsyncWrapper(vnode)) {
            let subTree;

            if (isFragmentStart) {
              subTree = runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Fragment);
              subTree.anchor = nextNode ? nextNode.previousSibling : container.lastChild;
            } else {
              subTree = node.nodeType === 3 ? createTextVNode('') : runtime_core_esm_bundler_createVNode('div');
            }

            subTree.el = node;
            vnode.component.subTree = subTree;
          }
        } else if (shapeFlag & 64
        /* TELEPORT */
        ) {
          if (domType !== 8
          /* COMMENT */
          ) {
            nextNode = onMismatch();
          } else {
            nextNode = vnode.type.hydrate(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized, rendererInternals, hydrateChildren);
          }
        } else if (shapeFlag & 128
        /* SUSPENSE */
        ) {
          nextNode = vnode.type.hydrate(node, vnode, parentComponent, parentSuspense, isSVGContainer(parentNode(node)), slotScopeIds, optimized, rendererInternals, hydrateNode);
        } else if (false) {}

    }

    if (ref != null) {
      setRef(ref, null, parentSuspense, vnode);
    }

    return nextNode;
  };

  const hydrateElement = (el, vnode, parentComponent, parentSuspense, slotScopeIds, optimized) => {
    optimized = optimized || !!vnode.dynamicChildren;
    const {
      type,
      props,
      patchFlag,
      shapeFlag,
      dirs
    } = vnode; // #4006 for form elements with non-string v-model value bindings
    // e.g. <option :value="obj">, <input type="checkbox" :true-value="1">

    const forcePatchValue = type === 'input' && dirs || type === 'option'; // skip props & children if this is hoisted static nodes

    if (forcePatchValue || patchFlag !== -1
    /* HOISTED */
    ) {
      if (dirs) {
        invokeDirectiveHook(vnode, null, parentComponent, 'created');
      } // props


      if (props) {
        if (forcePatchValue || !optimized || patchFlag & (16
        /* FULL_PROPS */
        | 32
        /* HYDRATE_EVENTS */
        )) {
          for (const key in props) {
            if (forcePatchValue && key.endsWith('value') || isOn(key) && !isReservedProp(key)) {
              patchProp(el, key, null, props[key], false, undefined, parentComponent);
            }
          }
        } else if (props.onClick) {
          // Fast path for click listeners (which is most often) to avoid
          // iterating through props.
          patchProp(el, 'onClick', null, props.onClick, false, undefined, parentComponent);
        }
      } // vnode / directive hooks


      let vnodeHooks;

      if (vnodeHooks = props && props.onVnodeBeforeMount) {
        invokeVNodeHook(vnodeHooks, parentComponent, vnode);
      }

      if (dirs) {
        invokeDirectiveHook(vnode, null, parentComponent, 'beforeMount');
      }

      if ((vnodeHooks = props && props.onVnodeMounted) || dirs) {
        queueEffectWithSuspense(() => {
          vnodeHooks && invokeVNodeHook(vnodeHooks, parentComponent, vnode);
          dirs && invokeDirectiveHook(vnode, null, parentComponent, 'mounted');
        }, parentSuspense);
      } // children


      if (shapeFlag & 16
      /* ARRAY_CHILDREN */
      && // skip if element has innerHTML / textContent
      !(props && (props.innerHTML || props.textContent))) {
        let next = hydrateChildren(el.firstChild, vnode, el, parentComponent, parentSuspense, slotScopeIds, optimized);
        let hasWarned = false;

        while (next) {
          hasMismatch = true;

          if (false) {} // The SSRed DOM contains more nodes than it should. Remove them.


          const cur = next;
          next = next.nextSibling;
          remove(cur);
        }
      } else if (shapeFlag & 8
      /* TEXT_CHILDREN */
      ) {
        if (el.textContent !== vnode.children) {
          hasMismatch = true;
           false && 0;
          el.textContent = vnode.children;
        }
      }
    }

    return el.nextSibling;
  };

  const hydrateChildren = (node, parentVNode, container, parentComponent, parentSuspense, slotScopeIds, optimized) => {
    optimized = optimized || !!parentVNode.dynamicChildren;
    const children = parentVNode.children;
    const l = children.length;
    let hasWarned = false;

    for (let i = 0; i < l; i++) {
      const vnode = optimized ? children[i] : children[i] = normalizeVNode(children[i]);

      if (node) {
        node = hydrateNode(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized);
      } else if (vnode.type === runtime_core_esm_bundler_Text && !vnode.children) {
        continue;
      } else {
        hasMismatch = true;

        if (false) {} // the SSRed DOM didn't contain enough nodes. Mount the missing ones.


        patch(null, vnode, container, null, parentComponent, parentSuspense, isSVGContainer(container), slotScopeIds);
      }
    }

    return node;
  };

  const hydrateFragment = (node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized) => {
    const {
      slotScopeIds: fragmentSlotScopeIds
    } = vnode;

    if (fragmentSlotScopeIds) {
      slotScopeIds = slotScopeIds ? slotScopeIds.concat(fragmentSlotScopeIds) : fragmentSlotScopeIds;
    }

    const container = parentNode(node);
    const next = hydrateChildren(nextSibling(node), vnode, container, parentComponent, parentSuspense, slotScopeIds, optimized);

    if (next && isComment(next) && next.data === ']') {
      return nextSibling(vnode.anchor = next);
    } else {
      // fragment didn't hydrate successfully, since we didn't get a end anchor
      // back. This should have led to node/children mismatch warnings.
      hasMismatch = true; // since the anchor is missing, we need to create one and insert it

      insert(vnode.anchor = createComment(`]`), container, next);
      return next;
    }
  };

  const handleMismatch = (node, vnode, parentComponent, parentSuspense, slotScopeIds, isFragment) => {
    hasMismatch = true;
     false && 0;
    vnode.el = null;

    if (isFragment) {
      // remove excessive fragment nodes
      const end = locateClosingAsyncAnchor(node);

      while (true) {
        const next = nextSibling(node);

        if (next && next !== end) {
          remove(next);
        } else {
          break;
        }
      }
    }

    const next = nextSibling(node);
    const container = parentNode(node);
    remove(node);
    patch(null, vnode, container, next, parentComponent, parentSuspense, isSVGContainer(container), slotScopeIds);
    return next;
  };

  const locateClosingAsyncAnchor = node => {
    let match = 0;

    while (node) {
      node = nextSibling(node);

      if (node && isComment(node)) {
        if (node.data === '[') match++;

        if (node.data === ']') {
          if (match === 0) {
            return nextSibling(node);
          } else {
            match--;
          }
        }
      }
    }

    return node;
  };

  return [hydrate, hydrateNode];
}
/* eslint-disable no-restricted-globals */


let supported;
let perf;

function startMeasure(instance, type) {
  if (instance.appContext.config.performance && isSupported()) {
    perf.mark(`vue-${type}-${instance.uid}`);
  }

  if ( false || __VUE_PROD_DEVTOOLS__) {
    devtoolsPerfStart(instance, type, supported ? perf.now() : Date.now());
  }
}

function endMeasure(instance, type) {
  if (instance.appContext.config.performance && isSupported()) {
    const startTag = `vue-${type}-${instance.uid}`;
    const endTag = startTag + `:end`;
    perf.mark(endTag);
    perf.measure(`<${formatComponentName(instance, instance.type)}> ${type}`, startTag, endTag);
    perf.clearMarks(startTag);
    perf.clearMarks(endTag);
  }

  if ( false || __VUE_PROD_DEVTOOLS__) {
    devtoolsPerfEnd(instance, type, supported ? perf.now() : Date.now());
  }
}

function isSupported() {
  if (supported !== undefined) {
    return supported;
  }

  if (typeof window !== 'undefined' && window.performance) {
    supported = true;
    perf = window.performance;
  } else {
    supported = false;
  }

  return supported;
}
/**
 * This is only called in esm-bundler builds.
 * It is called when a renderer is created, in `baseCreateRenderer` so that
 * importing runtime-core is side-effects free.
 *
 * istanbul-ignore-next
 */


function initFeatureFlags() {
  const needWarn = [];

  if (typeof __VUE_OPTIONS_API__ !== 'boolean') {
     false && 0;
    getGlobalThis().__VUE_OPTIONS_API__ = true;
  }

  if (typeof __VUE_PROD_DEVTOOLS__ !== 'boolean') {
     false && 0;
    getGlobalThis().__VUE_PROD_DEVTOOLS__ = false;
  }

  if (false) {}
}

const queuePostRenderEffect = queueEffectWithSuspense;
/**
 * The createRenderer function accepts two generic arguments:
 * HostNode and HostElement, corresponding to Node and Element types in the
 * host environment. For example, for runtime-dom, HostNode would be the DOM
 * `Node` interface and HostElement would be the DOM `Element` interface.
 *
 * Custom renderers can pass in the platform specific types like this:
 *
 * ``` js
 * const { render, createApp } = createRenderer<Node, Element>({
 *   patchProp,
 *   ...nodeOps
 * })
 * ```
 */

function createRenderer(options) {
  return baseCreateRenderer(options);
} // Separate API for creating hydration-enabled renderer.
// Hydration logic is only used when calling this function, making it
// tree-shakable.


function runtime_core_esm_bundler_createHydrationRenderer(options) {
  return baseCreateRenderer(options, createHydrationFunctions);
} // implementation


function baseCreateRenderer(options, createHydrationFns) {
  // compile-time feature flags check
  {
    initFeatureFlags();
  }
  const target = getGlobalThis();
  target.__VUE__ = true;

  if ( false || __VUE_PROD_DEVTOOLS__) {
    setDevtoolsHook(target.__VUE_DEVTOOLS_GLOBAL_HOOK__, target);
  }

  const {
    insert: hostInsert,
    remove: hostRemove,
    patchProp: hostPatchProp,
    createElement: hostCreateElement,
    createText: hostCreateText,
    createComment: hostCreateComment,
    setText: hostSetText,
    setElementText: hostSetElementText,
    parentNode: hostParentNode,
    nextSibling: hostNextSibling,
    setScopeId: hostSetScopeId = shared_esm_bundler_NOOP,
    cloneNode: hostCloneNode,
    insertStaticContent: hostInsertStaticContent
  } = options; // Note: functions inside this closure should use `const xxx = () => {}`
  // style in order to prevent being inlined by minifiers.

  const patch = (n1, n2, container, anchor = null, parentComponent = null, parentSuspense = null, isSVG = false, slotScopeIds = null, optimized =  false ? 0 : !!n2.dynamicChildren) => {
    if (n1 === n2) {
      return;
    } // patching & not same type, unmount old tree


    if (n1 && !isSameVNodeType(n1, n2)) {
      anchor = getNextHostNode(n1);
      unmount(n1, parentComponent, parentSuspense, true);
      n1 = null;
    }

    if (n2.patchFlag === -2
    /* BAIL */
    ) {
      optimized = false;
      n2.dynamicChildren = null;
    }

    const {
      type,
      ref,
      shapeFlag
    } = n2;

    switch (type) {
      case runtime_core_esm_bundler_Text:
        processText(n1, n2, container, anchor);
        break;

      case runtime_core_esm_bundler_Comment:
        processCommentNode(n1, n2, container, anchor);
        break;

      case runtime_core_esm_bundler_Static:
        if (n1 == null) {
          mountStaticNode(n2, container, anchor, isSVG);
        } else if (false) {}

        break;

      case runtime_core_esm_bundler_Fragment:
        processFragment(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        break;

      default:
        if (shapeFlag & 1
        /* ELEMENT */
        ) {
          processElement(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        } else if (shapeFlag & 6
        /* COMPONENT */
        ) {
          processComponent(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        } else if (shapeFlag & 64
        /* TELEPORT */
        ) {
          type.process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals);
        } else if (shapeFlag & 128
        /* SUSPENSE */
        ) {
          type.process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals);
        } else if (false) {}

    } // set ref


    if (ref != null && parentComponent) {
      setRef(ref, n1 && n1.ref, parentSuspense, n2 || n1, !n2);
    }
  };

  const processText = (n1, n2, container, anchor) => {
    if (n1 == null) {
      hostInsert(n2.el = hostCreateText(n2.children), container, anchor);
    } else {
      const el = n2.el = n1.el;

      if (n2.children !== n1.children) {
        hostSetText(el, n2.children);
      }
    }
  };

  const processCommentNode = (n1, n2, container, anchor) => {
    if (n1 == null) {
      hostInsert(n2.el = hostCreateComment(n2.children || ''), container, anchor);
    } else {
      // there's no support for dynamic comments
      n2.el = n1.el;
    }
  };

  const mountStaticNode = (n2, container, anchor, isSVG) => {
    [n2.el, n2.anchor] = hostInsertStaticContent(n2.children, container, anchor, isSVG, n2.el, n2.anchor);
  };
  /**
   * Dev / HMR only
   */


  const patchStaticNode = (n1, n2, container, isSVG) => {
    // static nodes are only patched during dev for HMR
    if (n2.children !== n1.children) {
      const anchor = hostNextSibling(n1.anchor); // remove existing

      removeStaticNode(n1);
      [n2.el, n2.anchor] = hostInsertStaticContent(n2.children, container, anchor, isSVG);
    } else {
      n2.el = n1.el;
      n2.anchor = n1.anchor;
    }
  };

  const moveStaticNode = ({
    el,
    anchor
  }, container, nextSibling) => {
    let next;

    while (el && el !== anchor) {
      next = hostNextSibling(el);
      hostInsert(el, container, nextSibling);
      el = next;
    }

    hostInsert(anchor, container, nextSibling);
  };

  const removeStaticNode = ({
    el,
    anchor
  }) => {
    let next;

    while (el && el !== anchor) {
      next = hostNextSibling(el);
      hostRemove(el);
      el = next;
    }

    hostRemove(anchor);
  };

  const processElement = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
    isSVG = isSVG || n2.type === 'svg';

    if (n1 == null) {
      mountElement(n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
    } else {
      patchElement(n1, n2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
    }
  };

  const mountElement = (vnode, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
    let el;
    let vnodeHook;
    const {
      type,
      props,
      shapeFlag,
      transition,
      patchFlag,
      dirs
    } = vnode;

    if ( true && vnode.el && hostCloneNode !== undefined && patchFlag === -1
    /* HOISTED */
    ) {
      // If a vnode has non-null el, it means it's being reused.
      // Only static vnodes can be reused, so its mounted DOM nodes should be
      // exactly the same, and we can simply do a clone here.
      // only do this in production since cloned trees cannot be HMR updated.
      el = vnode.el = hostCloneNode(vnode.el);
    } else {
      el = vnode.el = hostCreateElement(vnode.type, isSVG, props && props.is, props); // mount children first, since some props may rely on child content
      // being already rendered, e.g. `<select value>`

      if (shapeFlag & 8
      /* TEXT_CHILDREN */
      ) {
        hostSetElementText(el, vnode.children);
      } else if (shapeFlag & 16
      /* ARRAY_CHILDREN */
      ) {
        mountChildren(vnode.children, el, null, parentComponent, parentSuspense, isSVG && type !== 'foreignObject', slotScopeIds, optimized);
      }

      if (dirs) {
        invokeDirectiveHook(vnode, null, parentComponent, 'created');
      } // props


      if (props) {
        for (const key in props) {
          if (key !== 'value' && !shared_esm_bundler_isReservedProp(key)) {
            hostPatchProp(el, key, null, props[key], isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
          }
        }
        /**
         * Special case for setting value on DOM elements:
         * - it can be order-sensitive (e.g. should be set *after* min/max, #2325, #4024)
         * - it needs to be forced (#1471)
         * #2353 proposes adding another renderer option to configure this, but
         * the properties affects are so finite it is worth special casing it
         * here to reduce the complexity. (Special casing it also should not
         * affect non-DOM renderers)
         */


        if ('value' in props) {
          hostPatchProp(el, 'value', null, props.value);
        }

        if (vnodeHook = props.onVnodeBeforeMount) {
          invokeVNodeHook(vnodeHook, parentComponent, vnode);
        }
      } // scopeId


      setScopeId(el, vnode, vnode.scopeId, slotScopeIds, parentComponent);
    }

    if ( false || __VUE_PROD_DEVTOOLS__) {
      Object.defineProperty(el, '__vnode', {
        value: vnode,
        enumerable: false
      });
      Object.defineProperty(el, '__vueParentComponent', {
        value: parentComponent,
        enumerable: false
      });
    }

    if (dirs) {
      invokeDirectiveHook(vnode, null, parentComponent, 'beforeMount');
    } // #1583 For inside suspense + suspense not resolved case, enter hook should call when suspense resolved
    // #1689 For inside suspense + suspense resolved case, just call it


    const needCallTransitionHooks = (!parentSuspense || parentSuspense && !parentSuspense.pendingBranch) && transition && !transition.persisted;

    if (needCallTransitionHooks) {
      transition.beforeEnter(el);
    }

    hostInsert(el, container, anchor);

    if ((vnodeHook = props && props.onVnodeMounted) || needCallTransitionHooks || dirs) {
      queuePostRenderEffect(() => {
        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
        needCallTransitionHooks && transition.enter(el);
        dirs && invokeDirectiveHook(vnode, null, parentComponent, 'mounted');
      }, parentSuspense);
    }
  };

  const setScopeId = (el, vnode, scopeId, slotScopeIds, parentComponent) => {
    if (scopeId) {
      hostSetScopeId(el, scopeId);
    }

    if (slotScopeIds) {
      for (let i = 0; i < slotScopeIds.length; i++) {
        hostSetScopeId(el, slotScopeIds[i]);
      }
    }

    if (parentComponent) {
      let subTree = parentComponent.subTree;

      if (false
      /* DEV_ROOT_FRAGMENT */
      ) {}

      if (vnode === subTree) {
        const parentVNode = parentComponent.vnode;
        setScopeId(el, parentVNode, parentVNode.scopeId, parentVNode.slotScopeIds, parentComponent.parent);
      }
    }
  };

  const mountChildren = (children, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, start = 0) => {
    for (let i = start; i < children.length; i++) {
      const child = children[i] = optimized ? cloneIfMounted(children[i]) : normalizeVNode(children[i]);
      patch(null, child, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
    }
  };

  const patchElement = (n1, n2, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
    const el = n2.el = n1.el;
    let {
      patchFlag,
      dynamicChildren,
      dirs
    } = n2; // #1426 take the old vnode's patch flag into account since user may clone a
    // compiler-generated vnode, which de-opts to FULL_PROPS

    patchFlag |= n1.patchFlag & 16
    /* FULL_PROPS */
    ;
    const oldProps = n1.props || shared_esm_bundler_EMPTY_OBJ;
    const newProps = n2.props || shared_esm_bundler_EMPTY_OBJ;
    let vnodeHook; // disable recurse in beforeUpdate hooks

    parentComponent && toggleRecurse(parentComponent, false);

    if (vnodeHook = newProps.onVnodeBeforeUpdate) {
      invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
    }

    if (dirs) {
      invokeDirectiveHook(n2, n1, parentComponent, 'beforeUpdate');
    }

    parentComponent && toggleRecurse(parentComponent, true);

    if (false) {}

    const areChildrenSVG = isSVG && n2.type !== 'foreignObject';

    if (dynamicChildren) {
      patchBlockChildren(n1.dynamicChildren, dynamicChildren, el, parentComponent, parentSuspense, areChildrenSVG, slotScopeIds);

      if (false) {}
    } else if (!optimized) {
      // full diff
      patchChildren(n1, n2, el, null, parentComponent, parentSuspense, areChildrenSVG, slotScopeIds, false);
    }

    if (patchFlag > 0) {
      // the presence of a patchFlag means this element's render code was
      // generated by the compiler and can take the fast path.
      // in this path old node and new node are guaranteed to have the same shape
      // (i.e. at the exact same position in the source template)
      if (patchFlag & 16
      /* FULL_PROPS */
      ) {
        // element props contain dynamic keys, full diff needed
        patchProps(el, n2, oldProps, newProps, parentComponent, parentSuspense, isSVG);
      } else {
        // class
        // this flag is matched when the element has dynamic class bindings.
        if (patchFlag & 2
        /* CLASS */
        ) {
          if (oldProps.class !== newProps.class) {
            hostPatchProp(el, 'class', null, newProps.class, isSVG);
          }
        } // style
        // this flag is matched when the element has dynamic style bindings


        if (patchFlag & 4
        /* STYLE */
        ) {
          hostPatchProp(el, 'style', oldProps.style, newProps.style, isSVG);
        } // props
        // This flag is matched when the element has dynamic prop/attr bindings
        // other than class and style. The keys of dynamic prop/attrs are saved for
        // faster iteration.
        // Note dynamic keys like :[foo]="bar" will cause this optimization to
        // bail out and go through a full diff because we need to unset the old key


        if (patchFlag & 8
        /* PROPS */
        ) {
          // if the flag is present then dynamicProps must be non-null
          const propsToUpdate = n2.dynamicProps;

          for (let i = 0; i < propsToUpdate.length; i++) {
            const key = propsToUpdate[i];
            const prev = oldProps[key];
            const next = newProps[key]; // #1471 force patch value

            if (next !== prev || key === 'value') {
              hostPatchProp(el, key, prev, next, isSVG, n1.children, parentComponent, parentSuspense, unmountChildren);
            }
          }
        }
      } // text
      // This flag is matched when the element has only dynamic text children.


      if (patchFlag & 1
      /* TEXT */
      ) {
        if (n1.children !== n2.children) {
          hostSetElementText(el, n2.children);
        }
      }
    } else if (!optimized && dynamicChildren == null) {
      // unoptimized, full diff
      patchProps(el, n2, oldProps, newProps, parentComponent, parentSuspense, isSVG);
    }

    if ((vnodeHook = newProps.onVnodeUpdated) || dirs) {
      queuePostRenderEffect(() => {
        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, n2, n1);
        dirs && invokeDirectiveHook(n2, n1, parentComponent, 'updated');
      }, parentSuspense);
    }
  }; // The fast path for blocks.


  const patchBlockChildren = (oldChildren, newChildren, fallbackContainer, parentComponent, parentSuspense, isSVG, slotScopeIds) => {
    for (let i = 0; i < newChildren.length; i++) {
      const oldVNode = oldChildren[i];
      const newVNode = newChildren[i]; // Determine the container (parent element) for the patch.

      const container = // oldVNode may be an errored async setup() component inside Suspense
      // which will not have a mounted element
      oldVNode.el && ( // - In the case of a Fragment, we need to provide the actual parent
      // of the Fragment itself so it can move its children.
      oldVNode.type === runtime_core_esm_bundler_Fragment || // - In the case of different nodes, there is going to be a replacement
      // which also requires the correct parent container
      !isSameVNodeType(oldVNode, newVNode) || // - In the case of a component, it could contain anything.
      oldVNode.shapeFlag & (6
      /* COMPONENT */
      | 64
      /* TELEPORT */
      )) ? hostParentNode(oldVNode.el) : // In other cases, the parent container is not actually used so we
      // just pass the block element here to avoid a DOM parentNode call.
      fallbackContainer;
      patch(oldVNode, newVNode, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, true);
    }
  };

  const patchProps = (el, vnode, oldProps, newProps, parentComponent, parentSuspense, isSVG) => {
    if (oldProps !== newProps) {
      for (const key in newProps) {
        // empty string is not valid prop
        if (shared_esm_bundler_isReservedProp(key)) continue;
        const next = newProps[key];
        const prev = oldProps[key]; // defer patching value

        if (next !== prev && key !== 'value') {
          hostPatchProp(el, key, prev, next, isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
        }
      }

      if (oldProps !== shared_esm_bundler_EMPTY_OBJ) {
        for (const key in oldProps) {
          if (!shared_esm_bundler_isReservedProp(key) && !(key in newProps)) {
            hostPatchProp(el, key, oldProps[key], null, isSVG, vnode.children, parentComponent, parentSuspense, unmountChildren);
          }
        }
      }

      if ('value' in newProps) {
        hostPatchProp(el, 'value', oldProps.value, newProps.value);
      }
    }
  };

  const processFragment = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
    const fragmentStartAnchor = n2.el = n1 ? n1.el : hostCreateText('');
    const fragmentEndAnchor = n2.anchor = n1 ? n1.anchor : hostCreateText('');
    let {
      patchFlag,
      dynamicChildren,
      slotScopeIds: fragmentSlotScopeIds
    } = n2;

    if (false) {} // check if this is a slot fragment with :slotted scope ids


    if (fragmentSlotScopeIds) {
      slotScopeIds = slotScopeIds ? slotScopeIds.concat(fragmentSlotScopeIds) : fragmentSlotScopeIds;
    }

    if (n1 == null) {
      hostInsert(fragmentStartAnchor, container, anchor);
      hostInsert(fragmentEndAnchor, container, anchor); // a fragment can only have array children
      // since they are either generated by the compiler, or implicitly created
      // from arrays.

      mountChildren(n2.children, container, fragmentEndAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
    } else {
      if (patchFlag > 0 && patchFlag & 64
      /* STABLE_FRAGMENT */
      && dynamicChildren && // #2715 the previous fragment could've been a BAILed one as a result
      // of renderSlot() with no valid children
      n1.dynamicChildren) {
        // a stable fragment (template root or <template v-for>) doesn't need to
        // patch children order, but it may contain dynamicChildren.
        patchBlockChildren(n1.dynamicChildren, dynamicChildren, container, parentComponent, parentSuspense, isSVG, slotScopeIds);

        if (false) {} else if ( // #2080 if the stable fragment has a key, it's a <template v-for> that may
        //  get moved around. Make sure all root level vnodes inherit el.
        // #2134 or if it's a component root, it may also get moved around
        // as the component is being moved.
        n2.key != null || parentComponent && n2 === parentComponent.subTree) {
          traverseStaticChildren(n1, n2, true
          /* shallow */
          );
        }
      } else {
        // keyed / unkeyed, or manual fragments.
        // for keyed & unkeyed, since they are compiler generated from v-for,
        // each child is guaranteed to be a block so the fragment will never
        // have dynamicChildren.
        patchChildren(n1, n2, container, fragmentEndAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
      }
    }
  };

  const processComponent = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
    n2.slotScopeIds = slotScopeIds;

    if (n1 == null) {
      if (n2.shapeFlag & 512
      /* COMPONENT_KEPT_ALIVE */
      ) {
        parentComponent.ctx.activate(n2, container, anchor, isSVG, optimized);
      } else {
        mountComponent(n2, container, anchor, parentComponent, parentSuspense, isSVG, optimized);
      }
    } else {
      updateComponent(n1, n2, optimized);
    }
  };

  const mountComponent = (initialVNode, container, anchor, parentComponent, parentSuspense, isSVG, optimized) => {
    const instance = initialVNode.component = createComponentInstance(initialVNode, parentComponent, parentSuspense);

    if (false) {}

    if (false) {} // inject renderer internals for keepAlive


    if (isKeepAlive(initialVNode)) {
      instance.ctx.renderer = internals;
    } // resolve props and slots for setup context


    {
      if (false) {}

      setupComponent(instance);

      if (false) {}
    } // setup() is async. This component relies on async logic to be resolved
    // before proceeding

    if (instance.asyncDep) {
      parentSuspense && parentSuspense.registerDep(instance, setupRenderEffect); // Give it a placeholder if this is not hydration
      // TODO handle self-defined fallback

      if (!initialVNode.el) {
        const placeholder = instance.subTree = runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Comment);
        processCommentNode(null, placeholder, container, anchor);
      }

      return;
    }

    setupRenderEffect(instance, initialVNode, container, anchor, parentSuspense, isSVG, optimized);

    if (false) {}
  };

  const updateComponent = (n1, n2, optimized) => {
    const instance = n2.component = n1.component;

    if (shouldUpdateComponent(n1, n2, optimized)) {
      if (instance.asyncDep && !instance.asyncResolved) {
        // async & still pending - just update props and slots
        // since the component's reactive effect for render isn't set-up yet
        if (false) {}

        updateComponentPreRender(instance, n2, optimized);

        if (false) {}

        return;
      } else {
        // normal update
        instance.next = n2; // in case the child component is also queued, remove it to avoid
        // double updating the same child component in the same flush.

        invalidateJob(instance.update); // instance.update is the reactive effect.

        instance.update();
      }
    } else {
      // no update needed. just copy over properties
      n2.component = n1.component;
      n2.el = n1.el;
      instance.vnode = n2;
    }
  };

  const setupRenderEffect = (instance, initialVNode, container, anchor, parentSuspense, isSVG, optimized) => {
    const componentUpdateFn = () => {
      if (!instance.isMounted) {
        let vnodeHook;
        const {
          el,
          props
        } = initialVNode;
        const {
          bm,
          m,
          parent
        } = instance;
        const isAsyncWrapperVNode = isAsyncWrapper(initialVNode);
        toggleRecurse(instance, false); // beforeMount hook

        if (bm) {
          invokeArrayFns(bm);
        } // onVnodeBeforeMount


        if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeBeforeMount)) {
          invokeVNodeHook(vnodeHook, parent, initialVNode);
        }

        toggleRecurse(instance, true);

        if (el && hydrateNode) {
          // vnode has adopted host node - perform hydration instead of mount.
          const hydrateSubTree = () => {
            if (false) {}

            instance.subTree = renderComponentRoot(instance);

            if (false) {}

            if (false) {}

            hydrateNode(el, instance.subTree, instance, parentSuspense, null);

            if (false) {}
          };

          if (isAsyncWrapperVNode) {
            initialVNode.type.__asyncLoader().then( // note: we are moving the render call into an async callback,
            // which means it won't track dependencies - but it's ok because
            // a server-rendered async wrapper is already in resolved state
            // and it will never need to change.
            () => !instance.isUnmounted && hydrateSubTree());
          } else {
            hydrateSubTree();
          }
        } else {
          if (false) {}

          const subTree = instance.subTree = renderComponentRoot(instance);

          if (false) {}

          if (false) {}

          patch(null, subTree, container, anchor, instance, parentSuspense, isSVG);

          if (false) {}

          initialVNode.el = subTree.el;
        } // mounted hook


        if (m) {
          queuePostRenderEffect(m, parentSuspense);
        } // onVnodeMounted


        if (!isAsyncWrapperVNode && (vnodeHook = props && props.onVnodeMounted)) {
          const scopedInitialVNode = initialVNode;
          queuePostRenderEffect(() => invokeVNodeHook(vnodeHook, parent, scopedInitialVNode), parentSuspense);
        } // activated hook for keep-alive roots.
        // #1742 activated hook must be accessed after first render
        // since the hook may be injected by a child keep-alive


        if (initialVNode.shapeFlag & 256
        /* COMPONENT_SHOULD_KEEP_ALIVE */
        ) {
          instance.a && queuePostRenderEffect(instance.a, parentSuspense);
        }

        instance.isMounted = true;

        if ( false || __VUE_PROD_DEVTOOLS__) {
          devtoolsComponentAdded(instance);
        } // #2458: deference mount-only object parameters to prevent memleaks


        initialVNode = container = anchor = null;
      } else {
        // updateComponent
        // This is triggered by mutation of component's own state (next: null)
        // OR parent calling processComponent (next: VNode)
        let {
          next,
          bu,
          u,
          parent,
          vnode
        } = instance;
        let originNext = next;
        let vnodeHook;

        if (false) {} // Disallow component effect recursion during pre-lifecycle hooks.


        toggleRecurse(instance, false);

        if (next) {
          next.el = vnode.el;
          updateComponentPreRender(instance, next, optimized);
        } else {
          next = vnode;
        } // beforeUpdate hook


        if (bu) {
          invokeArrayFns(bu);
        } // onVnodeBeforeUpdate


        if (vnodeHook = next.props && next.props.onVnodeBeforeUpdate) {
          invokeVNodeHook(vnodeHook, parent, next, vnode);
        }

        toggleRecurse(instance, true); // render

        if (false) {}

        const nextTree = renderComponentRoot(instance);

        if (false) {}

        const prevTree = instance.subTree;
        instance.subTree = nextTree;

        if (false) {}

        patch(prevTree, nextTree, // parent may have changed if it's in a teleport
        hostParentNode(prevTree.el), // anchor may have changed if it's in a fragment
        getNextHostNode(prevTree), instance, parentSuspense, isSVG);

        if (false) {}

        next.el = nextTree.el;

        if (originNext === null) {
          // self-triggered update. In case of HOC, update parent component
          // vnode el. HOC is indicated by parent instance's subTree pointing
          // to child component's vnode
          updateHOCHostEl(instance, nextTree.el);
        } // updated hook


        if (u) {
          queuePostRenderEffect(u, parentSuspense);
        } // onVnodeUpdated


        if (vnodeHook = next.props && next.props.onVnodeUpdated) {
          queuePostRenderEffect(() => invokeVNodeHook(vnodeHook, parent, next, vnode), parentSuspense);
        }

        if ( false || __VUE_PROD_DEVTOOLS__) {
          devtoolsComponentUpdated(instance);
        }

        if (false) {}
      }
    }; // create reactive effect for rendering


    const effect = instance.effect = new ReactiveEffect(componentUpdateFn, () => queueJob(instance.update), instance.scope // track it in component's effect scope
    );
    const update = instance.update = effect.run.bind(effect);
    update.id = instance.uid; // allowRecurse
    // #1801, #2043 component render effects should allow recursive updates

    toggleRecurse(instance, true);

    if (false) {}

    update();
  };

  const updateComponentPreRender = (instance, nextVNode, optimized) => {
    nextVNode.component = instance;
    const prevProps = instance.vnode.props;
    instance.vnode = nextVNode;
    instance.next = null;
    updateProps(instance, nextVNode.props, prevProps, optimized);
    updateSlots(instance, nextVNode.children, optimized);
    pauseTracking(); // props update may have triggered pre-flush watchers.
    // flush them before the render update.

    flushPreFlushCbs(undefined, instance.update);
    resetTracking();
  };

  const patchChildren = (n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized = false) => {
    const c1 = n1 && n1.children;
    const prevShapeFlag = n1 ? n1.shapeFlag : 0;
    const c2 = n2.children;
    const {
      patchFlag,
      shapeFlag
    } = n2; // fast path

    if (patchFlag > 0) {
      if (patchFlag & 128
      /* KEYED_FRAGMENT */
      ) {
        // this could be either fully-keyed or mixed (some keyed some not)
        // presence of patchFlag means children are guaranteed to be arrays
        patchKeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        return;
      } else if (patchFlag & 256
      /* UNKEYED_FRAGMENT */
      ) {
        // unkeyed
        patchUnkeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        return;
      }
    } // children has 3 possibilities: text, array or no children.


    if (shapeFlag & 8
    /* TEXT_CHILDREN */
    ) {
      // text children fast path
      if (prevShapeFlag & 16
      /* ARRAY_CHILDREN */
      ) {
        unmountChildren(c1, parentComponent, parentSuspense);
      }

      if (c2 !== c1) {
        hostSetElementText(container, c2);
      }
    } else {
      if (prevShapeFlag & 16
      /* ARRAY_CHILDREN */
      ) {
        // prev children was array
        if (shapeFlag & 16
        /* ARRAY_CHILDREN */
        ) {
          // two arrays, cannot assume anything, do full diff
          patchKeyedChildren(c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        } else {
          // no new children, just unmount old
          unmountChildren(c1, parentComponent, parentSuspense, true);
        }
      } else {
        // prev children was text OR null
        // new children is array OR null
        if (prevShapeFlag & 8
        /* TEXT_CHILDREN */
        ) {
          hostSetElementText(container, '');
        } // mount new if array


        if (shapeFlag & 16
        /* ARRAY_CHILDREN */
        ) {
          mountChildren(c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        }
      }
    }
  };

  const patchUnkeyedChildren = (c1, c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
    c1 = c1 || EMPTY_ARR;
    c2 = c2 || EMPTY_ARR;
    const oldLength = c1.length;
    const newLength = c2.length;
    const commonLength = Math.min(oldLength, newLength);
    let i;

    for (i = 0; i < commonLength; i++) {
      const nextChild = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);
      patch(c1[i], nextChild, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
    }

    if (oldLength > newLength) {
      // remove old
      unmountChildren(c1, parentComponent, parentSuspense, true, false, commonLength);
    } else {
      // mount new
      mountChildren(c2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, commonLength);
    }
  }; // can be all-keyed or mixed


  const patchKeyedChildren = (c1, c2, container, parentAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized) => {
    let i = 0;
    const l2 = c2.length;
    let e1 = c1.length - 1; // prev ending index

    let e2 = l2 - 1; // next ending index
    // 1. sync from start
    // (a b) c
    // (a b) d e

    while (i <= e1 && i <= e2) {
      const n1 = c1[i];
      const n2 = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);

      if (isSameVNodeType(n1, n2)) {
        patch(n1, n2, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
      } else {
        break;
      }

      i++;
    } // 2. sync from end
    // a (b c)
    // d e (b c)


    while (i <= e1 && i <= e2) {
      const n1 = c1[e1];
      const n2 = c2[e2] = optimized ? cloneIfMounted(c2[e2]) : normalizeVNode(c2[e2]);

      if (isSameVNodeType(n1, n2)) {
        patch(n1, n2, container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
      } else {
        break;
      }

      e1--;
      e2--;
    } // 3. common sequence + mount
    // (a b)
    // (a b) c
    // i = 2, e1 = 1, e2 = 2
    // (a b)
    // c (a b)
    // i = 0, e1 = -1, e2 = 0


    if (i > e1) {
      if (i <= e2) {
        const nextPos = e2 + 1;
        const anchor = nextPos < l2 ? c2[nextPos].el : parentAnchor;

        while (i <= e2) {
          patch(null, c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]), container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
          i++;
        }
      }
    } // 4. common sequence + unmount
    // (a b) c
    // (a b)
    // i = 2, e1 = 2, e2 = 1
    // a (b c)
    // (b c)
    // i = 0, e1 = 0, e2 = -1
    else if (i > e2) {
      while (i <= e1) {
        unmount(c1[i], parentComponent, parentSuspense, true);
        i++;
      }
    } // 5. unknown sequence
    // [i ... e1 + 1]: a b [c d e] f g
    // [i ... e2 + 1]: a b [e d c h] f g
    // i = 2, e1 = 4, e2 = 5
    else {
      const s1 = i; // prev starting index

      const s2 = i; // next starting index
      // 5.1 build key:index map for newChildren

      const keyToNewIndexMap = new Map();

      for (i = s2; i <= e2; i++) {
        const nextChild = c2[i] = optimized ? cloneIfMounted(c2[i]) : normalizeVNode(c2[i]);

        if (nextChild.key != null) {
          if (false) {}

          keyToNewIndexMap.set(nextChild.key, i);
        }
      } // 5.2 loop through old children left to be patched and try to patch
      // matching nodes & remove nodes that are no longer present


      let j;
      let patched = 0;
      const toBePatched = e2 - s2 + 1;
      let moved = false; // used to track whether any node has moved

      let maxNewIndexSoFar = 0; // works as Map<newIndex, oldIndex>
      // Note that oldIndex is offset by +1
      // and oldIndex = 0 is a special value indicating the new node has
      // no corresponding old node.
      // used for determining longest stable subsequence

      const newIndexToOldIndexMap = new Array(toBePatched);

      for (i = 0; i < toBePatched; i++) newIndexToOldIndexMap[i] = 0;

      for (i = s1; i <= e1; i++) {
        const prevChild = c1[i];

        if (patched >= toBePatched) {
          // all new children have been patched so this can only be a removal
          unmount(prevChild, parentComponent, parentSuspense, true);
          continue;
        }

        let newIndex;

        if (prevChild.key != null) {
          newIndex = keyToNewIndexMap.get(prevChild.key);
        } else {
          // key-less node, try to locate a key-less node of the same type
          for (j = s2; j <= e2; j++) {
            if (newIndexToOldIndexMap[j - s2] === 0 && isSameVNodeType(prevChild, c2[j])) {
              newIndex = j;
              break;
            }
          }
        }

        if (newIndex === undefined) {
          unmount(prevChild, parentComponent, parentSuspense, true);
        } else {
          newIndexToOldIndexMap[newIndex - s2] = i + 1;

          if (newIndex >= maxNewIndexSoFar) {
            maxNewIndexSoFar = newIndex;
          } else {
            moved = true;
          }

          patch(prevChild, c2[newIndex], container, null, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
          patched++;
        }
      } // 5.3 move and mount
      // generate longest stable subsequence only when nodes have moved


      const increasingNewIndexSequence = moved ? getSequence(newIndexToOldIndexMap) : EMPTY_ARR;
      j = increasingNewIndexSequence.length - 1; // looping backwards so that we can use last patched node as anchor

      for (i = toBePatched - 1; i >= 0; i--) {
        const nextIndex = s2 + i;
        const nextChild = c2[nextIndex];
        const anchor = nextIndex + 1 < l2 ? c2[nextIndex + 1].el : parentAnchor;

        if (newIndexToOldIndexMap[i] === 0) {
          // mount new
          patch(null, nextChild, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        } else if (moved) {
          // move if:
          // There is no stable subsequence (e.g. a reverse)
          // OR current node is not among the stable sequence
          if (j < 0 || i !== increasingNewIndexSequence[j]) {
            move(nextChild, container, anchor, 2
            /* REORDER */
            );
          } else {
            j--;
          }
        }
      }
    }
  };

  const move = (vnode, container, anchor, moveType, parentSuspense = null) => {
    const {
      el,
      type,
      transition,
      children,
      shapeFlag
    } = vnode;

    if (shapeFlag & 6
    /* COMPONENT */
    ) {
      move(vnode.component.subTree, container, anchor, moveType);
      return;
    }

    if (shapeFlag & 128
    /* SUSPENSE */
    ) {
      vnode.suspense.move(container, anchor, moveType);
      return;
    }

    if (shapeFlag & 64
    /* TELEPORT */
    ) {
      type.move(vnode, container, anchor, internals);
      return;
    }

    if (type === runtime_core_esm_bundler_Fragment) {
      hostInsert(el, container, anchor);

      for (let i = 0; i < children.length; i++) {
        move(children[i], container, anchor, moveType);
      }

      hostInsert(vnode.anchor, container, anchor);
      return;
    }

    if (type === runtime_core_esm_bundler_Static) {
      moveStaticNode(vnode, container, anchor);
      return;
    } // single nodes


    const needTransition = moveType !== 2
    /* REORDER */
    && shapeFlag & 1
    /* ELEMENT */
    && transition;

    if (needTransition) {
      if (moveType === 0
      /* ENTER */
      ) {
        transition.beforeEnter(el);
        hostInsert(el, container, anchor);
        queuePostRenderEffect(() => transition.enter(el), parentSuspense);
      } else {
        const {
          leave,
          delayLeave,
          afterLeave
        } = transition;

        const remove = () => hostInsert(el, container, anchor);

        const performLeave = () => {
          leave(el, () => {
            remove();
            afterLeave && afterLeave();
          });
        };

        if (delayLeave) {
          delayLeave(el, remove, performLeave);
        } else {
          performLeave();
        }
      }
    } else {
      hostInsert(el, container, anchor);
    }
  };

  const unmount = (vnode, parentComponent, parentSuspense, doRemove = false, optimized = false) => {
    const {
      type,
      props,
      ref,
      children,
      dynamicChildren,
      shapeFlag,
      patchFlag,
      dirs
    } = vnode; // unset ref

    if (ref != null) {
      setRef(ref, null, parentSuspense, vnode, true);
    }

    if (shapeFlag & 256
    /* COMPONENT_SHOULD_KEEP_ALIVE */
    ) {
      parentComponent.ctx.deactivate(vnode);
      return;
    }

    const shouldInvokeDirs = shapeFlag & 1
    /* ELEMENT */
    && dirs;
    const shouldInvokeVnodeHook = !isAsyncWrapper(vnode);
    let vnodeHook;

    if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeBeforeUnmount)) {
      invokeVNodeHook(vnodeHook, parentComponent, vnode);
    }

    if (shapeFlag & 6
    /* COMPONENT */
    ) {
      unmountComponent(vnode.component, parentSuspense, doRemove);
    } else {
      if (shapeFlag & 128
      /* SUSPENSE */
      ) {
        vnode.suspense.unmount(parentSuspense, doRemove);
        return;
      }

      if (shouldInvokeDirs) {
        invokeDirectiveHook(vnode, null, parentComponent, 'beforeUnmount');
      }

      if (shapeFlag & 64
      /* TELEPORT */
      ) {
        vnode.type.remove(vnode, parentComponent, parentSuspense, optimized, internals, doRemove);
      } else if (dynamicChildren && ( // #1153: fast path should not be taken for non-stable (v-for) fragments
      type !== runtime_core_esm_bundler_Fragment || patchFlag > 0 && patchFlag & 64
      /* STABLE_FRAGMENT */
      )) {
        // fast path for block nodes: only need to unmount dynamic children.
        unmountChildren(dynamicChildren, parentComponent, parentSuspense, false, true);
      } else if (type === runtime_core_esm_bundler_Fragment && patchFlag & (128
      /* KEYED_FRAGMENT */
      | 256
      /* UNKEYED_FRAGMENT */
      ) || !optimized && shapeFlag & 16
      /* ARRAY_CHILDREN */
      ) {
        unmountChildren(children, parentComponent, parentSuspense);
      }

      if (doRemove) {
        remove(vnode);
      }
    }

    if (shouldInvokeVnodeHook && (vnodeHook = props && props.onVnodeUnmounted) || shouldInvokeDirs) {
      queuePostRenderEffect(() => {
        vnodeHook && invokeVNodeHook(vnodeHook, parentComponent, vnode);
        shouldInvokeDirs && invokeDirectiveHook(vnode, null, parentComponent, 'unmounted');
      }, parentSuspense);
    }
  };

  const remove = vnode => {
    const {
      type,
      el,
      anchor,
      transition
    } = vnode;

    if (type === runtime_core_esm_bundler_Fragment) {
      removeFragment(el, anchor);
      return;
    }

    if (type === runtime_core_esm_bundler_Static) {
      removeStaticNode(vnode);
      return;
    }

    const performRemove = () => {
      hostRemove(el);

      if (transition && !transition.persisted && transition.afterLeave) {
        transition.afterLeave();
      }
    };

    if (vnode.shapeFlag & 1
    /* ELEMENT */
    && transition && !transition.persisted) {
      const {
        leave,
        delayLeave
      } = transition;

      const performLeave = () => leave(el, performRemove);

      if (delayLeave) {
        delayLeave(vnode.el, performRemove, performLeave);
      } else {
        performLeave();
      }
    } else {
      performRemove();
    }
  };

  const removeFragment = (cur, end) => {
    // For fragments, directly remove all contained DOM nodes.
    // (fragment child nodes cannot have transition)
    let next;

    while (cur !== end) {
      next = hostNextSibling(cur);
      hostRemove(cur);
      cur = next;
    }

    hostRemove(end);
  };

  const unmountComponent = (instance, parentSuspense, doRemove) => {
    if (false) {}

    const {
      bum,
      scope,
      update,
      subTree,
      um
    } = instance; // beforeUnmount hook

    if (bum) {
      invokeArrayFns(bum);
    } // stop effects in component scope


    scope.stop(); // update may be null if a component is unmounted before its async
    // setup has resolved.

    if (update) {
      // so that scheduler will no longer invoke it
      update.active = false;
      unmount(subTree, instance, parentSuspense, doRemove);
    } // unmounted hook


    if (um) {
      queuePostRenderEffect(um, parentSuspense);
    }

    queuePostRenderEffect(() => {
      instance.isUnmounted = true;
    }, parentSuspense); // A component with async dep inside a pending suspense is unmounted before
    // its async dep resolves. This should remove the dep from the suspense, and
    // cause the suspense to resolve immediately if that was the last dep.

    if (parentSuspense && parentSuspense.pendingBranch && !parentSuspense.isUnmounted && instance.asyncDep && !instance.asyncResolved && instance.suspenseId === parentSuspense.pendingId) {
      parentSuspense.deps--;

      if (parentSuspense.deps === 0) {
        parentSuspense.resolve();
      }
    }

    if ( false || __VUE_PROD_DEVTOOLS__) {
      devtoolsComponentRemoved(instance);
    }
  };

  const unmountChildren = (children, parentComponent, parentSuspense, doRemove = false, optimized = false, start = 0) => {
    for (let i = start; i < children.length; i++) {
      unmount(children[i], parentComponent, parentSuspense, doRemove, optimized);
    }
  };

  const getNextHostNode = vnode => {
    if (vnode.shapeFlag & 6
    /* COMPONENT */
    ) {
      return getNextHostNode(vnode.component.subTree);
    }

    if (vnode.shapeFlag & 128
    /* SUSPENSE */
    ) {
      return vnode.suspense.next();
    }

    return hostNextSibling(vnode.anchor || vnode.el);
  };

  const render = (vnode, container, isSVG) => {
    if (vnode == null) {
      if (container._vnode) {
        unmount(container._vnode, null, null, true);
      }
    } else {
      patch(container._vnode || null, vnode, container, null, null, null, isSVG);
    }

    flushPostFlushCbs();
    container._vnode = vnode;
  };

  const internals = {
    p: patch,
    um: unmount,
    m: move,
    r: remove,
    mt: mountComponent,
    mc: mountChildren,
    pc: patchChildren,
    pbc: patchBlockChildren,
    n: getNextHostNode,
    o: options
  };
  let hydrate;
  let hydrateNode;

  if (createHydrationFns) {
    [hydrate, hydrateNode] = createHydrationFns(internals);
  }

  return {
    render,
    hydrate,
    createApp: createAppAPI(render, hydrate)
  };
}

function toggleRecurse({
  effect,
  update
}, allowed) {
  effect.allowRecurse = update.allowRecurse = allowed;
}
/**
 * #1156
 * When a component is HMR-enabled, we need to make sure that all static nodes
 * inside a block also inherit the DOM element from the previous tree so that
 * HMR updates (which are full updates) can retrieve the element for patching.
 *
 * #2080
 * Inside keyed `template` fragment static children, if a fragment is moved,
 * the children will always be moved. Therefore, in order to ensure correct move
 * position, el should be inherited from previous nodes.
 */


function traverseStaticChildren(n1, n2, shallow = false) {
  const ch1 = n1.children;
  const ch2 = n2.children;

  if (shared_esm_bundler_isArray(ch1) && shared_esm_bundler_isArray(ch2)) {
    for (let i = 0; i < ch1.length; i++) {
      // this is only called in the optimized path so array children are
      // guaranteed to be vnodes
      const c1 = ch1[i];
      let c2 = ch2[i];

      if (c2.shapeFlag & 1
      /* ELEMENT */
      && !c2.dynamicChildren) {
        if (c2.patchFlag <= 0 || c2.patchFlag === 32
        /* HYDRATE_EVENTS */
        ) {
          c2 = ch2[i] = cloneIfMounted(ch2[i]);
          c2.el = c1.el;
        }

        if (!shallow) traverseStaticChildren(c1, c2);
      } // also inherit for comment nodes, but not placeholders (e.g. v-if which
      // would have received .el during block patch)


      if (false) {}
    }
  }
} // https://en.wikipedia.org/wiki/Longest_increasing_subsequence


function getSequence(arr) {
  const p = arr.slice();
  const result = [0];
  let i, j, u, v, c;
  const len = arr.length;

  for (i = 0; i < len; i++) {
    const arrI = arr[i];

    if (arrI !== 0) {
      j = result[result.length - 1];

      if (arr[j] < arrI) {
        p[i] = j;
        result.push(i);
        continue;
      }

      u = 0;
      v = result.length - 1;

      while (u < v) {
        c = u + v >> 1;

        if (arr[result[c]] < arrI) {
          u = c + 1;
        } else {
          v = c;
        }
      }

      if (arrI < arr[result[u]]) {
        if (u > 0) {
          p[i] = result[u - 1];
        }

        result[u] = i;
      }
    }
  }

  u = result.length;
  v = result[u - 1];

  while (u-- > 0) {
    result[u] = v;
    v = p[v];
  }

  return result;
}

const isTeleport = type => type.__isTeleport;

const isTeleportDisabled = props => props && (props.disabled || props.disabled === '');

const isTargetSVG = target => typeof SVGElement !== 'undefined' && target instanceof SVGElement;

const resolveTarget = (props, select) => {
  const targetSelector = props && props.to;

  if (shared_esm_bundler_isString(targetSelector)) {
    if (!select) {
       false && 0;
      return null;
    } else {
      const target = select(targetSelector);

      if (!target) {
         false && 0;
      }

      return target;
    }
  } else {
    if (false) {}

    return targetSelector;
  }
};

const TeleportImpl = {
  __isTeleport: true,

  process(n1, n2, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized, internals) {
    const {
      mc: mountChildren,
      pc: patchChildren,
      pbc: patchBlockChildren,
      o: {
        insert,
        querySelector,
        createText,
        createComment
      }
    } = internals;
    const disabled = isTeleportDisabled(n2.props);
    let {
      shapeFlag,
      children,
      dynamicChildren
    } = n2; // #3302
    // HMR updated, force full diff

    if (false) {}

    if (n1 == null) {
      // insert anchors in the main view
      const placeholder = n2.el =  false ? 0 : createText('');
      const mainAnchor = n2.anchor =  false ? 0 : createText('');
      insert(placeholder, container, anchor);
      insert(mainAnchor, container, anchor);
      const target = n2.target = resolveTarget(n2.props, querySelector);
      const targetAnchor = n2.targetAnchor = createText('');

      if (target) {
        insert(targetAnchor, target); // #2652 we could be teleporting from a non-SVG tree into an SVG tree

        isSVG = isSVG || isTargetSVG(target);
      } else if (false) {}

      const mount = (container, anchor) => {
        // Teleport *always* has Array children. This is enforced in both the
        // compiler and vnode children normalization.
        if (shapeFlag & 16
        /* ARRAY_CHILDREN */
        ) {
          mountChildren(children, container, anchor, parentComponent, parentSuspense, isSVG, slotScopeIds, optimized);
        }
      };

      if (disabled) {
        mount(container, mainAnchor);
      } else if (target) {
        mount(target, targetAnchor);
      }
    } else {
      // update content
      n2.el = n1.el;
      const mainAnchor = n2.anchor = n1.anchor;
      const target = n2.target = n1.target;
      const targetAnchor = n2.targetAnchor = n1.targetAnchor;
      const wasDisabled = isTeleportDisabled(n1.props);
      const currentContainer = wasDisabled ? container : target;
      const currentAnchor = wasDisabled ? mainAnchor : targetAnchor;
      isSVG = isSVG || isTargetSVG(target);

      if (dynamicChildren) {
        // fast path when the teleport happens to be a block root
        patchBlockChildren(n1.dynamicChildren, dynamicChildren, currentContainer, parentComponent, parentSuspense, isSVG, slotScopeIds); // even in block tree mode we need to make sure all root-level nodes
        // in the teleport inherit previous DOM references so that they can
        // be moved in future patches.

        traverseStaticChildren(n1, n2, true);
      } else if (!optimized) {
        patchChildren(n1, n2, currentContainer, currentAnchor, parentComponent, parentSuspense, isSVG, slotScopeIds, false);
      }

      if (disabled) {
        if (!wasDisabled) {
          // enabled -> disabled
          // move into main container
          moveTeleport(n2, container, mainAnchor, internals, 1
          /* TOGGLE */
          );
        }
      } else {
        // target changed
        if ((n2.props && n2.props.to) !== (n1.props && n1.props.to)) {
          const nextTarget = n2.target = resolveTarget(n2.props, querySelector);

          if (nextTarget) {
            moveTeleport(n2, nextTarget, null, internals, 0
            /* TARGET_CHANGE */
            );
          } else if (false) {}
        } else if (wasDisabled) {
          // disabled -> enabled
          // move into teleport target
          moveTeleport(n2, target, targetAnchor, internals, 1
          /* TOGGLE */
          );
        }
      }
    }
  },

  remove(vnode, parentComponent, parentSuspense, optimized, {
    um: unmount,
    o: {
      remove: hostRemove
    }
  }, doRemove) {
    const {
      shapeFlag,
      children,
      anchor,
      targetAnchor,
      target,
      props
    } = vnode;

    if (target) {
      hostRemove(targetAnchor);
    } // an unmounted teleport should always remove its children if not disabled


    if (doRemove || !isTeleportDisabled(props)) {
      hostRemove(anchor);

      if (shapeFlag & 16
      /* ARRAY_CHILDREN */
      ) {
        for (let i = 0; i < children.length; i++) {
          const child = children[i];
          unmount(child, parentComponent, parentSuspense, true, !!child.dynamicChildren);
        }
      }
    }
  },

  move: moveTeleport,
  hydrate: hydrateTeleport
};

function moveTeleport(vnode, container, parentAnchor, {
  o: {
    insert
  },
  m: move
}, moveType = 2
/* REORDER */
) {
  // move target anchor if this is a target change.
  if (moveType === 0
  /* TARGET_CHANGE */
  ) {
    insert(vnode.targetAnchor, container, parentAnchor);
  }

  const {
    el,
    anchor,
    shapeFlag,
    children,
    props
  } = vnode;
  const isReorder = moveType === 2
  /* REORDER */
  ; // move main view anchor if this is a re-order.

  if (isReorder) {
    insert(el, container, parentAnchor);
  } // if this is a re-order and teleport is enabled (content is in target)
  // do not move children. So the opposite is: only move children if this
  // is not a reorder, or the teleport is disabled


  if (!isReorder || isTeleportDisabled(props)) {
    // Teleport has either Array children or no children.
    if (shapeFlag & 16
    /* ARRAY_CHILDREN */
    ) {
      for (let i = 0; i < children.length; i++) {
        move(children[i], container, parentAnchor, 2
        /* REORDER */
        );
      }
    }
  } // move main view anchor if this is a re-order.


  if (isReorder) {
    insert(anchor, container, parentAnchor);
  }
}

function hydrateTeleport(node, vnode, parentComponent, parentSuspense, slotScopeIds, optimized, {
  o: {
    nextSibling,
    parentNode,
    querySelector
  }
}, hydrateChildren) {
  const target = vnode.target = resolveTarget(vnode.props, querySelector);

  if (target) {
    // if multiple teleports rendered to the same target element, we need to
    // pick up from where the last teleport finished instead of the first node
    const targetNode = target._lpa || target.firstChild;

    if (vnode.shapeFlag & 16
    /* ARRAY_CHILDREN */
    ) {
      if (isTeleportDisabled(vnode.props)) {
        vnode.anchor = hydrateChildren(nextSibling(node), vnode, parentNode(node), parentComponent, parentSuspense, slotScopeIds, optimized);
        vnode.targetAnchor = targetNode;
      } else {
        vnode.anchor = nextSibling(node);
        vnode.targetAnchor = hydrateChildren(targetNode, vnode, target, parentComponent, parentSuspense, slotScopeIds, optimized);
      }

      target._lpa = vnode.targetAnchor && nextSibling(vnode.targetAnchor);
    }
  }

  return vnode.anchor && nextSibling(vnode.anchor);
} // Force-casted public typing for h and TSX props inference


const Teleport = TeleportImpl;
const COMPONENTS = 'components';
const DIRECTIVES = 'directives';
/**
 * @private
 */

function resolveComponent(name, maybeSelfReference) {
  return resolveAsset(COMPONENTS, name, true, maybeSelfReference) || name;
}

const NULL_DYNAMIC_COMPONENT = Symbol();
/**
 * @private
 */

function resolveDynamicComponent(component) {
  if (shared_esm_bundler_isString(component)) {
    return resolveAsset(COMPONENTS, component, false) || component;
  } else {
    // invalid types will fallthrough to createVNode and raise warning
    return component || NULL_DYNAMIC_COMPONENT;
  }
}
/**
 * @private
 */


function resolveDirective(name) {
  return resolveAsset(DIRECTIVES, name);
} // implementation


function resolveAsset(type, name, warnMissing = true, maybeSelfReference = false) {
  const instance = currentRenderingInstance || currentInstance;

  if (instance) {
    const Component = instance.type; // explicit self name has highest priority

    if (type === COMPONENTS) {
      const selfName = getComponentName(Component);

      if (selfName && (selfName === name || selfName === shared_esm_bundler_camelize(name) || selfName === shared_esm_bundler_capitalize(shared_esm_bundler_camelize(name)))) {
        return Component;
      }
    }

    const res = // local registration
    // check instance[type] first which is resolved for options API
    resolve(instance[type] || Component[type], name) || // global registration
    resolve(instance.appContext[type], name);

    if (!res && maybeSelfReference) {
      // fallback to implicit self-reference
      return Component;
    }

    if (false) {}

    return res;
  } else if (false) {}
}

function resolve(registry, name) {
  return registry && (registry[name] || registry[shared_esm_bundler_camelize(name)] || registry[shared_esm_bundler_capitalize(shared_esm_bundler_camelize(name))]);
}

const runtime_core_esm_bundler_Fragment = Symbol( false ? 0 : undefined);
const runtime_core_esm_bundler_Text = Symbol( false ? 0 : undefined);
const runtime_core_esm_bundler_Comment = Symbol( false ? 0 : undefined);
const runtime_core_esm_bundler_Static = Symbol( false ? 0 : undefined); // Since v-if and v-for are the two possible ways node structure can dynamically
// change, once we consider v-if branches and each v-for fragment a block, we
// can divide a template into nested blocks, and within each block the node
// structure would be stable. This allows us to skip most children diffing
// and only worry about the dynamic nodes (indicated by patch flags).

const blockStack = [];
let currentBlock = null;
/**
 * Open a block.
 * This must be called before `createBlock`. It cannot be part of `createBlock`
 * because the children of the block are evaluated before `createBlock` itself
 * is called. The generated code typically looks like this:
 *
 * ```js
 * function render() {
 *   return (openBlock(),createBlock('div', null, [...]))
 * }
 * ```
 * disableTracking is true when creating a v-for fragment block, since a v-for
 * fragment always diffs its children.
 *
 * @private
 */

function runtime_core_esm_bundler_openBlock(disableTracking = false) {
  blockStack.push(currentBlock = disableTracking ? null : []);
}

function closeBlock() {
  blockStack.pop();
  currentBlock = blockStack[blockStack.length - 1] || null;
} // Whether we should be tracking dynamic child nodes inside a block.
// Only tracks when this value is > 0
// We are not using a simple boolean because this value may need to be
// incremented/decremented by nested usage of v-once (see below)


let isBlockTreeEnabled = 1;
/**
 * Block tracking sometimes needs to be disabled, for example during the
 * creation of a tree that needs to be cached by v-once. The compiler generates
 * code like this:
 *
 * ``` js
 * _cache[1] || (
 *   setBlockTracking(-1),
 *   _cache[1] = createVNode(...),
 *   setBlockTracking(1),
 *   _cache[1]
 * )
 * ```
 *
 * @private
 */

function setBlockTracking(value) {
  isBlockTreeEnabled += value;
}

function setupBlock(vnode) {
  // save current block children on the block vnode
  vnode.dynamicChildren = isBlockTreeEnabled > 0 ? currentBlock || EMPTY_ARR : null; // close block

  closeBlock(); // a block is always going to be patched, so track it as a child of its
  // parent block

  if (isBlockTreeEnabled > 0 && currentBlock) {
    currentBlock.push(vnode);
  }

  return vnode;
}
/**
 * @private
 */


function createElementBlock(type, props, children, patchFlag, dynamicProps, shapeFlag) {
  return setupBlock(createBaseVNode(type, props, children, patchFlag, dynamicProps, shapeFlag, true
  /* isBlock */
  ));
}
/**
 * Create a block root vnode. Takes the same exact arguments as `createVNode`.
 * A block root keeps track of dynamic nodes within the block in the
 * `dynamicChildren` array.
 *
 * @private
 */


function runtime_core_esm_bundler_createBlock(type, props, children, patchFlag, dynamicProps) {
  return setupBlock(runtime_core_esm_bundler_createVNode(type, props, children, patchFlag, dynamicProps, true
  /* isBlock: prevent a block from tracking itself */
  ));
}

function runtime_core_esm_bundler_isVNode(value) {
  return value ? value.__v_isVNode === true : false;
}

function isSameVNodeType(n1, n2) {
  if (false) {}

  return n1.type === n2.type && n1.key === n2.key;
}

let vnodeArgsTransformer;
/**
 * Internal API for registering an arguments transform for createVNode
 * used for creating stubs in the test-utils
 * It is *internal* but needs to be exposed for test-utils to pick up proper
 * typings
 */

function transformVNodeArgs(transformer) {
  vnodeArgsTransformer = transformer;
}

const createVNodeWithArgsTransform = (...args) => {
  return _createVNode(...(vnodeArgsTransformer ? vnodeArgsTransformer(args, currentRenderingInstance) : args));
};

const InternalObjectKey = `__vInternal`;

const normalizeKey = ({
  key
}) => key != null ? key : null;

const normalizeRef = ({
  ref,
  ref_key,
  ref_for
}) => {
  return ref != null ? shared_esm_bundler_isString(ref) || reactivity_esm_bundler_isRef(ref) || shared_esm_bundler_isFunction(ref) ? {
    i: currentRenderingInstance,
    r: ref,
    k: ref_key,
    f: !!ref_for
  } : ref : null;
};

function createBaseVNode(type, props = null, children = null, patchFlag = 0, dynamicProps = null, shapeFlag = type === runtime_core_esm_bundler_Fragment ? 0 : 1
/* ELEMENT */
, isBlockNode = false, needFullChildrenNormalization = false) {
  const vnode = {
    __v_isVNode: true,
    __v_skip: true,
    type,
    props,
    key: props && normalizeKey(props),
    ref: props && normalizeRef(props),
    scopeId: currentScopeId,
    slotScopeIds: null,
    children,
    component: null,
    suspense: null,
    ssContent: null,
    ssFallback: null,
    dirs: null,
    transition: null,
    el: null,
    anchor: null,
    target: null,
    targetAnchor: null,
    staticCount: 0,
    shapeFlag,
    patchFlag,
    dynamicProps,
    dynamicChildren: null,
    appContext: null
  };

  if (needFullChildrenNormalization) {
    normalizeChildren(vnode, children); // normalize suspense children

    if (shapeFlag & 128
    /* SUSPENSE */
    ) {
      type.normalize(vnode);
    }
  } else if (children) {
    // compiled element vnode - if children is passed, only possible types are
    // string or Array.
    vnode.shapeFlag |= shared_esm_bundler_isString(children) ? 8
    /* TEXT_CHILDREN */
    : 16
    /* ARRAY_CHILDREN */
    ;
  } // validate key


  if (false) {} // track vnode for block tree


  if (isBlockTreeEnabled > 0 && // avoid a block node from tracking itself
  !isBlockNode && // has current parent block
  currentBlock && ( // presence of a patch flag indicates this node needs patching on updates.
  // component nodes also should always be patched, because even if the
  // component doesn't need to update, it needs to persist the instance on to
  // the next vnode so that it can be properly unmounted later.
  vnode.patchFlag > 0 || shapeFlag & 6
  /* COMPONENT */
  ) && // the EVENTS flag is only for hydration and if it is the only flag, the
  // vnode should not be considered dynamic due to handler caching.
  vnode.patchFlag !== 32
  /* HYDRATE_EVENTS */
  ) {
    currentBlock.push(vnode);
  }

  return vnode;
}

const runtime_core_esm_bundler_createVNode =  false ? 0 : _createVNode;

function _createVNode(type, props = null, children = null, patchFlag = 0, dynamicProps = null, isBlockNode = false) {
  if (!type || type === NULL_DYNAMIC_COMPONENT) {
    if (false) {}

    type = runtime_core_esm_bundler_Comment;
  }

  if (runtime_core_esm_bundler_isVNode(type)) {
    // createVNode receiving an existing vnode. This happens in cases like
    // <component :is="vnode"/>
    // #2078 make sure to merge refs during the clone instead of overwriting it
    const cloned = cloneVNode(type, props, true
    /* mergeRef: true */
    );

    if (children) {
      normalizeChildren(cloned, children);
    }

    return cloned;
  } // class component normalization.


  if (isClassComponent(type)) {
    type = type.__vccOpts;
  } // class & style normalization.


  if (props) {
    // for reactive or proxy objects, we need to clone it to enable mutation.
    props = guardReactiveProps(props);
    let {
      class: klass,
      style
    } = props;

    if (klass && !shared_esm_bundler_isString(klass)) {
      props.class = normalizeClass(klass);
    }

    if (shared_esm_bundler_isObject(style)) {
      // reactive state objects need to be cloned since they are likely to be
      // mutated
      if (isProxy(style) && !shared_esm_bundler_isArray(style)) {
        style = shared_esm_bundler_extend({}, style);
      }

      props.style = normalizeStyle(style);
    }
  } // encode the vnode type information into a bitmap


  const shapeFlag = shared_esm_bundler_isString(type) ? 1
  /* ELEMENT */
  : isSuspense(type) ? 128
  /* SUSPENSE */
  : isTeleport(type) ? 64
  /* TELEPORT */
  : shared_esm_bundler_isObject(type) ? 4
  /* STATEFUL_COMPONENT */
  : shared_esm_bundler_isFunction(type) ? 2
  /* FUNCTIONAL_COMPONENT */
  : 0;

  if (false) {}

  return createBaseVNode(type, props, children, patchFlag, dynamicProps, shapeFlag, isBlockNode, true);
}

function guardReactiveProps(props) {
  if (!props) return null;
  return isProxy(props) || InternalObjectKey in props ? shared_esm_bundler_extend({}, props) : props;
}

function cloneVNode(vnode, extraProps, mergeRef = false) {
  // This is intentionally NOT using spread or extend to avoid the runtime
  // key enumeration cost.
  const {
    props,
    ref,
    patchFlag,
    children
  } = vnode;
  const mergedProps = extraProps ? mergeProps(props || {}, extraProps) : props;
  const cloned = {
    __v_isVNode: true,
    __v_skip: true,
    type: vnode.type,
    props: mergedProps,
    key: mergedProps && normalizeKey(mergedProps),
    ref: extraProps && extraProps.ref ? // #2078 in the case of <component :is="vnode" ref="extra"/>
    // if the vnode itself already has a ref, cloneVNode will need to merge
    // the refs so the single vnode can be set on multiple refs
    mergeRef && ref ? shared_esm_bundler_isArray(ref) ? ref.concat(normalizeRef(extraProps)) : [ref, normalizeRef(extraProps)] : normalizeRef(extraProps) : ref,
    scopeId: vnode.scopeId,
    slotScopeIds: vnode.slotScopeIds,
    children:  false ? 0 : children,
    target: vnode.target,
    targetAnchor: vnode.targetAnchor,
    staticCount: vnode.staticCount,
    shapeFlag: vnode.shapeFlag,
    // if the vnode is cloned with extra props, we can no longer assume its
    // existing patch flag to be reliable and need to add the FULL_PROPS flag.
    // note: preserve flag for fragments since they use the flag for children
    // fast paths only.
    patchFlag: extraProps && vnode.type !== runtime_core_esm_bundler_Fragment ? patchFlag === -1 // hoisted node
    ? 16
    /* FULL_PROPS */
    : patchFlag | 16
    /* FULL_PROPS */
    : patchFlag,
    dynamicProps: vnode.dynamicProps,
    dynamicChildren: vnode.dynamicChildren,
    appContext: vnode.appContext,
    dirs: vnode.dirs,
    transition: vnode.transition,
    // These should technically only be non-null on mounted VNodes. However,
    // they *should* be copied for kept-alive vnodes. So we just always copy
    // them since them being non-null during a mount doesn't affect the logic as
    // they will simply be overwritten.
    component: vnode.component,
    suspense: vnode.suspense,
    ssContent: vnode.ssContent && cloneVNode(vnode.ssContent),
    ssFallback: vnode.ssFallback && cloneVNode(vnode.ssFallback),
    el: vnode.el,
    anchor: vnode.anchor
  };
  return cloned;
}
/**
 * Dev only, for HMR of hoisted vnodes reused in v-for
 * https://github.com/vitejs/vite/issues/2022
 */


function deepCloneVNode(vnode) {
  const cloned = cloneVNode(vnode);

  if (isArray(vnode.children)) {
    cloned.children = vnode.children.map(deepCloneVNode);
  }

  return cloned;
}
/**
 * @private
 */


function createTextVNode(text = ' ', flag = 0) {
  return runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Text, null, text, flag);
}
/**
 * @private
 */


function createStaticVNode(content, numberOfNodes) {
  // A static vnode can contain multiple stringified elements, and the number
  // of elements is necessary for hydration.
  const vnode = runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Static, null, content);
  vnode.staticCount = numberOfNodes;
  return vnode;
}
/**
 * @private
 */


function runtime_core_esm_bundler_createCommentVNode(text = '', // when used as the v-else branch, the comment node must be created as a
// block to ensure correct updates.
asBlock = false) {
  return asBlock ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(runtime_core_esm_bundler_Comment, null, text)) : runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Comment, null, text);
}

function normalizeVNode(child) {
  if (child == null || typeof child === 'boolean') {
    // empty placeholder
    return runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Comment);
  } else if (shared_esm_bundler_isArray(child)) {
    // fragment
    return runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Fragment, null, // #3666, avoid reference pollution when reusing vnode
    child.slice());
  } else if (typeof child === 'object') {
    // already vnode, this should be the most common since compiled templates
    // always produce all-vnode children arrays
    return cloneIfMounted(child);
  } else {
    // strings and numbers
    return runtime_core_esm_bundler_createVNode(runtime_core_esm_bundler_Text, null, String(child));
  }
} // optimized normalization for template-compiled render fns


function cloneIfMounted(child) {
  return child.el === null || child.memo ? child : cloneVNode(child);
}

function normalizeChildren(vnode, children) {
  let type = 0;
  const {
    shapeFlag
  } = vnode;

  if (children == null) {
    children = null;
  } else if (shared_esm_bundler_isArray(children)) {
    type = 16
    /* ARRAY_CHILDREN */
    ;
  } else if (typeof children === 'object') {
    if (shapeFlag & (1
    /* ELEMENT */
    | 64
    /* TELEPORT */
    )) {
      // Normalize slot to plain children for plain element and Teleport
      const slot = children.default;

      if (slot) {
        // _c marker is added by withCtx() indicating this is a compiled slot
        slot._c && (slot._d = false);
        normalizeChildren(vnode, slot());
        slot._c && (slot._d = true);
      }

      return;
    } else {
      type = 32
      /* SLOTS_CHILDREN */
      ;
      const slotFlag = children._;

      if (!slotFlag && !(InternalObjectKey in children)) {
        children._ctx = currentRenderingInstance;
      } else if (slotFlag === 3
      /* FORWARDED */
      && currentRenderingInstance) {
        // a child component receives forwarded slots from the parent.
        // its slot type is determined by its parent's slot type.
        if (currentRenderingInstance.slots._ === 1
        /* STABLE */
        ) {
          children._ = 1
          /* STABLE */
          ;
        } else {
          children._ = 2
          /* DYNAMIC */
          ;
          vnode.patchFlag |= 1024
          /* DYNAMIC_SLOTS */
          ;
        }
      }
    }
  } else if (shared_esm_bundler_isFunction(children)) {
    children = {
      default: children,
      _ctx: currentRenderingInstance
    };
    type = 32
    /* SLOTS_CHILDREN */
    ;
  } else {
    children = String(children); // force teleport children to array so it can be moved around

    if (shapeFlag & 64
    /* TELEPORT */
    ) {
      type = 16
      /* ARRAY_CHILDREN */
      ;
      children = [createTextVNode(children)];
    } else {
      type = 8
      /* TEXT_CHILDREN */
      ;
    }
  }

  vnode.children = children;
  vnode.shapeFlag |= type;
}

function mergeProps(...args) {
  const ret = {};

  for (let i = 0; i < args.length; i++) {
    const toMerge = args[i];

    for (const key in toMerge) {
      if (key === 'class') {
        if (ret.class !== toMerge.class) {
          ret.class = normalizeClass([ret.class, toMerge.class]);
        }
      } else if (key === 'style') {
        ret.style = normalizeStyle([ret.style, toMerge.style]);
      } else if (shared_esm_bundler_isOn(key)) {
        const existing = ret[key];
        const incoming = toMerge[key];

        if (incoming && existing !== incoming && !(shared_esm_bundler_isArray(existing) && existing.includes(incoming))) {
          ret[key] = existing ? [].concat(existing, incoming) : incoming;
        }
      } else if (key !== '') {
        ret[key] = toMerge[key];
      }
    }
  }

  return ret;
}

function invokeVNodeHook(hook, instance, vnode, prevVNode = null) {
  callWithAsyncErrorHandling(hook, instance, 7
  /* VNODE_HOOK */
  , [vnode, prevVNode]);
}
/**
 * Actual implementation
 */


function renderList(source, renderItem, cache, index) {
  let ret;
  const cached = cache && cache[index];

  if (shared_esm_bundler_isArray(source) || shared_esm_bundler_isString(source)) {
    ret = new Array(source.length);

    for (let i = 0, l = source.length; i < l; i++) {
      ret[i] = renderItem(source[i], i, undefined, cached && cached[i]);
    }
  } else if (typeof source === 'number') {
    if (false) {}

    ret = new Array(source);

    for (let i = 0; i < source; i++) {
      ret[i] = renderItem(i + 1, i, undefined, cached && cached[i]);
    }
  } else if (shared_esm_bundler_isObject(source)) {
    if (source[Symbol.iterator]) {
      ret = Array.from(source, (item, i) => renderItem(item, i, undefined, cached && cached[i]));
    } else {
      const keys = Object.keys(source);
      ret = new Array(keys.length);

      for (let i = 0, l = keys.length; i < l; i++) {
        const key = keys[i];
        ret[i] = renderItem(source[key], key, i, cached && cached[i]);
      }
    }
  } else {
    ret = [];
  }

  if (cache) {
    cache[index] = ret;
  }

  return ret;
}
/**
 * Compiler runtime helper for creating dynamic slots object
 * @private
 */


function createSlots(slots, dynamicSlots) {
  for (let i = 0; i < dynamicSlots.length; i++) {
    const slot = dynamicSlots[i]; // array of dynamic slot generated by <template v-for="..." #[...]>

    if (shared_esm_bundler_isArray(slot)) {
      for (let j = 0; j < slot.length; j++) {
        slots[slot[j].name] = slot[j].fn;
      }
    } else if (slot) {
      // conditional single slot generated by <template v-if="..." #foo>
      slots[slot.name] = slot.fn;
    }
  }

  return slots;
}
/**
 * Compiler runtime helper for rendering `<slot/>`
 * @private
 */


function renderSlot(slots, name, props = {}, // this is not a user-facing function, so the fallback is always generated by
// the compiler and guaranteed to be a function returning an array
fallback, noSlotted) {
  if (currentRenderingInstance.isCE) {
    return runtime_core_esm_bundler_createVNode('slot', name === 'default' ? null : {
      name
    }, fallback && fallback());
  }

  let slot = slots[name];

  if (false) {} // a compiled slot disables block tracking by default to avoid manual
  // invocation interfering with template-based block tracking, but in
  // `renderSlot` we can be sure that it's template-based so we can force
  // enable it.


  if (slot && slot._c) {
    slot._d = false;
  }

  runtime_core_esm_bundler_openBlock();
  const validSlotContent = slot && ensureValidVNode(slot(props));
  const rendered = runtime_core_esm_bundler_createBlock(runtime_core_esm_bundler_Fragment, {
    key: props.key || `_${name}`
  }, validSlotContent || (fallback ? fallback() : []), validSlotContent && slots._ === 1
  /* STABLE */
  ? 64
  /* STABLE_FRAGMENT */
  : -2
  /* BAIL */
  );

  if (!noSlotted && rendered.scopeId) {
    rendered.slotScopeIds = [rendered.scopeId + '-s'];
  }

  if (slot && slot._c) {
    slot._d = true;
  }

  return rendered;
}

function ensureValidVNode(vnodes) {
  return vnodes.some(child => {
    if (!runtime_core_esm_bundler_isVNode(child)) return true;
    if (child.type === runtime_core_esm_bundler_Comment) return false;
    if (child.type === runtime_core_esm_bundler_Fragment && !ensureValidVNode(child.children)) return false;
    return true;
  }) ? vnodes : null;
}
/**
 * For prefixing keys in v-on="obj" with "on"
 * @private
 */


function toHandlers(obj) {
  const ret = {};

  if (false) {}

  for (const key in obj) {
    ret[toHandlerKey(key)] = obj[key];
  }

  return ret;
}
/**
 * #2437 In Vue 3, functional components do not have a public instance proxy but
 * they exist in the internal parent chain. For code that relies on traversing
 * public $parent chains, skip functional ones and go to the parent instead.
 */


const getPublicInstance = i => {
  if (!i) return null;
  if (isStatefulComponent(i)) return getExposeProxy(i) || i.proxy;
  return getPublicInstance(i.parent);
};

const publicPropertiesMap = shared_esm_bundler_extend(Object.create(null), {
  $: i => i,
  $el: i => i.vnode.el,
  $data: i => i.data,
  $props: i =>  false ? 0 : i.props,
  $attrs: i =>  false ? 0 : i.attrs,
  $slots: i =>  false ? 0 : i.slots,
  $refs: i =>  false ? 0 : i.refs,
  $parent: i => getPublicInstance(i.parent),
  $root: i => getPublicInstance(i.root),
  $emit: i => i.emit,
  $options: i => __VUE_OPTIONS_API__ ? resolveMergedOptions(i) : i.type,
  $forceUpdate: i => () => queueJob(i.update),
  $nextTick: i => runtime_core_esm_bundler_nextTick.bind(i.proxy),
  $watch: i => __VUE_OPTIONS_API__ ? instanceWatch.bind(i) : shared_esm_bundler_NOOP
});
const PublicInstanceProxyHandlers = {
  get({
    _: instance
  }, key) {
    const {
      ctx,
      setupState,
      data,
      props,
      accessCache,
      type,
      appContext
    } = instance; // for internal formatters to know that this is a Vue instance

    if (false) {} // prioritize <script setup> bindings during dev.
    // this allows even properties that start with _ or $ to be used - so that
    // it aligns with the production behavior where the render fn is inlined and
    // indeed has access to all declared variables.


    if (false) {} // data / props / ctx
    // This getter gets called for every property access on the render context
    // during render and is a major hotspot. The most expensive part of this
    // is the multiple hasOwn() calls. It's much faster to do a simple property
    // access on a plain object, so we use an accessCache object (with null
    // prototype) to memoize what access type a key corresponds to.


    let normalizedProps;

    if (key[0] !== '$') {
      const n = accessCache[key];

      if (n !== undefined) {
        switch (n) {
          case 1
          /* SETUP */
          :
            return setupState[key];

          case 2
          /* DATA */
          :
            return data[key];

          case 4
          /* CONTEXT */
          :
            return ctx[key];

          case 3
          /* PROPS */
          :
            return props[key];
          // default: just fallthrough
        }
      } else if (setupState !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(setupState, key)) {
        accessCache[key] = 1
        /* SETUP */
        ;
        return setupState[key];
      } else if (data !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(data, key)) {
        accessCache[key] = 2
        /* DATA */
        ;
        return data[key];
      } else if ( // only cache other properties when instance has declared (thus stable)
      // props
      (normalizedProps = instance.propsOptions[0]) && shared_esm_bundler_hasOwn(normalizedProps, key)) {
        accessCache[key] = 3
        /* PROPS */
        ;
        return props[key];
      } else if (ctx !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(ctx, key)) {
        accessCache[key] = 4
        /* CONTEXT */
        ;
        return ctx[key];
      } else if (!__VUE_OPTIONS_API__ || shouldCacheAccess) {
        accessCache[key] = 0
        /* OTHER */
        ;
      }
    }

    const publicGetter = publicPropertiesMap[key];
    let cssModule, globalProperties; // public $xxx properties

    if (publicGetter) {
      if (key === '$attrs') {
        track(instance, "get"
        /* GET */
        , key);
         false && 0;
      }

      return publicGetter(instance);
    } else if ( // css module (injected by vue-loader)
    (cssModule = type.__cssModules) && (cssModule = cssModule[key])) {
      return cssModule;
    } else if (ctx !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(ctx, key)) {
      // user may set custom properties to `this` that start with `$`
      accessCache[key] = 4
      /* CONTEXT */
      ;
      return ctx[key];
    } else if ( // global properties
    globalProperties = appContext.config.globalProperties, shared_esm_bundler_hasOwn(globalProperties, key)) {
      {
        return globalProperties[key];
      }
    } else if (false) {}
  },

  set({
    _: instance
  }, key, value) {
    const {
      data,
      setupState,
      ctx
    } = instance;

    if (setupState !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(setupState, key)) {
      setupState[key] = value;
    } else if (data !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(data, key)) {
      data[key] = value;
    } else if (shared_esm_bundler_hasOwn(instance.props, key)) {
       false && 0;
      return false;
    }

    if (key[0] === '$' && key.slice(1) in instance) {
       false && 0;
      return false;
    } else {
      if (false) {} else {
        ctx[key] = value;
      }
    }

    return true;
  },

  has({
    _: {
      data,
      setupState,
      accessCache,
      ctx,
      appContext,
      propsOptions
    }
  }, key) {
    let normalizedProps;
    return !!accessCache[key] || data !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(data, key) || setupState !== shared_esm_bundler_EMPTY_OBJ && shared_esm_bundler_hasOwn(setupState, key) || (normalizedProps = propsOptions[0]) && shared_esm_bundler_hasOwn(normalizedProps, key) || shared_esm_bundler_hasOwn(ctx, key) || shared_esm_bundler_hasOwn(publicPropertiesMap, key) || shared_esm_bundler_hasOwn(appContext.config.globalProperties, key);
  }

};

if (false) {}

const RuntimeCompiledPublicInstanceProxyHandlers = /*#__PURE__*/shared_esm_bundler_extend({}, PublicInstanceProxyHandlers, {
  get(target, key) {
    // fast path for unscopables when using `with` block
    if (key === Symbol.unscopables) {
      return;
    }

    return PublicInstanceProxyHandlers.get(target, key, target);
  },

  has(_, key) {
    const has = key[0] !== '_' && !isGloballyWhitelisted(key);

    if (false) {}

    return has;
  }

}); // dev only
// In dev mode, the proxy target exposes the same properties as seen on `this`
// for easier console inspection. In prod mode it will be an empty object so
// these properties definitions can be skipped.

function createDevRenderContext(instance) {
  const target = {}; // expose internal instance for proxy handlers

  Object.defineProperty(target, `_`, {
    configurable: true,
    enumerable: false,
    get: () => instance
  }); // expose public properties

  Object.keys(publicPropertiesMap).forEach(key => {
    Object.defineProperty(target, key, {
      configurable: true,
      enumerable: false,
      get: () => publicPropertiesMap[key](instance),
      // intercepted by the proxy so no need for implementation,
      // but needed to prevent set errors
      set: NOOP
    });
  });
  return target;
} // dev only


function exposePropsOnRenderContext(instance) {
  const {
    ctx,
    propsOptions: [propsOptions]
  } = instance;

  if (propsOptions) {
    Object.keys(propsOptions).forEach(key => {
      Object.defineProperty(ctx, key, {
        enumerable: true,
        configurable: true,
        get: () => instance.props[key],
        set: NOOP
      });
    });
  }
} // dev only


function exposeSetupStateOnRenderContext(instance) {
  const {
    ctx,
    setupState
  } = instance;
  Object.keys(toRaw(setupState)).forEach(key => {
    if (!setupState.__isScriptSetup) {
      if (key[0] === '$' || key[0] === '_') {
        runtime_core_esm_bundler_warn(`setup() return property ${JSON.stringify(key)} should not start with "$" or "_" ` + `which are reserved prefixes for Vue internals.`);
        return;
      }

      Object.defineProperty(ctx, key, {
        enumerable: true,
        configurable: true,
        get: () => setupState[key],
        set: NOOP
      });
    }
  });
}

const emptyAppContext = createAppContext();
let uid$1 = 0;

function createComponentInstance(vnode, parent, suspense) {
  const type = vnode.type; // inherit parent app context - or - if root, adopt from root vnode

  const appContext = (parent ? parent.appContext : vnode.appContext) || emptyAppContext;
  const instance = {
    uid: uid$1++,
    vnode,
    type,
    parent,
    appContext,
    root: null,
    next: null,
    subTree: null,
    effect: null,
    update: null,
    scope: new EffectScope(true
    /* detached */
    ),
    render: null,
    proxy: null,
    exposed: null,
    exposeProxy: null,
    withProxy: null,
    provides: parent ? parent.provides : Object.create(appContext.provides),
    accessCache: null,
    renderCache: [],
    // local resovled assets
    components: null,
    directives: null,
    // resolved props and emits options
    propsOptions: normalizePropsOptions(type, appContext),
    emitsOptions: normalizeEmitsOptions(type, appContext),
    // emit
    emit: null,
    emitted: null,
    // props default value
    propsDefaults: shared_esm_bundler_EMPTY_OBJ,
    // inheritAttrs
    inheritAttrs: type.inheritAttrs,
    // state
    ctx: shared_esm_bundler_EMPTY_OBJ,
    data: shared_esm_bundler_EMPTY_OBJ,
    props: shared_esm_bundler_EMPTY_OBJ,
    attrs: shared_esm_bundler_EMPTY_OBJ,
    slots: shared_esm_bundler_EMPTY_OBJ,
    refs: shared_esm_bundler_EMPTY_OBJ,
    setupState: shared_esm_bundler_EMPTY_OBJ,
    setupContext: null,
    // suspense related
    suspense,
    suspenseId: suspense ? suspense.pendingId : 0,
    asyncDep: null,
    asyncResolved: false,
    // lifecycle hooks
    // not using enums here because it results in computed properties
    isMounted: false,
    isUnmounted: false,
    isDeactivated: false,
    bc: null,
    c: null,
    bm: null,
    m: null,
    bu: null,
    u: null,
    um: null,
    bum: null,
    da: null,
    a: null,
    rtg: null,
    rtc: null,
    ec: null,
    sp: null
  };

  if (false) {} else {
    instance.ctx = {
      _: instance
    };
  }

  instance.root = parent ? parent.root : instance;
  instance.emit = emit$1.bind(null, instance); // apply custom element special handling

  if (vnode.ce) {
    vnode.ce(instance);
  }

  return instance;
}

let currentInstance = null;

const runtime_core_esm_bundler_getCurrentInstance = () => currentInstance || currentRenderingInstance;

const setCurrentInstance = instance => {
  currentInstance = instance;
  instance.scope.on();
};

const unsetCurrentInstance = () => {
  currentInstance && currentInstance.scope.off();
  currentInstance = null;
};

const isBuiltInTag = /*#__PURE__*/(/* unused pure expression or super */ null && (makeMap('slot,component')));

function validateComponentName(name, config) {
  const appIsNativeTag = config.isNativeTag || NO;

  if (isBuiltInTag(name) || appIsNativeTag(name)) {
    runtime_core_esm_bundler_warn('Do not use built-in or reserved HTML elements as component id: ' + name);
  }
}

function isStatefulComponent(instance) {
  return instance.vnode.shapeFlag & 4
  /* STATEFUL_COMPONENT */
  ;
}

let isInSSRComponentSetup = false;

function setupComponent(instance, isSSR = false) {
  isInSSRComponentSetup = isSSR;
  const {
    props,
    children
  } = instance.vnode;
  const isStateful = isStatefulComponent(instance);
  initProps(instance, props, isStateful, isSSR);
  initSlots(instance, children);
  const setupResult = isStateful ? setupStatefulComponent(instance, isSSR) : undefined;
  isInSSRComponentSetup = false;
  return setupResult;
}

function setupStatefulComponent(instance, isSSR) {
  const Component = instance.type;

  if (false) {} // 0. create render proxy property access cache


  instance.accessCache = Object.create(null); // 1. create public instance / render proxy
  // also mark it raw so it's never observed

  instance.proxy = reactivity_esm_bundler_markRaw(new Proxy(instance.ctx, PublicInstanceProxyHandlers));

  if (false) {} // 2. call setup()


  const {
    setup
  } = Component;

  if (setup) {
    const setupContext = instance.setupContext = setup.length > 1 ? createSetupContext(instance) : null;
    setCurrentInstance(instance);
    pauseTracking();
    const setupResult = callWithErrorHandling(setup, instance, 0
    /* SETUP_FUNCTION */
    , [ false ? 0 : instance.props, setupContext]);
    resetTracking();
    unsetCurrentInstance();

    if (shared_esm_bundler_isPromise(setupResult)) {
      setupResult.then(unsetCurrentInstance, unsetCurrentInstance);

      if (isSSR) {
        // return the promise so server-renderer can wait on it
        return setupResult.then(resolvedResult => {
          handleSetupResult(instance, resolvedResult, isSSR);
        }).catch(e => {
          handleError(e, instance, 0
          /* SETUP_FUNCTION */
          );
        });
      } else {
        // async setup returned Promise.
        // bail here and wait for re-entry.
        instance.asyncDep = setupResult;
      }
    } else {
      handleSetupResult(instance, setupResult, isSSR);
    }
  } else {
    finishComponentSetup(instance, isSSR);
  }
}

function handleSetupResult(instance, setupResult, isSSR) {
  if (shared_esm_bundler_isFunction(setupResult)) {
    // setup returned an inline render function
    if (instance.type.__ssrInlineRender) {
      // when the function's name is `ssrRender` (compiled by SFC inline mode),
      // set it as ssrRender instead.
      instance.ssrRender = setupResult;
    } else {
      instance.render = setupResult;
    }
  } else if (shared_esm_bundler_isObject(setupResult)) {
    if (false) {} // setup returned bindings.
    // assuming a render function compiled from template is present.


    if ( false || __VUE_PROD_DEVTOOLS__) {
      instance.devtoolsRawSetupState = setupResult;
    }

    instance.setupState = proxyRefs(setupResult);

    if (false) {}
  } else if (false) {}

  finishComponentSetup(instance, isSSR);
}

let compile;
let installWithProxy;
/**
 * For runtime-dom to register the compiler.
 * Note the exported method uses any to avoid d.ts relying on the compiler types.
 */

function registerRuntimeCompiler(_compile) {
  compile = _compile;

  installWithProxy = i => {
    if (i.render._rc) {
      i.withProxy = new Proxy(i.ctx, RuntimeCompiledPublicInstanceProxyHandlers);
    }
  };
} // dev only


const runtime_core_esm_bundler_isRuntimeOnly = () => !compile;

function finishComponentSetup(instance, isSSR, skipOptions) {
  const Component = instance.type; // template / render function normalization
  // could be already set when returned from setup()

  if (!instance.render) {
    // only do on-the-fly compile if not in SSR - SSR on-the-fly compilation
    // is done by server-renderer
    if (!isSSR && compile && !Component.render) {
      const template = Component.template;

      if (template) {
        if (false) {}

        const {
          isCustomElement,
          compilerOptions
        } = instance.appContext.config;
        const {
          delimiters,
          compilerOptions: componentCompilerOptions
        } = Component;
        const finalCompilerOptions = shared_esm_bundler_extend(shared_esm_bundler_extend({
          isCustomElement,
          delimiters
        }, compilerOptions), componentCompilerOptions);
        Component.render = compile(template, finalCompilerOptions);

        if (false) {}
      }
    }

    instance.render = Component.render || shared_esm_bundler_NOOP; // for runtime-compiled render functions using `with` blocks, the render
    // proxy used needs a different `has` handler which is more performant and
    // also only allows a whitelist of globals to fallthrough.

    if (installWithProxy) {
      installWithProxy(instance);
    }
  } // support for 2.x options


  if (__VUE_OPTIONS_API__ && !false) {
    setCurrentInstance(instance);
    pauseTracking();
    applyOptions(instance);
    resetTracking();
    unsetCurrentInstance();
  } // warn missing template/render
  // the runtime compilation of template in SSR is done by server-render


  if (false) {}
}

function createAttrsProxy(instance) {
  return new Proxy(instance.attrs,  false ? 0 : {
    get(target, key) {
      track(instance, "get"
      /* GET */
      , '$attrs');
      return target[key];
    }

  });
}

function createSetupContext(instance) {
  const expose = exposed => {
    if (false) {}

    instance.exposed = exposed || {};
  };

  let attrs;

  if (false) {} else {
    return {
      get attrs() {
        return attrs || (attrs = createAttrsProxy(instance));
      },

      slots: instance.slots,
      emit: instance.emit,
      expose
    };
  }
}

function getExposeProxy(instance) {
  if (instance.exposed) {
    return instance.exposeProxy || (instance.exposeProxy = new Proxy(proxyRefs(reactivity_esm_bundler_markRaw(instance.exposed)), {
      get(target, key) {
        if (key in target) {
          return target[key];
        } else if (key in publicPropertiesMap) {
          return publicPropertiesMap[key](instance);
        }
      }

    }));
  }
}

const classifyRE = /(?:^|[-_])(\w)/g;

const classify = str => str.replace(classifyRE, c => c.toUpperCase()).replace(/[-_]/g, '');

function getComponentName(Component) {
  return shared_esm_bundler_isFunction(Component) ? Component.displayName || Component.name : Component.name;
}
/* istanbul ignore next */


function formatComponentName(instance, Component, isRoot = false) {
  let name = getComponentName(Component);

  if (!name && Component.__file) {
    const match = Component.__file.match(/([^/\\]+)\.\w+$/);

    if (match) {
      name = match[1];
    }
  }

  if (!name && instance && instance.parent) {
    // try to infer the name based on reverse resolution
    const inferFromRegistry = registry => {
      for (const key in registry) {
        if (registry[key] === Component) {
          return key;
        }
      }
    };

    name = inferFromRegistry(instance.components || instance.parent.type.components) || inferFromRegistry(instance.appContext.components);
  }

  return name ? classify(name) : isRoot ? `App` : `Anonymous`;
}

function isClassComponent(value) {
  return shared_esm_bundler_isFunction(value) && '__vccOpts' in value;
}

const runtime_core_esm_bundler_computed = (getterOrOptions, debugOptions) => {
  // @ts-ignore
  return reactivity_esm_bundler_computed(getterOrOptions, debugOptions, isInSSRComponentSetup);
}; // dev only


const warnRuntimeUsage = method => runtime_core_esm_bundler_warn(`${method}() is a compiler-hint helper that is only usable inside ` + `<script setup> of a single file component. Its arguments should be ` + `compiled away and passing it at runtime has no effect.`); // implementation


function defineProps() {
  if (false) {}

  return null;
} // implementation


function defineEmits() {
  if (false) {}

  return null;
}
/**
 * Vue `<script setup>` compiler macro for declaring a component's exposed
 * instance properties when it is accessed by a parent component via template
 * refs.
 *
 * `<script setup>` components are closed by default - i.e. variables inside
 * the `<script setup>` scope is not exposed to parent unless explicitly exposed
 * via `defineExpose`.
 *
 * This is only usable inside `<script setup>`, is compiled away in the
 * output and should **not** be actually called at runtime.
 */


function defineExpose(exposed) {
  if (false) {}
}
/**
 * Vue `<script setup>` compiler macro for providing props default values when
 * using type-based `defineProps` declaration.
 *
 * Example usage:
 * ```ts
 * withDefaults(defineProps<{
 *   size?: number
 *   labels?: string[]
 * }>(), {
 *   size: 3,
 *   labels: () => ['default label']
 * })
 * ```
 *
 * This is only usable inside `<script setup>`, is compiled away in the output
 * and should **not** be actually called at runtime.
 */


function withDefaults(props, defaults) {
  if (false) {}

  return null;
}

function useSlots() {
  return getContext().slots;
}

function useAttrs() {
  return getContext().attrs;
}

function getContext() {
  const i = runtime_core_esm_bundler_getCurrentInstance();

  if (false) {}

  return i.setupContext || (i.setupContext = createSetupContext(i));
}
/**
 * Runtime helper for merging default declarations. Imported by compiled code
 * only.
 * @internal
 */


function mergeDefaults(raw, defaults) {
  const props = isArray(raw) ? raw.reduce((normalized, p) => (normalized[p] = {}, normalized), {}) : raw;

  for (const key in defaults) {
    const opt = props[key];

    if (opt) {
      if (isArray(opt) || isFunction(opt)) {
        props[key] = {
          type: opt,
          default: defaults[key]
        };
      } else {
        opt.default = defaults[key];
      }
    } else if (opt === null) {
      props[key] = {
        default: defaults[key]
      };
    } else if (false) {}
  }

  return props;
}
/**
 * Used to create a proxy for the rest element when destructuring props with
 * defineProps().
 * @internal
 */


function createPropsRestProxy(props, excludedKeys) {
  const ret = {};

  for (const key in props) {
    if (!excludedKeys.includes(key)) {
      Object.defineProperty(ret, key, {
        enumerable: true,
        get: () => props[key]
      });
    }
  }

  return ret;
}
/**
 * `<script setup>` helper for persisting the current instance context over
 * async/await flows.
 *
 * `@vue/compiler-sfc` converts the following:
 *
 * ```ts
 * const x = await foo()
 * ```
 *
 * into:
 *
 * ```ts
 * let __temp, __restore
 * const x = (([__temp, __restore] = withAsyncContext(() => foo())),__temp=await __temp,__restore(),__temp)
 * ```
 * @internal
 */


function withAsyncContext(getAwaitable) {
  const ctx = runtime_core_esm_bundler_getCurrentInstance();

  if (false) {}

  let awaitable = getAwaitable();
  unsetCurrentInstance();

  if (isPromise(awaitable)) {
    awaitable = awaitable.catch(e => {
      setCurrentInstance(ctx);
      throw e;
    });
  }

  return [awaitable, () => setCurrentInstance(ctx)];
} // Actual implementation


function h(type, propsOrChildren, children) {
  const l = arguments.length;

  if (l === 2) {
    if (shared_esm_bundler_isObject(propsOrChildren) && !shared_esm_bundler_isArray(propsOrChildren)) {
      // single vnode without props
      if (runtime_core_esm_bundler_isVNode(propsOrChildren)) {
        return runtime_core_esm_bundler_createVNode(type, null, [propsOrChildren]);
      } // props without children


      return runtime_core_esm_bundler_createVNode(type, propsOrChildren);
    } else {
      // omit props
      return runtime_core_esm_bundler_createVNode(type, null, propsOrChildren);
    }
  } else {
    if (l > 3) {
      children = Array.prototype.slice.call(arguments, 2);
    } else if (l === 3 && runtime_core_esm_bundler_isVNode(children)) {
      children = [children];
    }

    return runtime_core_esm_bundler_createVNode(type, propsOrChildren, children);
  }
}

const ssrContextKey = Symbol( false ? 0 : ``);

const useSSRContext = () => {
  {
    const ctx = runtime_core_esm_bundler_inject(ssrContextKey);

    if (!ctx) {
      runtime_core_esm_bundler_warn(`Server rendering context not provided. Make sure to only call ` + `useSSRContext() conditionally in the server build.`);
    }

    return ctx;
  }
};

function runtime_core_esm_bundler_isShallow(value) {
  return !!(value && value["__v_isShallow"
  /* IS_SHALLOW */
  ]);
}

function initCustomFormatter() {
  /* eslint-disable no-restricted-globals */
  if (true) {
    return;
  }

  const vueStyle = {
    style: 'color:#3ba776'
  };
  const numberStyle = {
    style: 'color:#0b1bc9'
  };
  const stringStyle = {
    style: 'color:#b62e24'
  };
  const keywordStyle = {
    style: 'color:#9d288c'
  }; // custom formatter for Chrome
  // https://www.mattzeunert.com/2016/02/19/custom-chrome-devtools-object-formatters.html

  const formatter = {
    header(obj) {
      // TODO also format ComponentPublicInstance & ctx.slots/attrs in setup
      if (!isObject(obj)) {
        return null;
      }

      if (obj.__isVue) {
        return ['div', vueStyle, `VueInstance`];
      } else if (isRef(obj)) {
        return ['div', {}, ['span', vueStyle, genRefFlag(obj)], '<', formatValue(obj.value), `>`];
      } else if (isReactive(obj)) {
        return ['div', {}, ['span', vueStyle, runtime_core_esm_bundler_isShallow(obj) ? 'ShallowReactive' : 'Reactive'], '<', formatValue(obj), `>${isReadonly(obj) ? ` (readonly)` : ``}`];
      } else if (isReadonly(obj)) {
        return ['div', {}, ['span', vueStyle, runtime_core_esm_bundler_isShallow(obj) ? 'ShallowReadonly' : 'Readonly'], '<', formatValue(obj), '>'];
      }

      return null;
    },

    hasBody(obj) {
      return obj && obj.__isVue;
    },

    body(obj) {
      if (obj && obj.__isVue) {
        return ['div', {}, ...formatInstance(obj.$)];
      }
    }

  };

  function formatInstance(instance) {
    const blocks = [];

    if (instance.type.props && instance.props) {
      blocks.push(createInstanceBlock('props', toRaw(instance.props)));
    }

    if (instance.setupState !== EMPTY_OBJ) {
      blocks.push(createInstanceBlock('setup', instance.setupState));
    }

    if (instance.data !== EMPTY_OBJ) {
      blocks.push(createInstanceBlock('data', toRaw(instance.data)));
    }

    const computed = extractKeys(instance, 'computed');

    if (computed) {
      blocks.push(createInstanceBlock('computed', computed));
    }

    const injected = extractKeys(instance, 'inject');

    if (injected) {
      blocks.push(createInstanceBlock('injected', injected));
    }

    blocks.push(['div', {}, ['span', {
      style: keywordStyle.style + ';opacity:0.66'
    }, '$ (internal): '], ['object', {
      object: instance
    }]]);
    return blocks;
  }

  function createInstanceBlock(type, target) {
    target = extend({}, target);

    if (!Object.keys(target).length) {
      return ['span', {}];
    }

    return ['div', {
      style: 'line-height:1.25em;margin-bottom:0.6em'
    }, ['div', {
      style: 'color:#476582'
    }, type], ['div', {
      style: 'padding-left:1.25em'
    }, ...Object.keys(target).map(key => {
      return ['div', {}, ['span', keywordStyle, key + ': '], formatValue(target[key], false)];
    })]];
  }

  function formatValue(v, asRaw = true) {
    if (typeof v === 'number') {
      return ['span', numberStyle, v];
    } else if (typeof v === 'string') {
      return ['span', stringStyle, JSON.stringify(v)];
    } else if (typeof v === 'boolean') {
      return ['span', keywordStyle, v];
    } else if (isObject(v)) {
      return ['object', {
        object: asRaw ? toRaw(v) : v
      }];
    } else {
      return ['span', stringStyle, String(v)];
    }
  }

  function extractKeys(instance, type) {
    const Comp = instance.type;

    if (isFunction(Comp)) {
      return;
    }

    const extracted = {};

    for (const key in instance.ctx) {
      if (isKeyOfType(Comp, key, type)) {
        extracted[key] = instance.ctx[key];
      }
    }

    return extracted;
  }

  function isKeyOfType(Comp, key, type) {
    const opts = Comp[type];

    if (isArray(opts) && opts.includes(key) || isObject(opts) && key in opts) {
      return true;
    }

    if (Comp.extends && isKeyOfType(Comp.extends, key, type)) {
      return true;
    }

    if (Comp.mixins && Comp.mixins.some(m => isKeyOfType(m, key, type))) {
      return true;
    }
  }

  function genRefFlag(v) {
    if (runtime_core_esm_bundler_isShallow(v)) {
      return `ShallowRef`;
    }

    if (v.effect) {
      return `ComputedRef`;
    }

    return `Ref`;
  }

  if (window.devtoolsFormatters) {
    window.devtoolsFormatters.push(formatter);
  } else {
    window.devtoolsFormatters = [formatter];
  }
}

function withMemo(memo, render, cache, index) {
  const cached = cache[index];

  if (cached && isMemoSame(cached, memo)) {
    return cached;
  }

  const ret = render(); // shallow clone

  ret.memo = memo.slice();
  return cache[index] = ret;
}

function isMemoSame(cached, memo) {
  const prev = cached.memo;

  if (prev.length != memo.length) {
    return false;
  }

  for (let i = 0; i < prev.length; i++) {
    if (prev[i] !== memo[i]) {
      return false;
    }
  } // make sure to let parent block track it when returning cached


  if (isBlockTreeEnabled > 0 && currentBlock) {
    currentBlock.push(cached);
  }

  return true;
} // Core API ------------------------------------------------------------------


const version = "3.2.28";
const _ssrUtils = {
  createComponentInstance,
  setupComponent,
  renderComponentRoot,
  setCurrentRenderingInstance,
  isVNode: runtime_core_esm_bundler_isVNode,
  normalizeVNode
};
/**
 * SSR utils for \@vue/server-renderer. Only exposed in cjs builds.
 * @internal
 */

const ssrUtils = (/* unused pure expression or super */ null && (_ssrUtils));
/**
 * @internal only exposed in compat builds
 */

const resolveFilter = null;
/**
 * @internal only exposed in compat builds.
 */

const compatUtils = null;

;// CONCATENATED MODULE: ./node_modules/@vue/runtime-dom/dist/runtime-dom.esm-bundler.js



const svgNS = 'http://www.w3.org/2000/svg';
const doc = typeof document !== 'undefined' ? document : null;
const templateContainer = doc && doc.createElement('template');
const nodeOps = {
  insert: (child, parent, anchor) => {
    parent.insertBefore(child, anchor || null);
  },
  remove: child => {
    const parent = child.parentNode;

    if (parent) {
      parent.removeChild(child);
    }
  },
  createElement: (tag, isSVG, is, props) => {
    const el = isSVG ? doc.createElementNS(svgNS, tag) : doc.createElement(tag, is ? {
      is
    } : undefined);

    if (tag === 'select' && props && props.multiple != null) {
      el.setAttribute('multiple', props.multiple);
    }

    return el;
  },
  createText: text => doc.createTextNode(text),
  createComment: text => doc.createComment(text),
  setText: (node, text) => {
    node.nodeValue = text;
  },
  setElementText: (el, text) => {
    el.textContent = text;
  },
  parentNode: node => node.parentNode,
  nextSibling: node => node.nextSibling,
  querySelector: selector => doc.querySelector(selector),

  setScopeId(el, id) {
    el.setAttribute(id, '');
  },

  cloneNode(el) {
    const cloned = el.cloneNode(true); // #3072
    // - in `patchDOMProp`, we store the actual value in the `el._value` property.
    // - normally, elements using `:value` bindings will not be hoisted, but if
    //   the bound value is a constant, e.g. `:value="true"` - they do get
    //   hoisted.
    // - in production, hoisted nodes are cloned when subsequent inserts, but
    //   cloneNode() does not copy the custom property we attached.
    // - This may need to account for other custom DOM properties we attach to
    //   elements in addition to `_value` in the future.

    if (`_value` in el) {
      cloned._value = el._value;
    }

    return cloned;
  },

  // __UNSAFE__
  // Reason: innerHTML.
  // Static content here can only come from compiled templates.
  // As long as the user only uses trusted templates, this is safe.
  insertStaticContent(content, parent, anchor, isSVG, start, end) {
    // <parent> before | first ... last | anchor </parent>
    const before = anchor ? anchor.previousSibling : parent.lastChild;

    if (start && end) {
      // cached
      while (true) {
        parent.insertBefore(start.cloneNode(true), anchor);
        if (start === end || !(start = start.nextSibling)) break;
      }
    } else {
      // fresh insert
      templateContainer.innerHTML = isSVG ? `<svg>${content}</svg>` : content;
      const template = templateContainer.content;

      if (isSVG) {
        // remove outer svg wrapper
        const wrapper = template.firstChild;

        while (wrapper.firstChild) {
          template.appendChild(wrapper.firstChild);
        }

        template.removeChild(wrapper);
      }

      parent.insertBefore(template, anchor);
    }

    return [// first
    before ? before.nextSibling : parent.firstChild, // last
    anchor ? anchor.previousSibling : parent.lastChild];
  }

}; // compiler should normalize class + :class bindings on the same element
// into a single binding ['staticClass', dynamic]

function patchClass(el, value, isSVG) {
  // directly setting className should be faster than setAttribute in theory
  // if this is an element during a transition, take the temporary transition
  // classes into account.
  const transitionClasses = el._vtc;

  if (transitionClasses) {
    value = (value ? [value, ...transitionClasses] : [...transitionClasses]).join(' ');
  }

  if (value == null) {
    el.removeAttribute('class');
  } else if (isSVG) {
    el.setAttribute('class', value);
  } else {
    el.className = value;
  }
}

function patchStyle(el, prev, next) {
  const style = el.style;
  const isCssString = shared_esm_bundler_isString(next);

  if (next && !isCssString) {
    for (const key in next) {
      setStyle(style, key, next[key]);
    }

    if (prev && !shared_esm_bundler_isString(prev)) {
      for (const key in prev) {
        if (next[key] == null) {
          setStyle(style, key, '');
        }
      }
    }
  } else {
    const currentDisplay = style.display;

    if (isCssString) {
      if (prev !== next) {
        style.cssText = next;
      }
    } else if (prev) {
      el.removeAttribute('style');
    } // indicates that the `display` of the element is controlled by `v-show`,
    // so we always keep the current `display` value regardless of the `style`
    // value, thus handing over control to `v-show`.


    if ('_vod' in el) {
      style.display = currentDisplay;
    }
  }
}

const importantRE = /\s*!important$/;

function setStyle(style, name, val) {
  if (shared_esm_bundler_isArray(val)) {
    val.forEach(v => setStyle(style, name, v));
  } else {
    if (name.startsWith('--')) {
      // custom property definition
      style.setProperty(name, val);
    } else {
      const prefixed = autoPrefix(style, name);

      if (importantRE.test(val)) {
        // !important
        style.setProperty(shared_esm_bundler_hyphenate(prefixed), val.replace(importantRE, ''), 'important');
      } else {
        style[prefixed] = val;
      }
    }
  }
}

const prefixes = ['Webkit', 'Moz', 'ms'];
const prefixCache = {};

function autoPrefix(style, rawName) {
  const cached = prefixCache[rawName];

  if (cached) {
    return cached;
  }

  let name = shared_esm_bundler_camelize(rawName);

  if (name !== 'filter' && name in style) {
    return prefixCache[rawName] = name;
  }

  name = shared_esm_bundler_capitalize(name);

  for (let i = 0; i < prefixes.length; i++) {
    const prefixed = prefixes[i] + name;

    if (prefixed in style) {
      return prefixCache[rawName] = prefixed;
    }
  }

  return rawName;
}

const xlinkNS = 'http://www.w3.org/1999/xlink';

function patchAttr(el, key, value, isSVG, instance) {
  if (isSVG && key.startsWith('xlink:')) {
    if (value == null) {
      el.removeAttributeNS(xlinkNS, key.slice(6, key.length));
    } else {
      el.setAttributeNS(xlinkNS, key, value);
    }
  } else {
    // note we are only checking boolean attributes that don't have a
    // corresponding dom prop of the same name here.
    const isBoolean = isSpecialBooleanAttr(key);

    if (value == null || isBoolean && !includeBooleanAttr(value)) {
      el.removeAttribute(key);
    } else {
      el.setAttribute(key, isBoolean ? '' : value);
    }
  }
} // __UNSAFE__
// functions. The user is responsible for using them with only trusted content.


function patchDOMProp(el, key, value, // the following args are passed only due to potential innerHTML/textContent
// overriding existing VNodes, in which case the old tree must be properly
// unmounted.
prevChildren, parentComponent, parentSuspense, unmountChildren) {
  if (key === 'innerHTML' || key === 'textContent') {
    if (prevChildren) {
      unmountChildren(prevChildren, parentComponent, parentSuspense);
    }

    el[key] = value == null ? '' : value;
    return;
  }

  if (key === 'value' && el.tagName !== 'PROGRESS' && // custom elements may use _value internally
  !el.tagName.includes('-')) {
    // store value as _value as well since
    // non-string values will be stringified.
    el._value = value;
    const newValue = value == null ? '' : value;

    if (el.value !== newValue || // #4956: always set for OPTION elements because its value falls back to
    // textContent if no value attribute is present. And setting .value for
    // OPTION has no side effect
    el.tagName === 'OPTION') {
      el.value = newValue;
    }

    if (value == null) {
      el.removeAttribute(key);
    }

    return;
  }

  if (value === '' || value == null) {
    const type = typeof el[key];

    if (type === 'boolean') {
      // e.g. <select multiple> compiles to { multiple: '' }
      el[key] = includeBooleanAttr(value);
      return;
    } else if (value == null && type === 'string') {
      // e.g. <div :id="null">
      el[key] = '';
      el.removeAttribute(key);
      return;
    } else if (type === 'number') {
      // e.g. <img :width="null">
      // the value of some IDL attr must be greater than 0, e.g. input.size = 0 -> error
      try {
        el[key] = 0;
      } catch (_a) {}

      el.removeAttribute(key);
      return;
    }
  } // some properties perform value validation and throw


  try {
    el[key] = value;
  } catch (e) {
    if (false) {}
  }
} // Async edge case fix requires storing an event listener's attach timestamp.


let _getNow = Date.now;
let skipTimestampCheck = false;

if (typeof window !== 'undefined') {
  // Determine what event timestamp the browser is using. Annoyingly, the
  // timestamp can either be hi-res (relative to page load) or low-res
  // (relative to UNIX epoch), so in order to compare time we have to use the
  // same timestamp type when saving the flush timestamp.
  if (_getNow() > document.createEvent('Event').timeStamp) {
    // if the low-res timestamp which is bigger than the event timestamp
    // (which is evaluated AFTER) it means the event is using a hi-res timestamp,
    // and we need to use the hi-res version for event listeners as well.
    _getNow = () => performance.now();
  } // #3485: Firefox <= 53 has incorrect Event.timeStamp implementation
  // and does not fire microtasks in between event propagation, so safe to exclude.


  const ffMatch = navigator.userAgent.match(/firefox\/(\d+)/i);
  skipTimestampCheck = !!(ffMatch && Number(ffMatch[1]) <= 53);
} // To avoid the overhead of repeatedly calling performance.now(), we cache
// and use the same timestamp for all event listeners attached in the same tick.


let cachedNow = 0;
const p = Promise.resolve();

const runtime_dom_esm_bundler_reset = () => {
  cachedNow = 0;
};

const getNow = () => cachedNow || (p.then(runtime_dom_esm_bundler_reset), cachedNow = _getNow());

function addEventListener(el, event, handler, options) {
  el.addEventListener(event, handler, options);
}

function removeEventListener(el, event, handler, options) {
  el.removeEventListener(event, handler, options);
}

function patchEvent(el, rawName, prevValue, nextValue, instance = null) {
  // vei = vue event invokers
  const invokers = el._vei || (el._vei = {});
  const existingInvoker = invokers[rawName];

  if (nextValue && existingInvoker) {
    // patch
    existingInvoker.value = nextValue;
  } else {
    const [name, options] = parseName(rawName);

    if (nextValue) {
      // add
      const invoker = invokers[rawName] = createInvoker(nextValue, instance);
      addEventListener(el, name, invoker, options);
    } else if (existingInvoker) {
      // remove
      removeEventListener(el, name, existingInvoker, options);
      invokers[rawName] = undefined;
    }
  }
}

const optionsModifierRE = /(?:Once|Passive|Capture)$/;

function parseName(name) {
  let options;

  if (optionsModifierRE.test(name)) {
    options = {};
    let m;

    while (m = name.match(optionsModifierRE)) {
      name = name.slice(0, name.length - m[0].length);
      options[m[0].toLowerCase()] = true;
    }
  }

  return [shared_esm_bundler_hyphenate(name.slice(2)), options];
}

function createInvoker(initialValue, instance) {
  const invoker = e => {
    // async edge case #6566: inner click event triggers patch, event handler
    // attached to outer element during patch, and triggered again. This
    // happens because browsers fire microtask ticks between event propagation.
    // the solution is simple: we save the timestamp when a handler is attached,
    // and the handler would only fire if the event passed to it was fired
    // AFTER it was attached.
    const timeStamp = e.timeStamp || _getNow();

    if (skipTimestampCheck || timeStamp >= invoker.attached - 1) {
      callWithAsyncErrorHandling(patchStopImmediatePropagation(e, invoker.value), instance, 5
      /* NATIVE_EVENT_HANDLER */
      , [e]);
    }
  };

  invoker.value = initialValue;
  invoker.attached = getNow();
  return invoker;
}

function patchStopImmediatePropagation(e, value) {
  if (shared_esm_bundler_isArray(value)) {
    const originalStop = e.stopImmediatePropagation;

    e.stopImmediatePropagation = () => {
      originalStop.call(e);
      e._stopped = true;
    };

    return value.map(fn => e => !e._stopped && fn && fn(e));
  } else {
    return value;
  }
}

const nativeOnRE = /^on[a-z]/;

const patchProp = (el, key, prevValue, nextValue, isSVG = false, prevChildren, parentComponent, parentSuspense, unmountChildren) => {
  if (key === 'class') {
    patchClass(el, nextValue, isSVG);
  } else if (key === 'style') {
    patchStyle(el, prevValue, nextValue);
  } else if (shared_esm_bundler_isOn(key)) {
    // ignore v-model listeners
    if (!isModelListener(key)) {
      patchEvent(el, key, prevValue, nextValue, parentComponent);
    }
  } else if (key[0] === '.' ? (key = key.slice(1), true) : key[0] === '^' ? (key = key.slice(1), false) : shouldSetAsProp(el, key, nextValue, isSVG)) {
    patchDOMProp(el, key, nextValue, prevChildren, parentComponent, parentSuspense, unmountChildren);
  } else {
    // special case for <input v-model type="checkbox"> with
    // :true-value & :false-value
    // store value as dom properties since non-string values will be
    // stringified.
    if (key === 'true-value') {
      el._trueValue = nextValue;
    } else if (key === 'false-value') {
      el._falseValue = nextValue;
    }

    patchAttr(el, key, nextValue, isSVG);
  }
};

function shouldSetAsProp(el, key, value, isSVG) {
  if (isSVG) {
    // most keys must be set as attribute on svg elements to work
    // ...except innerHTML & textContent
    if (key === 'innerHTML' || key === 'textContent') {
      return true;
    } // or native onclick with function values


    if (key in el && nativeOnRE.test(key) && shared_esm_bundler_isFunction(value)) {
      return true;
    }

    return false;
  } // spellcheck and draggable are numerated attrs, however their
  // corresponding DOM properties are actually booleans - this leads to
  // setting it with a string "false" value leading it to be coerced to
  // `true`, so we need to always treat them as attributes.
  // Note that `contentEditable` doesn't have this problem: its DOM
  // property is also enumerated string values.


  if (key === 'spellcheck' || key === 'draggable') {
    return false;
  } // #1787, #2840 form property on form elements is readonly and must be set as
  // attribute.


  if (key === 'form') {
    return false;
  } // #1526 <input list> must be set as attribute


  if (key === 'list' && el.tagName === 'INPUT') {
    return false;
  } // #2766 <textarea type> must be set as attribute


  if (key === 'type' && el.tagName === 'TEXTAREA') {
    return false;
  } // native onclick with string value, must be set as attribute


  if (nativeOnRE.test(key) && shared_esm_bundler_isString(value)) {
    return false;
  }

  return key in el;
}

function defineCustomElement(options, hydate) {
  const Comp = defineComponent(options);

  class VueCustomElement extends VueElement {
    constructor(initialProps) {
      super(Comp, initialProps, hydate);
    }

  }

  VueCustomElement.def = Comp;
  return VueCustomElement;
}

const defineSSRCustomElement = options => {
  // @ts-ignore
  return defineCustomElement(options, hydrate);
};

const BaseClass = typeof HTMLElement !== 'undefined' ? HTMLElement : class {};

class VueElement extends (/* unused pure expression or super */ null && (BaseClass)) {
  constructor(_def, _props = {}, hydrate) {
    super();
    this._def = _def;
    this._props = _props;
    /**
     * @internal
     */

    this._instance = null;
    this._connected = false;
    this._resolved = false;
    this._numberProps = null;

    if (this.shadowRoot && hydrate) {
      hydrate(this._createVNode(), this.shadowRoot);
    } else {
      if (false) {}

      this.attachShadow({
        mode: 'open'
      });
    }
  }

  connectedCallback() {
    this._connected = true;

    if (!this._instance) {
      this._resolveDef();
    }
  }

  disconnectedCallback() {
    this._connected = false;
    nextTick(() => {
      if (!this._connected) {
        render(null, this.shadowRoot);
        this._instance = null;
      }
    });
  }
  /**
   * resolve inner component definition (handle possible async component)
   */


  _resolveDef() {
    if (this._resolved) {
      return;
    }

    this._resolved = true; // set initial attrs

    for (let i = 0; i < this.attributes.length; i++) {
      this._setAttr(this.attributes[i].name);
    } // watch future attr changes


    new MutationObserver(mutations => {
      for (const m of mutations) {
        this._setAttr(m.attributeName);
      }
    }).observe(this, {
      attributes: true
    });

    const resolve = def => {
      const {
        props,
        styles
      } = def;
      const hasOptions = !isArray(props);
      const rawKeys = props ? hasOptions ? Object.keys(props) : props : []; // cast Number-type props set before resolve

      let numberProps;

      if (hasOptions) {
        for (const key in this._props) {
          const opt = props[key];

          if (opt === Number || opt && opt.type === Number) {
            this._props[key] = toNumber(this._props[key]);
            (numberProps || (numberProps = Object.create(null)))[key] = true;
          }
        }
      }

      this._numberProps = numberProps; // check if there are props set pre-upgrade or connect

      for (const key of Object.keys(this)) {
        if (key[0] !== '_') {
          this._setProp(key, this[key], true, false);
        }
      } // defining getter/setters on prototype


      for (const key of rawKeys.map(camelize$1)) {
        Object.defineProperty(this, key, {
          get() {
            return this._getProp(key);
          },

          set(val) {
            this._setProp(key, val);
          }

        });
      } // apply CSS


      this._applyStyles(styles); // initial render


      this._update();
    };

    const asyncDef = this._def.__asyncLoader;

    if (asyncDef) {
      asyncDef().then(resolve);
    } else {
      resolve(this._def);
    }
  }

  _setAttr(key) {
    let value = this.getAttribute(key);

    if (this._numberProps && this._numberProps[key]) {
      value = toNumber(value);
    }

    this._setProp(camelize$1(key), value, false);
  }
  /**
   * @internal
   */


  _getProp(key) {
    return this._props[key];
  }
  /**
   * @internal
   */


  _setProp(key, val, shouldReflect = true, shouldUpdate = true) {
    if (val !== this._props[key]) {
      this._props[key] = val;

      if (shouldUpdate && this._instance) {
        this._update();
      } // reflect


      if (shouldReflect) {
        if (val === true) {
          this.setAttribute(hyphenate(key), '');
        } else if (typeof val === 'string' || typeof val === 'number') {
          this.setAttribute(hyphenate(key), val + '');
        } else if (!val) {
          this.removeAttribute(hyphenate(key));
        }
      }
    }
  }

  _update() {
    render(this._createVNode(), this.shadowRoot);
  }

  _createVNode() {
    const vnode = createVNode(this._def, extend({}, this._props));

    if (!this._instance) {
      vnode.ce = instance => {
        this._instance = instance;
        instance.isCE = true; // HMR

        if (false) {} // intercept emit


        instance.emit = (event, ...args) => {
          this.dispatchEvent(new CustomEvent(event, {
            detail: args
          }));
        }; // locate nearest Vue custom element parent for provide/inject


        let parent = this;

        while (parent = parent && (parent.parentNode || parent.host)) {
          if (parent instanceof VueElement) {
            instance.parent = parent._instance;
            break;
          }
        }
      };
    }

    return vnode;
  }

  _applyStyles(styles) {
    if (styles) {
      styles.forEach(css => {
        const s = document.createElement('style');
        s.textContent = css;
        this.shadowRoot.appendChild(s); // record for HMR

        if (false) {}
      });
    }
  }

}

function useCssModule(name = '$style') {
  /* istanbul ignore else */
  {
    const instance = getCurrentInstance();

    if (!instance) {
       false && 0;
      return EMPTY_OBJ;
    }

    const modules = instance.type.__cssModules;

    if (!modules) {
       false && 0;
      return EMPTY_OBJ;
    }

    const mod = modules[name];

    if (!mod) {
       false && 0;
      return EMPTY_OBJ;
    }

    return mod;
  }
}
/**
 * Runtime helper for SFC's CSS variable injection feature.
 * @private
 */


function useCssVars(getter) {
  const instance = getCurrentInstance();
  /* istanbul ignore next */

  if (!instance) {
     false && 0;
    return;
  }

  const setVars = () => setVarsOnVNode(instance.subTree, getter(instance.proxy));

  watchPostEffect(setVars);
  onMounted(() => {
    const ob = new MutationObserver(setVars);
    ob.observe(instance.subTree.el.parentNode, {
      childList: true
    });
    onUnmounted(() => ob.disconnect());
  });
}

function setVarsOnVNode(vnode, vars) {
  if (vnode.shapeFlag & 128
  /* SUSPENSE */
  ) {
    const suspense = vnode.suspense;
    vnode = suspense.activeBranch;

    if (suspense.pendingBranch && !suspense.isHydrating) {
      suspense.effects.push(() => {
        setVarsOnVNode(suspense.activeBranch, vars);
      });
    }
  } // drill down HOCs until it's a non-component vnode


  while (vnode.component) {
    vnode = vnode.component.subTree;
  }

  if (vnode.shapeFlag & 1
  /* ELEMENT */
  && vnode.el) {
    setVarsOnNode(vnode.el, vars);
  } else if (vnode.type === Fragment) {
    vnode.children.forEach(c => setVarsOnVNode(c, vars));
  } else if (vnode.type === Static) {
    let {
      el,
      anchor
    } = vnode;

    while (el) {
      setVarsOnNode(el, vars);
      if (el === anchor) break;
      el = el.nextSibling;
    }
  }
}

function setVarsOnNode(el, vars) {
  if (el.nodeType === 1) {
    const style = el.style;

    for (const key in vars) {
      style.setProperty(`--${key}`, vars[key]);
    }
  }
}

const TRANSITION = 'transition';
const ANIMATION = 'animation'; // DOM Transition is a higher-order-component based on the platform-agnostic
// base Transition component, with DOM-specific logic.

const Transition = (props, {
  slots
}) => h(BaseTransition, resolveTransitionProps(props), slots);

Transition.displayName = 'Transition';
const DOMTransitionPropsValidators = {
  name: String,
  type: String,
  css: {
    type: Boolean,
    default: true
  },
  duration: [String, Number, Object],
  enterFromClass: String,
  enterActiveClass: String,
  enterToClass: String,
  appearFromClass: String,
  appearActiveClass: String,
  appearToClass: String,
  leaveFromClass: String,
  leaveActiveClass: String,
  leaveToClass: String
};
const TransitionPropsValidators = Transition.props = /*#__PURE__*/shared_esm_bundler_extend({}, BaseTransition.props, DOMTransitionPropsValidators);
/**
 * #3227 Incoming hooks may be merged into arrays when wrapping Transition
 * with custom HOCs.
 */

const runtime_dom_esm_bundler_callHook = (hook, args = []) => {
  if (shared_esm_bundler_isArray(hook)) {
    hook.forEach(h => h(...args));
  } else if (hook) {
    hook(...args);
  }
};
/**
 * Check if a hook expects a callback (2nd arg), which means the user
 * intends to explicitly control the end of the transition.
 */


const hasExplicitCallback = hook => {
  return hook ? shared_esm_bundler_isArray(hook) ? hook.some(h => h.length > 1) : hook.length > 1 : false;
};

function resolveTransitionProps(rawProps) {
  const baseProps = {};

  for (const key in rawProps) {
    if (!(key in DOMTransitionPropsValidators)) {
      baseProps[key] = rawProps[key];
    }
  }

  if (rawProps.css === false) {
    return baseProps;
  }

  const {
    name = 'v',
    type,
    duration,
    enterFromClass = `${name}-enter-from`,
    enterActiveClass = `${name}-enter-active`,
    enterToClass = `${name}-enter-to`,
    appearFromClass = enterFromClass,
    appearActiveClass = enterActiveClass,
    appearToClass = enterToClass,
    leaveFromClass = `${name}-leave-from`,
    leaveActiveClass = `${name}-leave-active`,
    leaveToClass = `${name}-leave-to`
  } = rawProps;
  const durations = normalizeDuration(duration);
  const enterDuration = durations && durations[0];
  const leaveDuration = durations && durations[1];
  const {
    onBeforeEnter,
    onEnter,
    onEnterCancelled,
    onLeave,
    onLeaveCancelled,
    onBeforeAppear = onBeforeEnter,
    onAppear = onEnter,
    onAppearCancelled = onEnterCancelled
  } = baseProps;

  const finishEnter = (el, isAppear, done) => {
    removeTransitionClass(el, isAppear ? appearToClass : enterToClass);
    removeTransitionClass(el, isAppear ? appearActiveClass : enterActiveClass);
    done && done();
  };

  const finishLeave = (el, done) => {
    removeTransitionClass(el, leaveToClass);
    removeTransitionClass(el, leaveActiveClass);
    done && done();
  };

  const makeEnterHook = isAppear => {
    return (el, done) => {
      const hook = isAppear ? onAppear : onEnter;

      const resolve = () => finishEnter(el, isAppear, done);

      runtime_dom_esm_bundler_callHook(hook, [el, resolve]);
      nextFrame(() => {
        removeTransitionClass(el, isAppear ? appearFromClass : enterFromClass);
        addTransitionClass(el, isAppear ? appearToClass : enterToClass);

        if (!hasExplicitCallback(hook)) {
          whenTransitionEnds(el, type, enterDuration, resolve);
        }
      });
    };
  };

  return shared_esm_bundler_extend(baseProps, {
    onBeforeEnter(el) {
      runtime_dom_esm_bundler_callHook(onBeforeEnter, [el]);
      addTransitionClass(el, enterFromClass);
      addTransitionClass(el, enterActiveClass);
    },

    onBeforeAppear(el) {
      runtime_dom_esm_bundler_callHook(onBeforeAppear, [el]);
      addTransitionClass(el, appearFromClass);
      addTransitionClass(el, appearActiveClass);
    },

    onEnter: makeEnterHook(false),
    onAppear: makeEnterHook(true),

    onLeave(el, done) {
      const resolve = () => finishLeave(el, done);

      addTransitionClass(el, leaveFromClass); // force reflow so *-leave-from classes immediately take effect (#2593)

      forceReflow();
      addTransitionClass(el, leaveActiveClass);
      nextFrame(() => {
        removeTransitionClass(el, leaveFromClass);
        addTransitionClass(el, leaveToClass);

        if (!hasExplicitCallback(onLeave)) {
          whenTransitionEnds(el, type, leaveDuration, resolve);
        }
      });
      runtime_dom_esm_bundler_callHook(onLeave, [el, resolve]);
    },

    onEnterCancelled(el) {
      finishEnter(el, false);
      runtime_dom_esm_bundler_callHook(onEnterCancelled, [el]);
    },

    onAppearCancelled(el) {
      finishEnter(el, true);
      runtime_dom_esm_bundler_callHook(onAppearCancelled, [el]);
    },

    onLeaveCancelled(el) {
      finishLeave(el);
      runtime_dom_esm_bundler_callHook(onLeaveCancelled, [el]);
    }

  });
}

function normalizeDuration(duration) {
  if (duration == null) {
    return null;
  } else if (shared_esm_bundler_isObject(duration)) {
    return [NumberOf(duration.enter), NumberOf(duration.leave)];
  } else {
    const n = NumberOf(duration);
    return [n, n];
  }
}

function NumberOf(val) {
  const res = shared_esm_bundler_toNumber(val);
  if (false) {}
  return res;
}

function validateDuration(val) {
  if (typeof val !== 'number') {
    warn(`<transition> explicit duration is not a valid number - ` + `got ${JSON.stringify(val)}.`);
  } else if (isNaN(val)) {
    warn(`<transition> explicit duration is NaN - ` + 'the duration expression might be incorrect.');
  }
}

function addTransitionClass(el, cls) {
  cls.split(/\s+/).forEach(c => c && el.classList.add(c));
  (el._vtc || (el._vtc = new Set())).add(cls);
}

function removeTransitionClass(el, cls) {
  cls.split(/\s+/).forEach(c => c && el.classList.remove(c));
  const {
    _vtc
  } = el;

  if (_vtc) {
    _vtc.delete(cls);

    if (!_vtc.size) {
      el._vtc = undefined;
    }
  }
}

function nextFrame(cb) {
  requestAnimationFrame(() => {
    requestAnimationFrame(cb);
  });
}

let endId = 0;

function whenTransitionEnds(el, expectedType, explicitTimeout, resolve) {
  const id = el._endId = ++endId;

  const resolveIfNotStale = () => {
    if (id === el._endId) {
      resolve();
    }
  };

  if (explicitTimeout) {
    return setTimeout(resolveIfNotStale, explicitTimeout);
  }

  const {
    type,
    timeout,
    propCount
  } = getTransitionInfo(el, expectedType);

  if (!type) {
    return resolve();
  }

  const endEvent = type + 'end';
  let ended = 0;

  const end = () => {
    el.removeEventListener(endEvent, onEnd);
    resolveIfNotStale();
  };

  const onEnd = e => {
    if (e.target === el && ++ended >= propCount) {
      end();
    }
  };

  setTimeout(() => {
    if (ended < propCount) {
      end();
    }
  }, timeout + 1);
  el.addEventListener(endEvent, onEnd);
}

function getTransitionInfo(el, expectedType) {
  const styles = window.getComputedStyle(el); // JSDOM may return undefined for transition properties

  const getStyleProperties = key => (styles[key] || '').split(', ');

  const transitionDelays = getStyleProperties(TRANSITION + 'Delay');
  const transitionDurations = getStyleProperties(TRANSITION + 'Duration');
  const transitionTimeout = getTimeout(transitionDelays, transitionDurations);
  const animationDelays = getStyleProperties(ANIMATION + 'Delay');
  const animationDurations = getStyleProperties(ANIMATION + 'Duration');
  const animationTimeout = getTimeout(animationDelays, animationDurations);
  let type = null;
  let timeout = 0;
  let propCount = 0;
  /* istanbul ignore if */

  if (expectedType === TRANSITION) {
    if (transitionTimeout > 0) {
      type = TRANSITION;
      timeout = transitionTimeout;
      propCount = transitionDurations.length;
    }
  } else if (expectedType === ANIMATION) {
    if (animationTimeout > 0) {
      type = ANIMATION;
      timeout = animationTimeout;
      propCount = animationDurations.length;
    }
  } else {
    timeout = Math.max(transitionTimeout, animationTimeout);
    type = timeout > 0 ? transitionTimeout > animationTimeout ? TRANSITION : ANIMATION : null;
    propCount = type ? type === TRANSITION ? transitionDurations.length : animationDurations.length : 0;
  }

  const hasTransform = type === TRANSITION && /\b(transform|all)(,|$)/.test(styles[TRANSITION + 'Property']);
  return {
    type,
    timeout,
    propCount,
    hasTransform
  };
}

function getTimeout(delays, durations) {
  while (delays.length < durations.length) {
    delays = delays.concat(delays);
  }

  return Math.max(...durations.map((d, i) => toMs(d) + toMs(delays[i])));
} // Old versions of Chromium (below 61.0.3163.100) formats floating pointer
// numbers in a locale-dependent way, using a comma instead of a dot.
// If comma is not replaced with a dot, the input will be rounded down
// (i.e. acting as a floor function) causing unexpected behaviors


function toMs(s) {
  return Number(s.slice(0, -1).replace(',', '.')) * 1000;
} // synchronously force layout to put elements into a certain state


function forceReflow() {
  return document.body.offsetHeight;
}

const positionMap = new WeakMap();
const newPositionMap = new WeakMap();
const TransitionGroupImpl = {
  name: 'TransitionGroup',
  props: /*#__PURE__*/shared_esm_bundler_extend({}, TransitionPropsValidators, {
    tag: String,
    moveClass: String
  }),

  setup(props, {
    slots
  }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const state = useTransitionState();
    let prevChildren;
    let children;
    runtime_core_esm_bundler_onUpdated(() => {
      // children is guaranteed to exist after initial render
      if (!prevChildren.length) {
        return;
      }

      const moveClass = props.moveClass || `${props.name || 'v'}-move`;

      if (!hasCSSTransform(prevChildren[0].el, instance.vnode.el, moveClass)) {
        return;
      } // we divide the work into three loops to avoid mixing DOM reads and writes
      // in each iteration - which helps prevent layout thrashing.


      prevChildren.forEach(callPendingCbs);
      prevChildren.forEach(recordPosition);
      const movedChildren = prevChildren.filter(applyTranslation); // force reflow to put everything in position

      forceReflow();
      movedChildren.forEach(c => {
        const el = c.el;
        const style = el.style;
        addTransitionClass(el, moveClass);
        style.transform = style.webkitTransform = style.transitionDuration = '';

        const cb = el._moveCb = e => {
          if (e && e.target !== el) {
            return;
          }

          if (!e || /transform$/.test(e.propertyName)) {
            el.removeEventListener('transitionend', cb);
            el._moveCb = null;
            removeTransitionClass(el, moveClass);
          }
        };

        el.addEventListener('transitionend', cb);
      });
    });
    return () => {
      const rawProps = reactivity_esm_bundler_toRaw(props);
      const cssTransitionProps = resolveTransitionProps(rawProps);
      let tag = rawProps.tag || runtime_core_esm_bundler_Fragment;
      prevChildren = children;
      children = slots.default ? getTransitionRawChildren(slots.default()) : [];

      for (let i = 0; i < children.length; i++) {
        const child = children[i];

        if (child.key != null) {
          setTransitionHooks(child, resolveTransitionHooks(child, cssTransitionProps, state, instance));
        } else if (false) {}
      }

      if (prevChildren) {
        for (let i = 0; i < prevChildren.length; i++) {
          const child = prevChildren[i];
          setTransitionHooks(child, resolveTransitionHooks(child, cssTransitionProps, state, instance));
          positionMap.set(child, child.el.getBoundingClientRect());
        }
      }

      return runtime_core_esm_bundler_createVNode(tag, null, children);
    };
  }

};
const TransitionGroup = TransitionGroupImpl;

function callPendingCbs(c) {
  const el = c.el;

  if (el._moveCb) {
    el._moveCb();
  }

  if (el._enterCb) {
    el._enterCb();
  }
}

function recordPosition(c) {
  newPositionMap.set(c, c.el.getBoundingClientRect());
}

function applyTranslation(c) {
  const oldPos = positionMap.get(c);
  const newPos = newPositionMap.get(c);
  const dx = oldPos.left - newPos.left;
  const dy = oldPos.top - newPos.top;

  if (dx || dy) {
    const s = c.el.style;
    s.transform = s.webkitTransform = `translate(${dx}px,${dy}px)`;
    s.transitionDuration = '0s';
    return c;
  }
}

function hasCSSTransform(el, root, moveClass) {
  // Detect whether an element with the move class applied has
  // CSS transitions. Since the element may be inside an entering
  // transition at this very moment, we make a clone of it and remove
  // all other transition classes applied to ensure only the move class
  // is applied.
  const clone = el.cloneNode();

  if (el._vtc) {
    el._vtc.forEach(cls => {
      cls.split(/\s+/).forEach(c => c && clone.classList.remove(c));
    });
  }

  moveClass.split(/\s+/).forEach(c => c && clone.classList.add(c));
  clone.style.display = 'none';
  const container = root.nodeType === 1 ? root : root.parentNode;
  container.appendChild(clone);
  const {
    hasTransform
  } = getTransitionInfo(clone);
  container.removeChild(clone);
  return hasTransform;
}

const getModelAssigner = vnode => {
  const fn = vnode.props['onUpdate:modelValue'];
  return shared_esm_bundler_isArray(fn) ? value => invokeArrayFns(fn, value) : fn;
};

function onCompositionStart(e) {
  e.target.composing = true;
}

function onCompositionEnd(e) {
  const target = e.target;

  if (target.composing) {
    target.composing = false;
    runtime_dom_esm_bundler_trigger(target, 'input');
  }
}

function runtime_dom_esm_bundler_trigger(el, type) {
  const e = document.createEvent('HTMLEvents');
  e.initEvent(type, true, true);
  el.dispatchEvent(e);
} // We are exporting the v-model runtime directly as vnode hooks so that it can
// be tree-shaken in case v-model is never used.


const vModelText = {
  created(el, {
    modifiers: {
      lazy,
      trim,
      number
    }
  }, vnode) {
    el._assign = getModelAssigner(vnode);
    const castToNumber = number || vnode.props && vnode.props.type === 'number';
    addEventListener(el, lazy ? 'change' : 'input', e => {
      if (e.target.composing) return;
      let domValue = el.value;

      if (trim) {
        domValue = domValue.trim();
      } else if (castToNumber) {
        domValue = shared_esm_bundler_toNumber(domValue);
      }

      el._assign(domValue);
    });

    if (trim) {
      addEventListener(el, 'change', () => {
        el.value = el.value.trim();
      });
    }

    if (!lazy) {
      addEventListener(el, 'compositionstart', onCompositionStart);
      addEventListener(el, 'compositionend', onCompositionEnd); // Safari < 10.2 & UIWebView doesn't fire compositionend when
      // switching focus before confirming composition choice
      // this also fixes the issue where some browsers e.g. iOS Chrome
      // fires "change" instead of "input" on autocomplete.

      addEventListener(el, 'change', onCompositionEnd);
    }
  },

  // set value on mounted so it's after min/max for type="range"
  mounted(el, {
    value
  }) {
    el.value = value == null ? '' : value;
  },

  beforeUpdate(el, {
    value,
    modifiers: {
      lazy,
      trim,
      number
    }
  }, vnode) {
    el._assign = getModelAssigner(vnode); // avoid clearing unresolved text. #2302

    if (el.composing) return;

    if (document.activeElement === el) {
      if (lazy) {
        return;
      }

      if (trim && el.value.trim() === value) {
        return;
      }

      if ((number || el.type === 'number') && shared_esm_bundler_toNumber(el.value) === value) {
        return;
      }
    }

    const newValue = value == null ? '' : value;

    if (el.value !== newValue) {
      el.value = newValue;
    }
  }

};
const vModelCheckbox = {
  // #4096 array checkboxes need to be deep traversed
  deep: true,

  created(el, _, vnode) {
    el._assign = getModelAssigner(vnode);
    addEventListener(el, 'change', () => {
      const modelValue = el._modelValue;
      const elementValue = getValue(el);
      const checked = el.checked;
      const assign = el._assign;

      if (shared_esm_bundler_isArray(modelValue)) {
        const index = shared_esm_bundler_looseIndexOf(modelValue, elementValue);
        const found = index !== -1;

        if (checked && !found) {
          assign(modelValue.concat(elementValue));
        } else if (!checked && found) {
          const filtered = [...modelValue];
          filtered.splice(index, 1);
          assign(filtered);
        }
      } else if (shared_esm_bundler_isSet(modelValue)) {
        const cloned = new Set(modelValue);

        if (checked) {
          cloned.add(elementValue);
        } else {
          cloned.delete(elementValue);
        }

        assign(cloned);
      } else {
        assign(getCheckboxValue(el, checked));
      }
    });
  },

  // set initial checked on mount to wait for true-value/false-value
  mounted: setChecked,

  beforeUpdate(el, binding, vnode) {
    el._assign = getModelAssigner(vnode);
    setChecked(el, binding, vnode);
  }

};

function setChecked(el, {
  value,
  oldValue
}, vnode) {
  el._modelValue = value;

  if (shared_esm_bundler_isArray(value)) {
    el.checked = shared_esm_bundler_looseIndexOf(value, vnode.props.value) > -1;
  } else if (shared_esm_bundler_isSet(value)) {
    el.checked = value.has(vnode.props.value);
  } else if (value !== oldValue) {
    el.checked = shared_esm_bundler_looseEqual(value, getCheckboxValue(el, true));
  }
}

const vModelRadio = {
  created(el, {
    value
  }, vnode) {
    el.checked = shared_esm_bundler_looseEqual(value, vnode.props.value);
    el._assign = getModelAssigner(vnode);
    addEventListener(el, 'change', () => {
      el._assign(getValue(el));
    });
  },

  beforeUpdate(el, {
    value,
    oldValue
  }, vnode) {
    el._assign = getModelAssigner(vnode);

    if (value !== oldValue) {
      el.checked = shared_esm_bundler_looseEqual(value, vnode.props.value);
    }
  }

};
const vModelSelect = {
  // <select multiple> value need to be deep traversed
  deep: true,

  created(el, {
    value,
    modifiers: {
      number
    }
  }, vnode) {
    const isSetModel = shared_esm_bundler_isSet(value);
    addEventListener(el, 'change', () => {
      const selectedVal = Array.prototype.filter.call(el.options, o => o.selected).map(o => number ? shared_esm_bundler_toNumber(getValue(o)) : getValue(o));

      el._assign(el.multiple ? isSetModel ? new Set(selectedVal) : selectedVal : selectedVal[0]);
    });
    el._assign = getModelAssigner(vnode);
  },

  // set value in mounted & updated because <select> relies on its children
  // <option>s.
  mounted(el, {
    value
  }) {
    setSelected(el, value);
  },

  beforeUpdate(el, _binding, vnode) {
    el._assign = getModelAssigner(vnode);
  },

  updated(el, {
    value
  }) {
    setSelected(el, value);
  }

};

function setSelected(el, value) {
  const isMultiple = el.multiple;

  if (isMultiple && !shared_esm_bundler_isArray(value) && !shared_esm_bundler_isSet(value)) {
     false && 0;
    return;
  }

  for (let i = 0, l = el.options.length; i < l; i++) {
    const option = el.options[i];
    const optionValue = getValue(option);

    if (isMultiple) {
      if (shared_esm_bundler_isArray(value)) {
        option.selected = shared_esm_bundler_looseIndexOf(value, optionValue) > -1;
      } else {
        option.selected = value.has(optionValue);
      }
    } else {
      if (shared_esm_bundler_looseEqual(getValue(option), value)) {
        if (el.selectedIndex !== i) el.selectedIndex = i;
        return;
      }
    }
  }

  if (!isMultiple && el.selectedIndex !== -1) {
    el.selectedIndex = -1;
  }
} // retrieve raw value set via :value bindings


function getValue(el) {
  return '_value' in el ? el._value : el.value;
} // retrieve raw value for true-value and false-value set via :true-value or :false-value bindings


function getCheckboxValue(el, checked) {
  const key = checked ? '_trueValue' : '_falseValue';
  return key in el ? el[key] : checked;
}

const vModelDynamic = {
  created(el, binding, vnode) {
    callModelHook(el, binding, vnode, null, 'created');
  },

  mounted(el, binding, vnode) {
    callModelHook(el, binding, vnode, null, 'mounted');
  },

  beforeUpdate(el, binding, vnode, prevVNode) {
    callModelHook(el, binding, vnode, prevVNode, 'beforeUpdate');
  },

  updated(el, binding, vnode, prevVNode) {
    callModelHook(el, binding, vnode, prevVNode, 'updated');
  }

};

function callModelHook(el, binding, vnode, prevVNode, hook) {
  let modelToUse;

  switch (el.tagName) {
    case 'SELECT':
      modelToUse = vModelSelect;
      break;

    case 'TEXTAREA':
      modelToUse = vModelText;
      break;

    default:
      switch (vnode.props && vnode.props.type) {
        case 'checkbox':
          modelToUse = vModelCheckbox;
          break;

        case 'radio':
          modelToUse = vModelRadio;
          break;

        default:
          modelToUse = vModelText;
      }

  }

  const fn = modelToUse[hook];
  fn && fn(el, binding, vnode, prevVNode);
} // SSR vnode transforms, only used when user includes client-oriented render
// function in SSR


function initVModelForSSR() {
  vModelText.getSSRProps = ({
    value
  }) => ({
    value
  });

  vModelRadio.getSSRProps = ({
    value
  }, vnode) => {
    if (vnode.props && looseEqual(vnode.props.value, value)) {
      return {
        checked: true
      };
    }
  };

  vModelCheckbox.getSSRProps = ({
    value
  }, vnode) => {
    if (isArray(value)) {
      if (vnode.props && looseIndexOf(value, vnode.props.value) > -1) {
        return {
          checked: true
        };
      }
    } else if (isSet(value)) {
      if (vnode.props && value.has(vnode.props.value)) {
        return {
          checked: true
        };
      }
    } else if (value) {
      return {
        checked: true
      };
    }
  };
}

const systemModifiers = ['ctrl', 'shift', 'alt', 'meta'];
const modifierGuards = {
  stop: e => e.stopPropagation(),
  prevent: e => e.preventDefault(),
  self: e => e.target !== e.currentTarget,
  ctrl: e => !e.ctrlKey,
  shift: e => !e.shiftKey,
  alt: e => !e.altKey,
  meta: e => !e.metaKey,
  left: e => 'button' in e && e.button !== 0,
  middle: e => 'button' in e && e.button !== 1,
  right: e => 'button' in e && e.button !== 2,
  exact: (e, modifiers) => systemModifiers.some(m => e[`${m}Key`] && !modifiers.includes(m))
};
/**
 * @private
 */

const withModifiers = (fn, modifiers) => {
  return (event, ...args) => {
    for (let i = 0; i < modifiers.length; i++) {
      const guard = modifierGuards[modifiers[i]];
      if (guard && guard(event, modifiers)) return;
    }

    return fn(event, ...args);
  };
}; // Kept for 2.x compat.
// Note: IE11 compat for `spacebar` and `del` is removed for now.


const keyNames = {
  esc: 'escape',
  space: ' ',
  up: 'arrow-up',
  left: 'arrow-left',
  right: 'arrow-right',
  down: 'arrow-down',
  delete: 'backspace'
};
/**
 * @private
 */

const withKeys = (fn, modifiers) => {
  return event => {
    if (!('key' in event)) {
      return;
    }

    const eventKey = shared_esm_bundler_hyphenate(event.key);

    if (modifiers.some(k => k === eventKey || keyNames[k] === eventKey)) {
      return fn(event);
    }
  };
};

const vShow = {
  beforeMount(el, {
    value
  }, {
    transition
  }) {
    el._vod = el.style.display === 'none' ? '' : el.style.display;

    if (transition && value) {
      transition.beforeEnter(el);
    } else {
      setDisplay(el, value);
    }
  },

  mounted(el, {
    value
  }, {
    transition
  }) {
    if (transition && value) {
      transition.enter(el);
    }
  },

  updated(el, {
    value,
    oldValue
  }, {
    transition
  }) {
    if (!value === !oldValue) return;

    if (transition) {
      if (value) {
        transition.beforeEnter(el);
        setDisplay(el, true);
        transition.enter(el);
      } else {
        transition.leave(el, () => {
          setDisplay(el, false);
        });
      }
    } else {
      setDisplay(el, value);
    }
  },

  beforeUnmount(el, {
    value
  }) {
    setDisplay(el, value);
  }

};

function setDisplay(el, value) {
  el.style.display = value ? el._vod : 'none';
} // SSR vnode transforms, only used when user includes client-oriented render
// function in SSR


function initVShowForSSR() {
  vShow.getSSRProps = ({
    value
  }) => {
    if (!value) {
      return {
        style: {
          display: 'none'
        }
      };
    }
  };
}

const rendererOptions = shared_esm_bundler_extend({
  patchProp
}, nodeOps); // lazy create the renderer - this makes core renderer logic tree-shakable
// in case the user only imports reactivity utilities from Vue.

let renderer;
let enabledHydration = false;

function ensureRenderer() {
  return renderer || (renderer = createRenderer(rendererOptions));
}

function ensureHydrationRenderer() {
  renderer = enabledHydration ? renderer : createHydrationRenderer(rendererOptions);
  enabledHydration = true;
  return renderer;
} // use explicit type casts here to avoid import() calls in rolled-up d.ts


const render = (...args) => {
  ensureRenderer().render(...args);
};

const hydrate = (...args) => {
  ensureHydrationRenderer().hydrate(...args);
};

const createApp = (...args) => {
  const app = ensureRenderer().createApp(...args);

  if (false) {}

  const {
    mount
  } = app;

  app.mount = containerOrSelector => {
    const container = normalizeContainer(containerOrSelector);
    if (!container) return;
    const component = app._component;

    if (!shared_esm_bundler_isFunction(component) && !component.render && !component.template) {
      // __UNSAFE__
      // Reason: potential execution of JS expressions in in-DOM template.
      // The user must make sure the in-DOM template is trusted. If it's
      // rendered by the server, the template should not contain any user data.
      component.template = container.innerHTML;
    } // clear content before mounting


    container.innerHTML = '';
    const proxy = mount(container, false, container instanceof SVGElement);

    if (container instanceof Element) {
      container.removeAttribute('v-cloak');
      container.setAttribute('data-v-app', '');
    }

    return proxy;
  };

  return app;
};

const createSSRApp = (...args) => {
  const app = ensureHydrationRenderer().createApp(...args);

  if (false) {}

  const {
    mount
  } = app;

  app.mount = containerOrSelector => {
    const container = normalizeContainer(containerOrSelector);

    if (container) {
      return mount(container, true, container instanceof SVGElement);
    }
  };

  return app;
};

function injectNativeTagCheck(app) {
  // Inject `isNativeTag`
  // this is used for component name validation (dev only)
  Object.defineProperty(app.config, 'isNativeTag', {
    value: tag => isHTMLTag(tag) || isSVGTag(tag),
    writable: false
  });
} // dev only


function injectCompilerOptionsCheck(app) {
  if (isRuntimeOnly()) {
    const isCustomElement = app.config.isCustomElement;
    Object.defineProperty(app.config, 'isCustomElement', {
      get() {
        return isCustomElement;
      },

      set() {
        warn(`The \`isCustomElement\` config option is deprecated. Use ` + `\`compilerOptions.isCustomElement\` instead.`);
      }

    });
    const compilerOptions = app.config.compilerOptions;
    const msg = `The \`compilerOptions\` config option is only respected when using ` + `a build of Vue.js that includes the runtime compiler (aka "full build"). ` + `Since you are using the runtime-only build, \`compilerOptions\` ` + `must be passed to \`@vue/compiler-dom\` in the build setup instead.\n` + `- For vue-loader: pass it via vue-loader's \`compilerOptions\` loader option.\n` + `- For vue-cli: see https://cli.vuejs.org/guide/webpack.html#modifying-options-of-a-loader\n` + `- For vite: pass it via @vitejs/plugin-vue options. See https://github.com/vitejs/vite/tree/main/packages/plugin-vue#example-for-passing-options-to-vuecompiler-dom`;
    Object.defineProperty(app.config, 'compilerOptions', {
      get() {
        warn(msg);
        return compilerOptions;
      },

      set() {
        warn(msg);
      }

    });
  }
}

function normalizeContainer(container) {
  if (shared_esm_bundler_isString(container)) {
    const res = document.querySelector(container);

    if (false) {}

    return res;
  }

  if (false) {}

  return container;
}

let ssrDirectiveInitialized = false;
/**
 * @internal
 */

const initDirectivesForSSR = () => {
  if (!ssrDirectiveInitialized) {
    ssrDirectiveInitialized = true;
    initVModelForSSR();
    initVShowForSSR();
  }
};


// EXTERNAL MODULE: ./node_modules/style-loader/dist/runtime/injectStylesIntoStyleTag.js
var injectStylesIntoStyleTag = __webpack_require__("./node_modules/style-loader/dist/runtime/injectStylesIntoStyleTag.js");
var injectStylesIntoStyleTag_default = /*#__PURE__*/__webpack_require__.n(injectStylesIntoStyleTag);
// EXTERNAL MODULE: ./node_modules/style-loader/dist/runtime/styleDomAPI.js
var styleDomAPI = __webpack_require__("./node_modules/style-loader/dist/runtime/styleDomAPI.js");
var styleDomAPI_default = /*#__PURE__*/__webpack_require__.n(styleDomAPI);
// EXTERNAL MODULE: ./node_modules/style-loader/dist/runtime/insertBySelector.js
var insertBySelector = __webpack_require__("./node_modules/style-loader/dist/runtime/insertBySelector.js");
var insertBySelector_default = /*#__PURE__*/__webpack_require__.n(insertBySelector);
// EXTERNAL MODULE: ./node_modules/style-loader/dist/runtime/setAttributesWithoutAttributes.js
var setAttributesWithoutAttributes = __webpack_require__("./node_modules/style-loader/dist/runtime/setAttributesWithoutAttributes.js");
var setAttributesWithoutAttributes_default = /*#__PURE__*/__webpack_require__.n(setAttributesWithoutAttributes);
// EXTERNAL MODULE: ./node_modules/style-loader/dist/runtime/insertStyleElement.js
var insertStyleElement = __webpack_require__("./node_modules/style-loader/dist/runtime/insertStyleElement.js");
var insertStyleElement_default = /*#__PURE__*/__webpack_require__.n(insertStyleElement);
// EXTERNAL MODULE: ./node_modules/style-loader/dist/runtime/styleTagTransform.js
var styleTagTransform = __webpack_require__("./node_modules/style-loader/dist/runtime/styleTagTransform.js");
var styleTagTransform_default = /*#__PURE__*/__webpack_require__.n(styleTagTransform);
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/base.css
var base = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/base.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/base.css

      
      
      
      
      
      
      
      
      

var options = {};

options.styleTagTransform = (styleTagTransform_default());
options.setAttributes = (setAttributesWithoutAttributes_default());

      options.insert = insertBySelector_default().bind(null, "head");
    
options.domAPI = (styleDomAPI_default());
options.insertStyleElement = (insertStyleElement_default());

var update = injectStylesIntoStyleTag_default()(base/* default */.Z, options);




       /* harmony default export */ const theme_chalk_base = (base/* default */.Z && base/* default.locals */.Z.locals ? base/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/base/style/css.mjs

//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-container.css
var el_container = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-container.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-container.css

      
      
      
      
      
      
      
      
      

var el_container_options = {};

el_container_options.styleTagTransform = (styleTagTransform_default());
el_container_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_container_options.insert = insertBySelector_default().bind(null, "head");
    
el_container_options.domAPI = (styleDomAPI_default());
el_container_options.insertStyleElement = (insertStyleElement_default());

var el_container_update = injectStylesIntoStyleTag_default()(el_container/* default */.Z, el_container_options);




       /* harmony default export */ const theme_chalk_el_container = (el_container/* default */.Z && el_container/* default.locals */.Z.locals ? el_container/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-aside.css
var el_aside = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-aside.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-aside.css

      
      
      
      
      
      
      
      
      

var el_aside_options = {};

el_aside_options.styleTagTransform = (styleTagTransform_default());
el_aside_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_aside_options.insert = insertBySelector_default().bind(null, "head");
    
el_aside_options.domAPI = (styleDomAPI_default());
el_aside_options.insertStyleElement = (insertStyleElement_default());

var el_aside_update = injectStylesIntoStyleTag_default()(el_aside/* default */.Z, el_aside_options);




       /* harmony default export */ const theme_chalk_el_aside = (el_aside/* default */.Z && el_aside/* default.locals */.Z.locals ? el_aside/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-footer.css
var el_footer = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-footer.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-footer.css

      
      
      
      
      
      
      
      
      

var el_footer_options = {};

el_footer_options.styleTagTransform = (styleTagTransform_default());
el_footer_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_footer_options.insert = insertBySelector_default().bind(null, "head");
    
el_footer_options.domAPI = (styleDomAPI_default());
el_footer_options.insertStyleElement = (insertStyleElement_default());

var el_footer_update = injectStylesIntoStyleTag_default()(el_footer/* default */.Z, el_footer_options);




       /* harmony default export */ const theme_chalk_el_footer = (el_footer/* default */.Z && el_footer/* default.locals */.Z.locals ? el_footer/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-header.css
var el_header = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-header.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-header.css

      
      
      
      
      
      
      
      
      

var el_header_options = {};

el_header_options.styleTagTransform = (styleTagTransform_default());
el_header_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_header_options.insert = insertBySelector_default().bind(null, "head");
    
el_header_options.domAPI = (styleDomAPI_default());
el_header_options.insertStyleElement = (insertStyleElement_default());

var el_header_update = injectStylesIntoStyleTag_default()(el_header/* default */.Z, el_header_options);




       /* harmony default export */ const theme_chalk_el_header = (el_header/* default */.Z && el_header/* default.locals */.Z.locals ? el_header/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-main.css
var el_main = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-main.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-main.css

      
      
      
      
      
      
      
      
      

var el_main_options = {};

el_main_options.styleTagTransform = (styleTagTransform_default());
el_main_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_main_options.insert = insertBySelector_default().bind(null, "head");
    
el_main_options.domAPI = (styleDomAPI_default());
el_main_options.insertStyleElement = (insertStyleElement_default());

var el_main_update = injectStylesIntoStyleTag_default()(el_main/* default */.Z, el_main_options);




       /* harmony default export */ const theme_chalk_el_main = (el_main/* default */.Z && el_main/* default.locals */.Z.locals ? el_main/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/container/style/css.mjs






//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-scrollbar.css
var el_scrollbar = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-scrollbar.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-scrollbar.css

      
      
      
      
      
      
      
      
      

var el_scrollbar_options = {};

el_scrollbar_options.styleTagTransform = (styleTagTransform_default());
el_scrollbar_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_scrollbar_options.insert = insertBySelector_default().bind(null, "head");
    
el_scrollbar_options.domAPI = (styleDomAPI_default());
el_scrollbar_options.insertStyleElement = (insertStyleElement_default());

var el_scrollbar_update = injectStylesIntoStyleTag_default()(el_scrollbar/* default */.Z, el_scrollbar_options);




       /* harmony default export */ const theme_chalk_el_scrollbar = (el_scrollbar/* default */.Z && el_scrollbar/* default.locals */.Z.locals ? el_scrollbar/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/main/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/aside/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/header/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/with-install.mjs


const withInstall = (main, extra) => {
  ;
  main.install = (app) => {
    for (const comp of [main, ...Object.values(extra != null ? extra : {})]) {
      app.component(comp.name, comp);
    }
  };
  if (extra) {
    for (const [key, comp] of Object.entries(extra)) {
      ;
      main[key] = comp;
    }
  }
  return main;
};
const withInstallFunction = (fn, name) => {
  ;
  fn.install = (app) => {
    app.config.globalProperties[name] = fn;
  };
  return fn;
};
const withNoopInstall = (component) => {
  ;
  component.install = shared_esm_bundler_NOOP;
  return component;
};


//# sourceMappingURL=with-install.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/_virtual/plugin-vue_export-helper.mjs
var _export_sfc = (sfc, props) => {
  const target = sfc.__vccOpts || sfc;
  for (const [key, val] of props) {
    target[key] = val;
  }
  return target;
};


//# sourceMappingURL=plugin-vue_export-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/tokens/config-provider.mjs
const config_provider_configProviderContextKey = Symbol();


//# sourceMappingURL=config-provider.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-global-config/index.mjs







const cache = reactivity_esm_bundler_ref({});
function useGlobalConfig(key) {
  const config = runtime_core_esm_bundler_inject(config_provider_configProviderContextKey, cache);
  if (key) {
    return shared_esm_bundler_isObject(config.value) && shared_esm_bundler_hasOwn(config.value, key) ? runtime_core_esm_bundler_computed(() => config.value[key]) : reactivity_esm_bundler_ref(void 0);
  } else {
    return config;
  }
}
const provideGlobalConfig = (config, app) => {
  var _a;
  const inSetup = !!getCurrentInstance();
  const oldConfig = inSetup ? useGlobalConfig() : void 0;
  const provideFn = (_a = app == null ? void 0 : app.provide) != null ? _a : inSetup ? provide : void 0;
  if (!provideFn) {
    debugWarn("provideGlobalConfig", "provideGlobalConfig() can only be used inside setup().");
    return;
  }
  const context = computed(() => {
    const cfg = unref(config);
    if (!oldConfig)
      return cfg;
    return merge(oldConfig.value, cfg);
  });
  provideFn(configProviderContextKey, context);
  cache.value = context.value;
  return context;
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-namespace/index.mjs



const defaultNamespace = "el";
const statePrefix = "is-";
const _bem = (namespace, block, blockSuffix, element, modifier) => {
  let cls = `${namespace}-${block}`;
  if (blockSuffix) {
    cls += `-${blockSuffix}`;
  }
  if (element) {
    cls += `__${element}`;
  }
  if (modifier) {
    cls += `--${modifier}`;
  }
  return cls;
};
const useNamespace = (block) => {
  const namespace = runtime_core_esm_bundler_computed(() => useGlobalConfig("namespace").value || defaultNamespace);
  const b = (blockSuffix = "") => _bem(reactivity_esm_bundler_unref(namespace), block, blockSuffix, "", "");
  const e = (element) => element ? _bem(reactivity_esm_bundler_unref(namespace), block, "", element, "") : "";
  const m = (modifier) => modifier ? _bem(reactivity_esm_bundler_unref(namespace), block, "", "", modifier) : "";
  const be = (blockSuffix, element) => blockSuffix && element ? _bem(reactivity_esm_bundler_unref(namespace), block, blockSuffix, element, "") : "";
  const em = (element, modifier) => element && modifier ? _bem(reactivity_esm_bundler_unref(namespace), block, "", element, modifier) : "";
  const bm = (blockSuffix, modifier) => blockSuffix && modifier ? _bem(reactivity_esm_bundler_unref(namespace), block, blockSuffix, "", modifier) : "";
  const bem = (blockSuffix, element, modifier) => blockSuffix && element && modifier ? _bem(reactivity_esm_bundler_unref(namespace), block, blockSuffix, element, modifier) : "";
  const is = (name, state = true) => state ? `${statePrefix}${name}` : "";
  return {
    namespace,
    b,
    e,
    m,
    be,
    em,
    bm,
    bem,
    is
  };
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/container/src/container.mjs





const _sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElContainer",
  props: {
    direction: {
      type: String,
      default: ""
    }
  },
  setup(props, { slots }) {
    const ns = useNamespace("container");
    const isVertical = runtime_core_esm_bundler_computed(() => {
      if (props.direction === "vertical") {
        return true;
      } else if (props.direction === "horizontal") {
        return false;
      }
      if (slots && slots.default) {
        const vNodes = slots.default();
        return vNodes.some((vNode) => {
          const tag = vNode.type.name;
          return tag === "ElHeader" || tag === "ElFooter";
        });
      } else {
        return false;
      }
    });
    return {
      isVertical,
      ns
    };
  }
});
function _sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("section", {
    class: normalizeClass([_ctx.ns.b(), _ctx.ns.is("vertical", _ctx.isVertical)])
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 2);
}
var Container = /* @__PURE__ */ _export_sfc(_sfc_main, [["render", _sfc_render]]);


//# sourceMappingURL=container.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/container/src/aside.mjs





const aside_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElAside",
  props: {
    width: {
      type: String,
      default: null
    }
  },
  setup(props) {
    const ns = useNamespace("aside");
    return {
      style: runtime_core_esm_bundler_computed(() => {
        return props.width ? { "--el-aside-width": props.width } : {};
      }),
      ns
    };
  }
});
function aside_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("aside", {
    class: normalizeClass(_ctx.ns.b()),
    style: normalizeStyle(_ctx.style)
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 6);
}
var Aside = /* @__PURE__ */ _export_sfc(aside_sfc_main, [["render", aside_sfc_render]]);


//# sourceMappingURL=aside.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/container/src/footer.mjs





const footer_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElFooter",
  props: {
    height: {
      type: String,
      default: null
    }
  },
  setup(props) {
    const ns = useNamespace("footer");
    return {
      style: runtime_core_esm_bundler_computed(() => props.height ? {
        "--el-footer-height": props.height
      } : {}),
      ns
    };
  }
});
function footer_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("footer", {
    class: normalizeClass(_ctx.ns.b()),
    style: normalizeStyle(_ctx.style)
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 6);
}
var Footer = /* @__PURE__ */ _export_sfc(footer_sfc_main, [["render", footer_sfc_render]]);


//# sourceMappingURL=footer.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/container/src/header.mjs





const header_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElHeader",
  props: {
    height: {
      type: String,
      default: null
    }
  },
  setup(props) {
    const ns = useNamespace("header");
    return {
      style: runtime_core_esm_bundler_computed(() => props.height ? {
        "--el-header-height": props.height
      } : {}),
      ns
    };
  }
});
function header_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("header", {
    class: normalizeClass(_ctx.ns.b()),
    style: normalizeStyle(_ctx.style)
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 6);
}
var Header = /* @__PURE__ */ _export_sfc(header_sfc_main, [["render", header_sfc_render]]);


//# sourceMappingURL=header.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/container/src/main.mjs





const main_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElMain",
  setup() {
    const ns = useNamespace("main");
    return {
      ns
    };
  }
});
function main_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("main", {
    class: normalizeClass(_ctx.ns.b())
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 2);
}
var Main = /* @__PURE__ */ _export_sfc(main_sfc_main, [["render", main_sfc_render]]);


//# sourceMappingURL=main.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/container/index.mjs







const ElContainer = withInstall(Container, {
  Aside: Aside,
  Footer: Footer,
  Header: Header,
  Main: Main
});
const ElAside = withNoopInstall(Aside);
const ElFooter = withNoopInstall(Footer);
const ElHeader = withNoopInstall(Header);
const ElMain = withNoopInstall(Main);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/@vueuse/shared/index.mjs


function and(...args) {
  return computed(() => args.every((i) => unref(i)));
}

function shared_biSyncRef(a, b) {
  const flush = "sync";
  const stop1 = watch(a, (newValue) => {
    b.value = newValue;
  }, {
    flush,
    immediate: true
  });
  const stop2 = watch(b, (newValue) => {
    a.value = newValue;
  }, {
    flush,
    immediate: true
  });
  return () => {
    stop1();
    stop2();
  };
}

function controlledComputed(source, fn) {
  let v = void 0;
  let track;
  let trigger;
  const dirty = ref(true);
  watch(source, () => {
    dirty.value = true;
    trigger();
  }, { flush: "sync" });
  return customRef((_track, _trigger) => {
    track = _track;
    trigger = _trigger;
    return {
      get() {
        if (dirty.value) {
          v = fn();
          dirty.value = false;
        }
        track();
        return v;
      },
      set() {
      }
    };
  });
}

function __onlyVue3(name = "this function") {
  if (isVue3)
    return;
  throw new Error(`[VueUse] ${name} is only works on Vue 3.`);
}

function extendRef(ref, extend, { enumerable = false, unwrap = true } = {}) {
  __onlyVue3();
  for (const [key, value] of Object.entries(extend)) {
    if (key === "value")
      continue;
    if (isRef(value) && unwrap) {
      Object.defineProperty(ref, key, {
        get() {
          return value.value;
        },
        set(v) {
          value.value = v;
        },
        enumerable
      });
    } else {
      Object.defineProperty(ref, key, { value, enumerable });
    }
  }
  return ref;
}

function controlledRef(initial, options = {}) {
  let source = initial;
  let track;
  let trigger;
  const ref = customRef((_track, _trigger) => {
    track = _track;
    trigger = _trigger;
    return {
      get() {
        return get();
      },
      set(v) {
        set(v);
      }
    };
  });
  function get(tracking = true) {
    if (tracking)
      track();
    return source;
  }
  function set(value, triggering = true) {
    var _a, _b;
    if (value === source)
      return;
    const old = source;
    if (((_a = options.onBeforeChange) == null ? void 0 : _a.call(options, value, old)) === false)
      return;
    source = value;
    (_b = options.onChanged) == null ? void 0 : _b.call(options, value, old);
    if (triggering)
      trigger();
  }
  const untrackedGet = () => get(false);
  const silentSet = (v) => set(v, false);
  const peek = () => get(false);
  const lay = (v) => set(v, false);
  return extendRef(ref, {
    get,
    set,
    untrackedGet,
    silentSet,
    peek,
    lay
  }, { enumerable: true });
}

function shared_createEventHook() {
  const fns = [];
  const off = (fn) => {
    const index = fns.indexOf(fn);
    if (index !== -1)
      fns.splice(index, 1);
  };
  const on = (fn) => {
    fns.push(fn);
    return {
      off: () => off(fn)
    };
  };
  const trigger = (param) => {
    fns.forEach((fn) => fn(param));
  };
  return {
    on,
    off,
    trigger
  };
}

function createGlobalState(stateFactory) {
  let initialized = false;
  let state;
  const scope = effectScope(true);
  return () => {
    if (!initialized) {
      state = scope.run(stateFactory);
      initialized = true;
    }
    return state;
  };
}

function reactify(fn) {
  return function(...args) {
    return computed(() => fn.apply(this, args.map((i) => unref(i))));
  };
}

function shared_tryOnScopeDispose(fn) {
  if (reactivity_esm_bundler_getCurrentScope()) {
    onScopeDispose(fn);
    return true;
  }
  return false;
}

function createSharedComposable(composable) {
  let subscribers = 0;
  let state;
  let scope;
  const dispose = () => {
    subscribers -= 1;
    if (scope && subscribers <= 0) {
      scope.stop();
      state = void 0;
      scope = void 0;
    }
  };
  return (...args) => {
    subscribers += 1;
    if (!state) {
      scope = effectScope(true);
      state = scope.run(() => composable(...args));
    }
    shared_tryOnScopeDispose(dispose);
    return state;
  };
}

const shared_isClient = typeof window !== "undefined";
const isDef = (val) => typeof val !== "undefined";
const assert = (condition, ...infos) => {
  if (!condition)
    console.warn(...infos);
};
const shared_toString = Object.prototype.toString;
const shared_isBoolean = (val) => typeof val === "boolean";
const shared_isFunction = (val) => typeof val === "function";
const shared_isNumber = (val) => typeof val === "number";
const shared_isString = (val) => typeof val === "string";
const shared_isObject = (val) => shared_toString.call(val) === "[object Object]";
const isWindow = (val) => typeof window !== "undefined" && shared_toString.call(val) === "[object Window]";
const now = () => Date.now();
const shared_timestamp = () => +Date.now();
const shared_clamp = (n, min, max) => Math.min(max, Math.max(min, n));
const shared_noop = () => {
};
const rand = (min, max) => {
  min = Math.ceil(min);
  max = Math.floor(max);
  return Math.floor(Math.random() * (max - min + 1)) + min;
};

function shared_createFilterWrapper(filter, fn) {
  function wrapper(...args) {
    filter(() => fn.apply(this, args), { fn, thisArg: this, args });
  }
  return wrapper;
}
const shared_bypassFilter = (invoke) => {
  return invoke();
};
function shared_debounceFilter(ms, options = {}) {
  let timer;
  let maxTimer;
  const filter = (invoke) => {
    const duration = unref(ms);
    const maxDuration = unref(options.maxWait);
    if (timer)
      clearTimeout(timer);
    if (duration <= 0 || maxDuration !== void 0 && maxDuration <= 0) {
      if (maxTimer) {
        clearTimeout(maxTimer);
        maxTimer = null;
      }
      return invoke();
    }
    if (maxDuration && !maxTimer) {
      maxTimer = setTimeout(() => {
        if (timer)
          clearTimeout(timer);
        maxTimer = null;
        invoke();
      }, maxDuration);
    }
    timer = setTimeout(() => {
      if (maxTimer)
        clearTimeout(maxTimer);
      maxTimer = null;
      invoke();
    }, duration);
  };
  return filter;
}
function shared_throttleFilter(ms, trailing = true, leading = true) {
  let lastExec = 0;
  let timer;
  let preventLeading = !leading;
  const clear = () => {
    if (timer) {
      clearTimeout(timer);
      timer = void 0;
    }
  };
  const filter = (invoke) => {
    const duration = unref(ms);
    const elapsed = Date.now() - lastExec;
    clear();
    if (duration <= 0) {
      lastExec = Date.now();
      return invoke();
    }
    if (elapsed > duration) {
      lastExec = Date.now();
      if (preventLeading)
        preventLeading = false;
      else
        invoke();
    }
    if (trailing) {
      timer = setTimeout(() => {
        lastExec = Date.now();
        if (!leading)
          preventLeading = true;
        clear();
        invoke();
      }, duration);
    }
    if (!leading && !timer)
      timer = setTimeout(() => preventLeading = true, duration);
  };
  return filter;
}
function shared_pausableFilter(extendFilter = shared_bypassFilter) {
  const isActive = ref(true);
  function pause() {
    isActive.value = false;
  }
  function resume() {
    isActive.value = true;
  }
  const eventFilter = (...args) => {
    if (isActive.value)
      extendFilter(...args);
  };
  return { isActive, pause, resume, eventFilter };
}

function shared_promiseTimeout(ms, throwOnTimeout = false, reason = "Timeout") {
  return new Promise((resolve, reject) => {
    if (throwOnTimeout)
      setTimeout(() => reject(reason), ms);
    else
      setTimeout(resolve, ms);
  });
}
function shared_identity(arg) {
  return arg;
}
function shared_createSingletonPromise(fn) {
  let _promise;
  function wrapper() {
    if (!_promise)
      _promise = fn();
    return _promise;
  }
  wrapper.reset = async () => {
    const _prev = _promise;
    _promise = void 0;
    if (_prev)
      await _prev;
  };
  return wrapper;
}
function invoke(fn) {
  return fn();
}
function shared_containsProp(obj, ...props) {
  return props.some((k) => k in obj);
}
function shared_increaseWithUnit(target, delta) {
  var _a;
  if (typeof target === "number")
    return target + delta;
  const value = ((_a = target.match(/^-?[0-9]+\.?[0-9]*/)) == null ? void 0 : _a[0]) || "";
  const unit = target.slice(value.length);
  const result = parseFloat(value) + delta;
  if (Number.isNaN(result))
    return target;
  return result + unit;
}
function shared_objectPick(obj, keys, omitUndefined = false) {
  return keys.reduce((n, k) => {
    if (k in obj) {
      if (!omitUndefined || !obj[k] === void 0)
        n[k] = obj[k];
    }
    return n;
  }, {});
}

function shared_useDebounceFn(fn, ms = 200, options = {}) {
  return shared_createFilterWrapper(shared_debounceFilter(ms, options), fn);
}

function useDebounce(value, ms = 200, options = {}) {
  if (ms <= 0)
    return value;
  const debounced = ref(value.value);
  const updater = shared_useDebounceFn(() => {
    debounced.value = value.value;
  }, ms, options);
  watch(value, () => updater());
  return debounced;
}

var __getOwnPropSymbols$a = Object.getOwnPropertySymbols;
var __hasOwnProp$a = Object.prototype.hasOwnProperty;
var __propIsEnum$a = Object.prototype.propertyIsEnumerable;
var __objRest$5 = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (__hasOwnProp$a.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && __getOwnPropSymbols$a)
    for (var prop of __getOwnPropSymbols$a(source)) {
      if (exclude.indexOf(prop) < 0 && __propIsEnum$a.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function shared_watchWithFilter(source, cb, options = {}) {
  const _a = options, {
    eventFilter = shared_bypassFilter
  } = _a, watchOptions = __objRest$5(_a, [
    "eventFilter"
  ]);
  return watch(source, shared_createFilterWrapper(eventFilter, cb), watchOptions);
}

var __defProp$8 = Object.defineProperty;
var __defProps$5 = Object.defineProperties;
var __getOwnPropDescs$5 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$9 = Object.getOwnPropertySymbols;
var __hasOwnProp$9 = Object.prototype.hasOwnProperty;
var __propIsEnum$9 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$8 = (obj, key, value) => key in obj ? __defProp$8(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$8 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$9.call(b, prop))
      __defNormalProp$8(a, prop, b[prop]);
  if (__getOwnPropSymbols$9)
    for (var prop of __getOwnPropSymbols$9(b)) {
      if (__propIsEnum$9.call(b, prop))
        __defNormalProp$8(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$5 = (a, b) => __defProps$5(a, __getOwnPropDescs$5(b));
var __objRest$4 = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (__hasOwnProp$9.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && __getOwnPropSymbols$9)
    for (var prop of __getOwnPropSymbols$9(source)) {
      if (exclude.indexOf(prop) < 0 && __propIsEnum$9.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function debouncedWatch(source, cb, options = {}) {
  const _a = options, {
    debounce = 0
  } = _a, watchOptions = __objRest$4(_a, [
    "debounce"
  ]);
  return shared_watchWithFilter(source, cb, __spreadProps$5(__spreadValues$8({}, watchOptions), {
    eventFilter: shared_debounceFilter(debounce)
  }));
}

var __defProp$7 = Object.defineProperty;
var __defProps$4 = Object.defineProperties;
var __getOwnPropDescs$4 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$8 = Object.getOwnPropertySymbols;
var __hasOwnProp$8 = Object.prototype.hasOwnProperty;
var __propIsEnum$8 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$7 = (obj, key, value) => key in obj ? __defProp$7(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$7 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$8.call(b, prop))
      __defNormalProp$7(a, prop, b[prop]);
  if (__getOwnPropSymbols$8)
    for (var prop of __getOwnPropSymbols$8(b)) {
      if (__propIsEnum$8.call(b, prop))
        __defNormalProp$7(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$4 = (a, b) => __defProps$4(a, __getOwnPropDescs$4(b));
function eagerComputed(fn, options) {
  var _a;
  const result = shallowRef();
  watchEffect(() => {
    result.value = fn();
  }, __spreadProps$4(__spreadValues$7({}, options), {
    flush: (_a = options == null ? void 0 : options.flush) != null ? _a : "sync"
  }));
  return readonly(result);
}

function shared_get(obj, key) {
  if (key == null)
    return unref(obj);
  return unref(obj)[key];
}

var __defProp$6 = Object.defineProperty;
var __defProps$3 = Object.defineProperties;
var __getOwnPropDescs$3 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$7 = Object.getOwnPropertySymbols;
var __hasOwnProp$7 = Object.prototype.hasOwnProperty;
var __propIsEnum$7 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$6 = (obj, key, value) => key in obj ? __defProp$6(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$6 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$7.call(b, prop))
      __defNormalProp$6(a, prop, b[prop]);
  if (__getOwnPropSymbols$7)
    for (var prop of __getOwnPropSymbols$7(b)) {
      if (__propIsEnum$7.call(b, prop))
        __defNormalProp$6(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$3 = (a, b) => __defProps$3(a, __getOwnPropDescs$3(b));
var __objRest$3 = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (__hasOwnProp$7.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && __getOwnPropSymbols$7)
    for (var prop of __getOwnPropSymbols$7(source)) {
      if (exclude.indexOf(prop) < 0 && __propIsEnum$7.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function shared_ignorableWatch(source, cb, options = {}) {
  const _a = options, {
    eventFilter = shared_bypassFilter
  } = _a, watchOptions = __objRest$3(_a, [
    "eventFilter"
  ]);
  const filteredCb = shared_createFilterWrapper(eventFilter, cb);
  let ignoreUpdates;
  let ignorePrevAsyncUpdates;
  let stop;
  if (watchOptions.flush === "sync") {
    const ignore = ref(false);
    ignorePrevAsyncUpdates = () => {
    };
    ignoreUpdates = (updater) => {
      ignore.value = true;
      updater();
      ignore.value = false;
    };
    stop = watch(source, (...args) => {
      if (!ignore.value)
        filteredCb(...args);
    }, watchOptions);
  } else {
    const disposables = [];
    const ignoreCounter = ref(0);
    const syncCounter = ref(0);
    ignorePrevAsyncUpdates = () => {
      ignoreCounter.value = syncCounter.value;
    };
    disposables.push(watch(source, () => {
      syncCounter.value++;
    }, __spreadProps$3(__spreadValues$6({}, watchOptions), { flush: "sync" })));
    ignoreUpdates = (updater) => {
      const syncCounterPrev = syncCounter.value;
      updater();
      ignoreCounter.value += syncCounter.value - syncCounterPrev;
    };
    disposables.push(watch(source, (...args) => {
      const ignore = ignoreCounter.value > 0 && ignoreCounter.value === syncCounter.value;
      ignoreCounter.value = 0;
      syncCounter.value = 0;
      if (ignore)
        return;
      filteredCb(...args);
    }, watchOptions));
    stop = () => {
      disposables.forEach((fn) => fn());
    };
  }
  return { stop, ignoreUpdates, ignorePrevAsyncUpdates };
}

function isDefined(v) {
  return unref(v) != null;
}

var __defProp$5 = Object.defineProperty;
var __getOwnPropSymbols$6 = Object.getOwnPropertySymbols;
var __hasOwnProp$6 = Object.prototype.hasOwnProperty;
var __propIsEnum$6 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$5 = (obj, key, value) => key in obj ? __defProp$5(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$5 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$6.call(b, prop))
      __defNormalProp$5(a, prop, b[prop]);
  if (__getOwnPropSymbols$6)
    for (var prop of __getOwnPropSymbols$6(b)) {
      if (__propIsEnum$6.call(b, prop))
        __defNormalProp$5(a, prop, b[prop]);
    }
  return a;
};
function makeDestructurable(obj, arr) {
  if (typeof Symbol !== "undefined") {
    const clone = __spreadValues$5({}, obj);
    Object.defineProperty(clone, Symbol.iterator, {
      enumerable: false,
      value() {
        let index = 0;
        return {
          next: () => ({
            value: arr[index++],
            done: index > arr.length
          })
        };
      }
    });
    return clone;
  } else {
    return Object.assign([...arr], obj);
  }
}

function not(v) {
  return computed(() => !unref(v));
}

function or(...args) {
  return computed(() => args.some((i) => unref(i)));
}

var __defProp$4 = Object.defineProperty;
var __defProps$2 = Object.defineProperties;
var __getOwnPropDescs$2 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$5 = Object.getOwnPropertySymbols;
var __hasOwnProp$5 = Object.prototype.hasOwnProperty;
var __propIsEnum$5 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$4 = (obj, key, value) => key in obj ? __defProp$4(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$4 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$5.call(b, prop))
      __defNormalProp$4(a, prop, b[prop]);
  if (__getOwnPropSymbols$5)
    for (var prop of __getOwnPropSymbols$5(b)) {
      if (__propIsEnum$5.call(b, prop))
        __defNormalProp$4(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$2 = (a, b) => __defProps$2(a, __getOwnPropDescs$2(b));
var __objRest$2 = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (__hasOwnProp$5.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && __getOwnPropSymbols$5)
    for (var prop of __getOwnPropSymbols$5(source)) {
      if (exclude.indexOf(prop) < 0 && __propIsEnum$5.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function shared_pausableWatch(source, cb, options = {}) {
  const _a = options, {
    eventFilter: filter
  } = _a, watchOptions = __objRest$2(_a, [
    "eventFilter"
  ]);
  const { eventFilter, pause, resume, isActive } = shared_pausableFilter(filter);
  const stop = shared_watchWithFilter(source, cb, __spreadProps$2(__spreadValues$4({}, watchOptions), {
    eventFilter
  }));
  return { stop, pause, resume, isActive };
}

function reactifyObject(obj, optionsOrKeys = {}) {
  let keys = [];
  if (Array.isArray(optionsOrKeys)) {
    keys = optionsOrKeys;
  } else {
    const { includeOwnProperties = true } = optionsOrKeys;
    keys.push(...Object.keys(obj));
    if (includeOwnProperties)
      keys.push(...Object.getOwnPropertyNames(obj));
  }
  return Object.fromEntries(keys.map((key) => {
    const value = obj[key];
    return [
      key,
      typeof value === "function" ? reactify(value.bind(obj)) : value
    ];
  }));
}

function reactivePick(obj, ...keys) {
  return reactive(Object.fromEntries(keys.map((k) => [k, toRef(obj, k)])));
}

function refDefault(source, defaultValue) {
  return computed({
    get() {
      var _a;
      return (_a = source.value) != null ? _a : defaultValue;
    },
    set(value) {
      source.value = value;
    }
  });
}

function shared_set(...args) {
  if (args.length === 2) {
    const [ref, value] = args;
    ref.value = value;
  }
  if (args.length === 3) {
    if (isVue2) {
      set$1(...args);
    } else {
      const [target, key, value] = args;
      target[key] = value;
    }
  }
}

function syncRef(source, targets, {
  flush = "sync",
  deep = false,
  immediate = true
} = {}) {
  if (!Array.isArray(targets))
    targets = [targets];
  return watch(source, (newValue) => targets.forEach((target) => target.value = newValue), { flush, deep, immediate });
}

function shared_useThrottleFn(fn, ms = 200, trailing = true, leading = true) {
  return shared_createFilterWrapper(shared_throttleFilter(ms, trailing, leading), fn);
}

function useThrottle(value, delay = 200, trailing = true, leading = true) {
  if (delay <= 0)
    return value;
  const throttled = ref(value.value);
  const updater = shared_useThrottleFn(() => {
    throttled.value = value.value;
  }, delay, trailing, leading);
  watch(value, () => updater());
  return throttled;
}

var __defProp$3 = Object.defineProperty;
var __defProps$1 = Object.defineProperties;
var __getOwnPropDescs$1 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$4 = Object.getOwnPropertySymbols;
var __hasOwnProp$4 = Object.prototype.hasOwnProperty;
var __propIsEnum$4 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$3 = (obj, key, value) => key in obj ? __defProp$3(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$3 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$4.call(b, prop))
      __defNormalProp$3(a, prop, b[prop]);
  if (__getOwnPropSymbols$4)
    for (var prop of __getOwnPropSymbols$4(b)) {
      if (__propIsEnum$4.call(b, prop))
        __defNormalProp$3(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$1 = (a, b) => __defProps$1(a, __getOwnPropDescs$1(b));
var __objRest$1 = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (__hasOwnProp$4.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && __getOwnPropSymbols$4)
    for (var prop of __getOwnPropSymbols$4(source)) {
      if (exclude.indexOf(prop) < 0 && __propIsEnum$4.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function throttledWatch(source, cb, options = {}) {
  const _a = options, {
    throttle = 0,
    trailing = true,
    leading = true
  } = _a, watchOptions = __objRest$1(_a, [
    "throttle",
    "trailing",
    "leading"
  ]);
  return shared_watchWithFilter(source, cb, __spreadProps$1(__spreadValues$3({}, watchOptions), {
    eventFilter: shared_throttleFilter(throttle, trailing, leading)
  }));
}

function shared_toReactive(objectRef) {
  if (!isRef(objectRef))
    return reactive(objectRef);
  const proxy = new Proxy({}, {
    get(_, p, receiver) {
      return Reflect.get(objectRef.value, p, receiver);
    },
    set(_, p, value) {
      objectRef.value[p] = value;
      return true;
    },
    deleteProperty(_, p) {
      return Reflect.deleteProperty(objectRef.value, p);
    },
    has(_, p) {
      return Reflect.has(objectRef.value, p);
    },
    ownKeys() {
      return Object.keys(objectRef.value);
    },
    getOwnPropertyDescriptor() {
      return {
        enumerable: true,
        configurable: true
      };
    }
  });
  return reactive(proxy);
}

var __defProp$2 = Object.defineProperty;
var __defProps = Object.defineProperties;
var __getOwnPropDescs = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$3 = Object.getOwnPropertySymbols;
var __hasOwnProp$3 = Object.prototype.hasOwnProperty;
var __propIsEnum$3 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$2 = (obj, key, value) => key in obj ? __defProp$2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$2 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$3.call(b, prop))
      __defNormalProp$2(a, prop, b[prop]);
  if (__getOwnPropSymbols$3)
    for (var prop of __getOwnPropSymbols$3(b)) {
      if (__propIsEnum$3.call(b, prop))
        __defNormalProp$2(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps = (a, b) => __defProps(a, __getOwnPropDescs(b));
function shared_toRefs(objectRef) {
  if (!isRef(objectRef))
    return toRefs$1(objectRef);
  const result = Array.isArray(objectRef.value) ? new Array(objectRef.value.length) : {};
  for (const key in objectRef.value) {
    result[key] = customRef(() => ({
      get() {
        return objectRef.value[key];
      },
      set(v) {
        if (Array.isArray(objectRef.value)) {
          const copy = [...objectRef.value];
          copy[key] = v;
          objectRef.value = copy;
        } else {
          objectRef.value = __spreadProps(__spreadValues$2({}, objectRef.value), { [key]: v });
        }
      }
    }));
  }
  return result;
}

function tryOnBeforeUnmount(fn) {
  if (getCurrentInstance())
    onBeforeUnmount(fn);
}

function shared_tryOnMounted(fn, sync = true) {
  if (getCurrentInstance())
    onMounted(fn);
  else if (sync)
    fn();
  else
    nextTick(fn);
}

function shared_tryOnUnmounted(fn) {
  if (getCurrentInstance())
    onUnmounted(fn);
}

function shared_until(r) {
  let isNot = false;
  function toMatch(condition, { flush = "sync", deep = false, timeout, throwOnTimeout } = {}) {
    let stop = null;
    const watcher = new Promise((resolve) => {
      stop = watch(r, (v) => {
        if (condition(v) === !isNot) {
          stop == null ? void 0 : stop();
          resolve();
        }
      }, {
        flush,
        deep,
        immediate: true
      });
    });
    const promises = [watcher];
    if (timeout) {
      promises.push(shared_promiseTimeout(timeout, throwOnTimeout).finally(() => {
        stop == null ? void 0 : stop();
      }));
    }
    return Promise.race(promises);
  }
  function toBe(value, options) {
    return toMatch((v) => v === unref(value), options);
  }
  function toBeTruthy(options) {
    return toMatch((v) => Boolean(v), options);
  }
  function toBeNull(options) {
    return toBe(null, options);
  }
  function toBeUndefined(options) {
    return toBe(void 0, options);
  }
  function toBeNaN(options) {
    return toMatch(Number.isNaN, options);
  }
  function toContains(value, options) {
    return toMatch((v) => {
      const array = Array.from(v);
      return array.includes(value) || array.includes(unref(value));
    }, options);
  }
  function changed(options) {
    return changedTimes(1, options);
  }
  function changedTimes(n = 1, options) {
    let count = -1;
    return toMatch(() => {
      count += 1;
      return count >= n;
    }, options);
  }
  if (Array.isArray(unref(r))) {
    const instance = {
      toMatch,
      toContains,
      changed,
      changedTimes,
      get not() {
        isNot = !isNot;
        return this;
      }
    };
    return instance;
  } else {
    const instance = {
      toMatch,
      toBe,
      toBeTruthy,
      toBeNull,
      toBeNaN,
      toBeUndefined,
      changed,
      changedTimes,
      get not() {
        isNot = !isNot;
        return this;
      }
    };
    return instance;
  }
}

function useCounter(initialValue = 0, options = {}) {
  const count = ref(initialValue);
  const {
    max = Infinity,
    min = -Infinity
  } = options;
  const inc = (delta = 1) => count.value = Math.min(max, count.value + delta);
  const dec = (delta = 1) => count.value = Math.max(min, count.value - delta);
  const get = () => count.value;
  const set = (val) => count.value = val;
  const reset = (val = initialValue) => {
    initialValue = val;
    return set(val);
  };
  return { count, inc, dec, get, set, reset };
}

function shared_useIntervalFn(cb, interval = 1e3, options = {}) {
  const {
    immediate = true,
    immediateCallback = false
  } = options;
  let timer = null;
  const isActive = ref(false);
  function clean() {
    if (timer) {
      clearInterval(timer);
      timer = null;
    }
  }
  function pause() {
    isActive.value = false;
    clean();
  }
  function resume() {
    if (interval <= 0)
      return;
    isActive.value = true;
    if (immediateCallback)
      cb();
    clean();
    timer = setInterval(cb, unref(interval));
  }
  if (immediate && shared_isClient)
    resume();
  if (isRef(interval)) {
    const stopWatch = watch(interval, () => {
      if (immediate && shared_isClient)
        resume();
    });
    shared_tryOnScopeDispose(stopWatch);
  }
  shared_tryOnScopeDispose(pause);
  return {
    isActive,
    pause,
    resume
  };
}

var __defProp$1 = Object.defineProperty;
var __getOwnPropSymbols$2 = Object.getOwnPropertySymbols;
var __hasOwnProp$2 = Object.prototype.hasOwnProperty;
var __propIsEnum$2 = Object.prototype.propertyIsEnumerable;
var __defNormalProp$1 = (obj, key, value) => key in obj ? __defProp$1(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$1 = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$2.call(b, prop))
      __defNormalProp$1(a, prop, b[prop]);
  if (__getOwnPropSymbols$2)
    for (var prop of __getOwnPropSymbols$2(b)) {
      if (__propIsEnum$2.call(b, prop))
        __defNormalProp$1(a, prop, b[prop]);
    }
  return a;
};
function useInterval(interval = 1e3, options = {}) {
  const {
    controls: exposeControls = false,
    immediate = true
  } = options;
  const counter = ref(0);
  const controls = shared_useIntervalFn(() => counter.value += 1, interval, { immediate });
  if (exposeControls) {
    return __spreadValues$1({
      counter
    }, controls);
  } else {
    return counter;
  }
}

function useLastChanged(source, options = {}) {
  var _a;
  const ms = ref((_a = options.initialValue) != null ? _a : null);
  watch(source, () => ms.value = shared_timestamp(), options);
  return ms;
}

function shared_useTimeoutFn(cb, interval, options = {}) {
  const {
    immediate = true
  } = options;
  const isPending = reactivity_esm_bundler_ref(false);
  let timer = null;
  function clear() {
    if (timer) {
      clearTimeout(timer);
      timer = null;
    }
  }
  function stop() {
    isPending.value = false;
    clear();
  }
  function start(...args) {
    clear();
    isPending.value = true;
    timer = setTimeout(() => {
      isPending.value = false;
      timer = null;
      cb(...args);
    }, reactivity_esm_bundler_unref(interval));
  }
  if (immediate) {
    isPending.value = true;
    if (shared_isClient)
      start();
  }
  shared_tryOnScopeDispose(stop);
  return {
    isPending,
    start,
    stop
  };
}

var __defProp = Object.defineProperty;
var __getOwnPropSymbols$1 = Object.getOwnPropertySymbols;
var __hasOwnProp$1 = Object.prototype.hasOwnProperty;
var __propIsEnum$1 = Object.prototype.propertyIsEnumerable;
var __defNormalProp = (obj, key, value) => key in obj ? __defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$1.call(b, prop))
      __defNormalProp(a, prop, b[prop]);
  if (__getOwnPropSymbols$1)
    for (var prop of __getOwnPropSymbols$1(b)) {
      if (__propIsEnum$1.call(b, prop))
        __defNormalProp(a, prop, b[prop]);
    }
  return a;
};
function useTimeout(interval = 1e3, options = {}) {
  const {
    controls: exposeControls = false
  } = options;
  const controls = shared_useTimeoutFn(shared_noop, interval, options);
  const ready = computed(() => !controls.isPending.value);
  if (exposeControls) {
    return __spreadValues({
      ready
    }, controls);
  } else {
    return ready;
  }
}

function useToggle(initialValue = false) {
  if (isRef(initialValue)) {
    return (value) => {
      initialValue.value = typeof value === "boolean" ? value : !initialValue.value;
      return initialValue.value;
    };
  } else {
    const boolean = ref(initialValue);
    const toggle = (value) => {
      boolean.value = typeof value === "boolean" ? value : !boolean.value;
      return boolean.value;
    };
    return [boolean, toggle];
  }
}

var __getOwnPropSymbols = Object.getOwnPropertySymbols;
var __hasOwnProp = Object.prototype.hasOwnProperty;
var __propIsEnum = Object.prototype.propertyIsEnumerable;
var __objRest = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (__hasOwnProp.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && __getOwnPropSymbols)
    for (var prop of __getOwnPropSymbols(source)) {
      if (exclude.indexOf(prop) < 0 && __propIsEnum.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function watchAtMost(source, cb, options) {
  const _a = options, {
    count
  } = _a, watchOptions = __objRest(_a, [
    "count"
  ]);
  const current = ref(0);
  const stop = shared_watchWithFilter(source, (...args) => {
    current.value += 1;
    if (current.value >= unref(count))
      nextTick(() => stop());
    cb(...args);
  }, watchOptions);
  return { count: current, stop };
}

function watchOnce(source, cb, options) {
  const stop = watch(source, (...args) => {
    nextTick(() => stop());
    return cb(...args);
  }, options);
}

function whenever(source, cb, options) {
  return watch(source, (v, ov, onInvalidate) => {
    if (v)
      cb(v, ov, onInvalidate);
  }, options);
}



;// CONCATENATED MODULE: ./node_modules/@vueuse/core/index.mjs





function asyncComputed(evaluationCallback, initialState, optionsOrRef) {
  let options;
  if (isRef(optionsOrRef)) {
    options = {
      evaluating: optionsOrRef
    };
  } else {
    options = optionsOrRef || {};
  }
  const {
    lazy = false,
    evaluating = void 0,
    onError = noop
  } = options;
  const started = ref(!lazy);
  const current = ref(initialState);
  let counter = 0;
  watchEffect(async (onInvalidate) => {
    if (!started.value)
      return;
    counter++;
    const counterAtBeginning = counter;
    let hasFinished = false;
    if (evaluating) {
      Promise.resolve().then(() => {
        evaluating.value = true;
      });
    }
    try {
      const result = await evaluationCallback((cancelCallback) => {
        onInvalidate(() => {
          if (evaluating)
            evaluating.value = false;
          if (!hasFinished)
            cancelCallback();
        });
      });
      if (counterAtBeginning === counter)
        current.value = result;
    } catch (e) {
      onError(e);
    } finally {
      if (evaluating)
        evaluating.value = false;
      hasFinished = true;
    }
  });
  if (lazy) {
    return computed(() => {
      started.value = true;
      return current.value;
    });
  } else {
    return current;
  }
}

function autoResetRef(defaultValue, afterMs = 1e4) {
  return customRef((track, trigger) => {
    let value = defaultValue;
    let timer;
    const resetAfter = () => setTimeout(() => {
      value = defaultValue;
      trigger();
    }, unref(afterMs));
    return {
      get() {
        track();
        return value;
      },
      set(newValue) {
        value = newValue;
        trigger();
        clearTimeout(timer);
        timer = resetAfter();
      }
    };
  });
}

function computedInject(key, options, defaultSource, treatDefaultAsFactory) {
  let source = inject(key);
  if (defaultSource)
    source = inject(key, defaultSource);
  if (treatDefaultAsFactory)
    source = inject(key, defaultSource, treatDefaultAsFactory);
  if (typeof options === "function") {
    return computed((ctx) => options(source, ctx));
  } else {
    return computed({
      get: (ctx) => options.get(source, ctx),
      set: options.set
    });
  }
}

const createUnrefFn = (fn) => {
  return function(...args) {
    return fn.apply(this, args.map((i) => unref(i)));
  };
};

function unrefElement(elRef) {
  var _a;
  const plain = reactivity_esm_bundler_unref(elRef);
  return (_a = plain == null ? void 0 : plain.$el) != null ? _a : plain;
}

const defaultWindow = shared_isClient ? window : void 0;
const defaultDocument = shared_isClient ? window.document : void 0;
const defaultNavigator = shared_isClient ? window.navigator : void 0;
const defaultLocation = shared_isClient ? window.location : void 0;

function useEventListener(...args) {
  let target;
  let event;
  let listener;
  let options;
  if (shared_isString(args[0])) {
    [event, listener, options] = args;
    target = defaultWindow;
  } else {
    [target, event, listener, options] = args;
  }
  if (!target)
    return shared_noop;
  let cleanup = shared_noop;
  const stopWatch = runtime_core_esm_bundler_watch(() => reactivity_esm_bundler_unref(target), (el) => {
    cleanup();
    if (!el)
      return;
    el.addEventListener(event, listener, options);
    cleanup = () => {
      el.removeEventListener(event, listener, options);
      cleanup = shared_noop;
    };
  }, { immediate: true, flush: "post" });
  const stop = () => {
    stopWatch();
    cleanup();
  };
  shared_tryOnScopeDispose(stop);
  return stop;
}

function onClickOutside(target, handler, options = {}) {
  const { window = defaultWindow, ignore } = options;
  if (!window)
    return;
  const shouldListen = reactivity_esm_bundler_ref(true);
  const listener = (event) => {
    const el = unrefElement(target);
    const composedPath = event.composedPath();
    if (!el || el === event.target || composedPath.includes(el) || !shouldListen.value)
      return;
    if (ignore && ignore.length > 0) {
      if (ignore.some((target2) => {
        const el2 = unrefElement(target2);
        return el2 && (event.target === el2 || composedPath.includes(el2));
      }))
        return;
    }
    handler(event);
  };
  const cleanup = [
    useEventListener(window, "click", listener, { passive: true, capture: true }),
    useEventListener(window, "pointerdown", (e) => {
      const el = unrefElement(target);
      shouldListen.value = !!el && !e.composedPath().includes(el);
    }, { passive: true })
  ];
  const stop = () => cleanup.forEach((fn) => fn());
  return stop;
}

var __defProp$h = Object.defineProperty;
var __defProps$9 = Object.defineProperties;
var __getOwnPropDescs$9 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$j = Object.getOwnPropertySymbols;
var __hasOwnProp$j = Object.prototype.hasOwnProperty;
var __propIsEnum$j = Object.prototype.propertyIsEnumerable;
var __defNormalProp$h = (obj, key, value) => key in obj ? __defProp$h(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$h = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$j.call(b, prop))
      __defNormalProp$h(a, prop, b[prop]);
  if (__getOwnPropSymbols$j)
    for (var prop of __getOwnPropSymbols$j(b)) {
      if (__propIsEnum$j.call(b, prop))
        __defNormalProp$h(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$9 = (a, b) => __defProps$9(a, __getOwnPropDescs$9(b));
const createKeyPredicate = (keyFilter) => {
  if (typeof keyFilter === "function")
    return keyFilter;
  else if (typeof keyFilter === "string")
    return (event) => event.key === keyFilter;
  else if (Array.isArray(keyFilter))
    return (event) => keyFilter.includes(event.key);
  else if (keyFilter)
    return () => true;
  else
    return () => false;
};
function onKeyStroke(key, handler, options = {}) {
  const { target = defaultWindow, eventName = "keydown", passive = false } = options;
  const predicate = createKeyPredicate(key);
  const listener = (e) => {
    if (predicate(e))
      handler(e);
  };
  return useEventListener(target, eventName, listener, passive);
}
function onKeyDown(key, handler, options = {}) {
  return onKeyStroke(key, handler, __spreadProps$9(__spreadValues$h({}, options), { eventName: "keydown" }));
}
function onKeyPressed(key, handler, options = {}) {
  return onKeyStroke(key, handler, __spreadProps$9(__spreadValues$h({}, options), { eventName: "keypress" }));
}
function onKeyUp(key, handler, options = {}) {
  return onKeyStroke(key, handler, __spreadProps$9(__spreadValues$h({}, options), { eventName: "keyup" }));
}

const DEFAULT_DELAY = 500;
function onLongPress(target, handler, options) {
  const elementRef = computed(() => unrefElement$1(target));
  let timeout = null;
  function clear() {
    if (timeout != null) {
      clearTimeout(timeout);
      timeout = null;
    }
  }
  function onDown(ev) {
    var _a;
    clear();
    timeout = setTimeout(() => handler(ev), (_a = options == null ? void 0 : options.delay) != null ? _a : DEFAULT_DELAY);
  }
  useEventListener$1(elementRef, "pointerdown", onDown);
  useEventListener$1(elementRef, "pointerup", clear);
  useEventListener$1(elementRef, "pointerleave", clear);
}

const isFocusedElementEditable = () => {
  const { activeElement, body } = document;
  if (!activeElement)
    return false;
  if (activeElement === body)
    return false;
  switch (activeElement.tagName) {
    case "INPUT":
    case "TEXTAREA":
      return true;
  }
  return activeElement.hasAttribute("contenteditable");
};
const isTypedCharValid = ({
  keyCode,
  metaKey,
  ctrlKey,
  altKey
}) => {
  if (metaKey || ctrlKey || altKey)
    return false;
  if (keyCode >= 48 && keyCode <= 57 || keyCode >= 96 && keyCode <= 105)
    return true;
  if (keyCode >= 65 && keyCode <= 90)
    return true;
  return false;
};
function onStartTyping(callback, options = {}) {
  const { document: document2 = defaultDocument } = options;
  const keydown = (event) => {
    !isFocusedElementEditable() && isTypedCharValid(event) && callback(event);
  };
  if (document2)
    useEventListener(document2, "keydown", keydown, { passive: true });
}

function templateRef(key, initialValue = null) {
  const instance = getCurrentInstance();
  let _trigger = () => {
  };
  const element = customRef((track, trigger) => {
    _trigger = trigger;
    return {
      get() {
        var _a, _b;
        track();
        return (_b = (_a = instance == null ? void 0 : instance.proxy) == null ? void 0 : _a.$refs[key]) != null ? _b : initialValue;
      },
      set() {
      }
    };
  });
  tryOnMounted(_trigger);
  onUpdated(_trigger);
  return element;
}

function useActiveElement(options = {}) {
  const { window = defaultWindow } = options;
  const counter = ref(0);
  if (window) {
    useEventListener(window, "blur", () => counter.value += 1, true);
    useEventListener(window, "focus", () => counter.value += 1, true);
  }
  return computed(() => {
    counter.value;
    return window == null ? void 0 : window.document.activeElement;
  });
}

function useAsyncQueue(tasks, options = {}) {
  const {
    interrupt = true,
    onError = noop,
    onFinished = noop
  } = options;
  const promiseState = {
    pending: "pending",
    rejected: "rejected",
    fulfilled: "fulfilled"
  };
  const initialResult = Array.from(new Array(tasks.length), () => ({ state: promiseState.pending, data: null }));
  const result = reactive(initialResult);
  const activeIndex = ref(-1);
  if (!tasks || tasks.length === 0) {
    onFinished();
    return {
      activeIndex,
      result
    };
  }
  function updateResult(state, res) {
    activeIndex.value++;
    result[activeIndex.value].data = res;
    result[activeIndex.value].state = state;
  }
  tasks.reduce((prev, curr) => {
    return prev.then((prevRes) => {
      var _a;
      if (((_a = result[activeIndex.value]) == null ? void 0 : _a.state) === promiseState.rejected && interrupt) {
        onFinished();
        return;
      }
      return curr(prevRes).then((currentRes) => {
        updateResult(promiseState.fulfilled, currentRes);
        activeIndex.value === tasks.length - 1 && onFinished();
        return currentRes;
      });
    }).catch((e) => {
      updateResult(promiseState.rejected, e);
      onError();
      return e;
    });
  }, Promise.resolve());
  return {
    activeIndex,
    result
  };
}

function useAsyncState(promise, initialState, options) {
  const {
    immediate = true,
    delay = 0,
    onError = noop,
    resetOnExecute = true,
    shallow = true
  } = options != null ? options : {};
  const state = shallow ? shallowRef(initialState) : ref(initialState);
  const isReady = ref(false);
  const isLoading = ref(false);
  const error = ref(void 0);
  async function execute(delay2 = 0, ...args) {
    if (resetOnExecute)
      state.value = initialState;
    error.value = void 0;
    isReady.value = false;
    isLoading.value = true;
    if (delay2 > 0)
      await promiseTimeout(delay2);
    const _promise = typeof promise === "function" ? promise(...args) : promise;
    try {
      const data = await _promise;
      state.value = data;
      isReady.value = true;
    } catch (e) {
      error.value = e;
      onError(e);
    }
    isLoading.value = false;
    return state.value;
  }
  if (immediate)
    execute(delay);
  return {
    state,
    isReady,
    isLoading,
    error,
    execute
  };
}

function useBase64(target, options) {
  const base64 = ref("");
  const promise = ref();
  function execute() {
    if (!isClient)
      return;
    promise.value = new Promise((resolve, reject) => {
      try {
        const _target = unref(target);
        if (_target === void 0 || _target === null) {
          resolve("");
        } else if (typeof _target === "string") {
          resolve(blobToBase64(new Blob([_target], { type: "text/plain" })));
        } else if (_target instanceof Blob) {
          resolve(blobToBase64(_target));
        } else if (_target instanceof ArrayBuffer) {
          resolve(window.btoa(String.fromCharCode(...new Uint8Array(_target))));
        } else if (_target instanceof HTMLCanvasElement) {
          resolve(_target.toDataURL(options == null ? void 0 : options.type, options == null ? void 0 : options.quality));
        } else if (_target instanceof HTMLImageElement) {
          const img = _target.cloneNode(false);
          img.crossOrigin = "Anonymous";
          imgLoaded(img).then(() => {
            const canvas = document.createElement("canvas");
            const ctx = canvas.getContext("2d");
            canvas.width = img.width;
            canvas.height = img.height;
            ctx.drawImage(img, 0, 0, canvas.width, canvas.height);
            resolve(canvas.toDataURL(options == null ? void 0 : options.type, options == null ? void 0 : options.quality));
          }).catch(reject);
        } else {
          reject(new Error("target is unsupported types"));
        }
      } catch (error) {
        reject(error);
      }
    });
    promise.value.then((res) => base64.value = res);
    return promise.value;
  }
  watch(target, execute, { immediate: true });
  return {
    base64,
    promise,
    execute
  };
}
function imgLoaded(img) {
  return new Promise((resolve, reject) => {
    if (!img.complete) {
      img.onload = () => {
        resolve();
      };
      img.onerror = reject;
    } else {
      resolve();
    }
  });
}
function blobToBase64(blob) {
  return new Promise((resolve, reject) => {
    const fr = new FileReader();
    fr.onload = (e) => {
      resolve(e.target.result);
    };
    fr.onerror = reject;
    fr.readAsDataURL(blob);
  });
}

function useBattery({ navigator = defaultNavigator } = {}) {
  const events = ["chargingchange", "chargingtimechange", "dischargingtimechange", "levelchange"];
  const isSupported = navigator && "getBattery" in navigator;
  const charging = ref(false);
  const chargingTime = ref(0);
  const dischargingTime = ref(0);
  const level = ref(1);
  let battery;
  function updateBatteryInfo() {
    charging.value = this.charging;
    chargingTime.value = this.chargingTime || 0;
    dischargingTime.value = this.dischargingTime || 0;
    level.value = this.level;
  }
  if (isSupported) {
    navigator.getBattery().then((_battery) => {
      battery = _battery;
      updateBatteryInfo.call(battery);
      for (const event of events)
        useEventListener(battery, event, updateBatteryInfo, { passive: true });
    });
  }
  return {
    isSupported,
    charging,
    chargingTime,
    dischargingTime,
    level
  };
}

function useMediaQuery(query, options = {}) {
  const { window = defaultWindow } = options;
  let mediaQuery;
  const matches = ref(false);
  const update = () => {
    if (!window)
      return;
    if (!mediaQuery)
      mediaQuery = window.matchMedia(query);
    matches.value = mediaQuery.matches;
  };
  tryOnMounted(() => {
    update();
    if (!mediaQuery)
      return;
    if ("addEventListener" in mediaQuery)
      mediaQuery.addEventListener("change", update);
    else
      mediaQuery.addListener(update);
    tryOnScopeDispose(() => {
      if ("removeEventListener" in update)
        mediaQuery.removeEventListener("change", update);
      else
        mediaQuery.removeListener(update);
    });
  });
  return matches;
}

const breakpointsTailwind = {
  "sm": 640,
  "md": 768,
  "lg": 1024,
  "xl": 1280,
  "2xl": 1536
};
const breakpointsBootstrapV5 = {
  sm: 576,
  md: 768,
  lg: 992,
  xl: 1200,
  xxl: 1400
};
const breakpointsVuetify = {
  xs: 600,
  sm: 960,
  md: 1264,
  lg: 1904
};
const breakpointsAntDesign = {
  xs: 480,
  sm: 576,
  md: 768,
  lg: 992,
  xl: 1200,
  xxl: 1600
};
const breakpointsQuasar = {
  xs: 600,
  sm: 1024,
  md: 1440,
  lg: 1920
};
const breakpointsSematic = {
  mobileS: 320,
  mobileM: 375,
  mobileL: 425,
  tablet: 768,
  laptop: 1024,
  laptopL: 1440,
  desktop4K: 2560
};

var __defProp$g = Object.defineProperty;
var __getOwnPropSymbols$i = Object.getOwnPropertySymbols;
var __hasOwnProp$i = Object.prototype.hasOwnProperty;
var __propIsEnum$i = Object.prototype.propertyIsEnumerable;
var __defNormalProp$g = (obj, key, value) => key in obj ? __defProp$g(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$g = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$i.call(b, prop))
      __defNormalProp$g(a, prop, b[prop]);
  if (__getOwnPropSymbols$i)
    for (var prop of __getOwnPropSymbols$i(b)) {
      if (__propIsEnum$i.call(b, prop))
        __defNormalProp$g(a, prop, b[prop]);
    }
  return a;
};
function useBreakpoints(breakpoints, options = {}) {
  function getValue(k, delta) {
    let v = breakpoints[k];
    if (delta != null)
      v = increaseWithUnit(v, delta);
    if (typeof v === "number")
      v = `${v}px`;
    return v;
  }
  const { window = defaultWindow } = options;
  function match(query) {
    if (!window)
      return false;
    return window.matchMedia(query).matches;
  }
  const greater = (k) => {
    return useMediaQuery(`(min-width: ${getValue(k)})`, options);
  };
  const shortcutMethods = Object.keys(breakpoints).reduce((shortcuts, k) => {
    Object.defineProperty(shortcuts, k, {
      get: () => greater(k),
      enumerable: true,
      configurable: true
    });
    return shortcuts;
  }, {});
  return __spreadValues$g({
    greater,
    smaller(k) {
      return useMediaQuery(`(max-width: ${getValue(k, -0.1)})`, options);
    },
    between(a, b) {
      return useMediaQuery(`(min-width: ${getValue(a)}) and (max-width: ${getValue(b, -0.1)})`, options);
    },
    isGreater(k) {
      return match(`(min-width: ${getValue(k)})`);
    },
    isSmaller(k) {
      return match(`(max-width: ${getValue(k, -0.1)})`);
    },
    isInBetween(a, b) {
      return match(`(min-width: ${getValue(a)}) and (max-width: ${getValue(b, -0.1)})`);
    }
  }, shortcutMethods);
}

const useBroadcastChannel = (options) => {
  const {
    name,
    window = defaultWindow
  } = options;
  const isSupported = window && "BroadcastChannel" in window;
  const isClosed = ref(false);
  const channel = ref();
  const data = ref();
  const error = ref(null);
  const post = (data2) => {
    if (channel.value)
      channel.value.postMessage(data2);
  };
  const close = () => {
    if (channel.value)
      channel.value.close();
    isClosed.value = true;
  };
  if (isSupported) {
    tryOnMounted(() => {
      error.value = null;
      channel.value = new BroadcastChannel(name);
      channel.value.addEventListener("message", (e) => {
        data.value = e.data;
      }, { passive: true });
      channel.value.addEventListener("messageerror", (e) => {
        error.value = e;
      }, { passive: true });
      channel.value.addEventListener("close", () => {
        isClosed.value = true;
      });
    });
  }
  tryOnScopeDispose(() => {
    close();
  });
  return {
    isSupported,
    channel,
    data,
    post,
    close,
    error,
    isClosed
  };
};

function useBrowserLocation({ window = defaultWindow } = {}) {
  const buildState = (trigger) => {
    const { state: state2, length } = (window == null ? void 0 : window.history) || {};
    const { hash, host, hostname, href, origin, pathname, port, protocol, search } = (window == null ? void 0 : window.location) || {};
    return {
      trigger,
      state: state2,
      length,
      hash,
      host,
      hostname,
      href,
      origin,
      pathname,
      port,
      protocol,
      search
    };
  };
  const state = ref(buildState("load"));
  if (window) {
    useEventListener(window, "popstate", () => state.value = buildState("popstate"), { passive: true });
    useEventListener(window, "hashchange", () => state.value = buildState("hashchange"), { passive: true });
  }
  return state;
}

function useCached(refValue, comparator = (a, b) => a === b, watchOptions) {
  const cachedValue = ref(refValue.value);
  watch(() => refValue.value, (value) => {
    if (!comparator(value, cachedValue.value))
      cachedValue.value = value;
  }, watchOptions);
  return cachedValue;
}

function useClamp(value, min, max) {
  const _value = ref(value);
  return computed({
    get() {
      return clamp(_value.value, unref(min), unref(max));
    },
    set(value2) {
      _value.value = clamp(value2, unref(min), unref(max));
    }
  });
}

function useClipboard(options = {}) {
  const {
    navigator = defaultNavigator,
    read = false,
    source,
    copiedDuring = 1500
  } = options;
  const events = ["copy", "cut"];
  const isSupported = Boolean(navigator && "clipboard" in navigator);
  const text = ref("");
  const copied = ref(false);
  const timeout = useTimeoutFn(() => copied.value = false, copiedDuring);
  function updateText() {
    navigator.clipboard.readText().then((value) => {
      text.value = value;
    });
  }
  if (isSupported && read) {
    for (const event of events)
      useEventListener(event, updateText);
  }
  async function copy(value = unref(source)) {
    if (isSupported && value != null) {
      await navigator.clipboard.writeText(value);
      text.value = value;
      copied.value = true;
      timeout.start();
    }
  }
  return {
    isSupported,
    text,
    copied,
    copy
  };
}

const _global = typeof globalThis !== "undefined" ? globalThis : typeof window !== "undefined" ? window : typeof global !== "undefined" ? global : typeof self !== "undefined" ? self : {};
const globalKey = "__vueuse_ssr_handlers__";
_global[globalKey] = _global[globalKey] || {};
const handlers = _global[globalKey];
function getSSRHandler(key, fallback) {
  return handlers[key] || fallback;
}
function setSSRHandler(key, fn) {
  handlers[key] = fn;
}

function guessSerializerType(rawInit) {
  return rawInit == null ? "any" : rawInit instanceof Set ? "set" : rawInit instanceof Map ? "map" : typeof rawInit === "boolean" ? "boolean" : typeof rawInit === "string" ? "string" : typeof rawInit === "object" ? "object" : Array.isArray(rawInit) ? "object" : !Number.isNaN(rawInit) ? "number" : "any";
}

const StorageSerializers = {
  boolean: {
    read: (v) => v === "true",
    write: (v) => String(v)
  },
  object: {
    read: (v) => JSON.parse(v),
    write: (v) => JSON.stringify(v)
  },
  number: {
    read: (v) => Number.parseFloat(v),
    write: (v) => String(v)
  },
  any: {
    read: (v) => v,
    write: (v) => String(v)
  },
  string: {
    read: (v) => v,
    write: (v) => String(v)
  },
  map: {
    read: (v) => new Map(JSON.parse(v)),
    write: (v) => JSON.stringify(Array.from(v.entries()))
  },
  set: {
    read: (v) => new Set(JSON.parse(v)),
    write: (v) => JSON.stringify(Array.from(v.entries()))
  }
};
function useStorage(key, initialValue, storage, options = {}) {
  var _a;
  const {
    flush = "pre",
    deep = true,
    listenToStorageChanges = true,
    writeDefaults = true,
    shallow,
    window = defaultWindow,
    eventFilter,
    onError = (e) => {
      console.error(e);
    }
  } = options;
  const rawInit = unref(initialValue);
  const type = guessSerializerType(rawInit);
  const data = (shallow ? shallowRef : ref)(initialValue);
  const serializer = (_a = options.serializer) != null ? _a : StorageSerializers[type];
  if (!storage) {
    try {
      storage = getSSRHandler("getDefaultStorage", () => {
        var _a2;
        return (_a2 = defaultWindow) == null ? void 0 : _a2.localStorage;
      })();
    } catch (e) {
      onError(e);
    }
  }
  function read(event) {
    if (!storage || event && event.key !== key)
      return;
    try {
      const rawValue = event ? event.newValue : storage.getItem(key);
      if (rawValue == null) {
        data.value = rawInit;
        if (writeDefaults && rawInit !== null)
          storage.setItem(key, serializer.write(rawInit));
      } else if (typeof rawValue !== "string") {
        data.value = rawValue;
      } else {
        data.value = serializer.read(rawValue);
      }
    } catch (e) {
      onError(e);
    }
  }
  read();
  if (window && listenToStorageChanges)
    useEventListener(window, "storage", (e) => setTimeout(() => read(e), 0));
  if (storage) {
    watchWithFilter(data, () => {
      try {
        if (data.value == null)
          storage.removeItem(key);
        else
          storage.setItem(key, serializer.write(data.value));
      } catch (e) {
        onError(e);
      }
    }, {
      flush,
      deep,
      eventFilter
    });
  }
  return data;
}

function usePreferredDark(options) {
  return useMediaQuery("(prefers-color-scheme: dark)", options);
}

var __defProp$f = Object.defineProperty;
var __getOwnPropSymbols$h = Object.getOwnPropertySymbols;
var __hasOwnProp$h = Object.prototype.hasOwnProperty;
var __propIsEnum$h = Object.prototype.propertyIsEnumerable;
var __defNormalProp$f = (obj, key, value) => key in obj ? __defProp$f(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$f = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$h.call(b, prop))
      __defNormalProp$f(a, prop, b[prop]);
  if (__getOwnPropSymbols$h)
    for (var prop of __getOwnPropSymbols$h(b)) {
      if (__propIsEnum$h.call(b, prop))
        __defNormalProp$f(a, prop, b[prop]);
    }
  return a;
};
function useColorMode(options = {}) {
  const {
    selector = "html",
    attribute = "class",
    window = defaultWindow,
    storage,
    storageKey = "vueuse-color-scheme",
    listenToStorageChanges = true,
    storageRef
  } = options;
  const modes = __spreadValues$f({
    auto: "",
    light: "light",
    dark: "dark"
  }, options.modes || {});
  const preferredDark = usePreferredDark({ window });
  const preferredMode = computed(() => preferredDark.value ? "dark" : "light");
  const store = storageRef || (storageKey == null ? ref("auto") : useStorage(storageKey, "auto", storage, { window, listenToStorageChanges }));
  const state = computed({
    get() {
      return store.value === "auto" ? preferredMode.value : store.value;
    },
    set(v) {
      store.value = v;
    }
  });
  const updateHTMLAttrs = getSSRHandler("updateHTMLAttrs", (selector2, attribute2, value) => {
    const el = window == null ? void 0 : window.document.querySelector(selector2);
    if (!el)
      return;
    if (attribute2 === "class") {
      const current = value.split(/\s/g);
      Object.values(modes).flatMap((i) => (i || "").split(/\s/g)).filter(Boolean).forEach((v) => {
        if (current.includes(v))
          el.classList.add(v);
        else
          el.classList.remove(v);
      });
    } else {
      el.setAttribute(attribute2, value);
    }
  });
  function defaultOnChanged(mode) {
    var _a;
    updateHTMLAttrs(selector, attribute, (_a = modes[mode]) != null ? _a : mode);
  }
  function onChanged(mode) {
    if (options.onChanged)
      options.onChanged(mode, defaultOnChanged);
    else
      defaultOnChanged(mode);
  }
  watch(state, onChanged, { flush: "post", immediate: true });
  tryOnMounted(() => onChanged(state.value));
  return state;
}

function useConfirmDialog(revealed = ref(false)) {
  const confirmHook = createEventHook();
  const cancelHook = createEventHook();
  const revealHook = createEventHook();
  let _resolve = noop;
  const reveal = (data) => {
    revealHook.trigger(data);
    revealed.value = true;
    return new Promise((resolve) => {
      _resolve = resolve;
    });
  };
  const confirm = (data) => {
    revealed.value = false;
    confirmHook.trigger(data);
    _resolve({ data, isCanceled: false });
  };
  const cancel = (data) => {
    revealed.value = false;
    cancelHook.trigger(data);
    _resolve({ data, isCanceled: true });
  };
  return {
    isRevealed: computed(() => revealed.value),
    reveal,
    confirm,
    cancel,
    onReveal: revealHook.on,
    onConfirm: confirmHook.on,
    onCancel: cancelHook.on
  };
}

function useCssVar(prop, target, { window = defaultWindow } = {}) {
  const variable = reactivity_esm_bundler_ref("");
  const elRef = runtime_core_esm_bundler_computed(() => {
    var _a;
    return unrefElement(target) || ((_a = window == null ? void 0 : window.document) == null ? void 0 : _a.documentElement);
  });
  runtime_core_esm_bundler_watch([elRef, () => reactivity_esm_bundler_unref(prop)], ([el, prop2]) => {
    if (el && window)
      variable.value = window.getComputedStyle(el).getPropertyValue(prop2);
  }, { immediate: true });
  runtime_core_esm_bundler_watch(variable, (val) => {
    var _a;
    if ((_a = elRef.value) == null ? void 0 : _a.style)
      elRef.value.style.setProperty(reactivity_esm_bundler_unref(prop), val);
  });
  return variable;
}

function useCycleList(list, options) {
  const state = shallowRef((options == null ? void 0 : options.initialValue) || list[0]);
  const index = computed({
    get() {
      var _a;
      let index2 = (options == null ? void 0 : options.getIndexOf) ? options.getIndexOf(state.value, list) : list.indexOf(state.value);
      if (index2 < 0)
        index2 = (_a = options == null ? void 0 : options.fallbackIndex) != null ? _a : 0;
      return index2;
    },
    set(v) {
      set(v);
    }
  });
  function set(i) {
    const length = list.length;
    const index2 = (i % length + length) % length;
    const value = list[index2];
    state.value = value;
    return value;
  }
  function shift(delta = 1) {
    return set(index.value + delta);
  }
  function next(n = 1) {
    return shift(n);
  }
  function prev(n = 1) {
    return shift(-n);
  }
  return {
    state,
    index,
    next,
    prev
  };
}

var __defProp$e = Object.defineProperty;
var __defProps$8 = Object.defineProperties;
var __getOwnPropDescs$8 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$g = Object.getOwnPropertySymbols;
var __hasOwnProp$g = Object.prototype.hasOwnProperty;
var __propIsEnum$g = Object.prototype.propertyIsEnumerable;
var __defNormalProp$e = (obj, key, value) => key in obj ? __defProp$e(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$e = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$g.call(b, prop))
      __defNormalProp$e(a, prop, b[prop]);
  if (__getOwnPropSymbols$g)
    for (var prop of __getOwnPropSymbols$g(b)) {
      if (__propIsEnum$g.call(b, prop))
        __defNormalProp$e(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$8 = (a, b) => __defProps$8(a, __getOwnPropDescs$8(b));
function useDark(options = {}) {
  const {
    valueDark = "dark",
    valueLight = "",
    window = defaultWindow
  } = options;
  const mode = useColorMode(__spreadProps$8(__spreadValues$e({}, options), {
    onChanged: (mode2, defaultHandler) => {
      var _a;
      if (options.onChanged)
        (_a = options.onChanged) == null ? void 0 : _a.call(options, mode2 === "dark");
      else
        defaultHandler(mode2);
    },
    modes: {
      dark: valueDark,
      light: valueLight
    }
  }));
  const preferredDark = usePreferredDark({ window });
  const isDark = computed({
    get() {
      return mode.value === "dark";
    },
    set(v) {
      if (v === preferredDark.value)
        mode.value = "auto";
      else
        mode.value = v ? "dark" : "light";
    }
  });
  return isDark;
}

const fnClone = (v) => JSON.parse(JSON.stringify(v));
const fnBypass = (v) => v;
const fnSetSource = (source, value) => source.value = value;
function defaultDump(clone) {
  return clone ? isFunction(clone) ? clone : fnClone : fnBypass;
}
function defaultParse(clone) {
  return clone ? isFunction(clone) ? clone : fnClone : fnBypass;
}
function useManualRefHistory(source, options = {}) {
  const {
    clone = false,
    dump = defaultDump(clone),
    parse = defaultParse(clone),
    setSource = fnSetSource
  } = options;
  function _createHistoryRecord() {
    return markRaw({
      snapshot: dump(source.value),
      timestamp: timestamp()
    });
  }
  const last = ref(_createHistoryRecord());
  const undoStack = ref([]);
  const redoStack = ref([]);
  const _setSource = (record) => {
    setSource(source, parse(record.snapshot));
    last.value = record;
  };
  const commit = () => {
    undoStack.value.unshift(last.value);
    last.value = _createHistoryRecord();
    if (options.capacity && undoStack.value.length > options.capacity)
      undoStack.value.splice(options.capacity, Infinity);
    if (redoStack.value.length)
      redoStack.value.splice(0, redoStack.value.length);
  };
  const clear = () => {
    undoStack.value.splice(0, undoStack.value.length);
    redoStack.value.splice(0, redoStack.value.length);
  };
  const undo = () => {
    const state = undoStack.value.shift();
    if (state) {
      redoStack.value.unshift(last.value);
      _setSource(state);
    }
  };
  const redo = () => {
    const state = redoStack.value.shift();
    if (state) {
      undoStack.value.unshift(last.value);
      _setSource(state);
    }
  };
  const reset = () => {
    _setSource(last.value);
  };
  const history = computed(() => [last.value, ...undoStack.value]);
  const canUndo = computed(() => undoStack.value.length > 0);
  const canRedo = computed(() => redoStack.value.length > 0);
  return {
    source,
    undoStack,
    redoStack,
    last,
    history,
    canUndo,
    canRedo,
    clear,
    commit,
    reset,
    undo,
    redo
  };
}

var __defProp$d = Object.defineProperty;
var __defProps$7 = Object.defineProperties;
var __getOwnPropDescs$7 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$f = Object.getOwnPropertySymbols;
var __hasOwnProp$f = Object.prototype.hasOwnProperty;
var __propIsEnum$f = Object.prototype.propertyIsEnumerable;
var __defNormalProp$d = (obj, key, value) => key in obj ? __defProp$d(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$d = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$f.call(b, prop))
      __defNormalProp$d(a, prop, b[prop]);
  if (__getOwnPropSymbols$f)
    for (var prop of __getOwnPropSymbols$f(b)) {
      if (__propIsEnum$f.call(b, prop))
        __defNormalProp$d(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$7 = (a, b) => __defProps$7(a, __getOwnPropDescs$7(b));
function useRefHistory(source, options = {}) {
  const {
    deep = false,
    flush = "pre",
    eventFilter
  } = options;
  const {
    eventFilter: composedFilter,
    pause,
    resume: resumeTracking,
    isActive: isTracking
  } = pausableFilter(eventFilter);
  const {
    ignoreUpdates,
    ignorePrevAsyncUpdates,
    stop
  } = ignorableWatch(source, commit, { deep, flush, eventFilter: composedFilter });
  function setSource(source2, value) {
    ignorePrevAsyncUpdates();
    ignoreUpdates(() => {
      source2.value = value;
    });
  }
  const manualHistory = useManualRefHistory(source, __spreadProps$7(__spreadValues$d({}, options), { clone: options.clone || deep, setSource }));
  const { clear, commit: manualCommit } = manualHistory;
  function commit() {
    ignorePrevAsyncUpdates();
    manualCommit();
  }
  function resume(commitNow) {
    resumeTracking();
    if (commitNow)
      commit();
  }
  function batch(fn) {
    let canceled = false;
    const cancel = () => canceled = true;
    ignoreUpdates(() => {
      fn(cancel);
    });
    if (!canceled)
      commit();
  }
  function dispose() {
    stop();
    clear();
  }
  return __spreadProps$7(__spreadValues$d({}, manualHistory), {
    isTracking,
    pause,
    resume,
    commit,
    batch,
    dispose
  });
}

var __defProp$c = Object.defineProperty;
var __defProps$6 = Object.defineProperties;
var __getOwnPropDescs$6 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$e = Object.getOwnPropertySymbols;
var __hasOwnProp$e = Object.prototype.hasOwnProperty;
var __propIsEnum$e = Object.prototype.propertyIsEnumerable;
var __defNormalProp$c = (obj, key, value) => key in obj ? __defProp$c(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$c = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$e.call(b, prop))
      __defNormalProp$c(a, prop, b[prop]);
  if (__getOwnPropSymbols$e)
    for (var prop of __getOwnPropSymbols$e(b)) {
      if (__propIsEnum$e.call(b, prop))
        __defNormalProp$c(a, prop, b[prop]);
    }
  return a;
};
var __spreadProps$6 = (a, b) => __defProps$6(a, __getOwnPropDescs$6(b));
function useDebouncedRefHistory(source, options = {}) {
  const filter = options.debounce ? debounceFilter(options.debounce) : void 0;
  const history = useRefHistory(source, __spreadProps$6(__spreadValues$c({}, options), { eventFilter: filter }));
  return __spreadValues$c({}, history);
}

function useDeviceMotion(options = {}) {
  const {
    window = defaultWindow,
    eventFilter = bypassFilter
  } = options;
  const acceleration = ref({ x: null, y: null, z: null });
  const rotationRate = ref({ alpha: null, beta: null, gamma: null });
  const interval = ref(0);
  const accelerationIncludingGravity = ref({
    x: null,
    y: null,
    z: null
  });
  if (window) {
    const onDeviceMotion = createFilterWrapper(eventFilter, (event) => {
      acceleration.value = event.acceleration;
      accelerationIncludingGravity.value = event.accelerationIncludingGravity;
      rotationRate.value = event.rotationRate;
      interval.value = event.interval;
    });
    useEventListener(window, "devicemotion", onDeviceMotion);
  }
  return {
    acceleration,
    accelerationIncludingGravity,
    rotationRate,
    interval
  };
}

function useDeviceOrientation(options = {}) {
  const { window = defaultWindow } = options;
  const isSupported = Boolean(window && "DeviceOrientationEvent" in window);
  const isAbsolute = ref(false);
  const alpha = ref(null);
  const beta = ref(null);
  const gamma = ref(null);
  if (window && isSupported) {
    useEventListener(window, "deviceorientation", (event) => {
      isAbsolute.value = event.absolute;
      alpha.value = event.alpha;
      beta.value = event.beta;
      gamma.value = event.gamma;
    });
  }
  return {
    isSupported,
    isAbsolute,
    alpha,
    beta,
    gamma
  };
}

const DEVICE_PIXEL_RATIO_SCALES = (/* unused pure expression or super */ null && ([
  1,
  1.325,
  1.4,
  1.5,
  1.8,
  2,
  2.4,
  2.5,
  2.75,
  3,
  3.5,
  4
]));
function useDevicePixelRatio({
  window = defaultWindow
} = {}) {
  if (!window) {
    return {
      pixelRatio: ref(1)
    };
  }
  const pixelRatio = ref(window.devicePixelRatio);
  const handleDevicePixelRatio = () => {
    pixelRatio.value = window.devicePixelRatio;
  };
  useEventListener(window, "resize", handleDevicePixelRatio, { passive: true });
  DEVICE_PIXEL_RATIO_SCALES.forEach((dppx) => {
    const mqlMin = useMediaQuery(`screen and (min-resolution: ${dppx}dppx)`);
    const mqlMax = useMediaQuery(`screen and (max-resolution: ${dppx}dppx)`);
    watch([mqlMin, mqlMax], handleDevicePixelRatio);
  });
  return { pixelRatio };
}

function usePermission(permissionDesc, options = {}) {
  const {
    controls = false,
    navigator = defaultNavigator
  } = options;
  const isSupported = Boolean(navigator && "permissions" in navigator);
  let permissionStatus;
  const desc = typeof permissionDesc === "string" ? { name: permissionDesc } : permissionDesc;
  const state = ref();
  const onChange = () => {
    if (permissionStatus)
      state.value = permissionStatus.state;
  };
  const query = createSingletonPromise(async () => {
    if (!isSupported)
      return;
    if (!permissionStatus) {
      try {
        permissionStatus = await navigator.permissions.query(desc);
        useEventListener(permissionStatus, "change", onChange);
        onChange();
      } catch (e) {
        state.value = "prompt";
      }
    }
    return permissionStatus;
  });
  query();
  if (controls) {
    return {
      state,
      isSupported,
      query
    };
  } else {
    return state;
  }
}

function useDevicesList(options = {}) {
  const {
    navigator = defaultNavigator,
    requestPermissions = false,
    constraints = { audio: true, video: true },
    onUpdated
  } = options;
  const devices = ref([]);
  const videoInputs = computed(() => devices.value.filter((i) => i.kind === "videoinput"));
  const audioInputs = computed(() => devices.value.filter((i) => i.kind === "audioinput"));
  const audioOutputs = computed(() => devices.value.filter((i) => i.kind === "audiooutput"));
  let isSupported = false;
  const permissionGranted = ref(false);
  async function update() {
    if (!isSupported)
      return;
    devices.value = await navigator.mediaDevices.enumerateDevices();
    onUpdated == null ? void 0 : onUpdated(devices.value);
  }
  async function ensurePermissions() {
    if (!isSupported)
      return false;
    if (permissionGranted.value)
      return true;
    const { state, query } = usePermission("camera", { controls: true });
    await query();
    if (state.value !== "granted") {
      const stream = await navigator.mediaDevices.getUserMedia(constraints);
      stream.getTracks().forEach((t) => t.stop());
      update();
      permissionGranted.value = true;
    } else {
      permissionGranted.value = true;
    }
    return permissionGranted.value;
  }
  if (navigator) {
    isSupported = Boolean(navigator.mediaDevices && navigator.mediaDevices.enumerateDevices);
    if (isSupported) {
      if (requestPermissions)
        ensurePermissions();
      useEventListener(navigator.mediaDevices, "devicechange", update);
      update();
    }
  }
  return {
    devices,
    ensurePermissions,
    permissionGranted,
    videoInputs,
    audioInputs,
    audioOutputs,
    isSupported
  };
}

function useDisplayMedia(options = {}) {
  var _a, _b;
  const enabled = ref((_a = options.enabled) != null ? _a : false);
  const video = options.video;
  const audio = options.audio;
  const { navigator = defaultNavigator } = options;
  const isSupported = Boolean((_b = navigator == null ? void 0 : navigator.mediaDevices) == null ? void 0 : _b.getDisplayMedia);
  const constraint = { audio, video };
  const stream = shallowRef();
  async function _start() {
    if (!isSupported || stream.value)
      return;
    stream.value = await navigator.mediaDevices.getDisplayMedia(constraint);
    return stream.value;
  }
  async function _stop() {
    var _a2;
    (_a2 = stream.value) == null ? void 0 : _a2.getTracks().forEach((t) => t.stop());
    stream.value = void 0;
  }
  function stop() {
    _stop();
    enabled.value = false;
  }
  async function start() {
    await _start();
    if (stream.value)
      enabled.value = true;
    return stream.value;
  }
  watch(enabled, (v) => {
    if (v)
      _start();
    else
      _stop();
  }, { immediate: true });
  return {
    isSupported,
    stream,
    start,
    stop,
    enabled
  };
}

function useDocumentVisibility({ document = defaultDocument } = {}) {
  if (!document)
    return ref("visible");
  const visibility = ref(document.visibilityState);
  useEventListener(document, "visibilitychange", () => {
    visibility.value = document.visibilityState;
  });
  return visibility;
}

var __defProp$b = Object.defineProperty;
var core_defProps$5 = Object.defineProperties;
var core_getOwnPropDescs$5 = Object.getOwnPropertyDescriptors;
var __getOwnPropSymbols$d = Object.getOwnPropertySymbols;
var __hasOwnProp$d = Object.prototype.hasOwnProperty;
var __propIsEnum$d = Object.prototype.propertyIsEnumerable;
var __defNormalProp$b = (obj, key, value) => key in obj ? __defProp$b(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$b = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$d.call(b, prop))
      __defNormalProp$b(a, prop, b[prop]);
  if (__getOwnPropSymbols$d)
    for (var prop of __getOwnPropSymbols$d(b)) {
      if (__propIsEnum$d.call(b, prop))
        __defNormalProp$b(a, prop, b[prop]);
    }
  return a;
};
var core_spreadProps$5 = (a, b) => core_defProps$5(a, core_getOwnPropDescs$5(b));
function useDraggable(target, options = {}) {
  var _a, _b;
  const draggingElement = (_a = options.draggingElement) != null ? _a : defaultWindow;
  const position = ref((_b = options.initialValue) != null ? _b : { x: 0, y: 0 });
  const pressedDelta = ref();
  const filterEvent = (e) => {
    if (options.pointerTypes)
      return options.pointerTypes.includes(e.pointerType);
    return true;
  };
  const preventDefault = (e) => {
    if (unref(options.preventDefault))
      e.preventDefault();
  };
  const start = (e) => {
    var _a2;
    if (!filterEvent(e))
      return;
    if (unref(options.exact) && e.target !== unref(target))
      return;
    const rect = unref(target).getBoundingClientRect();
    const pos = {
      x: e.pageX - rect.left,
      y: e.pageY - rect.top
    };
    if (((_a2 = options.onStart) == null ? void 0 : _a2.call(options, pos, e)) === false)
      return;
    pressedDelta.value = pos;
    preventDefault(e);
  };
  const move = (e) => {
    var _a2;
    if (!filterEvent(e))
      return;
    if (!pressedDelta.value)
      return;
    position.value = {
      x: e.pageX - pressedDelta.value.x,
      y: e.pageY - pressedDelta.value.y
    };
    (_a2 = options.onMove) == null ? void 0 : _a2.call(options, position.value, e);
    preventDefault(e);
  };
  const end = (e) => {
    var _a2;
    if (!filterEvent(e))
      return;
    if (!pressedDelta.value)
      return;
    pressedDelta.value = void 0;
    (_a2 = options.onEnd) == null ? void 0 : _a2.call(options, position.value, e);
    preventDefault(e);
  };
  if (isClient) {
    useEventListener(target, "pointerdown", start, true);
    useEventListener(draggingElement, "pointermove", move, true);
    useEventListener(draggingElement, "pointerup", end, true);
  }
  return core_spreadProps$5(__spreadValues$b({}, toRefs(position)), {
    position,
    isDragging: computed(() => !!pressedDelta.value),
    style: computed(() => `left:${position.value.x}px;top:${position.value.y}px;`)
  });
}

var __getOwnPropSymbols$c = Object.getOwnPropertySymbols;
var __hasOwnProp$c = Object.prototype.hasOwnProperty;
var __propIsEnum$c = Object.prototype.propertyIsEnumerable;
var core_objRest$2 = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (__hasOwnProp$c.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && __getOwnPropSymbols$c)
    for (var prop of __getOwnPropSymbols$c(source)) {
      if (exclude.indexOf(prop) < 0 && __propIsEnum$c.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function useResizeObserver(target, callback, options = {}) {
  const _a = options, { window = defaultWindow } = _a, observerOptions = core_objRest$2(_a, ["window"]);
  let observer;
  const isSupported = window && "ResizeObserver" in window;
  const cleanup = () => {
    if (observer) {
      observer.disconnect();
      observer = void 0;
    }
  };
  const stopWatch = runtime_core_esm_bundler_watch(() => unrefElement(target), (el) => {
    cleanup();
    if (isSupported && window && el) {
      observer = new window.ResizeObserver(callback);
      observer.observe(el, observerOptions);
    }
  }, { immediate: true, flush: "post" });
  const stop = () => {
    cleanup();
    stopWatch();
  };
  shared_tryOnScopeDispose(stop);
  return {
    isSupported,
    stop
  };
}

function useElementBounding(target) {
  const height = ref(0);
  const bottom = ref(0);
  const left = ref(0);
  const right = ref(0);
  const top = ref(0);
  const width = ref(0);
  const x = ref(0);
  const y = ref(0);
  function update() {
    const el = unrefElement(target);
    if (!el) {
      height.value = 0;
      bottom.value = 0;
      left.value = 0;
      right.value = 0;
      top.value = 0;
      width.value = 0;
      x.value = 0;
      y.value = 0;
      return;
    }
    const rect = el.getBoundingClientRect();
    height.value = rect.height;
    bottom.value = rect.bottom;
    left.value = rect.left;
    right.value = rect.right;
    top.value = rect.top;
    width.value = rect.width;
    x.value = rect.x;
    y.value = rect.y;
  }
  useEventListener("scroll", update, true);
  useResizeObserver(target, update);
  watch(() => unrefElement(target), (ele) => !ele && update());
  return {
    height,
    bottom,
    left,
    right,
    top,
    width,
    x,
    y,
    update
  };
}

function useRafFn(fn, options = {}) {
  const {
    immediate = true,
    window = defaultWindow
  } = options;
  const isActive = ref(false);
  function loop() {
    if (!isActive.value || !window)
      return;
    fn();
    window.requestAnimationFrame(loop);
  }
  function resume() {
    if (!isActive.value && window) {
      isActive.value = true;
      loop();
    }
  }
  function pause() {
    isActive.value = false;
  }
  if (immediate)
    resume();
  tryOnScopeDispose(pause);
  return {
    isActive,
    pause,
    resume
  };
}

var __defProp$a = Object.defineProperty;
var __getOwnPropSymbols$b = Object.getOwnPropertySymbols;
var __hasOwnProp$b = Object.prototype.hasOwnProperty;
var __propIsEnum$b = Object.prototype.propertyIsEnumerable;
var __defNormalProp$a = (obj, key, value) => key in obj ? __defProp$a(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$a = (a, b) => {
  for (var prop in b || (b = {}))
    if (__hasOwnProp$b.call(b, prop))
      __defNormalProp$a(a, prop, b[prop]);
  if (__getOwnPropSymbols$b)
    for (var prop of __getOwnPropSymbols$b(b)) {
      if (__propIsEnum$b.call(b, prop))
        __defNormalProp$a(a, prop, b[prop]);
    }
  return a;
};
function useElementByPoint(options) {
  const element = ref(null);
  const { x, y } = options;
  const controls = useRafFn(() => {
    element.value = document.elementFromPoint(unref(x), unref(y));
  });
  return __spreadValues$a({
    element
  }, controls);
}

function useElementHover(el) {
  const isHovered = ref(false);
  useEventListener(el, "mouseenter", () => isHovered.value = true);
  useEventListener(el, "mouseleave", () => isHovered.value = false);
  return isHovered;
}

function useElementSize(target, initialSize = { width: 0, height: 0 }, options = {}) {
  const width = ref(initialSize.width);
  const height = ref(initialSize.height);
  useResizeObserver(target, ([entry]) => {
    width.value = entry.contentRect.width;
    height.value = entry.contentRect.height;
  }, options);
  watch(() => unrefElement(target), (ele) => {
    width.value = ele ? initialSize.width : 0;
    height.value = ele ? initialSize.height : 0;
  });
  return {
    width,
    height
  };
}

function useElementVisibility(element, { window = defaultWindow, scrollTarget } = {}) {
  const elementIsVisible = ref(false);
  const testBounding = () => {
    if (!window)
      return;
    const document = window.document;
    if (!element.value) {
      elementIsVisible.value = false;
    } else {
      const rect = element.value.getBoundingClientRect();
      elementIsVisible.value = rect.top <= (window.innerHeight || document.documentElement.clientHeight) && rect.left <= (window.innerWidth || document.documentElement.clientWidth) && rect.bottom >= 0 && rect.right >= 0;
    }
  };
  tryOnMounted(testBounding);
  if (window)
    tryOnMounted(() => useEventListener((scrollTarget == null ? void 0 : scrollTarget.value) || window, "scroll", testBounding, { capture: false, passive: true }));
  return elementIsVisible;
}

const events = /* @__PURE__ */ new Map();

function useEventBus(key) {
  const scope = getCurrentScope();
  function on(listener) {
    const listeners = events.get(key) || [];
    listeners.push(listener);
    events.set(key, listeners);
    const _off = () => off(listener);
    scope == null ? void 0 : scope.cleanups.push(_off);
    return _off;
  }
  function once(listener) {
    function _listener(...args) {
      off(_listener);
      listener(...args);
    }
    return on(_listener);
  }
  function off(listener) {
    const listeners = events.get(key);
    if (!listeners)
      return;
    const index = listeners.indexOf(listener);
    if (index > -1)
      listeners.splice(index, 1);
    if (!listeners.length)
      events.delete(key);
  }
  function reset() {
    events.delete(key);
  }
  function emit(event) {
    var _a;
    (_a = events.get(key)) == null ? void 0 : _a.forEach((v) => v(event));
  }
  return { on, once, off, emit, reset };
}

function useEventSource(url, events = [], options = {}) {
  const event = ref(null);
  const data = ref(null);
  const status = ref("CONNECTING");
  const eventSource = ref(null);
  const error = ref(null);
  const {
    withCredentials = false
  } = options;
  const close = () => {
    if (eventSource.value) {
      eventSource.value.close();
      eventSource.value = null;
      status.value = "CLOSED";
    }
  };
  const es = new EventSource(url, { withCredentials });
  eventSource.value = es;
  es.onopen = () => {
    status.value = "OPEN";
    error.value = null;
  };
  es.onerror = (e) => {
    status.value = "CLOSED";
    error.value = e;
  };
  es.onmessage = (e) => {
    event.value = null;
    data.value = e.data;
  };
  for (const event_name of events) {
    useEventListener(es, event_name, (e) => {
      event.value = event_name;
      data.value = e.data || null;
    });
  }
  tryOnScopeDispose(() => {
    close();
  });
  return {
    eventSource,
    event,
    data,
    status,
    error,
    close
  };
}

function useEyeDropper(options = {}) {
  const { initialValue = "" } = options;
  const isSupported = Boolean(typeof window !== "undefined" && "EyeDropper" in window);
  const sRGBHex = ref(initialValue);
  async function open(openOptions) {
    if (!isSupported)
      return;
    const eyeDropper = new window.EyeDropper();
    const result = await eyeDropper.open(openOptions);
    sRGBHex.value = result.sRGBHex;
    return result;
  }
  return { isSupported, sRGBHex, open };
}

function useFavicon(newIcon = null, options = {}) {
  const {
    baseUrl = "",
    rel = "icon",
    document = defaultDocument
  } = options;
  const favicon = isRef(newIcon) ? newIcon : ref(newIcon);
  const applyIcon = (icon) => {
    document == null ? void 0 : document.head.querySelectorAll(`link[rel*="${rel}"]`).forEach((el) => el.href = `${baseUrl}${icon}`);
  };
  watch(favicon, (i, o) => {
    if (isString(i) && i !== o)
      applyIcon(i);
  }, { immediate: true });
  return favicon;
}

var __defProp$9 = Object.defineProperty;
var core_defProps$4 = Object.defineProperties;
var core_getOwnPropDescs$4 = Object.getOwnPropertyDescriptors;
var core_getOwnPropSymbols$a = Object.getOwnPropertySymbols;
var core_hasOwnProp$a = Object.prototype.hasOwnProperty;
var core_propIsEnum$a = Object.prototype.propertyIsEnumerable;
var __defNormalProp$9 = (obj, key, value) => key in obj ? __defProp$9(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var __spreadValues$9 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$a.call(b, prop))
      __defNormalProp$9(a, prop, b[prop]);
  if (core_getOwnPropSymbols$a)
    for (var prop of core_getOwnPropSymbols$a(b)) {
      if (core_propIsEnum$a.call(b, prop))
        __defNormalProp$9(a, prop, b[prop]);
    }
  return a;
};
var core_spreadProps$4 = (a, b) => core_defProps$4(a, core_getOwnPropDescs$4(b));
const payloadMapping = {
  json: "application/json",
  text: "text/plain",
  formData: "multipart/form-data"
};
function isFetchOptions(obj) {
  return containsProp(obj, "immediate", "refetch", "initialData", "timeout", "beforeFetch", "afterFetch", "onFetchError");
}
function headersToObject(headers) {
  if (headers instanceof Headers)
    return Object.fromEntries([...headers.entries()]);
  return headers;
}
function createFetch(config = {}) {
  const _options = config.options || {};
  const _fetchOptions = config.fetchOptions || {};
  function useFactoryFetch(url, ...args) {
    const computedUrl = computed(() => config.baseUrl ? joinPaths(unref(config.baseUrl), unref(url)) : unref(url));
    let options = _options;
    let fetchOptions = _fetchOptions;
    if (args.length > 0) {
      if (isFetchOptions(args[0])) {
        options = __spreadValues$9(__spreadValues$9({}, options), args[0]);
      } else {
        fetchOptions = core_spreadProps$4(__spreadValues$9(__spreadValues$9({}, fetchOptions), args[0]), {
          headers: __spreadValues$9(__spreadValues$9({}, headersToObject(fetchOptions.headers) || {}), headersToObject(args[0].headers) || {})
        });
      }
    }
    if (args.length > 1 && isFetchOptions(args[1]))
      options = __spreadValues$9(__spreadValues$9({}, options), args[1]);
    return useFetch(computedUrl, fetchOptions, options);
  }
  return useFactoryFetch;
}
function useFetch(url, ...args) {
  var _a;
  const supportsAbort = typeof AbortController === "function";
  let fetchOptions = {};
  let options = { immediate: true, refetch: false, timeout: 0 };
  const config = {
    method: "get",
    type: "text",
    payload: void 0
  };
  if (args.length > 0) {
    if (isFetchOptions(args[0]))
      options = __spreadValues$9(__spreadValues$9({}, options), args[0]);
    else
      fetchOptions = args[0];
  }
  if (args.length > 1) {
    if (isFetchOptions(args[1]))
      options = __spreadValues$9(__spreadValues$9({}, options), args[1]);
  }
  const {
    fetch = (_a = defaultWindow) == null ? void 0 : _a.fetch,
    initialData,
    timeout
  } = options;
  const responseEvent = createEventHook();
  const errorEvent = createEventHook();
  const finallyEvent = createEventHook();
  const isFinished = ref(false);
  const isFetching = ref(false);
  const aborted = ref(false);
  const statusCode = ref(null);
  const response = shallowRef(null);
  const error = ref(null);
  const data = shallowRef(initialData);
  const canAbort = computed(() => supportsAbort && isFetching.value);
  let controller;
  let timer;
  const abort = () => {
    if (supportsAbort && controller)
      controller.abort();
  };
  const loading = (isLoading) => {
    isFetching.value = isLoading;
    isFinished.value = !isLoading;
  };
  if (timeout)
    timer = useTimeoutFn(abort, timeout, { immediate: false });
  const execute = async (throwOnFailed = false) => {
    var _a2;
    loading(true);
    error.value = null;
    statusCode.value = null;
    aborted.value = false;
    controller = void 0;
    if (supportsAbort) {
      controller = new AbortController();
      controller.signal.onabort = () => aborted.value = true;
      fetchOptions = core_spreadProps$4(__spreadValues$9({}, fetchOptions), {
        signal: controller.signal
      });
    }
    const defaultFetchOptions = {
      method: config.method,
      headers: {}
    };
    if (config.payload) {
      const headers = headersToObject(defaultFetchOptions.headers);
      if (config.payloadType)
        headers["Content-Type"] = (_a2 = payloadMapping[config.payloadType]) != null ? _a2 : config.payloadType;
      defaultFetchOptions.body = config.payloadType === "json" ? JSON.stringify(unref(config.payload)) : unref(config.payload);
    }
    let isCanceled = false;
    const context = { url: unref(url), options: fetchOptions, cancel: () => {
      isCanceled = true;
    } };
    if (options.beforeFetch)
      Object.assign(context, await options.beforeFetch(context));
    if (isCanceled || !fetch) {
      loading(false);
      return Promise.resolve(null);
    }
    let responseData = null;
    if (timer)
      timer.start();
    return new Promise((resolve, reject) => {
      var _a3;
      fetch(context.url, core_spreadProps$4(__spreadValues$9(__spreadValues$9({}, defaultFetchOptions), context.options), {
        headers: __spreadValues$9(__spreadValues$9({}, headersToObject(defaultFetchOptions.headers)), headersToObject((_a3 = context.options) == null ? void 0 : _a3.headers))
      })).then(async (fetchResponse) => {
        response.value = fetchResponse;
        statusCode.value = fetchResponse.status;
        responseData = await fetchResponse[config.type]();
        if (options.afterFetch)
          ({ data: responseData } = await options.afterFetch({ data: responseData, response: fetchResponse }));
        data.value = responseData;
        if (!fetchResponse.ok)
          throw new Error(fetchResponse.statusText);
        responseEvent.trigger(fetchResponse);
        return resolve(fetchResponse);
      }).catch(async (fetchError) => {
        let errorData = fetchError.message || fetchError.name;
        if (options.onFetchError)
          ({ data: responseData, error: errorData } = await options.onFetchError({ data: responseData, error: fetchError }));
        data.value = responseData;
        error.value = errorData;
        errorEvent.trigger(fetchError);
        if (throwOnFailed)
          return reject(fetchError);
        return resolve(null);
      }).finally(() => {
        loading(false);
        if (timer)
          timer.stop();
        finallyEvent.trigger(null);
      });
    });
  };
  watch(() => [
    unref(url),
    unref(options.refetch)
  ], () => unref(options.refetch) && execute(), { deep: true });
  const shell = {
    isFinished,
    statusCode,
    response,
    error,
    data,
    isFetching,
    canAbort,
    aborted,
    abort,
    execute,
    onFetchResponse: responseEvent.on,
    onFetchError: errorEvent.on,
    onFetchFinally: finallyEvent.on,
    get: setMethod("get"),
    put: setMethod("put"),
    post: setMethod("post"),
    delete: setMethod("delete"),
    patch: setMethod("patch"),
    head: setMethod("head"),
    options: setMethod("options"),
    json: setType("json"),
    text: setType("text"),
    blob: setType("blob"),
    arrayBuffer: setType("arrayBuffer"),
    formData: setType("formData")
  };
  function setMethod(method) {
    return (payload, payloadType) => {
      if (!isFetching.value) {
        config.method = method;
        config.payload = payload;
        config.payloadType = payloadType;
        if (isRef(config.payload)) {
          watch(() => [
            unref(config.payload),
            unref(options.refetch)
          ], () => unref(options.refetch) && execute(), { deep: true });
        }
        if (!payloadType && unref(payload) && Object.getPrototypeOf(unref(payload)) === Object.prototype)
          config.payloadType = "json";
        return shell;
      }
      return void 0;
    };
  }
  function waitUntilFinished() {
    return new Promise((resolve, reject) => {
      until(isFinished).toBe(true).then(() => resolve(shell)).catch((error2) => reject(error2));
    });
  }
  function setType(type) {
    return () => {
      if (!isFetching.value) {
        config.type = type;
        return core_spreadProps$4(__spreadValues$9({}, shell), {
          then(onFulfilled, onRejected) {
            return waitUntilFinished().then(onFulfilled, onRejected);
          }
        });
      }
      return void 0;
    };
  }
  if (options.immediate)
    setTimeout(execute, 0);
  return core_spreadProps$4(__spreadValues$9({}, shell), {
    then(onFulfilled, onRejected) {
      return waitUntilFinished().then(onFulfilled, onRejected);
    }
  });
}
function joinPaths(start, end) {
  if (!start.endsWith("/") && !end.startsWith("/"))
    return `${start}/${end}`;
  return `${start}${end}`;
}

function useFocus(options = {}) {
  const {
    initialValue = false
  } = options;
  const activeElement = useActiveElement(options);
  const target = computed(() => unrefElement(options.target));
  const focused = computed({
    get() {
      return activeElement.value === target.value;
    },
    set(value) {
      var _a, _b;
      if (!value && focused.value)
        (_a = target.value) == null ? void 0 : _a.blur();
      if (value && !focused.value)
        (_b = target.value) == null ? void 0 : _b.focus();
    }
  });
  watch(target, () => {
    focused.value = initialValue;
  }, { immediate: true, flush: "post" });
  return { focused };
}

function useFocusWithin(target, options = {}) {
  const activeElement = useActiveElement(options);
  const targetElement = computed(() => unrefElement(target));
  const focused = computed(() => targetElement.value && activeElement.value ? targetElement.value.contains(activeElement.value) : false);
  return { focused };
}

function useFps(options) {
  var _a;
  const fps = ref(0);
  if (typeof performance === "undefined")
    return fps;
  const every = (_a = options == null ? void 0 : options.every) != null ? _a : 10;
  let last = performance.now();
  let ticks = 0;
  useRafFn(() => {
    ticks += 1;
    if (ticks >= every) {
      const now = performance.now();
      const diff = now - last;
      fps.value = Math.round(1e3 / (diff / ticks));
      last = now;
      ticks = 0;
    }
  });
  return fps;
}

const functionsMap = (/* unused pure expression or super */ null && ([
  [
    "requestFullscreen",
    "exitFullscreen",
    "fullscreenElement",
    "fullscreenEnabled",
    "fullscreenchange",
    "fullscreenerror"
  ],
  [
    "webkitRequestFullscreen",
    "webkitExitFullscreen",
    "webkitFullscreenElement",
    "webkitFullscreenEnabled",
    "webkitfullscreenchange",
    "webkitfullscreenerror"
  ],
  [
    "webkitRequestFullScreen",
    "webkitCancelFullScreen",
    "webkitCurrentFullScreenElement",
    "webkitCancelFullScreen",
    "webkitfullscreenchange",
    "webkitfullscreenerror"
  ],
  [
    "mozRequestFullScreen",
    "mozCancelFullScreen",
    "mozFullScreenElement",
    "mozFullScreenEnabled",
    "mozfullscreenchange",
    "mozfullscreenerror"
  ],
  [
    "msRequestFullscreen",
    "msExitFullscreen",
    "msFullscreenElement",
    "msFullscreenEnabled",
    "MSFullscreenChange",
    "MSFullscreenError"
  ]
]));
function useFullscreen(target, options = {}) {
  const { document = defaultDocument } = options;
  const targetRef = target || (document == null ? void 0 : document.querySelector("html"));
  const isFullscreen = ref(false);
  let isSupported = false;
  let map = functionsMap[0];
  if (!document) {
    isSupported = false;
  } else {
    for (const m of functionsMap) {
      if (m[1] in document) {
        map = m;
        isSupported = true;
        break;
      }
    }
  }
  const [REQUEST, EXIT, ELEMENT, , EVENT] = map;
  async function exit() {
    if (!isSupported)
      return;
    if (document == null ? void 0 : document[ELEMENT])
      await document[EXIT]();
    isFullscreen.value = false;
  }
  async function enter() {
    if (!isSupported)
      return;
    await exit();
    const target2 = unrefElement(targetRef);
    if (target2) {
      await target2[REQUEST]();
      isFullscreen.value = true;
    }
  }
  async function toggle() {
    if (isFullscreen.value)
      await exit();
    else
      await enter();
  }
  if (document) {
    useEventListener(document, EVENT, () => {
      isFullscreen.value = !!(document == null ? void 0 : document[ELEMENT]);
    }, false);
  }
  return {
    isSupported,
    isFullscreen,
    enter,
    exit,
    toggle
  };
}

function useGeolocation(options = {}) {
  const {
    enableHighAccuracy = true,
    maximumAge = 3e4,
    timeout = 27e3,
    navigator = defaultNavigator
  } = options;
  const isSupported = navigator && "geolocation" in navigator;
  const locatedAt = ref(null);
  const error = ref(null);
  const coords = ref({
    accuracy: 0,
    latitude: Infinity,
    longitude: Infinity,
    altitude: null,
    altitudeAccuracy: null,
    heading: null,
    speed: null
  });
  function updatePosition(position) {
    locatedAt.value = position.timestamp;
    coords.value = position.coords;
    error.value = null;
  }
  let watcher;
  if (isSupported) {
    watcher = navigator.geolocation.watchPosition(updatePosition, (err) => error.value = err, {
      enableHighAccuracy,
      maximumAge,
      timeout
    });
  }
  tryOnScopeDispose(() => {
    if (watcher && navigator)
      navigator.geolocation.clearWatch(watcher);
  });
  return {
    isSupported,
    coords,
    locatedAt,
    error
  };
}

const defaultEvents$1 = (/* unused pure expression or super */ null && (["mousemove", "mousedown", "resize", "keydown", "touchstart", "wheel"]));
const oneMinute = 6e4;
function useIdle(timeout = oneMinute, options = {}) {
  const {
    initialState = false,
    listenForVisibilityChange = true,
    events = defaultEvents$1,
    window = defaultWindow,
    eventFilter = throttleFilter(50)
  } = options;
  const idle = ref(initialState);
  const lastActive = ref(timestamp());
  let timer;
  const onEvent = createFilterWrapper(eventFilter, () => {
    idle.value = false;
    lastActive.value = timestamp();
    clearTimeout(timer);
    timer = setTimeout(() => idle.value = true, timeout);
  });
  if (window) {
    const document = window.document;
    for (const event of events)
      useEventListener(window, event, onEvent, { passive: true });
    if (listenForVisibilityChange) {
      useEventListener(document, "visibilitychange", () => {
        if (!document.hidden)
          onEvent();
      });
    }
  }
  timer = setTimeout(() => idle.value = true, timeout);
  return { idle, lastActive };
}

function useScroll(element, options = {}) {
  const {
    throttle = 0,
    idle = 200,
    onStop = noop,
    onScroll = noop,
    offset = {
      left: 0,
      right: 0,
      top: 0,
      bottom: 0
    },
    eventListenerOptions = {
      capture: false,
      passive: true
    }
  } = options;
  const x = ref(0);
  const y = ref(0);
  const isScrolling = ref(false);
  const arrivedState = reactive({
    left: true,
    right: false,
    top: true,
    bottom: false
  });
  const directions = reactive({
    left: false,
    right: false,
    top: false,
    bottom: false
  });
  if (element) {
    const onScrollEnd = useDebounceFn((e) => {
      isScrolling.value = false;
      directions.left = false;
      directions.right = false;
      directions.top = false;
      directions.bottom = false;
      onStop(e);
    }, throttle + idle);
    const onScrollHandler = (e) => {
      const eventTarget = e.target === document ? e.target.documentElement : e.target;
      const scrollLeft = eventTarget.scrollLeft;
      directions.left = scrollLeft < x.value;
      directions.right = scrollLeft > x.value;
      arrivedState.left = scrollLeft <= 0 + (offset.left || 0);
      arrivedState.right = scrollLeft + eventTarget.clientWidth >= eventTarget.scrollWidth - (offset.right || 0);
      x.value = scrollLeft;
      const scrollTop = eventTarget.scrollTop;
      directions.top = scrollTop < y.value;
      directions.bottom = scrollTop > y.value;
      arrivedState.top = scrollTop <= 0 + (offset.top || 0);
      arrivedState.bottom = scrollTop + eventTarget.clientHeight >= eventTarget.scrollHeight - (offset.bottom || 0);
      y.value = scrollTop;
      isScrolling.value = true;
      onScrollEnd(e);
      onScroll(e);
    };
    useEventListener(element, "scroll", throttle ? useThrottleFn(onScrollHandler, throttle) : onScrollHandler, eventListenerOptions);
  }
  return {
    x,
    y,
    isScrolling,
    arrivedState,
    directions
  };
}

var core_defProp$8 = Object.defineProperty;
var core_defProps$3 = Object.defineProperties;
var core_getOwnPropDescs$3 = Object.getOwnPropertyDescriptors;
var core_getOwnPropSymbols$9 = Object.getOwnPropertySymbols;
var core_hasOwnProp$9 = Object.prototype.hasOwnProperty;
var core_propIsEnum$9 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$8 = (obj, key, value) => key in obj ? core_defProp$8(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$8 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$9.call(b, prop))
      core_defNormalProp$8(a, prop, b[prop]);
  if (core_getOwnPropSymbols$9)
    for (var prop of core_getOwnPropSymbols$9(b)) {
      if (core_propIsEnum$9.call(b, prop))
        core_defNormalProp$8(a, prop, b[prop]);
    }
  return a;
};
var core_spreadProps$3 = (a, b) => core_defProps$3(a, core_getOwnPropDescs$3(b));
function useInfiniteScroll(element, onLoadMore, options = {}) {
  var _a;
  const state = reactive(useScroll(element, core_spreadProps$3(core_spreadValues$8({}, options), {
    offset: core_spreadValues$8({
      bottom: (_a = options.distance) != null ? _a : 0
    }, options.offset)
  })));
  watch(() => state.arrivedState.bottom, (v) => {
    if (v)
      onLoadMore(state);
  });
}

function useIntersectionObserver(target, callback, options = {}) {
  const {
    root,
    rootMargin = "0px",
    threshold = 0.1,
    window = defaultWindow
  } = options;
  const isSupported = window && "IntersectionObserver" in window;
  let cleanup = noop;
  const stopWatch = isSupported ? watch(() => ({
    el: unrefElement(target),
    root: unrefElement(root)
  }), ({ el, root: root2 }) => {
    cleanup();
    if (!el)
      return;
    const observer = new window.IntersectionObserver(callback, {
      root: root2,
      rootMargin,
      threshold
    });
    observer.observe(el);
    cleanup = () => {
      observer.disconnect();
      cleanup = noop;
    };
  }, { immediate: true, flush: "post" }) : noop;
  const stop = () => {
    cleanup();
    stopWatch();
  };
  tryOnScopeDispose(stop);
  return {
    isSupported,
    stop
  };
}

const defaultEvents = (/* unused pure expression or super */ null && (["mousedown", "mouseup", "keydown", "keyup"]));
function useKeyModifier(modifier, options = {}) {
  const {
    events = defaultEvents,
    document = defaultDocument,
    initial = null
  } = options;
  const state = ref(initial);
  if (document) {
    events.forEach((listenerEvent) => {
      useEventListener(document, listenerEvent, (evt) => {
        state.value = evt.getModifierState(modifier);
      });
    });
  }
  return state;
}

function useLocalStorage(key, initialValue, options = {}) {
  const { window = defaultWindow } = options;
  return useStorage(key, initialValue, window == null ? void 0 : window.localStorage, options);
}

const DefaultMagicKeysAliasMap = {
  ctrl: "control",
  command: "meta",
  cmd: "meta",
  option: "alt",
  up: "arrowup",
  down: "arrowdown",
  left: "arrowleft",
  right: "arrowright"
};

function useMagicKeys(options = {}) {
  const {
    reactive: useReactive = false,
    target = defaultWindow,
    aliasMap = DefaultMagicKeysAliasMap,
    passive = true,
    onEventFired = noop
  } = options;
  const current = reactive(/* @__PURE__ */ new Set());
  const obj = { toJSON() {
    return {};
  }, current };
  const refs = useReactive ? reactive(obj) : obj;
  function updateRefs(e, value) {
    var _a, _b;
    const key = (_a = e.key) == null ? void 0 : _a.toLowerCase();
    const code = (_b = e.code) == null ? void 0 : _b.toLowerCase();
    const values = [code, key].filter(Boolean);
    if (code) {
      if (value)
        current.add(e.code);
      else
        current.delete(e.code);
    }
    for (const key2 of values) {
      if (key2 in refs) {
        if (useReactive)
          refs[key2] = value;
        else
          refs[key2].value = value;
      }
    }
  }
  if (target) {
    useEventListener(target, "keydown", (e) => {
      updateRefs(e, true);
      return onEventFired(e);
    }, { passive });
    useEventListener(target, "keyup", (e) => {
      updateRefs(e, false);
      return onEventFired(e);
    }, { passive });
  }
  const proxy = new Proxy(refs, {
    get(target2, prop, rec) {
      if (typeof prop !== "string")
        return Reflect.get(target2, prop, rec);
      prop = prop.toLowerCase();
      if (prop in aliasMap)
        prop = aliasMap[prop];
      if (!(prop in refs)) {
        if (/[+_-]/.test(prop)) {
          const keys = prop.split(/[+_-]/g).map((i) => i.trim());
          refs[prop] = computed(() => keys.every((key) => unref(proxy[key])));
        } else {
          refs[prop] = ref(false);
        }
      }
      const r = Reflect.get(target2, prop, rec);
      return useReactive ? unref(r) : r;
    }
  });
  return proxy;
}

var core_defProp$7 = Object.defineProperty;
var core_getOwnPropSymbols$8 = Object.getOwnPropertySymbols;
var core_hasOwnProp$8 = Object.prototype.hasOwnProperty;
var core_propIsEnum$8 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$7 = (obj, key, value) => key in obj ? core_defProp$7(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$7 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$8.call(b, prop))
      core_defNormalProp$7(a, prop, b[prop]);
  if (core_getOwnPropSymbols$8)
    for (var prop of core_getOwnPropSymbols$8(b)) {
      if (core_propIsEnum$8.call(b, prop))
        core_defNormalProp$7(a, prop, b[prop]);
    }
  return a;
};
function usingElRef(source, cb) {
  if (unref(source))
    cb(unref(source));
}
function timeRangeToArray(timeRanges) {
  let ranges = [];
  for (let i = 0; i < timeRanges.length; ++i)
    ranges = [...ranges, [timeRanges.start(i), timeRanges.end(i)]];
  return ranges;
}
function tracksToArray(tracks) {
  return Array.from(tracks).map(({ label, kind, language, mode, activeCues, cues, inBandMetadataTrackDispatchType }, id) => ({ id, label, kind, language, mode, activeCues, cues, inBandMetadataTrackDispatchType }));
}
const defaultOptions = {
  src: "",
  tracks: []
};
function useMediaControls(target, options = {}) {
  options = core_spreadValues$7(core_spreadValues$7({}, defaultOptions), options);
  const {
    document = defaultDocument
  } = options;
  const currentTime = ref(0);
  const duration = ref(0);
  const seeking = ref(false);
  const volume = ref(1);
  const waiting = ref(false);
  const ended = ref(false);
  const playing = ref(false);
  const rate = ref(1);
  const stalled = ref(false);
  const buffered = ref([]);
  const tracks = ref([]);
  const selectedTrack = ref(-1);
  const isPictureInPicture = ref(false);
  const muted = ref(false);
  const supportsPictureInPicture = document && "pictureInPictureEnabled" in document;
  const sourceErrorEvent = createEventHook();
  const disableTrack = (track) => {
    usingElRef(target, (el) => {
      if (track) {
        const id = isNumber(track) ? track : track.id;
        el.textTracks[id].mode = "disabled";
      } else {
        for (let i = 0; i < el.textTracks.length; ++i)
          el.textTracks[i].mode = "disabled";
      }
      selectedTrack.value = -1;
    });
  };
  const enableTrack = (track, disableTracks = true) => {
    usingElRef(target, (el) => {
      const id = isNumber(track) ? track : track.id;
      if (disableTracks)
        disableTrack();
      el.textTracks[id].mode = "showing";
      selectedTrack.value = id;
    });
  };
  const togglePictureInPicture = () => {
    return new Promise((resolve, reject) => {
      usingElRef(target, async (el) => {
        if (supportsPictureInPicture) {
          if (!isPictureInPicture.value) {
            el.requestPictureInPicture().then(resolve).catch(reject);
          } else {
            document.exitPictureInPicture().then(resolve).catch(reject);
          }
        }
      });
    });
  };
  watchEffect(() => {
    if (!document)
      return;
    const el = unref(target);
    if (!el)
      return;
    const src = unref(options.src);
    let sources = [];
    if (!src)
      return;
    if (isString(src))
      sources = [{ src }];
    else if (Array.isArray(src))
      sources = src;
    else if (isObject(src))
      sources = [src];
    el.querySelectorAll("source").forEach((e) => {
      e.removeEventListener("error", sourceErrorEvent.trigger);
      e.remove();
    });
    sources.forEach(({ src: src2, type }) => {
      const source = document.createElement("source");
      source.setAttribute("src", src2);
      source.setAttribute("type", type || "");
      source.addEventListener("error", sourceErrorEvent.trigger);
      el.appendChild(source);
    });
    el.load();
  });
  tryOnScopeDispose(() => {
    const el = unref(target);
    if (!el)
      return;
    el.querySelectorAll("source").forEach((e) => e.removeEventListener("error", sourceErrorEvent.trigger));
  });
  watch(volume, (vol) => {
    const el = unref(target);
    if (!el)
      return;
    el.volume = vol;
  });
  watch(muted, (mute) => {
    const el = unref(target);
    if (!el)
      return;
    el.muted = mute;
  });
  watch(rate, (rate2) => {
    const el = unref(target);
    if (!el)
      return;
    el.playbackRate = rate2;
  });
  watchEffect(() => {
    if (!document)
      return;
    const textTracks = unref(options.tracks);
    const el = unref(target);
    if (!textTracks || !textTracks.length || !el)
      return;
    el.querySelectorAll("track").forEach((e) => e.remove());
    textTracks.forEach(({ default: isDefault, kind, label, src, srcLang }, i) => {
      const track = document.createElement("track");
      track.default = isDefault || false;
      track.kind = kind;
      track.label = label;
      track.src = src;
      track.srclang = srcLang;
      if (track.default)
        selectedTrack.value = i;
      el.appendChild(track);
    });
  });
  const { ignoreUpdates: ignoreCurrentTimeUpdates } = ignorableWatch(currentTime, (time) => {
    const el = unref(target);
    if (!el)
      return;
    el.currentTime = time;
  });
  const { ignoreUpdates: ignorePlayingUpdates } = ignorableWatch(playing, (isPlaying) => {
    const el = unref(target);
    if (!el)
      return;
    isPlaying ? el.play() : el.pause();
  });
  useEventListener(target, "timeupdate", () => ignoreCurrentTimeUpdates(() => currentTime.value = unref(target).currentTime));
  useEventListener(target, "durationchange", () => duration.value = unref(target).duration);
  useEventListener(target, "progress", () => buffered.value = timeRangeToArray(unref(target).buffered));
  useEventListener(target, "seeking", () => seeking.value = true);
  useEventListener(target, "seeked", () => seeking.value = false);
  useEventListener(target, "waiting", () => waiting.value = true);
  useEventListener(target, "playing", () => waiting.value = false);
  useEventListener(target, "ratechange", () => rate.value = unref(target).playbackRate);
  useEventListener(target, "stalled", () => stalled.value = true);
  useEventListener(target, "ended", () => ended.value = true);
  useEventListener(target, "pause", () => ignorePlayingUpdates(() => playing.value = false));
  useEventListener(target, "play", () => ignorePlayingUpdates(() => playing.value = true));
  useEventListener(target, "enterpictureinpicture", () => isPictureInPicture.value = true);
  useEventListener(target, "leavepictureinpicture", () => isPictureInPicture.value = false);
  useEventListener(target, "volumechange", () => {
    const el = unref(target);
    if (!el)
      return;
    volume.value = el.volume;
    muted.value = el.muted;
  });
  const listeners = [];
  const stop = watch([target], () => {
    const el = unref(target);
    if (!el)
      return;
    stop();
    listeners[0] = useEventListener(el.textTracks, "addtrack", () => tracks.value = tracksToArray(el.textTracks));
    listeners[1] = useEventListener(el.textTracks, "removetrack", () => tracks.value = tracksToArray(el.textTracks));
    listeners[2] = useEventListener(el.textTracks, "change", () => tracks.value = tracksToArray(el.textTracks));
  });
  tryOnScopeDispose(() => listeners.forEach((listener) => listener()));
  return {
    currentTime,
    duration,
    waiting,
    seeking,
    ended,
    stalled,
    buffered,
    playing,
    rate,
    volume,
    muted,
    tracks,
    selectedTrack,
    enableTrack,
    disableTrack,
    supportsPictureInPicture,
    togglePictureInPicture,
    isPictureInPicture,
    onSourceError: sourceErrorEvent.on
  };
}

const getMapVue2Compat = () => {
  const data = reactive({});
  return {
    get: (key) => data[key],
    set: (key, value) => set(data, key, value),
    has: (key) => Object.prototype.hasOwnProperty.call(data, key),
    delete: (key) => del(data, key),
    clear: () => {
      Object.keys(data).forEach((key) => {
        del(data, key);
      });
    }
  };
};
function useMemoize(resolver, options) {
  const initCache = () => {
    if (options == null ? void 0 : options.cache)
      return reactive(options.cache);
    if (isVue2)
      return getMapVue2Compat();
    return reactive(/* @__PURE__ */ new Map());
  };
  const cache = initCache();
  const generateKey = (...args) => (options == null ? void 0 : options.getKey) ? options.getKey(...args) : JSON.stringify(args);
  const _loadData = (key, ...args) => {
    cache.set(key, resolver(...args));
    return cache.get(key);
  };
  const loadData = (...args) => _loadData(generateKey(...args), ...args);
  const deleteData = (...args) => {
    cache.delete(generateKey(...args));
  };
  const clearData = () => {
    cache.clear();
  };
  const memoized = (...args) => {
    const key = generateKey(...args);
    if (cache.has(key))
      return cache.get(key);
    return _loadData(key, ...args);
  };
  memoized.load = loadData;
  memoized.delete = deleteData;
  memoized.clear = clearData;
  memoized.generateKey = generateKey;
  memoized.cache = cache;
  return memoized;
}

function useMemory(options = {}) {
  const memory = ref();
  const isSupported = typeof performance !== "undefined" && "memory" in performance;
  if (isSupported) {
    const { interval = 1e3 } = options;
    useIntervalFn(() => {
      memory.value = performance.memory;
    }, interval, { immediate: options.immediate, immediateCallback: options.immediateCallback });
  }
  return { isSupported, memory };
}

function useMounted() {
  const isMounted = ref(false);
  onMounted(() => {
    isMounted.value = true;
  });
  return isMounted;
}

function useMouse(options = {}) {
  const {
    type = "page",
    touch = true,
    resetOnTouchEnds = false,
    initialValue = { x: 0, y: 0 },
    window = defaultWindow
  } = options;
  const x = ref(initialValue.x);
  const y = ref(initialValue.y);
  const sourceType = ref(null);
  const mouseHandler = (event) => {
    if (type === "page") {
      x.value = event.pageX;
      y.value = event.pageY;
    } else if (type === "client") {
      x.value = event.clientX;
      y.value = event.clientY;
    }
    sourceType.value = "mouse";
  };
  const reset = () => {
    x.value = initialValue.x;
    y.value = initialValue.y;
  };
  const touchHandler = (event) => {
    if (event.touches.length > 0) {
      const touch2 = event.touches[0];
      if (type === "page") {
        x.value = touch2.pageX;
        y.value = touch2.pageY;
      } else if (type === "client") {
        x.value = touch2.clientX;
        y.value = touch2.clientY;
      }
      sourceType.value = "touch";
    }
  };
  if (window) {
    useEventListener(window, "mousemove", mouseHandler, { passive: true });
    useEventListener(window, "dragover", mouseHandler, { passive: true });
    if (touch) {
      useEventListener(window, "touchstart", touchHandler, { passive: true });
      useEventListener(window, "touchmove", touchHandler, { passive: true });
      if (resetOnTouchEnds)
        useEventListener(window, "touchend", reset, { passive: true });
    }
  }
  return {
    x,
    y,
    sourceType
  };
}

function useMouseInElement(target, options = {}) {
  const {
    handleOutside = true,
    window = defaultWindow
  } = options;
  const { x, y, sourceType } = useMouse(options);
  const targetRef = ref(target != null ? target : window == null ? void 0 : window.document.body);
  const elementX = ref(0);
  const elementY = ref(0);
  const elementPositionX = ref(0);
  const elementPositionY = ref(0);
  const elementHeight = ref(0);
  const elementWidth = ref(0);
  const isOutside = ref(false);
  let stop = () => {
  };
  if (window) {
    stop = watch([targetRef, x, y], () => {
      const el = unrefElement(targetRef);
      if (!el)
        return;
      const {
        left,
        top,
        width,
        height
      } = el.getBoundingClientRect();
      elementPositionX.value = left + window.pageXOffset;
      elementPositionY.value = top + window.pageYOffset;
      elementHeight.value = height;
      elementWidth.value = width;
      const elX = x.value - elementPositionX.value;
      const elY = y.value - elementPositionY.value;
      isOutside.value = elX < 0 || elY < 0 || elX > elementWidth.value || elY > elementHeight.value;
      if (handleOutside || !isOutside.value) {
        elementX.value = elX;
        elementY.value = elY;
      }
    }, { immediate: true });
  }
  return {
    x,
    y,
    sourceType,
    elementX,
    elementY,
    elementPositionX,
    elementPositionY,
    elementHeight,
    elementWidth,
    isOutside,
    stop
  };
}

function useMousePressed(options = {}) {
  const {
    touch = true,
    drag = true,
    initialValue = false,
    window = defaultWindow
  } = options;
  const pressed = ref(initialValue);
  const sourceType = ref(null);
  if (!window) {
    return {
      pressed,
      sourceType
    };
  }
  const onPressed = (srcType) => () => {
    pressed.value = true;
    sourceType.value = srcType;
  };
  const onReleased = () => {
    pressed.value = false;
    sourceType.value = null;
  };
  const target = computed(() => unrefElement(options.target) || window);
  useEventListener(target, "mousedown", onPressed("mouse"), { passive: true });
  useEventListener(window, "mouseleave", onReleased, { passive: true });
  useEventListener(window, "mouseup", onReleased, { passive: true });
  if (drag) {
    useEventListener(target, "dragstart", onPressed("mouse"), { passive: true });
    useEventListener(window, "drop", onReleased, { passive: true });
    useEventListener(window, "dragend", onReleased, { passive: true });
  }
  if (touch) {
    useEventListener(target, "touchstart", onPressed("touch"), { passive: true });
    useEventListener(window, "touchend", onReleased, { passive: true });
    useEventListener(window, "touchcancel", onReleased, { passive: true });
  }
  return {
    pressed,
    sourceType
  };
}

var core_getOwnPropSymbols$7 = Object.getOwnPropertySymbols;
var core_hasOwnProp$7 = Object.prototype.hasOwnProperty;
var core_propIsEnum$7 = Object.prototype.propertyIsEnumerable;
var core_objRest$1 = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (core_hasOwnProp$7.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && core_getOwnPropSymbols$7)
    for (var prop of core_getOwnPropSymbols$7(source)) {
      if (exclude.indexOf(prop) < 0 && core_propIsEnum$7.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
function useMutationObserver(target, callback, options = {}) {
  const _a = options, { window = defaultWindow } = _a, mutationOptions = core_objRest$1(_a, ["window"]);
  let observer;
  const isSupported = window && "IntersectionObserver" in window;
  const cleanup = () => {
    if (observer) {
      observer.disconnect();
      observer = void 0;
    }
  };
  const stopWatch = watch(() => unrefElement(target), (el) => {
    cleanup();
    if (isSupported && window && el) {
      observer = new window.MutationObserver(callback);
      observer.observe(el, mutationOptions);
    }
  }, { immediate: true });
  const stop = () => {
    cleanup();
    stopWatch();
  };
  tryOnScopeDispose(stop);
  return {
    isSupported,
    stop
  };
}

const useNavigatorLanguage = (options = {}) => {
  const { window = defaultWindow } = options;
  const navigator = window == null ? void 0 : window.navigator;
  const isSupported = Boolean(navigator && "language" in navigator);
  const language = ref(navigator == null ? void 0 : navigator.language);
  useEventListener(window, "languagechange", () => {
    if (navigator)
      language.value = navigator.language;
  });
  return {
    isSupported,
    language
  };
};

function useNetwork(options = {}) {
  const { window = defaultWindow } = options;
  const navigator = window == null ? void 0 : window.navigator;
  const isSupported = Boolean(navigator && "connection" in navigator);
  const isOnline = ref(true);
  const saveData = ref(false);
  const offlineAt = ref(void 0);
  const downlink = ref(void 0);
  const downlinkMax = ref(void 0);
  const rtt = ref(void 0);
  const effectiveType = ref(void 0);
  const type = ref("unknown");
  const connection = isSupported && navigator.connection;
  function updateNetworkInformation() {
    if (!navigator)
      return;
    isOnline.value = navigator.onLine;
    offlineAt.value = isOnline.value ? void 0 : Date.now();
    if (connection) {
      downlink.value = connection.downlink;
      downlinkMax.value = connection.downlinkMax;
      effectiveType.value = connection.effectiveType;
      rtt.value = connection.rtt;
      saveData.value = connection.saveData;
      type.value = connection.type;
    }
  }
  if (window) {
    useEventListener(window, "offline", () => {
      isOnline.value = false;
      offlineAt.value = Date.now();
    });
    useEventListener(window, "online", () => {
      isOnline.value = true;
    });
  }
  if (connection)
    useEventListener(connection, "change", updateNetworkInformation, false);
  updateNetworkInformation();
  return {
    isSupported,
    isOnline,
    saveData,
    offlineAt,
    downlink,
    downlinkMax,
    effectiveType,
    rtt,
    type
  };
}

var core_defProp$6 = Object.defineProperty;
var core_getOwnPropSymbols$6 = Object.getOwnPropertySymbols;
var core_hasOwnProp$6 = Object.prototype.hasOwnProperty;
var core_propIsEnum$6 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$6 = (obj, key, value) => key in obj ? core_defProp$6(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$6 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$6.call(b, prop))
      core_defNormalProp$6(a, prop, b[prop]);
  if (core_getOwnPropSymbols$6)
    for (var prop of core_getOwnPropSymbols$6(b)) {
      if (core_propIsEnum$6.call(b, prop))
        core_defNormalProp$6(a, prop, b[prop]);
    }
  return a;
};
function useNow(options = {}) {
  const {
    controls: exposeControls = false,
    interval = "requestAnimationFrame"
  } = options;
  const now = ref(new Date());
  const update = () => now.value = new Date();
  const controls = interval === "requestAnimationFrame" ? useRafFn(update, { immediate: true }) : useIntervalFn(update, interval, { immediate: true });
  if (exposeControls) {
    return core_spreadValues$6({
      now
    }, controls);
  } else {
    return now;
  }
}

function useOffsetPagination(options) {
  const {
    total = Infinity,
    pageSize = 10,
    page = 1,
    onPageChange = noop$1,
    onPageSizeChange = noop$1,
    onPageCountChange = noop$1
  } = options;
  const currentPageSize = useClamp$1(pageSize, 1, Infinity);
  const pageCount = computed(() => Math.ceil(unref(total) / unref(currentPageSize)));
  const currentPage = useClamp$1(page, 1, pageCount);
  const isFirstPage = computed(() => currentPage.value === 1);
  const isLastPage = computed(() => currentPage.value === pageCount.value);
  if (isRef(page))
    biSyncRef(page, currentPage);
  if (isRef(pageSize))
    biSyncRef(pageSize, currentPageSize);
  function prev() {
    currentPage.value--;
  }
  function next() {
    currentPage.value++;
  }
  const returnValue = {
    currentPage,
    currentPageSize,
    pageCount,
    isFirstPage,
    isLastPage,
    prev,
    next
  };
  watch(currentPage, () => {
    onPageChange(reactive(returnValue));
  });
  watch(currentPageSize, () => {
    onPageSizeChange(reactive(returnValue));
  });
  watch(pageCount, () => {
    onPageCountChange(reactive(returnValue));
  });
  return returnValue;
}

function useOnline(options = {}) {
  const { isOnline } = useNetwork(options);
  return isOnline;
}

function usePageLeave(options = {}) {
  const { window = defaultWindow } = options;
  const isLeft = ref(false);
  const handler = (event) => {
    if (!window)
      return;
    event = event || window.event;
    const from = event.relatedTarget || event.toElement;
    isLeft.value = !from;
  };
  if (window) {
    useEventListener(window, "mouseout", handler, { passive: true });
    useEventListener(window.document, "mouseleave", handler, { passive: true });
    useEventListener(window.document, "mouseenter", handler, { passive: true });
  }
  return isLeft;
}

function useParallax(target, options = {}) {
  const {
    deviceOrientationTiltAdjust = (i) => i,
    deviceOrientationRollAdjust = (i) => i,
    mouseTiltAdjust = (i) => i,
    mouseRollAdjust = (i) => i,
    window = defaultWindow
  } = options;
  const orientation = reactive(useDeviceOrientation({ window }));
  const {
    elementX: x,
    elementY: y,
    elementWidth: width,
    elementHeight: height
  } = useMouseInElement(target, { handleOutside: false, window });
  const source = computed(() => {
    if (orientation.isSupported && (orientation.alpha != null && orientation.alpha !== 0 || orientation.gamma != null && orientation.gamma !== 0))
      return "deviceOrientation";
    return "mouse";
  });
  const roll = computed(() => {
    if (source.value === "deviceOrientation") {
      const value = -orientation.beta / 90;
      return deviceOrientationRollAdjust(value);
    } else {
      const value = -(y.value - height.value / 2) / height.value;
      return mouseRollAdjust(value);
    }
  });
  const tilt = computed(() => {
    if (source.value === "deviceOrientation") {
      const value = orientation.gamma / 90;
      return deviceOrientationTiltAdjust(value);
    } else {
      const value = (x.value - width.value / 2) / width.value;
      return mouseTiltAdjust(value);
    }
  });
  return { roll, tilt, source };
}

var core_defProp$5 = Object.defineProperty;
var core_defProps$2 = Object.defineProperties;
var core_getOwnPropDescs$2 = Object.getOwnPropertyDescriptors;
var core_getOwnPropSymbols$5 = Object.getOwnPropertySymbols;
var core_hasOwnProp$5 = Object.prototype.hasOwnProperty;
var core_propIsEnum$5 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$5 = (obj, key, value) => key in obj ? core_defProp$5(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$5 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$5.call(b, prop))
      core_defNormalProp$5(a, prop, b[prop]);
  if (core_getOwnPropSymbols$5)
    for (var prop of core_getOwnPropSymbols$5(b)) {
      if (core_propIsEnum$5.call(b, prop))
        core_defNormalProp$5(a, prop, b[prop]);
    }
  return a;
};
var core_spreadProps$2 = (a, b) => core_defProps$2(a, core_getOwnPropDescs$2(b));
const defaultState = {
  x: 0,
  y: 0,
  pointerId: 0,
  pressure: 0,
  tiltX: 0,
  tiltY: 0,
  width: 0,
  height: 0,
  twist: 0,
  pointerType: null
};
const keys = /* @__PURE__ */ (/* unused pure expression or super */ null && (Object.keys(defaultState)));
function usePointer(options = {}) {
  const {
    target = defaultWindow
  } = options;
  const isInside = ref(false);
  const state = ref(options.initialValue || {});
  Object.assign(state.value, defaultState, state.value);
  const handler = (event) => {
    isInside.value = true;
    if (options.pointerTypes && !options.pointerTypes.includes(event.pointerType))
      return;
    state.value = objectPick(event, keys, false);
  };
  if (target) {
    useEventListener(target, "pointerdown", handler, { passive: true });
    useEventListener(target, "pointermove", handler, { passive: true });
    useEventListener(target, "pointerleave", () => isInside.value = false, { passive: true });
  }
  return core_spreadProps$2(core_spreadValues$5({}, toRefs(state)), {
    isInside
  });
}

var SwipeDirection = /* @__PURE__ */ ((SwipeDirection2) => {
  SwipeDirection2["UP"] = "UP";
  SwipeDirection2["RIGHT"] = "RIGHT";
  SwipeDirection2["DOWN"] = "DOWN";
  SwipeDirection2["LEFT"] = "LEFT";
  SwipeDirection2["NONE"] = "NONE";
  return SwipeDirection2;
})(SwipeDirection || {});
function useSwipe(target, options = {}) {
  const {
    threshold = 50,
    onSwipe,
    onSwipeEnd,
    onSwipeStart,
    passive = true,
    window = defaultWindow
  } = options;
  const coordsStart = reactive({ x: 0, y: 0 });
  const coordsEnd = reactive({ x: 0, y: 0 });
  const diffX = computed(() => coordsStart.x - coordsEnd.x);
  const diffY = computed(() => coordsStart.y - coordsEnd.y);
  const { max, abs } = Math;
  const isThresholdExceeded = computed(() => max(abs(diffX.value), abs(diffY.value)) >= threshold);
  const isSwiping = ref(false);
  const direction = computed(() => {
    if (!isThresholdExceeded.value)
      return "NONE" /* NONE */;
    if (abs(diffX.value) > abs(diffY.value)) {
      return diffX.value > 0 ? "LEFT" /* LEFT */ : "RIGHT" /* RIGHT */;
    } else {
      return diffY.value > 0 ? "UP" /* UP */ : "DOWN" /* DOWN */;
    }
  });
  const getTouchEventCoords = (e) => [e.touches[0].clientX, e.touches[0].clientY];
  const updateCoordsStart = (x, y) => {
    coordsStart.x = x;
    coordsStart.y = y;
  };
  const updateCoordsEnd = (x, y) => {
    coordsEnd.x = x;
    coordsEnd.y = y;
  };
  let listenerOptions;
  const isPassiveEventSupported = checkPassiveEventSupport(window == null ? void 0 : window.document);
  if (!passive)
    listenerOptions = isPassiveEventSupported ? { passive: false, capture: true } : { capture: true };
  else
    listenerOptions = isPassiveEventSupported ? { passive: true } : { capture: false };
  const onTouchEnd = (e) => {
    if (isSwiping.value)
      onSwipeEnd == null ? void 0 : onSwipeEnd(e, direction.value);
    isSwiping.value = false;
  };
  const stops = [
    useEventListener(target, "touchstart", (e) => {
      if (listenerOptions.capture && !listenerOptions.passive)
        e.preventDefault();
      const [x, y] = getTouchEventCoords(e);
      updateCoordsStart(x, y);
      updateCoordsEnd(x, y);
      onSwipeStart == null ? void 0 : onSwipeStart(e);
    }, listenerOptions),
    useEventListener(target, "touchmove", (e) => {
      const [x, y] = getTouchEventCoords(e);
      updateCoordsEnd(x, y);
      if (!isSwiping.value && isThresholdExceeded.value)
        isSwiping.value = true;
      if (isSwiping.value)
        onSwipe == null ? void 0 : onSwipe(e);
    }, listenerOptions),
    useEventListener(target, "touchend", onTouchEnd, listenerOptions),
    useEventListener(target, "touchcancel", onTouchEnd, listenerOptions)
  ];
  const stop = () => stops.forEach((s) => s());
  return {
    isPassiveEventSupported,
    isSwiping,
    direction,
    coordsStart,
    coordsEnd,
    lengthX: diffX,
    lengthY: diffY,
    stop
  };
}
function checkPassiveEventSupport(document) {
  if (!document)
    return false;
  let supportsPassive = false;
  const optionsBlock = {
    get passive() {
      supportsPassive = true;
      return false;
    }
  };
  document.addEventListener("x", noop, optionsBlock);
  document.removeEventListener("x", noop);
  return supportsPassive;
}

function usePointerSwipe(target, options = {}) {
  const targetRef = ref(target);
  const {
    threshold = 50,
    onSwipe,
    onSwipeEnd,
    onSwipeStart
  } = options;
  const posStart = reactive({ x: 0, y: 0 });
  const updatePosStart = (x, y) => {
    posStart.x = x;
    posStart.y = y;
  };
  const posEnd = reactive({ x: 0, y: 0 });
  const updatePosEnd = (x, y) => {
    posEnd.x = x;
    posEnd.y = y;
  };
  const distanceX = computed(() => posStart.x - posEnd.x);
  const distanceY = computed(() => posStart.y - posEnd.y);
  const { max, abs } = Math;
  const isThresholdExceeded = computed(() => max(abs(distanceX.value), abs(distanceY.value)) >= threshold);
  const isSwiping = ref(false);
  const isPointerDown = ref(false);
  const direction = computed(() => {
    if (!isThresholdExceeded.value)
      return SwipeDirection.NONE;
    if (abs(distanceX.value) > abs(distanceY.value)) {
      return distanceX.value > 0 ? SwipeDirection.LEFT : SwipeDirection.RIGHT;
    } else {
      return distanceY.value > 0 ? SwipeDirection.UP : SwipeDirection.DOWN;
    }
  });
  const filterEvent = (e) => {
    if (options.pointerTypes)
      return options.pointerTypes.includes(e.pointerType);
    return true;
  };
  const stops = [
    useEventListener(target, "pointerdown", (e) => {
      var _a, _b;
      if (!filterEvent(e))
        return;
      isPointerDown.value = true;
      (_b = (_a = targetRef.value) == null ? void 0 : _a.style) == null ? void 0 : _b.setProperty("touch-action", "none");
      const eventTarget = e.target;
      eventTarget == null ? void 0 : eventTarget.setPointerCapture(e.pointerId);
      const { clientX: x, clientY: y } = e;
      updatePosStart(x, y);
      updatePosEnd(x, y);
      onSwipeStart == null ? void 0 : onSwipeStart(e);
    }),
    useEventListener(target, "pointermove", (e) => {
      if (!filterEvent(e))
        return;
      if (!isPointerDown.value)
        return;
      const { clientX: x, clientY: y } = e;
      updatePosEnd(x, y);
      if (!isSwiping.value && isThresholdExceeded.value)
        isSwiping.value = true;
      if (isSwiping.value)
        onSwipe == null ? void 0 : onSwipe(e);
    }),
    useEventListener(target, "pointerup", (e) => {
      var _a, _b;
      if (!filterEvent(e))
        return;
      if (isSwiping.value)
        onSwipeEnd == null ? void 0 : onSwipeEnd(e, direction.value);
      isPointerDown.value = false;
      isSwiping.value = false;
      (_b = (_a = targetRef.value) == null ? void 0 : _a.style) == null ? void 0 : _b.setProperty("touch-action", "initial");
    })
  ];
  const stop = () => stops.forEach((s) => s());
  return {
    isSwiping: readonly(isSwiping),
    direction: readonly(direction),
    posStart: readonly(posStart),
    posEnd: readonly(posEnd),
    distanceX,
    distanceY,
    stop
  };
}

function usePreferredColorScheme(options) {
  const isLight = useMediaQuery("(prefers-color-scheme: light)", options);
  const isDark = useMediaQuery("(prefers-color-scheme: dark)", options);
  return computed(() => {
    if (isDark.value)
      return "dark";
    if (isLight.value)
      return "light";
    return "no-preference";
  });
}

function usePreferredLanguages(options = {}) {
  const { window = defaultWindow } = options;
  if (!window)
    return ref(["en"]);
  const navigator = window.navigator;
  const value = ref(navigator.languages);
  useEventListener(window, "languagechange", () => {
    value.value = navigator.languages;
  });
  return value;
}

const topVarName = "--vueuse-safe-area-top";
const rightVarName = "--vueuse-safe-area-right";
const bottomVarName = "--vueuse-safe-area-bottom";
const leftVarName = "--vueuse-safe-area-left";
function useScreenSafeArea() {
  const top = ref("");
  const right = ref("");
  const bottom = ref("");
  const left = ref("");
  if (isClient) {
    const topCssVar = useCssVar(topVarName);
    const rightCssVar = useCssVar(rightVarName);
    const bottomCssVar = useCssVar(bottomVarName);
    const leftCssVar = useCssVar(leftVarName);
    topCssVar.value = "env(safe-area-inset-top, 0px)";
    rightCssVar.value = "env(safe-area-inset-right, 0px)";
    bottomCssVar.value = "env(safe-area-inset-bottom, 0px)";
    leftCssVar.value = "env(safe-area-inset-left, 0px)";
    update();
    useEventListener("resize", useDebounceFn(update));
  }
  function update() {
    top.value = core_getValue(topVarName);
    right.value = core_getValue(rightVarName);
    bottom.value = core_getValue(bottomVarName);
    left.value = core_getValue(leftVarName);
  }
  return {
    top,
    right,
    bottom,
    left,
    update
  };
}
function core_getValue(position) {
  return getComputedStyle(document.documentElement).getPropertyValue(position);
}

function useScriptTag(src, onLoaded = noop, options = {}) {
  const {
    immediate = true,
    manual = false,
    type = "text/javascript",
    async = true,
    crossOrigin,
    referrerPolicy,
    noModule,
    defer,
    document = defaultDocument,
    attrs = {}
  } = options;
  const scriptTag = ref(null);
  let _promise = null;
  const loadScript = (waitForScriptLoad) => new Promise((resolve, reject) => {
    const resolveWithElement = (el2) => {
      scriptTag.value = el2;
      resolve(el2);
      return el2;
    };
    if (!document) {
      resolve(false);
      return;
    }
    let shouldAppend = false;
    let el = document.querySelector(`script[src="${src}"]`);
    if (!el) {
      el = document.createElement("script");
      el.type = type;
      el.async = async;
      el.src = unref(src);
      if (defer)
        el.defer = defer;
      if (crossOrigin)
        el.crossOrigin = crossOrigin;
      if (noModule)
        el.noModule = noModule;
      if (referrerPolicy)
        el.referrerPolicy = referrerPolicy;
      for (const attr in attrs)
        el[attr] = attrs[attr];
      shouldAppend = true;
    } else if (el.hasAttribute("data-loaded")) {
      resolveWithElement(el);
    }
    el.addEventListener("error", (event) => reject(event));
    el.addEventListener("abort", (event) => reject(event));
    el.addEventListener("load", () => {
      el.setAttribute("data-loaded", "true");
      onLoaded(el);
      resolveWithElement(el);
    });
    if (shouldAppend)
      el = document.head.appendChild(el);
    if (!waitForScriptLoad)
      resolveWithElement(el);
  });
  const load = (waitForScriptLoad = true) => {
    if (!_promise)
      _promise = loadScript(waitForScriptLoad);
    return _promise;
  };
  const unload = () => {
    if (!document)
      return;
    _promise = null;
    if (scriptTag.value)
      scriptTag.value = null;
    const el = document.querySelector(`script[src="${src}"]`);
    if (el)
      document.head.removeChild(el);
  };
  if (immediate && !manual)
    tryOnMounted(load);
  if (!manual)
    tryOnUnmounted(unload);
  return { scriptTag, load, unload };
}

var core_a, _b;
function preventDefault(rawEvent) {
  const e = rawEvent || window.event;
  if (e.touches.length > 1)
    return true;
  if (e.preventDefault)
    e.preventDefault();
  return false;
}
const isIOS = shared_isClient && (window == null ? void 0 : window.navigator) && ((core_a = window == null ? void 0 : window.navigator) == null ? void 0 : core_a.platform) && /iP(ad|hone|od)/.test((_b = window == null ? void 0 : window.navigator) == null ? void 0 : _b.platform);
function useScrollLock(element, initialState = false) {
  const isLocked = ref(initialState);
  let touchMoveListener = null;
  let initialOverflow;
  const lock = () => {
    const ele = unref(element);
    if (!ele || isLocked.value)
      return;
    initialOverflow = ele.style.overflow;
    if (isIOS) {
      touchMoveListener = useEventListener(document, "touchmove", preventDefault, { passive: false });
    }
    ele.style.overflow = "hidden";
    isLocked.value = true;
  };
  const unlock = () => {
    const ele = unref(element);
    if (!ele || !isLocked.value)
      return;
    isIOS && (touchMoveListener == null ? void 0 : touchMoveListener());
    ele.style.overflow = initialOverflow;
    isLocked.value = false;
  };
  return computed({
    get() {
      return isLocked.value;
    },
    set(v) {
      if (v)
        lock();
      else
        unlock();
    }
  });
}

function useSessionStorage(key, initialValue, options = {}) {
  const { window = defaultWindow } = options;
  return useStorage(key, initialValue, window == null ? void 0 : window.sessionStorage, options);
}

var core_defProp$4 = Object.defineProperty;
var core_getOwnPropSymbols$4 = Object.getOwnPropertySymbols;
var core_hasOwnProp$4 = Object.prototype.hasOwnProperty;
var core_propIsEnum$4 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$4 = (obj, key, value) => key in obj ? core_defProp$4(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$4 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$4.call(b, prop))
      core_defNormalProp$4(a, prop, b[prop]);
  if (core_getOwnPropSymbols$4)
    for (var prop of core_getOwnPropSymbols$4(b)) {
      if (core_propIsEnum$4.call(b, prop))
        core_defNormalProp$4(a, prop, b[prop]);
    }
  return a;
};
function useShare(shareOptions = {}, options = {}) {
  const { navigator = defaultNavigator } = options;
  const _navigator = navigator;
  const isSupported = _navigator && "canShare" in _navigator;
  const share = async (overrideOptions = {}) => {
    if (isSupported) {
      const data = core_spreadValues$4(core_spreadValues$4({}, unref(shareOptions)), unref(overrideOptions));
      let granted = true;
      if (data.files && _navigator.canShare)
        granted = _navigator.canShare({ files: data.files });
      if (granted)
        return _navigator.share(data);
    }
  };
  return {
    isSupported,
    share
  };
}

function useSpeechRecognition(options = {}) {
  const {
    interimResults = true,
    continuous = true,
    window = defaultWindow
  } = options;
  const lang = ref(options.lang || "en-US");
  const isListening = ref(false);
  const isFinal = ref(false);
  const result = ref("");
  const error = shallowRef(void 0);
  const toggle = (value = !isListening.value) => {
    isListening.value = value;
  };
  const start = () => {
    isListening.value = true;
  };
  const stop = () => {
    isListening.value = false;
  };
  const SpeechRecognition = window && (window.SpeechRecognition || window.webkitSpeechRecognition);
  const isSupported = Boolean(SpeechRecognition);
  let recognition;
  if (isSupported) {
    recognition = new SpeechRecognition();
    recognition.continuous = continuous;
    recognition.interimResults = interimResults;
    recognition.lang = unref(lang);
    recognition.onstart = () => {
      isFinal.value = false;
    };
    watch(lang, (lang2) => {
      if (recognition && !isListening.value)
        recognition.lang = lang2;
    });
    recognition.onresult = (event) => {
      const transcript = Array.from(event.results).map((result2) => {
        isFinal.value = result2.isFinal;
        return result2[0];
      }).map((result2) => result2.transcript).join("");
      result.value = transcript;
      error.value = void 0;
    };
    recognition.onerror = (event) => {
      error.value = event;
    };
    recognition.onend = () => {
      isListening.value = false;
      recognition.lang = unref(lang);
    };
    watch(isListening, () => {
      if (isListening.value)
        recognition.start();
      else
        recognition.stop();
    });
  }
  tryOnScopeDispose(() => {
    isListening.value = false;
  });
  return {
    isSupported,
    isListening,
    isFinal,
    recognition,
    result,
    error,
    toggle,
    start,
    stop
  };
}

function useSpeechSynthesis(text, options = {}) {
  var _a, _b;
  const {
    pitch = 1,
    rate = 1,
    volume = 1,
    window = defaultWindow
  } = options;
  const synth = window && window.speechSynthesis;
  const isSupported = Boolean(synth);
  const isPlaying = ref(false);
  const status = ref("init");
  const voiceInfo = {
    lang: ((_a = options.voice) == null ? void 0 : _a.lang) || "default",
    name: ((_b = options.voice) == null ? void 0 : _b.name) || ""
  };
  const spokenText = ref(text || "");
  const lang = ref(options.lang || "en-US");
  const error = shallowRef(void 0);
  const toggle = (value = !isPlaying.value) => {
    isPlaying.value = value;
  };
  const bindEventsForUtterance = (utterance2) => {
    utterance2.lang = unref(lang);
    options.voice && (utterance2.voice = options.voice);
    utterance2.pitch = pitch;
    utterance2.rate = rate;
    utterance2.volume = volume;
    utterance2.onstart = () => {
      isPlaying.value = true;
      status.value = "play";
    };
    utterance2.onpause = () => {
      isPlaying.value = false;
      status.value = "pause";
    };
    utterance2.onresume = () => {
      isPlaying.value = true;
      status.value = "play";
    };
    utterance2.onend = () => {
      isPlaying.value = false;
      status.value = "end";
    };
    utterance2.onerror = (event) => {
      error.value = event;
    };
    utterance2.onend = () => {
      isPlaying.value = false;
      utterance2.lang = unref(lang);
    };
  };
  const utterance = computed(() => {
    isPlaying.value = false;
    status.value = "init";
    const newUtterance = new SpeechSynthesisUtterance(spokenText.value);
    bindEventsForUtterance(newUtterance);
    return newUtterance;
  });
  const speak = () => {
    synth.cancel();
    utterance && synth.speak(utterance.value);
  };
  if (isSupported) {
    bindEventsForUtterance(utterance.value);
    watch(lang, (lang2) => {
      if (utterance.value && !isPlaying.value)
        utterance.value.lang = lang2;
    });
    watch(isPlaying, () => {
      if (isPlaying.value)
        synth.resume();
      else
        synth.pause();
    });
  }
  tryOnScopeDispose(() => {
    isPlaying.value = false;
  });
  return {
    isSupported,
    isPlaying,
    status,
    voiceInfo,
    utterance,
    error,
    toggle,
    speak
  };
}

function useStorageAsync(key, initialValue, storage, options = {}) {
  var _a;
  const {
    flush = "pre",
    deep = true,
    listenToStorageChanges = true,
    writeDefaults = true,
    shallow,
    window = defaultWindow,
    eventFilter,
    onError = (e) => {
      console.error(e);
    }
  } = options;
  const rawInit = unref(initialValue);
  const type = guessSerializerType(rawInit);
  const data = (shallow ? shallowRef : ref)(initialValue);
  const serializer = (_a = options.serializer) != null ? _a : StorageSerializers[type];
  if (!storage) {
    try {
      storage = getSSRHandler("getDefaultStorage", () => {
        var _a2;
        return (_a2 = defaultWindow) == null ? void 0 : _a2.localStorage;
      })();
    } catch (e) {
      onError(e);
    }
  }
  async function read(event) {
    if (!storage || event && event.key !== key)
      return;
    try {
      const rawValue = event ? event.newValue : await storage.getItem(key);
      if (rawValue == null) {
        data.value = rawInit;
        if (writeDefaults && rawInit !== null)
          await storage.setItem(key, await serializer.write(rawInit));
      } else {
        data.value = await serializer.read(rawValue);
      }
    } catch (e) {
      onError(e);
    }
  }
  read();
  if (window && listenToStorageChanges)
    useEventListener(window, "storage", (e) => setTimeout(() => read(e), 0));
  if (storage) {
    watchWithFilter(data, async () => {
      try {
        if (data.value == null)
          await storage.removeItem(key);
        else
          await storage.setItem(key, await serializer.write(data.value));
      } catch (e) {
        onError(e);
      }
    }, {
      flush,
      deep,
      eventFilter
    });
  }
  return data;
}

let _id = 0;
function useStyleTag(css, options = {}) {
  const isLoaded = ref(false);
  const {
    document = defaultDocument,
    immediate = true,
    manual = false,
    id = `vueuse_styletag_${++_id}`
  } = options;
  const cssRef = ref(css);
  let stop = () => {
  };
  const load = () => {
    if (!document)
      return;
    const el = document.getElementById(id) || document.createElement("style");
    el.type = "text/css";
    el.id = id;
    if (options.media)
      el.media = options.media;
    document.head.appendChild(el);
    if (isLoaded.value)
      return;
    stop = watch(cssRef, (value) => {
      el.innerText = value;
    }, { immediate: true });
    isLoaded.value = true;
  };
  const unload = () => {
    if (!document || !isLoaded.value)
      return;
    stop();
    document.head.removeChild(document.getElementById(id));
    isLoaded.value = false;
  };
  if (immediate && !manual)
    load();
  if (!manual)
    tryOnScopeDispose(unload);
  return {
    id,
    css: cssRef,
    unload,
    load,
    isLoaded: readonly(isLoaded)
  };
}

function useTemplateRefsList() {
  const refs = ref([]);
  refs.value.set = (el) => {
    if (el)
      refs.value.push(el);
  };
  onBeforeUpdate(() => {
    refs.value.length = 0;
  });
  return refs;
}

var core_defProp$3 = Object.defineProperty;
var core_defProps$1 = Object.defineProperties;
var core_getOwnPropDescs$1 = Object.getOwnPropertyDescriptors;
var core_getOwnPropSymbols$3 = Object.getOwnPropertySymbols;
var core_hasOwnProp$3 = Object.prototype.hasOwnProperty;
var core_propIsEnum$3 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$3 = (obj, key, value) => key in obj ? core_defProp$3(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$3 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$3.call(b, prop))
      core_defNormalProp$3(a, prop, b[prop]);
  if (core_getOwnPropSymbols$3)
    for (var prop of core_getOwnPropSymbols$3(b)) {
      if (core_propIsEnum$3.call(b, prop))
        core_defNormalProp$3(a, prop, b[prop]);
    }
  return a;
};
var core_spreadProps$1 = (a, b) => core_defProps$1(a, core_getOwnPropDescs$1(b));
const initialRect = {
  top: 0,
  left: 0,
  bottom: 0,
  right: 0,
  height: 0,
  width: 0
};
const initialState = core_spreadValues$3({
  text: ""
}, initialRect);
function getRectFromSelection(selection) {
  if (!selection || selection.rangeCount < 1)
    return initialRect;
  const range = selection.getRangeAt(0);
  const { height, width, top, left, right, bottom } = range.getBoundingClientRect();
  return {
    height,
    width,
    top,
    left,
    right,
    bottom
  };
}
function useTextSelection(element) {
  var _a;
  const state = ref(initialState);
  if (!((_a = defaultWindow) == null ? void 0 : _a.getSelection))
    return state;
  const onMouseup = () => {
    var _a2;
    const text = (_a2 = window.getSelection()) == null ? void 0 : _a2.toString();
    if (text) {
      const rect = getRectFromSelection(window.getSelection());
      state.value = core_spreadProps$1(core_spreadValues$3(core_spreadValues$3({}, state.value), rect), {
        text
      });
    }
  };
  const onMousedown = () => {
    var _a2;
    state.value.text && (state.value = initialState);
    (_a2 = window.getSelection()) == null ? void 0 : _a2.removeAllRanges();
  };
  useEventListener(element != null ? element : document, "mouseup", onMouseup);
  useEventListener(document, "mousedown", onMousedown);
  return state;
}

var core_defProp$2 = Object.defineProperty;
var core_defProps = Object.defineProperties;
var core_getOwnPropDescs = Object.getOwnPropertyDescriptors;
var core_getOwnPropSymbols$2 = Object.getOwnPropertySymbols;
var core_hasOwnProp$2 = Object.prototype.hasOwnProperty;
var core_propIsEnum$2 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$2 = (obj, key, value) => key in obj ? core_defProp$2(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$2 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$2.call(b, prop))
      core_defNormalProp$2(a, prop, b[prop]);
  if (core_getOwnPropSymbols$2)
    for (var prop of core_getOwnPropSymbols$2(b)) {
      if (core_propIsEnum$2.call(b, prop))
        core_defNormalProp$2(a, prop, b[prop]);
    }
  return a;
};
var core_spreadProps = (a, b) => core_defProps(a, core_getOwnPropDescs(b));
function useThrottledRefHistory(source, options = {}) {
  const { throttle = 200, trailing = true } = options;
  const filter = throttleFilter(throttle, trailing);
  const history = useRefHistory(source, core_spreadProps(core_spreadValues$2({}, options), { eventFilter: filter }));
  return core_spreadValues$2({}, history);
}

var core_defProp$1 = Object.defineProperty;
var core_getOwnPropSymbols$1 = Object.getOwnPropertySymbols;
var core_hasOwnProp$1 = Object.prototype.hasOwnProperty;
var core_propIsEnum$1 = Object.prototype.propertyIsEnumerable;
var core_defNormalProp$1 = (obj, key, value) => key in obj ? core_defProp$1(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues$1 = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp$1.call(b, prop))
      core_defNormalProp$1(a, prop, b[prop]);
  if (core_getOwnPropSymbols$1)
    for (var prop of core_getOwnPropSymbols$1(b)) {
      if (core_propIsEnum$1.call(b, prop))
        core_defNormalProp$1(a, prop, b[prop]);
    }
  return a;
};
var core_objRest = (source, exclude) => {
  var target = {};
  for (var prop in source)
    if (core_hasOwnProp$1.call(source, prop) && exclude.indexOf(prop) < 0)
      target[prop] = source[prop];
  if (source != null && core_getOwnPropSymbols$1)
    for (var prop of core_getOwnPropSymbols$1(source)) {
      if (exclude.indexOf(prop) < 0 && core_propIsEnum$1.call(source, prop))
        target[prop] = source[prop];
    }
  return target;
};
const UNITS = [
  { max: 6e4, value: 1e3, name: "second" },
  { max: 276e4, value: 6e4, name: "minute" },
  { max: 72e6, value: 36e5, name: "hour" },
  { max: 5184e5, value: 864e5, name: "day" },
  { max: 24192e5, value: 6048e5, name: "week" },
  { max: 28512e6, value: 2592e6, name: "month" },
  { max: Infinity, value: 31536e6, name: "year" }
];
const DEFAULT_MESSAGES = {
  justNow: "just now",
  past: (n) => n.match(/\d/) ? `${n} ago` : n,
  future: (n) => n.match(/\d/) ? `in ${n}` : n,
  month: (n, past) => n === 1 ? past ? "last month" : "next month" : `${n} month${n > 1 ? "s" : ""}`,
  year: (n, past) => n === 1 ? past ? "last year" : "next year" : `${n} year${n > 1 ? "s" : ""}`,
  day: (n, past) => n === 1 ? past ? "yesterday" : "tomorrow" : `${n} day${n > 1 ? "s" : ""}`,
  week: (n, past) => n === 1 ? past ? "last week" : "next week" : `${n} week${n > 1 ? "s" : ""}`,
  hour: (n) => `${n} hour${n > 1 ? "s" : ""}`,
  minute: (n) => `${n} minute${n > 1 ? "s" : ""}`,
  second: (n) => `${n} second${n > 1 ? "s" : ""}`
};
const DEFAULT_FORMATTER = (date) => date.toISOString().slice(0, 10);
function useTimeAgo(time, options = {}) {
  const {
    controls: exposeControls = false,
    max,
    updateInterval = 3e4,
    messages = DEFAULT_MESSAGES,
    fullDateFormatter = DEFAULT_FORMATTER
  } = options;
  const { abs, round } = Math;
  const _a = useNow({ interval: updateInterval, controls: true }), { now } = _a, controls = core_objRest(_a, ["now"]);
  function getTimeago(from, now2) {
    var _a2;
    const diff = +now2 - +from;
    const absDiff = abs(diff);
    if (absDiff < 6e4)
      return messages.justNow;
    if (typeof max === "number" && absDiff > max)
      return fullDateFormatter(new Date(from));
    if (typeof max === "string") {
      const unitMax = (_a2 = UNITS.find((i) => i.name === max)) == null ? void 0 : _a2.max;
      if (unitMax && absDiff > unitMax)
        return fullDateFormatter(new Date(from));
    }
    for (const unit of UNITS) {
      if (absDiff < unit.max)
        return format(diff, unit);
    }
  }
  function applyFormat(name, val, isPast) {
    const formatter = messages[name];
    if (typeof formatter === "function")
      return formatter(val, isPast);
    return formatter.replace("{0}", val.toString());
  }
  function format(diff, unit) {
    const val = round(abs(diff) / unit.value);
    const past = diff > 0;
    const str = applyFormat(unit.name, val, past);
    return applyFormat(past ? "past" : "future", str, past);
  }
  const timeAgo = computed(() => getTimeago(new Date(unref(time)), unref(now.value)));
  if (exposeControls) {
    return core_spreadValues$1({
      timeAgo
    }, controls);
  } else {
    return timeAgo;
  }
}

var core_defProp = Object.defineProperty;
var core_getOwnPropSymbols = Object.getOwnPropertySymbols;
var core_hasOwnProp = Object.prototype.hasOwnProperty;
var core_propIsEnum = Object.prototype.propertyIsEnumerable;
var core_defNormalProp = (obj, key, value) => key in obj ? core_defProp(obj, key, { enumerable: true, configurable: true, writable: true, value }) : obj[key] = value;
var core_spreadValues = (a, b) => {
  for (var prop in b || (b = {}))
    if (core_hasOwnProp.call(b, prop))
      core_defNormalProp(a, prop, b[prop]);
  if (core_getOwnPropSymbols)
    for (var prop of core_getOwnPropSymbols(b)) {
      if (core_propIsEnum.call(b, prop))
        core_defNormalProp(a, prop, b[prop]);
    }
  return a;
};
function useTimestamp(options = {}) {
  const {
    controls: exposeControls = false,
    offset = 0,
    immediate = true,
    interval = "requestAnimationFrame"
  } = options;
  const ts = ref(timestamp() + offset);
  const update = () => ts.value = timestamp() + offset;
  const controls = interval === "requestAnimationFrame" ? useRafFn(update, { immediate }) : useIntervalFn(update, interval, { immediate });
  if (exposeControls) {
    return core_spreadValues({
      timestamp: ts
    }, controls);
  } else {
    return ts;
  }
}

function useTitle(newTitle = null, options = {}) {
  var _a, _b;
  const {
    document = defaultDocument,
    observe = false,
    titleTemplate = "%s"
  } = options;
  const title = ref((_a = newTitle != null ? newTitle : document == null ? void 0 : document.title) != null ? _a : null);
  watch(title, (t, o) => {
    if (isString(t) && t !== o && document)
      document.title = titleTemplate.replace("%s", t);
  }, { immediate: true });
  if (observe && document) {
    useMutationObserver((_b = document.head) == null ? void 0 : _b.querySelector("title"), () => {
      if (document && document.title !== title.value)
        title.value = titleTemplate.replace("%s", document.title);
    }, { childList: true });
  }
  return title;
}

const TransitionPresets = {
  linear: shared_identity,
  easeInSine: [0.12, 0, 0.39, 0],
  easeOutSine: [0.61, 1, 0.88, 1],
  easeInOutSine: [0.37, 0, 0.63, 1],
  easeInQuad: [0.11, 0, 0.5, 0],
  easeOutQuad: [0.5, 1, 0.89, 1],
  easeInOutQuad: [0.45, 0, 0.55, 1],
  easeInCubic: [0.32, 0, 0.67, 0],
  easeOutCubic: [0.33, 1, 0.68, 1],
  easeInOutCubic: [0.65, 0, 0.35, 1],
  easeInQuart: [0.5, 0, 0.75, 0],
  easeOutQuart: [0.25, 1, 0.5, 1],
  easeInOutQuart: [0.76, 0, 0.24, 1],
  easeInQuint: [0.64, 0, 0.78, 0],
  easeOutQuint: [0.22, 1, 0.36, 1],
  easeInOutQuint: [0.83, 0, 0.17, 1],
  easeInExpo: [0.7, 0, 0.84, 0],
  easeOutExpo: [0.16, 1, 0.3, 1],
  easeInOutExpo: [0.87, 0, 0.13, 1],
  easeInCirc: [0.55, 0, 1, 0.45],
  easeOutCirc: [0, 0.55, 0.45, 1],
  easeInOutCirc: [0.85, 0, 0.15, 1],
  easeInBack: [0.36, 0, 0.66, -0.56],
  easeOutBack: [0.34, 1.56, 0.64, 1],
  easeInOutBack: [0.68, -0.6, 0.32, 1.6]
};
function createEasingFunction([p0, p1, p2, p3]) {
  const a = (a1, a2) => 1 - 3 * a2 + 3 * a1;
  const b = (a1, a2) => 3 * a2 - 6 * a1;
  const c = (a1) => 3 * a1;
  const calcBezier = (t, a1, a2) => ((a(a1, a2) * t + b(a1, a2)) * t + c(a1)) * t;
  const getSlope = (t, a1, a2) => 3 * a(a1, a2) * t * t + 2 * b(a1, a2) * t + c(a1);
  const getTforX = (x) => {
    let aGuessT = x;
    for (let i = 0; i < 4; ++i) {
      const currentSlope = getSlope(aGuessT, p0, p2);
      if (currentSlope === 0)
        return aGuessT;
      const currentX = calcBezier(aGuessT, p0, p2) - x;
      aGuessT -= currentX / currentSlope;
    }
    return aGuessT;
  };
  return (x) => p0 === p1 && p2 === p3 ? x : calcBezier(getTforX(x), p1, p3);
}
function useTransition(source, options = {}) {
  const {
    delay = 0,
    disabled = false,
    duration = 1e3,
    onFinished = noop,
    onStarted = noop,
    transition = identity
  } = options;
  const currentTransition = computed(() => {
    const t = unref(transition);
    return isFunction(t) ? t : createEasingFunction(t);
  });
  const sourceValue = computed(() => {
    const s = unref(source);
    return isNumber(s) ? s : s.map(unref);
  });
  const sourceVector = computed(() => isNumber(sourceValue.value) ? [sourceValue.value] : sourceValue.value);
  const outputVector = ref(sourceVector.value.slice(0));
  let currentDuration;
  let diffVector;
  let endAt;
  let startAt;
  let startVector;
  const { resume, pause } = useRafFn(() => {
    const now = Date.now();
    const progress = clamp(1 - (endAt - now) / currentDuration, 0, 1);
    outputVector.value = startVector.map((val, i) => {
      var _a;
      return val + ((_a = diffVector[i]) != null ? _a : 0) * currentTransition.value(progress);
    });
    if (progress >= 1) {
      pause();
      onFinished();
    }
  }, { immediate: false });
  const start = () => {
    pause();
    currentDuration = unref(duration);
    diffVector = outputVector.value.map((n, i) => {
      var _a, _b;
      return ((_a = sourceVector.value[i]) != null ? _a : 0) - ((_b = outputVector.value[i]) != null ? _b : 0);
    });
    startVector = outputVector.value.slice(0);
    startAt = Date.now();
    endAt = startAt + currentDuration;
    resume();
    onStarted();
  };
  const timeout = useTimeoutFn(start, delay, { immediate: false });
  watch(sourceVector, () => {
    if (unref(disabled)) {
      outputVector.value = sourceVector.value.slice(0);
    } else {
      if (unref(delay) <= 0)
        start();
      else
        timeout.start();
    }
  }, { deep: true });
  return computed(() => {
    const targetVector = unref(disabled) ? sourceVector : outputVector;
    return isNumber(sourceValue.value) ? targetVector.value[0] : targetVector.value;
  });
}

function useUrlSearchParams(mode = "history", options = {}) {
  const {
    initialValue = {},
    removeNullishValues = true,
    removeFalsyValues = false,
    window = defaultWindow
  } = options;
  if (!window)
    return reactive(initialValue);
  const state = reactive(initialValue);
  function getRawParams() {
    if (mode === "history") {
      return window.location.search || "";
    } else if (mode === "hash") {
      const hash = window.location.hash || "";
      const index = hash.indexOf("?");
      return index > 0 ? hash.slice(index) : "";
    } else {
      return (window.location.hash || "").replace(/^#/, "");
    }
  }
  function constructQuery(params) {
    const stringified = params.toString();
    if (mode === "history")
      return `${stringified ? `?${stringified}` : ""}${location.hash || ""}`;
    if (mode === "hash-params")
      return `${location.search || ""}${stringified ? `#${stringified}` : ""}`;
    const hash = window.location.hash || "#";
    const index = hash.indexOf("?");
    if (index > 0)
      return `${hash.slice(0, index)}${stringified ? `?${stringified}` : ""}`;
    return `${hash}${stringified ? `?${stringified}` : ""}`;
  }
  function read() {
    return new URLSearchParams(getRawParams());
  }
  function updateState(params) {
    const unusedKeys = new Set(Object.keys(state));
    for (const key of params.keys()) {
      const paramsForKey = params.getAll(key);
      state[key] = paramsForKey.length > 1 ? paramsForKey : params.get(key) || "";
      unusedKeys.delete(key);
    }
    Array.from(unusedKeys).forEach((key) => delete state[key]);
  }
  const { pause, resume } = pausableWatch(state, () => {
    const params = new URLSearchParams("");
    Object.keys(state).forEach((key) => {
      const mapEntry = state[key];
      if (Array.isArray(mapEntry))
        mapEntry.forEach((value) => params.append(key, value));
      else if (removeNullishValues && mapEntry == null)
        params.delete(key);
      else if (removeFalsyValues && !mapEntry)
        params.delete(key);
      else
        params.set(key, mapEntry);
    });
    write(params);
  }, { deep: true });
  function write(params, shouldUpdate) {
    pause();
    if (shouldUpdate)
      updateState(params);
    window.history.replaceState({}, "", window.location.pathname + constructQuery(params));
    resume();
  }
  function onChanged() {
    write(read(), true);
  }
  useEventListener(window, "popstate", onChanged, false);
  if (mode !== "history")
    useEventListener(window, "hashchange", onChanged, false);
  updateState(read());
  return state;
}

function useUserMedia(options = {}) {
  var _a, _b, _c;
  const enabled = ref((_a = options.enabled) != null ? _a : false);
  const autoSwitch = ref((_b = options.autoSwitch) != null ? _b : true);
  const videoDeviceId = ref(options.videoDeviceId);
  const audioDeviceId = ref(options.audioDeviceId);
  const { navigator = defaultNavigator } = options;
  const isSupported = Boolean((_c = navigator == null ? void 0 : navigator.mediaDevices) == null ? void 0 : _c.getUserMedia);
  const stream = shallowRef();
  function getDeviceOptions(device) {
    if (device.value === "none" || device.value === false)
      return false;
    if (device.value == null)
      return true;
    return {
      deviceId: device.value
    };
  }
  async function _start() {
    if (!isSupported || stream.value)
      return;
    stream.value = await navigator.mediaDevices.getUserMedia({
      video: getDeviceOptions(videoDeviceId),
      audio: getDeviceOptions(audioDeviceId)
    });
    return stream.value;
  }
  async function _stop() {
    var _a2;
    (_a2 = stream.value) == null ? void 0 : _a2.getTracks().forEach((t) => t.stop());
    stream.value = void 0;
  }
  function stop() {
    _stop();
    enabled.value = false;
  }
  async function start() {
    await _start();
    if (stream.value)
      enabled.value = true;
    return stream.value;
  }
  async function restart() {
    _stop();
    return await start();
  }
  watch(enabled, (v) => {
    if (v)
      _start();
    else
      _stop();
  }, { immediate: true });
  watch([videoDeviceId, audioDeviceId], () => {
    if (autoSwitch.value && stream.value)
      restart();
  }, { immediate: true });
  return {
    isSupported,
    stream,
    start,
    stop,
    restart,
    videoDeviceId,
    audioDeviceId,
    enabled,
    autoSwitch
  };
}

function useVModel(props, key, emit, options = {}) {
  var _a, _b, _c;
  const {
    passive = false,
    eventName,
    deep = false
  } = options;
  const vm = getCurrentInstance();
  const _emit = emit || (vm == null ? void 0 : vm.emit) || ((_a = vm == null ? void 0 : vm.$emit) == null ? void 0 : _a.bind(vm));
  let event = eventName;
  if (!key) {
    if (isVue2) {
      const modelOptions = (_c = (_b = vm == null ? void 0 : vm.proxy) == null ? void 0 : _b.$options) == null ? void 0 : _c.model;
      key = (modelOptions == null ? void 0 : modelOptions.value) || "value";
      if (!eventName)
        event = (modelOptions == null ? void 0 : modelOptions.event) || "input";
    } else {
      key = "modelValue";
    }
  }
  event = eventName || event || `update:${key}`;
  if (passive) {
    const proxy = ref(props[key]);
    watch(() => props[key], (v) => proxy.value = v);
    watch(proxy, (v) => {
      if (v !== props[key] || deep)
        _emit(event, v);
    }, {
      deep
    });
    return proxy;
  } else {
    return computed({
      get() {
        return props[key];
      },
      set(value) {
        _emit(event, value);
      }
    });
  }
}

function useVModels(props, emit, options = {}) {
  const ret = {};
  for (const key in props)
    ret[key] = useVModel(props, key, emit, options);
  return ret;
}

function useVibrate(options) {
  const {
    pattern = [],
    interval = 0,
    navigator = defaultNavigator
  } = options || {};
  const isSupported = typeof navigator !== "undefined" && "vibrate" in navigator;
  const patternRef = ref(pattern);
  let intervalControls;
  const vibrate = (pattern2 = patternRef.value) => {
    if (isSupported)
      navigator.vibrate(pattern2);
  };
  const stop = () => {
    if (isSupported)
      navigator.vibrate(0);
    intervalControls == null ? void 0 : intervalControls.pause();
  };
  if (interval > 0) {
    intervalControls = useIntervalFn(vibrate, interval, {
      immediate: false,
      immediateCallback: false
    });
  }
  return {
    isSupported,
    pattern,
    intervalControls,
    vibrate,
    stop
  };
}

function useVirtualList(list, options) {
  const containerRef = ref();
  const size = useElementSize(containerRef);
  const currentList = ref([]);
  const source = shallowRef(list);
  const state = ref({ start: 0, end: 10 });
  const { itemHeight, overscan = 5 } = options;
  const getViewCapacity = (containerHeight) => {
    if (typeof itemHeight === "number")
      return Math.ceil(containerHeight / itemHeight);
    const { start = 0 } = state.value;
    let sum = 0;
    let capacity = 0;
    for (let i = start; i < source.value.length; i++) {
      const height = itemHeight(i);
      sum += height;
      if (sum >= containerHeight) {
        capacity = i;
        break;
      }
    }
    return capacity - start;
  };
  const getOffset = (scrollTop) => {
    if (typeof itemHeight === "number")
      return Math.floor(scrollTop / itemHeight) + 1;
    let sum = 0;
    let offset = 0;
    for (let i = 0; i < source.value.length; i++) {
      const height = itemHeight(i);
      sum += height;
      if (sum >= scrollTop) {
        offset = i;
        break;
      }
    }
    return offset + 1;
  };
  const calculateRange = () => {
    const element = containerRef.value;
    if (element) {
      const offset = getOffset(element.scrollTop);
      const viewCapacity = getViewCapacity(element.clientHeight);
      const from = offset - overscan;
      const to = offset + viewCapacity + overscan;
      state.value = {
        start: from < 0 ? 0 : from,
        end: to > source.value.length ? source.value.length : to
      };
      currentList.value = source.value.slice(state.value.start, state.value.end).map((ele, index) => ({
        data: ele,
        index: index + state.value.start
      }));
    }
  };
  watch([size.width, size.height, list], () => {
    calculateRange();
  });
  const totalHeight = computed(() => {
    if (typeof itemHeight === "number")
      return source.value.length * itemHeight;
    return source.value.reduce((sum, _, index) => sum + itemHeight(index), 0);
  });
  const getDistanceTop = (index) => {
    if (typeof itemHeight === "number") {
      const height2 = index * itemHeight;
      return height2;
    }
    const height = source.value.slice(0, index).reduce((sum, _, i) => sum + itemHeight(i), 0);
    return height;
  };
  const scrollTo = (index) => {
    if (containerRef.value) {
      containerRef.value.scrollTop = getDistanceTop(index);
      calculateRange();
    }
  };
  const offsetTop = computed(() => getDistanceTop(state.value.start));
  const wrapperProps = computed(() => {
    return {
      style: {
        width: "100%",
        height: `${totalHeight.value - offsetTop.value}px`,
        marginTop: `${offsetTop.value}px`
      }
    };
  });
  const containerStyle = { overflowY: "auto" };
  return {
    list: currentList,
    scrollTo,
    containerProps: {
      ref: containerRef,
      onScroll: () => {
        calculateRange();
      },
      style: containerStyle
    },
    wrapperProps
  };
}

const useWakeLock = (options = {}) => {
  const {
    navigator = defaultNavigator,
    document = defaultDocument
  } = options;
  let wakeLock;
  const isSupported = navigator && "wakeLock" in navigator;
  const isActive = ref(false);
  async function onVisibilityChange() {
    if (!isSupported || !wakeLock)
      return;
    if (document && document.visibilityState === "visible")
      wakeLock = await navigator.wakeLock.request("screen");
    isActive.value = !wakeLock.released;
  }
  if (document)
    useEventListener(document, "visibilitychange", onVisibilityChange, { passive: true });
  async function request(type) {
    if (!isSupported)
      return;
    wakeLock = await navigator.wakeLock.request(type);
    isActive.value = !wakeLock.released;
  }
  async function release() {
    if (!isSupported || !wakeLock)
      return;
    await wakeLock.release();
    isActive.value = !wakeLock.released;
    wakeLock = null;
  }
  return {
    isSupported,
    isActive,
    request,
    release
  };
};

const useWebNotification = (defaultOptions = {}) => {
  const {
    window = defaultWindow
  } = defaultOptions;
  const isSupported = !!window && "Notification" in window;
  const notification = ref(null);
  const requestPermission = async () => {
    if (!isSupported)
      return;
    if ("permission" in Notification && Notification.permission !== "denied")
      await Notification.requestPermission();
  };
  const onClick = createEventHook();
  const onShow = createEventHook();
  const onError = createEventHook();
  const onClose = createEventHook();
  const show = async (overrides) => {
    if (!isSupported)
      return;
    await requestPermission();
    const options = Object.assign({}, defaultOptions, overrides);
    notification.value = new Notification(options.title || "", options);
    notification.value.onclick = (event) => onClick.trigger(event);
    notification.value.onshow = (event) => onShow.trigger(event);
    notification.value.onerror = (event) => onError.trigger(event);
    notification.value.onclose = (event) => onClose.trigger(event);
    return notification.value;
  };
  const close = () => {
    if (notification.value)
      notification.value.close();
    notification.value = null;
  };
  tryOnMounted(async () => {
    if (isSupported)
      await requestPermission();
  });
  tryOnScopeDispose(close);
  if (isSupported && window) {
    const document = window.document;
    useEventListener(document, "visibilitychange", (e) => {
      e.preventDefault();
      if (document.visibilityState === "visible") {
        close();
      }
    });
  }
  return {
    isSupported,
    notification,
    show,
    close,
    onClick,
    onShow,
    onError,
    onClose
  };
};

function resolveNestedOptions(options) {
  if (options === true)
    return {};
  return options;
}
function useWebSocket(url, options = {}) {
  const {
    onConnected,
    onDisconnected,
    onError,
    onMessage,
    immediate = true,
    autoClose = true,
    protocols = []
  } = options;
  const data = ref(null);
  const status = ref("CONNECTING");
  const wsRef = ref();
  let heartbeatPause;
  let heartbeatResume;
  let explicitlyClosed = false;
  let retried = 0;
  let bufferedData = [];
  const close = (code = 1e3, reason) => {
    if (!wsRef.value)
      return;
    explicitlyClosed = true;
    heartbeatPause == null ? void 0 : heartbeatPause();
    wsRef.value.close(code, reason);
  };
  const _sendBuffer = () => {
    if (bufferedData.length && wsRef.value && status.value === "OPEN") {
      for (const buffer of bufferedData)
        wsRef.value.send(buffer);
      bufferedData = [];
    }
  };
  const send = (data2, useBuffer = true) => {
    if (!wsRef.value || status.value !== "OPEN") {
      if (useBuffer)
        bufferedData.push(data2);
      return false;
    }
    _sendBuffer();
    wsRef.value.send(data2);
    return true;
  };
  const _init = () => {
    const ws = new WebSocket(url, protocols);
    wsRef.value = ws;
    status.value = "CONNECTING";
    explicitlyClosed = false;
    ws.onopen = () => {
      status.value = "OPEN";
      onConnected == null ? void 0 : onConnected(ws);
      heartbeatResume == null ? void 0 : heartbeatResume();
      _sendBuffer();
    };
    ws.onclose = (ev) => {
      status.value = "CLOSED";
      wsRef.value = void 0;
      onDisconnected == null ? void 0 : onDisconnected(ws, ev);
      if (!explicitlyClosed && options.autoReconnect) {
        const {
          retries = -1,
          delay = 1e3,
          onFailed
        } = resolveNestedOptions(options.autoReconnect);
        retried += 1;
        if (retries < 0 || retried < retries)
          setTimeout(_init, delay);
        else
          onFailed == null ? void 0 : onFailed();
      }
    };
    ws.onerror = (e) => {
      onError == null ? void 0 : onError(ws, e);
    };
    ws.onmessage = (e) => {
      data.value = e.data;
      onMessage == null ? void 0 : onMessage(ws, e);
    };
  };
  if (options.heartbeat) {
    const {
      message = "ping",
      interval = 1e3
    } = resolveNestedOptions(options.heartbeat);
    const { pause, resume } = useIntervalFn(() => send(message, false), interval, { immediate: false });
    heartbeatPause = pause;
    heartbeatResume = resume;
  }
  if (immediate)
    _init();
  if (autoClose) {
    useEventListener(window, "beforeunload", () => close());
    tryOnScopeDispose(close);
  }
  const open = () => {
    close();
    retried = 0;
    _init();
  };
  return {
    data,
    status,
    close,
    send,
    open,
    ws: wsRef
  };
}

function useWebWorker(url, workerOptions, options = {}) {
  const {
    window = defaultWindow
  } = options;
  const data = ref(null);
  const worker = shallowRef();
  const post = function post2(val) {
    if (!worker.value)
      return;
    worker.value.postMessage(val);
  };
  const terminate = function terminate2() {
    if (!worker.value)
      return;
    worker.value.terminate();
  };
  if (window) {
    worker.value = new window.Worker(url, workerOptions);
    worker.value.onmessage = (e) => {
      data.value = e.data;
    };
    tryOnScopeDispose(() => {
      if (worker.value)
        worker.value.terminate();
    });
  }
  return {
    data,
    post,
    terminate,
    worker
  };
}

const jobRunner = (userFunc) => (e) => {
  const userFuncArgs = e.data[0];
  return Promise.resolve(userFunc.apply(void 0, userFuncArgs)).then((result) => {
    postMessage(["SUCCESS", result]);
  }).catch((error) => {
    postMessage(["ERROR", error]);
  });
};

const depsParser = (deps) => {
  if (deps.length === 0)
    return "";
  const depsString = deps.map((dep) => `'${dep}'`).toString();
  return `importScripts(${depsString})`;
};

const createWorkerBlobUrl = (fn, deps) => {
  const blobCode = `${depsParser(deps)}; onmessage=(${jobRunner})(${fn})`;
  const blob = new Blob([blobCode], { type: "text/javascript" });
  const url = URL.createObjectURL(blob);
  return url;
};

const useWebWorkerFn = (fn, options = {}) => {
  const {
    dependencies = [],
    timeout,
    window = defaultWindow
  } = options;
  const worker = ref();
  const workerStatus = ref("PENDING");
  const promise = ref({});
  const timeoutId = ref();
  const workerTerminate = (status = "PENDING") => {
    if (worker.value && worker.value._url && window) {
      worker.value.terminate();
      URL.revokeObjectURL(worker.value._url);
      promise.value = {};
      worker.value = void 0;
      window.clearTimeout(timeoutId.value);
      workerStatus.value = status;
    }
  };
  workerTerminate();
  tryOnScopeDispose(workerTerminate);
  const generateWorker = () => {
    const blobUrl = createWorkerBlobUrl(fn, dependencies);
    const newWorker = new Worker(blobUrl);
    newWorker._url = blobUrl;
    newWorker.onmessage = (e) => {
      const { resolve = () => {
      }, reject = () => {
      } } = promise.value;
      const [status, result] = e.data;
      switch (status) {
        case "SUCCESS":
          resolve(result);
          workerTerminate(status);
          break;
        default:
          reject(result);
          workerTerminate("ERROR");
          break;
      }
    };
    newWorker.onerror = (e) => {
      const { reject = () => {
      } } = promise.value;
      reject(e);
      workerTerminate("ERROR");
    };
    if (timeout) {
      timeoutId.value = setTimeout(() => workerTerminate("TIMEOUT_EXPIRED"), timeout);
    }
    return newWorker;
  };
  const callWorker = (...fnArgs) => new Promise((resolve, reject) => {
    promise.value = {
      resolve,
      reject
    };
    worker.value && worker.value.postMessage([[...fnArgs]]);
    workerStatus.value = "RUNNING";
  });
  const workerFn = (...fnArgs) => {
    if (workerStatus.value === "RUNNING") {
      console.error("[useWebWorkerFn] You can only run one instance of the worker at a time.");
      return Promise.reject();
    }
    worker.value = generateWorker();
    return callWorker(...fnArgs);
  };
  return {
    workerFn,
    workerStatus,
    workerTerminate
  };
};

function useWindowFocus({ window = defaultWindow } = {}) {
  if (!window)
    return ref(false);
  const focused = ref(window.document.hasFocus());
  useEventListener(window, "blur", () => {
    focused.value = false;
  });
  useEventListener(window, "focus", () => {
    focused.value = true;
  });
  return focused;
}

function useWindowScroll({ window = defaultWindow } = {}) {
  if (!window) {
    return {
      x: ref(0),
      y: ref(0)
    };
  }
  const x = ref(window.pageXOffset);
  const y = ref(window.pageYOffset);
  useEventListener("scroll", () => {
    x.value = window.pageXOffset;
    y.value = window.pageYOffset;
  }, {
    capture: false,
    passive: true
  });
  return { x, y };
}

function useWindowSize({ window = defaultWindow, initialWidth = Infinity, initialHeight = Infinity } = {}) {
  const width = ref(initialWidth);
  const height = ref(initialHeight);
  const update = () => {
    if (window) {
      width.value = window.innerWidth;
      height.value = window.innerHeight;
    }
  };
  update();
  tryOnMounted(update);
  useEventListener("resize", update, { passive: true });
  return { width, height };
}



// EXTERNAL MODULE: ./node_modules/lodash/isEqualWith.js
var lodash_isEqualWith = __webpack_require__("./node_modules/lodash/isEqualWith.js");
;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/error.mjs
class ElementPlusError extends Error {
  constructor(m) {
    super(m);
    this.name = "ElementPlusError";
  }
}
function throwError(scope, m) {
  throw new ElementPlusError(`[${scope}] ${m}`);
}
function error_debugWarn(scope, message) {
  if (false) {}
}


//# sourceMappingURL=error.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/util.mjs







const SCOPE = "Util";
function toObject(arr) {
  const res = {};
  for (let i = 0; i < arr.length; i++) {
    if (arr[i]) {
      extend(res, arr[i]);
    }
  }
  return res;
}
const getValueByPath = (obj, paths = "") => {
  let ret = obj;
  paths.split(".").map((path) => {
    ret = ret == null ? void 0 : ret[path];
  });
  return ret;
};
function getPropByPath(obj, path, strict) {
  let tempObj = obj;
  let key, value;
  if (obj && shared_esm_bundler_hasOwn(obj, path)) {
    key = path;
    value = tempObj == null ? void 0 : tempObj[path];
  } else {
    path = path.replace(/\[(\w+)\]/g, ".$1");
    path = path.replace(/^\./, "");
    const keyArr = path.split(".");
    let i = 0;
    for (i; i < keyArr.length - 1; i++) {
      if (!tempObj && !strict)
        break;
      const key2 = keyArr[i];
      if (key2 in tempObj) {
        tempObj = tempObj[key2];
      } else {
        if (strict) {
          throwError(SCOPE, "Please transfer a valid prop path to form item!");
        }
        break;
      }
    }
    key = keyArr[i];
    value = tempObj == null ? void 0 : tempObj[keyArr[i]];
  }
  return {
    o: tempObj,
    k: key,
    v: value
  };
}
const util_generateId = () => Math.floor(Math.random() * 1e4);
const escapeRegexpString = (value = "") => String(value).replace(/[|\\{}()[\]^$+*?.]/g, "\\$&");
const coerceTruthyValueToArray = (arr) => {
  if (!arr && arr !== 0) {
    return [];
  }
  return Array.isArray(arr) ? arr : [arr];
};
const isFirefox = function() {
  return shared_isClient && !!window.navigator.userAgent.match(/firefox/i);
};
const autoprefixer = function(style) {
  const rules = ["transform", "transition", "animation"];
  const prefixes = ["ms-", "webkit-"];
  rules.forEach((rule) => {
    const value = style[rule];
    if (rule && value) {
      prefixes.forEach((prefix) => {
        style[prefix + rule] = value;
      });
    }
  });
  return style;
};
const kebabCase = (/* unused pure expression or super */ null && (hyphenate));
const isBool = (val) => typeof val === "boolean";
const util_isNumber = (val) => typeof val === "number";
const isHTMLElement = (val) => toRawType(val).startsWith("HTML");
function rafThrottle(fn) {
  let locked = false;
  return function(...args) {
    if (locked)
      return;
    locked = true;
    window.requestAnimationFrame(() => {
      Reflect.apply(fn, this, args);
      locked = false;
    });
  };
}
const clearTimer = (timer) => {
  clearTimeout(timer.value);
  timer.value = null;
};
function getRandomInt(max) {
  return Math.floor(Math.random() * Math.floor(max));
}
function isUndefined(val) {
  return val === void 0;
}
function isEmpty(val) {
  if (!val && val !== 0 || isArray(val) && !val.length || isObject(val) && !Object.keys(val).length)
    return true;
  return false;
}
function arrayFlat(arr) {
  return arr.reduce((acm, item) => {
    const val = Array.isArray(item) ? arrayFlat(item) : item;
    return acm.concat(val);
  }, []);
}
function deduplicate(arr) {
  return Array.from(new Set(arr));
}
function addUnit(value) {
  if (shared_esm_bundler_isString(value)) {
    return value;
  } else if (util_isNumber(value)) {
    return `${value}px`;
  }
  error_debugWarn(SCOPE, "binding value must be a string or number");
  return "";
}
function isEqualWithFunction(obj, other) {
  return isEqualWith(obj, other, (objVal, otherVal) => {
    return isFunction(objVal) && isFunction(otherVal) ? `${objVal}` === `${otherVal}` : void 0;
  });
}
const refAttacher = (ref) => {
  return (val) => {
    ref.value = val;
  };
};
const util_merge = (a, b) => {
  var _a;
  const keys = [
    .../* @__PURE__ */ new Set([...Object.keys(a), ...Object.keys(b)])
  ];
  const obj = {};
  for (const key of keys) {
    obj[key] = (_a = b[key]) != null ? _a : a[key];
  }
  return obj;
};


//# sourceMappingURL=util.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/src/util.mjs
const BAR_MAP = {
  vertical: {
    offset: "offsetHeight",
    scroll: "scrollTop",
    scrollSize: "scrollHeight",
    size: "height",
    key: "vertical",
    axis: "Y",
    client: "clientY",
    direction: "top"
  },
  horizontal: {
    offset: "offsetWidth",
    scroll: "scrollLeft",
    scrollSize: "scrollWidth",
    size: "width",
    key: "horizontal",
    axis: "X",
    client: "clientX",
    direction: "left"
  }
};
const renderThumbStyle = ({ move, size, bar }) => ({
  [bar.size]: size,
  transform: `translate${bar.axis}(${move}%)`
});


//# sourceMappingURL=util.mjs.map

// EXTERNAL MODULE: ./node_modules/lodash/fromPairs.js
var fromPairs = __webpack_require__("./node_modules/lodash/fromPairs.js");
;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/props.mjs




const wrapperKey = Symbol();
const propKey = "__elPropsReservedKey";
function buildProp(option, key) {
  if (!shared_esm_bundler_isObject(option) || !!option[propKey])
    return option;
  const { values, required, default: defaultValue, type, validator } = option;
  const _validator = values || validator ? (val) => {
    let valid = false;
    let allowedValues = [];
    if (values) {
      allowedValues = [...values, defaultValue];
      valid || (valid = allowedValues.includes(val));
    }
    if (validator)
      valid || (valid = validator(val));
    if (!valid && allowedValues.length > 0) {
      const allowValuesText = [...new Set(allowedValues)].map((value) => JSON.stringify(value)).join(", ");
      runtime_core_esm_bundler_warn(`Invalid prop: validation failed${key ? ` for prop "${key}"` : ""}. Expected one of [${allowValuesText}], got value ${JSON.stringify(val)}.`);
    }
    return valid;
  } : void 0;
  return {
    type: typeof type === "object" && Object.getOwnPropertySymbols(type).includes(wrapperKey) ? type[wrapperKey] : type,
    required: !!required,
    default: defaultValue,
    validator: _validator,
    [propKey]: true
  };
}
const buildProps = (props) => fromPairs(Object.entries(props).map(([key, option]) => [
  key,
  buildProp(option, key)
]));
const definePropType = (val) => ({ [wrapperKey]: val });
const keyOf = (arr) => Object.keys(arr);
const mutable = (val) => val;
const componentSize = ["large", "default", "small"];


//# sourceMappingURL=props.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/src/thumb.mjs


const thumbProps = buildProps({
  vertical: Boolean,
  size: String,
  move: Number,
  ratio: {
    type: Number,
    required: true
  },
  always: Boolean
});


//# sourceMappingURL=thumb.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/tokens/scrollbar.mjs
const scrollbarContextKey = Symbol("scrollbarContextKey");


//# sourceMappingURL=scrollbar.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/src/thumb2.mjs











const COMPONENT_NAME = "Thumb";
const thumb2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: COMPONENT_NAME,
  props: thumbProps,
  setup(props) {
    const scrollbar = runtime_core_esm_bundler_inject(scrollbarContextKey);
    const ns = useNamespace("scrollbar");
    if (!scrollbar)
      throwError(COMPONENT_NAME, "can not inject scrollbar context");
    const instance = reactivity_esm_bundler_ref();
    const thumb = reactivity_esm_bundler_ref();
    const thumbState = reactivity_esm_bundler_ref({});
    const visible = reactivity_esm_bundler_ref(false);
    let cursorDown = false;
    let cursorLeave = false;
    let originalOnSelectStart = shared_isClient ? document.onselectstart : null;
    const bar = runtime_core_esm_bundler_computed(() => BAR_MAP[props.vertical ? "vertical" : "horizontal"]);
    const thumbStyle = runtime_core_esm_bundler_computed(() => renderThumbStyle({
      size: props.size,
      move: props.move,
      bar: bar.value
    }));
    const offsetRatio = runtime_core_esm_bundler_computed(() => instance.value[bar.value.offset] ** 2 / scrollbar.wrapElement[bar.value.scrollSize] / props.ratio / thumb.value[bar.value.offset]);
    const clickThumbHandler = (e) => {
      var _a;
      e.stopPropagation();
      if (e.ctrlKey || [1, 2].includes(e.button))
        return;
      (_a = window.getSelection()) == null ? void 0 : _a.removeAllRanges();
      startDrag(e);
      const el = e.currentTarget;
      if (!el)
        return;
      thumbState.value[bar.value.axis] = el[bar.value.offset] - (e[bar.value.client] - el.getBoundingClientRect()[bar.value.direction]);
    };
    const clickTrackHandler = (e) => {
      if (!thumb.value || !instance.value || !scrollbar.wrapElement)
        return;
      const offset = Math.abs(e.target.getBoundingClientRect()[bar.value.direction] - e[bar.value.client]);
      const thumbHalf = thumb.value[bar.value.offset] / 2;
      const thumbPositionPercentage = (offset - thumbHalf) * 100 * offsetRatio.value / instance.value[bar.value.offset];
      scrollbar.wrapElement[bar.value.scroll] = thumbPositionPercentage * scrollbar.wrapElement[bar.value.scrollSize] / 100;
    };
    const startDrag = (e) => {
      e.stopImmediatePropagation();
      cursorDown = true;
      document.addEventListener("mousemove", mouseMoveDocumentHandler);
      document.addEventListener("mouseup", mouseUpDocumentHandler);
      originalOnSelectStart = document.onselectstart;
      document.onselectstart = () => false;
    };
    const mouseMoveDocumentHandler = (e) => {
      if (!instance.value || !thumb.value)
        return;
      if (cursorDown === false)
        return;
      const prevPage = thumbState.value[bar.value.axis];
      if (!prevPage)
        return;
      const offset = (instance.value.getBoundingClientRect()[bar.value.direction] - e[bar.value.client]) * -1;
      const thumbClickPosition = thumb.value[bar.value.offset] - prevPage;
      const thumbPositionPercentage = (offset - thumbClickPosition) * 100 * offsetRatio.value / instance.value[bar.value.offset];
      scrollbar.wrapElement[bar.value.scroll] = thumbPositionPercentage * scrollbar.wrapElement[bar.value.scrollSize] / 100;
    };
    const mouseUpDocumentHandler = () => {
      cursorDown = false;
      thumbState.value[bar.value.axis] = 0;
      document.removeEventListener("mousemove", mouseMoveDocumentHandler);
      document.removeEventListener("mouseup", mouseUpDocumentHandler);
      restoreOnselectstart();
      if (cursorLeave)
        visible.value = false;
    };
    const mouseMoveScrollbarHandler = () => {
      cursorLeave = false;
      visible.value = !!props.size;
    };
    const mouseLeaveScrollbarHandler = () => {
      cursorLeave = true;
      visible.value = cursorDown;
    };
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      restoreOnselectstart();
      document.removeEventListener("mouseup", mouseUpDocumentHandler);
    });
    const restoreOnselectstart = () => {
      if (document.onselectstart !== originalOnSelectStart)
        document.onselectstart = originalOnSelectStart;
    };
    useEventListener(reactivity_esm_bundler_toRef(scrollbar, "scrollbarElement"), "mousemove", mouseMoveScrollbarHandler);
    useEventListener(reactivity_esm_bundler_toRef(scrollbar, "scrollbarElement"), "mouseleave", mouseLeaveScrollbarHandler);
    return {
      ns,
      instance,
      thumb,
      bar,
      thumbStyle,
      visible,
      clickTrackHandler,
      clickThumbHandler
    };
  }
});
function thumb2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(Transition, {
    name: _ctx.ns.b("fade")
  }, {
    default: withCtx(() => [
      withDirectives(createBaseVNode("div", {
        ref: "instance",
        class: normalizeClass([_ctx.ns.e("bar"), _ctx.ns.is(_ctx.bar.key)]),
        onMousedown: _cache[1] || (_cache[1] = (...args) => _ctx.clickTrackHandler && _ctx.clickTrackHandler(...args))
      }, [
        createBaseVNode("div", {
          ref: "thumb",
          class: normalizeClass(_ctx.ns.e("thumb")),
          style: normalizeStyle(_ctx.thumbStyle),
          onMousedown: _cache[0] || (_cache[0] = (...args) => _ctx.clickThumbHandler && _ctx.clickThumbHandler(...args))
        }, null, 38)
      ], 34), [
        [vShow, _ctx.always || _ctx.visible]
      ])
    ]),
    _: 1
  }, 8, ["name"]);
}
var Thumb = /* @__PURE__ */ _export_sfc(thumb2_sfc_main, [["render", thumb2_sfc_render]]);


//# sourceMappingURL=thumb2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/src/bar.mjs


const barProps = buildProps({
  always: {
    type: Boolean,
    default: true
  },
  width: {
    type: String,
    default: ""
  },
  height: {
    type: String,
    default: ""
  },
  ratioX: {
    type: Number,
    default: 1
  },
  ratioY: {
    type: Number,
    default: 1
  }
});


//# sourceMappingURL=bar.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/src/bar2.mjs





const bar2_sfc_main = runtime_core_esm_bundler_defineComponent({
  components: {
    Thumb: Thumb
  },
  props: barProps,
  setup(props) {
    const moveX = reactivity_esm_bundler_ref(0);
    const moveY = reactivity_esm_bundler_ref(0);
    const GAP = 4;
    const handleScroll = (wrap) => {
      if (wrap) {
        const offsetHeight = wrap.offsetHeight - GAP;
        const offsetWidth = wrap.offsetWidth - GAP;
        moveY.value = wrap.scrollTop * 100 / offsetHeight * props.ratioY;
        moveX.value = wrap.scrollLeft * 100 / offsetWidth * props.ratioX;
      }
    };
    return {
      handleScroll,
      moveX,
      moveY
    };
  }
});
function bar2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_thumb = resolveComponent("thumb");
  return runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, null, [
    runtime_core_esm_bundler_createVNode(_component_thumb, {
      move: _ctx.moveX,
      ratio: _ctx.ratioX,
      size: _ctx.width,
      always: _ctx.always
    }, null, 8, ["move", "ratio", "size", "always"]),
    runtime_core_esm_bundler_createVNode(_component_thumb, {
      move: _ctx.moveY,
      ratio: _ctx.ratioY,
      size: _ctx.height,
      vertical: "",
      always: _ctx.always
    }, null, 8, ["move", "ratio", "size", "always"])
  ], 64);
}
var Bar = /* @__PURE__ */ _export_sfc(bar2_sfc_main, [["render", bar2_sfc_render]]);


//# sourceMappingURL=bar2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/src/scrollbar.mjs



const scrollbarProps = buildProps({
  height: {
    type: [String, Number],
    default: ""
  },
  maxHeight: {
    type: [String, Number],
    default: ""
  },
  native: {
    type: Boolean,
    default: false
  },
  wrapStyle: {
    type: definePropType([String, Object, Array]),
    default: ""
  },
  wrapClass: {
    type: [String, Array],
    default: ""
  },
  viewClass: {
    type: [String, Array],
    default: ""
  },
  viewStyle: {
    type: [String, Array],
    default: ""
  },
  noresize: Boolean,
  tag: {
    type: String,
    default: "div"
  },
  always: {
    type: Boolean,
    default: false
  },
  minSize: {
    type: Number,
    default: 20
  }
});
const scrollbarEmits = {
  scroll: ({
    scrollTop,
    scrollLeft
  }) => util_isNumber(scrollTop) && util_isNumber(scrollLeft)
};


//# sourceMappingURL=scrollbar.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/src/scrollbar2.mjs












const scrollbar2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElScrollbar",
  components: {
    Bar: Bar
  },
  props: scrollbarProps,
  emits: scrollbarEmits,
  setup(props, { emit }) {
    const ns = useNamespace("scrollbar");
    let stopResizeObserver = void 0;
    let stopResizeListener = void 0;
    const scrollbar$ = reactivity_esm_bundler_ref();
    const wrap$ = reactivity_esm_bundler_ref();
    const resize$ = reactivity_esm_bundler_ref();
    const sizeWidth = reactivity_esm_bundler_ref("0");
    const sizeHeight = reactivity_esm_bundler_ref("0");
    const barRef = reactivity_esm_bundler_ref();
    const moveX = reactivity_esm_bundler_ref(0);
    const moveY = reactivity_esm_bundler_ref(0);
    const ratioY = reactivity_esm_bundler_ref(1);
    const ratioX = reactivity_esm_bundler_ref(1);
    const SCOPE = "ElScrollbar";
    const GAP = 4;
    const style = runtime_core_esm_bundler_computed(() => {
      const style2 = {};
      if (props.height)
        style2.height = addUnit(props.height);
      if (props.maxHeight)
        style2.maxHeight = addUnit(props.maxHeight);
      return [props.wrapStyle, style2];
    });
    const handleScroll = () => {
      var _a;
      if (wrap$.value) {
        (_a = barRef.value) == null ? void 0 : _a.handleScroll(wrap$.value);
        emit("scroll", {
          scrollTop: wrap$.value.scrollTop,
          scrollLeft: wrap$.value.scrollLeft
        });
      }
    };
    const setScrollTop = (value) => {
      if (!util_isNumber(value)) {
        error_debugWarn(SCOPE, "value must be a number");
        return;
      }
      wrap$.value.scrollTop = value;
    };
    const setScrollLeft = (value) => {
      if (!util_isNumber(value)) {
        error_debugWarn(SCOPE, "value must be a number");
        return;
      }
      wrap$.value.scrollLeft = value;
    };
    const update = () => {
      if (!wrap$.value)
        return;
      const offsetHeight = wrap$.value.offsetHeight - GAP;
      const offsetWidth = wrap$.value.offsetWidth - GAP;
      const originalHeight = offsetHeight ** 2 / wrap$.value.scrollHeight;
      const originalWidth = offsetWidth ** 2 / wrap$.value.scrollWidth;
      const height = Math.max(originalHeight, props.minSize);
      const width = Math.max(originalWidth, props.minSize);
      ratioY.value = originalHeight / (offsetHeight - originalHeight) / (height / (offsetHeight - height));
      ratioX.value = originalWidth / (offsetWidth - originalWidth) / (width / (offsetWidth - width));
      sizeHeight.value = height + GAP < offsetHeight ? `${height}px` : "";
      sizeWidth.value = width + GAP < offsetWidth ? `${width}px` : "";
    };
    runtime_core_esm_bundler_watch(() => props.noresize, (noresize) => {
      if (noresize) {
        stopResizeObserver == null ? void 0 : stopResizeObserver();
        stopResizeListener == null ? void 0 : stopResizeListener();
      } else {
        ;
        ({ stop: stopResizeObserver } = useResizeObserver(resize$, update));
        stopResizeListener = useEventListener("resize", update);
      }
    }, { immediate: true });
    runtime_core_esm_bundler_provide(scrollbarContextKey, reactivity_esm_bundler_reactive({
      scrollbarElement: scrollbar$,
      wrapElement: wrap$
    }));
    runtime_core_esm_bundler_onMounted(() => {
      if (!props.native)
        runtime_core_esm_bundler_nextTick(() => update());
    });
    return {
      ns,
      scrollbar$,
      wrap$,
      resize$,
      barRef,
      moveX,
      moveY,
      ratioX,
      ratioY,
      sizeWidth,
      sizeHeight,
      style,
      update,
      handleScroll,
      setScrollTop,
      setScrollLeft
    };
  }
});
function scrollbar2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_bar = resolveComponent("bar");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    ref: "scrollbar$",
    class: normalizeClass(_ctx.ns.b())
  }, [
    createBaseVNode("div", {
      ref: "wrap$",
      class: normalizeClass([
        _ctx.wrapClass,
        _ctx.ns.e("wrap"),
        { [_ctx.ns.em("wrap", "hidden-default")]: !_ctx.native }
      ]),
      style: normalizeStyle(_ctx.style),
      onScroll: _cache[0] || (_cache[0] = (...args) => _ctx.handleScroll && _ctx.handleScroll(...args))
    }, [
      (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.tag), {
        ref: "resize$",
        class: normalizeClass([_ctx.ns.e("view"), _ctx.viewClass]),
        style: normalizeStyle(_ctx.viewStyle)
      }, {
        default: withCtx(() => [
          renderSlot(_ctx.$slots, "default")
        ]),
        _: 3
      }, 8, ["class", "style"]))
    ], 38),
    !_ctx.native ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_bar, {
      key: 0,
      ref: "barRef",
      height: _ctx.sizeHeight,
      width: _ctx.sizeWidth,
      always: _ctx.always,
      "ratio-x": _ctx.ratioX,
      "ratio-y": _ctx.ratioY
    }, null, 8, ["height", "width", "always", "ratio-x", "ratio-y"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 2);
}
var Scrollbar = /* @__PURE__ */ _export_sfc(scrollbar2_sfc_main, [["render", scrollbar2_sfc_render]]);


//# sourceMappingURL=scrollbar2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/scrollbar/index.mjs






const ElScrollbar = withInstall(Scrollbar);


//# sourceMappingURL=index.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-menu.css
var el_menu = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-menu.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-menu.css

      
      
      
      
      
      
      
      
      

var el_menu_options = {};

el_menu_options.styleTagTransform = (styleTagTransform_default());
el_menu_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_menu_options.insert = insertBySelector_default().bind(null, "head");
    
el_menu_options.domAPI = (styleDomAPI_default());
el_menu_options.insertStyleElement = (insertStyleElement_default());

var el_menu_update = injectStylesIntoStyleTag_default()(el_menu/* default */.Z, el_menu_options);




       /* harmony default export */ const theme_chalk_el_menu = (el_menu/* default */.Z && el_menu/* default.locals */.Z.locals ? el_menu/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-tooltip.css
var el_tooltip = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-tooltip.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-tooltip.css

      
      
      
      
      
      
      
      
      

var el_tooltip_options = {};

el_tooltip_options.styleTagTransform = (styleTagTransform_default());
el_tooltip_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_tooltip_options.insert = insertBySelector_default().bind(null, "head");
    
el_tooltip_options.domAPI = (styleDomAPI_default());
el_tooltip_options.insertStyleElement = (insertStyleElement_default());

var el_tooltip_update = injectStylesIntoStyleTag_default()(el_tooltip/* default */.Z, el_tooltip_options);




       /* harmony default export */ const theme_chalk_el_tooltip = (el_tooltip/* default */.Z && el_tooltip/* default.locals */.Z.locals ? el_tooltip/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-popper.css
var el_popper = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-popper.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-popper.css

      
      
      
      
      
      
      
      
      

var el_popper_options = {};

el_popper_options.styleTagTransform = (styleTagTransform_default());
el_popper_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_popper_options.insert = insertBySelector_default().bind(null, "head");
    
el_popper_options.domAPI = (styleDomAPI_default());
el_popper_options.insertStyleElement = (insertStyleElement_default());

var el_popper_update = injectStylesIntoStyleTag_default()(el_popper/* default */.Z, el_popper_options);




       /* harmony default export */ const theme_chalk_el_popper = (el_popper/* default */.Z && el_popper/* default.locals */.Z.locals ? el_popper/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/style/css.mjs



//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/style/css.mjs



//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/sub-menu/style/css.mjs

//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu-item-group/style/css.mjs

//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu-item/style/css.mjs

//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-icon.css
var el_icon = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-icon.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-icon.css

      
      
      
      
      
      
      
      
      

var el_icon_options = {};

el_icon_options.styleTagTransform = (styleTagTransform_default());
el_icon_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_icon_options.insert = insertBySelector_default().bind(null, "head");
    
el_icon_options.domAPI = (styleDomAPI_default());
el_icon_options.insertStyleElement = (insertStyleElement_default());

var el_icon_update = injectStylesIntoStyleTag_default()(el_icon/* default */.Z, el_icon_options);




       /* harmony default export */ const theme_chalk_el_icon = (el_icon/* default */.Z && el_icon/* default.locals */.Z.locals ? el_icon/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/icon/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/icon/src/icon.mjs


const iconProps = buildProps({
  size: {
    type: definePropType([Number, String])
  },
  color: {
    type: String
  }
});


//# sourceMappingURL=icon.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/icon/src/icon2.mjs







const icon2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElIcon",
  inheritAttrs: false,
  props: iconProps,
  setup(props) {
    const ns = useNamespace("icon");
    const style = runtime_core_esm_bundler_computed(() => {
      if (!props.size && !props.color)
        return {};
      return {
        fontSize: isUndefined(props.size) ? void 0 : addUnit(props.size),
        "--color": props.color
      };
    });
    return {
      ns,
      style
    };
  }
});
function icon2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("i", mergeProps({
    class: _ctx.ns.b(),
    style: _ctx.style
  }, _ctx.$attrs), [
    renderSlot(_ctx.$slots, "default")
  ], 16);
}
var Icon = /* @__PURE__ */ _export_sfc(icon2_sfc_main, [["render", icon2_sfc_render]]);


//# sourceMappingURL=icon2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/icon/index.mjs




const ElIcon = withInstall(Icon);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/_virtual/plugin-vue_export-helper.mjs
var plugin_vue_export_helper_export_sfc = (sfc, props) => {
  const target = sfc.__vccOpts || sfc;
  for (const [key, val] of props) {
    target[key] = val;
  }
  return target;
};



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/more.mjs



const more_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "More"
});
const _hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const _hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M176 416a112 112 0 100 224 112 112 0 000-224m0 64a48 48 0 110 96 48 48 0 010-96zm336-64a112 112 0 110 224 112 112 0 010-224zm0 64a48 48 0 100 96 48 48 0 000-96zm336-64a112 112 0 110 224 112 112 0 010-224zm0 64a48 48 0 100 96 48 48 0 000-96z"
}, null, -1);
const _hoisted_3 = [
  _hoisted_2
];
function more_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", _hoisted_1, _hoisted_3);
}
var more = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(more_sfc_main, [["render", more_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/aria.mjs
const aria_EVENT_CODE = {
  tab: "Tab",
  enter: "Enter",
  space: "Space",
  left: "ArrowLeft",
  up: "ArrowUp",
  right: "ArrowRight",
  down: "ArrowDown",
  esc: "Escape",
  delete: "Delete",
  backspace: "Backspace",
  numpadEnter: "NumpadEnter",
  pageUp: "PageUp",
  pageDown: "PageDown",
  home: "Home",
  end: "End"
};
const FOCUSABLE_ELEMENT_SELECTORS = `a[href],button:not([disabled]),button:not([hidden]),:not([tabindex="-1"]),input:not([disabled]),input:not([type="hidden"]),select:not([disabled]),textarea:not([disabled])`;
const isVisible = (element) => {
  if (false)
    {}
  const computed = getComputedStyle(element);
  return computed.position === "fixed" ? false : element.offsetParent !== null;
};
const obtainAllFocusableElements = (element) => {
  return Array.from(element.querySelectorAll(FOCUSABLE_ELEMENT_SELECTORS)).filter((item) => isFocusable(item) && isVisible(item));
};
const isFocusable = (element) => {
  if (element.tabIndex > 0 || element.tabIndex === 0 && element.getAttribute("tabIndex") !== null) {
    return true;
  }
  if (element.disabled) {
    return false;
  }
  switch (element.nodeName) {
    case "A": {
      return !!element.href && element.rel !== "ignore";
    }
    case "INPUT": {
      return !(element.type === "hidden" || element.type === "file");
    }
    case "BUTTON":
    case "SELECT":
    case "TEXTAREA": {
      return true;
    }
    default: {
      return false;
    }
  }
};
const attemptFocus = (element) => {
  var _a;
  if (!isFocusable(element)) {
    return false;
  }
  Utils.IgnoreUtilFocusChanges = true;
  (_a = element.focus) == null ? void 0 : _a.call(element);
  Utils.IgnoreUtilFocusChanges = false;
  return document.activeElement === element;
};
const aria_triggerEvent = function(elm, name, ...opts) {
  let eventName;
  if (name.includes("mouse") || name.includes("click")) {
    eventName = "MouseEvents";
  } else if (name.includes("key")) {
    eventName = "KeyboardEvent";
  } else {
    eventName = "HTMLEvents";
  }
  const evt = document.createEvent(eventName);
  evt.initEvent(name, ...opts);
  elm.dispatchEvent(evt);
  return elm;
};
const isLeaf = (el) => !el.getAttribute("aria-owns");
const getSibling = (el, distance, elClass) => {
  const { parentNode } = el;
  if (!parentNode)
    return null;
  const siblings = parentNode.querySelectorAll(elClass);
  const index = Array.prototype.indexOf.call(siblings, el);
  return siblings[index + distance] || null;
};
const focusNode = (el) => {
  if (!el)
    return;
  el.focus();
  !isLeaf(el) && el.click();
};
const Utils = {
  IgnoreUtilFocusChanges: false,
  focusFirstDescendant(element) {
    for (let i = 0; i < element.childNodes.length; i++) {
      const child = element.childNodes[i];
      if (attemptFocus(child) || this.focusFirstDescendant(child)) {
        return true;
      }
    }
    return false;
  },
  focusLastDescendant(element) {
    for (let i = element.childNodes.length - 1; i >= 0; i--) {
      const child = element.childNodes[i];
      if (attemptFocus(child) || this.focusLastDescendant(child)) {
        return true;
      }
    }
    return false;
  }
};


//# sourceMappingURL=aria.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/menu/submenu.mjs


class SubMenu {
  constructor(parent, domNode) {
    this.parent = parent;
    this.domNode = domNode;
    this.subIndex = 0;
    this.subIndex = 0;
    this.init();
  }
  init() {
    this.subMenuItems = this.domNode.querySelectorAll("li");
    this.addListeners();
  }
  gotoSubIndex(idx) {
    if (idx === this.subMenuItems.length) {
      idx = 0;
    } else if (idx < 0) {
      idx = this.subMenuItems.length - 1;
    }
    ;
    this.subMenuItems[idx].focus();
    this.subIndex = idx;
  }
  addListeners() {
    const parentNode = this.parent.domNode;
    Array.prototype.forEach.call(this.subMenuItems, (el) => {
      el.addEventListener("keydown", (event) => {
        let prevDef = false;
        switch (event.code) {
          case aria_EVENT_CODE.down: {
            this.gotoSubIndex(this.subIndex + 1);
            prevDef = true;
            break;
          }
          case aria_EVENT_CODE.up: {
            this.gotoSubIndex(this.subIndex - 1);
            prevDef = true;
            break;
          }
          case aria_EVENT_CODE.tab: {
            aria_triggerEvent(parentNode, "mouseleave");
            break;
          }
          case aria_EVENT_CODE.enter:
          case aria_EVENT_CODE.space: {
            prevDef = true;
            event.currentTarget.click();
            break;
          }
        }
        if (prevDef) {
          event.preventDefault();
          event.stopPropagation();
        }
        return false;
      });
    });
  }
}


//# sourceMappingURL=submenu.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/menu/menu-item.mjs



class MenuItem {
  constructor(domNode) {
    this.domNode = domNode;
    this.submenu = null;
    this.submenu = null;
    this.init();
  }
  init() {
    this.domNode.setAttribute("tabindex", "0");
    const menuChild = this.domNode.querySelector(".el-menu");
    if (menuChild) {
      this.submenu = new SubMenu(this, menuChild);
    }
    this.addListeners();
  }
  addListeners() {
    this.domNode.addEventListener("keydown", (event) => {
      let prevDef = false;
      switch (event.code) {
        case aria_EVENT_CODE.down: {
          aria_triggerEvent(event.currentTarget, "mouseenter");
          this.submenu && this.submenu.gotoSubIndex(0);
          prevDef = true;
          break;
        }
        case aria_EVENT_CODE.up: {
          aria_triggerEvent(event.currentTarget, "mouseenter");
          this.submenu && this.submenu.gotoSubIndex(this.submenu.subMenuItems.length - 1);
          prevDef = true;
          break;
        }
        case aria_EVENT_CODE.tab: {
          aria_triggerEvent(event.currentTarget, "mouseleave");
          break;
        }
        case aria_EVENT_CODE.enter:
        case aria_EVENT_CODE.space: {
          prevDef = true;
          event.currentTarget.click();
          break;
        }
      }
      if (prevDef) {
        event.preventDefault();
      }
    });
  }
}


//# sourceMappingURL=menu-item.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/menu/menu-bar.mjs


class Menu {
  constructor(domNode) {
    this.domNode = domNode;
    this.init();
  }
  init() {
    const menuChildren = this.domNode.childNodes;
    Array.from(menuChildren, (child) => {
      if (child.nodeType === 1) {
        new MenuItem(child);
      }
    });
  }
}


//# sourceMappingURL=menu-bar.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/dom.mjs




const trimArr = function(s) {
  return (s || "").split(" ").filter((item) => !!item.trim());
};
const dom_on = function(element, event, handler, useCapture = false) {
  if (element && event && handler) {
    element == null ? void 0 : element.addEventListener(event, handler, useCapture);
  }
};
const off = function(element, event, handler, useCapture = false) {
  if (element && event && handler) {
    element == null ? void 0 : element.removeEventListener(event, handler, useCapture);
  }
};
const once = function(el, event, fn) {
  const listener = function(...args) {
    if (fn) {
      fn.apply(this, args);
    }
    off(el, event, listener);
  };
  dom_on(el, event, listener);
};
function hasClass(el, cls) {
  if (!el || !cls)
    return false;
  if (cls.indexOf(" ") !== -1)
    throw new Error("className should not contain space.");
  if (el.classList) {
    return el.classList.contains(cls);
  } else {
    const className = el.getAttribute("class") || "";
    return className.split(" ").includes(cls);
  }
}
function dom_addClass(el, cls) {
  if (!el)
    return;
  let className = el.getAttribute("class") || "";
  const curClass = trimArr(className);
  const classes = (cls || "").split(" ").filter((item) => !curClass.includes(item) && !!item.trim());
  if (el.classList) {
    el.classList.add(...classes);
  } else {
    className += ` ${classes.join(" ")}`;
    el.setAttribute("class", className);
  }
}
function removeClass(el, cls) {
  if (!el || !cls)
    return;
  const classes = trimArr(cls);
  let curClass = el.getAttribute("class") || "";
  if (el.classList) {
    el.classList.remove(...classes);
    return;
  }
  classes.forEach((item) => {
    curClass = curClass.replace(` ${item} `, " ");
  });
  const className = trimArr(curClass).join(" ");
  el.setAttribute("class", className);
}
const getStyle = function(element, styleName) {
  var _a;
  if (!shared_isClient)
    return "";
  if (!element || !styleName)
    return "";
  styleName = shared_esm_bundler_camelize(styleName);
  if (styleName === "float") {
    styleName = "cssFloat";
  }
  try {
    const style = element.style[styleName];
    if (style)
      return style;
    const computed = (_a = document.defaultView) == null ? void 0 : _a.getComputedStyle(element, "");
    return computed ? computed[styleName] : "";
  } catch (e) {
    return element.style[styleName];
  }
};
function dom_setStyle(element, styleName, value) {
  if (!element || !styleName)
    return;
  if (isObject(styleName)) {
    Object.keys(styleName).forEach((prop) => {
      dom_setStyle(element, prop, styleName[prop]);
    });
  } else {
    styleName = camelize(styleName);
    element.style[styleName] = value;
  }
}
function removeStyle(element, style) {
  if (!element || !style)
    return;
  if (isObject(style)) {
    Object.keys(style).forEach((prop) => {
      dom_setStyle(element, prop, "");
    });
  } else {
    dom_setStyle(element, style, "");
  }
}
const isScroll = (el, isVertical) => {
  if (!isClient)
    return null;
  const determinedDirection = isVertical === null || isVertical === void 0;
  const overflow = determinedDirection ? getStyle(el, "overflow") : isVertical ? getStyle(el, "overflow-y") : getStyle(el, "overflow-x");
  return overflow.match(/(scroll|auto|overlay)/);
};
const getScrollContainer = (el, isVertical) => {
  if (!isClient)
    return;
  let parent = el;
  while (parent) {
    if ([window, document, document.documentElement].includes(parent)) {
      return window;
    }
    if (isScroll(parent, isVertical)) {
      return parent;
    }
    parent = parent.parentNode;
  }
  return parent;
};
const isInContainer = (el, container) => {
  if (!isClient || !el || !container)
    return false;
  const elRect = el.getBoundingClientRect();
  let containerRect;
  if (container instanceof Element) {
    containerRect = container.getBoundingClientRect();
  } else {
    containerRect = {
      top: 0,
      right: window.innerWidth,
      bottom: window.innerHeight,
      left: 0
    };
  }
  return elRect.top < containerRect.bottom && elRect.bottom > containerRect.top && elRect.right > containerRect.left && elRect.left < containerRect.right;
};
const getOffsetTop = (el) => {
  let offset = 0;
  let parent = el;
  while (parent) {
    offset += parent.offsetTop;
    parent = parent.offsetParent;
  }
  return offset;
};
const getOffsetTopDistance = (el, containerEl) => {
  return Math.abs(getOffsetTop(el) - getOffsetTop(containerEl));
};
const dom_stop = (e) => e.stopPropagation();
const getClientXY = (event) => {
  let clientX;
  let clientY;
  if (event.type === "touchend") {
    clientY = event.changedTouches[0].clientY;
    clientX = event.changedTouches[0].clientX;
  } else if (event.type.startsWith("touch")) {
    clientY = event.touches[0].clientY;
    clientX = event.touches[0].clientX;
  } else {
    clientY = event.clientY;
    clientX = event.clientX;
  }
  return {
    clientX,
    clientY
  };
};
const composeEventHandlers = (theirsHandler, oursHandler, { checkForDefaultPrevented = true } = {}) => {
  const handleEvent = (event) => {
    const shouldPrevent = theirsHandler == null ? void 0 : theirsHandler(event);
    if (checkForDefaultPrevented === false || !shouldPrevent) {
      return oursHandler == null ? void 0 : oursHandler(event);
    }
  };
  return handleEvent;
};
const whenMouse = (handler) => {
  return (e) => e.pointerType === "mouse" ? handler(e) : void 0;
};
const composeStoppableHandler = (handler) => {
  return (e) => {
    if (!e.defaultPrevented) {
      handler(e);
    }
  };
};
const composeRefs = (...refs) => {
  return (el) => {
    refs.forEach((ref) => {
      ref.value = el;
    });
  };
};


//# sourceMappingURL=dom.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/menu-collapse-transition.mjs




const menu_collapse_transition_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElMenuCollapseTransition",
  setup() {
    const listeners = {
      onBeforeEnter: (el) => el.style.opacity = "0.2",
      onEnter(el, done) {
        dom_addClass(el, "el-opacity-transition");
        el.style.opacity = "1";
        done();
      },
      onAfterEnter(el) {
        removeClass(el, "el-opacity-transition");
        el.style.opacity = "";
      },
      onBeforeLeave(el) {
        if (!el.dataset) {
          ;
          el.dataset = {};
        }
        if (hasClass(el, "el-menu--collapse")) {
          removeClass(el, "el-menu--collapse");
          el.dataset.oldOverflow = el.style.overflow;
          el.dataset.scrollWidth = el.clientWidth.toString();
          dom_addClass(el, "el-menu--collapse");
        } else {
          dom_addClass(el, "el-menu--collapse");
          el.dataset.oldOverflow = el.style.overflow;
          el.dataset.scrollWidth = el.clientWidth.toString();
          removeClass(el, "el-menu--collapse");
        }
        el.style.width = `${el.scrollWidth}px`;
        el.style.overflow = "hidden";
      },
      onLeave(el) {
        dom_addClass(el, "horizontal-collapse-transition");
        el.style.width = `${el.dataset.scrollWidth}px`;
      }
    };
    return {
      listeners
    };
  }
});
function menu_collapse_transition_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(Transition, mergeProps({ mode: "out-in" }, _ctx.listeners), {
    default: withCtx(() => [
      renderSlot(_ctx.$slots, "default")
    ]),
    _: 3
  }, 16);
}
var ElMenuCollapseTransition = /* @__PURE__ */ _export_sfc(menu_collapse_transition_sfc_main, [["render", menu_collapse_transition_sfc_render]]);


//# sourceMappingURL=menu-collapse-transition.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/collapse-transition/src/collapse-transition.mjs



const collapse_transition_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElCollapseTransition",
  setup() {
    return {
      on: {
        beforeEnter(el) {
          if (!el.dataset)
            el.dataset = {};
          el.dataset.oldPaddingTop = el.style.paddingTop;
          el.dataset.oldPaddingBottom = el.style.paddingBottom;
          el.style.maxHeight = 0;
          el.style.paddingTop = 0;
          el.style.paddingBottom = 0;
        },
        enter(el) {
          el.dataset.oldOverflow = el.style.overflow;
          if (el.scrollHeight !== 0) {
            el.style.maxHeight = `${el.scrollHeight}px`;
            el.style.paddingTop = el.dataset.oldPaddingTop;
            el.style.paddingBottom = el.dataset.oldPaddingBottom;
          } else {
            el.style.maxHeight = 0;
            el.style.paddingTop = el.dataset.oldPaddingTop;
            el.style.paddingBottom = el.dataset.oldPaddingBottom;
          }
          el.style.overflow = "hidden";
        },
        afterEnter(el) {
          el.style.maxHeight = "";
          el.style.overflow = el.dataset.oldOverflow;
        },
        beforeLeave(el) {
          if (!el.dataset)
            el.dataset = {};
          el.dataset.oldPaddingTop = el.style.paddingTop;
          el.dataset.oldPaddingBottom = el.style.paddingBottom;
          el.dataset.oldOverflow = el.style.overflow;
          el.style.maxHeight = `${el.scrollHeight}px`;
          el.style.overflow = "hidden";
        },
        leave(el) {
          if (el.scrollHeight !== 0) {
            el.style.maxHeight = 0;
            el.style.paddingTop = 0;
            el.style.paddingBottom = 0;
          }
        },
        afterLeave(el) {
          el.style.maxHeight = "";
          el.style.overflow = el.dataset.oldOverflow;
          el.style.paddingTop = el.dataset.oldPaddingTop;
          el.style.paddingBottom = el.dataset.oldPaddingBottom;
        }
      }
    };
  }
});
function collapse_transition_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(Transition, mergeProps({ name: "el-collapse-transition" }, toHandlers(_ctx.on)), {
    default: withCtx(() => [
      renderSlot(_ctx.$slots, "default")
    ]),
    _: 3
  }, 16);
}
var CollapseTransition = /* @__PURE__ */ _export_sfc(collapse_transition_sfc_main, [["render", collapse_transition_sfc_render]]);


//# sourceMappingURL=collapse-transition.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/collapse-transition/index.mjs


CollapseTransition.install = (app) => {
  app.component(CollapseTransition.name, CollapseTransition);
};
const _CollapseTransition = CollapseTransition;
const ElCollapseTransition = (/* unused pure expression or super */ null && (_CollapseTransition));


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/src/tokens.mjs
const POPPER_INJECTION_KEY = Symbol("elPopper");
const POPPER_CONTENT_INJECTION_KEY = Symbol("elPopperContent");


//# sourceMappingURL=tokens.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/src/popper2.mjs




const popper2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElPopperProvider",
  inheritAttrs: false,
  setup() {
    const popperProvides = {
      triggerRef: reactivity_esm_bundler_ref(null),
      popperInstanceRef: reactivity_esm_bundler_ref(null),
      contentRef: reactivity_esm_bundler_ref(null)
    };
    runtime_core_esm_bundler_provide(POPPER_INJECTION_KEY, popperProvides);
    return popperProvides;
  }
});
function popper2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return renderSlot(_ctx.$slots, "default");
}
var Popper = /* @__PURE__ */ _export_sfc(popper2_sfc_main, [["render", popper2_sfc_render]]);


//# sourceMappingURL=popper2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/index.mjs









const ElPopper = withInstall(Popper);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-timeout/index.mjs


function use_timeout_useTimeout() {
  let timeoutHandle;
  const registerTimeout = (fn, delay) => {
    cancelTimeout();
    timeoutHandle = window.setTimeout(fn, delay);
  };
  const cancelTimeout = () => window.clearTimeout(timeoutHandle);
  shared_tryOnScopeDispose(() => cancelTimeout());
  return {
    registerTimeout,
    cancelTimeout
  };
}


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-delayed-toggle/index.mjs




const useDelayedToggleProps = buildProps({
  showAfter: {
    type: Number,
    default: 0
  },
  hideAfter: {
    type: Number,
    default: 200
  }
});
const useDelayedToggle = ({
  showAfter,
  hideAfter,
  open,
  close
}) => {
  const { registerTimeout } = use_timeout_useTimeout();
  const onOpen = () => {
    registerTimeout(() => {
      open();
    }, reactivity_esm_bundler_unref(showAfter));
  };
  const onClose = () => {
    registerTimeout(() => {
      close();
    }, reactivity_esm_bundler_unref(hideAfter));
  };
  return {
    onOpen,
    onClose
  };
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/enums.js
var enums_top = 'top';
var bottom = 'bottom';
var right = 'right';
var left = 'left';
var auto = 'auto';
var basePlacements = [enums_top, bottom, right, left];
var start = 'start';
var end = 'end';
var clippingParents = 'clippingParents';
var viewport = 'viewport';
var popper = 'popper';
var reference = 'reference';
var variationPlacements = /*#__PURE__*/basePlacements.reduce(function (acc, placement) {
  return acc.concat([placement + "-" + start, placement + "-" + end]);
}, []);
var enums_placements = /*#__PURE__*/[].concat(basePlacements, [auto]).reduce(function (acc, placement) {
  return acc.concat([placement, placement + "-" + start, placement + "-" + end]);
}, []); // modifiers that need to read the DOM

var beforeRead = 'beforeRead';
var read = 'read';
var afterRead = 'afterRead'; // pure-logic modifiers

var beforeMain = 'beforeMain';
var main = 'main';
var afterMain = 'afterMain'; // modifier with the purpose to write to the DOM (or write into a framework state)

var beforeWrite = 'beforeWrite';
var write = 'write';
var afterWrite = 'afterWrite';
var modifierPhases = [beforeRead, read, afterRead, beforeMain, main, afterMain, beforeWrite, write, afterWrite];
;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/src/popper.mjs



const effects = (/* unused pure expression or super */ null && (["light", "dark"]));
const triggers = (/* unused pure expression or super */ null && (["click", "contextmenu", "hover", "focus"]));
const Effect = {
  LIGHT: "light",
  DARK: "dark"
};
const usePopperArrowProps = buildProps({
  arrowOffset: {
    type: Number,
    default: 5
  }
});
const usePopperCoreConfigProps = buildProps({
  boundariesPadding: {
    type: Number,
    default: 0
  },
  fallbackPlacements: {
    type: definePropType(Array),
    default: () => []
  },
  gpuAcceleration: {
    type: Boolean,
    default: true
  },
  offset: {
    type: Number,
    default: 12
  },
  placement: {
    type: String,
    values: enums_placements,
    default: "bottom"
  },
  popperOptions: {
    type: definePropType(Object),
    default: () => ({})
  },
  strategy: {
    type: String,
    values: ["fixed", "absolute"],
    default: "absolute"
  }
});
const usePopperProps = buildProps({
  autoClose: {
    type: Number,
    default: 0
  },
  cutoff: {
    type: Boolean,
    default: false
  },
  disabled: {
    type: Boolean,
    default: false
  }
});
const usePopperContentProps = buildProps({
  ...usePopperCoreConfigProps,
  style: { type: definePropType([String, Array, Object]) },
  className: { type: definePropType([String, Array, Object]) },
  effect: {
    type: String,
    default: "dark"
  },
  enterable: {
    type: Boolean,
    default: true
  },
  pure: {
    type: Boolean
  },
  popperClass: {
    type: definePropType([String, Array, Object])
  },
  popperStyle: {
    type: definePropType([String, Array, Object])
  },
  referenceEl: {
    type: definePropType(Object)
  },
  stopPopperMouseEvent: {
    type: Boolean,
    default: true
  },
  zIndex: Number
});
const usePopperTriggerProps = buildProps({
  virtualRef: { type: definePropType(Object) },
  virtualTriggering: { type: Boolean }
});


//# sourceMappingURL=popper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-popper-container/index.mjs




let cachedContainer;
const POPPER_CONTAINER_ID = `el-popper-container-${util_generateId()}`;
const POPPER_CONTAINER_SELECTOR = `#${POPPER_CONTAINER_ID}`;
const usePopperContainer = () => {
  onBeforeMount(() => {
    if (!shared_isClient)
      return;
    if ( false || !cachedContainer) {
      const container = document.createElement("div");
      container.id = POPPER_CONTAINER_ID;
      document.body.appendChild(container);
      cachedContainer = container;
    }
  });
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/src/tooltip.mjs







const tooltip_triggers = (/* unused pure expression or super */ null && (["hover", "focus", "click", "contextmenu"]));
const useTooltipContentProps = {
  ...useDelayedToggleProps,
  ...usePopperContentProps,
  ...buildProps({
    appendTo: {
      type: definePropType([String, Object]),
      default: POPPER_CONTAINER_SELECTOR
    },
    content: {
      type: String,
      default: ""
    },
    rawContent: {
      type: Boolean,
      default: false
    },
    persistent: Boolean,
    ariaLabel: String,
    visible: {
      type: definePropType(Boolean),
      default: null
    },
    transition: {
      type: String,
      default: "el-fade-in-linear"
    },
    teleported: {
      type: Boolean,
      default: true
    },
    disabled: {
      type: Boolean
    }
  })
};
const useTooltipTriggerProps = {
  ...usePopperTriggerProps,
  disabled: Boolean,
  trigger: {
    type: [String, Array],
    default: "hover"
  }
};
const useTooltipProps = buildProps({
  openDelay: {
    type: Number
  },
  visibleArrow: {
    type: Boolean,
    default: void 0
  },
  hideAfter: {
    type: Number,
    default: 200
  },
  showArrow: {
    type: Boolean,
    default: true
  }
});


//# sourceMappingURL=tooltip.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/src/tokens.mjs
const TOOLTIP_INJECTION_KEY = Symbol("elTooltip");


//# sourceMappingURL=tokens.mjs.map

;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getWindow.js
function getWindow(node) {
  if (node == null) {
    return window;
  }

  if (node.toString() !== '[object Window]') {
    var ownerDocument = node.ownerDocument;
    return ownerDocument ? ownerDocument.defaultView || window : window;
  }

  return node;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/instanceOf.js


function isElement(node) {
  var OwnElement = getWindow(node).Element;
  return node instanceof OwnElement || node instanceof Element;
}

function instanceOf_isHTMLElement(node) {
  var OwnElement = getWindow(node).HTMLElement;
  return node instanceof OwnElement || node instanceof HTMLElement;
}

function isShadowRoot(node) {
  // IE 11 has no ShadowRoot
  if (typeof ShadowRoot === 'undefined') {
    return false;
  }

  var OwnElement = getWindow(node).ShadowRoot;
  return node instanceof OwnElement || node instanceof ShadowRoot;
}


;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/math.js
var math_max = Math.max;
var math_min = Math.min;
var round = Math.round;
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getBoundingClientRect.js


function getBoundingClientRect(element, includeScale) {
  if (includeScale === void 0) {
    includeScale = false;
  }

  var rect = element.getBoundingClientRect();
  var scaleX = 1;
  var scaleY = 1;

  if (instanceOf_isHTMLElement(element) && includeScale) {
    var offsetHeight = element.offsetHeight;
    var offsetWidth = element.offsetWidth; // Do not attempt to divide by 0, otherwise we get `Infinity` as scale
    // Fallback to 1 in case both values are `0`

    if (offsetWidth > 0) {
      scaleX = round(rect.width) / offsetWidth || 1;
    }

    if (offsetHeight > 0) {
      scaleY = round(rect.height) / offsetHeight || 1;
    }
  }

  return {
    width: rect.width / scaleX,
    height: rect.height / scaleY,
    top: rect.top / scaleY,
    right: rect.right / scaleX,
    bottom: rect.bottom / scaleY,
    left: rect.left / scaleX,
    x: rect.left / scaleX,
    y: rect.top / scaleY
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getWindowScroll.js

function getWindowScroll(node) {
  var win = getWindow(node);
  var scrollLeft = win.pageXOffset;
  var scrollTop = win.pageYOffset;
  return {
    scrollLeft: scrollLeft,
    scrollTop: scrollTop
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getHTMLElementScroll.js
function getHTMLElementScroll(element) {
  return {
    scrollLeft: element.scrollLeft,
    scrollTop: element.scrollTop
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getNodeScroll.js




function getNodeScroll(node) {
  if (node === getWindow(node) || !instanceOf_isHTMLElement(node)) {
    return getWindowScroll(node);
  } else {
    return getHTMLElementScroll(node);
  }
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getNodeName.js
function getNodeName(element) {
  return element ? (element.nodeName || '').toLowerCase() : null;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getDocumentElement.js

function getDocumentElement(element) {
  // $FlowFixMe[incompatible-return]: assume body is always available
  return ((isElement(element) ? element.ownerDocument : // $FlowFixMe[prop-missing]
  element.document) || window.document).documentElement;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getWindowScrollBarX.js



function getWindowScrollBarX(element) {
  // If <html> has a CSS width greater than the viewport, then this will be
  // incorrect for RTL.
  // Popper 1 is broken in this case and never had a bug report so let's assume
  // it's not an issue. I don't think anyone ever specifies width on <html>
  // anyway.
  // Browsers where the left scrollbar doesn't cause an issue report `0` for
  // this (e.g. Edge 2019, IE11, Safari)
  return getBoundingClientRect(getDocumentElement(element)).left + getWindowScroll(element).scrollLeft;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getComputedStyle.js

function getComputedStyle_getComputedStyle(element) {
  return getWindow(element).getComputedStyle(element);
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/isScrollParent.js

function isScrollParent(element) {
  // Firefox wants us to check `-x` and `-y` variations as well
  var _getComputedStyle = getComputedStyle_getComputedStyle(element),
      overflow = _getComputedStyle.overflow,
      overflowX = _getComputedStyle.overflowX,
      overflowY = _getComputedStyle.overflowY;

  return /auto|scroll|overlay|hidden/.test(overflow + overflowY + overflowX);
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getCompositeRect.js









function isElementScaled(element) {
  var rect = element.getBoundingClientRect();
  var scaleX = round(rect.width) / element.offsetWidth || 1;
  var scaleY = round(rect.height) / element.offsetHeight || 1;
  return scaleX !== 1 || scaleY !== 1;
} // Returns the composite rect of an element relative to its offsetParent.
// Composite means it takes into account transforms as well as layout.


function getCompositeRect(elementOrVirtualElement, offsetParent, isFixed) {
  if (isFixed === void 0) {
    isFixed = false;
  }

  var isOffsetParentAnElement = instanceOf_isHTMLElement(offsetParent);
  var offsetParentIsScaled = instanceOf_isHTMLElement(offsetParent) && isElementScaled(offsetParent);
  var documentElement = getDocumentElement(offsetParent);
  var rect = getBoundingClientRect(elementOrVirtualElement, offsetParentIsScaled);
  var scroll = {
    scrollLeft: 0,
    scrollTop: 0
  };
  var offsets = {
    x: 0,
    y: 0
  };

  if (isOffsetParentAnElement || !isOffsetParentAnElement && !isFixed) {
    if (getNodeName(offsetParent) !== 'body' || // https://github.com/popperjs/popper-core/issues/1078
    isScrollParent(documentElement)) {
      scroll = getNodeScroll(offsetParent);
    }

    if (instanceOf_isHTMLElement(offsetParent)) {
      offsets = getBoundingClientRect(offsetParent, true);
      offsets.x += offsetParent.clientLeft;
      offsets.y += offsetParent.clientTop;
    } else if (documentElement) {
      offsets.x = getWindowScrollBarX(documentElement);
    }
  }

  return {
    x: rect.left + scroll.scrollLeft - offsets.x,
    y: rect.top + scroll.scrollTop - offsets.y,
    width: rect.width,
    height: rect.height
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getLayoutRect.js
 // Returns the layout rect of an element relative to its offsetParent. Layout
// means it doesn't take into account transforms.

function getLayoutRect(element) {
  var clientRect = getBoundingClientRect(element); // Use the clientRect sizes if it's not been transformed.
  // Fixes https://github.com/popperjs/popper-core/issues/1223

  var width = element.offsetWidth;
  var height = element.offsetHeight;

  if (Math.abs(clientRect.width - width) <= 1) {
    width = clientRect.width;
  }

  if (Math.abs(clientRect.height - height) <= 1) {
    height = clientRect.height;
  }

  return {
    x: element.offsetLeft,
    y: element.offsetTop,
    width: width,
    height: height
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getParentNode.js



function getParentNode(element) {
  if (getNodeName(element) === 'html') {
    return element;
  }

  return (// this is a quicker (but less type safe) way to save quite some bytes from the bundle
    // $FlowFixMe[incompatible-return]
    // $FlowFixMe[prop-missing]
    element.assignedSlot || // step into the shadow DOM of the parent of a slotted node
    element.parentNode || ( // DOM Element detected
    isShadowRoot(element) ? element.host : null) || // ShadowRoot detected
    // $FlowFixMe[incompatible-call]: HTMLElement is a Node
    getDocumentElement(element) // fallback

  );
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getScrollParent.js




function getScrollParent(node) {
  if (['html', 'body', '#document'].indexOf(getNodeName(node)) >= 0) {
    // $FlowFixMe[incompatible-return]: assume body is always available
    return node.ownerDocument.body;
  }

  if (instanceOf_isHTMLElement(node) && isScrollParent(node)) {
    return node;
  }

  return getScrollParent(getParentNode(node));
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/listScrollParents.js




/*
given a DOM element, return the list of all scroll parents, up the list of ancesors
until we get to the top window object. This list is what we attach scroll listeners
to, because if any of these parent elements scroll, we'll need to re-calculate the
reference element's position.
*/

function listScrollParents(element, list) {
  var _element$ownerDocumen;

  if (list === void 0) {
    list = [];
  }

  var scrollParent = getScrollParent(element);
  var isBody = scrollParent === ((_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body);
  var win = getWindow(scrollParent);
  var target = isBody ? [win].concat(win.visualViewport || [], isScrollParent(scrollParent) ? scrollParent : []) : scrollParent;
  var updatedList = list.concat(target);
  return isBody ? updatedList : // $FlowFixMe[incompatible-call]: isBody tells us target will be an HTMLElement here
  updatedList.concat(listScrollParents(getParentNode(target)));
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/isTableElement.js

function isTableElement(element) {
  return ['table', 'td', 'th'].indexOf(getNodeName(element)) >= 0;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getOffsetParent.js







function getTrueOffsetParent(element) {
  if (!instanceOf_isHTMLElement(element) || // https://github.com/popperjs/popper-core/issues/837
  getComputedStyle_getComputedStyle(element).position === 'fixed') {
    return null;
  }

  return element.offsetParent;
} // `.offsetParent` reports `null` for fixed elements, while absolute elements
// return the containing block


function getContainingBlock(element) {
  var isFirefox = navigator.userAgent.toLowerCase().indexOf('firefox') !== -1;
  var isIE = navigator.userAgent.indexOf('Trident') !== -1;

  if (isIE && instanceOf_isHTMLElement(element)) {
    // In IE 9, 10 and 11 fixed elements containing block is always established by the viewport
    var elementCss = getComputedStyle_getComputedStyle(element);

    if (elementCss.position === 'fixed') {
      return null;
    }
  }

  var currentNode = getParentNode(element);

  while (instanceOf_isHTMLElement(currentNode) && ['html', 'body'].indexOf(getNodeName(currentNode)) < 0) {
    var css = getComputedStyle_getComputedStyle(currentNode); // This is non-exhaustive but covers the most common CSS properties that
    // create a containing block.
    // https://developer.mozilla.org/en-US/docs/Web/CSS/Containing_block#identifying_the_containing_block

    if (css.transform !== 'none' || css.perspective !== 'none' || css.contain === 'paint' || ['transform', 'perspective'].indexOf(css.willChange) !== -1 || isFirefox && css.willChange === 'filter' || isFirefox && css.filter && css.filter !== 'none') {
      return currentNode;
    } else {
      currentNode = currentNode.parentNode;
    }
  }

  return null;
} // Gets the closest ancestor positioned element. Handles some edge cases,
// such as table ancestors and cross browser bugs.


function getOffsetParent(element) {
  var window = getWindow(element);
  var offsetParent = getTrueOffsetParent(element);

  while (offsetParent && isTableElement(offsetParent) && getComputedStyle_getComputedStyle(offsetParent).position === 'static') {
    offsetParent = getTrueOffsetParent(offsetParent);
  }

  if (offsetParent && (getNodeName(offsetParent) === 'html' || getNodeName(offsetParent) === 'body' && getComputedStyle_getComputedStyle(offsetParent).position === 'static')) {
    return window;
  }

  return offsetParent || getContainingBlock(element) || window;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/orderModifiers.js
 // source: https://stackoverflow.com/questions/49875255

function order(modifiers) {
  var map = new Map();
  var visited = new Set();
  var result = [];
  modifiers.forEach(function (modifier) {
    map.set(modifier.name, modifier);
  }); // On visiting object, check for its dependencies and visit them recursively

  function sort(modifier) {
    visited.add(modifier.name);
    var requires = [].concat(modifier.requires || [], modifier.requiresIfExists || []);
    requires.forEach(function (dep) {
      if (!visited.has(dep)) {
        var depModifier = map.get(dep);

        if (depModifier) {
          sort(depModifier);
        }
      }
    });
    result.push(modifier);
  }

  modifiers.forEach(function (modifier) {
    if (!visited.has(modifier.name)) {
      // check for visited object
      sort(modifier);
    }
  });
  return result;
}

function orderModifiers(modifiers) {
  // order based on dependencies
  var orderedModifiers = order(modifiers); // order based on phase

  return modifierPhases.reduce(function (acc, phase) {
    return acc.concat(orderedModifiers.filter(function (modifier) {
      return modifier.phase === phase;
    }));
  }, []);
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/debounce.js
function debounce(fn) {
  var pending;
  return function () {
    if (!pending) {
      pending = new Promise(function (resolve) {
        Promise.resolve().then(function () {
          pending = undefined;
          resolve(fn());
        });
      });
    }

    return pending;
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/mergeByName.js
function mergeByName(modifiers) {
  var merged = modifiers.reduce(function (merged, current) {
    var existing = merged[current.name];
    merged[current.name] = existing ? Object.assign({}, existing, current, {
      options: Object.assign({}, existing.options, current.options),
      data: Object.assign({}, existing.data, current.data)
    }) : current;
    return merged;
  }, {}); // IE11 does not support Object.values

  return Object.keys(merged).map(function (key) {
    return merged[key];
  });
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/createPopper.js














var INVALID_ELEMENT_ERROR = 'Popper: Invalid reference or popper argument provided. They must be either a DOM element or virtual element.';
var INFINITE_LOOP_ERROR = 'Popper: An infinite loop in the modifiers cycle has been detected! The cycle has been interrupted to prevent a browser crash.';
var DEFAULT_OPTIONS = {
  placement: 'bottom',
  modifiers: [],
  strategy: 'absolute'
};

function areValidElements() {
  for (var _len = arguments.length, args = new Array(_len), _key = 0; _key < _len; _key++) {
    args[_key] = arguments[_key];
  }

  return !args.some(function (element) {
    return !(element && typeof element.getBoundingClientRect === 'function');
  });
}

function popperGenerator(generatorOptions) {
  if (generatorOptions === void 0) {
    generatorOptions = {};
  }

  var _generatorOptions = generatorOptions,
      _generatorOptions$def = _generatorOptions.defaultModifiers,
      defaultModifiers = _generatorOptions$def === void 0 ? [] : _generatorOptions$def,
      _generatorOptions$def2 = _generatorOptions.defaultOptions,
      defaultOptions = _generatorOptions$def2 === void 0 ? DEFAULT_OPTIONS : _generatorOptions$def2;
  return function createPopper(reference, popper, options) {
    if (options === void 0) {
      options = defaultOptions;
    }

    var state = {
      placement: 'bottom',
      orderedModifiers: [],
      options: Object.assign({}, DEFAULT_OPTIONS, defaultOptions),
      modifiersData: {},
      elements: {
        reference: reference,
        popper: popper
      },
      attributes: {},
      styles: {}
    };
    var effectCleanupFns = [];
    var isDestroyed = false;
    var instance = {
      state: state,
      setOptions: function setOptions(setOptionsAction) {
        var options = typeof setOptionsAction === 'function' ? setOptionsAction(state.options) : setOptionsAction;
        cleanupModifierEffects();
        state.options = Object.assign({}, defaultOptions, state.options, options);
        state.scrollParents = {
          reference: isElement(reference) ? listScrollParents(reference) : reference.contextElement ? listScrollParents(reference.contextElement) : [],
          popper: listScrollParents(popper)
        }; // Orders the modifiers based on their dependencies and `phase`
        // properties

        var orderedModifiers = orderModifiers(mergeByName([].concat(defaultModifiers, state.options.modifiers))); // Strip out disabled modifiers

        state.orderedModifiers = orderedModifiers.filter(function (m) {
          return m.enabled;
        }); // Validate the provided modifiers so that the consumer will get warned
        // if one of the modifiers is invalid for any reason

        if (false) { var _getComputedStyle, marginTop, marginRight, marginBottom, marginLeft, flipModifier, modifiers; }

        runModifierEffects();
        return instance.update();
      },
      // Sync update – it will always be executed, even if not necessary. This
      // is useful for low frequency updates where sync behavior simplifies the
      // logic.
      // For high frequency updates (e.g. `resize` and `scroll` events), always
      // prefer the async Popper#update method
      forceUpdate: function forceUpdate() {
        if (isDestroyed) {
          return;
        }

        var _state$elements = state.elements,
            reference = _state$elements.reference,
            popper = _state$elements.popper; // Don't proceed if `reference` or `popper` are not valid elements
        // anymore

        if (!areValidElements(reference, popper)) {
          if (false) {}

          return;
        } // Store the reference and popper rects to be read by modifiers


        state.rects = {
          reference: getCompositeRect(reference, getOffsetParent(popper), state.options.strategy === 'fixed'),
          popper: getLayoutRect(popper)
        }; // Modifiers have the ability to reset the current update cycle. The
        // most common use case for this is the `flip` modifier changing the
        // placement, which then needs to re-run all the modifiers, because the
        // logic was previously ran for the previous placement and is therefore
        // stale/incorrect

        state.reset = false;
        state.placement = state.options.placement; // On each update cycle, the `modifiersData` property for each modifier
        // is filled with the initial data specified by the modifier. This means
        // it doesn't persist and is fresh on each update.
        // To ensure persistent data, use `${name}#persistent`

        state.orderedModifiers.forEach(function (modifier) {
          return state.modifiersData[modifier.name] = Object.assign({}, modifier.data);
        });
        var __debug_loops__ = 0;

        for (var index = 0; index < state.orderedModifiers.length; index++) {
          if (false) {}

          if (state.reset === true) {
            state.reset = false;
            index = -1;
            continue;
          }

          var _state$orderedModifie = state.orderedModifiers[index],
              fn = _state$orderedModifie.fn,
              _state$orderedModifie2 = _state$orderedModifie.options,
              _options = _state$orderedModifie2 === void 0 ? {} : _state$orderedModifie2,
              name = _state$orderedModifie.name;

          if (typeof fn === 'function') {
            state = fn({
              state: state,
              options: _options,
              name: name,
              instance: instance
            }) || state;
          }
        }
      },
      // Async and optimistically optimized update – it will not be executed if
      // not necessary (debounced to run at most once-per-tick)
      update: debounce(function () {
        return new Promise(function (resolve) {
          instance.forceUpdate();
          resolve(state);
        });
      }),
      destroy: function destroy() {
        cleanupModifierEffects();
        isDestroyed = true;
      }
    };

    if (!areValidElements(reference, popper)) {
      if (false) {}

      return instance;
    }

    instance.setOptions(options).then(function (state) {
      if (!isDestroyed && options.onFirstUpdate) {
        options.onFirstUpdate(state);
      }
    }); // Modifiers have the ability to execute arbitrary code before the first
    // update cycle runs. They will be executed in the same order as the update
    // cycle. This is useful when a modifier adds some persistent data that
    // other modifiers need to use, but the modifier is run after the dependent
    // one.

    function runModifierEffects() {
      state.orderedModifiers.forEach(function (_ref3) {
        var name = _ref3.name,
            _ref3$options = _ref3.options,
            options = _ref3$options === void 0 ? {} : _ref3$options,
            effect = _ref3.effect;

        if (typeof effect === 'function') {
          var cleanupFn = effect({
            state: state,
            name: name,
            instance: instance,
            options: options
          });

          var noopFn = function noopFn() {};

          effectCleanupFns.push(cleanupFn || noopFn);
        }
      });
    }

    function cleanupModifierEffects() {
      effectCleanupFns.forEach(function (fn) {
        return fn();
      });
      effectCleanupFns = [];
    }

    return instance;
  };
}
var createPopper = /*#__PURE__*/(/* unused pure expression or super */ null && (popperGenerator())); // eslint-disable-next-line import/no-unused-modules


;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/eventListeners.js
 // eslint-disable-next-line import/no-unused-modules

var passive = {
  passive: true
};

function eventListeners_effect(_ref) {
  var state = _ref.state,
      instance = _ref.instance,
      options = _ref.options;
  var _options$scroll = options.scroll,
      scroll = _options$scroll === void 0 ? true : _options$scroll,
      _options$resize = options.resize,
      resize = _options$resize === void 0 ? true : _options$resize;
  var window = getWindow(state.elements.popper);
  var scrollParents = [].concat(state.scrollParents.reference, state.scrollParents.popper);

  if (scroll) {
    scrollParents.forEach(function (scrollParent) {
      scrollParent.addEventListener('scroll', instance.update, passive);
    });
  }

  if (resize) {
    window.addEventListener('resize', instance.update, passive);
  }

  return function () {
    if (scroll) {
      scrollParents.forEach(function (scrollParent) {
        scrollParent.removeEventListener('scroll', instance.update, passive);
      });
    }

    if (resize) {
      window.removeEventListener('resize', instance.update, passive);
    }
  };
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const eventListeners = ({
  name: 'eventListeners',
  enabled: true,
  phase: 'write',
  fn: function fn() {},
  effect: eventListeners_effect,
  data: {}
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/getBasePlacement.js

function getBasePlacement(placement) {
  return placement.split('-')[0];
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/getVariation.js
function getVariation(placement) {
  return placement.split('-')[1];
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/getMainAxisFromPlacement.js
function getMainAxisFromPlacement(placement) {
  return ['top', 'bottom'].indexOf(placement) >= 0 ? 'x' : 'y';
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/computeOffsets.js




function computeOffsets(_ref) {
  var reference = _ref.reference,
      element = _ref.element,
      placement = _ref.placement;
  var basePlacement = placement ? getBasePlacement(placement) : null;
  var variation = placement ? getVariation(placement) : null;
  var commonX = reference.x + reference.width / 2 - element.width / 2;
  var commonY = reference.y + reference.height / 2 - element.height / 2;
  var offsets;

  switch (basePlacement) {
    case enums_top:
      offsets = {
        x: commonX,
        y: reference.y - element.height
      };
      break;

    case bottom:
      offsets = {
        x: commonX,
        y: reference.y + reference.height
      };
      break;

    case right:
      offsets = {
        x: reference.x + reference.width,
        y: commonY
      };
      break;

    case left:
      offsets = {
        x: reference.x - element.width,
        y: commonY
      };
      break;

    default:
      offsets = {
        x: reference.x,
        y: reference.y
      };
  }

  var mainAxis = basePlacement ? getMainAxisFromPlacement(basePlacement) : null;

  if (mainAxis != null) {
    var len = mainAxis === 'y' ? 'height' : 'width';

    switch (variation) {
      case start:
        offsets[mainAxis] = offsets[mainAxis] - (reference[len] / 2 - element[len] / 2);
        break;

      case end:
        offsets[mainAxis] = offsets[mainAxis] + (reference[len] / 2 - element[len] / 2);
        break;

      default:
    }
  }

  return offsets;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/popperOffsets.js


function popperOffsets(_ref) {
  var state = _ref.state,
      name = _ref.name; // Offsets are the actual position the popper needs to have to be
  // properly positioned near its reference element
  // This is the most basic placement, and will be adjusted by
  // the modifiers in the next step

  state.modifiersData[name] = computeOffsets({
    reference: state.rects.reference,
    element: state.rects.popper,
    strategy: 'absolute',
    placement: state.placement
  });
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_popperOffsets = ({
  name: 'popperOffsets',
  enabled: true,
  phase: 'read',
  fn: popperOffsets,
  data: {}
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/computeStyles.js







 // eslint-disable-next-line import/no-unused-modules

var unsetSides = {
  top: 'auto',
  right: 'auto',
  bottom: 'auto',
  left: 'auto'
}; // Round the offsets to the nearest suitable subpixel based on the DPR.
// Zooming can change the DPR, but it seems to report a value that will
// cleanly divide the values into the appropriate subpixels.

function roundOffsetsByDPR(_ref) {
  var x = _ref.x,
      y = _ref.y;
  var win = window;
  var dpr = win.devicePixelRatio || 1;
  return {
    x: round(x * dpr) / dpr || 0,
    y: round(y * dpr) / dpr || 0
  };
}

function mapToStyles(_ref2) {
  var _Object$assign2;

  var popper = _ref2.popper,
      popperRect = _ref2.popperRect,
      placement = _ref2.placement,
      variation = _ref2.variation,
      offsets = _ref2.offsets,
      position = _ref2.position,
      gpuAcceleration = _ref2.gpuAcceleration,
      adaptive = _ref2.adaptive,
      roundOffsets = _ref2.roundOffsets,
      isFixed = _ref2.isFixed;
  var _offsets$x = offsets.x,
      x = _offsets$x === void 0 ? 0 : _offsets$x,
      _offsets$y = offsets.y,
      y = _offsets$y === void 0 ? 0 : _offsets$y;

  var _ref3 = typeof roundOffsets === 'function' ? roundOffsets({
    x: x,
    y: y
  }) : {
    x: x,
    y: y
  };

  x = _ref3.x;
  y = _ref3.y;
  var hasX = offsets.hasOwnProperty('x');
  var hasY = offsets.hasOwnProperty('y');
  var sideX = left;
  var sideY = enums_top;
  var win = window;

  if (adaptive) {
    var offsetParent = getOffsetParent(popper);
    var heightProp = 'clientHeight';
    var widthProp = 'clientWidth';

    if (offsetParent === getWindow(popper)) {
      offsetParent = getDocumentElement(popper);

      if (getComputedStyle_getComputedStyle(offsetParent).position !== 'static' && position === 'absolute') {
        heightProp = 'scrollHeight';
        widthProp = 'scrollWidth';
      }
    } // $FlowFixMe[incompatible-cast]: force type refinement, we compare offsetParent with window above, but Flow doesn't detect it


    offsetParent = offsetParent;

    if (placement === enums_top || (placement === left || placement === right) && variation === end) {
      sideY = bottom;
      var offsetY = isFixed && win.visualViewport ? win.visualViewport.height : // $FlowFixMe[prop-missing]
      offsetParent[heightProp];
      y -= offsetY - popperRect.height;
      y *= gpuAcceleration ? 1 : -1;
    }

    if (placement === left || (placement === enums_top || placement === bottom) && variation === end) {
      sideX = right;
      var offsetX = isFixed && win.visualViewport ? win.visualViewport.width : // $FlowFixMe[prop-missing]
      offsetParent[widthProp];
      x -= offsetX - popperRect.width;
      x *= gpuAcceleration ? 1 : -1;
    }
  }

  var commonStyles = Object.assign({
    position: position
  }, adaptive && unsetSides);

  var _ref4 = roundOffsets === true ? roundOffsetsByDPR({
    x: x,
    y: y
  }) : {
    x: x,
    y: y
  };

  x = _ref4.x;
  y = _ref4.y;

  if (gpuAcceleration) {
    var _Object$assign;

    return Object.assign({}, commonStyles, (_Object$assign = {}, _Object$assign[sideY] = hasY ? '0' : '', _Object$assign[sideX] = hasX ? '0' : '', _Object$assign.transform = (win.devicePixelRatio || 1) <= 1 ? "translate(" + x + "px, " + y + "px)" : "translate3d(" + x + "px, " + y + "px, 0)", _Object$assign));
  }

  return Object.assign({}, commonStyles, (_Object$assign2 = {}, _Object$assign2[sideY] = hasY ? y + "px" : '', _Object$assign2[sideX] = hasX ? x + "px" : '', _Object$assign2.transform = '', _Object$assign2));
}

function computeStyles(_ref5) {
  var state = _ref5.state,
      options = _ref5.options;
  var _options$gpuAccelerat = options.gpuAcceleration,
      gpuAcceleration = _options$gpuAccelerat === void 0 ? true : _options$gpuAccelerat,
      _options$adaptive = options.adaptive,
      adaptive = _options$adaptive === void 0 ? true : _options$adaptive,
      _options$roundOffsets = options.roundOffsets,
      roundOffsets = _options$roundOffsets === void 0 ? true : _options$roundOffsets;

  if (false) { var transitionProperty; }

  var commonStyles = {
    placement: getBasePlacement(state.placement),
    variation: getVariation(state.placement),
    popper: state.elements.popper,
    popperRect: state.rects.popper,
    gpuAcceleration: gpuAcceleration,
    isFixed: state.options.strategy === 'fixed'
  };

  if (state.modifiersData.popperOffsets != null) {
    state.styles.popper = Object.assign({}, state.styles.popper, mapToStyles(Object.assign({}, commonStyles, {
      offsets: state.modifiersData.popperOffsets,
      position: state.options.strategy,
      adaptive: adaptive,
      roundOffsets: roundOffsets
    })));
  }

  if (state.modifiersData.arrow != null) {
    state.styles.arrow = Object.assign({}, state.styles.arrow, mapToStyles(Object.assign({}, commonStyles, {
      offsets: state.modifiersData.arrow,
      position: 'absolute',
      adaptive: false,
      roundOffsets: roundOffsets
    })));
  }

  state.attributes.popper = Object.assign({}, state.attributes.popper, {
    'data-popper-placement': state.placement
  });
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_computeStyles = ({
  name: 'computeStyles',
  enabled: true,
  phase: 'beforeWrite',
  fn: computeStyles,
  data: {}
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/applyStyles.js

 // This modifier takes the styles prepared by the `computeStyles` modifier
// and applies them to the HTMLElements such as popper and arrow

function applyStyles(_ref) {
  var state = _ref.state;
  Object.keys(state.elements).forEach(function (name) {
    var style = state.styles[name] || {};
    var attributes = state.attributes[name] || {};
    var element = state.elements[name]; // arrow is optional + virtual elements

    if (!instanceOf_isHTMLElement(element) || !getNodeName(element)) {
      return;
    } // Flow doesn't support to extend this property, but it's the most
    // effective way to apply styles to an HTMLElement
    // $FlowFixMe[cannot-write]


    Object.assign(element.style, style);
    Object.keys(attributes).forEach(function (name) {
      var value = attributes[name];

      if (value === false) {
        element.removeAttribute(name);
      } else {
        element.setAttribute(name, value === true ? '' : value);
      }
    });
  });
}

function applyStyles_effect(_ref2) {
  var state = _ref2.state;
  var initialStyles = {
    popper: {
      position: state.options.strategy,
      left: '0',
      top: '0',
      margin: '0'
    },
    arrow: {
      position: 'absolute'
    },
    reference: {}
  };
  Object.assign(state.elements.popper.style, initialStyles.popper);
  state.styles = initialStyles;

  if (state.elements.arrow) {
    Object.assign(state.elements.arrow.style, initialStyles.arrow);
  }

  return function () {
    Object.keys(state.elements).forEach(function (name) {
      var element = state.elements[name];
      var attributes = state.attributes[name] || {};
      var styleProperties = Object.keys(state.styles.hasOwnProperty(name) ? state.styles[name] : initialStyles[name]); // Set all values to an empty string to unset them

      var style = styleProperties.reduce(function (style, property) {
        style[property] = '';
        return style;
      }, {}); // arrow is optional + virtual elements

      if (!instanceOf_isHTMLElement(element) || !getNodeName(element)) {
        return;
      }

      Object.assign(element.style, style);
      Object.keys(attributes).forEach(function (attribute) {
        element.removeAttribute(attribute);
      });
    });
  };
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_applyStyles = ({
  name: 'applyStyles',
  enabled: true,
  phase: 'write',
  fn: applyStyles,
  effect: applyStyles_effect,
  requires: ['computeStyles']
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/offset.js

 // eslint-disable-next-line import/no-unused-modules

function distanceAndSkiddingToXY(placement, rects, offset) {
  var basePlacement = getBasePlacement(placement);
  var invertDistance = [left, enums_top].indexOf(basePlacement) >= 0 ? -1 : 1;

  var _ref = typeof offset === 'function' ? offset(Object.assign({}, rects, {
    placement: placement
  })) : offset,
      skidding = _ref[0],
      distance = _ref[1];

  skidding = skidding || 0;
  distance = (distance || 0) * invertDistance;
  return [left, right].indexOf(basePlacement) >= 0 ? {
    x: distance,
    y: skidding
  } : {
    x: skidding,
    y: distance
  };
}

function offset(_ref2) {
  var state = _ref2.state,
      options = _ref2.options,
      name = _ref2.name;
  var _options$offset = options.offset,
      offset = _options$offset === void 0 ? [0, 0] : _options$offset;
  var data = enums_placements.reduce(function (acc, placement) {
    acc[placement] = distanceAndSkiddingToXY(placement, state.rects, offset);
    return acc;
  }, {});
  var _data$state$placement = data[state.placement],
      x = _data$state$placement.x,
      y = _data$state$placement.y;

  if (state.modifiersData.popperOffsets != null) {
    state.modifiersData.popperOffsets.x += x;
    state.modifiersData.popperOffsets.y += y;
  }

  state.modifiersData[name] = data;
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_offset = ({
  name: 'offset',
  enabled: true,
  phase: 'main',
  requires: ['popperOffsets'],
  fn: offset
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/getOppositePlacement.js
var hash = {
  left: 'right',
  right: 'left',
  bottom: 'top',
  top: 'bottom'
};
function getOppositePlacement(placement) {
  return placement.replace(/left|right|bottom|top/g, function (matched) {
    return hash[matched];
  });
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/getOppositeVariationPlacement.js
var getOppositeVariationPlacement_hash = {
  start: 'end',
  end: 'start'
};
function getOppositeVariationPlacement(placement) {
  return placement.replace(/start|end/g, function (matched) {
    return getOppositeVariationPlacement_hash[matched];
  });
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getViewportRect.js



function getViewportRect(element) {
  var win = getWindow(element);
  var html = getDocumentElement(element);
  var visualViewport = win.visualViewport;
  var width = html.clientWidth;
  var height = html.clientHeight;
  var x = 0;
  var y = 0; // NB: This isn't supported on iOS <= 12. If the keyboard is open, the popper
  // can be obscured underneath it.
  // Also, `html.clientHeight` adds the bottom bar height in Safari iOS, even
  // if it isn't open, so if this isn't available, the popper will be detected
  // to overflow the bottom of the screen too early.

  if (visualViewport) {
    width = visualViewport.width;
    height = visualViewport.height; // Uses Layout Viewport (like Chrome; Safari does not currently)
    // In Chrome, it returns a value very close to 0 (+/-) but contains rounding
    // errors due to floating point numbers, so we need to check precision.
    // Safari returns a number <= 0, usually < -1 when pinch-zoomed
    // Feature detection fails in mobile emulation mode in Chrome.
    // Math.abs(win.innerWidth / visualViewport.scale - visualViewport.width) <
    // 0.001
    // Fallback here: "Not Safari" userAgent

    if (!/^((?!chrome|android).)*safari/i.test(navigator.userAgent)) {
      x = visualViewport.offsetLeft;
      y = visualViewport.offsetTop;
    }
  }

  return {
    width: width,
    height: height,
    x: x + getWindowScrollBarX(element),
    y: y
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getDocumentRect.js




 // Gets the entire size of the scrollable document area, even extending outside
// of the `<html>` and `<body>` rect bounds if horizontally scrollable

function getDocumentRect(element) {
  var _element$ownerDocumen;

  var html = getDocumentElement(element);
  var winScroll = getWindowScroll(element);
  var body = (_element$ownerDocumen = element.ownerDocument) == null ? void 0 : _element$ownerDocumen.body;
  var width = math_max(html.scrollWidth, html.clientWidth, body ? body.scrollWidth : 0, body ? body.clientWidth : 0);
  var height = math_max(html.scrollHeight, html.clientHeight, body ? body.scrollHeight : 0, body ? body.clientHeight : 0);
  var x = -winScroll.scrollLeft + getWindowScrollBarX(element);
  var y = -winScroll.scrollTop;

  if (getComputedStyle_getComputedStyle(body || html).direction === 'rtl') {
    x += math_max(html.clientWidth, body ? body.clientWidth : 0) - width;
  }

  return {
    width: width,
    height: height,
    x: x,
    y: y
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/contains.js

function contains(parent, child) {
  var rootNode = child.getRootNode && child.getRootNode(); // First, attempt with faster native method

  if (parent.contains(child)) {
    return true;
  } // then fallback to custom implementation with Shadow DOM support
  else if (rootNode && isShadowRoot(rootNode)) {
    var next = child;

    do {
      if (next && parent.isSameNode(next)) {
        return true;
      } // $FlowFixMe[prop-missing]: need a better way to handle this...


      next = next.parentNode || next.host;
    } while (next);
  } // Give up, the result is false


  return false;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/rectToClientRect.js
function rectToClientRect(rect) {
  return Object.assign({}, rect, {
    left: rect.x,
    top: rect.y,
    right: rect.x + rect.width,
    bottom: rect.y + rect.height
  });
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/dom-utils/getClippingRect.js















function getInnerBoundingClientRect(element) {
  var rect = getBoundingClientRect(element);
  rect.top = rect.top + element.clientTop;
  rect.left = rect.left + element.clientLeft;
  rect.bottom = rect.top + element.clientHeight;
  rect.right = rect.left + element.clientWidth;
  rect.width = element.clientWidth;
  rect.height = element.clientHeight;
  rect.x = rect.left;
  rect.y = rect.top;
  return rect;
}

function getClientRectFromMixedType(element, clippingParent) {
  return clippingParent === viewport ? rectToClientRect(getViewportRect(element)) : isElement(clippingParent) ? getInnerBoundingClientRect(clippingParent) : rectToClientRect(getDocumentRect(getDocumentElement(element)));
} // A "clipping parent" is an overflowable container with the characteristic of
// clipping (or hiding) overflowing elements with a position different from
// `initial`


function getClippingParents(element) {
  var clippingParents = listScrollParents(getParentNode(element));
  var canEscapeClipping = ['absolute', 'fixed'].indexOf(getComputedStyle_getComputedStyle(element).position) >= 0;
  var clipperElement = canEscapeClipping && instanceOf_isHTMLElement(element) ? getOffsetParent(element) : element;

  if (!isElement(clipperElement)) {
    return [];
  } // $FlowFixMe[incompatible-return]: https://github.com/facebook/flow/issues/1414


  return clippingParents.filter(function (clippingParent) {
    return isElement(clippingParent) && contains(clippingParent, clipperElement) && getNodeName(clippingParent) !== 'body';
  });
} // Gets the maximum area that the element is visible in due to any number of
// clipping parents


function getClippingRect(element, boundary, rootBoundary) {
  var mainClippingParents = boundary === 'clippingParents' ? getClippingParents(element) : [].concat(boundary);
  var clippingParents = [].concat(mainClippingParents, [rootBoundary]);
  var firstClippingParent = clippingParents[0];
  var clippingRect = clippingParents.reduce(function (accRect, clippingParent) {
    var rect = getClientRectFromMixedType(element, clippingParent);
    accRect.top = math_max(rect.top, accRect.top);
    accRect.right = math_min(rect.right, accRect.right);
    accRect.bottom = math_min(rect.bottom, accRect.bottom);
    accRect.left = math_max(rect.left, accRect.left);
    return accRect;
  }, getClientRectFromMixedType(element, firstClippingParent));
  clippingRect.width = clippingRect.right - clippingRect.left;
  clippingRect.height = clippingRect.bottom - clippingRect.top;
  clippingRect.x = clippingRect.left;
  clippingRect.y = clippingRect.top;
  return clippingRect;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/getFreshSideObject.js
function getFreshSideObject() {
  return {
    top: 0,
    right: 0,
    bottom: 0,
    left: 0
  };
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/mergePaddingObject.js

function mergePaddingObject(paddingObject) {
  return Object.assign({}, getFreshSideObject(), paddingObject);
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/expandToHashMap.js
function expandToHashMap(value, keys) {
  return keys.reduce(function (hashMap, key) {
    hashMap[key] = value;
    return hashMap;
  }, {});
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/detectOverflow.js








 // eslint-disable-next-line import/no-unused-modules

function detectOverflow(state, options) {
  if (options === void 0) {
    options = {};
  }

  var _options = options,
      _options$placement = _options.placement,
      placement = _options$placement === void 0 ? state.placement : _options$placement,
      _options$boundary = _options.boundary,
      boundary = _options$boundary === void 0 ? clippingParents : _options$boundary,
      _options$rootBoundary = _options.rootBoundary,
      rootBoundary = _options$rootBoundary === void 0 ? viewport : _options$rootBoundary,
      _options$elementConte = _options.elementContext,
      elementContext = _options$elementConte === void 0 ? popper : _options$elementConte,
      _options$altBoundary = _options.altBoundary,
      altBoundary = _options$altBoundary === void 0 ? false : _options$altBoundary,
      _options$padding = _options.padding,
      padding = _options$padding === void 0 ? 0 : _options$padding;
  var paddingObject = mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));
  var altContext = elementContext === popper ? reference : popper;
  var popperRect = state.rects.popper;
  var element = state.elements[altBoundary ? altContext : elementContext];
  var clippingClientRect = getClippingRect(isElement(element) ? element : element.contextElement || getDocumentElement(state.elements.popper), boundary, rootBoundary);
  var referenceClientRect = getBoundingClientRect(state.elements.reference);
  var popperOffsets = computeOffsets({
    reference: referenceClientRect,
    element: popperRect,
    strategy: 'absolute',
    placement: placement
  });
  var popperClientRect = rectToClientRect(Object.assign({}, popperRect, popperOffsets));
  var elementClientRect = elementContext === popper ? popperClientRect : referenceClientRect; // positive = overflowing the clipping rect
  // 0 or negative = within the clipping rect

  var overflowOffsets = {
    top: clippingClientRect.top - elementClientRect.top + paddingObject.top,
    bottom: elementClientRect.bottom - clippingClientRect.bottom + paddingObject.bottom,
    left: clippingClientRect.left - elementClientRect.left + paddingObject.left,
    right: elementClientRect.right - clippingClientRect.right + paddingObject.right
  };
  var offsetData = state.modifiersData.offset; // Offsets can be applied only to the popper element

  if (elementContext === popper && offsetData) {
    var offset = offsetData[placement];
    Object.keys(overflowOffsets).forEach(function (key) {
      var multiply = [right, bottom].indexOf(key) >= 0 ? 1 : -1;
      var axis = [enums_top, bottom].indexOf(key) >= 0 ? 'y' : 'x';
      overflowOffsets[key] += offset[axis] * multiply;
    });
  }

  return overflowOffsets;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/computeAutoPlacement.js




function computeAutoPlacement(state, options) {
  if (options === void 0) {
    options = {};
  }

  var _options = options,
      placement = _options.placement,
      boundary = _options.boundary,
      rootBoundary = _options.rootBoundary,
      padding = _options.padding,
      flipVariations = _options.flipVariations,
      _options$allowedAutoP = _options.allowedAutoPlacements,
      allowedAutoPlacements = _options$allowedAutoP === void 0 ? enums_placements : _options$allowedAutoP;
  var variation = getVariation(placement);
  var placements = variation ? flipVariations ? variationPlacements : variationPlacements.filter(function (placement) {
    return getVariation(placement) === variation;
  }) : basePlacements;
  var allowedPlacements = placements.filter(function (placement) {
    return allowedAutoPlacements.indexOf(placement) >= 0;
  });

  if (allowedPlacements.length === 0) {
    allowedPlacements = placements;

    if (false) {}
  } // $FlowFixMe[incompatible-type]: Flow seems to have problems with two array unions...


  var overflows = allowedPlacements.reduce(function (acc, placement) {
    acc[placement] = detectOverflow(state, {
      placement: placement,
      boundary: boundary,
      rootBoundary: rootBoundary,
      padding: padding
    })[getBasePlacement(placement)];
    return acc;
  }, {});
  return Object.keys(overflows).sort(function (a, b) {
    return overflows[a] - overflows[b];
  });
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/flip.js






 // eslint-disable-next-line import/no-unused-modules

function getExpandedFallbackPlacements(placement) {
  if (getBasePlacement(placement) === auto) {
    return [];
  }

  var oppositePlacement = getOppositePlacement(placement);
  return [getOppositeVariationPlacement(placement), oppositePlacement, getOppositeVariationPlacement(oppositePlacement)];
}

function flip(_ref) {
  var state = _ref.state,
      options = _ref.options,
      name = _ref.name;

  if (state.modifiersData[name]._skip) {
    return;
  }

  var _options$mainAxis = options.mainAxis,
      checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,
      _options$altAxis = options.altAxis,
      checkAltAxis = _options$altAxis === void 0 ? true : _options$altAxis,
      specifiedFallbackPlacements = options.fallbackPlacements,
      padding = options.padding,
      boundary = options.boundary,
      rootBoundary = options.rootBoundary,
      altBoundary = options.altBoundary,
      _options$flipVariatio = options.flipVariations,
      flipVariations = _options$flipVariatio === void 0 ? true : _options$flipVariatio,
      allowedAutoPlacements = options.allowedAutoPlacements;
  var preferredPlacement = state.options.placement;
  var basePlacement = getBasePlacement(preferredPlacement);
  var isBasePlacement = basePlacement === preferredPlacement;
  var fallbackPlacements = specifiedFallbackPlacements || (isBasePlacement || !flipVariations ? [getOppositePlacement(preferredPlacement)] : getExpandedFallbackPlacements(preferredPlacement));
  var placements = [preferredPlacement].concat(fallbackPlacements).reduce(function (acc, placement) {
    return acc.concat(getBasePlacement(placement) === auto ? computeAutoPlacement(state, {
      placement: placement,
      boundary: boundary,
      rootBoundary: rootBoundary,
      padding: padding,
      flipVariations: flipVariations,
      allowedAutoPlacements: allowedAutoPlacements
    }) : placement);
  }, []);
  var referenceRect = state.rects.reference;
  var popperRect = state.rects.popper;
  var checksMap = new Map();
  var makeFallbackChecks = true;
  var firstFittingPlacement = placements[0];

  for (var i = 0; i < placements.length; i++) {
    var placement = placements[i];

    var _basePlacement = getBasePlacement(placement);

    var isStartVariation = getVariation(placement) === start;
    var isVertical = [enums_top, bottom].indexOf(_basePlacement) >= 0;
    var len = isVertical ? 'width' : 'height';
    var overflow = detectOverflow(state, {
      placement: placement,
      boundary: boundary,
      rootBoundary: rootBoundary,
      altBoundary: altBoundary,
      padding: padding
    });
    var mainVariationSide = isVertical ? isStartVariation ? right : left : isStartVariation ? bottom : enums_top;

    if (referenceRect[len] > popperRect[len]) {
      mainVariationSide = getOppositePlacement(mainVariationSide);
    }

    var altVariationSide = getOppositePlacement(mainVariationSide);
    var checks = [];

    if (checkMainAxis) {
      checks.push(overflow[_basePlacement] <= 0);
    }

    if (checkAltAxis) {
      checks.push(overflow[mainVariationSide] <= 0, overflow[altVariationSide] <= 0);
    }

    if (checks.every(function (check) {
      return check;
    })) {
      firstFittingPlacement = placement;
      makeFallbackChecks = false;
      break;
    }

    checksMap.set(placement, checks);
  }

  if (makeFallbackChecks) {
    // `2` may be desired in some cases – research later
    var numberOfChecks = flipVariations ? 3 : 1;

    var _loop = function _loop(_i) {
      var fittingPlacement = placements.find(function (placement) {
        var checks = checksMap.get(placement);

        if (checks) {
          return checks.slice(0, _i).every(function (check) {
            return check;
          });
        }
      });

      if (fittingPlacement) {
        firstFittingPlacement = fittingPlacement;
        return "break";
      }
    };

    for (var _i = numberOfChecks; _i > 0; _i--) {
      var _ret = _loop(_i);

      if (_ret === "break") break;
    }
  }

  if (state.placement !== firstFittingPlacement) {
    state.modifiersData[name]._skip = true;
    state.placement = firstFittingPlacement;
    state.reset = true;
  }
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_flip = ({
  name: 'flip',
  enabled: true,
  phase: 'main',
  fn: flip,
  requiresIfExists: ['offset'],
  data: {
    _skip: false
  }
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/getAltAxis.js
function getAltAxis(axis) {
  return axis === 'x' ? 'y' : 'x';
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/utils/within.js

function within(min, value, max) {
  return math_max(min, math_min(value, max));
}
function withinMaxClamp(min, value, max) {
  var v = within(min, value, max);
  return v > max ? max : v;
}
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/preventOverflow.js












function preventOverflow(_ref) {
  var state = _ref.state,
      options = _ref.options,
      name = _ref.name;
  var _options$mainAxis = options.mainAxis,
      checkMainAxis = _options$mainAxis === void 0 ? true : _options$mainAxis,
      _options$altAxis = options.altAxis,
      checkAltAxis = _options$altAxis === void 0 ? false : _options$altAxis,
      boundary = options.boundary,
      rootBoundary = options.rootBoundary,
      altBoundary = options.altBoundary,
      padding = options.padding,
      _options$tether = options.tether,
      tether = _options$tether === void 0 ? true : _options$tether,
      _options$tetherOffset = options.tetherOffset,
      tetherOffset = _options$tetherOffset === void 0 ? 0 : _options$tetherOffset;
  var overflow = detectOverflow(state, {
    boundary: boundary,
    rootBoundary: rootBoundary,
    padding: padding,
    altBoundary: altBoundary
  });
  var basePlacement = getBasePlacement(state.placement);
  var variation = getVariation(state.placement);
  var isBasePlacement = !variation;
  var mainAxis = getMainAxisFromPlacement(basePlacement);
  var altAxis = getAltAxis(mainAxis);
  var popperOffsets = state.modifiersData.popperOffsets;
  var referenceRect = state.rects.reference;
  var popperRect = state.rects.popper;
  var tetherOffsetValue = typeof tetherOffset === 'function' ? tetherOffset(Object.assign({}, state.rects, {
    placement: state.placement
  })) : tetherOffset;
  var normalizedTetherOffsetValue = typeof tetherOffsetValue === 'number' ? {
    mainAxis: tetherOffsetValue,
    altAxis: tetherOffsetValue
  } : Object.assign({
    mainAxis: 0,
    altAxis: 0
  }, tetherOffsetValue);
  var offsetModifierState = state.modifiersData.offset ? state.modifiersData.offset[state.placement] : null;
  var data = {
    x: 0,
    y: 0
  };

  if (!popperOffsets) {
    return;
  }

  if (checkMainAxis) {
    var _offsetModifierState$;

    var mainSide = mainAxis === 'y' ? enums_top : left;
    var altSide = mainAxis === 'y' ? bottom : right;
    var len = mainAxis === 'y' ? 'height' : 'width';
    var offset = popperOffsets[mainAxis];
    var min = offset + overflow[mainSide];
    var max = offset - overflow[altSide];
    var additive = tether ? -popperRect[len] / 2 : 0;
    var minLen = variation === start ? referenceRect[len] : popperRect[len];
    var maxLen = variation === start ? -popperRect[len] : -referenceRect[len]; // We need to include the arrow in the calculation so the arrow doesn't go
    // outside the reference bounds

    var arrowElement = state.elements.arrow;
    var arrowRect = tether && arrowElement ? getLayoutRect(arrowElement) : {
      width: 0,
      height: 0
    };
    var arrowPaddingObject = state.modifiersData['arrow#persistent'] ? state.modifiersData['arrow#persistent'].padding : getFreshSideObject();
    var arrowPaddingMin = arrowPaddingObject[mainSide];
    var arrowPaddingMax = arrowPaddingObject[altSide]; // If the reference length is smaller than the arrow length, we don't want
    // to include its full size in the calculation. If the reference is small
    // and near the edge of a boundary, the popper can overflow even if the
    // reference is not overflowing as well (e.g. virtual elements with no
    // width or height)

    var arrowLen = within(0, referenceRect[len], arrowRect[len]);
    var minOffset = isBasePlacement ? referenceRect[len] / 2 - additive - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis : minLen - arrowLen - arrowPaddingMin - normalizedTetherOffsetValue.mainAxis;
    var maxOffset = isBasePlacement ? -referenceRect[len] / 2 + additive + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis : maxLen + arrowLen + arrowPaddingMax + normalizedTetherOffsetValue.mainAxis;
    var arrowOffsetParent = state.elements.arrow && getOffsetParent(state.elements.arrow);
    var clientOffset = arrowOffsetParent ? mainAxis === 'y' ? arrowOffsetParent.clientTop || 0 : arrowOffsetParent.clientLeft || 0 : 0;
    var offsetModifierValue = (_offsetModifierState$ = offsetModifierState == null ? void 0 : offsetModifierState[mainAxis]) != null ? _offsetModifierState$ : 0;
    var tetherMin = offset + minOffset - offsetModifierValue - clientOffset;
    var tetherMax = offset + maxOffset - offsetModifierValue;
    var preventedOffset = within(tether ? math_min(min, tetherMin) : min, offset, tether ? math_max(max, tetherMax) : max);
    popperOffsets[mainAxis] = preventedOffset;
    data[mainAxis] = preventedOffset - offset;
  }

  if (checkAltAxis) {
    var _offsetModifierState$2;

    var _mainSide = mainAxis === 'x' ? enums_top : left;

    var _altSide = mainAxis === 'x' ? bottom : right;

    var _offset = popperOffsets[altAxis];

    var _len = altAxis === 'y' ? 'height' : 'width';

    var _min = _offset + overflow[_mainSide];

    var _max = _offset - overflow[_altSide];

    var isOriginSide = [enums_top, left].indexOf(basePlacement) !== -1;

    var _offsetModifierValue = (_offsetModifierState$2 = offsetModifierState == null ? void 0 : offsetModifierState[altAxis]) != null ? _offsetModifierState$2 : 0;

    var _tetherMin = isOriginSide ? _min : _offset - referenceRect[_len] - popperRect[_len] - _offsetModifierValue + normalizedTetherOffsetValue.altAxis;

    var _tetherMax = isOriginSide ? _offset + referenceRect[_len] + popperRect[_len] - _offsetModifierValue - normalizedTetherOffsetValue.altAxis : _max;

    var _preventedOffset = tether && isOriginSide ? withinMaxClamp(_tetherMin, _offset, _tetherMax) : within(tether ? _tetherMin : _min, _offset, tether ? _tetherMax : _max);

    popperOffsets[altAxis] = _preventedOffset;
    data[altAxis] = _preventedOffset - _offset;
  }

  state.modifiersData[name] = data;
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_preventOverflow = ({
  name: 'preventOverflow',
  enabled: true,
  phase: 'main',
  fn: preventOverflow,
  requiresIfExists: ['offset']
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/arrow.js









 // eslint-disable-next-line import/no-unused-modules

var toPaddingObject = function toPaddingObject(padding, state) {
  padding = typeof padding === 'function' ? padding(Object.assign({}, state.rects, {
    placement: state.placement
  })) : padding;
  return mergePaddingObject(typeof padding !== 'number' ? padding : expandToHashMap(padding, basePlacements));
};

function arrow(_ref) {
  var _state$modifiersData$;

  var state = _ref.state,
      name = _ref.name,
      options = _ref.options;
  var arrowElement = state.elements.arrow;
  var popperOffsets = state.modifiersData.popperOffsets;
  var basePlacement = getBasePlacement(state.placement);
  var axis = getMainAxisFromPlacement(basePlacement);
  var isVertical = [left, right].indexOf(basePlacement) >= 0;
  var len = isVertical ? 'height' : 'width';

  if (!arrowElement || !popperOffsets) {
    return;
  }

  var paddingObject = toPaddingObject(options.padding, state);
  var arrowRect = getLayoutRect(arrowElement);
  var minProp = axis === 'y' ? enums_top : left;
  var maxProp = axis === 'y' ? bottom : right;
  var endDiff = state.rects.reference[len] + state.rects.reference[axis] - popperOffsets[axis] - state.rects.popper[len];
  var startDiff = popperOffsets[axis] - state.rects.reference[axis];
  var arrowOffsetParent = getOffsetParent(arrowElement);
  var clientSize = arrowOffsetParent ? axis === 'y' ? arrowOffsetParent.clientHeight || 0 : arrowOffsetParent.clientWidth || 0 : 0;
  var centerToReference = endDiff / 2 - startDiff / 2; // Make sure the arrow doesn't overflow the popper if the center point is
  // outside of the popper bounds

  var min = paddingObject[minProp];
  var max = clientSize - arrowRect[len] - paddingObject[maxProp];
  var center = clientSize / 2 - arrowRect[len] / 2 + centerToReference;
  var offset = within(min, center, max); // Prevents breaking syntax highlighting...

  var axisProp = axis;
  state.modifiersData[name] = (_state$modifiersData$ = {}, _state$modifiersData$[axisProp] = offset, _state$modifiersData$.centerOffset = offset - center, _state$modifiersData$);
}

function arrow_effect(_ref2) {
  var state = _ref2.state,
      options = _ref2.options;
  var _options$element = options.element,
      arrowElement = _options$element === void 0 ? '[data-popper-arrow]' : _options$element;

  if (arrowElement == null) {
    return;
  } // CSS selector


  if (typeof arrowElement === 'string') {
    arrowElement = state.elements.popper.querySelector(arrowElement);

    if (!arrowElement) {
      return;
    }
  }

  if (false) {}

  if (!contains(state.elements.popper, arrowElement)) {
    if (false) {}

    return;
  }

  state.elements.arrow = arrowElement;
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_arrow = ({
  name: 'arrow',
  enabled: true,
  phase: 'main',
  fn: arrow,
  effect: arrow_effect,
  requires: ['popperOffsets'],
  requiresIfExists: ['preventOverflow']
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/modifiers/hide.js



function getSideOffsets(overflow, rect, preventedOffsets) {
  if (preventedOffsets === void 0) {
    preventedOffsets = {
      x: 0,
      y: 0
    };
  }

  return {
    top: overflow.top - rect.height - preventedOffsets.y,
    right: overflow.right - rect.width + preventedOffsets.x,
    bottom: overflow.bottom - rect.height + preventedOffsets.y,
    left: overflow.left - rect.width - preventedOffsets.x
  };
}

function isAnySideFullyClipped(overflow) {
  return [enums_top, right, bottom, left].some(function (side) {
    return overflow[side] >= 0;
  });
}

function hide(_ref) {
  var state = _ref.state,
      name = _ref.name;
  var referenceRect = state.rects.reference;
  var popperRect = state.rects.popper;
  var preventedOffsets = state.modifiersData.preventOverflow;
  var referenceOverflow = detectOverflow(state, {
    elementContext: 'reference'
  });
  var popperAltOverflow = detectOverflow(state, {
    altBoundary: true
  });
  var referenceClippingOffsets = getSideOffsets(referenceOverflow, referenceRect);
  var popperEscapeOffsets = getSideOffsets(popperAltOverflow, popperRect, preventedOffsets);
  var isReferenceHidden = isAnySideFullyClipped(referenceClippingOffsets);
  var hasPopperEscaped = isAnySideFullyClipped(popperEscapeOffsets);
  state.modifiersData[name] = {
    referenceClippingOffsets: referenceClippingOffsets,
    popperEscapeOffsets: popperEscapeOffsets,
    isReferenceHidden: isReferenceHidden,
    hasPopperEscaped: hasPopperEscaped
  };
  state.attributes.popper = Object.assign({}, state.attributes.popper, {
    'data-popper-reference-hidden': isReferenceHidden,
    'data-popper-escaped': hasPopperEscaped
  });
} // eslint-disable-next-line import/no-unused-modules


/* harmony default export */ const modifiers_hide = ({
  name: 'hide',
  enabled: true,
  phase: 'main',
  requiresIfExists: ['preventOverflow'],
  fn: hide
});
;// CONCATENATED MODULE: ./node_modules/@popperjs/core/lib/popper.js










var defaultModifiers = [eventListeners, modifiers_popperOffsets, modifiers_computeStyles, modifiers_applyStyles, modifiers_offset, modifiers_flip, modifiers_preventOverflow, modifiers_arrow, modifiers_hide];
var popper_createPopper = /*#__PURE__*/popperGenerator({
  defaultModifiers: defaultModifiers
}); // eslint-disable-next-line import/no-unused-modules

 // eslint-disable-next-line import/no-unused-modules

 // eslint-disable-next-line import/no-unused-modules


;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/popup-manager.mjs







const onTouchMove = (e) => {
  e.preventDefault();
  e.stopPropagation();
};
const onModalClick = () => {
  PopupManager == null ? void 0 : PopupManager.doOnModalClick();
};
let hasModal = false;
const getModal = function() {
  if (!shared_isClient)
    return void 0;
  let modalDom = PopupManager.modalDom;
  if (modalDom) {
    hasModal = true;
  } else {
    hasModal = false;
    modalDom = document.createElement("div");
    PopupManager.modalDom = modalDom;
    dom_on(modalDom, "touchmove", onTouchMove);
    dom_on(modalDom, "click", onModalClick);
  }
  return modalDom;
};
const instances = {};
const PopupManager = {
  modalFade: true,
  modalDom: void 0,
  globalInitialZIndex: 2e3,
  zIndex: 0,
  getInitialZIndex() {
    var _a;
    if (!runtime_core_esm_bundler_getCurrentInstance())
      return this.globalInitialZIndex;
    return (_a = useGlobalConfig("zIndex").value) != null ? _a : this.globalInitialZIndex;
  },
  getInstance(id) {
    return instances[id];
  },
  register(id, instance) {
    if (id && instance) {
      instances[id] = instance;
    }
  },
  deregister(id) {
    if (id) {
      instances[id] = null;
      delete instances[id];
    }
  },
  nextZIndex() {
    return this.getInitialZIndex() + ++this.zIndex;
  },
  modalStack: [],
  doOnModalClick() {
    const topItem = PopupManager.modalStack[PopupManager.modalStack.length - 1];
    if (!topItem)
      return;
    const instance = PopupManager.getInstance(topItem.id);
    if (instance && instance.closeOnClickModal.value) {
      instance.close();
    }
  },
  openModal(id, zIndex, dom, modalClass, modalFade) {
    if (!shared_isClient)
      return;
    if (!id || zIndex === void 0)
      return;
    this.modalFade = modalFade;
    const modalStack = this.modalStack;
    for (let i = 0, j = modalStack.length; i < j; i++) {
      const item = modalStack[i];
      if (item.id === id) {
        return;
      }
    }
    const modalDom = getModal();
    dom_addClass(modalDom, "v-modal");
    if (this.modalFade && !hasModal) {
      dom_addClass(modalDom, "v-modal-enter");
    }
    if (modalClass) {
      const classArr = modalClass.trim().split(/\s+/);
      classArr.forEach((item) => dom_addClass(modalDom, item));
    }
    setTimeout(() => {
      removeClass(modalDom, "v-modal-enter");
    }, 200);
    if (dom && dom.parentNode && dom.parentNode.nodeType !== 11) {
      dom.parentNode.appendChild(modalDom);
    } else {
      document.body.appendChild(modalDom);
    }
    if (zIndex) {
      modalDom.style.zIndex = String(zIndex);
    }
    modalDom.tabIndex = 0;
    modalDom.style.display = "";
    this.modalStack.push({ id, zIndex, modalClass });
  },
  closeModal(id) {
    const modalStack = this.modalStack;
    const modalDom = getModal();
    if (modalStack.length > 0) {
      const topItem = modalStack[modalStack.length - 1];
      if (topItem.id === id) {
        if (topItem.modalClass) {
          const classArr = topItem.modalClass.trim().split(/\s+/);
          classArr.forEach((item) => removeClass(modalDom, item));
        }
        modalStack.pop();
        if (modalStack.length > 0) {
          modalDom.style.zIndex = `${modalStack[modalStack.length - 1].zIndex}`;
        }
      } else {
        for (let i = modalStack.length - 1; i >= 0; i--) {
          if (modalStack[i].id === id) {
            modalStack.splice(i, 1);
            break;
          }
        }
      }
    }
    if (modalStack.length === 0) {
      if (this.modalFade) {
        dom_addClass(modalDom, "v-modal-leave");
      }
      setTimeout(() => {
        if (modalStack.length === 0) {
          if (modalDom.parentNode)
            modalDom.parentNode.removeChild(modalDom);
          modalDom.style.display = "none";
          PopupManager.modalDom = void 0;
        }
        removeClass(modalDom, "v-modal-leave");
      }, 200);
    }
  }
};
const getTopPopup = function() {
  if (!shared_isClient)
    return;
  if (PopupManager.modalStack.length > 0) {
    const topPopup = PopupManager.modalStack[PopupManager.modalStack.length - 1];
    if (!topPopup)
      return;
    const instance = PopupManager.getInstance(topPopup.id);
    return instance;
  }
};
if (shared_isClient) {
  window.addEventListener("keydown", function(event) {
    if (event.code === aria_EVENT_CODE.esc) {
      const topPopup = getTopPopup();
      if (topPopup && topPopup.closeOnPressEscape.value) {
        topPopup.handleClose ? topPopup.handleClose() : topPopup.handleAction ? topPopup.handleAction("cancel") : topPopup.close();
      }
    }
  });
}


//# sourceMappingURL=popup-manager.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/src/utils.mjs
const buildPopperOptions = (props, arrowProps) => {
  const { placement, strategy, popperOptions } = props;
  const options = {
    placement,
    strategy,
    ...popperOptions,
    modifiers: genModifiers(props)
  };
  attachArrow(options, arrowProps);
  deriveExtraModifiers(options, popperOptions == null ? void 0 : popperOptions.modifiers);
  return options;
};
const unwrapMeasurableEl = ($el) => {
  let el = null;
  if (!$el)
    return null;
  if ("getBoundingClientRect" in $el || $el instanceof HTMLElement) {
    el = $el;
  } else {
    el = $el.$el;
  }
  return el;
};
function genModifiers(options) {
  const { offset, gpuAcceleration, fallbackPlacements } = options;
  return [
    {
      name: "offset",
      options: {
        offset: [0, offset != null ? offset : 12]
      }
    },
    {
      name: "preventOverflow",
      options: {
        padding: {
          top: 2,
          bottom: 2,
          left: 5,
          right: 5
        }
      }
    },
    {
      name: "flip",
      options: {
        padding: 5,
        fallbackPlacements: fallbackPlacements != null ? fallbackPlacements : []
      }
    },
    {
      name: "computeStyles",
      options: {
        gpuAcceleration,
        adaptive: gpuAcceleration
      }
    }
  ];
}
function attachArrow(options, { arrowEl, arrowOffset }) {
  options.modifiers.push({
    name: "arrow",
    options: {
      element: arrowEl,
      padding: arrowOffset != null ? arrowOffset : 5
    }
  });
}
function deriveExtraModifiers(options, modifiers) {
  if (modifiers) {
    options.modifiers = [...options.modifiers, ...modifiers != null ? modifiers : []];
  }
}


//# sourceMappingURL=utils.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/src/content.mjs








const content_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElPopperContent",
  props: usePopperContentProps,
  emits: ["mouseenter", "mouseleave"],
  setup(props) {
    const { triggerRef, popperInstanceRef, contentRef } = runtime_core_esm_bundler_inject(POPPER_INJECTION_KEY, void 0);
    const popperContentRef = reactivity_esm_bundler_ref(null);
    const arrowRef = reactivity_esm_bundler_ref(null);
    const arrowOffset = reactivity_esm_bundler_ref();
    runtime_core_esm_bundler_provide(POPPER_CONTENT_INJECTION_KEY, {
      arrowRef,
      arrowOffset
    });
    const contentZIndex = reactivity_esm_bundler_ref(props.zIndex || PopupManager.nextZIndex());
    const contentStyle = runtime_core_esm_bundler_computed(() => [{ zIndex: reactivity_esm_bundler_unref(contentZIndex) }, props.popperStyle]);
    const contentClass = runtime_core_esm_bundler_computed(() => [
      {
        "el-popper": true,
        "is-pure": props.pure,
        [`is-${props.effect}`]: !!props.effect
      },
      props.popperClass
    ]);
    const createPopperInstance = ({
      referenceEl,
      popperContentEl,
      arrowEl
    }) => {
      const options = buildPopperOptions(props, {
        arrowEl,
        arrowOffset: reactivity_esm_bundler_unref(arrowOffset)
      });
      return popper_createPopper(referenceEl, popperContentEl, options);
    };
    const updatePopper = () => {
      var _a;
      (_a = reactivity_esm_bundler_unref(popperInstanceRef)) == null ? void 0 : _a.update();
      contentZIndex.value = props.zIndex || PopupManager.nextZIndex();
    };
    runtime_core_esm_bundler_onMounted(() => {
      let updateHandle;
      runtime_core_esm_bundler_watch(() => unwrapMeasurableEl(props.referenceEl) || reactivity_esm_bundler_unref(triggerRef), (val) => {
        var _a;
        updateHandle == null ? void 0 : updateHandle();
        if (val) {
          (_a = popperInstanceRef.value) == null ? void 0 : _a.destroy();
          const popperContentEl = reactivity_esm_bundler_unref(popperContentRef);
          contentRef.value = popperContentEl;
          const arrowEl = reactivity_esm_bundler_unref(arrowRef);
          const newInstance = createPopperInstance({
            referenceEl: val,
            popperContentEl: reactivity_esm_bundler_unref(popperContentRef),
            arrowEl
          });
          popperInstanceRef.value = newInstance;
          updateHandle = runtime_core_esm_bundler_watch(() => val.getBoundingClientRect(), () => {
            updatePopper();
          }, {
            immediate: true
          });
        } else {
          popperInstanceRef.value = null;
        }
      }, {
        immediate: true
      });
    });
    return {
      popperContentRef,
      popperInstanceRef,
      contentStyle,
      contentClass,
      updatePopper
    };
  }
});
function content_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    ref: "popperContentRef",
    style: normalizeStyle(_ctx.contentStyle),
    class: normalizeClass(_ctx.contentClass),
    role: "tooltip",
    onMouseenter: _cache[0] || (_cache[0] = (e) => _ctx.$emit("mouseenter", e)),
    onMouseleave: _cache[1] || (_cache[1] = (e) => _ctx.$emit("mouseleave", e))
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 38);
}
var ElPopperContent = /* @__PURE__ */ _export_sfc(content_sfc_main, [["render", content_sfc_render]]);


//# sourceMappingURL=content.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/visual-hidden/src/visual-hidden.mjs



const visual_hidden_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElVisuallyHidden",
  props: {
    style: {
      type: [String, Object, Array]
    }
  },
  setup(props) {
    return {
      computedStyle: runtime_core_esm_bundler_computed(() => {
        return [
          props.style,
          {
            position: "absolute",
            border: 0,
            width: 1,
            height: 1,
            padding: 0,
            margin: -1,
            overflow: "hidden",
            clip: "rect(0, 0, 0, 0)",
            whiteSpace: "nowrap",
            wordWrap: "normal"
          }
        ];
      })
    };
  }
});
function visual_hidden_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("span", mergeProps(_ctx.$attrs, { style: _ctx.computedStyle }), null, 16);
}
var ElVisuallyHidden = /* @__PURE__ */ _export_sfc(visual_hidden_sfc_main, [["render", visual_hidden_sfc_render]]);


//# sourceMappingURL=visual-hidden.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-escape-keydown/index.mjs




const useEscapeKeydown = (handler) => {
  const cachedHandler = (e) => {
    const event = e;
    if (event.key === aria_EVENT_CODE.esc) {
      handler == null ? void 0 : handler(event);
    }
  };
  runtime_core_esm_bundler_onMounted(() => {
    dom_on(document, "keydown", cachedHandler);
  });
  runtime_core_esm_bundler_onBeforeUnmount(() => {
    off(document, "keydown", cachedHandler);
  });
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/src/content.mjs













const src_content_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElTooltipContent",
  components: {
    ElPopperContent: ElPopperContent,
    ElVisuallyHidden: ElVisuallyHidden
  },
  inheritAttrs: false,
  props: useTooltipContentProps,
  setup(props) {
    const contentRef = reactivity_esm_bundler_ref(null);
    const intermediateOpen = reactivity_esm_bundler_ref(false);
    const entering = reactivity_esm_bundler_ref(false);
    const leaving = reactivity_esm_bundler_ref(false);
    const { controlled, id, open, trigger, onClose, onOpen, onShow, onHide } = runtime_core_esm_bundler_inject(TOOLTIP_INJECTION_KEY, void 0);
    const persistentRef = runtime_core_esm_bundler_computed(() => {
      if (false) {}
      return props.persistent;
    });
    const shouldRender = runtime_core_esm_bundler_computed(() => {
      return reactivity_esm_bundler_unref(persistentRef) ? true : reactivity_esm_bundler_unref(open);
    });
    const shouldShow = runtime_core_esm_bundler_computed(() => {
      return props.disabled ? false : reactivity_esm_bundler_unref(open);
    });
    const contentStyle = runtime_core_esm_bundler_computed(() => {
      var _a;
      return (_a = props.style) != null ? _a : {};
    });
    const ariaHidden = runtime_core_esm_bundler_computed(() => !reactivity_esm_bundler_unref(open));
    useEscapeKeydown(onClose);
    const onTransitionLeave = () => {
      onHide();
    };
    const stopWhenControlled = () => {
      if (reactivity_esm_bundler_unref(controlled))
        return true;
    };
    const onContentEnter = composeEventHandlers(stopWhenControlled, () => {
      if (props.enterable && reactivity_esm_bundler_unref(trigger) === "hover") {
        onOpen();
      }
    });
    const onContentLeave = composeEventHandlers(stopWhenControlled, () => {
      if (reactivity_esm_bundler_unref(trigger) === "hover") {
        onClose();
      }
    });
    const onBeforeEnter = () => {
      var _a, _b;
      (_b = (_a = contentRef.value) == null ? void 0 : _a.updatePopper) == null ? void 0 : _b.call(_a);
    };
    const onAfterShow = () => {
      onShow();
    };
    let stopHandle;
    runtime_core_esm_bundler_watch(() => reactivity_esm_bundler_unref(open), (val) => {
      if (val) {
        stopHandle = onClickOutside(runtime_core_esm_bundler_computed(() => {
          var _a;
          return (_a = contentRef.value) == null ? void 0 : _a.popperContentRef;
        }), () => {
          if (reactivity_esm_bundler_unref(controlled))
            return;
          const $trigger = reactivity_esm_bundler_unref(trigger);
          if ($trigger !== "hover") {
            onClose();
          }
        });
      } else {
        stopHandle == null ? void 0 : stopHandle();
      }
    }, {
      flush: "post"
    });
    return {
      ariaHidden,
      entering,
      leaving,
      id,
      intermediateOpen,
      contentStyle,
      contentRef,
      shouldRender,
      shouldShow,
      open,
      onAfterShow,
      onBeforeEnter,
      onContentEnter,
      onContentLeave,
      onTransitionLeave
    };
  }
});
function src_content_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_visually_hidden = resolveComponent("el-visually-hidden");
  const _component_el_popper_content = resolveComponent("el-popper-content");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(Teleport, {
    disabled: !_ctx.teleported,
    to: _ctx.appendTo
  }, [
    runtime_core_esm_bundler_createVNode(Transition, {
      name: _ctx.transition,
      onAfterLeave: _ctx.onTransitionLeave,
      onBeforeEnter: _ctx.onBeforeEnter,
      onAfterEnter: _ctx.onAfterShow
    }, {
      default: withCtx(() => [
        _ctx.shouldRender ? withDirectives((runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_popper_content, mergeProps({
          key: 0,
          ref: "contentRef"
        }, _ctx.$attrs, {
          "aria-hidden": _ctx.ariaHidden,
          "boundaries-padding": _ctx.boundariesPadding,
          "fallback-placements": _ctx.fallbackPlacements,
          "gpu-acceleration": _ctx.gpuAcceleration,
          offset: _ctx.offset,
          placement: _ctx.placement,
          "popper-options": _ctx.popperOptions,
          strategy: _ctx.strategy,
          effect: _ctx.effect,
          enterable: _ctx.enterable,
          pure: _ctx.pure,
          "popper-class": _ctx.popperClass,
          "popper-style": [_ctx.popperStyle, _ctx.contentStyle],
          "reference-el": _ctx.referenceEl,
          "z-index": _ctx.zIndex,
          onMouseenter: _ctx.onContentEnter,
          onMouseleave: _ctx.onContentLeave
        }), {
          default: withCtx(() => [
            renderSlot(_ctx.$slots, "default"),
            runtime_core_esm_bundler_createVNode(_component_el_visually_hidden, {
              id: _ctx.id,
              role: "tooltip"
            }, {
              default: withCtx(() => [
                createTextVNode(toDisplayString(_ctx.ariaLabel), 1)
              ]),
              _: 1
            }, 8, ["id"])
          ]),
          _: 3
        }, 16, ["aria-hidden", "boundaries-padding", "fallback-placements", "gpu-acceleration", "offset", "placement", "popper-options", "strategy", "effect", "enterable", "pure", "popper-class", "popper-style", "reference-el", "z-index", "onMouseenter", "onMouseleave"])), [
          [vShow, _ctx.shouldShow]
        ]) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
      ]),
      _: 3
    }, 8, ["name", "onAfterLeave", "onBeforeEnter", "onAfterEnter"])
  ], 8, ["disabled", "to"]);
}
var ElTooltipContent = /* @__PURE__ */ _export_sfc(src_content_sfc_main, [["render", src_content_sfc_render]]);


//# sourceMappingURL=content.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/src/utils.mjs




const isTriggerType = (trigger, type) => {
  if (shared_esm_bundler_isArray(trigger)) {
    return trigger.includes(type);
  }
  return trigger === type;
};
const whenTrigger = (trigger, type, handler) => {
  return (e) => {
    isTriggerType(reactivity_esm_bundler_unref(trigger), type) && handler(e);
  };
};


//# sourceMappingURL=utils.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-forward-ref/index.mjs


const FORWARD_REF_INJECTION_KEY = Symbol("elForwardRef");
const useForwardRef = (forwardRef) => {
  const setForwardRef = (el) => {
    forwardRef.value = el;
  };
  runtime_core_esm_bundler_provide(FORWARD_REF_INJECTION_KEY, {
    setForwardRef
  });
};
const useForwardRefDirective = (setForwardRef) => {
  return {
    mounted(el) {
      setForwardRef(el);
    },
    updated(el) {
      setForwardRef(el);
    },
    unmounted() {
      setForwardRef(null);
    }
  };
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slot/src/only-child.mjs






const NAME = "ElOnlyChild";
const OnlyChild = runtime_core_esm_bundler_defineComponent({
  name: NAME,
  setup(_, { slots, attrs }) {
    var _a;
    const forwardRefInjection = runtime_core_esm_bundler_inject(FORWARD_REF_INJECTION_KEY, void 0);
    const forwardRefDirective = useForwardRefDirective((_a = forwardRefInjection.setForwardRef) != null ? _a : shared_esm_bundler_NOOP);
    return () => {
      var _a2;
      const defaultSlot = (_a2 = slots.default) == null ? void 0 : _a2.call(slots, attrs);
      if (!defaultSlot)
        return null;
      if (defaultSlot.length > 1) {
        error_debugWarn(NAME, "ElOnlyChild requires exact only one valid child.");
        return null;
      }
      const firstLegitNode = findFirstLegitChild(defaultSlot);
      if (!firstLegitNode) {
        error_debugWarn(NAME, "no valid child node found");
        return null;
      }
      return withDirectives(cloneVNode(firstLegitNode, attrs), [
        [forwardRefDirective]
      ]);
    };
  }
});
function findFirstLegitChild(node) {
  if (!node)
    return null;
  const children = node;
  for (let i = 0; i < children.length; i++) {
    const child = children[i];
    if (shared_esm_bundler_isObject(child)) {
      switch (child.type) {
        case runtime_core_esm_bundler_Comment:
          continue;
        case runtime_core_esm_bundler_Text:
          return wrapTextContent(child);
        case runtime_core_esm_bundler_Fragment:
          return findFirstLegitChild(child.children);
        default:
          return child;
      }
    }
    return wrapTextContent(child);
  }
  return null;
}
function wrapTextContent(s) {
  return h("span", { class: "el-only-child__content" }, [s]);
}


//# sourceMappingURL=only-child.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/src/trigger.mjs










const trigger_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElPopperTrigger",
  components: { ElOnlyChild: OnlyChild },
  inheritAttrs: false,
  props: {
    ...usePopperTriggerProps,
    onMouseenter: Function,
    onMouseleave: Function,
    onClick: Function,
    onKeydown: Function,
    onFocus: Function,
    onBlur: Function,
    onContextmenu: Function,
    id: String,
    open: Boolean
  },
  setup(props) {
    const { triggerRef } = runtime_core_esm_bundler_inject(POPPER_INJECTION_KEY, void 0);
    useForwardRef(triggerRef);
    runtime_core_esm_bundler_watch(() => props.virtualRef, (val) => {
      if (val) {
        triggerRef.value = unwrapMeasurableEl(val);
      }
    }, {
      immediate: true
    });
    runtime_core_esm_bundler_watch(() => triggerRef.value, (el, prevEl) => {
      if (el && el instanceof HTMLElement) {
        ;
        [
          "onMouseenter",
          "onMouseleave",
          "onClick",
          "onKeydown",
          "onFocus",
          "onBlur",
          "onContextmenu"
        ].forEach((eventName) => {
          const handler = props[eventName];
          if (handler) {
            ;
            el.addEventListener(eventName.slice(2).toLowerCase(), handler);
            prevEl == null ? void 0 : prevEl.removeEventListener(eventName.slice(2).toLowerCase(), handler);
          }
        });
      }
    }, {
      immediate: true
    });
    return {
      triggerRef
    };
  }
});
function trigger_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_only_child = resolveComponent("el-only-child");
  return !_ctx.virtualTriggering ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_only_child, mergeProps({ key: 0 }, _ctx.$attrs, {
    "aria-describedby": _ctx.open ? _ctx.id : void 0
  }), {
    default: withCtx(() => [
      renderSlot(_ctx.$slots, "default")
    ]),
    _: 3
  }, 16, ["aria-describedby"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true);
}
var ElPopperTrigger = /* @__PURE__ */ _export_sfc(trigger_sfc_main, [["render", trigger_sfc_render]]);


//# sourceMappingURL=trigger.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/src/trigger.mjs










const src_trigger_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElTooltipTrigger",
  components: {
    ElPopperTrigger: ElPopperTrigger
  },
  props: useTooltipTriggerProps,
  setup(props) {
    const { controlled, id, open, onOpen, onClose, onToggle } = runtime_core_esm_bundler_inject(TOOLTIP_INJECTION_KEY, void 0);
    const triggerRef = reactivity_esm_bundler_ref(null);
    const stopWhenControlledOrDisabled = () => {
      if (reactivity_esm_bundler_unref(controlled) || props.disabled) {
        return true;
      }
    };
    const trigger = reactivity_esm_bundler_toRef(props, "trigger");
    const onMouseenter = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "hover", onOpen));
    const onMouseleave = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "hover", onClose));
    const onClick = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "click", (e) => {
      if (e.button === 0) {
        onToggle(e);
      }
    }));
    const onFocus = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "focus", onOpen));
    const onBlur = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "focus", onClose));
    const onContextMenu = composeEventHandlers(stopWhenControlledOrDisabled, whenTrigger(trigger, "contextmenu", (e) => {
      e.preventDefault();
      onToggle(e);
    }));
    const onKeydown = composeEventHandlers(stopWhenControlledOrDisabled, (e) => {
      const { code } = e;
      if (code === aria_EVENT_CODE.enter || code === aria_EVENT_CODE.space) {
        onToggle(e);
      }
    });
    return {
      onBlur,
      onContextMenu,
      onFocus,
      onMouseenter,
      onMouseleave,
      onClick,
      onKeydown,
      open,
      id,
      triggerRef
    };
  }
});
function src_trigger_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_popper_trigger = resolveComponent("el-popper-trigger");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_popper_trigger, {
    id: _ctx.id,
    "virtual-ref": _ctx.virtualRef,
    open: _ctx.open,
    "virtual-triggering": _ctx.virtualTriggering,
    class: "el-tooltip__trigger",
    onBlur: _ctx.onBlur,
    onClick: _ctx.onClick,
    onContextmenu: _ctx.onContextMenu,
    onFocus: _ctx.onFocus,
    onMouseenter: _ctx.onMouseenter,
    onMouseleave: _ctx.onMouseleave,
    onKeydown: _ctx.onKeydown
  }, {
    default: withCtx(() => [
      renderSlot(_ctx.$slots, "default")
    ]),
    _: 3
  }, 8, ["id", "virtual-ref", "open", "virtual-triggering", "onBlur", "onClick", "onContextmenu", "onFocus", "onMouseenter", "onMouseleave", "onKeydown"]);
}
var ElTooltipTrigger = /* @__PURE__ */ _export_sfc(src_trigger_sfc_main, [["render", src_trigger_sfc_render]]);


//# sourceMappingURL=trigger.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-model-toggle/index.mjs






const createModelToggleComposable = (name) => {
  const useModelToggleProps2 = {
    [name]: buildProp({
      type: definePropType(Boolean),
      default: null
    }),
    [`onUpdate:${name}`]: buildProp({
      type: definePropType(Function)
    })
  };
  const useModelToggleEmits2 = [`update:${name}`];
  const useModelToggle2 = ({
    indicator,
    shouldHideWhenRouteChanges,
    shouldProceed,
    onShow,
    onHide
  }) => {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const props = instance.props;
    const { emit } = instance;
    const updateEventKey = `update:${name}`;
    const hasUpdateHandler = runtime_core_esm_bundler_computed(() => shared_esm_bundler_isFunction(props[`onUpdate:${name}`]));
    const isModelBindingAbsent = runtime_core_esm_bundler_computed(() => props[name] === null);
    const doShow = () => {
      if (indicator.value === true) {
        return;
      }
      indicator.value = true;
      if (shared_esm_bundler_isFunction(onShow)) {
        onShow();
      }
    };
    const doHide = () => {
      if (indicator.value === false) {
        return;
      }
      indicator.value = false;
      if (shared_esm_bundler_isFunction(onHide)) {
        onHide();
      }
    };
    const show = () => {
      if (props.disabled === true || shared_esm_bundler_isFunction(shouldProceed) && !shouldProceed())
        return;
      const shouldEmit = hasUpdateHandler.value && shared_isClient;
      if (shouldEmit) {
        emit(updateEventKey, true);
      }
      if (isModelBindingAbsent.value || !shouldEmit) {
        doShow();
      }
    };
    const hide = () => {
      if (props.disabled === true || !shared_isClient)
        return;
      const shouldEmit = hasUpdateHandler.value && shared_isClient;
      if (shouldEmit) {
        emit(updateEventKey, false);
      }
      if (isModelBindingAbsent.value || !shouldEmit) {
        doHide();
      }
    };
    const onChange = (val) => {
      if (!isBool(val))
        return;
      if (props.disabled && val) {
        if (hasUpdateHandler.value) {
          emit(updateEventKey, false);
        }
      } else if (indicator.value !== val) {
        if (val) {
          doShow();
        } else {
          doHide();
        }
      }
    };
    const toggle = () => {
      if (indicator.value) {
        hide();
      } else {
        show();
      }
    };
    runtime_core_esm_bundler_watch(() => props[name], onChange);
    if (shouldHideWhenRouteChanges && instance.appContext.config.globalProperties.$route !== void 0) {
      runtime_core_esm_bundler_watch(() => ({
        ...instance.proxy.$route
      }), () => {
        if (shouldHideWhenRouteChanges.value && indicator.value) {
          hide();
        }
      });
    }
    runtime_core_esm_bundler_onMounted(() => {
      onChange(props[name]);
    });
    return {
      hide,
      show,
      toggle
    };
  };
  return {
    useModelToggle: useModelToggle2,
    useModelToggleProps: useModelToggleProps2,
    useModelToggleEmits: useModelToggleEmits2
  };
};
const { useModelToggle, useModelToggleProps, useModelToggleEmits } = createModelToggleComposable("modelValue");


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/popper/src/arrow.mjs





const arrow_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElPopperArrow",
  props: usePopperArrowProps,
  setup(props) {
    const arrowRef = reactivity_esm_bundler_ref(null);
    const popperContentInjection = runtime_core_esm_bundler_inject(POPPER_CONTENT_INJECTION_KEY, void 0);
    runtime_core_esm_bundler_watch(() => props.arrowOffset, (val) => {
      popperContentInjection.arrowOffset.value = val;
    });
    runtime_core_esm_bundler_onMounted(() => {
      popperContentInjection.arrowRef.value = reactivity_esm_bundler_unref(arrowRef);
    });
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      popperContentInjection.arrowRef.value = null;
    });
    return {
      arrowRef
    };
  }
});
const arrow_hoisted_1 = {
  ref: "arrowRef",
  class: "el-popper__arrow",
  "data-popper-arrow": ""
};
function arrow_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("span", arrow_hoisted_1, null, 512);
}
var ElPopperArrow = /* @__PURE__ */ _export_sfc(arrow_sfc_main, [["render", arrow_sfc_render]]);


//# sourceMappingURL=arrow.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-id/index.mjs




const defaultIdInjection = {
  prefix: Math.floor(Math.random() * 1e4),
  current: 0
};
const ID_INJECTION_KEY = Symbol("elIdInjection");
const useId = (deterministicId) => {
  const idInjection = runtime_core_esm_bundler_inject(ID_INJECTION_KEY, defaultIdInjection);
  if (!shared_isClient && idInjection === defaultIdInjection) {
    error_debugWarn("IdInjection", `Looks like you are using server rendering, you must provide a id provider to ensure the hydration process to be succeed
usage: app.provide(ID_INJECTION_KEY, {
  prefix: number,
  current: number,
})`);
  }
  const idRef = runtime_core_esm_bundler_computed(() => reactivity_esm_bundler_unref(deterministicId) || `el-id-${idInjection.prefix}-${idInjection.current++}`);
  return idRef;
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/src/tooltip2.mjs

















const { useModelToggleProps: tooltip2_useModelToggleProps, useModelToggle: tooltip2_useModelToggle, useModelToggleEmits: tooltip2_useModelToggleEmits } = createModelToggleComposable("visible");
const tooltip2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElTooltip",
  components: {
    ElPopper: ElPopper,
    ElPopperArrow: ElPopperArrow,
    ElTooltipContent: ElTooltipContent,
    ElTooltipTrigger: ElTooltipTrigger
  },
  props: {
    ...tooltip2_useModelToggleProps,
    ...useTooltipContentProps,
    ...useTooltipTriggerProps,
    ...usePopperArrowProps,
    ...useTooltipProps
  },
  emits: [...tooltip2_useModelToggleEmits, "show", "hide"],
  setup(props, { emit }) {
    usePopperContainer();
    const compatShowAfter = runtime_core_esm_bundler_computed(() => {
      if (!isUndefined(props.openDelay)) {
        error_debugWarn("ElTooltip", "open-delay is about to be deprecated in the next major version, please use `show-after` instead");
      }
      return props.openDelay || props.showAfter;
    });
    const compatShowArrow = runtime_core_esm_bundler_computed(() => {
      if (!isUndefined(props.visibleArrow)) {
        error_debugWarn("ElTooltip", "`visible-arrow` is about to be deprecated in the next major version, please use `show-arrow` instead");
      }
      return isBool(props.visibleArrow) ? props.visibleArrow : props.showArrow;
    });
    const id = useId();
    const popperRef = reactivity_esm_bundler_ref(null);
    const updatePopper = () => {
      var _a;
      const popperComponent = reactivity_esm_bundler_unref(popperRef);
      if (popperComponent) {
        (_a = popperComponent.popperInstanceRef) == null ? void 0 : _a.update();
      }
    };
    const open = reactivity_esm_bundler_ref(false);
    const { show, hide } = tooltip2_useModelToggle({
      indicator: open
    });
    const { onOpen, onClose } = useDelayedToggle({
      showAfter: compatShowAfter,
      hideAfter: reactivity_esm_bundler_toRef(props, "hideAfter"),
      open: show,
      close: hide
    });
    const controlled = runtime_core_esm_bundler_computed(() => isBool(props.visible));
    runtime_core_esm_bundler_provide(TOOLTIP_INJECTION_KEY, {
      controlled,
      id,
      open: reactivity_esm_bundler_readonly(open),
      trigger: reactivity_esm_bundler_toRef(props, "trigger"),
      onOpen,
      onClose,
      onToggle: () => {
        if (reactivity_esm_bundler_unref(open)) {
          onClose();
        } else {
          onOpen();
        }
      },
      onShow: () => {
        emit("show");
      },
      onHide: () => {
        emit("hide");
      },
      updatePopper
    });
    return {
      compatShowAfter,
      compatShowArrow,
      popperRef,
      open,
      hide,
      updatePopper,
      onOpen,
      onClose
    };
  }
});
const tooltip2_hoisted_1 = ["innerHTML"];
const tooltip2_hoisted_2 = { key: 1 };
function tooltip2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_tooltip_trigger = resolveComponent("el-tooltip-trigger");
  const _component_el_popper_arrow = resolveComponent("el-popper-arrow");
  const _component_el_tooltip_content = resolveComponent("el-tooltip-content");
  const _component_el_popper = resolveComponent("el-popper");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_popper, { ref: "popperRef" }, {
    default: withCtx(() => [
      runtime_core_esm_bundler_createVNode(_component_el_tooltip_trigger, {
        disabled: _ctx.disabled,
        trigger: _ctx.trigger,
        "virtual-ref": _ctx.virtualRef,
        "virtual-triggering": _ctx.virtualTriggering
      }, {
        default: withCtx(() => [
          _ctx.$slots.default ? renderSlot(_ctx.$slots, "default", { key: 0 }) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
        ]),
        _: 3
      }, 8, ["disabled", "trigger", "virtual-ref", "virtual-triggering"]),
      runtime_core_esm_bundler_createVNode(_component_el_tooltip_content, {
        "aria-label": _ctx.ariaLabel,
        "boundaries-padding": _ctx.boundariesPadding,
        content: _ctx.content,
        disabled: _ctx.disabled,
        effect: _ctx.effect,
        enterable: _ctx.enterable,
        "fallback-placements": _ctx.fallbackPlacements,
        "hide-after": _ctx.hideAfter,
        "gpu-acceleration": _ctx.gpuAcceleration,
        offset: _ctx.offset,
        persistent: _ctx.persistent,
        "popper-class": _ctx.popperClass,
        "popper-style": _ctx.popperStyle,
        placement: _ctx.placement,
        "popper-options": _ctx.popperOptions,
        pure: _ctx.pure,
        "raw-content": _ctx.rawContent,
        "reference-el": _ctx.referenceEl,
        "show-after": _ctx.compatShowAfter,
        strategy: _ctx.strategy,
        teleported: _ctx.teleported,
        transition: _ctx.transition,
        "z-index": _ctx.zIndex
      }, {
        default: withCtx(() => [
          renderSlot(_ctx.$slots, "content", {}, () => [
            _ctx.rawContent ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
              key: 0,
              innerHTML: _ctx.content
            }, null, 8, tooltip2_hoisted_1)) : (runtime_core_esm_bundler_openBlock(), createElementBlock("span", tooltip2_hoisted_2, toDisplayString(_ctx.content), 1))
          ]),
          _ctx.compatShowArrow ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_popper_arrow, {
            key: 0,
            "arrow-offset": _ctx.arrowOffset
          }, null, 8, ["arrow-offset"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
        ]),
        _: 3
      }, 8, ["aria-label", "boundaries-padding", "content", "disabled", "effect", "enterable", "fallback-placements", "hide-after", "gpu-acceleration", "offset", "persistent", "popper-class", "popper-style", "placement", "popper-options", "pure", "raw-content", "reference-el", "show-after", "strategy", "teleported", "transition", "z-index"])
    ]),
    _: 3
  }, 512);
}
var Tooltip = /* @__PURE__ */ _export_sfc(tooltip2_sfc_main, [["render", tooltip2_sfc_render]]);


//# sourceMappingURL=tooltip2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tooltip/index.mjs





const ElTooltip = withInstall(Tooltip);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/arrow-down.mjs



const arrow_down_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ArrowDown"
});
const arrow_down_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const arrow_down_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M831.872 340.864L512 652.672 192.128 340.864a30.592 30.592 0 00-42.752 0 29.12 29.12 0 000 41.6L489.664 714.24a32 32 0 0044.672 0l340.288-331.712a29.12 29.12 0 000-41.728 30.592 30.592 0 00-42.752 0z"
}, null, -1);
const arrow_down_hoisted_3 = [
  arrow_down_hoisted_2
];
function arrow_down_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", arrow_down_hoisted_1, arrow_down_hoisted_3);
}
var arrowDown = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(arrow_down_sfc_main, [["render", arrow_down_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/arrow-right.mjs



const arrow_right_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ArrowRight"
});
const arrow_right_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const arrow_right_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M340.864 149.312a30.592 30.592 0 000 42.752L652.736 512 340.864 831.872a30.592 30.592 0 000 42.752 29.12 29.12 0 0041.728 0L714.24 534.336a32 32 0 000-44.672L382.592 149.376a29.12 29.12 0 00-41.728 0z"
}, null, -1);
const arrow_right_hoisted_3 = [
  arrow_right_hoisted_2
];
function arrow_right_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", arrow_right_hoisted_1, arrow_right_hoisted_3);
}
var arrowRight = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(arrow_right_sfc_main, [["render", arrow_right_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/use-menu.mjs



function useMenu(instance, currentIndex) {
  const rootMenu = runtime_core_esm_bundler_inject("rootMenu");
  if (!rootMenu)
    throwError("useMenu", "can not inject root menu");
  const indexPath = runtime_core_esm_bundler_computed(() => {
    let parent = instance.parent;
    const path = [currentIndex.value];
    while (parent.type.name !== "ElMenu") {
      if (parent.props.index) {
        path.unshift(parent.props.index);
      }
      parent = parent.parent;
    }
    return path;
  });
  const parentMenu = runtime_core_esm_bundler_computed(() => {
    let parent = instance.parent;
    while (parent && !["ElMenu", "ElSubMenu"].includes(parent.type.name)) {
      parent = parent.parent;
    }
    return parent;
  });
  const paddingStyle = runtime_core_esm_bundler_computed(() => {
    let parent = instance.parent;
    if (rootMenu.props.mode !== "vertical")
      return {};
    let padding = 20;
    if (rootMenu.props.collapse) {
      padding = 20;
    } else {
      while (parent && parent.type.name !== "ElMenu") {
        if (parent.type.name === "ElSubMenu") {
          padding += 20;
        }
        parent = parent.parent;
      }
    }
    return { paddingLeft: `${padding}px` };
  });
  return {
    parentMenu,
    paddingStyle,
    indexPath
  };
}


//# sourceMappingURL=use-menu.mjs.map

;// CONCATENATED MODULE: ./node_modules/@ctrl/tinycolor/dist/module/util.js
/**
 * Take input from [0, n] and return it as [0, 1]
 * @hidden
 */
function bound01(n, max) {
  if (isOnePointZero(n)) {
    n = '100%';
  }

  var isPercent = isPercentage(n);
  n = max === 360 ? n : Math.min(max, Math.max(0, parseFloat(n))); // Automatically convert percentage into number

  if (isPercent) {
    n = parseInt(String(n * max), 10) / 100;
  } // Handle floating point rounding errors


  if (Math.abs(n - max) < 0.000001) {
    return 1;
  } // Convert into [0, 1] range if it isn't already


  if (max === 360) {
    // If n is a hue given in degrees,
    // wrap around out-of-range values into [0, 360] range
    // then convert into [0, 1].
    n = (n < 0 ? n % max + max : n % max) / parseFloat(String(max));
  } else {
    // If n not a hue given in degrees
    // Convert into [0, 1] range if it isn't already.
    n = n % max / parseFloat(String(max));
  }

  return n;
}
/**
 * Force a number between 0 and 1
 * @hidden
 */

function clamp01(val) {
  return Math.min(1, Math.max(0, val));
}
/**
 * Need to handle 1.0 as 100%, since once it is a number, there is no difference between it and 1
 * <http://stackoverflow.com/questions/7422072/javascript-how-to-detect-number-as-a-decimal-including-1-0>
 * @hidden
 */

function isOnePointZero(n) {
  return typeof n === 'string' && n.indexOf('.') !== -1 && parseFloat(n) === 1;
}
/**
 * Check to see if string passed in is a percentage
 * @hidden
 */

function isPercentage(n) {
  return typeof n === 'string' && n.indexOf('%') !== -1;
}
/**
 * Return a valid alpha value [0,1] with all invalid values being set to 1
 * @hidden
 */

function boundAlpha(a) {
  a = parseFloat(a);

  if (isNaN(a) || a < 0 || a > 1) {
    a = 1;
  }

  return a;
}
/**
 * Replace a decimal with it's percentage value
 * @hidden
 */

function convertToPercentage(n) {
  if (n <= 1) {
    return Number(n) * 100 + "%";
  }

  return n;
}
/**
 * Force a hex value to have 2 characters
 * @hidden
 */

function util_pad2(c) {
  return c.length === 1 ? '0' + c : String(c);
}
;// CONCATENATED MODULE: ./node_modules/@ctrl/tinycolor/dist/module/conversion.js
 // `rgbToHsl`, `rgbToHsv`, `hslToRgb`, `hsvToRgb` modified from:
// <http://mjijackson.com/2008/02/rgb-to-hsl-and-rgb-to-hsv-color-model-conversion-algorithms-in-javascript>

/**
 * Handle bounds / percentage checking to conform to CSS color spec
 * <http://www.w3.org/TR/css3-color/>
 * *Assumes:* r, g, b in [0, 255] or [0, 1]
 * *Returns:* { r, g, b } in [0, 255]
 */

function rgbToRgb(r, g, b) {
  return {
    r: bound01(r, 255) * 255,
    g: bound01(g, 255) * 255,
    b: bound01(b, 255) * 255
  };
}
/**
 * Converts an RGB color value to HSL.
 * *Assumes:* r, g, and b are contained in [0, 255] or [0, 1]
 * *Returns:* { h, s, l } in [0,1]
 */

function rgbToHsl(r, g, b) {
  r = bound01(r, 255);
  g = bound01(g, 255);
  b = bound01(b, 255);
  var max = Math.max(r, g, b);
  var min = Math.min(r, g, b);
  var h = 0;
  var s = 0;
  var l = (max + min) / 2;

  if (max === min) {
    s = 0;
    h = 0; // achromatic
  } else {
    var d = max - min;
    s = l > 0.5 ? d / (2 - max - min) : d / (max + min);

    switch (max) {
      case r:
        h = (g - b) / d + (g < b ? 6 : 0);
        break;

      case g:
        h = (b - r) / d + 2;
        break;

      case b:
        h = (r - g) / d + 4;
        break;

      default:
        break;
    }

    h /= 6;
  }

  return {
    h: h,
    s: s,
    l: l
  };
}

function hue2rgb(p, q, t) {
  if (t < 0) {
    t += 1;
  }

  if (t > 1) {
    t -= 1;
  }

  if (t < 1 / 6) {
    return p + (q - p) * (6 * t);
  }

  if (t < 1 / 2) {
    return q;
  }

  if (t < 2 / 3) {
    return p + (q - p) * (2 / 3 - t) * 6;
  }

  return p;
}
/**
 * Converts an HSL color value to RGB.
 *
 * *Assumes:* h is contained in [0, 1] or [0, 360] and s and l are contained [0, 1] or [0, 100]
 * *Returns:* { r, g, b } in the set [0, 255]
 */


function hslToRgb(h, s, l) {
  var r;
  var g;
  var b;
  h = bound01(h, 360);
  s = bound01(s, 100);
  l = bound01(l, 100);

  if (s === 0) {
    // achromatic
    g = l;
    b = l;
    r = l;
  } else {
    var q = l < 0.5 ? l * (1 + s) : l + s - l * s;
    var p = 2 * l - q;
    r = hue2rgb(p, q, h + 1 / 3);
    g = hue2rgb(p, q, h);
    b = hue2rgb(p, q, h - 1 / 3);
  }

  return {
    r: r * 255,
    g: g * 255,
    b: b * 255
  };
}
/**
 * Converts an RGB color value to HSV
 *
 * *Assumes:* r, g, and b are contained in the set [0, 255] or [0, 1]
 * *Returns:* { h, s, v } in [0,1]
 */

function rgbToHsv(r, g, b) {
  r = bound01(r, 255);
  g = bound01(g, 255);
  b = bound01(b, 255);
  var max = Math.max(r, g, b);
  var min = Math.min(r, g, b);
  var h = 0;
  var v = max;
  var d = max - min;
  var s = max === 0 ? 0 : d / max;

  if (max === min) {
    h = 0; // achromatic
  } else {
    switch (max) {
      case r:
        h = (g - b) / d + (g < b ? 6 : 0);
        break;

      case g:
        h = (b - r) / d + 2;
        break;

      case b:
        h = (r - g) / d + 4;
        break;

      default:
        break;
    }

    h /= 6;
  }

  return {
    h: h,
    s: s,
    v: v
  };
}
/**
 * Converts an HSV color value to RGB.
 *
 * *Assumes:* h is contained in [0, 1] or [0, 360] and s and v are contained in [0, 1] or [0, 100]
 * *Returns:* { r, g, b } in the set [0, 255]
 */

function hsvToRgb(h, s, v) {
  h = bound01(h, 360) * 6;
  s = bound01(s, 100);
  v = bound01(v, 100);
  var i = Math.floor(h);
  var f = h - i;
  var p = v * (1 - s);
  var q = v * (1 - f * s);
  var t = v * (1 - (1 - f) * s);
  var mod = i % 6;
  var r = [v, q, p, p, t, v][mod];
  var g = [t, v, v, q, p, p][mod];
  var b = [p, p, t, v, v, q][mod];
  return {
    r: r * 255,
    g: g * 255,
    b: b * 255
  };
}
/**
 * Converts an RGB color to hex
 *
 * Assumes r, g, and b are contained in the set [0, 255]
 * Returns a 3 or 6 character hex
 */

function rgbToHex(r, g, b, allow3Char) {
  var hex = [util_pad2(Math.round(r).toString(16)), util_pad2(Math.round(g).toString(16)), util_pad2(Math.round(b).toString(16))]; // Return a 3 character hex if possible

  if (allow3Char && hex[0].startsWith(hex[0].charAt(1)) && hex[1].startsWith(hex[1].charAt(1)) && hex[2].startsWith(hex[2].charAt(1))) {
    return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0);
  }

  return hex.join('');
}
/**
 * Converts an RGBA color plus alpha transparency to hex
 *
 * Assumes r, g, b are contained in the set [0, 255] and
 * a in [0, 1]. Returns a 4 or 8 character rgba hex
 */
// eslint-disable-next-line max-params

function rgbaToHex(r, g, b, a, allow4Char) {
  var hex = [util_pad2(Math.round(r).toString(16)), util_pad2(Math.round(g).toString(16)), util_pad2(Math.round(b).toString(16)), util_pad2(convertDecimalToHex(a))]; // Return a 4 character hex if possible

  if (allow4Char && hex[0].startsWith(hex[0].charAt(1)) && hex[1].startsWith(hex[1].charAt(1)) && hex[2].startsWith(hex[2].charAt(1)) && hex[3].startsWith(hex[3].charAt(1))) {
    return hex[0].charAt(0) + hex[1].charAt(0) + hex[2].charAt(0) + hex[3].charAt(0);
  }

  return hex.join('');
}
/**
 * Converts an RGBA color to an ARGB Hex8 string
 * Rarely used, but required for "toFilter()"
 */

function rgbaToArgbHex(r, g, b, a) {
  var hex = [pad2(convertDecimalToHex(a)), pad2(Math.round(r).toString(16)), pad2(Math.round(g).toString(16)), pad2(Math.round(b).toString(16))];
  return hex.join('');
}
/** Converts a decimal to a hex value */

function convertDecimalToHex(d) {
  return Math.round(parseFloat(d) * 255).toString(16);
}
/** Converts a hex value to a decimal */

function convertHexToDecimal(h) {
  return parseIntFromHex(h) / 255;
}
/** Parse a base-16 hex value into a base-10 integer */

function parseIntFromHex(val) {
  return parseInt(val, 16);
}
function numberInputToObject(color) {
  return {
    r: color >> 16,
    g: (color & 0xff00) >> 8,
    b: color & 0xff
  };
}
;// CONCATENATED MODULE: ./node_modules/@ctrl/tinycolor/dist/module/css-color-names.js
// https://github.com/bahamas10/css-color-names/blob/master/css-color-names.json

/**
 * @hidden
 */
var names = {
  aliceblue: '#f0f8ff',
  antiquewhite: '#faebd7',
  aqua: '#00ffff',
  aquamarine: '#7fffd4',
  azure: '#f0ffff',
  beige: '#f5f5dc',
  bisque: '#ffe4c4',
  black: '#000000',
  blanchedalmond: '#ffebcd',
  blue: '#0000ff',
  blueviolet: '#8a2be2',
  brown: '#a52a2a',
  burlywood: '#deb887',
  cadetblue: '#5f9ea0',
  chartreuse: '#7fff00',
  chocolate: '#d2691e',
  coral: '#ff7f50',
  cornflowerblue: '#6495ed',
  cornsilk: '#fff8dc',
  crimson: '#dc143c',
  cyan: '#00ffff',
  darkblue: '#00008b',
  darkcyan: '#008b8b',
  darkgoldenrod: '#b8860b',
  darkgray: '#a9a9a9',
  darkgreen: '#006400',
  darkgrey: '#a9a9a9',
  darkkhaki: '#bdb76b',
  darkmagenta: '#8b008b',
  darkolivegreen: '#556b2f',
  darkorange: '#ff8c00',
  darkorchid: '#9932cc',
  darkred: '#8b0000',
  darksalmon: '#e9967a',
  darkseagreen: '#8fbc8f',
  darkslateblue: '#483d8b',
  darkslategray: '#2f4f4f',
  darkslategrey: '#2f4f4f',
  darkturquoise: '#00ced1',
  darkviolet: '#9400d3',
  deeppink: '#ff1493',
  deepskyblue: '#00bfff',
  dimgray: '#696969',
  dimgrey: '#696969',
  dodgerblue: '#1e90ff',
  firebrick: '#b22222',
  floralwhite: '#fffaf0',
  forestgreen: '#228b22',
  fuchsia: '#ff00ff',
  gainsboro: '#dcdcdc',
  ghostwhite: '#f8f8ff',
  goldenrod: '#daa520',
  gold: '#ffd700',
  gray: '#808080',
  green: '#008000',
  greenyellow: '#adff2f',
  grey: '#808080',
  honeydew: '#f0fff0',
  hotpink: '#ff69b4',
  indianred: '#cd5c5c',
  indigo: '#4b0082',
  ivory: '#fffff0',
  khaki: '#f0e68c',
  lavenderblush: '#fff0f5',
  lavender: '#e6e6fa',
  lawngreen: '#7cfc00',
  lemonchiffon: '#fffacd',
  lightblue: '#add8e6',
  lightcoral: '#f08080',
  lightcyan: '#e0ffff',
  lightgoldenrodyellow: '#fafad2',
  lightgray: '#d3d3d3',
  lightgreen: '#90ee90',
  lightgrey: '#d3d3d3',
  lightpink: '#ffb6c1',
  lightsalmon: '#ffa07a',
  lightseagreen: '#20b2aa',
  lightskyblue: '#87cefa',
  lightslategray: '#778899',
  lightslategrey: '#778899',
  lightsteelblue: '#b0c4de',
  lightyellow: '#ffffe0',
  lime: '#00ff00',
  limegreen: '#32cd32',
  linen: '#faf0e6',
  magenta: '#ff00ff',
  maroon: '#800000',
  mediumaquamarine: '#66cdaa',
  mediumblue: '#0000cd',
  mediumorchid: '#ba55d3',
  mediumpurple: '#9370db',
  mediumseagreen: '#3cb371',
  mediumslateblue: '#7b68ee',
  mediumspringgreen: '#00fa9a',
  mediumturquoise: '#48d1cc',
  mediumvioletred: '#c71585',
  midnightblue: '#191970',
  mintcream: '#f5fffa',
  mistyrose: '#ffe4e1',
  moccasin: '#ffe4b5',
  navajowhite: '#ffdead',
  navy: '#000080',
  oldlace: '#fdf5e6',
  olive: '#808000',
  olivedrab: '#6b8e23',
  orange: '#ffa500',
  orangered: '#ff4500',
  orchid: '#da70d6',
  palegoldenrod: '#eee8aa',
  palegreen: '#98fb98',
  paleturquoise: '#afeeee',
  palevioletred: '#db7093',
  papayawhip: '#ffefd5',
  peachpuff: '#ffdab9',
  peru: '#cd853f',
  pink: '#ffc0cb',
  plum: '#dda0dd',
  powderblue: '#b0e0e6',
  purple: '#800080',
  rebeccapurple: '#663399',
  red: '#ff0000',
  rosybrown: '#bc8f8f',
  royalblue: '#4169e1',
  saddlebrown: '#8b4513',
  salmon: '#fa8072',
  sandybrown: '#f4a460',
  seagreen: '#2e8b57',
  seashell: '#fff5ee',
  sienna: '#a0522d',
  silver: '#c0c0c0',
  skyblue: '#87ceeb',
  slateblue: '#6a5acd',
  slategray: '#708090',
  slategrey: '#708090',
  snow: '#fffafa',
  springgreen: '#00ff7f',
  steelblue: '#4682b4',
  tan: '#d2b48c',
  teal: '#008080',
  thistle: '#d8bfd8',
  tomato: '#ff6347',
  turquoise: '#40e0d0',
  violet: '#ee82ee',
  wheat: '#f5deb3',
  white: '#ffffff',
  whitesmoke: '#f5f5f5',
  yellow: '#ffff00',
  yellowgreen: '#9acd32'
};
;// CONCATENATED MODULE: ./node_modules/@ctrl/tinycolor/dist/module/format-input.js



/**
 * Given a string or object, convert that input to RGB
 *
 * Possible string inputs:
 * ```
 * "red"
 * "#f00" or "f00"
 * "#ff0000" or "ff0000"
 * "#ff000000" or "ff000000"
 * "rgb 255 0 0" or "rgb (255, 0, 0)"
 * "rgb 1.0 0 0" or "rgb (1, 0, 0)"
 * "rgba (255, 0, 0, 1)" or "rgba 255, 0, 0, 1"
 * "rgba (1.0, 0, 0, 1)" or "rgba 1.0, 0, 0, 1"
 * "hsl(0, 100%, 50%)" or "hsl 0 100% 50%"
 * "hsla(0, 100%, 50%, 1)" or "hsla 0 100% 50%, 1"
 * "hsv(0, 100%, 100%)" or "hsv 0 100% 100%"
 * ```
 */

function inputToRGB(color) {
  var rgb = {
    r: 0,
    g: 0,
    b: 0
  };
  var a = 1;
  var s = null;
  var v = null;
  var l = null;
  var ok = false;
  var format = false;

  if (typeof color === 'string') {
    color = stringInputToObject(color);
  }

  if (typeof color === 'object') {
    if (isValidCSSUnit(color.r) && isValidCSSUnit(color.g) && isValidCSSUnit(color.b)) {
      rgb = rgbToRgb(color.r, color.g, color.b);
      ok = true;
      format = String(color.r).substr(-1) === '%' ? 'prgb' : 'rgb';
    } else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.v)) {
      s = convertToPercentage(color.s);
      v = convertToPercentage(color.v);
      rgb = hsvToRgb(color.h, s, v);
      ok = true;
      format = 'hsv';
    } else if (isValidCSSUnit(color.h) && isValidCSSUnit(color.s) && isValidCSSUnit(color.l)) {
      s = convertToPercentage(color.s);
      l = convertToPercentage(color.l);
      rgb = hslToRgb(color.h, s, l);
      ok = true;
      format = 'hsl';
    }

    if (Object.prototype.hasOwnProperty.call(color, 'a')) {
      a = color.a;
    }
  }

  a = boundAlpha(a);
  return {
    ok: ok,
    format: color.format || format,
    r: Math.min(255, Math.max(rgb.r, 0)),
    g: Math.min(255, Math.max(rgb.g, 0)),
    b: Math.min(255, Math.max(rgb.b, 0)),
    a: a
  };
} // <http://www.w3.org/TR/css3-values/#integers>

var CSS_INTEGER = '[-\\+]?\\d+%?'; // <http://www.w3.org/TR/css3-values/#number-value>

var CSS_NUMBER = '[-\\+]?\\d*\\.\\d+%?'; // Allow positive/negative integer/number.  Don't capture the either/or, just the entire outcome.

var CSS_UNIT = "(?:" + CSS_NUMBER + ")|(?:" + CSS_INTEGER + ")"; // Actual matching.
// Parentheses and commas are optional, but not required.
// Whitespace can take the place of commas or opening paren

var PERMISSIVE_MATCH3 = "[\\s|\\(]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")\\s*\\)?";
var PERMISSIVE_MATCH4 = "[\\s|\\(]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")[,|\\s]+(" + CSS_UNIT + ")\\s*\\)?";
var matchers = {
  CSS_UNIT: new RegExp(CSS_UNIT),
  rgb: new RegExp('rgb' + PERMISSIVE_MATCH3),
  rgba: new RegExp('rgba' + PERMISSIVE_MATCH4),
  hsl: new RegExp('hsl' + PERMISSIVE_MATCH3),
  hsla: new RegExp('hsla' + PERMISSIVE_MATCH4),
  hsv: new RegExp('hsv' + PERMISSIVE_MATCH3),
  hsva: new RegExp('hsva' + PERMISSIVE_MATCH4),
  hex3: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
  hex6: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/,
  hex4: /^#?([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})([0-9a-fA-F]{1})$/,
  hex8: /^#?([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})([0-9a-fA-F]{2})$/
};
/**
 * Permissive string parsing.  Take in a number of formats, and output an object
 * based on detected format.  Returns `{ r, g, b }` or `{ h, s, l }` or `{ h, s, v}`
 */

function stringInputToObject(color) {
  color = color.trim().toLowerCase();

  if (color.length === 0) {
    return false;
  }

  var named = false;

  if (names[color]) {
    color = names[color];
    named = true;
  } else if (color === 'transparent') {
    return {
      r: 0,
      g: 0,
      b: 0,
      a: 0,
      format: 'name'
    };
  } // Try to match string input using regular expressions.
  // Keep most of the number bounding out of this function - don't worry about [0,1] or [0,100] or [0,360]
  // Just return an object and let the conversion functions handle that.
  // This way the result will be the same whether the tinycolor is initialized with string or object.


  var match = matchers.rgb.exec(color);

  if (match) {
    return {
      r: match[1],
      g: match[2],
      b: match[3]
    };
  }

  match = matchers.rgba.exec(color);

  if (match) {
    return {
      r: match[1],
      g: match[2],
      b: match[3],
      a: match[4]
    };
  }

  match = matchers.hsl.exec(color);

  if (match) {
    return {
      h: match[1],
      s: match[2],
      l: match[3]
    };
  }

  match = matchers.hsla.exec(color);

  if (match) {
    return {
      h: match[1],
      s: match[2],
      l: match[3],
      a: match[4]
    };
  }

  match = matchers.hsv.exec(color);

  if (match) {
    return {
      h: match[1],
      s: match[2],
      v: match[3]
    };
  }

  match = matchers.hsva.exec(color);

  if (match) {
    return {
      h: match[1],
      s: match[2],
      v: match[3],
      a: match[4]
    };
  }

  match = matchers.hex8.exec(color);

  if (match) {
    return {
      r: parseIntFromHex(match[1]),
      g: parseIntFromHex(match[2]),
      b: parseIntFromHex(match[3]),
      a: convertHexToDecimal(match[4]),
      format: named ? 'name' : 'hex8'
    };
  }

  match = matchers.hex6.exec(color);

  if (match) {
    return {
      r: parseIntFromHex(match[1]),
      g: parseIntFromHex(match[2]),
      b: parseIntFromHex(match[3]),
      format: named ? 'name' : 'hex'
    };
  }

  match = matchers.hex4.exec(color);

  if (match) {
    return {
      r: parseIntFromHex(match[1] + match[1]),
      g: parseIntFromHex(match[2] + match[2]),
      b: parseIntFromHex(match[3] + match[3]),
      a: convertHexToDecimal(match[4] + match[4]),
      format: named ? 'name' : 'hex8'
    };
  }

  match = matchers.hex3.exec(color);

  if (match) {
    return {
      r: parseIntFromHex(match[1] + match[1]),
      g: parseIntFromHex(match[2] + match[2]),
      b: parseIntFromHex(match[3] + match[3]),
      format: named ? 'name' : 'hex'
    };
  }

  return false;
}
/**
 * Check to see if it looks like a CSS unit
 * (see `matchers` above for definition).
 */

function isValidCSSUnit(color) {
  return Boolean(matchers.CSS_UNIT.exec(String(color)));
}
;// CONCATENATED MODULE: ./node_modules/@ctrl/tinycolor/dist/module/index.js





var TinyColor =
/** @class */
function () {
  function TinyColor(color, opts) {
    if (color === void 0) {
      color = '';
    }

    if (opts === void 0) {
      opts = {};
    }

    var _a; // If input is already a tinycolor, return itself


    if (color instanceof TinyColor) {
      // eslint-disable-next-line no-constructor-return
      return color;
    }

    if (typeof color === 'number') {
      color = numberInputToObject(color);
    }

    this.originalInput = color;
    var rgb = inputToRGB(color);
    this.originalInput = color;
    this.r = rgb.r;
    this.g = rgb.g;
    this.b = rgb.b;
    this.a = rgb.a;
    this.roundA = Math.round(100 * this.a) / 100;
    this.format = (_a = opts.format) !== null && _a !== void 0 ? _a : rgb.format;
    this.gradientType = opts.gradientType; // Don't let the range of [0,255] come back in [0,1].
    // Potentially lose a little bit of precision here, but will fix issues where
    // .5 gets interpreted as half of the total, instead of half of 1
    // If it was supposed to be 128, this was already taken care of by `inputToRgb`

    if (this.r < 1) {
      this.r = Math.round(this.r);
    }

    if (this.g < 1) {
      this.g = Math.round(this.g);
    }

    if (this.b < 1) {
      this.b = Math.round(this.b);
    }

    this.isValid = rgb.ok;
  }

  TinyColor.prototype.isDark = function () {
    return this.getBrightness() < 128;
  };

  TinyColor.prototype.isLight = function () {
    return !this.isDark();
  };
  /**
   * Returns the perceived brightness of the color, from 0-255.
   */


  TinyColor.prototype.getBrightness = function () {
    // http://www.w3.org/TR/AERT#color-contrast
    var rgb = this.toRgb();
    return (rgb.r * 299 + rgb.g * 587 + rgb.b * 114) / 1000;
  };
  /**
   * Returns the perceived luminance of a color, from 0-1.
   */


  TinyColor.prototype.getLuminance = function () {
    // http://www.w3.org/TR/2008/REC-WCAG20-20081211/#relativeluminancedef
    var rgb = this.toRgb();
    var R;
    var G;
    var B;
    var RsRGB = rgb.r / 255;
    var GsRGB = rgb.g / 255;
    var BsRGB = rgb.b / 255;

    if (RsRGB <= 0.03928) {
      R = RsRGB / 12.92;
    } else {
      // eslint-disable-next-line prefer-exponentiation-operator
      R = Math.pow((RsRGB + 0.055) / 1.055, 2.4);
    }

    if (GsRGB <= 0.03928) {
      G = GsRGB / 12.92;
    } else {
      // eslint-disable-next-line prefer-exponentiation-operator
      G = Math.pow((GsRGB + 0.055) / 1.055, 2.4);
    }

    if (BsRGB <= 0.03928) {
      B = BsRGB / 12.92;
    } else {
      // eslint-disable-next-line prefer-exponentiation-operator
      B = Math.pow((BsRGB + 0.055) / 1.055, 2.4);
    }

    return 0.2126 * R + 0.7152 * G + 0.0722 * B;
  };
  /**
   * Returns the alpha value of a color, from 0-1.
   */


  TinyColor.prototype.getAlpha = function () {
    return this.a;
  };
  /**
   * Sets the alpha value on the current color.
   *
   * @param alpha - The new alpha value. The accepted range is 0-1.
   */


  TinyColor.prototype.setAlpha = function (alpha) {
    this.a = boundAlpha(alpha);
    this.roundA = Math.round(100 * this.a) / 100;
    return this;
  };
  /**
   * Returns the object as a HSVA object.
   */


  TinyColor.prototype.toHsv = function () {
    var hsv = rgbToHsv(this.r, this.g, this.b);
    return {
      h: hsv.h * 360,
      s: hsv.s,
      v: hsv.v,
      a: this.a
    };
  };
  /**
   * Returns the hsva values interpolated into a string with the following format:
   * "hsva(xxx, xxx, xxx, xx)".
   */


  TinyColor.prototype.toHsvString = function () {
    var hsv = rgbToHsv(this.r, this.g, this.b);
    var h = Math.round(hsv.h * 360);
    var s = Math.round(hsv.s * 100);
    var v = Math.round(hsv.v * 100);
    return this.a === 1 ? "hsv(" + h + ", " + s + "%, " + v + "%)" : "hsva(" + h + ", " + s + "%, " + v + "%, " + this.roundA + ")";
  };
  /**
   * Returns the object as a HSLA object.
   */


  TinyColor.prototype.toHsl = function () {
    var hsl = rgbToHsl(this.r, this.g, this.b);
    return {
      h: hsl.h * 360,
      s: hsl.s,
      l: hsl.l,
      a: this.a
    };
  };
  /**
   * Returns the hsla values interpolated into a string with the following format:
   * "hsla(xxx, xxx, xxx, xx)".
   */


  TinyColor.prototype.toHslString = function () {
    var hsl = rgbToHsl(this.r, this.g, this.b);
    var h = Math.round(hsl.h * 360);
    var s = Math.round(hsl.s * 100);
    var l = Math.round(hsl.l * 100);
    return this.a === 1 ? "hsl(" + h + ", " + s + "%, " + l + "%)" : "hsla(" + h + ", " + s + "%, " + l + "%, " + this.roundA + ")";
  };
  /**
   * Returns the hex value of the color.
   * @param allow3Char will shorten hex value to 3 char if possible
   */


  TinyColor.prototype.toHex = function (allow3Char) {
    if (allow3Char === void 0) {
      allow3Char = false;
    }

    return rgbToHex(this.r, this.g, this.b, allow3Char);
  };
  /**
   * Returns the hex value of the color -with a # appened.
   * @param allow3Char will shorten hex value to 3 char if possible
   */


  TinyColor.prototype.toHexString = function (allow3Char) {
    if (allow3Char === void 0) {
      allow3Char = false;
    }

    return '#' + this.toHex(allow3Char);
  };
  /**
   * Returns the hex 8 value of the color.
   * @param allow4Char will shorten hex value to 4 char if possible
   */


  TinyColor.prototype.toHex8 = function (allow4Char) {
    if (allow4Char === void 0) {
      allow4Char = false;
    }

    return rgbaToHex(this.r, this.g, this.b, this.a, allow4Char);
  };
  /**
   * Returns the hex 8 value of the color -with a # appened.
   * @param allow4Char will shorten hex value to 4 char if possible
   */


  TinyColor.prototype.toHex8String = function (allow4Char) {
    if (allow4Char === void 0) {
      allow4Char = false;
    }

    return '#' + this.toHex8(allow4Char);
  };
  /**
   * Returns the object as a RGBA object.
   */


  TinyColor.prototype.toRgb = function () {
    return {
      r: Math.round(this.r),
      g: Math.round(this.g),
      b: Math.round(this.b),
      a: this.a
    };
  };
  /**
   * Returns the RGBA values interpolated into a string with the following format:
   * "RGBA(xxx, xxx, xxx, xx)".
   */


  TinyColor.prototype.toRgbString = function () {
    var r = Math.round(this.r);
    var g = Math.round(this.g);
    var b = Math.round(this.b);
    return this.a === 1 ? "rgb(" + r + ", " + g + ", " + b + ")" : "rgba(" + r + ", " + g + ", " + b + ", " + this.roundA + ")";
  };
  /**
   * Returns the object as a RGBA object.
   */


  TinyColor.prototype.toPercentageRgb = function () {
    var fmt = function (x) {
      return Math.round(bound01(x, 255) * 100) + "%";
    };

    return {
      r: fmt(this.r),
      g: fmt(this.g),
      b: fmt(this.b),
      a: this.a
    };
  };
  /**
   * Returns the RGBA relative values interpolated into a string
   */


  TinyColor.prototype.toPercentageRgbString = function () {
    var rnd = function (x) {
      return Math.round(bound01(x, 255) * 100);
    };

    return this.a === 1 ? "rgb(" + rnd(this.r) + "%, " + rnd(this.g) + "%, " + rnd(this.b) + "%)" : "rgba(" + rnd(this.r) + "%, " + rnd(this.g) + "%, " + rnd(this.b) + "%, " + this.roundA + ")";
  };
  /**
   * The 'real' name of the color -if there is one.
   */


  TinyColor.prototype.toName = function () {
    if (this.a === 0) {
      return 'transparent';
    }

    if (this.a < 1) {
      return false;
    }

    var hex = '#' + rgbToHex(this.r, this.g, this.b, false);

    for (var _i = 0, _a = Object.entries(names); _i < _a.length; _i++) {
      var _b = _a[_i],
          key = _b[0],
          value = _b[1];

      if (hex === value) {
        return key;
      }
    }

    return false;
  };

  TinyColor.prototype.toString = function (format) {
    var formatSet = Boolean(format);
    format = format !== null && format !== void 0 ? format : this.format;
    var formattedString = false;
    var hasAlpha = this.a < 1 && this.a >= 0;
    var needsAlphaFormat = !formatSet && hasAlpha && (format.startsWith('hex') || format === 'name');

    if (needsAlphaFormat) {
      // Special case for "transparent", all other non-alpha formats
      // will return rgba when there is transparency.
      if (format === 'name' && this.a === 0) {
        return this.toName();
      }

      return this.toRgbString();
    }

    if (format === 'rgb') {
      formattedString = this.toRgbString();
    }

    if (format === 'prgb') {
      formattedString = this.toPercentageRgbString();
    }

    if (format === 'hex' || format === 'hex6') {
      formattedString = this.toHexString();
    }

    if (format === 'hex3') {
      formattedString = this.toHexString(true);
    }

    if (format === 'hex4') {
      formattedString = this.toHex8String(true);
    }

    if (format === 'hex8') {
      formattedString = this.toHex8String();
    }

    if (format === 'name') {
      formattedString = this.toName();
    }

    if (format === 'hsl') {
      formattedString = this.toHslString();
    }

    if (format === 'hsv') {
      formattedString = this.toHsvString();
    }

    return formattedString || this.toHexString();
  };

  TinyColor.prototype.toNumber = function () {
    return (Math.round(this.r) << 16) + (Math.round(this.g) << 8) + Math.round(this.b);
  };

  TinyColor.prototype.clone = function () {
    return new TinyColor(this.toString());
  };
  /**
   * Lighten the color a given amount. Providing 100 will always return white.
   * @param amount - valid between 1-100
   */


  TinyColor.prototype.lighten = function (amount) {
    if (amount === void 0) {
      amount = 10;
    }

    var hsl = this.toHsl();
    hsl.l += amount / 100;
    hsl.l = clamp01(hsl.l);
    return new TinyColor(hsl);
  };
  /**
   * Brighten the color a given amount, from 0 to 100.
   * @param amount - valid between 1-100
   */


  TinyColor.prototype.brighten = function (amount) {
    if (amount === void 0) {
      amount = 10;
    }

    var rgb = this.toRgb();
    rgb.r = Math.max(0, Math.min(255, rgb.r - Math.round(255 * -(amount / 100))));
    rgb.g = Math.max(0, Math.min(255, rgb.g - Math.round(255 * -(amount / 100))));
    rgb.b = Math.max(0, Math.min(255, rgb.b - Math.round(255 * -(amount / 100))));
    return new TinyColor(rgb);
  };
  /**
   * Darken the color a given amount, from 0 to 100.
   * Providing 100 will always return black.
   * @param amount - valid between 1-100
   */


  TinyColor.prototype.darken = function (amount) {
    if (amount === void 0) {
      amount = 10;
    }

    var hsl = this.toHsl();
    hsl.l -= amount / 100;
    hsl.l = clamp01(hsl.l);
    return new TinyColor(hsl);
  };
  /**
   * Mix the color with pure white, from 0 to 100.
   * Providing 0 will do nothing, providing 100 will always return white.
   * @param amount - valid between 1-100
   */


  TinyColor.prototype.tint = function (amount) {
    if (amount === void 0) {
      amount = 10;
    }

    return this.mix('white', amount);
  };
  /**
   * Mix the color with pure black, from 0 to 100.
   * Providing 0 will do nothing, providing 100 will always return black.
   * @param amount - valid between 1-100
   */


  TinyColor.prototype.shade = function (amount) {
    if (amount === void 0) {
      amount = 10;
    }

    return this.mix('black', amount);
  };
  /**
   * Desaturate the color a given amount, from 0 to 100.
   * Providing 100 will is the same as calling greyscale
   * @param amount - valid between 1-100
   */


  TinyColor.prototype.desaturate = function (amount) {
    if (amount === void 0) {
      amount = 10;
    }

    var hsl = this.toHsl();
    hsl.s -= amount / 100;
    hsl.s = clamp01(hsl.s);
    return new TinyColor(hsl);
  };
  /**
   * Saturate the color a given amount, from 0 to 100.
   * @param amount - valid between 1-100
   */


  TinyColor.prototype.saturate = function (amount) {
    if (amount === void 0) {
      amount = 10;
    }

    var hsl = this.toHsl();
    hsl.s += amount / 100;
    hsl.s = clamp01(hsl.s);
    return new TinyColor(hsl);
  };
  /**
   * Completely desaturates a color into greyscale.
   * Same as calling `desaturate(100)`
   */


  TinyColor.prototype.greyscale = function () {
    return this.desaturate(100);
  };
  /**
   * Spin takes a positive or negative amount within [-360, 360] indicating the change of hue.
   * Values outside of this range will be wrapped into this range.
   */


  TinyColor.prototype.spin = function (amount) {
    var hsl = this.toHsl();
    var hue = (hsl.h + amount) % 360;
    hsl.h = hue < 0 ? 360 + hue : hue;
    return new TinyColor(hsl);
  };
  /**
   * Mix the current color a given amount with another color, from 0 to 100.
   * 0 means no mixing (return current color).
   */


  TinyColor.prototype.mix = function (color, amount) {
    if (amount === void 0) {
      amount = 50;
    }

    var rgb1 = this.toRgb();
    var rgb2 = new TinyColor(color).toRgb();
    var p = amount / 100;
    var rgba = {
      r: (rgb2.r - rgb1.r) * p + rgb1.r,
      g: (rgb2.g - rgb1.g) * p + rgb1.g,
      b: (rgb2.b - rgb1.b) * p + rgb1.b,
      a: (rgb2.a - rgb1.a) * p + rgb1.a
    };
    return new TinyColor(rgba);
  };

  TinyColor.prototype.analogous = function (results, slices) {
    if (results === void 0) {
      results = 6;
    }

    if (slices === void 0) {
      slices = 30;
    }

    var hsl = this.toHsl();
    var part = 360 / slices;
    var ret = [this];

    for (hsl.h = (hsl.h - (part * results >> 1) + 720) % 360; --results;) {
      hsl.h = (hsl.h + part) % 360;
      ret.push(new TinyColor(hsl));
    }

    return ret;
  };
  /**
   * taken from https://github.com/infusion/jQuery-xcolor/blob/master/jquery.xcolor.js
   */


  TinyColor.prototype.complement = function () {
    var hsl = this.toHsl();
    hsl.h = (hsl.h + 180) % 360;
    return new TinyColor(hsl);
  };

  TinyColor.prototype.monochromatic = function (results) {
    if (results === void 0) {
      results = 6;
    }

    var hsv = this.toHsv();
    var h = hsv.h;
    var s = hsv.s;
    var v = hsv.v;
    var res = [];
    var modification = 1 / results;

    while (results--) {
      res.push(new TinyColor({
        h: h,
        s: s,
        v: v
      }));
      v = (v + modification) % 1;
    }

    return res;
  };

  TinyColor.prototype.splitcomplement = function () {
    var hsl = this.toHsl();
    var h = hsl.h;
    return [this, new TinyColor({
      h: (h + 72) % 360,
      s: hsl.s,
      l: hsl.l
    }), new TinyColor({
      h: (h + 216) % 360,
      s: hsl.s,
      l: hsl.l
    })];
  };
  /**
   * Compute how the color would appear on a background
   */


  TinyColor.prototype.onBackground = function (background) {
    var fg = this.toRgb();
    var bg = new TinyColor(background).toRgb();
    return new TinyColor({
      r: bg.r + (fg.r - bg.r) * fg.a,
      g: bg.g + (fg.g - bg.g) * fg.a,
      b: bg.b + (fg.b - bg.b) * fg.a
    });
  };
  /**
   * Alias for `polyad(3)`
   */


  TinyColor.prototype.triad = function () {
    return this.polyad(3);
  };
  /**
   * Alias for `polyad(4)`
   */


  TinyColor.prototype.tetrad = function () {
    return this.polyad(4);
  };
  /**
   * Get polyad colors, like (for 1, 2, 3, 4, 5, 6, 7, 8, etc...)
   * monad, dyad, triad, tetrad, pentad, hexad, heptad, octad, etc...
   */


  TinyColor.prototype.polyad = function (n) {
    var hsl = this.toHsl();
    var h = hsl.h;
    var result = [this];
    var increment = 360 / n;

    for (var i = 1; i < n; i++) {
      result.push(new TinyColor({
        h: (h + i * increment) % 360,
        s: hsl.s,
        l: hsl.l
      }));
    }

    return result;
  };
  /**
   * compare color vs current color
   */


  TinyColor.prototype.equals = function (color) {
    return this.toRgbString() === new TinyColor(color).toRgbString();
  };

  return TinyColor;
}();

 // kept for backwards compatability with v1

function tinycolor(color, opts) {
  if (color === void 0) {
    color = '';
  }

  if (opts === void 0) {
    opts = {};
  }

  return new TinyColor(color, opts);
}
;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/use-menu-color.mjs



function useMenuColor(props) {
  const menuBarColor = runtime_core_esm_bundler_computed(() => {
    const color = props.backgroundColor;
    if (!color) {
      return "";
    } else {
      return new TinyColor(color).shade(20).toString();
    }
  });
  return menuBarColor;
}


//# sourceMappingURL=use-menu-color.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/use-menu-css-var.mjs



const useMenuCssVar = (props) => {
  return runtime_core_esm_bundler_computed(() => {
    return {
      "--el-menu-text-color": props.textColor || "",
      "--el-menu-hover-text-color": props.textColor || "",
      "--el-menu-bg-color": props.backgroundColor || "",
      "--el-menu-hover-bg-color": useMenuColor(props).value || "",
      "--el-menu-active-color": props.activeTextColor || ""
    };
  });
};


//# sourceMappingURL=use-menu-css-var.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/sub-menu.mjs











const subMenuProps = buildProps({
  index: {
    type: String,
    required: true
  },
  showTimeout: {
    type: Number,
    default: 300
  },
  hideTimeout: {
    type: Number,
    default: 300
  },
  popperClass: String,
  disabled: Boolean,
  popperAppendToBody: {
    type: Boolean,
    default: void 0
  }
});
const sub_menu_COMPONENT_NAME = "ElSubMenu";
var sub_menu_SubMenu = runtime_core_esm_bundler_defineComponent({
  name: sub_menu_COMPONENT_NAME,
  props: subMenuProps,
  setup(props, { slots, expose }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const { paddingStyle, indexPath, parentMenu } = useMenu(instance, runtime_core_esm_bundler_computed(() => props.index));
    const rootMenu = runtime_core_esm_bundler_inject("rootMenu");
    if (!rootMenu)
      throwError(sub_menu_COMPONENT_NAME, "can not inject root menu");
    const subMenu = runtime_core_esm_bundler_inject(`subMenu:${parentMenu.value.uid}`);
    if (!subMenu)
      throwError(sub_menu_COMPONENT_NAME, "can not inject sub menu");
    const items = reactivity_esm_bundler_ref({});
    const subMenus = reactivity_esm_bundler_ref({});
    let timeout;
    const mouseInChild = reactivity_esm_bundler_ref(false);
    const verticalTitleRef = reactivity_esm_bundler_ref();
    const vPopper = reactivity_esm_bundler_ref(null);
    const currentPlacement = runtime_core_esm_bundler_computed(() => mode.value === "horizontal" && isFirstLevel.value ? "bottom-start" : "right-start");
    const subMenuTitleIcon = runtime_core_esm_bundler_computed(() => {
      return mode.value === "horizontal" && isFirstLevel.value || mode.value === "vertical" && !rootMenu.props.collapse ? arrowDown : arrowRight;
    });
    const isFirstLevel = runtime_core_esm_bundler_computed(() => {
      let isFirstLevel2 = true;
      let parent = instance.parent;
      while (parent && parent.type.name !== "ElMenu") {
        if (["ElSubMenu", "ElMenuItemGroup"].includes(parent.type.name)) {
          isFirstLevel2 = false;
          break;
        } else {
          parent = parent.parent;
        }
      }
      return isFirstLevel2;
    });
    const appendToBody = runtime_core_esm_bundler_computed(() => {
      return props.popperAppendToBody === void 0 ? isFirstLevel.value : Boolean(props.popperAppendToBody);
    });
    const menuTransitionName = runtime_core_esm_bundler_computed(() => rootMenu.props.collapse ? "el-zoom-in-left" : "el-zoom-in-top");
    const fallbackPlacements = runtime_core_esm_bundler_computed(() => mode.value === "horizontal" && isFirstLevel.value ? [
      "bottom-start",
      "bottom-end",
      "top-start",
      "top-end",
      "right-start",
      "left-start"
    ] : [
      "right-start",
      "left-start",
      "bottom-start",
      "bottom-end",
      "top-start",
      "top-end"
    ]);
    const opened = runtime_core_esm_bundler_computed(() => rootMenu.openedMenus.includes(props.index));
    const active = runtime_core_esm_bundler_computed(() => {
      let isActive = false;
      Object.values(items.value).forEach((item2) => {
        if (item2.active) {
          isActive = true;
        }
      });
      Object.values(subMenus.value).forEach((subItem) => {
        if (subItem.active) {
          isActive = true;
        }
      });
      return isActive;
    });
    const backgroundColor = runtime_core_esm_bundler_computed(() => rootMenu.props.backgroundColor || "");
    const activeTextColor = runtime_core_esm_bundler_computed(() => rootMenu.props.activeTextColor || "");
    const textColor = runtime_core_esm_bundler_computed(() => rootMenu.props.textColor || "");
    const mode = runtime_core_esm_bundler_computed(() => rootMenu.props.mode);
    const item = reactivity_esm_bundler_reactive({
      index: props.index,
      indexPath,
      active
    });
    const titleStyle = runtime_core_esm_bundler_computed(() => {
      if (mode.value !== "horizontal") {
        return {
          color: textColor.value
        };
      }
      return {
        borderBottomColor: active.value ? rootMenu.props.activeTextColor ? activeTextColor.value : "" : "transparent",
        color: active.value ? activeTextColor.value : textColor.value
      };
    });
    const doDestroy = () => {
      var _a, _b, _c;
      return (_c = (_b = (_a = vPopper.value) == null ? void 0 : _a.popperRef) == null ? void 0 : _b.popperInstanceRef) == null ? void 0 : _c.destroy();
    };
    const handleCollapseToggle = (value) => {
      if (!value) {
        doDestroy();
      }
    };
    const handleClick = () => {
      if (rootMenu.props.menuTrigger === "hover" && rootMenu.props.mode === "horizontal" || rootMenu.props.collapse && rootMenu.props.mode === "vertical" || props.disabled)
        return;
      rootMenu.handleSubMenuClick({
        index: props.index,
        indexPath: indexPath.value,
        active: active.value
      });
    };
    const handleMouseenter = (event, showTimeout = props.showTimeout) => {
      var _a;
      if (event.type === "focus" && !event.relatedTarget) {
        return;
      }
      if (rootMenu.props.menuTrigger === "click" && rootMenu.props.mode === "horizontal" || !rootMenu.props.collapse && rootMenu.props.mode === "vertical" || props.disabled) {
        return;
      }
      subMenu.mouseInChild.value = true;
      timeout == null ? void 0 : timeout();
      ({ stop: timeout } = shared_useTimeoutFn(() => {
        rootMenu.openMenu(props.index, indexPath.value);
      }, showTimeout));
      if (appendToBody.value) {
        (_a = parentMenu.value.vnode.el) == null ? void 0 : _a.dispatchEvent(new MouseEvent("mouseenter"));
      }
    };
    const handleMouseleave = (deepDispatch = false) => {
      var _a, _b;
      if (rootMenu.props.menuTrigger === "click" && rootMenu.props.mode === "horizontal" || !rootMenu.props.collapse && rootMenu.props.mode === "vertical") {
        return;
      }
      timeout == null ? void 0 : timeout();
      subMenu.mouseInChild.value = false;
      ({ stop: timeout } = shared_useTimeoutFn(() => !mouseInChild.value && rootMenu.closeMenu(props.index, indexPath.value), props.hideTimeout));
      if (appendToBody.value && deepDispatch) {
        if (((_a = instance.parent) == null ? void 0 : _a.type.name) === "ElSubMenu") {
          (_b = subMenu.handleMouseleave) == null ? void 0 : _b.call(subMenu, true);
        }
      }
    };
    runtime_core_esm_bundler_watch(() => rootMenu.props.collapse, (value) => handleCollapseToggle(Boolean(value)));
    {
      const addSubMenu = (item2) => {
        subMenus.value[item2.index] = item2;
      };
      const removeSubMenu = (item2) => {
        delete subMenus.value[item2.index];
      };
      runtime_core_esm_bundler_provide(`subMenu:${instance.uid}`, {
        addSubMenu,
        removeSubMenu,
        handleMouseleave,
        mouseInChild
      });
    }
    expose({
      opened
    });
    runtime_core_esm_bundler_onMounted(() => {
      rootMenu.addSubMenu(item);
      subMenu.addSubMenu(item);
    });
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      subMenu.removeSubMenu(item);
      rootMenu.removeSubMenu(item);
    });
    return () => {
      var _a;
      const titleTag = [
        (_a = slots.title) == null ? void 0 : _a.call(slots),
        h(ElIcon, {
          class: ["el-sub-menu__icon-arrow"]
        }, { default: () => h(subMenuTitleIcon.value) })
      ];
      const ulStyle = useMenuCssVar(rootMenu.props);
      const child = rootMenu.isMenuPopup ? h(ElTooltip, {
        ref: vPopper,
        visible: opened.value,
        effect: "light",
        pure: true,
        offset: 6,
        showArrow: false,
        persistent: true,
        popperClass: props.popperClass,
        placement: currentPlacement.value,
        teleported: appendToBody.value,
        fallbackPlacements: fallbackPlacements.value,
        transition: menuTransitionName.value,
        gpuAcceleration: false
      }, {
        content: () => {
          var _a2;
          return h("div", {
            class: [`el-menu--${mode.value}`, props.popperClass],
            onMouseenter: (evt) => handleMouseenter(evt, 100),
            onMouseleave: () => handleMouseleave(true),
            onFocus: (evt) => handleMouseenter(evt, 100)
          }, [
            h("ul", {
              class: [
                "el-menu el-menu--popup",
                `el-menu--popup-${currentPlacement.value}`
              ],
              style: ulStyle.value
            }, [(_a2 = slots.default) == null ? void 0 : _a2.call(slots)])
          ]);
        },
        default: () => h("div", {
          class: "el-sub-menu__title",
          style: [
            paddingStyle.value,
            titleStyle.value,
            { backgroundColor: backgroundColor.value }
          ],
          onClick: handleClick
        }, titleTag)
      }) : h(runtime_core_esm_bundler_Fragment, {}, [
        h("div", {
          class: "el-sub-menu__title",
          style: [
            paddingStyle.value,
            titleStyle.value,
            { backgroundColor: backgroundColor.value }
          ],
          ref: verticalTitleRef,
          onClick: handleClick
        }, titleTag),
        h(_CollapseTransition, {}, {
          default: () => {
            var _a2;
            return withDirectives(h("ul", {
              role: "menu",
              class: "el-menu el-menu--inline",
              style: ulStyle.value
            }, [(_a2 = slots.default) == null ? void 0 : _a2.call(slots)]), [[vShow, opened.value]]);
          }
        })
      ]);
      return h("li", {
        class: [
          "el-sub-menu",
          {
            "is-active": active.value,
            "is-opened": opened.value,
            "is-disabled": props.disabled
          }
        ],
        role: "menuitem",
        ariaHaspopup: true,
        ariaExpanded: opened.value,
        onMouseenter: handleMouseenter,
        onMouseleave: () => handleMouseleave(true),
        onFocus: handleMouseenter
      }, [child]);
    };
  }
});


//# sourceMappingURL=sub-menu.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/resize-event.mjs


const resizeHandler = function(entries) {
  for (const entry of entries) {
    const listeners = entry.target.__resizeListeners__ || [];
    if (listeners.length) {
      listeners.forEach((fn) => {
        fn();
      });
    }
  }
};
const addResizeListener = function(element, fn) {
  if (!shared_isClient || !element)
    return;
  if (!element.__resizeListeners__) {
    element.__resizeListeners__ = [];
    element.__ro__ = new ResizeObserver(resizeHandler);
    element.__ro__.observe(element);
  }
  element.__resizeListeners__.push(fn);
};
const removeResizeListener = function(element, fn) {
  var _a;
  if (!element || !element.__resizeListeners__)
    return;
  element.__resizeListeners__.splice(element.__resizeListeners__.indexOf(fn), 1);
  if (!element.__resizeListeners__.length) {
    (_a = element.__ro__) == null ? void 0 : _a.disconnect();
  }
};


//# sourceMappingURL=resize-event.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/directives/resize/index.mjs


const Resize = {
  beforeMount(el, binding) {
    el._handleResize = () => {
      var _a;
      el && ((_a = binding.value) == null ? void 0 : _a.call(binding, el));
    };
    addResizeListener(el, el._handleResize);
  },
  beforeUnmount(el) {
    removeResizeListener(el, el._handleResize);
  }
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/menu.mjs













const menuProps = buildProps({
  mode: {
    type: String,
    values: ["horizontal", "vertical"],
    default: "vertical"
  },
  defaultActive: {
    type: String,
    default: ""
  },
  defaultOpeneds: {
    type: definePropType(Array),
    default: () => mutable([])
  },
  uniqueOpened: Boolean,
  router: Boolean,
  menuTrigger: {
    type: String,
    values: ["hover", "click"],
    default: "hover"
  },
  collapse: Boolean,
  backgroundColor: String,
  textColor: String,
  activeTextColor: String,
  collapseTransition: {
    type: Boolean,
    default: true
  },
  ellipsis: {
    type: Boolean,
    default: true
  }
});
const checkIndexPath = (indexPath) => Array.isArray(indexPath) && indexPath.every((path) => shared_esm_bundler_isString(path));
const menuEmits = {
  close: (index, indexPath) => shared_esm_bundler_isString(index) && checkIndexPath(indexPath),
  open: (index, indexPath) => shared_esm_bundler_isString(index) && checkIndexPath(indexPath),
  select: (index, indexPath, item, routerResult) => shared_esm_bundler_isString(index) && checkIndexPath(indexPath) && shared_esm_bundler_isObject(item) && (routerResult === void 0 || routerResult instanceof Promise)
};
var menu_Menu = runtime_core_esm_bundler_defineComponent({
  name: "ElMenu",
  props: menuProps,
  emits: menuEmits,
  setup(props, { emit, slots, expose }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const router = instance.appContext.config.globalProperties.$router;
    const menu = reactivity_esm_bundler_ref();
    const openedMenus = reactivity_esm_bundler_ref(props.defaultOpeneds && !props.collapse ? props.defaultOpeneds.slice(0) : []);
    const activeIndex = reactivity_esm_bundler_ref(props.defaultActive);
    const items = reactivity_esm_bundler_ref({});
    const subMenus = reactivity_esm_bundler_ref({});
    const alteredCollapse = reactivity_esm_bundler_ref(false);
    const isMenuPopup = runtime_core_esm_bundler_computed(() => {
      return props.mode === "horizontal" || props.mode === "vertical" && props.collapse;
    });
    const initMenu = () => {
      const activeItem = activeIndex.value && items.value[activeIndex.value];
      if (!activeItem || props.mode === "horizontal" || props.collapse)
        return;
      const indexPath = activeItem.indexPath;
      indexPath.forEach((index) => {
        const subMenu = subMenus.value[index];
        subMenu && openMenu(index, subMenu.indexPath);
      });
    };
    const openMenu = (index, indexPath) => {
      if (openedMenus.value.includes(index))
        return;
      if (props.uniqueOpened) {
        openedMenus.value = openedMenus.value.filter((index2) => indexPath.includes(index2));
      }
      openedMenus.value.push(index);
      emit("open", index, indexPath);
    };
    const closeMenu = (index, indexPath) => {
      const i = openedMenus.value.indexOf(index);
      if (i !== -1) {
        openedMenus.value.splice(i, 1);
      }
      emit("close", index, indexPath);
    };
    const handleSubMenuClick = ({
      index,
      indexPath
    }) => {
      const isOpened = openedMenus.value.includes(index);
      if (isOpened) {
        closeMenu(index, indexPath);
      } else {
        openMenu(index, indexPath);
      }
    };
    const handleMenuItemClick = (menuItem) => {
      if (props.mode === "horizontal" || props.collapse) {
        openedMenus.value = [];
      }
      const { index, indexPath } = menuItem;
      if (index === void 0 || indexPath === void 0)
        return;
      if (props.router && router) {
        const route = menuItem.route || index;
        const routerResult = router.push(route).then((res) => {
          if (!res)
            activeIndex.value = index;
          return res;
        });
        emit("select", index, indexPath, { index, indexPath, route }, routerResult);
      } else {
        activeIndex.value = index;
        emit("select", index, indexPath, { index, indexPath });
      }
    };
    const updateActiveIndex = (val) => {
      const itemsInData = items.value;
      const item = itemsInData[val] || activeIndex.value && itemsInData[activeIndex.value] || itemsInData[props.defaultActive];
      if (item) {
        activeIndex.value = item.index;
        initMenu();
      } else {
        if (!alteredCollapse.value) {
          activeIndex.value = void 0;
        } else {
          alteredCollapse.value = false;
        }
      }
    };
    const handleResize = () => {
      runtime_core_esm_bundler_nextTick(() => instance.proxy.$forceUpdate());
    };
    runtime_core_esm_bundler_watch(() => props.defaultActive, (currentActive) => {
      if (!items.value[currentActive]) {
        activeIndex.value = "";
      }
      updateActiveIndex(currentActive);
    });
    runtime_core_esm_bundler_watch(items.value, () => initMenu());
    runtime_core_esm_bundler_watch(() => props.collapse, (value, prev) => {
      if (value !== prev) {
        alteredCollapse.value = true;
      }
      if (value)
        openedMenus.value = [];
    });
    {
      const addSubMenu = (item) => {
        subMenus.value[item.index] = item;
      };
      const removeSubMenu = (item) => {
        delete subMenus.value[item.index];
      };
      const addMenuItem = (item) => {
        items.value[item.index] = item;
      };
      const removeMenuItem = (item) => {
        delete items.value[item.index];
      };
      runtime_core_esm_bundler_provide("rootMenu", reactivity_esm_bundler_reactive({
        props,
        openedMenus,
        items,
        subMenus,
        activeIndex,
        isMenuPopup,
        addMenuItem,
        removeMenuItem,
        addSubMenu,
        removeSubMenu,
        openMenu,
        closeMenu,
        handleMenuItemClick,
        handleSubMenuClick
      }));
      runtime_core_esm_bundler_provide(`subMenu:${instance.uid}`, {
        addSubMenu,
        removeSubMenu,
        mouseInChild: reactivity_esm_bundler_ref(false)
      });
    }
    runtime_core_esm_bundler_onMounted(() => {
      initMenu();
      if (props.mode === "horizontal") {
        new Menu(instance.vnode.el);
      }
    });
    {
      const open = (index) => {
        const { indexPath } = subMenus.value[index];
        indexPath.forEach((i) => openMenu(i, indexPath));
      };
      expose({
        open,
        close: closeMenu,
        handleResize
      });
    }
    const flattedChildren = (children) => {
      const vnodes = Array.isArray(children) ? children : [children];
      const result = [];
      vnodes.forEach((child) => {
        if (Array.isArray(child.children)) {
          result.push(...flattedChildren(child.children));
        } else {
          result.push(child);
        }
      });
      return result;
    };
    const useVNodeResize = (vnode) => props.mode === "horizontal" ? withDirectives(vnode, [[Resize, handleResize]]) : vnode;
    return () => {
      var _a, _b, _c, _d;
      let slot = (_b = (_a = slots.default) == null ? void 0 : _a.call(slots)) != null ? _b : [];
      const vShowMore = [];
      if (props.mode === "horizontal" && menu.value) {
        const items2 = Array.from((_d = (_c = menu.value) == null ? void 0 : _c.childNodes) != null ? _d : []).filter((item) => item.nodeName !== "#text" || item.nodeValue);
        const originalSlot = flattedChildren(slot);
        const moreItemWidth = 64;
        const paddingLeft = parseInt(getComputedStyle(menu.value).paddingLeft, 10);
        const paddingRight = parseInt(getComputedStyle(menu.value).paddingRight, 10);
        const menuWidth = menu.value.clientWidth - paddingLeft - paddingRight;
        let calcWidth = 0;
        let sliceIndex = 0;
        items2.forEach((item, index) => {
          calcWidth += item.offsetWidth || 0;
          if (calcWidth <= menuWidth - moreItemWidth) {
            sliceIndex = index + 1;
          }
        });
        const slotDefault = originalSlot.slice(0, sliceIndex);
        const slotMore = originalSlot.slice(sliceIndex);
        if ((slotMore == null ? void 0 : slotMore.length) && props.ellipsis) {
          slot = slotDefault;
          vShowMore.push(h(sub_menu_SubMenu, {
            index: "sub-menu-more",
            class: "el-sub-menu__hide-arrow"
          }, {
            title: () => h(ElIcon, {
              class: ["el-sub-menu__icon-more"]
            }, { default: () => h(more) }),
            default: () => slotMore
          }));
        }
      }
      const ulStyle = useMenuCssVar(props);
      const resizeMenu = (vNode) => props.ellipsis ? useVNodeResize(vNode) : vNode;
      const vMenu = resizeMenu(h("ul", {
        key: String(props.collapse),
        role: "menubar",
        ref: menu,
        style: ulStyle.value,
        class: {
          "el-menu": true,
          "el-menu--horizontal": props.mode === "horizontal",
          "el-menu--collapse": props.collapse
        }
      }, [...slot.map((vnode) => resizeMenu(vnode)), ...vShowMore]));
      if (props.collapseTransition && props.mode === "vertical") {
        return h(ElMenuCollapseTransition, () => vMenu);
      }
      return vMenu;
    };
  }
});


//# sourceMappingURL=menu.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/menu-item.mjs




const menuItemProps = buildProps({
  index: {
    type: definePropType([String, null]),
    default: null
  },
  route: {
    type: definePropType([String, Object])
  },
  disabled: Boolean
});
const menuItemEmits = {
  click: (item) => shared_esm_bundler_isString(item.index) && Array.isArray(item.indexPath)
};


//# sourceMappingURL=menu-item.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/menu-item2.mjs









const menu_item2_COMPONENT_NAME = "ElMenuItem";
const menu_item2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: menu_item2_COMPONENT_NAME,
  components: {
    ElTooltip: ElTooltip
  },
  props: menuItemProps,
  emits: menuItemEmits,
  setup(props, { emit }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const rootMenu = runtime_core_esm_bundler_inject("rootMenu");
    if (!rootMenu)
      throwError(menu_item2_COMPONENT_NAME, "can not inject root menu");
    const { parentMenu, paddingStyle, indexPath } = useMenu(instance, reactivity_esm_bundler_toRef(props, "index"));
    const subMenu = runtime_core_esm_bundler_inject(`subMenu:${parentMenu.value.uid}`);
    if (!subMenu)
      throwError(menu_item2_COMPONENT_NAME, "can not inject sub menu");
    const active = runtime_core_esm_bundler_computed(() => props.index === rootMenu.activeIndex);
    const item = reactivity_esm_bundler_reactive({
      index: props.index,
      indexPath,
      active
    });
    const handleClick = () => {
      if (!props.disabled) {
        rootMenu.handleMenuItemClick({
          index: props.index,
          indexPath: indexPath.value,
          route: props.route
        });
        emit("click", item);
      }
    };
    runtime_core_esm_bundler_onMounted(() => {
      subMenu.addSubMenu(item);
      rootMenu.addMenuItem(item);
    });
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      subMenu.removeSubMenu(item);
      rootMenu.removeMenuItem(item);
    });
    return {
      Effect: Effect,
      parentMenu,
      rootMenu,
      paddingStyle,
      active,
      handleClick
    };
  }
});
const menu_item2_hoisted_1 = { style: {
  position: "absolute",
  left: 0,
  top: 0,
  height: "100%",
  width: "100%",
  display: "inline-block",
  boxSizing: "border-box",
  padding: "0 20px"
} };
function menu_item2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_tooltip = resolveComponent("el-tooltip");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("li", {
    class: normalizeClass(["el-menu-item", {
      "is-active": _ctx.active,
      "is-disabled": _ctx.disabled
    }]),
    role: "menuitem",
    tabindex: "-1",
    style: normalizeStyle(_ctx.paddingStyle),
    onClick: _cache[0] || (_cache[0] = (...args) => _ctx.handleClick && _ctx.handleClick(...args))
  }, [
    _ctx.parentMenu.type.name === "ElMenu" && _ctx.rootMenu.props.collapse && _ctx.$slots.title ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_tooltip, {
      key: 0,
      effect: _ctx.Effect.DARK,
      placement: "right",
      persistent: ""
    }, {
      content: withCtx(() => [
        renderSlot(_ctx.$slots, "title")
      ]),
      default: withCtx(() => [
        createBaseVNode("div", menu_item2_hoisted_1, [
          renderSlot(_ctx.$slots, "default")
        ])
      ]),
      _: 3
    }, 8, ["effect"])) : (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 1 }, [
      renderSlot(_ctx.$slots, "default"),
      renderSlot(_ctx.$slots, "title")
    ], 64))
  ], 6);
}
var menu_item2_MenuItem = /* @__PURE__ */ _export_sfc(menu_item2_sfc_main, [["render", menu_item2_sfc_render]]);


//# sourceMappingURL=menu-item2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/menu-item-group.mjs
const menuItemGroupProps = {
  title: String
};


//# sourceMappingURL=menu-item-group.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/src/menu-item-group2.mjs





const menu_item_group2_COMPONENT_NAME = "ElMenuItemGroup";
const menu_item_group2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: menu_item_group2_COMPONENT_NAME,
  props: menuItemGroupProps,
  setup() {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const menu = runtime_core_esm_bundler_inject("rootMenu");
    if (!menu)
      throwError(menu_item_group2_COMPONENT_NAME, "can not inject root menu");
    const levelPadding = runtime_core_esm_bundler_computed(() => {
      if (menu.props.collapse)
        return 20;
      let padding = 20;
      let parent = instance.parent;
      while (parent && parent.type.name !== "ElMenu") {
        if (parent.type.name === "ElSubMenu") {
          padding += 20;
        }
        parent = parent.parent;
      }
      return padding;
    });
    return {
      levelPadding
    };
  }
});
const menu_item_group2_hoisted_1 = { class: "el-menu-item-group" };
function menu_item_group2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("li", menu_item_group2_hoisted_1, [
    createBaseVNode("div", {
      class: "el-menu-item-group__title",
      style: normalizeStyle({ paddingLeft: `${_ctx.levelPadding}px` })
    }, [
      !_ctx.$slots.title ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 0 }, [
        createTextVNode(toDisplayString(_ctx.title), 1)
      ], 2112)) : renderSlot(_ctx.$slots, "title", { key: 1 })
    ], 4),
    createBaseVNode("ul", null, [
      renderSlot(_ctx.$slots, "default")
    ])
  ]);
}
var MenuItemGroup = /* @__PURE__ */ _export_sfc(menu_item_group2_sfc_main, [["render", menu_item_group2_sfc_render]]);


//# sourceMappingURL=menu-item-group2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/menu/index.mjs











const ElMenu = withInstall(menu_Menu, {
  MenuItem: menu_item2_MenuItem,
  MenuItemGroup: MenuItemGroup,
  SubMenu: sub_menu_SubMenu
});
const ElMenuItem = withNoopInstall(menu_item2_MenuItem);
const ElMenuItemGroup = withNoopInstall(MenuItemGroup);
const ElSubMenu = withNoopInstall(sub_menu_SubMenu);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/SideBar.vue?vue&type=template&id=2df32d5e&scoped=true
/* unplugin-vue-components disabled */








const _withScopeId = n => (pushScopeId("data-v-2df32d5e"), n = n(), popScopeId(), n);

const SideBarvue_type_template_id_2df32d5e_scoped_true_hoisted_1 = /*#__PURE__*/_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1646100577131",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "22083",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M426.666667 853.333333v-256h170.666666v256h213.333334v-341.333333h128L512 128 85.333333 512h128v341.333333h213.333334z",
  fill: "",
  "p-id": "22084"
})], -1
/* HOISTED */
));

const SideBarvue_type_template_id_2df32d5e_scoped_true_hoisted_2 = /*#__PURE__*/_withScopeId(() => /*#__PURE__*/createBaseVNode("span", null, "主页", -1
/* HOISTED */
));

const SideBarvue_type_template_id_2df32d5e_scoped_true_hoisted_3 = /*#__PURE__*/(/* unused pure expression or super */ null && (_withScopeId(() => /*#__PURE__*/_createElementVNode("svg", {
  t: "1646098033361",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "20883",
  width: "200",
  height: "200"
}, [/*#__PURE__*/_createElementVNode("path", {
  d: "M810.666667 810.666667H213.333333V341.333333h597.333334m-128-298.666666v85.333333H341.333333V42.666667H256v85.333333H213.333333c-47.36 0-85.333333 37.973333-85.333333 85.333333v597.333334a85.333333 85.333333 0 0 0 85.333333 85.333333h597.333334a85.333333 85.333333 0 0 0 85.333333-85.333333V213.333333a85.333333 85.333333 0 0 0-85.333333-85.333333h-42.666667V42.666667m-42.666667 469.333333h-213.333333v213.333333h213.333333v-213.333333z",
  fill: "",
  "p-id": "20884"
})], -1
/* HOISTED */
))));

const _hoisted_4 = /*#__PURE__*/(/* unused pure expression or super */ null && (_withScopeId(() => /*#__PURE__*/_createElementVNode("span", null, "课程列表", -1
/* HOISTED */
))));

const _hoisted_5 = /*#__PURE__*/_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1646098098097",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21183",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M384 170.666667a170.666667 170.666667 0 0 0-170.666667 170.666666 170.666667 170.666667 0 0 0 170.666667 170.666667 170.666667 170.666667 0 0 0 170.666667-170.666667 170.666667 170.666667 0 0 0-170.666667-170.666666m0 426.666666c-113.92 0-341.333333 56.746667-341.333333 170.666667v85.333333h472.746666c-2.133333-14.08-3.413333-28.16-3.413333-42.666666 0-64 21.333333-128 60.16-179.2-65.28-22.186667-137.813333-34.133333-188.16-34.133334m384 0a11.093333 11.093333 0 0 0-11.093333 8.96l-8.106667 56.32c-12.8 5.546667-25.173333 12.373333-36.266667 20.053334l-52.906666-21.333334c-4.693333 0-10.24 0-13.226667 5.546667l-42.666667 73.813333c-2.56 4.693333-1.706667 10.24 2.56 13.653334l45.226667 34.986666a178.901333 178.901333 0 0 0 0 42.666667l-45.226667 34.986667a11.093333 11.093333 0 0 0-2.56 13.653333l42.666667 73.813333c2.56 5.546667 8.106667 5.546667 13.226667 5.546667l52.906666-21.333333c11.093333 7.68 23.04 14.933333 36.266667 20.053333l8.106667 56.32c0.853333 5.12 5.12 8.96 11.093333 8.96h85.333333c4.693333 0 9.386667-3.84 10.24-8.96l8.106667-56.32c12.8-5.546667 24.32-12.373333 35.84-20.053333l52.48 21.333333c5.546667 0 11.093333 0 14.08-5.546667l42.666667-73.813333a11.093333 11.093333 0 0 0-2.56-13.653333l-45.653334-34.986667c0.853333-7.253333 1.706667-14.08 1.706667-21.333333 0-7.253333-0.426667-14.08-1.706667-21.333334l45.226667-34.986666a11.093333 11.093333 0 0 0 2.56-13.653334l-42.666667-73.813333c-2.56-5.546667-8.106667-5.546667-13.653333-5.546667l-52.48 21.333334c-11.52-7.68-23.04-14.933333-36.266667-20.053334l-8.106666-56.32A10.069333 10.069333 0 0 0 853.333333 597.333333m-42.666666 149.333334a64 64 0 0 1 64 64 64 64 0 0 1-64 64c-35.84 0-64-28.586667-64-64a64 64 0 0 1 64-64z",
  fill: "",
  "p-id": "21184"
})], -1
/* HOISTED */
));

const _hoisted_6 = /*#__PURE__*/_withScopeId(() => /*#__PURE__*/createBaseVNode("span", null, "个人设置", -1
/* HOISTED */
));

const _hoisted_7 = /*#__PURE__*/_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1646097918982",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "20733",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M554.666667 384h-85.333334V298.666667h85.333334m0 426.666666h-85.333334v-256h85.333334m-42.666667-384A426.666667 426.666667 0 0 0 85.333333 512a426.666667 426.666667 0 0 0 426.666667 426.666667 426.666667 426.666667 0 0 0 426.666667-426.666667A426.666667 426.666667 0 0 0 512 85.333333z",
  fill: "",
  "p-id": "20734"
})], -1
/* HOISTED */
));

const _hoisted_8 = /*#__PURE__*/_withScopeId(() => /*#__PURE__*/createBaseVNode("span", null, "关于", -1
/* HOISTED */
));

function SideBarvue_type_template_id_2df32d5e_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = ElIcon;

  const _component_el_menu_item = ElMenuItem;

  const _component_el_menu_item_group = ElMenuItemGroup;

  const _component_el_sub_menu = ElSubMenu;

  const _component_el_menu = ElMenu;

  const _component_el_aside = ElAside;

  const _component_el_scrollbar = ElScrollbar;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_scrollbar, null, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_aside, null, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_menu, {
        "default-active": "welcome",
        "text-color": "#7e8f9f",
        "active-text-color": "#005bac",
        "default-openeds": ['lesson'],
        onSelect: $options.handleSelect
      }, {
        default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_menu_item, {
          class: "mdui-ripple",
          index: "welcome"
        }, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, {
            size: $data.iconSize
          }, {
            default: withCtx(() => [SideBarvue_type_template_id_2df32d5e_scoped_true_hoisted_1]),
            _: 1
            /* STABLE */

          }, 8
          /* PROPS */
          , ["size"]), SideBarvue_type_template_id_2df32d5e_scoped_true_hoisted_2]),
          _: 1
          /* STABLE */

        }),  false ? (0) : runtime_core_esm_bundler_createCommentVNode("v-if", true), runtime_core_esm_bundler_createVNode(_component_el_menu_item, {
          class: "mdui-ripple",
          index: "profile"
        }, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, {
            size: $data.iconSize
          }, {
            default: withCtx(() => [_hoisted_5]),
            _: 1
            /* STABLE */

          }, 8
          /* PROPS */
          , ["size"]), _hoisted_6]),
          _: 1
          /* STABLE */

        }), runtime_core_esm_bundler_createVNode(_component_el_menu_item, {
          class: "mdui-ripple",
          index: "about"
        }, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, {
            size: $data.iconSize
          }, {
            default: withCtx(() => [_hoisted_7]),
            _: 1
            /* STABLE */

          }, 8
          /* PROPS */
          , ["size"]), _hoisted_8]),
          _: 1
          /* STABLE */

        })]),
        _: 1
        /* STABLE */

      }, 8
      /* PROPS */
      , ["onSelect"])]),
      _: 1
      /* STABLE */

    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Common/SideBar.vue?vue&type=template&id=2df32d5e&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/close.mjs



const close_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "Close"
});
const close_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const close_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M764.288 214.592L512 466.88 259.712 214.592a31.936 31.936 0 00-45.12 45.12L466.752 512 214.528 764.224a31.936 31.936 0 1045.12 45.184L512 557.184l252.288 252.288a31.936 31.936 0 0045.12-45.12L557.12 512.064l252.288-252.352a31.936 31.936 0 10-45.12-45.184z"
}, null, -1);
const close_hoisted_3 = [
  close_hoisted_2
];
function close_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", close_hoisted_1, close_hoisted_3);
}
var close_close = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(close_sfc_main, [["render", close_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/success-filled.mjs



const success_filled_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "SuccessFilled"
});
const success_filled_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const success_filled_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 64a448 448 0 110 896 448 448 0 010-896zm-55.808 536.384l-99.52-99.584a38.4 38.4 0 10-54.336 54.336l126.72 126.72a38.272 38.272 0 0054.336 0l262.4-262.464a38.4 38.4 0 10-54.272-54.336L456.192 600.384z"
}, null, -1);
const success_filled_hoisted_3 = [
  success_filled_hoisted_2
];
function success_filled_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", success_filled_hoisted_1, success_filled_hoisted_3);
}
var successFilled = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(success_filled_sfc_main, [["render", success_filled_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/info-filled.mjs



const info_filled_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "InfoFilled"
});
const info_filled_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const info_filled_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 64a448 448 0 110 896.064A448 448 0 01512 64zm67.2 275.072c33.28 0 60.288-23.104 60.288-57.344s-27.072-57.344-60.288-57.344c-33.28 0-60.16 23.104-60.16 57.344s26.88 57.344 60.16 57.344zM590.912 699.2c0-6.848 2.368-24.64 1.024-34.752l-52.608 60.544c-10.88 11.456-24.512 19.392-30.912 17.28a12.992 12.992 0 01-8.256-14.72l87.68-276.992c7.168-35.136-12.544-67.2-54.336-71.296-44.096 0-108.992 44.736-148.48 101.504 0 6.784-1.28 23.68.064 33.792l52.544-60.608c10.88-11.328 23.552-19.328 29.952-17.152a12.8 12.8 0 017.808 16.128L388.48 728.576c-10.048 32.256 8.96 63.872 55.04 71.04 67.84 0 107.904-43.648 147.456-100.416z"
}, null, -1);
const info_filled_hoisted_3 = [
  info_filled_hoisted_2
];
function info_filled_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", info_filled_hoisted_1, info_filled_hoisted_3);
}
var infoFilled = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(info_filled_sfc_main, [["render", info_filled_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/warning-filled.mjs



const warning_filled_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "WarningFilled"
});
const warning_filled_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const warning_filled_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 64a448 448 0 110 896 448 448 0 010-896zm0 192a58.432 58.432 0 00-58.24 63.744l23.36 256.384a35.072 35.072 0 0069.76 0l23.296-256.384A58.432 58.432 0 00512 256zm0 512a51.2 51.2 0 100-102.4 51.2 51.2 0 000 102.4z"
}, null, -1);
const warning_filled_hoisted_3 = [
  warning_filled_hoisted_2
];
function warning_filled_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", warning_filled_hoisted_1, warning_filled_hoisted_3);
}
var warningFilled = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(warning_filled_sfc_main, [["render", warning_filled_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/circle-close-filled.mjs



const circle_close_filled_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "CircleCloseFilled"
});
const circle_close_filled_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const circle_close_filled_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 64a448 448 0 110 896 448 448 0 010-896zm0 393.664L407.936 353.6a38.4 38.4 0 10-54.336 54.336L457.664 512 353.6 616.064a38.4 38.4 0 1054.336 54.336L512 566.336 616.064 670.4a38.4 38.4 0 1054.336-54.336L566.336 512 670.4 407.936a38.4 38.4 0 10-54.336-54.336L512 457.664z"
}, null, -1);
const circle_close_filled_hoisted_3 = [
  circle_close_filled_hoisted_2
];
function circle_close_filled_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", circle_close_filled_hoisted_1, circle_close_filled_hoisted_3);
}
var circleCloseFilled = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(circle_close_filled_sfc_main, [["render", circle_close_filled_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/loading.mjs



const loading_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "Loading"
});
const loading_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const loading_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 64a32 32 0 0132 32v192a32 32 0 01-64 0V96a32 32 0 0132-32zm0 640a32 32 0 0132 32v192a32 32 0 11-64 0V736a32 32 0 0132-32zm448-192a32 32 0 01-32 32H736a32 32 0 110-64h192a32 32 0 0132 32zm-640 0a32 32 0 01-32 32H96a32 32 0 010-64h192a32 32 0 0132 32zM195.2 195.2a32 32 0 0145.248 0L376.32 331.008a32 32 0 01-45.248 45.248L195.2 240.448a32 32 0 010-45.248zm452.544 452.544a32 32 0 0145.248 0L828.8 783.552a32 32 0 01-45.248 45.248L647.744 692.992a32 32 0 010-45.248zM828.8 195.264a32 32 0 010 45.184L692.992 376.32a32 32 0 01-45.248-45.248l135.808-135.808a32 32 0 0145.248 0zm-452.544 452.48a32 32 0 010 45.248L240.448 828.8a32 32 0 01-45.248-45.248l135.808-135.808a32 32 0 0145.248 0z"
}, null, -1);
const loading_hoisted_3 = [
  loading_hoisted_2
];
function loading_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", loading_hoisted_1, loading_hoisted_3);
}
var loading = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(loading_sfc_main, [["render", loading_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/circle-check.mjs



const circle_check_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "CircleCheck"
});
const circle_check_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const circle_check_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 896a384 384 0 100-768 384 384 0 000 768zm0 64a448 448 0 110-896 448 448 0 010 896z"
}, null, -1);
const circle_check_hoisted_3 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M745.344 361.344a32 32 0 0145.312 45.312l-288 288a32 32 0 01-45.312 0l-160-160a32 32 0 1145.312-45.312L480 626.752l265.344-265.408z"
}, null, -1);
const circle_check_hoisted_4 = [
  circle_check_hoisted_2,
  circle_check_hoisted_3
];
function circle_check_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", circle_check_hoisted_1, circle_check_hoisted_4);
}
var circleCheck = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(circle_check_sfc_main, [["render", circle_check_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/circle-close.mjs



const circle_close_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "CircleClose"
});
const circle_close_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const circle_close_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M466.752 512l-90.496-90.496a32 32 0 0145.248-45.248L512 466.752l90.496-90.496a32 32 0 1145.248 45.248L557.248 512l90.496 90.496a32 32 0 11-45.248 45.248L512 557.248l-90.496 90.496a32 32 0 01-45.248-45.248L466.752 512z"
}, null, -1);
const circle_close_hoisted_3 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 896a384 384 0 100-768 384 384 0 000 768zm0 64a448 448 0 110-896 448 448 0 010 896z"
}, null, -1);
const circle_close_hoisted_4 = [
  circle_close_hoisted_2,
  circle_close_hoisted_3
];
function circle_close_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", circle_close_hoisted_1, circle_close_hoisted_4);
}
var circleClose = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(circle_close_sfc_main, [["render", circle_close_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/icon.mjs



const iconPropType = definePropType([String, Object]);
const CloseComponents = {
  Close: close_close
};
const TypeComponents = {
  Close: close_close,
  SuccessFilled: successFilled,
  InfoFilled: infoFilled,
  WarningFilled: warningFilled,
  CircleCloseFilled: circleCloseFilled
};
const TypeComponentsMap = {
  success: successFilled,
  warning: warningFilled,
  error: circleCloseFilled,
  info: infoFilled
};
const ValidateComponentsMap = {
  validating: loading,
  success: circleCheck,
  error: circleClose
};


//# sourceMappingURL=icon.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/notification/src/notification.mjs


const notificationTypes = [
  "success",
  "info",
  "warning",
  "error"
];
const notificationProps = buildProps({
  customClass: {
    type: String,
    default: ""
  },
  dangerouslyUseHTMLString: {
    type: Boolean,
    default: false
  },
  duration: {
    type: Number,
    default: 4500
  },
  icon: {
    type: definePropType([String, Object]),
    default: ""
  },
  id: {
    type: String,
    default: ""
  },
  message: {
    type: definePropType([String, Object]),
    default: ""
  },
  offset: {
    type: Number,
    default: 0
  },
  onClick: {
    type: definePropType(Function),
    default: () => void 0
  },
  onClose: {
    type: definePropType(Function),
    required: true
  },
  position: {
    type: String,
    values: ["top-right", "top-left", "bottom-right", "bottom-left"],
    default: "top-right"
  },
  showClose: {
    type: Boolean,
    default: true
  },
  title: {
    type: String,
    default: ""
  },
  type: {
    type: String,
    values: [...notificationTypes, ""],
    default: ""
  },
  zIndex: {
    type: Number,
    default: 0
  }
});
const notificationEmits = {
  destroy: () => true
};


//# sourceMappingURL=notification.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/notification/src/notification2.mjs








const notification2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElNotification",
  components: {
    ElIcon: ElIcon,
    ...TypeComponents
  },
  props: notificationProps,
  emits: notificationEmits,
  setup(props) {
    const visible = reactivity_esm_bundler_ref(false);
    let timer = void 0;
    const typeClass = runtime_core_esm_bundler_computed(() => {
      const type = props.type;
      return type && TypeComponentsMap[props.type] ? `el-notification--${type}` : "";
    });
    const iconComponent = runtime_core_esm_bundler_computed(() => {
      return TypeComponentsMap[props.type] || props.icon || "";
    });
    const horizontalClass = runtime_core_esm_bundler_computed(() => props.position.endsWith("right") ? "right" : "left");
    const verticalProperty = runtime_core_esm_bundler_computed(() => props.position.startsWith("top") ? "top" : "bottom");
    const positionStyle = runtime_core_esm_bundler_computed(() => {
      return {
        [verticalProperty.value]: `${props.offset}px`,
        zIndex: props.zIndex
      };
    });
    function startTimer() {
      if (props.duration > 0) {
        ;
        ({ stop: timer } = shared_useTimeoutFn(() => {
          if (visible.value)
            close();
        }, props.duration));
      }
    }
    function clearTimer() {
      timer == null ? void 0 : timer();
    }
    function close() {
      visible.value = false;
    }
    function onKeydown({ code }) {
      if (code === aria_EVENT_CODE["delete"] || code === aria_EVENT_CODE.backspace) {
        clearTimer();
      } else if (code === aria_EVENT_CODE.esc) {
        if (visible.value) {
          close();
        }
      } else {
        startTimer();
      }
    }
    runtime_core_esm_bundler_onMounted(() => {
      startTimer();
      visible.value = true;
    });
    useEventListener(document, "keydown", onKeydown);
    return {
      horizontalClass,
      typeClass,
      iconComponent,
      positionStyle,
      visible,
      close,
      clearTimer,
      startTimer
    };
  }
});
const notification2_hoisted_1 = ["id"];
const notification2_hoisted_2 = { class: "el-notification__group" };
const notification2_hoisted_3 = ["textContent"];
const notification2_hoisted_4 = { key: 0 };
const notification2_hoisted_5 = ["innerHTML"];
function notification2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = resolveComponent("el-icon");
  const _component_close = resolveComponent("close");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(Transition, {
    name: "el-notification-fade",
    onBeforeLeave: _ctx.onClose,
    onAfterLeave: _cache[3] || (_cache[3] = ($event) => _ctx.$emit("destroy"))
  }, {
    default: withCtx(() => [
      withDirectives(createBaseVNode("div", {
        id: _ctx.id,
        class: normalizeClass(["el-notification", _ctx.customClass, _ctx.horizontalClass]),
        style: normalizeStyle(_ctx.positionStyle),
        role: "alert",
        onMouseenter: _cache[0] || (_cache[0] = (...args) => _ctx.clearTimer && _ctx.clearTimer(...args)),
        onMouseleave: _cache[1] || (_cache[1] = (...args) => _ctx.startTimer && _ctx.startTimer(...args)),
        onClick: _cache[2] || (_cache[2] = (...args) => _ctx.onClick && _ctx.onClick(...args))
      }, [
        _ctx.iconComponent ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
          key: 0,
          class: normalizeClass(["el-notification__icon", _ctx.typeClass])
        }, {
          default: withCtx(() => [
            (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.iconComponent)))
          ]),
          _: 1
        }, 8, ["class"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
        createBaseVNode("div", notification2_hoisted_2, [
          createBaseVNode("h2", {
            class: "el-notification__title",
            textContent: toDisplayString(_ctx.title)
          }, null, 8, notification2_hoisted_3),
          withDirectives(createBaseVNode("div", {
            class: "el-notification__content",
            style: normalizeStyle(!!_ctx.title ? void 0 : { margin: 0 })
          }, [
            renderSlot(_ctx.$slots, "default", {}, () => [
              !_ctx.dangerouslyUseHTMLString ? (runtime_core_esm_bundler_openBlock(), createElementBlock("p", notification2_hoisted_4, toDisplayString(_ctx.message), 1)) : (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 1 }, [
                runtime_core_esm_bundler_createCommentVNode(" Caution here, message could've been compromized, nerver use user's input as message "),
                runtime_core_esm_bundler_createCommentVNode(" eslint-disable-next-line "),
                createBaseVNode("p", { innerHTML: _ctx.message }, null, 8, notification2_hoisted_5)
              ], 2112))
            ])
          ], 4), [
            [vShow, _ctx.message]
          ]),
          _ctx.showClose ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
            key: 0,
            class: "el-notification__closeBtn",
            onClick: withModifiers(_ctx.close, ["stop"])
          }, {
            default: withCtx(() => [
              runtime_core_esm_bundler_createVNode(_component_close)
            ]),
            _: 1
          }, 8, ["onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
        ])
      ], 46, notification2_hoisted_1), [
        [vShow, _ctx.visible]
      ])
    ]),
    _: 3
  }, 8, ["onBeforeLeave"]);
}
var NotificationConstructor = /* @__PURE__ */ _export_sfc(notification2_sfc_main, [["render", notification2_sfc_render]]);


//# sourceMappingURL=notification2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/notification/src/notify.mjs








const notifications = {
  "top-left": [],
  "top-right": [],
  "bottom-left": [],
  "bottom-right": []
};
const GAP_SIZE = 16;
let seed = 1;
const notify = function(options = {}) {
  if (!shared_isClient)
    return { close: () => void 0 };
  if (typeof options === "string" || runtime_core_esm_bundler_isVNode(options)) {
    options = { message: options };
  }
  const position = options.position || "top-right";
  let verticalOffset = options.offset || 0;
  notifications[position].forEach(({ vm: vm2 }) => {
    var _a;
    verticalOffset += (((_a = vm2.el) == null ? void 0 : _a.offsetHeight) || 0) + GAP_SIZE;
  });
  verticalOffset += GAP_SIZE;
  const id = `notification_${seed++}`;
  const userOnClose = options.onClose;
  const props = {
    zIndex: PopupManager.nextZIndex(),
    offset: verticalOffset,
    ...options,
    id,
    onClose: () => {
      notify_close(id, position, userOnClose);
    }
  };
  let appendTo = document.body;
  if (options.appendTo instanceof HTMLElement) {
    appendTo = options.appendTo;
  } else if (typeof options.appendTo === "string") {
    appendTo = document.querySelector(options.appendTo);
  }
  if (!(appendTo instanceof HTMLElement)) {
    error_debugWarn("ElNotification", "the appendTo option is not an HTMLElement. Falling back to document.body.");
    appendTo = document.body;
  }
  const container = document.createElement("div");
  const vm = runtime_core_esm_bundler_createVNode(NotificationConstructor, props, runtime_core_esm_bundler_isVNode(props.message) ? {
    default: () => props.message
  } : null);
  vm.props.onDestroy = () => {
    render(null, container);
  };
  render(vm, container);
  notifications[position].push({ vm });
  appendTo.appendChild(container.firstElementChild);
  return {
    close: () => {
      ;
      vm.component.proxy.visible = false;
    }
  };
};
notificationTypes.forEach((type) => {
  notify[type] = (options = {}) => {
    if (typeof options === "string" || runtime_core_esm_bundler_isVNode(options)) {
      options = {
        message: options
      };
    }
    return notify({
      ...options,
      type
    });
  };
});
function notify_close(id, position, userOnClose) {
  const orientedNotifications = notifications[position];
  const idx = orientedNotifications.findIndex(({ vm: vm2 }) => {
    var _a;
    return ((_a = vm2.component) == null ? void 0 : _a.props.id) === id;
  });
  if (idx === -1)
    return;
  const { vm } = orientedNotifications[idx];
  if (!vm)
    return;
  userOnClose == null ? void 0 : userOnClose(vm);
  const removedHeight = vm.el.offsetHeight;
  const verticalPos = position.split("-")[0];
  orientedNotifications.splice(idx, 1);
  const len = orientedNotifications.length;
  if (len < 1)
    return;
  for (let i = idx; i < len; i++) {
    const { el, component } = orientedNotifications[i].vm;
    const pos = parseInt(el.style[verticalPos], 10) - removedHeight - GAP_SIZE;
    component.props.offset = pos;
  }
}
function closeAll() {
  for (const orientedNotifications of Object.values(notifications)) {
    orientedNotifications.forEach(({ vm }) => {
      ;
      vm.component.proxy.visible = false;
    });
  }
}
notify.closeAll = closeAll;


//# sourceMappingURL=notify.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/notification/index.mjs




const ElNotification = withInstallFunction(notify, "$notify");


//# sourceMappingURL=index.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-notification.css
var el_notification = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-notification.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-notification.css

      
      
      
      
      
      
      
      
      

var el_notification_options = {};

el_notification_options.styleTagTransform = (styleTagTransform_default());
el_notification_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_notification_options.insert = insertBySelector_default().bind(null, "head");
    
el_notification_options.domAPI = (styleDomAPI_default());
el_notification_options.insertStyleElement = (insertStyleElement_default());

var el_notification_update = injectStylesIntoStyleTag_default()(el_notification/* default */.Z, el_notification_options);




       /* harmony default export */ const theme_chalk_el_notification = (el_notification/* default */.Z && el_notification/* default.locals */.Z.locals ? el_notification/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/notification/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./src/ts/GetErrorTips.ts
const dictionary = {
    通知: ["inform"],
    检查更新: ["greasyfork"],
    作业: ["hw", "hwt", "hwtask"],
};
function getErrorTips(url) {
    let rtnContent = "";
    Object.keys(dictionary).forEach((errorType) => {
        dictionary[errorType].forEach((key) => {
            if (url.indexOf(key) !== -1) {
                rtnContent += `${errorType}`;
            }
        });
    });
    if (rtnContent === "") {
        return "";
    }
    else {
        return `可能与${rtnContent}有关,`;
    }
}
/* harmony default export */ const GetErrorTips = (getErrorTips);

;// CONCATENATED MODULE: ./src/ts/SendRequest.ts

async function sendRequest(url, callBack, options) {
    let res = await fetch(url, options)
        .then((response) => {
        if (response.ok === false) {
            let notify = ElNotification({
                title: "免Flash文件上传",
                type: "error",
                dangerouslyUseHTMLString: true,
                message: `吖,请求</br><a href="${url}">${url}</a></br>时出错了,${GetErrorTips(url)}请检查网络后重试或联系开发者`,
                duration: 0,
                onClick: () => {
                    // window.open(url);
                    notify.close();
                },
            });
            throw Error(`Request to ${url} rejected, with status ${response.status}`);
        }
        if (callBack === undefined)
            return response;
        else {
            return response
                .blob()
                .then((blob) => {
                return new Promise((resolve) => {
                    let reader = new FileReader();
                    reader.readAsText(blob, "GBK");
                    reader.onload = () => {
                        let data = reader.result;
                        let dom = new window.DOMParser().parseFromString(data, "text/html");
                        resolve(dom);
                    };
                });
            })
                .then((res) => {
                return callBack(res);
            });
        }
    })
        .catch((error) => {
        console.error(error);
    });
    return res;
}
/* harmony default export */ const SendRequest = (sendRequest);

;// CONCATENATED MODULE: ./src/ts/Requests/getHwtList.ts

async function getHwtList(courseId) {
    let url = `http://cc.bjtu.edu.cn:81/meol/hw/stu/hwStuHwtList.do?courseId=${courseId}&pagingNumberPer=100`;
    return await SendRequest(url, undefined).then((response) => {
        return response.json().then((json) => {
            let rtnArray = [];
            if (json.datas.hwtList === undefined)
                return [];
            json.datas.hwtList.forEach((item) => {
                rtnArray.push({
                    courseId: json.datas.courseId,
                    id: item.id.toString(),
                    title: item.title,
                    deadLine: item.deadLine,
                    remain: Math.floor((new Date(item.deadLine).getTime() - new Date().getTime()) /
                        (24 * 60 * 60 * 1000)),
                    able: item.submitStruts,
                    publisher: item.realName,
                    mutualTask: item.mutualTask,
                    answerStatus: item.answerStatus,
                    showGrade: item.showGrade, // answerStatus == true || able == false
                });
            });
            return rtnArray;
        });
    });
}
/* harmony default export */ const Requests_getHwtList = (getHwtList);

;// CONCATENATED MODULE: ./src/ts/Requests/getHwtSubmit.ts

async function getHwtDetail(courseId, hwtId) {
    let url = `http://cc.bjtu.edu.cn:81/meol/hw/stu/hwStuSubmit.do?courseId=${courseId}&hwtId=${hwtId}`;
    return await SendRequest(url, undefined);
    return {
        datas: {
            answer: "",
            content: "",
            deadLine: "",
            finishTime: "",
            fullMark: 0,
            hwaId: 1111111,
            id: 11111,
            manySubmitStatus: true,
            realName: "",
            title: "", // 作业标题
        },
        sessionid: "",
        status: 1,
    };
}
/* harmony default export */ const getHwtSubmit = (getHwtDetail);

;// CONCATENATED MODULE: ./src/ts/Requests/getHwtReview.ts

async function getHwtReview(courseId, hwtId) {
    let url = `http://cc.bjtu.edu.cn:81/meol/hw/stu/hwTaskAnswerView.do?courseId=${courseId}&hwtId=${hwtId}`;
    return await SendRequest(url, undefined);
    return {
        datas: {
            hwaAnswer: "",
            content: "",
            deadLine: "",
            finishTime: "",
            fullMark: 0,
            hwaId: 1111111,
            id: 11111,
            manySubmitStatus: true,
            realName: "",
            title: "", // 作业标题
        },
        sessionid: "",
        status: 1,
    };
}
/* harmony default export */ const Requests_getHwtReview = (getHwtReview);

;// CONCATENATED MODULE: ./src/ts/Requests/getLessonList.ts

async function getLessonList() {
    let url = `http://cc.bjtu.edu.cn:81/meol/lesson/blen.student.lesson.list.jsp`;
    return await SendRequest(url, (doc) => {
        return doc.querySelectorAll("tbody > tr");
    }).then((res) => {
        let rtnArray = [];
        res.forEach((item, index) => {
            if (index === 0)
                return;
            let course = item.querySelectorAll("td a")[0];
            let academy = item.children[2];
            let teacher = item.children[3];
            rtnArray.push({
                id: course
                    .getAttribute("onclick")
                    .split("courseId=")[1]
                    .split("','")[0],
                name: course.innerText.split("\n")[0].trim(),
                academy: academy.innerText.split("\n")[0],
                teacher: teacher.innerText.split("\n")[0],
            });
        });
        return rtnArray;
    });
}
/* harmony default export */ const Requests_getLessonList = (getLessonList);

;// CONCATENATED MODULE: ./src/ts/Requests/lessonOrderOperation.ts

async function lessonOrderOperation(courseId, action) {
    let LESSUP = `http://cc.bjtu.edu.cn:81/meol/lesson/blen.student.lesson.list.jsp?ACTION=LESSUP&lid=${courseId}`;
    let LESSDOWN = `http://cc.bjtu.edu.cn:81/meol/lesson/blen.student.lesson.list.jsp?ACTION=LESSDOWN&lid=${courseId}`;
    switch (action) {
        case "up":
            return await SendRequest(LESSUP);
        case "down":
            return await SendRequest(LESSDOWN);
    }
}
/* harmony default export */ const Requests_lessonOrderOperation = (lessonOrderOperation);

;// CONCATENATED MODULE: ./src/ts/API.ts





/* harmony default export */ const API = ({
    getHwtList: Requests_getHwtList,
    getHwtSubmit: getHwtSubmit,
    getHwtReview: Requests_getHwtReview,
    getLessonList: Requests_getLessonList,
    lessonOrderOperation: Requests_lessonOrderOperation,
});

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/SideBar.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const SideBarvue_type_script_lang_js = ({
  data() {
    return {
      lessonList: [],
      iconSize: 18
    };
  },

  mounted() {
    this.getLessonList();
  },

  methods: {
    async getLessonList() {
      this.lessonList = await API.getLessonList();
    },

    handleSelect(index, indexPath, item, routeResult) {
      let rtn = indexPath.length === 2 ? {
        path: `/${indexPath[0]}/${indexPath[1]}/info`
      } : {
        path: `/${index}`
      };
      this.$router.push(rtn);
    }

  }
});
;// CONCATENATED MODULE: ./src/components/Common/SideBar.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/SideBar.vue?vue&type=style&index=0&id=2df32d5e&scoped=true&lang=css
var SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/SideBar.vue?vue&type=style&index=0&id=2df32d5e&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/SideBar.vue?vue&type=style&index=0&id=2df32d5e&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_options = {};

SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css/* default */.Z, SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css_options);




       /* harmony default export */ const Common_SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css = (SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css/* default */.Z && SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css/* default.locals */.Z.locals ? SideBarvue_type_style_index_0_id_2df32d5e_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/Common/SideBar.vue?vue&type=style&index=0&id=2df32d5e&scoped=true&lang=css
/* unplugin-vue-components disabled */
// EXTERNAL MODULE: ./node_modules/vue-loader/dist/exportHelper.js
var exportHelper = __webpack_require__("./node_modules/vue-loader/dist/exportHelper.js");
;// CONCATENATED MODULE: ./src/components/Common/SideBar.vue
/* unplugin-vue-components disabled */



;


const __exports__ = /*#__PURE__*/(0,exportHelper/* default */.Z)(SideBarvue_type_script_lang_js, [['render',SideBarvue_type_template_id_2df32d5e_scoped_true_render],['__scopeId',"data-v-2df32d5e"]])

/* harmony default export */ const SideBar = (__exports__);
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-row.css
var el_row = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-row.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-row.css

      
      
      
      
      
      
      
      
      

var el_row_options = {};

el_row_options.styleTagTransform = (styleTagTransform_default());
el_row_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_row_options.insert = insertBySelector_default().bind(null, "head");
    
el_row_options.domAPI = (styleDomAPI_default());
el_row_options.insertStyleElement = (insertStyleElement_default());

var el_row_update = injectStylesIntoStyleTag_default()(el_row/* default */.Z, el_row_options);




       /* harmony default export */ const theme_chalk_el_row = (el_row/* default */.Z && el_row/* default.locals */.Z.locals ? el_row/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/row/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown.css
var el_dropdown = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-dropdown.css

      
      
      
      
      
      
      
      
      

var el_dropdown_options = {};

el_dropdown_options.styleTagTransform = (styleTagTransform_default());
el_dropdown_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_dropdown_options.insert = insertBySelector_default().bind(null, "head");
    
el_dropdown_options.domAPI = (styleDomAPI_default());
el_dropdown_options.insertStyleElement = (insertStyleElement_default());

var el_dropdown_update = injectStylesIntoStyleTag_default()(el_dropdown/* default */.Z, el_dropdown_options);




       /* harmony default export */ const theme_chalk_el_dropdown = (el_dropdown/* default */.Z && el_dropdown/* default.locals */.Z.locals ? el_dropdown/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-button.css
var el_button = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-button.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-button.css

      
      
      
      
      
      
      
      
      

var el_button_options = {};

el_button_options.styleTagTransform = (styleTagTransform_default());
el_button_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_button_options.insert = insertBySelector_default().bind(null, "head");
    
el_button_options.domAPI = (styleDomAPI_default());
el_button_options.insertStyleElement = (insertStyleElement_default());

var el_button_update = injectStylesIntoStyleTag_default()(el_button/* default */.Z, el_button_options);




       /* harmony default export */ const theme_chalk_el_button = (el_button/* default */.Z && el_button/* default.locals */.Z.locals ? el_button/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/button/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/style/css.mjs




//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown-menu.css
var el_dropdown_menu = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown-menu.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-dropdown-menu.css

      
      
      
      
      
      
      
      
      

var el_dropdown_menu_options = {};

el_dropdown_menu_options.styleTagTransform = (styleTagTransform_default());
el_dropdown_menu_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_dropdown_menu_options.insert = insertBySelector_default().bind(null, "head");
    
el_dropdown_menu_options.domAPI = (styleDomAPI_default());
el_dropdown_menu_options.insertStyleElement = (insertStyleElement_default());

var el_dropdown_menu_update = injectStylesIntoStyleTag_default()(el_dropdown_menu/* default */.Z, el_dropdown_menu_options);




       /* harmony default export */ const theme_chalk_el_dropdown_menu = (el_dropdown_menu/* default */.Z && el_dropdown_menu/* default.locals */.Z.locals ? el_dropdown_menu/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown-menu/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown-item.css
var el_dropdown_item = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-dropdown-item.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-dropdown-item.css

      
      
      
      
      
      
      
      
      

var el_dropdown_item_options = {};

el_dropdown_item_options.styleTagTransform = (styleTagTransform_default());
el_dropdown_item_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_dropdown_item_options.insert = insertBySelector_default().bind(null, "head");
    
el_dropdown_item_options.domAPI = (styleDomAPI_default());
el_dropdown_item_options.insertStyleElement = (insertStyleElement_default());

var el_dropdown_item_update = injectStylesIntoStyleTag_default()(el_dropdown_item/* default */.Z, el_dropdown_item_options);




       /* harmony default export */ const theme_chalk_el_dropdown_item = (el_dropdown_item/* default */.Z && el_dropdown_item/* default.locals */.Z.locals ? el_dropdown_item/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown-item/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-badge.css
var el_badge = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-badge.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-badge.css

      
      
      
      
      
      
      
      
      

var el_badge_options = {};

el_badge_options.styleTagTransform = (styleTagTransform_default());
el_badge_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_badge_options.insert = insertBySelector_default().bind(null, "head");
    
el_badge_options.domAPI = (styleDomAPI_default());
el_badge_options.insertStyleElement = (insertStyleElement_default());

var el_badge_update = injectStylesIntoStyleTag_default()(el_badge/* default */.Z, el_badge_options);




       /* harmony default export */ const theme_chalk_el_badge = (el_badge/* default */.Z && el_badge/* default.locals */.Z.locals ? el_badge/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/badge/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-col.css
var el_col = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-col.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-col.css

      
      
      
      
      
      
      
      
      

var el_col_options = {};

el_col_options.styleTagTransform = (styleTagTransform_default());
el_col_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_col_options.insert = insertBySelector_default().bind(null, "head");
    
el_col_options.domAPI = (styleDomAPI_default());
el_col_options.insertStyleElement = (insertStyleElement_default());

var el_col_update = injectStylesIntoStyleTag_default()(el_col/* default */.Z, el_col_options);




       /* harmony default export */ const theme_chalk_el_col = (el_col/* default */.Z && el_col/* default.locals */.Z.locals ? el_col/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/col/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/row/src/row.mjs





const rowProps = buildProps({
  tag: {
    type: String,
    default: "div"
  },
  gutter: {
    type: Number,
    default: 0
  },
  justify: {
    type: String,
    values: ["start", "center", "end", "space-around", "space-between"],
    default: "start"
  },
  align: {
    type: String,
    values: ["top", "middle", "bottom"],
    default: "top"
  }
});
const Row = runtime_core_esm_bundler_defineComponent({
  name: "ElRow",
  props: rowProps,
  setup(props, { slots }) {
    const ns = useNamespace("row");
    const gutter = runtime_core_esm_bundler_computed(() => props.gutter);
    runtime_core_esm_bundler_provide("ElRow", {
      gutter
    });
    const style = runtime_core_esm_bundler_computed(() => {
      const styles = {
        marginLeft: "",
        marginRight: ""
      };
      if (props.gutter) {
        styles.marginLeft = `-${props.gutter / 2}px`;
        styles.marginRight = styles.marginLeft;
      }
      return styles;
    });
    return () => {
      var _a;
      return h(props.tag, {
        class: [
          ns.b(),
          ns.is(`justify-${props.justify}`, props.justify !== "start"),
          ns.is(`align-${props.align}`, props.align !== "top")
        ],
        style: style.value
      }, (_a = slots.default) == null ? void 0 : _a.call(slots));
    };
  }
});


//# sourceMappingURL=row.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/row/index.mjs




const ElRow = withInstall(Row);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-prop/index.mjs


const useProp = (name) => {
  const vm = runtime_core_esm_bundler_getCurrentInstance();
  return runtime_core_esm_bundler_computed(() => {
    var _a, _b;
    return (_b = (_a = vm.proxy) == null ? void 0 : _a.$props[name]) != null ? _b : void 0;
  });
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/tokens/form.mjs
const elFormKey = Symbol("elForm");
const elFormItemKey = Symbol("elFormItem");


//# sourceMappingURL=form.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-common-props/index.mjs







const useSizeProp = buildProp({
  type: String,
  values: componentSize,
  required: false
});
const useSize = (fallback, ignore = {}) => {
  const emptyRef = reactivity_esm_bundler_ref(void 0);
  const size = ignore.prop ? emptyRef : useProp("size");
  const globalConfig = ignore.global ? emptyRef : useGlobalConfig("size");
  const form = ignore.form ? { size: void 0 } : runtime_core_esm_bundler_inject(elFormKey, void 0);
  const formItem = ignore.formItem ? { size: void 0 } : runtime_core_esm_bundler_inject(elFormItemKey, void 0);
  return runtime_core_esm_bundler_computed(() => size.value || reactivity_esm_bundler_unref(fallback) || (formItem == null ? void 0 : formItem.size) || (form == null ? void 0 : form.size) || globalConfig.value || "default");
};
const useDisabled = (fallback) => {
  const disabled = useProp("disabled");
  const form = runtime_core_esm_bundler_inject(elFormKey, void 0);
  return runtime_core_esm_bundler_computed(() => disabled.value || reactivity_esm_bundler_unref(fallback) || (form == null ? void 0 : form.disabled) || false);
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/button/src/button.mjs





const buttonType = [
  "default",
  "primary",
  "success",
  "warning",
  "info",
  "danger",
  "text",
  ""
];
const buttonNativeType = ["button", "submit", "reset"];
const buttonProps = buildProps({
  size: useSizeProp,
  disabled: Boolean,
  type: {
    type: String,
    values: buttonType,
    default: ""
  },
  icon: {
    type: definePropType([String, Object]),
    default: ""
  },
  nativeType: {
    type: String,
    values: buttonNativeType,
    default: "button"
  },
  loading: Boolean,
  loadingIcon: {
    type: definePropType([String, Object]),
    default: () => loading
  },
  plain: Boolean,
  autofocus: Boolean,
  round: Boolean,
  circle: Boolean,
  color: String,
  autoInsertSpace: {
    type: Boolean,
    default: void 0
  }
});
const buttonEmits = {
  click: (evt) => evt instanceof MouseEvent
};


//# sourceMappingURL=button.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/tokens/button.mjs
const buttonGroupContextKey = Symbol("buttonGroupContextKey");


//# sourceMappingURL=button.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-form-item/index.mjs




const useFormItem = () => {
  const form = runtime_core_esm_bundler_inject(elFormKey, void 0);
  const formItem = runtime_core_esm_bundler_inject(elFormItemKey, void 0);
  return {
    form,
    formItem
  };
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/button/src/button2.mjs















const button2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElButton",
  components: {
    ElIcon: ElIcon,
    Loading: loading
  },
  props: buttonProps,
  emits: buttonEmits,
  setup(props, { emit, slots }) {
    const buttonRef = reactivity_esm_bundler_ref();
    const buttonGroupContext = runtime_core_esm_bundler_inject(buttonGroupContextKey, void 0);
    const globalConfig = useGlobalConfig("button");
    const ns = useNamespace("button");
    const autoInsertSpace = runtime_core_esm_bundler_computed(() => {
      var _a, _b, _c;
      return (_c = (_b = props.autoInsertSpace) != null ? _b : (_a = globalConfig.value) == null ? void 0 : _a.autoInsertSpace) != null ? _c : false;
    });
    const shouldAddSpace = runtime_core_esm_bundler_computed(() => {
      var _a;
      const defaultSlot = (_a = slots.default) == null ? void 0 : _a.call(slots);
      if (autoInsertSpace.value && (defaultSlot == null ? void 0 : defaultSlot.length) === 1) {
        const slot = defaultSlot[0];
        if ((slot == null ? void 0 : slot.type) === runtime_core_esm_bundler_Text) {
          const text = slot.children;
          return /^\p{Unified_Ideograph}{2}$/u.test(text);
        }
      }
      return false;
    });
    const { form } = useFormItem();
    const buttonSize = useSize(runtime_core_esm_bundler_computed(() => buttonGroupContext == null ? void 0 : buttonGroupContext.size));
    const buttonDisabled = useDisabled();
    const buttonType = runtime_core_esm_bundler_computed(() => props.type || (buttonGroupContext == null ? void 0 : buttonGroupContext.type) || "");
    const typeColor = runtime_core_esm_bundler_computed(() => useCssVar(`--el-color-${props.type}`).value);
    const buttonStyle = runtime_core_esm_bundler_computed(() => {
      let styles = {};
      const buttonColor = props.color || typeColor.value;
      if (buttonColor) {
        const shadeBgColor = new TinyColor(buttonColor).shade(10).toString();
        if (props.plain) {
          styles = {
            "--el-button-bg-color": new TinyColor(buttonColor).tint(90).toString(),
            "--el-button-text-color": buttonColor,
            "--el-button-hover-text-color": "var(--el-color-white)",
            "--el-button-hover-bg-color": buttonColor,
            "--el-button-hover-border-color": buttonColor,
            "--el-button-active-bg-color": shadeBgColor,
            "--el-button-active-text-color": "var(--el-color-white)",
            "--el-button-active-border-color": shadeBgColor
          };
        } else {
          const tintBgColor = new TinyColor(buttonColor).tint(20).toString();
          styles = {
            "--el-button-bg-color": buttonColor,
            "--el-button-border-color": buttonColor,
            "--el-button-hover-bg-color": tintBgColor,
            "--el-button-hover-border-color": tintBgColor,
            "--el-button-active-bg-color": shadeBgColor,
            "--el-button-active-border-color": shadeBgColor
          };
        }
        if (buttonDisabled.value) {
          const disabledButtonColor = new TinyColor(buttonColor).tint(50).toString();
          styles["--el-button-disabled-bg-color"] = disabledButtonColor;
          styles["--el-button-disabled-border-color"] = disabledButtonColor;
        }
      }
      return styles;
    });
    const handleClick = (evt) => {
      if (props.nativeType === "reset") {
        form == null ? void 0 : form.resetFields();
      }
      emit("click", evt);
    };
    return {
      buttonRef,
      buttonStyle,
      buttonSize,
      buttonType,
      buttonDisabled,
      shouldAddSpace,
      handleClick,
      ns
    };
  }
});
const button2_hoisted_1 = ["disabled", "autofocus", "type"];
function button2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = resolveComponent("el-icon");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("button", {
    ref: "buttonRef",
    class: normalizeClass([
      _ctx.ns.b(),
      _ctx.ns.m(_ctx.buttonType),
      _ctx.ns.m(_ctx.buttonSize),
      _ctx.ns.is("disabled", _ctx.buttonDisabled),
      _ctx.ns.is("loading", _ctx.loading),
      _ctx.ns.is("plain", _ctx.plain),
      _ctx.ns.is("round", _ctx.round),
      _ctx.ns.is("circle", _ctx.circle)
    ]),
    disabled: _ctx.buttonDisabled || _ctx.loading,
    autofocus: _ctx.autofocus,
    type: _ctx.nativeType,
    style: normalizeStyle(_ctx.buttonStyle),
    onClick: _cache[0] || (_cache[0] = (...args) => _ctx.handleClick && _ctx.handleClick(...args))
  }, [
    _ctx.loading ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 0 }, [
      _ctx.$slots.loading ? renderSlot(_ctx.$slots, "loading", { key: 0 }) : (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
        key: 1,
        class: normalizeClass(_ctx.ns.is("loading"))
      }, {
        default: withCtx(() => [
          (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.loadingIcon)))
        ]),
        _: 1
      }, 8, ["class"]))
    ], 2112)) : _ctx.icon ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, { key: 1 }, {
      default: withCtx(() => [
        (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.icon)))
      ]),
      _: 1
    })) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    _ctx.$slots.default ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
      key: 2,
      class: normalizeClass({ [_ctx.ns.em("text", "expand")]: _ctx.shouldAddSpace })
    }, [
      renderSlot(_ctx.$slots, "default")
    ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 14, button2_hoisted_1);
}
var Button = /* @__PURE__ */ _export_sfc(button2_sfc_main, [["render", button2_sfc_render]]);


//# sourceMappingURL=button2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/button/src/button-group.mjs


const buttonGroupProps = {
  size: buttonProps.size,
  type: buttonProps.type
};


//# sourceMappingURL=button-group.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/button/src/button-group2.mjs








const button_group2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElButtonGroup",
  props: buttonGroupProps,
  setup(props) {
    runtime_core_esm_bundler_provide(buttonGroupContextKey, reactivity_esm_bundler_reactive({
      size: reactivity_esm_bundler_toRef(props, "size"),
      type: reactivity_esm_bundler_toRef(props, "type")
    }));
    const ns = useNamespace("button");
    return {
      ns
    };
  }
});
function button_group2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass(`${_ctx.ns.b("group")}`)
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 2);
}
var ButtonGroup = /* @__PURE__ */ _export_sfc(button_group2_sfc_main, [["render", button_group2_sfc_render]]);


//# sourceMappingURL=button-group2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/button/index.mjs





const ElButton = withInstall(Button, {
  ButtonGroup: ButtonGroup
});
const ElButtonGroup = withNoopInstall(ButtonGroup);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/collection/src/collection2.mjs



const collection2_sfc_main = runtime_core_esm_bundler_defineComponent({
  inheritAttrs: false
});
function collection2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return renderSlot(_ctx.$slots, "default");
}
var Collection = /* @__PURE__ */ _export_sfc(collection2_sfc_main, [["render", collection2_sfc_render]]);


//# sourceMappingURL=collection2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/collection/src/collection-item.mjs



const collection_item_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElCollectionItem",
  inheritAttrs: false
});
function collection_item_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return renderSlot(_ctx.$slots, "default");
}
var CollectionItem = /* @__PURE__ */ _export_sfc(collection_item_sfc_main, [["render", collection_item_sfc_render]]);


//# sourceMappingURL=collection-item.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/collection/src/collection.mjs




const COLLECTION_ITEM_SIGN = `data-el-collection-item`;
const createCollectionWithScope = (name) => {
  const COLLECTION_NAME = `El${name}Collection`;
  const COLLECTION_ITEM_NAME = `${COLLECTION_NAME}Item`;
  const COLLECTION_INJECTION_KEY = Symbol(COLLECTION_NAME);
  const COLLECTION_ITEM_INJECTION_KEY = Symbol(COLLECTION_ITEM_NAME);
  const ElCollection = {
    ...Collection,
    name: COLLECTION_NAME,
    setup() {
      const collectionRef = reactivity_esm_bundler_ref(null);
      const itemMap = /* @__PURE__ */ new Map();
      const getItems = () => {
        const collectionEl = reactivity_esm_bundler_unref(collectionRef);
        if (!collectionEl)
          return [];
        const orderedNodes = Array.from(collectionEl.querySelectorAll(`[${COLLECTION_ITEM_SIGN}]`));
        const items = [...itemMap.values()];
        const orderedItems = items.sort((a, b) => orderedNodes.indexOf(a.ref) - orderedNodes.indexOf(b.ref));
        return orderedItems;
      };
      runtime_core_esm_bundler_provide(COLLECTION_INJECTION_KEY, {
        itemMap,
        getItems,
        collectionRef
      });
    }
  };
  const ElCollectionItem = {
    ...CollectionItem,
    name: COLLECTION_ITEM_NAME,
    setup(_, { attrs }) {
      const collectionItemRef = reactivity_esm_bundler_ref(null);
      const collectionInjection = runtime_core_esm_bundler_inject(COLLECTION_INJECTION_KEY, void 0);
      runtime_core_esm_bundler_provide(COLLECTION_ITEM_INJECTION_KEY, {
        collectionItemRef
      });
      runtime_core_esm_bundler_onMounted(() => {
        const collectionItemEl = reactivity_esm_bundler_unref(collectionItemRef);
        if (collectionItemEl) {
          collectionInjection.itemMap.set(collectionItemEl, {
            ref: collectionItemEl,
            ...attrs
          });
        }
      });
      runtime_core_esm_bundler_onBeforeUnmount(() => {
        const collectionItemEl = reactivity_esm_bundler_unref(collectionItemRef);
        collectionInjection.itemMap.delete(collectionItemEl);
      });
    }
  };
  return {
    COLLECTION_INJECTION_KEY,
    COLLECTION_ITEM_INJECTION_KEY,
    ElCollection,
    ElCollectionItem
  };
};


//# sourceMappingURL=collection.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/src/dropdown.mjs







const dropdownProps = {
  trigger: useTooltipTriggerProps.trigger,
  effect: {
    ...useTooltipContentProps.effect,
    default: "light"
  },
  ...buildProps({
    type: {
      type: definePropType(String)
    },
    placement: {
      type: definePropType(String),
      default: "bottom"
    },
    popperOptions: {
      type: definePropType(Object),
      default: () => ({})
    },
    size: {
      type: String,
      default: ""
    },
    splitButton: Boolean,
    hideOnClick: {
      type: Boolean,
      default: true
    },
    loop: {
      type: Boolean
    },
    showTimeout: {
      type: Number,
      default: 150
    },
    hideTimeout: {
      type: Number,
      default: 150
    },
    tabindex: {
      type: definePropType([Number, String]),
      default: 0
    },
    maxHeight: {
      type: definePropType([Number, String]),
      default: ""
    },
    popperClass: {
      type: String,
      default: ""
    }
  })
};
const dropdownItemProps = buildProps({
  command: {
    type: [Object, String, Number],
    default: () => ({})
  },
  disabled: Boolean,
  divided: Boolean,
  textValue: String,
  icon: {
    type: definePropType([String, Object])
  }
});
const dropdownMenuProps = buildProps({
  onKeydown: { type: definePropType(Function) }
});
const FIRST_KEYS = [
  aria_EVENT_CODE.down,
  aria_EVENT_CODE.pageDown,
  aria_EVENT_CODE.home
];
const LAST_KEYS = [aria_EVENT_CODE.up, aria_EVENT_CODE.pageUp, aria_EVENT_CODE.end];
const FIRST_LAST_KEYS = [...FIRST_KEYS, ...LAST_KEYS];
const {
  ElCollection,
  ElCollectionItem,
  COLLECTION_INJECTION_KEY,
  COLLECTION_ITEM_INJECTION_KEY
} = createCollectionWithScope("Dropdown");


//# sourceMappingURL=dropdown.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/src/tokens.mjs
const DROPDOWN_INJECTION_KEY = Symbol("elDropdown");


//# sourceMappingURL=tokens.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/focus-trap/src/utils.mjs
const utils_obtainAllFocusableElements = (element) => {
  const nodes = [];
  const walker = document.createTreeWalker(element, NodeFilter.SHOW_ELEMENT, {
    acceptNode: (node) => {
      const isHiddenInput = node.tagName === "INPUT" && node.type === "hidden";
      if (node.disabled || node.hidden || isHiddenInput)
        return NodeFilter.FILTER_SKIP;
      return node.tabIndex >= 0 ? NodeFilter.FILTER_ACCEPT : NodeFilter.FILTER_SKIP;
    }
  });
  while (walker.nextNode())
    nodes.push(walker.currentNode);
  return nodes;
};
const getVisibleElement = (elements, container) => {
  for (const element of elements) {
    if (!isHidden(element, container))
      return element;
  }
};
const isHidden = (element, container) => {
  if (false)
    {}
  if (getComputedStyle(element).visibility === "hidden")
    return true;
  while (element) {
    if (container && element === container)
      return false;
    if (getComputedStyle(element).display === "none")
      return true;
    element = element.parentElement;
  }
  return false;
};
const getEdges = (container) => {
  const focusable = utils_obtainAllFocusableElements(container);
  const first = getVisibleElement(focusable, container);
  const last = getVisibleElement(focusable.reverse(), container);
  return [first, last];
};
const isSelectable = (element) => {
  return element instanceof HTMLInputElement && "select" in element;
};
const tryFocus = (element, shouldSelect) => {
  if (element && element.focus) {
    const prevFocusedElement = document.activeElement;
    element.focus({ preventScroll: true });
    if (element !== prevFocusedElement && isSelectable(element) && shouldSelect) {
      element.select();
    }
  }
};
function removeFromStack(list, item) {
  const copy = [...list];
  const idx = list.indexOf(item);
  if (idx !== -1) {
    copy.splice(idx, 1);
  }
  return copy;
}
const createFocusableStack = () => {
  let stack = [];
  const push = (layer) => {
    const currentLayer = stack[0];
    if (currentLayer && layer !== currentLayer) {
      currentLayer.pause();
    }
    stack = removeFromStack(stack, layer);
    stack.unshift(layer);
  };
  const remove = (layer) => {
    var _a, _b;
    stack = removeFromStack(stack, layer);
    (_b = (_a = stack[0]) == null ? void 0 : _a.resume) == null ? void 0 : _b.call(_a);
  };
  return {
    push,
    remove
  };
};
const focusFirstDescendant = (elements, shouldSelect = false) => {
  const prevFocusedElement = document.activeElement;
  for (const element of elements) {
    tryFocus(element, shouldSelect);
    if (document.activeElement !== prevFocusedElement)
      return;
  }
};
const focusableStack = createFocusableStack();


//# sourceMappingURL=utils.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/focus-trap/src/tokens.mjs
const FOCUS_ON_MOUNT = "focus-trap.focus-on-mount";
const FOCUS_ON_UNMOUNT = "focus-trap.focus-on-unmount";
const FOCUS_ON_MOUNT_OPTS = {
  cancelable: true,
  bubbles: false
};
const ON_MOUNT_FOCUS_EVT = "mountOnFocus";
const ON_UNMOUNT_FOCUS_EVT = "unmountOnFocus";
const FOCUS_TRAP_INJECTION_KEY = Symbol("elFocusTrap");


//# sourceMappingURL=tokens.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/focus-trap/src/focus-trap.mjs







const focus_trap_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElFocusTrap",
  inheritAttrs: false,
  props: {
    loop: Boolean,
    trapped: Boolean
  },
  emits: [ON_MOUNT_FOCUS_EVT, ON_UNMOUNT_FOCUS_EVT],
  setup(props, { emit }) {
    const focusTrapRef = reactivity_esm_bundler_ref();
    const forwardRef = reactivity_esm_bundler_ref(null);
    let lastFocusBeforeMounted;
    let lastFocusAfterMounted;
    const focusLayer = {
      paused: false,
      pause() {
        this.paused = true;
      },
      resume() {
        this.paused = false;
      }
    };
    const onKeydown = (e) => {
      if (!props.loop && !props.trapped)
        return;
      if (focusLayer.paused)
        return;
      const { key, altKey, ctrlKey, metaKey, currentTarget, shiftKey } = e;
      const { loop } = props;
      const isTabbing = key === aria_EVENT_CODE.tab && !altKey && !ctrlKey && !metaKey;
      const currentFocusingEl = document.activeElement;
      if (isTabbing && currentFocusingEl) {
        const container = currentTarget;
        const [first, last] = getEdges(container);
        const isTabbable = first && last;
        if (!isTabbable) {
          if (currentFocusingEl === container)
            e.preventDefault();
        } else {
          if (!shiftKey && currentFocusingEl === last) {
            e.preventDefault();
            if (loop)
              tryFocus(first, true);
          } else if (shiftKey && currentFocusingEl === first) {
            e.preventDefault();
            if (loop)
              tryFocus(last, true);
          }
        }
      }
    };
    runtime_core_esm_bundler_provide(FOCUS_TRAP_INJECTION_KEY, {
      focusTrapRef: forwardRef,
      onKeydown
    });
    const focusOnMount = (e) => {
      emit(ON_MOUNT_FOCUS_EVT, e);
    };
    const focusOnUnmount = (e) => emit(ON_UNMOUNT_FOCUS_EVT, e);
    const onFocusIn = (e) => {
      const trapContainer = reactivity_esm_bundler_unref(forwardRef);
      if (focusLayer.paused || !trapContainer)
        return;
      const target = e.target;
      if (target && trapContainer.contains(target)) {
        lastFocusAfterMounted = target;
      } else {
        tryFocus(lastFocusAfterMounted, true);
      }
    };
    const onFocusOut = (e) => {
      const trapContainer = reactivity_esm_bundler_unref(forwardRef);
      if (focusLayer.paused || !trapContainer)
        return;
      if (!trapContainer.contains(e.relatedTarget)) {
        tryFocus(lastFocusAfterMounted, true);
      }
    };
    runtime_core_esm_bundler_onMounted(() => {
      const trapContainer = reactivity_esm_bundler_unref(forwardRef);
      if (trapContainer) {
        focusableStack.push(focusLayer);
        const prevFocusedElement = document.activeElement;
        lastFocusBeforeMounted = prevFocusedElement;
        const isPrevFocusContained = trapContainer.contains(prevFocusedElement);
        if (!isPrevFocusContained) {
          const mountEvent = new Event(FOCUS_ON_MOUNT, FOCUS_ON_MOUNT_OPTS);
          dom_on(trapContainer, FOCUS_ON_MOUNT, focusOnMount);
          trapContainer.dispatchEvent(mountEvent);
          if (!mountEvent.defaultPrevented) {
            focusFirstDescendant(utils_obtainAllFocusableElements(trapContainer), true);
            if (document.activeElement === prevFocusedElement) {
              tryFocus(trapContainer);
            }
          }
        }
      }
      runtime_core_esm_bundler_watch(() => props.trapped, (trapped) => {
        if (trapped) {
          dom_on(document, "focusin", onFocusIn);
          dom_on(document, "focusout", onFocusOut);
        } else {
          off(document, "focusin", onFocusIn);
          off(document, "focusout", onFocusOut);
        }
      }, { immediate: true });
    });
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      const trapContainer = reactivity_esm_bundler_unref(forwardRef);
      if (trapContainer) {
        off(trapContainer, FOCUS_ON_MOUNT, focusOnMount);
        const unmountEvent = new Event(FOCUS_ON_UNMOUNT, FOCUS_ON_MOUNT_OPTS);
        dom_on(trapContainer, FOCUS_ON_UNMOUNT, focusOnUnmount);
        trapContainer.dispatchEvent(unmountEvent);
        if (!unmountEvent.defaultPrevented) {
          tryFocus(lastFocusBeforeMounted != null ? lastFocusBeforeMounted : document.body, true);
        }
        off(trapContainer, FOCUS_ON_UNMOUNT, focusOnUnmount);
        focusableStack.remove(focusLayer);
      }
    });
    return {
      focusTrapRef,
      forwardRef,
      onKeydown
    };
  }
});
function focus_trap_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return renderSlot(_ctx.$slots, "default");
}
var ElFocusTrap = /* @__PURE__ */ _export_sfc(focus_trap_sfc_main, [["render", focus_trap_sfc_render]]);


//# sourceMappingURL=focus-trap.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/roving-focus-group/src/roving-focus-group.mjs




const rovingFocusGroupProps = buildProps({
  style: { type: definePropType([String, Array, Object]) },
  currentTabId: {
    type: definePropType(String)
  },
  defaultCurrentTabId: String,
  loop: Boolean,
  dir: {
    type: String,
    values: ["ltr", "rtl"],
    default: "ltr"
  },
  orientation: {
    type: definePropType(String)
  },
  onBlur: Function,
  onFocus: Function,
  onMousedown: Function
});
const {
  ElCollection: roving_focus_group_ElCollection,
  ElCollectionItem: roving_focus_group_ElCollectionItem,
  COLLECTION_INJECTION_KEY: roving_focus_group_COLLECTION_INJECTION_KEY,
  COLLECTION_ITEM_INJECTION_KEY: roving_focus_group_COLLECTION_ITEM_INJECTION_KEY
} = createCollectionWithScope("RovingFocusGroup");


//# sourceMappingURL=roving-focus-group.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/roving-focus-group/src/tokens.mjs
const ROVING_FOCUS_GROUP_INJECTION_KEY = Symbol("elRovingFocusGroup");
const ROVING_FOCUS_GROUP_ITEM_INJECTION_KEY = Symbol("elRovingFocusGroupItem");


//# sourceMappingURL=tokens.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/roving-focus-group/src/utils.mjs


const MAP_KEY_TO_FOCUS_INTENT = {
  ArrowLeft: "prev",
  ArrowUp: "prev",
  ArrowRight: "next",
  ArrowDown: "next",
  PageUp: "first",
  Home: "first",
  PageDown: "last",
  End: "last"
};
const getDirectionAwareKey = (key, dir) => {
  if (dir !== "rtl")
    return key;
  switch (key) {
    case aria_EVENT_CODE.right:
      return aria_EVENT_CODE.left;
    case aria_EVENT_CODE.left:
      return aria_EVENT_CODE.right;
    default:
      return key;
  }
};
const getFocusIntent = (event, orientation, dir) => {
  const key = getDirectionAwareKey(event.key, dir);
  if (orientation === "vertical" && [aria_EVENT_CODE.left, aria_EVENT_CODE.right].includes(key))
    return void 0;
  if (orientation === "horizontal" && [aria_EVENT_CODE.up, aria_EVENT_CODE.down].includes(key))
    return void 0;
  return MAP_KEY_TO_FOCUS_INTENT[key];
};
const reorderArray = (array, atIdx) => {
  return array.map((_, idx) => array[(idx + atIdx) % array.length]);
};
const focusFirst = (elements) => {
  const { activeElement: prevActive } = document;
  for (const element of elements) {
    if (element === prevActive)
      return;
    element.focus();
    if (prevActive !== document.activeElement)
      return;
  }
};


//# sourceMappingURL=utils.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/roving-focus-group/src/roving-focus-group-impl.mjs







const CURRENT_TAB_ID_CHANGE_EVT = "currentTabIdChange";
const ENTRY_FOCUS_EVT = "rovingFocusGroup.entryFocus";
const EVT_OPTS = { bubbles: false, cancelable: true };
const roving_focus_group_impl_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElRovingFocusGroupImpl",
  inheritAttrs: false,
  props: rovingFocusGroupProps,
  emits: [CURRENT_TAB_ID_CHANGE_EVT, "entryFocus"],
  setup(props, { emit }) {
    var _a;
    const currentTabbedId = reactivity_esm_bundler_ref((_a = props.currentTabId || props.defaultCurrentTabId) != null ? _a : null);
    const isBackingOut = reactivity_esm_bundler_ref(false);
    const isClickFocus = reactivity_esm_bundler_ref(false);
    const rovingFocusGroupRef = reactivity_esm_bundler_ref(null);
    const { getItems } = runtime_core_esm_bundler_inject(roving_focus_group_COLLECTION_INJECTION_KEY, void 0);
    const rovingFocusGroupRootStyle = runtime_core_esm_bundler_computed(() => {
      return [
        {
          outline: "none"
        },
        props.style
      ];
    });
    const onItemFocus = (tabbedId) => {
      emit(CURRENT_TAB_ID_CHANGE_EVT, tabbedId);
    };
    const onItemShiftTab = () => {
      isBackingOut.value = true;
    };
    const onMousedown = composeEventHandlers((e) => {
      var _a2;
      (_a2 = props.onMousedown) == null ? void 0 : _a2.call(props, e);
    }, () => {
      isClickFocus.value = true;
    });
    const onFocus = composeEventHandlers((e) => {
      var _a2;
      (_a2 = props.onFocus) == null ? void 0 : _a2.call(props, e);
    }, (e) => {
      const isKeyboardFocus = !reactivity_esm_bundler_unref(isClickFocus);
      const { target, currentTarget } = e;
      if (target === currentTarget && isKeyboardFocus && !reactivity_esm_bundler_unref(isBackingOut)) {
        const entryFocusEvt = new Event(ENTRY_FOCUS_EVT, EVT_OPTS);
        currentTarget == null ? void 0 : currentTarget.dispatchEvent(entryFocusEvt);
        if (!entryFocusEvt.defaultPrevented) {
          const items = getItems().filter((item) => item.focusable);
          const activeItem = items.find((item) => item.active);
          const currentItem = items.find((item) => item.id === reactivity_esm_bundler_unref(currentTabbedId));
          const candidates = [activeItem, currentItem, ...items].filter(Boolean);
          const candidateNodes = candidates.map((item) => item.ref);
          focusFirst(candidateNodes);
        }
      }
      isClickFocus.value = false;
    });
    const onBlur = composeEventHandlers((e) => {
      var _a2;
      (_a2 = props.onBlur) == null ? void 0 : _a2.call(props, e);
    }, () => {
      isBackingOut.value = false;
    });
    const handleEntryFocus = (...args) => {
      emit("entryFocus", ...args);
    };
    runtime_core_esm_bundler_provide(ROVING_FOCUS_GROUP_INJECTION_KEY, {
      currentTabbedId: reactivity_esm_bundler_readonly(currentTabbedId),
      loop: reactivity_esm_bundler_toRef(props, "loop"),
      tabIndex: runtime_core_esm_bundler_computed(() => {
        return reactivity_esm_bundler_unref(isBackingOut) ? -1 : 0;
      }),
      rovingFocusGroupRef,
      rovingFocusGroupRootStyle,
      orientation: reactivity_esm_bundler_toRef(props, "orientation"),
      dir: reactivity_esm_bundler_toRef(props, "dir"),
      onItemFocus,
      onItemShiftTab,
      onBlur,
      onFocus,
      onMousedown
    });
    runtime_core_esm_bundler_watch(() => props.currentTabId, (val) => {
      currentTabbedId.value = val != null ? val : null;
    });
    runtime_core_esm_bundler_onMounted(() => {
      const rovingFocusGroupEl = reactivity_esm_bundler_unref(rovingFocusGroupRef);
      dom_on(rovingFocusGroupEl, ENTRY_FOCUS_EVT, handleEntryFocus);
    });
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      const rovingFocusGroupEl = reactivity_esm_bundler_unref(rovingFocusGroupRef);
      off(rovingFocusGroupEl, ENTRY_FOCUS_EVT, handleEntryFocus);
    });
  }
});
function roving_focus_group_impl_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return renderSlot(_ctx.$slots, "default");
}
var ElRovingFocusGroupImpl = /* @__PURE__ */ _export_sfc(roving_focus_group_impl_sfc_main, [["render", roving_focus_group_impl_sfc_render]]);


//# sourceMappingURL=roving-focus-group-impl.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/roving-focus-group/src/roving-focus-group2.mjs





const roving_focus_group2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElRovingFocusGroup",
  components: {
    ElFocusGroupCollection: roving_focus_group_ElCollection,
    ElRovingFocusGroupImpl: ElRovingFocusGroupImpl
  }
});
function roving_focus_group2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_roving_focus_group_impl = resolveComponent("el-roving-focus-group-impl");
  const _component_el_focus_group_collection = resolveComponent("el-focus-group-collection");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_focus_group_collection, null, {
    default: withCtx(() => [
      runtime_core_esm_bundler_createVNode(_component_el_roving_focus_group_impl, normalizeProps(guardReactiveProps(_ctx.$attrs)), {
        default: withCtx(() => [
          renderSlot(_ctx.$slots, "default")
        ]),
        _: 3
      }, 16)
    ]),
    _: 3
  });
}
var ElRovingFocusGroup = /* @__PURE__ */ _export_sfc(roving_focus_group2_sfc_main, [["render", roving_focus_group2_sfc_render]]);


//# sourceMappingURL=roving-focus-group2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/src/dropdown2.mjs

















const { ButtonGroup: dropdown2_ElButtonGroup } = ElButton;
const dropdown2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElDropdown",
  components: {
    ElButton: ElButton,
    ElFocusTrap: ElFocusTrap,
    ElButtonGroup: dropdown2_ElButtonGroup,
    ElScrollbar: ElScrollbar,
    ElDropdownCollection: ElCollection,
    ElTooltip: ElTooltip,
    ElRovingFocusGroup: ElRovingFocusGroup,
    ElIcon: ElIcon,
    ArrowDown: arrowDown
  },
  props: dropdownProps,
  emits: ["visible-change", "click", "command"],
  setup(props, { emit }) {
    const _instance = runtime_core_esm_bundler_getCurrentInstance();
    const triggeringElementRef = reactivity_esm_bundler_ref();
    const referenceElementRef = reactivity_esm_bundler_ref();
    const popperRef = reactivity_esm_bundler_ref(null);
    const contentRef = reactivity_esm_bundler_ref(null);
    const scrollbar = reactivity_esm_bundler_ref(null);
    const currentTabId = reactivity_esm_bundler_ref(null);
    const isUsingKeyboard = reactivity_esm_bundler_ref(false);
    const wrapStyle = runtime_core_esm_bundler_computed(() => ({
      maxHeight: addUnit(props.maxHeight)
    }));
    const dropdownTriggerKls = runtime_core_esm_bundler_computed(() => [
      [dropdownSize.value ? `el-dropdown--${dropdownSize.value}` : ""]
    ]);
    function handleClick() {
      handleClose();
    }
    function handleClose() {
      var _a;
      (_a = popperRef.value) == null ? void 0 : _a.onClose();
    }
    function handleOpen() {
      var _a;
      (_a = popperRef.value) == null ? void 0 : _a.onOpen();
    }
    const dropdownSize = useSize();
    function commandHandler(...args) {
      emit("command", ...args);
    }
    function onItemEnter() {
    }
    function onItemLeave() {
      const contentEl = reactivity_esm_bundler_unref(contentRef);
      contentEl == null ? void 0 : contentEl.focus();
      currentTabId.value = null;
    }
    function handleCurrentTabIdChange(id) {
      currentTabId.value = id;
    }
    function handleEntryFocus(e) {
      if (!isUsingKeyboard.value) {
        e.preventDefault();
        e.stopImmediatePropagation();
      }
    }
    runtime_core_esm_bundler_provide(DROPDOWN_INJECTION_KEY, {
      contentRef,
      isUsingKeyboard,
      onItemEnter,
      onItemLeave
    });
    runtime_core_esm_bundler_provide("elDropdown", {
      instance: _instance,
      dropdownSize,
      handleClick,
      commandHandler,
      trigger: reactivity_esm_bundler_toRef(props, "trigger"),
      hideOnClick: reactivity_esm_bundler_toRef(props, "hideOnClick")
    });
    const onMountOnFocus = (e) => {
      var _a, _b;
      e.preventDefault();
      (_b = (_a = contentRef.value) == null ? void 0 : _a.focus) == null ? void 0 : _b.call(_a, {
        preventScroll: true
      });
    };
    const handlerMainButtonClick = (event) => {
      emit("click", event);
    };
    return {
      scrollbar,
      wrapStyle,
      dropdownTriggerKls,
      dropdownSize,
      currentTabId,
      handleCurrentTabIdChange,
      handlerMainButtonClick,
      handleEntryFocus,
      handleClose,
      handleOpen,
      onMountOnFocus,
      popperRef,
      triggeringElementRef,
      referenceElementRef
    };
  }
});
const dropdown2_hoisted_1 = { class: "el-dropdown" };
function dropdown2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  var _a;
  const _component_el_dropdown_collection = resolveComponent("el-dropdown-collection");
  const _component_el_roving_focus_group = resolveComponent("el-roving-focus-group");
  const _component_el_focus_trap = resolveComponent("el-focus-trap");
  const _component_el_scrollbar = resolveComponent("el-scrollbar");
  const _component_el_tooltip = resolveComponent("el-tooltip");
  const _component_el_button = resolveComponent("el-button");
  const _component_arrow_down = resolveComponent("arrow-down");
  const _component_el_icon = resolveComponent("el-icon");
  const _component_el_button_group = resolveComponent("el-button-group");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", dropdown2_hoisted_1, [
    runtime_core_esm_bundler_createVNode(_component_el_tooltip, {
      ref: "popperRef",
      effect: _ctx.effect,
      "fallback-placements": ["bottom", "top"],
      "popper-options": _ctx.popperOptions,
      "gpu-acceleration": false,
      "hide-after": _ctx.hideTimeout,
      "manual-mode": true,
      placement: _ctx.placement,
      "popper-class": `el-dropdown__popper ${_ctx.popperClass}`,
      "reference-element": (_a = _ctx.referenceElementRef) == null ? void 0 : _a.$el,
      trigger: _ctx.trigger,
      "show-after": _ctx.showTimeout,
      "stop-popper-mouse-event": false,
      "virtual-ref": _ctx.triggeringElementRef,
      "virtual-triggering": _ctx.splitButton,
      "append-to-body": "",
      pure: "",
      transition: "el-zoom-in-top",
      persistent: "",
      onShow: _cache[0] || (_cache[0] = ($event) => _ctx.$emit("visible-change", true)),
      onHide: _cache[1] || (_cache[1] = ($event) => _ctx.$emit("visible-change", false))
    }, createSlots({
      content: withCtx(() => [
        runtime_core_esm_bundler_createVNode(_component_el_scrollbar, {
          ref: "scrollbar",
          "wrap-style": _ctx.wrapStyle,
          tag: "ul",
          "view-class": "el-dropdown__list"
        }, {
          default: withCtx(() => [
            runtime_core_esm_bundler_createVNode(_component_el_focus_trap, {
              trapped: "",
              onMountOnFocus: _ctx.onMountOnFocus
            }, {
              default: withCtx(() => [
                runtime_core_esm_bundler_createVNode(_component_el_roving_focus_group, {
                  loop: _ctx.loop,
                  "current-tab-id": _ctx.currentTabId,
                  orientation: "horizontal",
                  onCurrentTabIdChange: _ctx.handleCurrentTabIdChange,
                  onEntryFocus: _ctx.handleEntryFocus
                }, {
                  default: withCtx(() => [
                    runtime_core_esm_bundler_createVNode(_component_el_dropdown_collection, null, {
                      default: withCtx(() => [
                        renderSlot(_ctx.$slots, "dropdown")
                      ]),
                      _: 3
                    })
                  ]),
                  _: 3
                }, 8, ["loop", "current-tab-id", "onCurrentTabIdChange", "onEntryFocus"])
              ]),
              _: 3
            }, 8, ["onMountOnFocus"])
          ]),
          _: 3
        }, 8, ["wrap-style"])
      ]),
      _: 2
    }, [
      !_ctx.splitButton ? {
        name: "default",
        fn: withCtx(() => [
          createBaseVNode("div", {
            class: normalizeClass(_ctx.dropdownTriggerKls)
          }, [
            renderSlot(_ctx.$slots, "default")
          ], 2)
        ])
      } : void 0
    ]), 1032, ["effect", "popper-options", "hide-after", "placement", "popper-class", "reference-element", "trigger", "show-after", "virtual-ref", "virtual-triggering"]),
    _ctx.splitButton ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_button_group, { key: 0 }, {
      default: withCtx(() => [
        runtime_core_esm_bundler_createVNode(_component_el_button, {
          ref: "referenceElementRef",
          size: _ctx.dropdownSize,
          type: _ctx.type,
          onClick: _ctx.handlerMainButtonClick
        }, {
          default: withCtx(() => [
            renderSlot(_ctx.$slots, "default")
          ]),
          _: 3
        }, 8, ["size", "type", "onClick"]),
        runtime_core_esm_bundler_createVNode(_component_el_button, {
          ref: "triggeringElementRef",
          size: _ctx.dropdownSize,
          type: _ctx.type,
          class: "el-dropdown__caret-button"
        }, {
          default: withCtx(() => [
            runtime_core_esm_bundler_createVNode(_component_el_icon, { class: "el-dropdown__icon" }, {
              default: withCtx(() => [
                runtime_core_esm_bundler_createVNode(_component_arrow_down)
              ]),
              _: 1
            })
          ]),
          _: 1
        }, 8, ["size", "type"])
      ]),
      _: 3
    })) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ]);
}
var Dropdown = /* @__PURE__ */ _export_sfc(dropdown2_sfc_main, [["render", dropdown2_sfc_render]]);


//# sourceMappingURL=dropdown2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/src/dropdown-item-impl.mjs












const dropdown_item_impl_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "DropdownItemImpl",
  components: {
    ElIcon: ElIcon
  },
  props: dropdownItemProps,
  emits: ["pointermove", "pointerleave", "click"],
  setup(_, { emit }) {
    const { collectionItemRef: dropdownCollectionItemRef } = runtime_core_esm_bundler_inject(COLLECTION_ITEM_INJECTION_KEY, void 0);
    const { collectionItemRef: rovingFocusCollectionItemRef } = runtime_core_esm_bundler_inject(roving_focus_group_COLLECTION_ITEM_INJECTION_KEY, void 0);
    const {
      rovingFocusGroupItemRef,
      tabIndex,
      handleFocus,
      handleKeydown: handleItemKeydown,
      handleMousedown
    } = runtime_core_esm_bundler_inject(ROVING_FOCUS_GROUP_ITEM_INJECTION_KEY, void 0);
    const itemRef = composeRefs(dropdownCollectionItemRef, rovingFocusCollectionItemRef, rovingFocusGroupItemRef);
    const handleKeydown = composeEventHandlers((e) => {
      const { code } = e;
      if (code === aria_EVENT_CODE.enter || code === aria_EVENT_CODE.space) {
        e.preventDefault();
        e.stopImmediatePropagation();
        emit("click", e);
        return true;
      }
    }, handleItemKeydown);
    return {
      itemRef,
      dataset: {
        [COLLECTION_ITEM_SIGN]: ""
      },
      tabIndex,
      handleFocus,
      handleKeydown,
      handleMousedown
    };
  }
});
const dropdown_item_impl_hoisted_1 = {
  key: 0,
  class: "el-dropdown-menu__item--divided"
};
const dropdown_item_impl_hoisted_2 = ["aria-disabled", "tabindex"];
function dropdown_item_impl_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = resolveComponent("el-icon");
  return runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, null, [
    _ctx.divided ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", dropdown_item_impl_hoisted_1)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    createBaseVNode("div", mergeProps({ ref: _ctx.itemRef }, _ctx.dataset, {
      "aria-disabled": _ctx.disabled,
      class: {
        "el-dropdown-menu__item": true,
        "is-disabled": _ctx.disabled
      },
      tabindex: _ctx.tabIndex,
      role: "menuitem",
      onClick: _cache[0] || (_cache[0] = (e) => _ctx.$emit("click", e)),
      onFocus: _cache[1] || (_cache[1] = (...args) => _ctx.handleFocus && _ctx.handleFocus(...args)),
      onKeydown: _cache[2] || (_cache[2] = (...args) => _ctx.handleKeydown && _ctx.handleKeydown(...args)),
      onMousedown: _cache[3] || (_cache[3] = (...args) => _ctx.handleMousedown && _ctx.handleMousedown(...args)),
      onPointermove: _cache[4] || (_cache[4] = (e) => _ctx.$emit("pointermove", e)),
      onPointerleave: _cache[5] || (_cache[5] = (e) => _ctx.$emit("pointerleave", e))
    }), [
      _ctx.icon ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, { key: 0 }, {
        default: withCtx(() => [
          (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.icon)))
        ]),
        _: 1
      })) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
      renderSlot(_ctx.$slots, "default")
    ], 16, dropdown_item_impl_hoisted_2)
  ], 64);
}
var ElDropdownItemImpl = /* @__PURE__ */ _export_sfc(dropdown_item_impl_sfc_main, [["render", dropdown_item_impl_sfc_render]]);


//# sourceMappingURL=dropdown-item-impl.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/src/useDropdown.mjs





const useDropdown = () => {
  const elDropdown = runtime_core_esm_bundler_inject("elDropdown", {});
  const _elDropdownSize = runtime_core_esm_bundler_computed(() => elDropdown == null ? void 0 : elDropdown.dropdownSize);
  return {
    elDropdown,
    _elDropdownSize
  };
};
const initDropdownDomEvent = (dropdownChildren, triggerElm, _instance) => {
  const menuItems = ref(null);
  const menuItemsArray = ref(null);
  const dropdownElm = ref(null);
  const listId = ref(`dropdown-menu-${generateId()}`);
  dropdownElm.value = dropdownChildren == null ? void 0 : dropdownChildren.subTree.el;
  function removeTabindex() {
    var _a;
    triggerElm.setAttribute("tabindex", "-1");
    (_a = menuItemsArray.value) == null ? void 0 : _a.forEach((item) => {
      item.setAttribute("tabindex", "-1");
    });
  }
  function resetTabindex(ele) {
    removeTabindex();
    ele == null ? void 0 : ele.setAttribute("tabindex", "0");
  }
  function handleTriggerKeyDown(ev) {
    const code = ev.code;
    if ([EVENT_CODE.up, EVENT_CODE.down].includes(code)) {
      removeTabindex();
      resetTabindex(menuItems.value[0]);
      menuItems.value[0].focus();
      ev.preventDefault();
      ev.stopPropagation();
    } else if (code === EVENT_CODE.enter) {
      _instance.handleClick();
    } else if ([EVENT_CODE.tab, EVENT_CODE.esc].includes(code)) {
      _instance.hide();
    }
  }
  function handleItemKeyDown(ev) {
    const code = ev.code;
    const target = ev.target;
    const currentIndex = menuItemsArray.value.indexOf(target);
    const max = menuItemsArray.value.length - 1;
    let nextIndex;
    if ([EVENT_CODE.up, EVENT_CODE.down].includes(code)) {
      if (code === EVENT_CODE.up) {
        nextIndex = currentIndex !== 0 ? currentIndex - 1 : 0;
      } else {
        nextIndex = currentIndex < max ? currentIndex + 1 : max;
      }
      removeTabindex();
      resetTabindex(menuItems.value[nextIndex]);
      menuItems.value[nextIndex].focus();
      ev.preventDefault();
      ev.stopPropagation();
    } else if (code === EVENT_CODE.enter) {
      triggerElmFocus();
      target.click();
      if (_instance.props.hideOnClick) {
        _instance.hide();
      }
    } else if ([EVENT_CODE.tab, EVENT_CODE.esc].includes(code)) {
      _instance.hide();
      triggerElmFocus();
    }
  }
  function initAria() {
    dropdownElm.value.setAttribute("id", listId.value);
    triggerElm.setAttribute("aria-haspopup", "list");
    triggerElm.setAttribute("aria-controls", listId.value);
    if (!_instance.props.splitButton) {
      triggerElm.setAttribute("role", "button");
      triggerElm.setAttribute("tabindex", _instance.props.tabindex);
      addClass(triggerElm, "el-dropdown-selfdefine");
    }
  }
  function initEvent() {
    on(triggerElm, "keydown", handleTriggerKeyDown);
    on(dropdownElm.value, "keydown", handleItemKeyDown, true);
  }
  function initDomOperation() {
    menuItems.value = dropdownElm.value.querySelectorAll("[tabindex='-1']");
    menuItemsArray.value = [].slice.call(menuItems.value);
    initEvent();
    initAria();
  }
  function triggerElmFocus() {
    triggerElm.focus();
  }
  initDomOperation();
};


//# sourceMappingURL=useDropdown.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/roving-focus-group/src/roving-focus-item.mjs










const roving_focus_item_sfc_main = runtime_core_esm_bundler_defineComponent({
  components: {
    ElRovingFocusCollectionItem: roving_focus_group_ElCollectionItem
  },
  props: {
    focusable: {
      type: Boolean,
      default: true
    },
    active: {
      type: Boolean,
      default: false
    }
  },
  emits: ["mousedown", "focus", "keydown"],
  setup(props, { emit }) {
    const { currentTabbedId, loop, onItemFocus, onItemShiftTab } = runtime_core_esm_bundler_inject(ROVING_FOCUS_GROUP_INJECTION_KEY, void 0);
    const { getItems } = runtime_core_esm_bundler_inject(roving_focus_group_COLLECTION_INJECTION_KEY, void 0);
    const id = useId();
    const rovingFocusGroupItemRef = reactivity_esm_bundler_ref(null);
    const handleMousedown = composeEventHandlers((e) => {
      emit("mousedown", e);
    }, (e) => {
      if (!props.focusable) {
        e.preventDefault();
      } else {
        onItemFocus(reactivity_esm_bundler_unref(id));
      }
    });
    const handleFocus = composeEventHandlers((e) => {
      emit("focus", e);
    }, () => {
      onItemFocus(reactivity_esm_bundler_unref(id));
    });
    const handleKeydown = composeEventHandlers((e) => {
      emit("keydown", e);
    }, (e) => {
      const { key, shiftKey, target, currentTarget } = e;
      if (key === aria_EVENT_CODE.tab && shiftKey) {
        onItemShiftTab();
        return;
      }
      if (target !== currentTarget)
        return;
      const focusIntent = getFocusIntent(e);
      if (focusIntent) {
        e.preventDefault();
        const items = getItems().filter((item) => item.focusable);
        let elements = items.map((item) => item.ref);
        switch (focusIntent) {
          case "last": {
            elements.reverse();
            break;
          }
          case "prev":
          case "next": {
            if (focusIntent === "prev") {
              elements.reverse();
            }
            const currentIdx = elements.indexOf(currentTarget);
            elements = loop.value ? reorderArray(elements, currentIdx + 1) : elements.slice(currentIdx + 1);
            break;
          }
          default: {
            break;
          }
        }
        runtime_core_esm_bundler_nextTick(() => {
          focusFirst(elements);
        });
      }
    });
    const isCurrentTab = runtime_core_esm_bundler_computed(() => currentTabbedId.value === reactivity_esm_bundler_unref(id));
    runtime_core_esm_bundler_provide(ROVING_FOCUS_GROUP_ITEM_INJECTION_KEY, {
      rovingFocusGroupItemRef,
      tabIndex: runtime_core_esm_bundler_computed(() => reactivity_esm_bundler_unref(isCurrentTab) ? 0 : -1),
      handleMousedown,
      handleFocus,
      handleKeydown
    });
    return {
      id,
      handleKeydown,
      handleFocus,
      handleMousedown
    };
  }
});
function roving_focus_item_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_roving_focus_collection_item = resolveComponent("el-roving-focus-collection-item");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_roving_focus_collection_item, {
    id: _ctx.id,
    focusable: _ctx.focusable,
    active: _ctx.active
  }, {
    default: withCtx(() => [
      renderSlot(_ctx.$slots, "default")
    ]),
    _: 3
  }, 8, ["id", "focusable", "active"]);
}
var ElRovingFocusItem = /* @__PURE__ */ _export_sfc(roving_focus_item_sfc_main, [["render", roving_focus_item_sfc_render]]);


//# sourceMappingURL=roving-focus-item.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/src/dropdown-item.mjs










const dropdown_item_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElDropdownItem",
  components: {
    ElDropdownCollectionItem: ElCollectionItem,
    ElRovingFocusItem: ElRovingFocusItem,
    ElDropdownItemImpl: ElDropdownItemImpl
  },
  props: dropdownItemProps,
  emits: ["pointermove", "pointerleave", "click"],
  setup(props, { emit }) {
    const { elDropdown } = useDropdown();
    const _instance = runtime_core_esm_bundler_getCurrentInstance();
    const itemRef = reactivity_esm_bundler_ref(null);
    const textContent = runtime_core_esm_bundler_computed(() => {
      var _a, _b;
      return (_b = (_a = reactivity_esm_bundler_unref(itemRef)) == null ? void 0 : _a.textContent) != null ? _b : "";
    });
    const { onItemEnter, onItemLeave } = runtime_core_esm_bundler_inject(DROPDOWN_INJECTION_KEY, void 0);
    const handlePointerMove = composeEventHandlers((e) => {
      emit("pointermove", e);
      return e.defaultPrevented;
    }, whenMouse((e) => {
      var _a;
      if (props.disabled) {
        onItemLeave(e);
      } else {
        onItemEnter(e);
        if (!e.defaultPrevented) {
          ;
          (_a = e.currentTarget) == null ? void 0 : _a.focus();
        }
      }
    }));
    const handlePointerLeave = composeEventHandlers((e) => {
      emit("pointerleave", e);
      return e.defaultPrevented;
    }, whenMouse((e) => {
      onItemLeave(e);
    }));
    const handleClick = composeEventHandlers((e) => {
      emit("click", e);
      return e.defaultPrevented;
    }, (e) => {
      var _a, _b, _c;
      if (props.disabled) {
        e.stopImmediatePropagation();
        return;
      }
      if ((_a = elDropdown == null ? void 0 : elDropdown.hideOnClick) == null ? void 0 : _a.value) {
        (_b = elDropdown.handleClick) == null ? void 0 : _b.call(elDropdown);
      }
      (_c = elDropdown.commandHandler) == null ? void 0 : _c.call(elDropdown, props.command, _instance, e);
    });
    return {
      handleClick,
      handlePointerMove,
      handlePointerLeave,
      textContent
    };
  }
});
function dropdown_item_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  var _a;
  const _component_el_dropdown_item_impl = resolveComponent("el-dropdown-item-impl");
  const _component_el_roving_focus_item = resolveComponent("el-roving-focus-item");
  const _component_el_dropdown_collection_item = resolveComponent("el-dropdown-collection-item");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_dropdown_collection_item, {
    disabled: _ctx.disabled,
    "text-value": (_a = _ctx.textValue) != null ? _a : _ctx.textContent
  }, {
    default: withCtx(() => [
      runtime_core_esm_bundler_createVNode(_component_el_roving_focus_item, {
        focusable: !_ctx.disabled
      }, {
        default: withCtx(() => [
          runtime_core_esm_bundler_createVNode(_component_el_dropdown_item_impl, mergeProps(_ctx.$props, {
            onPointerleave: _ctx.handlePointerLeave,
            onPointermove: _ctx.handlePointerMove,
            onClick: _ctx.handleClick
          }), {
            default: withCtx(() => [
              renderSlot(_ctx.$slots, "default")
            ]),
            _: 3
          }, 16, ["onPointerleave", "onPointermove", "onClick"])
        ]),
        _: 3
      }, 8, ["focusable"])
    ]),
    _: 3
  }, 8, ["disabled", "text-value"]);
}
var DropdownItem = /* @__PURE__ */ _export_sfc(dropdown_item_sfc_main, [["render", dropdown_item_sfc_render]]);


//# sourceMappingURL=dropdown-item.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/src/dropdown-menu.mjs














const dropdown_menu_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElDropdownMenu",
  props: dropdownMenuProps,
  setup(props) {
    const { _elDropdownSize } = useDropdown();
    const size = _elDropdownSize.value;
    const { focusTrapRef, onKeydown } = runtime_core_esm_bundler_inject(FOCUS_TRAP_INJECTION_KEY, void 0);
    const { contentRef } = runtime_core_esm_bundler_inject(DROPDOWN_INJECTION_KEY, void 0);
    const { collectionRef: dropdownCollectionRef, getItems } = runtime_core_esm_bundler_inject(COLLECTION_INJECTION_KEY, void 0);
    const {
      rovingFocusGroupRef,
      rovingFocusGroupRootStyle,
      tabIndex,
      onBlur,
      onFocus,
      onMousedown
    } = runtime_core_esm_bundler_inject(ROVING_FOCUS_GROUP_INJECTION_KEY, void 0);
    const { collectionRef: rovingFocusGroupCollectionRef } = runtime_core_esm_bundler_inject(roving_focus_group_COLLECTION_INJECTION_KEY, void 0);
    const dropdownKls = runtime_core_esm_bundler_computed(() => {
      return [
        "el-dropdown-menu",
        size.value && `el-dropdown-menu--${size.value}`
      ];
    });
    const dropdownListWrapperRef = composeRefs(contentRef, dropdownCollectionRef, focusTrapRef, rovingFocusGroupRef, rovingFocusGroupCollectionRef);
    const composedKeydown = composeEventHandlers((e) => {
      var _a;
      (_a = props.onKeydown) == null ? void 0 : _a.call(props, e);
    }, (e) => {
      const { currentTarget, code, target } = e;
      const isKeydownContained = currentTarget.contains(target);
      if (isKeydownContained) {
      }
      if (aria_EVENT_CODE.tab === code) {
        e.stopImmediatePropagation();
      }
      e.preventDefault();
      if (target !== reactivity_esm_bundler_unref(contentRef))
        return;
      if (!FIRST_LAST_KEYS.includes(code))
        return;
      const items = getItems().filter((item) => !item.disabled);
      const targets = items.map((item) => item.ref);
      if (LAST_KEYS.includes(code)) {
        targets.reverse();
      }
      focusFirst(targets);
    });
    const handleKeydown = (e) => {
      composedKeydown(e);
      onKeydown(e);
    };
    return {
      size,
      rovingFocusGroupRootStyle,
      tabIndex,
      dropdownKls,
      dropdownListWrapperRef,
      handleKeydown,
      onBlur,
      onFocus,
      onMousedown
    };
  }
});
function dropdown_menu_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("ul", {
    ref: _ctx.dropdownListWrapperRef,
    class: normalizeClass(_ctx.dropdownKls),
    style: normalizeStyle(_ctx.rovingFocusGroupRootStyle),
    tabindex: -1,
    role: "menu",
    onBlur: _cache[0] || (_cache[0] = (...args) => _ctx.onBlur && _ctx.onBlur(...args)),
    onFocus: _cache[1] || (_cache[1] = (...args) => _ctx.onFocus && _ctx.onFocus(...args)),
    onKeydown: _cache[2] || (_cache[2] = (...args) => _ctx.handleKeydown && _ctx.handleKeydown(...args)),
    onMousedown: _cache[3] || (_cache[3] = (...args) => _ctx.onMousedown && _ctx.onMousedown(...args))
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 38);
}
var DropdownMenu = /* @__PURE__ */ _export_sfc(dropdown_menu_sfc_main, [["render", dropdown_menu_sfc_render]]);


//# sourceMappingURL=dropdown-menu.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/dropdown/index.mjs





const ElDropdown = withInstall(Dropdown, {
  DropdownItem: DropdownItem,
  DropdownMenu: DropdownMenu
});
const ElDropdownItem = withNoopInstall(DropdownItem);
const ElDropdownMenu = withNoopInstall(DropdownMenu);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/badge/src/badge.mjs


const badgeProps = buildProps({
  value: {
    type: [String, Number],
    default: ""
  },
  max: {
    type: Number,
    default: 99
  },
  isDot: Boolean,
  hidden: Boolean,
  type: {
    type: String,
    values: ["primary", "success", "warning", "info", "danger"],
    default: "danger"
  }
});


//# sourceMappingURL=badge.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/badge/src/badge2.mjs






const badge2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElBadge",
  props: badgeProps,
  setup(props) {
    const ns = useNamespace("badge");
    const content = runtime_core_esm_bundler_computed(() => {
      if (props.isDot)
        return "";
      if (typeof props.value === "number" && typeof props.max === "number") {
        return props.max < props.value ? `${props.max}+` : `${props.value}`;
      }
      return `${props.value}`;
    });
    return {
      ns,
      content
    };
  }
});
const badge2_hoisted_1 = ["textContent"];
function badge2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass(_ctx.ns.b())
  }, [
    renderSlot(_ctx.$slots, "default"),
    runtime_core_esm_bundler_createVNode(Transition, { name: "el-zoom-in-center" }, {
      default: withCtx(() => [
        withDirectives(createBaseVNode("sup", {
          class: normalizeClass([
            _ctx.ns.e("content"),
            _ctx.ns.em("content", _ctx.type),
            _ctx.ns.is("fixed", !!_ctx.$slots.default),
            _ctx.ns.is("dot", _ctx.isDot)
          ]),
          textContent: toDisplayString(_ctx.content)
        }, null, 10, badge2_hoisted_1), [
          [vShow, !_ctx.hidden && (_ctx.content || _ctx.content === "0" || _ctx.isDot)]
        ])
      ]),
      _: 1
    })
  ], 2);
}
var Badge = /* @__PURE__ */ _export_sfc(badge2_sfc_main, [["render", badge2_sfc_render]]);


//# sourceMappingURL=badge2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/badge/index.mjs




const ElBadge = withInstall(Badge);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/col/src/col.mjs



const colProps = buildProps({
  tag: {
    type: String,
    default: "div"
  },
  span: {
    type: Number,
    default: 24
  },
  offset: {
    type: Number,
    default: 0
  },
  pull: {
    type: Number,
    default: 0
  },
  push: {
    type: Number,
    default: 0
  },
  xs: {
    type: definePropType([Number, Object]),
    default: () => mutable({})
  },
  sm: {
    type: definePropType([Number, Object]),
    default: () => mutable({})
  },
  md: {
    type: definePropType([Number, Object]),
    default: () => mutable({})
  },
  lg: {
    type: definePropType([Number, Object]),
    default: () => mutable({})
  },
  xl: {
    type: definePropType([Number, Object]),
    default: () => mutable({})
  }
});
var Col = runtime_core_esm_bundler_defineComponent({
  name: "ElCol",
  props: colProps,
  setup(props, { slots }) {
    const { gutter } = runtime_core_esm_bundler_inject("ElRow", { gutter: { value: 0 } });
    const style = runtime_core_esm_bundler_computed(() => {
      if (gutter.value) {
        return {
          paddingLeft: `${gutter.value / 2}px`,
          paddingRight: `${gutter.value / 2}px`
        };
      }
      return {};
    });
    const classList = runtime_core_esm_bundler_computed(() => {
      const classes = [];
      const pos = ["span", "offset", "pull", "push"];
      pos.forEach((prop) => {
        const size = props[prop];
        if (typeof size === "number") {
          if (prop === "span")
            classes.push(`el-col-${props[prop]}`);
          else if (size > 0)
            classes.push(`el-col-${prop}-${props[prop]}`);
        }
      });
      const sizes = ["xs", "sm", "md", "lg", "xl"];
      sizes.forEach((size) => {
        if (typeof props[size] === "number") {
          classes.push(`el-col-${size}-${props[size]}`);
        } else if (typeof props[size] === "object") {
          const sizeProps = props[size];
          Object.keys(sizeProps).forEach((prop) => {
            classes.push(prop !== "span" ? `el-col-${size}-${prop}-${sizeProps[prop]}` : `el-col-${size}-${sizeProps[prop]}`);
          });
        }
      });
      if (gutter.value) {
        classes.push("is-guttered");
      }
      return classes;
    });
    return () => h(props.tag, {
      class: ["el-col", classList.value],
      style: style.value
    }, [renderSlot(slots, "default")]);
  }
});


//# sourceMappingURL=col.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/col/index.mjs




const ElCol = withInstall(Col);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/HeadBar.vue?vue&type=template&id=7638b672&scoped=true
/* unplugin-vue-components disabled */









const HeadBarvue_type_template_id_7638b672_scoped_true_withScopeId = n => (pushScopeId("data-v-7638b672"), n = n(), popScopeId(), n);

const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_1 = /*#__PURE__*/HeadBarvue_type_template_id_7638b672_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("div", {
  class: "title"
}, [/*#__PURE__*/createBaseVNode("img", {
  src: "https://bjtu.edu.cn/images/img2019/logo_01.png",
  alt: "logo"
}), /*#__PURE__*/createBaseVNode("h2", null, "课程平台")], -1
/* HOISTED */
));

const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_2 = {
  class: "welcome-info"
};
const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_3 = {
  class: "operation"
};

const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_4 = /*#__PURE__*/HeadBarvue_type_template_id_7638b672_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1645608428232",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "20733",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M128 256h768v85.333333H128V256m0 213.333333h768v85.333334H128v-85.333334m0 213.333334h768v85.333333H128v-85.333333z",
  fill: "",
  "p-id": "20734"
})], -1
/* HOISTED */
));

const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_5 = /*#__PURE__*/createTextVNode(" 检查更新 ");

const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_6 = /*#__PURE__*/createTextVNode("展示/隐藏侧栏");

const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_7 = /*#__PURE__*/createTextVNode("返回旧版");

const HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_8 = /*#__PURE__*/createTextVNode("退出当前账号");

function HeadBarvue_type_template_id_7638b672_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_col = ElCol;

  const _component_el_icon = ElIcon;

  const _component_el_button = ElButton;

  const _component_el_badge = ElBadge;

  const _component_el_dropdown_item = ElDropdownItem;

  const _component_el_dropdown_menu = ElDropdownMenu;

  const _component_el_dropdown = ElDropdown;

  const _component_el_row = ElRow;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_row, null, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 8
    }, {
      default: withCtx(() => [HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_1]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 8
    }), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 8
    }, {
      default: withCtx(() => [createBaseVNode("div", HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_2, [createBaseVNode("span", null, "欢迎你," + toDisplayString($data.userInfo.name), 1
      /* TEXT */
      )]), createBaseVNode("div", HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_3, [runtime_core_esm_bundler_createVNode(_component_el_dropdown, {
        onCommand: $options.handleCommand
      }, {
        dropdown: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_dropdown_menu, null, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_dropdown_item, {
            command: "check"
          }, {
            default: withCtx(() => [HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_5, runtime_core_esm_bundler_createVNode(_component_el_badge, {
              "is-dot": $data.needUpdate
            }, null, 8
            /* PROPS */
            , ["is-dot"])]),
            _: 1
            /* STABLE */

          }), runtime_core_esm_bundler_createVNode(_component_el_dropdown_item, {
            command: "sidebar"
          }, {
            default: withCtx(() => [HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_6]),
            _: 1
            /* STABLE */

          }), runtime_core_esm_bundler_createVNode(_component_el_dropdown_item, {
            command: "old"
          }, {
            default: withCtx(() => [HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_7]),
            _: 1
            /* STABLE */

          }), runtime_core_esm_bundler_createVNode(_component_el_dropdown_item, {
            command: "exit"
          }, {
            default: withCtx(() => [HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_8]),
            _: 1
            /* STABLE */

          })]),
          _: 1
          /* STABLE */

        })]),
        default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_badge, {
          "is-dot": $data.needUpdate
        }, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_button, {
            class: "el-dropdown-link",
            plain: ""
          }, {
            default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
              default: withCtx(() => [HeadBarvue_type_template_id_7638b672_scoped_true_hoisted_4]),
              _: 1
              /* STABLE */

            })]),
            _: 1
            /* STABLE */

          })]),
          _: 1
          /* STABLE */

        }, 8
        /* PROPS */
        , ["is-dot"])]),
        _: 1
        /* STABLE */

      }, 8
      /* PROPS */
      , ["onCommand"])])]),
      _: 1
      /* STABLE */

    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Common/HeadBar.vue?vue&type=template&id=7638b672&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/ts/GetInfo.ts

const baseUrl = `http://cc.bjtu.edu.cn:81/meol`;
const userinfoUrl = `${baseUrl}/welcomepage/student/index.jsp`; // 个人信息
const reminderUrl = `${baseUrl}/welcomepage/student/interaction_reminder.jsp`; // 互动提醒
const lessonUrl = `${baseUrl}/lesson/blen.student.lesson.list.jsp`; // 课程列表
const hwtListUrl = `${baseUrl}/common/hw/student/hwtask.jsp`; // 课程作业列表
const hwtDetailUrl = `${baseUrl}/common/hw/student/taskanswer.jsp`; // 课程作业查看结果 ?hwtid=
const hwtContentUrl = `${baseUrl}/common/hw/student/write.jsp`; // 作业提交
const hwtReviewContentUrl = `${baseUrl}/common/hw/student/taskanswer.jsp`; // 作业查看结果页
const notifyListUrl = `${baseUrl}/common/inform/index_stu.jsp`; // 课程通知列表(有已阅读信息) ?lid=
const notifyMessageUrl = `${baseUrl}/jpk/course/layout/course_meswrap.jsp`; // 通知内容
const lessonPageUrl = `${baseUrl}/jpk/course/layout/newpage/index.jsp`; // 课程主页 ?courseId=
const lessonPageInfo = `${baseUrl}/jpk/course/layout/newpage/default_demonstrate.jsp`; // 课程信息 ?courseId=
async function getUserInfo() {
    return await SendRequest(userinfoUrl, (obj) => {
        return obj.querySelectorAll(".userinfobody>ul>li");
    })
        .then((res) => {
        let obj = {
            name: "",
            loginTime: "",
            onlineTime: "",
            loginTimes: "",
        };
        res.forEach((item, index) => {
            obj[Object.keys(obj)[index]] = item.innerText.split(":")[1].trim();
        });
        return obj;
    })
        .catch((error) => {
        console.log(error);
    });
}
async function getRemindInfo() {
    return await SendRequest(reminderUrl, (obj) => {
        return obj.querySelectorAll("ul[id='reminder']>li>ul");
    })
        .then((res) => {
        let obj = {
            notify: [],
            hwt: [],
        };
        res.forEach((it, ind) => {
            it.querySelectorAll("li>a").forEach((item) => {
                let classobj = {
                    name: "",
                    id: "",
                    type: "",
                };
                classobj.name = item.innerText.trim();
                classobj.id = item
                    .getAttribute("href")
                    .split("lid=")[1]
                    .split("&t=")[0];
                classobj.type = item
                    .getAttribute("href")
                    .split("lid=")[1]
                    .split("&t=")[1];
                if (classobj.type === "hw") {
                    obj["hwt"].push(classobj);
                }
                else if (classobj.type === "info") {
                    obj["notify"].push(classobj);
                }
            });
        });
        return obj;
    })
        .catch((error) => {
        console.log(error);
    });
}
async function getLessonInfo() {
    return await SendRequest(lessonUrl, (obj) => {
        return obj.querySelectorAll("tbody>tr");
    })
        .then((res) => {
        let arry = [];
        res.forEach((item, index) => {
            if (index === 0)
                return;
            let obj = {
                id: "",
                name: "",
                academy: "",
                teacher: "",
            };
            let course = item.querySelectorAll("td a")[0];
            let academy = item.children[2];
            let teacher = item.children[3];
            obj.id = course
                .getAttribute("onclick")
                .split("courseId=")[1]
                .split("','")[0];
            obj.name = course.innerText.split("\n")[0].trim();
            obj.academy = academy.innerText.split("\n")[0];
            obj.teacher = teacher.innerText.split("\n")[0];
            arry.push(obj);
        });
        return arry;
    })
        .catch((error) => {
        console.log(error);
    });
}
async function getHwtInfo(lid) {
    return await SendRequest(`http://cc.bjtu.edu.cn:81/meol/hw/stu/hwStuHwtList.do?courseId=${lid}`, undefined).then((res) => {
        return res.json().then((res) => {
            if (res.datas.hwtList === undefined)
                return [];
            let lid = res.datas.courseId;
            let array = [];
            res.datas.hwtList.forEach((item) => {
                let obj = {
                    hwtID: "",
                    hwtName: "",
                    lid: lid,
                    date: "",
                    Date: new Date(res.deadLine),
                    remainTime: "",
                    able: false,
                    teacherName: "",
                };
                // obj.lid = res.
                obj.teacherName = item.realName;
                obj.able = item.submitStruts;
                obj.hwtName = item.title;
                obj.hwtID = item.id.toString();
                obj.date = item.deadLine;
                obj.Date = new Date(item.deadLine);
                obj.remainTime = parseInt(((obj.Date.getTime() - new Date().getTime()) /
                    (24 * 60 * 60 * 1000)).toString()).toString();
                array.push(obj);
            });
            console.log(array);
            return array;
        });
    });
}
async function getHwtSubmitStatus(hwtid) {
    return await SendRequest(hwtDetailUrl + `?hwtid=${hwtid}`, (obj) => {
        return (obj.querySelectorAll(".infotable")[1].querySelectorAll("input")
            .length !== 0);
    })
        .then((res) => {
        return res; // a boolean that whether submitted
    })
        .catch((err) => {
        console.log(err);
    });
}
async function getHwtSubmitContent(hwtid) {
    return await SendRequest(hwtReviewContentUrl + `?hwtid=${hwtid}`, (obj) => {
        return obj.querySelectorAll(".text>input")[1].attributes["value"].value;
    })
        .then((res) => {
        return res; // a string contain submit content
    })
        .catch((err) => {
        console.log(err);
    });
}
async function getNotifyList(lid) {
    return await SendRequest(notifyListUrl + `?tagbug=client&s_order=0&lid=${lid}`, (obj) => {
        return obj.querySelectorAll(".valuelist tr");
    }).then((res) => {
        let array = [];
        res.forEach((item, index) => {
            if (index === 0)
                return;
            let obj = {
                notifyName: "",
                id: "",
                pubTime: "",
                hadRead: false,
            };
            if (item.querySelectorAll("a").length === 0)
                return;
            obj.notifyName = item.querySelectorAll("a")[0].getAttribute("title");
            obj.id = item
                .querySelectorAll("a")[0]
                .getAttribute("href")
                .split("?nid=")[1]
                .split('"')[0];
            obj.pubTime = item.querySelectorAll(".align_c")[0].innerHTML;
            obj.hadRead = item.querySelectorAll("b").length === 0; // without </b> return true
            array.push(obj);
        });
        return array;
    });
}
async function getInformList() {
    return await getNotifyList("0");
}
async function visitLessonPage(lid) {
    return await SendRequest(lessonPageUrl + `?courseId=${lid}`, (obj) => {
        return obj;
    }).catch((err) => {
        console.log(err);
    });
}
async function getLessonPageInfo(lid) {
    return await SendRequest(lessonPageInfo + `?courseId=${lid}`, (obj) => {
        return obj;
    })
        .then(async (OuterRes) => {
        return await visitLessonPage(lid).then((InnerRes) => {
            return {
                introduction: OuterRes.querySelector(".coursecomm .body p").innerText,
                teacherInfo: {
                    name: InnerRes.querySelectorAll(".course_info .tutor .body li")[0].innerText.split("教师姓名:")[1],
                    academy: InnerRes.querySelectorAll(".course_info .tutor .body li")[1].innerText.split("所属院系:")[1],
                    selfIntroduce: InnerRes.querySelectorAll(".course_info .tutor .body li")[2].innerText.split("个人简介:")[1],
                },
                // TODO: 课程信息
            };
        });
    })
        .catch((err) => {
        console.log(err);
    });
}
async function getHwtContent(hwtid) {
    return await SendRequest(hwtContentUrl + `?hwtid=${hwtid}`, (obj) => {
        return obj;
    })
        .then((res) => {
        let table = res.querySelectorAll(".infotable>tbody>tr>td");
        return {
            // TODO: add only once submit
            title: table[0].innerText.trim(),
            deadline: table[1].innerText.split(`\n`)[0],
            score: table[2].innerText.trim(),
            content: table[3].querySelectorAll("input")[0].value,
            hwtid: res.querySelector("input[name=hwtid]").attributes["value"].value,
            hwaid: res.querySelector("input[name=hwaid]").attributes["value"].value,
        };
    })
        .catch((err) => {
        console.log(err);
    });
}
async function getHwtReviewContent(hwtid) {
    return await SendRequest(hwtReviewContentUrl + `?hwtid=${hwtid}`, (obj) => {
        return obj;
    })
        .then((res) => {
        let table = res.querySelectorAll(".infotable>tbody>tr>td");
        return {
            // TODO: add evaluation results and comments
            title: table[0].innerText.trim(),
            deadline: table[1].innerText.split(`\n`)[0],
            score: table[2].innerText.trim(),
            getscore: table[3].innerText.trim(),
            content: table[4].querySelectorAll("input")[0].value,
            answer: res.querySelectorAll(".text>input")[1] === undefined
                ? undefined
                : res.querySelectorAll(".text>input")[1].value,
            results: undefined,
            comments: undefined,
        };
    })
        .catch((err) => {
        console.log(err);
    });
}
/* harmony default export */ const GetInfo = ({
    getUserInfo: getUserInfo,
    getRemindInfo: getRemindInfo,
    getLessonInfo: getLessonInfo,
    getHwtInfo: getHwtInfo,
    getHwtSubmitStatus: getHwtSubmitStatus,
    getHwtContent: getHwtContent,
    getNotifyList: getNotifyList,
    getInformList: getInformList,
    visitLessonPage: visitLessonPage,
    getLessonPageInfo: getLessonPageInfo,
    getHwtSubmitContent: getHwtSubmitContent,
    getHwtReviewContent: getHwtReviewContent,
});

;// CONCATENATED MODULE: ./src/ts/Config/Config.ts
const { version: Config_version, repository, description } = __webpack_require__("./package.json");
const scriptID = "432056";
const greasyUrl = `http://greasyfork.icu/zh-CN/scripts/${scriptID}`;
const tencentUrl = `https://wj.qq.com/s2/9790218/23fe/`;
const githubJsonUrl = `https://raw.githubusercontent.com/ZiuChen/NO-FLASH-Upload/v2.x-Vue/package.json`;
const delivrUpdateUrl = `https://fastly.jsdelivr.net/gh/ZiuChen/NO-FLASH-Upload@master/publish/index.prod.user.js`;
const delivrJsonUrl = `https://fastly.jsdelivr.net/gh/ZiuChen/NO-FLASH-Upload@master/package.json`;
const userConfig = {
    "back-to-old": {
        value: false,
        default: false,
        id: "back-to-old",
        type: "config",
    },
    "show-side-bar": {
        value: true,
        default: true,
        id: "show-side-bar",
        type: "config",
    },
    "hwt-list-card-size": {
        value: 24,
        default: 24,
        id: "hwt-list-card-size",
        type: "card-size",
    },
    "notify-list-card-size": {
        value: 12,
        default: 12,
        id: "notify-list-card-size",
        type: "card-size",
    },
    "lesson-list-card-size": {
        value: 12,
        default: 12,
        id: "lesson-list-card-size",
        type: "card-size",
    },
    "inform-list-card-size": {
        value: 8,
        default: 8,
        id: "inform-list-card-size",
        type: "card-size",
    },
    "user-info-card-size": {
        value: 8,
        default: 8,
        id: "user-info-card-size",
        type: "card-size",
    },
    "calender-card-size": {
        value: 8,
        default: 8,
        id: "calender-card-size",
        type: "card-size",
    },
};
/* harmony default export */ const Config = ({
    version: Config_version,
    description: description,
    scriptID: scriptID,
    greasyUrl: greasyUrl,
    tencentUrl: tencentUrl,
    delivrUpdateUrl: delivrUpdateUrl,
    delivrJsonUrl: delivrJsonUrl,
    githubJsonUrl: githubJsonUrl,
    githubUrl: repository.url,
    userConfig: userConfig,
});

;// CONCATENATED MODULE: ./src/ts/Log.ts
function log(msg) {
    console.log(`%c[免Flash文件上传] ${msg}`, "color: #005bac");
}
/* harmony default export */ const Log = (log);

;// CONCATENATED MODULE: ./src/ts/Config/ConfigOperations.ts


function initConfig() {
    if (readConfig() === null) {
        localStorage.setItem("config", JSON.stringify(Config));
        return;
    }
    let currentConfig = readConfig();
    let currentUserConfig = currentConfig.userConfig;
    let currentUserConfigs = Object.getOwnPropertyNames(currentUserConfig);
    let defaultUserConfigs = Object.getOwnPropertyNames(Config.userConfig);
    let removedConfigs = currentUserConfigs.filter((item) => {
        return defaultUserConfigs.indexOf(item) === -1;
    });
    let newConfigs = defaultUserConfigs.filter((item) => {
        return currentUserConfigs.indexOf(item) === -1;
    });
    if (newConfigs.length === 0 && removedConfigs.length === 0)
        return;
    else {
        removedConfigs.forEach((item) => {
            delete currentUserConfig[item];
        });
        newConfigs.forEach((item) => {
            currentUserConfig[item] = Config.userConfig[item];
        });
        currentConfig.userConfig = currentUserConfig;
        updateConfig(currentConfig);
    }
}
function setUserConfig(id, value) {
    let currentConfig = readConfig();
    currentConfig.userConfig[id].value = value;
    updateConfig(currentConfig);
}
function readConfig() {
    return JSON.parse(localStorage.getItem("config"));
}
function readUserConfig() {
    return readConfig().userConfig;
}
function readUserConfigWithFilter(type) {
    let userConfig = readConfig().userConfig;
    let rtnArray = [];
    Object.keys(userConfig).forEach((key) => {
        if (userConfig[key].type === type) {
            rtnArray.push(userConfig[key]);
        }
    });
    return rtnArray;
}
function updateConfig(config) {
    localStorage.setItem("config", JSON.stringify(config));
    Log("config updated");
}
/* harmony default export */ const ConfigOperations = ({
    initConfig: initConfig,
    readConfig: readConfig,
    readUserConfig: readUserConfig,
    readUserConfigWithFilter: readUserConfigWithFilter,
    updateConfig: updateConfig,
    setUserConfig: setUserConfig,
});

;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/view.mjs



const view_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "View"
});
const view_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const view_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M512 160c320 0 512 352 512 352S832 864 512 864 0 512 0 512s192-352 512-352zm0 64c-225.28 0-384.128 208.064-436.8 288 52.608 79.872 211.456 288 436.8 288 225.28 0 384.128-208.064 436.8-288-52.608-79.872-211.456-288-436.8-288zm0 64a224 224 0 110 448 224 224 0 010-448zm0 64a160.192 160.192 0 00-160 160c0 88.192 71.744 160 160 160s160-71.808 160-160-71.744-160-160-160z"
}, null, -1);
const view_hoisted_3 = [
  view_hoisted_2
];
function view_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", view_hoisted_1, view_hoisted_3);
}
var view = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(view_sfc_main, [["render", view_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/constants.mjs
const UPDATE_MODEL_EVENT = "update:modelValue";
const CHANGE_EVENT = "change";
const INPUT_EVENT = "input";


//# sourceMappingURL=constants.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/isDef.mjs
function isKorean(text) {
  const reg = /([(\uAC00-\uD7AF)|(\u3130-\u318F)])+/gi;
  return reg.test(text);
}


//# sourceMappingURL=isDef.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input/src/calc-textarea-height.mjs


let hiddenTextarea = void 0;
const HIDDEN_STYLE = `
  height:0 !important;
  visibility:hidden !important;
  overflow:hidden !important;
  position:absolute !important;
  z-index:-1000 !important;
  top:0 !important;
  right:0 !important;
`;
const CONTEXT_STYLE = [
  "letter-spacing",
  "line-height",
  "padding-top",
  "padding-bottom",
  "font-family",
  "font-weight",
  "font-size",
  "text-rendering",
  "text-transform",
  "width",
  "text-indent",
  "padding-left",
  "padding-right",
  "border-width",
  "box-sizing"
];
function calculateNodeStyling(targetElement) {
  const style = window.getComputedStyle(targetElement);
  const boxSizing = style.getPropertyValue("box-sizing");
  const paddingSize = parseFloat(style.getPropertyValue("padding-bottom")) + parseFloat(style.getPropertyValue("padding-top"));
  const borderSize = parseFloat(style.getPropertyValue("border-bottom-width")) + parseFloat(style.getPropertyValue("border-top-width"));
  const contextStyle = CONTEXT_STYLE.map((name) => `${name}:${style.getPropertyValue(name)}`).join(";");
  return { contextStyle, paddingSize, borderSize, boxSizing };
}
function calcTextareaHeight(targetElement, minRows = 1, maxRows) {
  var _a;
  if (!hiddenTextarea) {
    hiddenTextarea = document.createElement("textarea");
    document.body.appendChild(hiddenTextarea);
  }
  const { paddingSize, borderSize, boxSizing, contextStyle } = calculateNodeStyling(targetElement);
  hiddenTextarea.setAttribute("style", `${contextStyle};${HIDDEN_STYLE}`);
  hiddenTextarea.value = targetElement.value || targetElement.placeholder || "";
  let height = hiddenTextarea.scrollHeight;
  const result = {};
  if (boxSizing === "border-box") {
    height = height + borderSize;
  } else if (boxSizing === "content-box") {
    height = height - paddingSize;
  }
  hiddenTextarea.value = "";
  const singleRowHeight = hiddenTextarea.scrollHeight - paddingSize;
  if (util_isNumber(minRows)) {
    let minHeight = singleRowHeight * minRows;
    if (boxSizing === "border-box") {
      minHeight = minHeight + paddingSize + borderSize;
    }
    height = Math.max(minHeight, height);
    result.minHeight = `${minHeight}px`;
  }
  if (util_isNumber(maxRows)) {
    let maxHeight = singleRowHeight * maxRows;
    if (boxSizing === "border-box") {
      maxHeight = maxHeight + paddingSize + borderSize;
    }
    height = Math.min(maxHeight, height);
  }
  result.height = `${height}px`;
  (_a = hiddenTextarea.parentNode) == null ? void 0 : _a.removeChild(hiddenTextarea);
  hiddenTextarea = void 0;
  return result;
}


//# sourceMappingURL=calc-textarea-height.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input/src/input.mjs






const inputProps = buildProps({
  size: useSizeProp,
  disabled: Boolean,
  modelValue: {
    type: definePropType(void 0),
    default: ""
  },
  type: {
    type: String,
    default: "text"
  },
  resize: {
    type: String,
    values: ["none", "both", "horizontal", "vertical"]
  },
  autosize: {
    type: definePropType([Boolean, Object]),
    default: false
  },
  autocomplete: {
    type: String,
    default: "off"
  },
  placeholder: {
    type: String
  },
  form: {
    type: String,
    default: ""
  },
  readonly: {
    type: Boolean,
    default: false
  },
  clearable: {
    type: Boolean,
    default: false
  },
  showPassword: {
    type: Boolean,
    default: false
  },
  showWordLimit: {
    type: Boolean,
    default: false
  },
  suffixIcon: {
    type: definePropType([String, Object]),
    default: ""
  },
  prefixIcon: {
    type: definePropType([String, Object]),
    default: ""
  },
  label: {
    type: String
  },
  tabindex: {
    type: [Number, String]
  },
  validateEvent: {
    type: Boolean,
    default: true
  },
  inputStyle: {
    type: definePropType([Object, Array, String]),
    default: () => mutable({})
  }
});
const inputEmits = {
  [UPDATE_MODEL_EVENT]: (value) => shared_esm_bundler_isString(value),
  input: (value) => shared_esm_bundler_isString(value),
  change: (value) => shared_esm_bundler_isString(value),
  focus: (evt) => evt instanceof FocusEvent,
  blur: (evt) => evt instanceof FocusEvent,
  clear: () => true,
  mouseleave: (evt) => evt instanceof MouseEvent,
  mouseenter: (evt) => evt instanceof MouseEvent,
  keydown: (evt) => evt instanceof KeyboardEvent,
  compositionstart: (evt) => evt instanceof CompositionEvent,
  compositionupdate: (evt) => evt instanceof CompositionEvent,
  compositionend: (evt) => evt instanceof CompositionEvent
};


//# sourceMappingURL=input.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-attrs/index.mjs




const DEFAULT_EXCLUDE_KEYS = ["class", "style"];
const LISTENER_PREFIX = /^on[A-Z]/;
const use_attrs_useAttrs = (params = {}) => {
  const { excludeListeners = false, excludeKeys = [] } = params;
  const allExcludeKeys = excludeKeys.concat(DEFAULT_EXCLUDE_KEYS);
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  if (!instance) {
    error_debugWarn("use-attrs", "getCurrentInstance() returned null. useAttrs() must be called at the top of a setup function");
    return runtime_core_esm_bundler_computed(() => ({}));
  }
  return runtime_core_esm_bundler_computed(() => {
    var _a;
    return fromPairs(Object.entries((_a = instance.proxy) == null ? void 0 : _a.$attrs).filter(([key]) => !allExcludeKeys.includes(key) && !(excludeListeners && LISTENER_PREFIX.test(key))));
  });
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input/src/input2.mjs


















const PENDANT_MAP = {
  suffix: "append",
  prefix: "prepend"
};
const input2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElInput",
  components: { ElIcon: ElIcon, CircleClose: circleClose, IconView: view },
  inheritAttrs: false,
  props: inputProps,
  emits: inputEmits,
  setup(props, { slots, emit, attrs: rawAttrs }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const attrs = use_attrs_useAttrs();
    const { form, formItem } = useFormItem();
    const inputSize = useSize();
    const inputDisabled = useDisabled();
    const nsInput = useNamespace("input");
    const nsTextarea = useNamespace("textarea");
    const input = reactivity_esm_bundler_ref();
    const textarea = reactivity_esm_bundler_ref();
    const focused = reactivity_esm_bundler_ref(false);
    const hovering = reactivity_esm_bundler_ref(false);
    const isComposing = reactivity_esm_bundler_ref(false);
    const passwordVisible = reactivity_esm_bundler_ref(false);
    const _textareaCalcStyle = reactivity_esm_bundler_shallowRef(props.inputStyle);
    const inputOrTextarea = runtime_core_esm_bundler_computed(() => input.value || textarea.value);
    const needStatusIcon = runtime_core_esm_bundler_computed(() => {
      var _a;
      return (_a = form == null ? void 0 : form.statusIcon) != null ? _a : false;
    });
    const validateState = runtime_core_esm_bundler_computed(() => (formItem == null ? void 0 : formItem.validateState) || "");
    const validateIcon = runtime_core_esm_bundler_computed(() => ValidateComponentsMap[validateState.value]);
    const containerStyle = runtime_core_esm_bundler_computed(() => rawAttrs.style);
    const computedTextareaStyle = runtime_core_esm_bundler_computed(() => [
      props.inputStyle,
      _textareaCalcStyle.value,
      { resize: props.resize }
    ]);
    const nativeInputValue = runtime_core_esm_bundler_computed(() => props.modelValue === null || props.modelValue === void 0 ? "" : String(props.modelValue));
    const showClear = runtime_core_esm_bundler_computed(() => props.clearable && !inputDisabled.value && !props.readonly && !!nativeInputValue.value && (focused.value || hovering.value));
    const showPwdVisible = runtime_core_esm_bundler_computed(() => props.showPassword && !inputDisabled.value && !props.readonly && (!!nativeInputValue.value || focused.value));
    const isWordLimitVisible = runtime_core_esm_bundler_computed(() => props.showWordLimit && !!attrs.value.maxlength && (props.type === "text" || props.type === "textarea") && !inputDisabled.value && !props.readonly && !props.showPassword);
    const textLength = runtime_core_esm_bundler_computed(() => Array.from(nativeInputValue.value).length);
    const inputExceed = runtime_core_esm_bundler_computed(() => !!isWordLimitVisible.value && textLength.value > Number(attrs.value.maxlength));
    const resizeTextarea = () => {
      const { type, autosize } = props;
      if (!shared_isClient || type !== "textarea")
        return;
      if (autosize) {
        const minRows = shared_esm_bundler_isObject(autosize) ? autosize.minRows : void 0;
        const maxRows = shared_esm_bundler_isObject(autosize) ? autosize.maxRows : void 0;
        _textareaCalcStyle.value = {
          ...calcTextareaHeight(textarea.value, minRows, maxRows)
        };
      } else {
        _textareaCalcStyle.value = {
          minHeight: calcTextareaHeight(textarea.value).minHeight
        };
      }
    };
    const setNativeInputValue = () => {
      const input2 = inputOrTextarea.value;
      if (!input2 || input2.value === nativeInputValue.value)
        return;
      input2.value = nativeInputValue.value;
    };
    const calcIconOffset = (place) => {
      const { el } = instance.vnode;
      if (!el)
        return;
      const elList = Array.from(el.querySelectorAll(`.${nsInput.e(place)}`));
      const target = elList.find((item) => item.parentNode === el);
      if (!target)
        return;
      const pendant = PENDANT_MAP[place];
      if (slots[pendant]) {
        target.style.transform = `translateX(${place === "suffix" ? "-" : ""}${el.querySelector(`.${nsInput.be("group", pendant)}`).offsetWidth}px)`;
      } else {
        target.removeAttribute("style");
      }
    };
    const updateIconOffset = () => {
      calcIconOffset("prefix");
      calcIconOffset("suffix");
    };
    const handleInput = (event) => {
      const { value } = event.target;
      if (isComposing.value)
        return;
      if (value === nativeInputValue.value)
        return;
      emit(UPDATE_MODEL_EVENT, value);
      emit("input", value);
      runtime_core_esm_bundler_nextTick(setNativeInputValue);
    };
    const handleChange = (event) => {
      emit("change", event.target.value);
    };
    const focus = () => {
      runtime_core_esm_bundler_nextTick(() => {
        var _a;
        (_a = inputOrTextarea.value) == null ? void 0 : _a.focus();
      });
    };
    const blur = () => {
      var _a;
      (_a = inputOrTextarea.value) == null ? void 0 : _a.blur();
    };
    const handleFocus = (event) => {
      focused.value = true;
      emit("focus", event);
    };
    const handleBlur = (event) => {
      var _a;
      focused.value = false;
      emit("blur", event);
      if (props.validateEvent) {
        (_a = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a.call(formItem, "blur");
      }
    };
    const select = () => {
      var _a;
      (_a = inputOrTextarea.value) == null ? void 0 : _a.select();
    };
    const handleCompositionStart = (event) => {
      emit("compositionstart", event);
      isComposing.value = true;
    };
    const handleCompositionUpdate = (event) => {
      var _a;
      emit("compositionupdate", event);
      const text = (_a = event.target) == null ? void 0 : _a.value;
      const lastCharacter = text[text.length - 1] || "";
      isComposing.value = !isKorean(lastCharacter);
    };
    const handleCompositionEnd = (event) => {
      emit("compositionend", event);
      if (isComposing.value) {
        isComposing.value = false;
        handleInput(event);
      }
    };
    const clear = () => {
      emit(UPDATE_MODEL_EVENT, "");
      emit("change", "");
      emit("clear");
      emit("input", "");
    };
    const handlePasswordVisible = () => {
      passwordVisible.value = !passwordVisible.value;
      focus();
    };
    const suffixVisible = runtime_core_esm_bundler_computed(() => !!slots.suffix || !!props.suffixIcon || showClear.value || props.showPassword || isWordLimitVisible.value || !!validateState.value && needStatusIcon.value);
    runtime_core_esm_bundler_watch(() => props.modelValue, () => {
      var _a;
      runtime_core_esm_bundler_nextTick(resizeTextarea);
      if (props.validateEvent) {
        (_a = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a.call(formItem, "change");
      }
    });
    runtime_core_esm_bundler_watch(nativeInputValue, () => setNativeInputValue());
    runtime_core_esm_bundler_watch(() => props.type, () => {
      runtime_core_esm_bundler_nextTick(() => {
        setNativeInputValue();
        resizeTextarea();
        updateIconOffset();
      });
    });
    runtime_core_esm_bundler_onMounted(() => {
      setNativeInputValue();
      updateIconOffset();
      runtime_core_esm_bundler_nextTick(resizeTextarea);
    });
    runtime_core_esm_bundler_onUpdated(() => {
      runtime_core_esm_bundler_nextTick(updateIconOffset);
    });
    const onMouseLeave = (evt) => {
      hovering.value = false;
      emit("mouseleave", evt);
    };
    const onMouseEnter = (evt) => {
      hovering.value = true;
      emit("mouseenter", evt);
    };
    const handleKeydown = (evt) => {
      emit("keydown", evt);
    };
    return {
      input,
      textarea,
      attrs,
      inputSize,
      validateState,
      validateIcon,
      containerStyle,
      computedTextareaStyle,
      inputDisabled,
      showClear,
      showPwdVisible,
      isWordLimitVisible,
      textLength,
      hovering,
      inputExceed,
      passwordVisible,
      inputOrTextarea,
      suffixVisible,
      needStatusIcon,
      resizeTextarea,
      handleInput,
      handleChange,
      handleFocus,
      handleBlur,
      handleCompositionStart,
      handleCompositionUpdate,
      handleCompositionEnd,
      handlePasswordVisible,
      clear,
      select,
      focus,
      blur,
      onMouseLeave,
      onMouseEnter,
      handleKeydown,
      nsInput,
      nsTextarea
    };
  }
});
const input2_hoisted_1 = ["type", "disabled", "readonly", "autocomplete", "tabindex", "aria-label", "placeholder"];
const input2_hoisted_2 = ["tabindex", "disabled", "readonly", "autocomplete", "aria-label", "placeholder"];
function input2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = resolveComponent("el-icon");
  const _component_circle_close = resolveComponent("circle-close");
  const _component_icon_view = resolveComponent("icon-view");
  return withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass([
      _ctx.type === "textarea" ? _ctx.nsTextarea.b() : _ctx.nsInput.b(),
      _ctx.nsInput.m(_ctx.inputSize),
      _ctx.nsInput.is("disabled", _ctx.inputDisabled),
      _ctx.nsInput.is("exceed", _ctx.inputExceed),
      {
        [_ctx.nsInput.b("group")]: _ctx.$slots.prepend || _ctx.$slots.append,
        [_ctx.nsInput.bm("group", "append")]: _ctx.$slots.append,
        [_ctx.nsInput.bm("group", "prepend")]: _ctx.$slots.prepend,
        [_ctx.nsInput.m("prefix")]: _ctx.$slots.prefix || _ctx.prefixIcon,
        [_ctx.nsInput.m("suffix")]: _ctx.$slots.suffix || _ctx.suffixIcon || _ctx.clearable || _ctx.showPassword,
        [_ctx.nsInput.m("suffix--password-clear")]: _ctx.clearable && _ctx.showPassword
      },
      _ctx.$attrs.class
    ]),
    style: normalizeStyle(_ctx.containerStyle),
    onMouseenter: _cache[17] || (_cache[17] = (...args) => _ctx.onMouseEnter && _ctx.onMouseEnter(...args)),
    onMouseleave: _cache[18] || (_cache[18] = (...args) => _ctx.onMouseLeave && _ctx.onMouseLeave(...args))
  }, [
    runtime_core_esm_bundler_createCommentVNode(" input "),
    _ctx.type !== "textarea" ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 0 }, [
      runtime_core_esm_bundler_createCommentVNode(" prepend slot "),
      _ctx.$slots.prepend ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
        key: 0,
        class: normalizeClass(_ctx.nsInput.be("group", "prepend"))
      }, [
        renderSlot(_ctx.$slots, "prepend")
      ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
      createBaseVNode("input", mergeProps({
        ref: "input",
        class: _ctx.nsInput.e("inner")
      }, _ctx.attrs, {
        type: _ctx.showPassword ? _ctx.passwordVisible ? "text" : "password" : _ctx.type,
        disabled: _ctx.inputDisabled,
        readonly: _ctx.readonly,
        autocomplete: _ctx.autocomplete,
        tabindex: _ctx.tabindex,
        "aria-label": _ctx.label,
        placeholder: _ctx.placeholder,
        style: _ctx.inputStyle,
        onCompositionstart: _cache[0] || (_cache[0] = (...args) => _ctx.handleCompositionStart && _ctx.handleCompositionStart(...args)),
        onCompositionupdate: _cache[1] || (_cache[1] = (...args) => _ctx.handleCompositionUpdate && _ctx.handleCompositionUpdate(...args)),
        onCompositionend: _cache[2] || (_cache[2] = (...args) => _ctx.handleCompositionEnd && _ctx.handleCompositionEnd(...args)),
        onInput: _cache[3] || (_cache[3] = (...args) => _ctx.handleInput && _ctx.handleInput(...args)),
        onFocus: _cache[4] || (_cache[4] = (...args) => _ctx.handleFocus && _ctx.handleFocus(...args)),
        onBlur: _cache[5] || (_cache[5] = (...args) => _ctx.handleBlur && _ctx.handleBlur(...args)),
        onChange: _cache[6] || (_cache[6] = (...args) => _ctx.handleChange && _ctx.handleChange(...args)),
        onKeydown: _cache[7] || (_cache[7] = (...args) => _ctx.handleKeydown && _ctx.handleKeydown(...args))
      }), null, 16, input2_hoisted_1),
      runtime_core_esm_bundler_createCommentVNode(" prefix slot "),
      _ctx.$slots.prefix || _ctx.prefixIcon ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
        key: 1,
        class: normalizeClass(_ctx.nsInput.e("prefix"))
      }, [
        createBaseVNode("span", {
          class: normalizeClass(_ctx.nsInput.e("prefix-inner"))
        }, [
          renderSlot(_ctx.$slots, "prefix"),
          _ctx.prefixIcon ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
            key: 0,
            class: normalizeClass(_ctx.nsInput.e("icon"))
          }, {
            default: withCtx(() => [
              (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.prefixIcon)))
            ]),
            _: 1
          }, 8, ["class"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
        ], 2)
      ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
      runtime_core_esm_bundler_createCommentVNode(" suffix slot "),
      _ctx.suffixVisible ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
        key: 2,
        class: normalizeClass(_ctx.nsInput.e("suffix"))
      }, [
        createBaseVNode("span", {
          class: normalizeClass(_ctx.nsInput.e("suffix-inner"))
        }, [
          !_ctx.showClear || !_ctx.showPwdVisible || !_ctx.isWordLimitVisible ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 0 }, [
            renderSlot(_ctx.$slots, "suffix"),
            _ctx.suffixIcon ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
              key: 0,
              class: normalizeClass(_ctx.nsInput.e("icon"))
            }, {
              default: withCtx(() => [
                (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.suffixIcon)))
              ]),
              _: 1
            }, 8, ["class"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
          ], 64)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
          _ctx.showClear ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
            key: 1,
            class: normalizeClass([_ctx.nsInput.e("icon"), _ctx.nsInput.e("clear")]),
            onMousedown: _cache[8] || (_cache[8] = withModifiers(() => {
            }, ["prevent"])),
            onClick: _ctx.clear
          }, {
            default: withCtx(() => [
              runtime_core_esm_bundler_createVNode(_component_circle_close)
            ]),
            _: 1
          }, 8, ["class", "onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
          _ctx.showPwdVisible ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
            key: 2,
            class: normalizeClass([_ctx.nsInput.e("icon"), _ctx.nsInput.e("clear")]),
            onClick: _ctx.handlePasswordVisible
          }, {
            default: withCtx(() => [
              runtime_core_esm_bundler_createVNode(_component_icon_view)
            ]),
            _: 1
          }, 8, ["class", "onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
          _ctx.isWordLimitVisible ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
            key: 3,
            class: normalizeClass(_ctx.nsInput.e("count"))
          }, [
            createBaseVNode("span", {
              class: normalizeClass(_ctx.nsInput.e("count-inner"))
            }, toDisplayString(_ctx.textLength) + " / " + toDisplayString(_ctx.attrs.maxlength), 3)
          ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
        ], 2),
        _ctx.validateState && _ctx.validateIcon && _ctx.needStatusIcon ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
          key: 0,
          class: normalizeClass([_ctx.nsInput.e("icon"), _ctx.nsInput.e("validateIcon")])
        }, {
          default: withCtx(() => [
            (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.validateIcon)))
          ]),
          _: 1
        }, 8, ["class"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
      ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
      runtime_core_esm_bundler_createCommentVNode(" append slot "),
      _ctx.$slots.append ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
        key: 3,
        class: normalizeClass(_ctx.nsInput.be("group", "append"))
      }, [
        renderSlot(_ctx.$slots, "append")
      ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
    ], 64)) : (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 1 }, [
      runtime_core_esm_bundler_createCommentVNode(" textarea "),
      createBaseVNode("textarea", mergeProps({
        ref: "textarea",
        class: _ctx.nsTextarea.e("inner")
      }, _ctx.attrs, {
        tabindex: _ctx.tabindex,
        disabled: _ctx.inputDisabled,
        readonly: _ctx.readonly,
        autocomplete: _ctx.autocomplete,
        style: _ctx.computedTextareaStyle,
        "aria-label": _ctx.label,
        placeholder: _ctx.placeholder,
        onCompositionstart: _cache[9] || (_cache[9] = (...args) => _ctx.handleCompositionStart && _ctx.handleCompositionStart(...args)),
        onCompositionupdate: _cache[10] || (_cache[10] = (...args) => _ctx.handleCompositionUpdate && _ctx.handleCompositionUpdate(...args)),
        onCompositionend: _cache[11] || (_cache[11] = (...args) => _ctx.handleCompositionEnd && _ctx.handleCompositionEnd(...args)),
        onInput: _cache[12] || (_cache[12] = (...args) => _ctx.handleInput && _ctx.handleInput(...args)),
        onFocus: _cache[13] || (_cache[13] = (...args) => _ctx.handleFocus && _ctx.handleFocus(...args)),
        onBlur: _cache[14] || (_cache[14] = (...args) => _ctx.handleBlur && _ctx.handleBlur(...args)),
        onChange: _cache[15] || (_cache[15] = (...args) => _ctx.handleChange && _ctx.handleChange(...args)),
        onKeydown: _cache[16] || (_cache[16] = (...args) => _ctx.handleKeydown && _ctx.handleKeydown(...args))
      }), null, 16, input2_hoisted_2),
      _ctx.isWordLimitVisible ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
        key: 0,
        class: normalizeClass(_ctx.nsInput.e("count"))
      }, toDisplayString(_ctx.textLength) + " / " + toDisplayString(_ctx.attrs.maxlength), 3)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
    ], 64))
  ], 38)), [
    [vShow, _ctx.type !== "hidden"]
  ]);
}
var Input = /* @__PURE__ */ _export_sfc(input2_sfc_main, [["render", input2_sfc_render]]);


//# sourceMappingURL=input2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input/index.mjs




const ElInput = withInstall(Input);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/vnode.mjs




const TEMPLATE = "template";
const vnode_SCOPE = "VNode";
var PatchFlags = /* @__PURE__ */ ((PatchFlags2) => {
  PatchFlags2[PatchFlags2["TEXT"] = 1] = "TEXT";
  PatchFlags2[PatchFlags2["CLASS"] = 2] = "CLASS";
  PatchFlags2[PatchFlags2["STYLE"] = 4] = "STYLE";
  PatchFlags2[PatchFlags2["PROPS"] = 8] = "PROPS";
  PatchFlags2[PatchFlags2["FULL_PROPS"] = 16] = "FULL_PROPS";
  PatchFlags2[PatchFlags2["HYDRATE_EVENTS"] = 32] = "HYDRATE_EVENTS";
  PatchFlags2[PatchFlags2["STABLE_FRAGMENT"] = 64] = "STABLE_FRAGMENT";
  PatchFlags2[PatchFlags2["KEYED_FRAGMENT"] = 128] = "KEYED_FRAGMENT";
  PatchFlags2[PatchFlags2["UNKEYED_FRAGMENT"] = 256] = "UNKEYED_FRAGMENT";
  PatchFlags2[PatchFlags2["NEED_PATCH"] = 512] = "NEED_PATCH";
  PatchFlags2[PatchFlags2["DYNAMIC_SLOTS"] = 1024] = "DYNAMIC_SLOTS";
  PatchFlags2[PatchFlags2["HOISTED"] = -1] = "HOISTED";
  PatchFlags2[PatchFlags2["BAIL"] = -2] = "BAIL";
  return PatchFlags2;
})(PatchFlags || {});
const isFragment = (node) => isVNode(node) && node.type === Fragment;
const isText = (node) => node.type === Text;
const vnode_isComment = (node) => node.type === Comment;
const isTemplate = (node) => node.type === TEMPLATE;
function getChildren(node, depth) {
  if (vnode_isComment(node))
    return;
  if (isFragment(node) || isTemplate(node)) {
    return depth > 0 ? getFirstValidNode(node.children, depth - 1) : void 0;
  }
  return node;
}
const isValidElementNode = (node) => isVNode(node) && !isFragment(node) && !vnode_isComment(node);
const getFirstValidNode = (nodes, maxDepth = 3) => {
  if (Array.isArray(nodes)) {
    return getChildren(nodes[0], maxDepth);
  } else {
    return getChildren(nodes, maxDepth);
  }
};
function renderIf(condition, node, props, children, patchFlag, patchProps) {
  return condition ? renderBlock(node, props, children, patchFlag, patchProps) : createCommentVNode("v-if", true);
}
function renderBlock(node, props, children, patchFlag, patchProps) {
  return openBlock(), createBlock(node, props, children, patchFlag, patchProps);
}
const getNormalizedProps = (node) => {
  if (!runtime_core_esm_bundler_isVNode(node)) {
    error_debugWarn(vnode_SCOPE, "value must be a VNode");
    return;
  }
  const raw = node.props || {};
  const type = node.type.props || {};
  const props = {};
  Object.keys(type).forEach((key) => {
    if (shared_esm_bundler_hasOwn(type[key], "default")) {
      props[key] = type[key].default;
    }
  });
  Object.keys(raw).forEach((key) => {
    props[shared_esm_bundler_camelize(key)] = raw[key];
  });
  return props;
};


//# sourceMappingURL=vnode.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-same-target/index.mjs


const useSameTarget = (handleClick) => {
  if (!handleClick) {
    return { onClick: shared_esm_bundler_NOOP, onMousedown: shared_esm_bundler_NOOP, onMouseup: shared_esm_bundler_NOOP };
  }
  let mousedownTarget = false;
  let mouseupTarget = false;
  const onClick = (e) => {
    if (mousedownTarget && mouseupTarget) {
      handleClick(e);
    }
    mousedownTarget = mouseupTarget = false;
  };
  const onMousedown = (e) => {
    mousedownTarget = e.target === e.currentTarget;
  };
  const onMouseup = (e) => {
    mouseupTarget = e.target === e.currentTarget;
  };
  return { onClick, onMousedown, onMouseup };
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/overlay/src/overlay.mjs






const overlayProps = buildProps({
  mask: {
    type: Boolean,
    default: true
  },
  customMaskEvent: {
    type: Boolean,
    default: false
  },
  overlayClass: {
    type: definePropType([
      String,
      Array,
      Object
    ])
  },
  zIndex: {
    type: definePropType([String, Number])
  }
});
const overlayEmits = {
  click: (evt) => evt instanceof MouseEvent
};
var Overlay = runtime_core_esm_bundler_defineComponent({
  name: "ElOverlay",
  props: overlayProps,
  emits: overlayEmits,
  setup(props, { slots, emit }) {
    const onMaskClick = (e) => {
      emit("click", e);
    };
    const { onClick, onMousedown, onMouseup } = useSameTarget(props.customMaskEvent ? void 0 : onMaskClick);
    return () => {
      return props.mask ? runtime_core_esm_bundler_createVNode("div", {
        class: ["el-overlay", props.overlayClass],
        style: {
          zIndex: props.zIndex
        },
        onClick,
        onMousedown,
        onMouseup
      }, [renderSlot(slots, "default")], PatchFlags.STYLE | PatchFlags.CLASS | PatchFlags.PROPS, ["onClick", "onMouseup", "onMousedown"]) : h("div", {
        class: props.overlayClass,
        style: {
          zIndex: props.zIndex,
          position: "fixed",
          top: "0px",
          right: "0px",
          bottom: "0px",
          left: "0px"
        }
      }, [renderSlot(slots, "default")]);
    };
  }
});


//# sourceMappingURL=overlay.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/overlay/index.mjs



const ElOverlay = Overlay;


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/validators.mjs
const isValidComponentSize = (val) => ["", "large", "default", "small"].includes(val);
const isValidDatePickType = (val) => [
  "year",
  "month",
  "date",
  "dates",
  "week",
  "datetime",
  "datetimerange",
  "daterange",
  "monthrange"
].includes(val);


//# sourceMappingURL=validators.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/directives/trap-focus/index.mjs




const FOCUSABLE_CHILDREN = "_trap-focus-children";
const TRAP_FOCUS_HANDLER = "_trap-focus-handler";
const FOCUS_STACK = [];
const FOCUS_HANDLER = (e) => {
  var _a;
  if (FOCUS_STACK.length === 0)
    return;
  const focusableElement = FOCUS_STACK[FOCUS_STACK.length - 1][FOCUSABLE_CHILDREN];
  if (focusableElement.length > 0 && e.code === aria_EVENT_CODE.tab) {
    if (focusableElement.length === 1) {
      e.preventDefault();
      if (document.activeElement !== focusableElement[0]) {
        focusableElement[0].focus();
      }
      return;
    }
    const goingBackward = e.shiftKey;
    const isFirst = e.target === focusableElement[0];
    const isLast = e.target === focusableElement[focusableElement.length - 1];
    if (isFirst && goingBackward) {
      e.preventDefault();
      focusableElement[focusableElement.length - 1].focus();
    }
    if (isLast && !goingBackward) {
      e.preventDefault();
      focusableElement[0].focus();
    }
    if (false) {}
  }
};
const TrapFocus = {
  beforeMount(el) {
    el[FOCUSABLE_CHILDREN] = obtainAllFocusableElements(el);
    FOCUS_STACK.push(el);
    if (FOCUS_STACK.length <= 1) {
      dom_on(document, "keydown", FOCUS_HANDLER);
    }
  },
  updated(el) {
    runtime_core_esm_bundler_nextTick(() => {
      el[FOCUSABLE_CHILDREN] = obtainAllFocusableElements(el);
    });
  },
  unmounted() {
    FOCUS_STACK.shift();
    if (FOCUS_STACK.length === 0) {
      off(document, "keydown", FOCUS_HANDLER);
    }
  }
};


//# sourceMappingURL=index.mjs.map

// EXTERNAL MODULE: ./node_modules/lodash/get.js
var lodash_get = __webpack_require__("./node_modules/lodash/get.js");
;// CONCATENATED MODULE: ./node_modules/element-plus/es/locale/lang/en.mjs
var English = {
  name: "en",
  el: {
    colorpicker: {
      confirm: "OK",
      clear: "Clear"
    },
    datepicker: {
      now: "Now",
      today: "Today",
      cancel: "Cancel",
      clear: "Clear",
      confirm: "OK",
      selectDate: "Select date",
      selectTime: "Select time",
      startDate: "Start Date",
      startTime: "Start Time",
      endDate: "End Date",
      endTime: "End Time",
      prevYear: "Previous Year",
      nextYear: "Next Year",
      prevMonth: "Previous Month",
      nextMonth: "Next Month",
      year: "",
      month1: "January",
      month2: "February",
      month3: "March",
      month4: "April",
      month5: "May",
      month6: "June",
      month7: "July",
      month8: "August",
      month9: "September",
      month10: "October",
      month11: "November",
      month12: "December",
      week: "week",
      weeks: {
        sun: "Sun",
        mon: "Mon",
        tue: "Tue",
        wed: "Wed",
        thu: "Thu",
        fri: "Fri",
        sat: "Sat"
      },
      months: {
        jan: "Jan",
        feb: "Feb",
        mar: "Mar",
        apr: "Apr",
        may: "May",
        jun: "Jun",
        jul: "Jul",
        aug: "Aug",
        sep: "Sep",
        oct: "Oct",
        nov: "Nov",
        dec: "Dec"
      }
    },
    select: {
      loading: "Loading",
      noMatch: "No matching data",
      noData: "No data",
      placeholder: "Select"
    },
    cascader: {
      noMatch: "No matching data",
      loading: "Loading",
      placeholder: "Select",
      noData: "No data"
    },
    pagination: {
      goto: "Go to",
      pagesize: "/page",
      total: "Total {total}",
      pageClassifier: "",
      deprecationWarning: "Deprecated usages detected, please refer to the el-pagination documentation for more details"
    },
    messagebox: {
      title: "Message",
      confirm: "OK",
      cancel: "Cancel",
      error: "Illegal input"
    },
    upload: {
      deleteTip: "press delete to remove",
      delete: "Delete",
      preview: "Preview",
      continue: "Continue"
    },
    table: {
      emptyText: "No Data",
      confirmFilter: "Confirm",
      resetFilter: "Reset",
      clearFilter: "All",
      sumText: "Sum"
    },
    tree: {
      emptyText: "No Data"
    },
    transfer: {
      noMatch: "No matching data",
      noData: "No data",
      titles: ["List 1", "List 2"],
      filterPlaceholder: "Enter keyword",
      noCheckedFormat: "{total} items",
      hasCheckedFormat: "{checked}/{total} checked"
    },
    image: {
      error: "FAILED"
    },
    pageHeader: {
      title: "Back"
    },
    popconfirm: {
      confirmButtonText: "Yes",
      cancelButtonText: "No"
    }
  }
};


//# sourceMappingURL=en.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-locale/index.mjs





const buildTranslator = (locale) => (path, option) => translate(path, option, reactivity_esm_bundler_unref(locale));
const translate = (path, option, locale) => lodash_get(locale, path, path).replace(/\{(\w+)\}/g, (_, key) => {
  var _a;
  return `${(_a = option == null ? void 0 : option[key]) != null ? _a : `{${key}}`}`;
});
const buildLocaleContext = (locale) => {
  const lang = runtime_core_esm_bundler_computed(() => reactivity_esm_bundler_unref(locale).name);
  const localeRef = reactivity_esm_bundler_isRef(locale) ? locale : reactivity_esm_bundler_ref(locale);
  return {
    lang,
    locale: localeRef,
    t: buildTranslator(locale)
  };
};
const useLocale = () => {
  const locale = useGlobalConfig("locale");
  return buildLocaleContext(runtime_core_esm_bundler_computed(() => locale.value || English));
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-draggable/index.mjs



const use_draggable_useDraggable = (targetRef, dragRef, draggable) => {
  let transform = {
    offsetX: 0,
    offsetY: 0
  };
  const onMousedown = (e) => {
    const downX = e.clientX;
    const downY = e.clientY;
    const { offsetX, offsetY } = transform;
    const targetRect = targetRef.value.getBoundingClientRect();
    const targetLeft = targetRect.left;
    const targetTop = targetRect.top;
    const targetWidth = targetRect.width;
    const targetHeight = targetRect.height;
    const clientWidth = document.documentElement.clientWidth;
    const clientHeight = document.documentElement.clientHeight;
    const minLeft = -targetLeft + offsetX;
    const minTop = -targetTop + offsetY;
    const maxLeft = clientWidth - targetLeft - targetWidth + offsetX;
    const maxTop = clientHeight - targetTop - targetHeight + offsetY;
    const onMousemove = (e2) => {
      const moveX = Math.min(Math.max(offsetX + e2.clientX - downX, minLeft), maxLeft);
      const moveY = Math.min(Math.max(offsetY + e2.clientY - downY, minTop), maxTop);
      transform = {
        offsetX: moveX,
        offsetY: moveY
      };
      targetRef.value.style.transform = `translate(${addUnit(moveX)}, ${addUnit(moveY)})`;
    };
    const onMouseup = () => {
      document.removeEventListener("mousemove", onMousemove);
      document.removeEventListener("mouseup", onMouseup);
    };
    document.addEventListener("mousemove", onMousemove);
    document.addEventListener("mouseup", onMouseup);
  };
  const onDraggable = () => {
    if (dragRef.value && targetRef.value) {
      dragRef.value.addEventListener("mousedown", onMousedown);
    }
  };
  const offDraggable = () => {
    if (dragRef.value && targetRef.value) {
      dragRef.value.removeEventListener("mousedown", onMousedown);
    }
  };
  runtime_core_esm_bundler_onMounted(() => {
    runtime_core_esm_bundler_watchEffect(() => {
      if (draggable.value) {
        onDraggable();
      } else {
        offDraggable();
      }
    });
  });
  runtime_core_esm_bundler_onBeforeUnmount(() => {
    offDraggable();
  });
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-modal/index.mjs




const modalStack = [];
const closeModal = (e) => {
  if (modalStack.length === 0)
    return;
  if (e.code === aria_EVENT_CODE.esc) {
    e.stopPropagation();
    const topModal = modalStack[modalStack.length - 1];
    topModal.handleClose();
  }
};
const useModal = (instance, visibleRef) => {
  runtime_core_esm_bundler_watch(visibleRef, (val) => {
    if (val) {
      modalStack.push(instance);
    } else {
      modalStack.splice(modalStack.findIndex((modal) => modal === instance), 1);
    }
  });
};
if (shared_isClient)
  useEventListener(document, "keydown", closeModal);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-prevent-global/index.mjs



const usePreventGlobal = (indicator, evt, cb) => {
  const prevent = (e) => {
    if (cb(e))
      e.stopImmediatePropagation();
  };
  let stop = void 0;
  runtime_core_esm_bundler_watch(() => indicator.value, (val) => {
    if (val) {
      stop = useEventListener(document, evt, prevent, true);
    } else {
      stop == null ? void 0 : stop();
    }
  }, { immediate: true });
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/utils/scrollbar-width.mjs


let scrollBarWidth;
function getScrollBarWidth() {
  var _a;
  if (!shared_isClient)
    return 0;
  if (scrollBarWidth !== void 0)
    return scrollBarWidth;
  const outer = document.createElement("div");
  outer.className = "el-scrollbar__wrap";
  outer.style.visibility = "hidden";
  outer.style.width = "100px";
  outer.style.position = "absolute";
  outer.style.top = "-9999px";
  document.body.appendChild(outer);
  const widthNoScroll = outer.offsetWidth;
  outer.style.overflow = "scroll";
  const inner = document.createElement("div");
  inner.style.width = "100%";
  outer.appendChild(inner);
  const widthWithScroll = inner.offsetWidth;
  (_a = outer.parentNode) == null ? void 0 : _a.removeChild(outer);
  scrollBarWidth = widthNoScroll - widthWithScroll;
  return scrollBarWidth;
}


//# sourceMappingURL=scrollbar-width.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-lockscreen/index.mjs






const useLockscreen = (trigger) => {
  if (!reactivity_esm_bundler_isRef(trigger)) {
    throwError("[useLockscreen]", "You need to pass a ref param to this function");
  }
  if (!shared_isClient || hasClass(document.body, "el-popup-parent--hidden")) {
    return;
  }
  let scrollBarWidth = 0;
  let withoutHiddenClass = false;
  let bodyPaddingRight = "0";
  let computedBodyPaddingRight = 0;
  const cleanup = () => {
    removeClass(document.body, "el-popup-parent--hidden");
    if (withoutHiddenClass) {
      document.body.style.paddingRight = bodyPaddingRight;
    }
  };
  runtime_core_esm_bundler_watch(trigger, (val) => {
    if (!val) {
      cleanup();
      return;
    }
    withoutHiddenClass = !hasClass(document.body, "el-popup-parent--hidden");
    if (withoutHiddenClass) {
      bodyPaddingRight = document.body.style.paddingRight;
      computedBodyPaddingRight = parseInt(getStyle(document.body, "paddingRight"), 10);
    }
    scrollBarWidth = getScrollBarWidth();
    const bodyHasOverflow = document.documentElement.clientHeight < document.body.scrollHeight;
    const bodyOverflowY = getStyle(document.body, "overflowY");
    if (scrollBarWidth > 0 && (bodyHasOverflow || bodyOverflowY === "scroll") && withoutHiddenClass) {
      document.body.style.paddingRight = `${computedBodyPaddingRight + scrollBarWidth}px`;
    }
    dom_addClass(document.body, "el-popup-parent--hidden");
  });
  onScopeDispose(() => cleanup());
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/hooks/use-restore-active/index.mjs


const useRestoreActive = (toggle, initialFocus) => {
  let previousActive;
  runtime_core_esm_bundler_watch(() => toggle.value, (val) => {
    var _a, _b;
    if (val) {
      previousActive = document.activeElement;
      if (reactivity_esm_bundler_isRef(initialFocus)) {
        (_b = (_a = initialFocus.value).focus) == null ? void 0 : _b.call(_a);
      }
    } else {
      if (false) {} else {
        previousActive.focus();
      }
    }
  });
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/message-box/src/index.mjs























const src_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElMessageBox",
  directives: {
    TrapFocus: TrapFocus
  },
  components: {
    ElButton: ElButton,
    ElInput: ElInput,
    ElOverlay: ElOverlay,
    ElIcon: ElIcon,
    ...TypeComponents
  },
  inheritAttrs: false,
  props: {
    buttonSize: {
      type: String,
      validator: isValidComponentSize
    },
    modal: {
      type: Boolean,
      default: true
    },
    lockScroll: {
      type: Boolean,
      default: true
    },
    showClose: {
      type: Boolean,
      default: true
    },
    closeOnClickModal: {
      type: Boolean,
      default: true
    },
    closeOnPressEscape: {
      type: Boolean,
      default: true
    },
    closeOnHashChange: {
      type: Boolean,
      default: true
    },
    center: Boolean,
    draggable: Boolean,
    roundButton: {
      default: false,
      type: Boolean
    },
    container: {
      type: String,
      default: "body"
    },
    boxType: {
      type: String,
      default: ""
    }
  },
  emits: ["vanish", "action"],
  setup(props, { emit }) {
    const { t } = useLocale();
    const visible = reactivity_esm_bundler_ref(false);
    const state = reactivity_esm_bundler_reactive({
      beforeClose: null,
      callback: null,
      cancelButtonText: "",
      cancelButtonClass: "",
      confirmButtonText: "",
      confirmButtonClass: "",
      customClass: "",
      customStyle: {},
      dangerouslyUseHTMLString: false,
      distinguishCancelAndClose: false,
      icon: "",
      inputPattern: null,
      inputPlaceholder: "",
      inputType: "text",
      inputValue: null,
      inputValidator: null,
      inputErrorMessage: "",
      message: null,
      modalFade: true,
      modalClass: "",
      showCancelButton: false,
      showConfirmButton: true,
      type: "",
      title: void 0,
      showInput: false,
      action: "",
      confirmButtonLoading: false,
      cancelButtonLoading: false,
      confirmButtonDisabled: false,
      editorErrorMessage: "",
      validateError: false,
      zIndex: PopupManager.nextZIndex()
    });
    const typeClass = runtime_core_esm_bundler_computed(() => {
      const type = state.type;
      return type && TypeComponentsMap[type] ? `el-message-box-icon--${type}` : "";
    });
    const btnSize = useSize(runtime_core_esm_bundler_computed(() => props.buttonSize), { prop: true, form: true, formItem: true });
    const iconComponent = runtime_core_esm_bundler_computed(() => state.icon || TypeComponentsMap[state.type] || "");
    const hasMessage = runtime_core_esm_bundler_computed(() => !!state.message);
    const rootRef = reactivity_esm_bundler_ref();
    const headerRef = reactivity_esm_bundler_ref();
    const inputRef = reactivity_esm_bundler_ref();
    const confirmRef = reactivity_esm_bundler_ref();
    const confirmButtonClasses = runtime_core_esm_bundler_computed(() => state.confirmButtonClass);
    runtime_core_esm_bundler_watch(() => state.inputValue, async (val) => {
      await runtime_core_esm_bundler_nextTick();
      if (props.boxType === "prompt" && val !== null) {
        validate();
      }
    }, { immediate: true });
    runtime_core_esm_bundler_watch(() => visible.value, (val) => {
      if (val) {
        if (props.boxType === "alert" || props.boxType === "confirm") {
          runtime_core_esm_bundler_nextTick().then(() => {
            var _a, _b, _c;
            (_c = (_b = (_a = confirmRef.value) == null ? void 0 : _a.$el) == null ? void 0 : _b.focus) == null ? void 0 : _c.call(_b);
          });
        }
        state.zIndex = PopupManager.nextZIndex();
      }
      if (props.boxType !== "prompt")
        return;
      if (val) {
        runtime_core_esm_bundler_nextTick().then(() => {
          if (inputRef.value && inputRef.value.$el) {
            getInputElement().focus();
          }
        });
      } else {
        state.editorErrorMessage = "";
        state.validateError = false;
      }
    });
    const draggable = runtime_core_esm_bundler_computed(() => props.draggable);
    use_draggable_useDraggable(rootRef, headerRef, draggable);
    runtime_core_esm_bundler_onMounted(async () => {
      await runtime_core_esm_bundler_nextTick();
      if (props.closeOnHashChange) {
        dom_on(window, "hashchange", doClose);
      }
    });
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      if (props.closeOnHashChange) {
        off(window, "hashchange", doClose);
      }
    });
    function doClose() {
      if (!visible.value)
        return;
      visible.value = false;
      runtime_core_esm_bundler_nextTick(() => {
        if (state.action)
          emit("action", state.action);
      });
    }
    const handleWrapperClick = () => {
      if (props.closeOnClickModal) {
        handleAction(state.distinguishCancelAndClose ? "close" : "cancel");
      }
    };
    const overlayEvent = useSameTarget(handleWrapperClick);
    const handleInputEnter = () => {
      if (state.inputType !== "textarea") {
        return handleAction("confirm");
      }
    };
    const handleAction = (action) => {
      var _a;
      if (props.boxType === "prompt" && action === "confirm" && !validate()) {
        return;
      }
      state.action = action;
      if (state.beforeClose) {
        (_a = state.beforeClose) == null ? void 0 : _a.call(state, action, state, doClose);
      } else {
        doClose();
      }
    };
    const validate = () => {
      if (props.boxType === "prompt") {
        const inputPattern = state.inputPattern;
        if (inputPattern && !inputPattern.test(state.inputValue || "")) {
          state.editorErrorMessage = state.inputErrorMessage || t("el.messagebox.error");
          state.validateError = true;
          return false;
        }
        const inputValidator = state.inputValidator;
        if (typeof inputValidator === "function") {
          const validateResult = inputValidator(state.inputValue);
          if (validateResult === false) {
            state.editorErrorMessage = state.inputErrorMessage || t("el.messagebox.error");
            state.validateError = true;
            return false;
          }
          if (typeof validateResult === "string") {
            state.editorErrorMessage = validateResult;
            state.validateError = true;
            return false;
          }
        }
      }
      state.editorErrorMessage = "";
      state.validateError = false;
      return true;
    };
    const getInputElement = () => {
      const inputRefs = inputRef.value.$refs;
      return inputRefs.input || inputRefs.textarea;
    };
    const handleClose = () => {
      handleAction("close");
    };
    if (props.closeOnPressEscape) {
      useModal({
        handleClose
      }, visible);
    } else {
      usePreventGlobal(visible, "keydown", (e) => e.code === aria_EVENT_CODE.esc);
    }
    if (props.lockScroll) {
      useLockscreen(visible);
    }
    useRestoreActive(visible);
    return {
      ...reactivity_esm_bundler_toRefs(state),
      overlayEvent,
      visible,
      hasMessage,
      typeClass,
      btnSize,
      iconComponent,
      confirmButtonClasses,
      rootRef,
      headerRef,
      inputRef,
      confirmRef,
      doClose,
      handleClose,
      handleWrapperClick,
      handleInputEnter,
      handleAction,
      t
    };
  }
});
const src_hoisted_1 = ["aria-label"];
const src_hoisted_2 = {
  key: 0,
  ref: "headerRef",
  class: "el-message-box__header"
};
const src_hoisted_3 = { class: "el-message-box__title" };
const src_hoisted_4 = { class: "el-message-box__content" };
const src_hoisted_5 = { class: "el-message-box__container" };
const src_hoisted_6 = {
  key: 1,
  class: "el-message-box__message"
};
const src_hoisted_7 = { key: 0 };
const src_hoisted_8 = ["innerHTML"];
const _hoisted_9 = { class: "el-message-box__input" };
const _hoisted_10 = { class: "el-message-box__btns" };
function src_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = resolveComponent("el-icon");
  const _component_close = resolveComponent("close");
  const _component_el_input = resolveComponent("el-input");
  const _component_el_button = resolveComponent("el-button");
  const _component_el_overlay = resolveComponent("el-overlay");
  const _directive_trap_focus = resolveDirective("trap-focus");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(Transition, {
    name: "fade-in-linear",
    onAfterLeave: _cache[11] || (_cache[11] = ($event) => _ctx.$emit("vanish"))
  }, {
    default: withCtx(() => [
      withDirectives(runtime_core_esm_bundler_createVNode(_component_el_overlay, {
        "z-index": _ctx.zIndex,
        "overlay-class": ["is-message-box", _ctx.modalClass],
        mask: _ctx.modal
      }, {
        default: withCtx(() => [
          createBaseVNode("div", {
            class: "el-overlay-message-box",
            onClick: _cache[8] || (_cache[8] = (...args) => _ctx.overlayEvent.onClick && _ctx.overlayEvent.onClick(...args)),
            onMousedown: _cache[9] || (_cache[9] = (...args) => _ctx.overlayEvent.onMousedown && _ctx.overlayEvent.onMousedown(...args)),
            onMouseup: _cache[10] || (_cache[10] = (...args) => _ctx.overlayEvent.onMouseup && _ctx.overlayEvent.onMouseup(...args))
          }, [
            withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
              ref: "rootRef",
              role: "dialog",
              "aria-label": _ctx.title || "dialog",
              "aria-modal": "true",
              class: normalizeClass([
                "el-message-box",
                _ctx.customClass,
                { "el-message-box--center": _ctx.center, "is-draggable": _ctx.draggable }
              ]),
              style: normalizeStyle(_ctx.customStyle),
              onClick: _cache[7] || (_cache[7] = withModifiers(() => {
              }, ["stop"]))
            }, [
              _ctx.title !== null && _ctx.title !== void 0 ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", src_hoisted_2, [
                createBaseVNode("div", src_hoisted_3, [
                  _ctx.iconComponent && _ctx.center ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
                    key: 0,
                    class: normalizeClass(["el-message-box__status", _ctx.typeClass])
                  }, {
                    default: withCtx(() => [
                      (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.iconComponent)))
                    ]),
                    _: 1
                  }, 8, ["class"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
                  createBaseVNode("span", null, toDisplayString(_ctx.title), 1)
                ]),
                _ctx.showClose ? (runtime_core_esm_bundler_openBlock(), createElementBlock("button", {
                  key: 0,
                  type: "button",
                  class: "el-message-box__headerbtn",
                  "aria-label": "Close",
                  onClick: _cache[0] || (_cache[0] = ($event) => _ctx.handleAction(_ctx.distinguishCancelAndClose ? "close" : "cancel")),
                  onKeydown: _cache[1] || (_cache[1] = withKeys(withModifiers(($event) => _ctx.handleAction(_ctx.distinguishCancelAndClose ? "close" : "cancel"), ["prevent"]), ["enter"]))
                }, [
                  runtime_core_esm_bundler_createVNode(_component_el_icon, { class: "el-message-box__close" }, {
                    default: withCtx(() => [
                      runtime_core_esm_bundler_createVNode(_component_close)
                    ]),
                    _: 1
                  })
                ], 32)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
              ], 512)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
              createBaseVNode("div", src_hoisted_4, [
                createBaseVNode("div", src_hoisted_5, [
                  _ctx.iconComponent && !_ctx.center && _ctx.hasMessage ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
                    key: 0,
                    class: normalizeClass(["el-message-box__status", _ctx.typeClass])
                  }, {
                    default: withCtx(() => [
                      (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.iconComponent)))
                    ]),
                    _: 1
                  }, 8, ["class"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
                  _ctx.hasMessage ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", src_hoisted_6, [
                    renderSlot(_ctx.$slots, "default", {}, () => [
                      !_ctx.dangerouslyUseHTMLString ? (runtime_core_esm_bundler_openBlock(), createElementBlock("p", src_hoisted_7, toDisplayString(_ctx.message), 1)) : (runtime_core_esm_bundler_openBlock(), createElementBlock("p", {
                        key: 1,
                        innerHTML: _ctx.message
                      }, null, 8, src_hoisted_8))
                    ])
                  ])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
                ]),
                withDirectives(createBaseVNode("div", _hoisted_9, [
                  runtime_core_esm_bundler_createVNode(_component_el_input, {
                    ref: "inputRef",
                    modelValue: _ctx.inputValue,
                    "onUpdate:modelValue": _cache[2] || (_cache[2] = ($event) => _ctx.inputValue = $event),
                    type: _ctx.inputType,
                    placeholder: _ctx.inputPlaceholder,
                    class: normalizeClass({ invalid: _ctx.validateError }),
                    onKeydown: withKeys(withModifiers(_ctx.handleInputEnter, ["prevent"]), ["enter"])
                  }, null, 8, ["modelValue", "type", "placeholder", "class", "onKeydown"]),
                  createBaseVNode("div", {
                    class: "el-message-box__errormsg",
                    style: normalizeStyle({
                      visibility: !!_ctx.editorErrorMessage ? "visible" : "hidden"
                    })
                  }, toDisplayString(_ctx.editorErrorMessage), 5)
                ], 512), [
                  [vShow, _ctx.showInput]
                ])
              ]),
              createBaseVNode("div", _hoisted_10, [
                _ctx.showCancelButton ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_button, {
                  key: 0,
                  loading: _ctx.cancelButtonLoading,
                  class: normalizeClass([_ctx.cancelButtonClass]),
                  round: _ctx.roundButton,
                  size: _ctx.btnSize,
                  onClick: _cache[3] || (_cache[3] = ($event) => _ctx.handleAction("cancel")),
                  onKeydown: _cache[4] || (_cache[4] = withKeys(withModifiers(($event) => _ctx.handleAction("cancel"), ["prevent"]), ["enter"]))
                }, {
                  default: withCtx(() => [
                    createTextVNode(toDisplayString(_ctx.cancelButtonText || _ctx.t("el.messagebox.cancel")), 1)
                  ]),
                  _: 1
                }, 8, ["loading", "class", "round", "size"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
                withDirectives(runtime_core_esm_bundler_createVNode(_component_el_button, {
                  ref: "confirmRef",
                  type: "primary",
                  loading: _ctx.confirmButtonLoading,
                  class: normalizeClass([_ctx.confirmButtonClasses]),
                  round: _ctx.roundButton,
                  disabled: _ctx.confirmButtonDisabled,
                  size: _ctx.btnSize,
                  onClick: _cache[5] || (_cache[5] = ($event) => _ctx.handleAction("confirm")),
                  onKeydown: _cache[6] || (_cache[6] = withKeys(withModifiers(($event) => _ctx.handleAction("confirm"), ["prevent"]), ["enter"]))
                }, {
                  default: withCtx(() => [
                    createTextVNode(toDisplayString(_ctx.confirmButtonText || _ctx.t("el.messagebox.confirm")), 1)
                  ]),
                  _: 1
                }, 8, ["loading", "class", "round", "disabled", "size"]), [
                  [vShow, _ctx.showConfirmButton]
                ])
              ])
            ], 14, src_hoisted_1)), [
              [_directive_trap_focus]
            ])
          ], 32)
        ]),
        _: 3
      }, 8, ["z-index", "overlay-class", "mask"]), [
        [vShow, _ctx.visible]
      ])
    ]),
    _: 3
  });
}
var MessageBoxConstructor = /* @__PURE__ */ _export_sfc(src_sfc_main, [["render", src_sfc_render]]);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/message-box/src/messageBox.mjs






const messageInstance = /* @__PURE__ */ new Map();
const initInstance = (props, container) => {
  const vnode = h(MessageBoxConstructor, props);
  render(vnode, container);
  document.body.appendChild(container.firstElementChild);
  return vnode.component;
};
const genContainer = () => {
  return document.createElement("div");
};
const showMessage = (options) => {
  const container = genContainer();
  options.onVanish = () => {
    render(null, container);
    messageInstance.delete(vm);
  };
  options.onAction = (action) => {
    const currentMsg = messageInstance.get(vm);
    let resolve;
    if (options.showInput) {
      resolve = { value: vm.inputValue, action };
    } else {
      resolve = action;
    }
    if (options.callback) {
      options.callback(resolve, instance.proxy);
    } else {
      if (action === "cancel" || action === "close") {
        if (options.distinguishCancelAndClose && action !== "cancel") {
          currentMsg.reject("close");
        } else {
          currentMsg.reject("cancel");
        }
      } else {
        currentMsg.resolve(resolve);
      }
    }
  };
  const instance = initInstance(options, container);
  const vm = instance.proxy;
  for (const prop in options) {
    if (shared_esm_bundler_hasOwn(options, prop) && !shared_esm_bundler_hasOwn(vm.$props, prop)) {
      vm[prop] = options[prop];
    }
  }
  runtime_core_esm_bundler_watch(() => vm.message, (newVal, oldVal) => {
    if (runtime_core_esm_bundler_isVNode(newVal)) {
      instance.slots.default = () => [newVal];
    } else if (runtime_core_esm_bundler_isVNode(oldVal) && !runtime_core_esm_bundler_isVNode(newVal)) {
      delete instance.slots.default;
    }
  }, {
    immediate: true
  });
  vm.visible = true;
  return vm;
};
function MessageBox(options) {
  if (!shared_isClient)
    return;
  let callback;
  if (shared_esm_bundler_isString(options) || runtime_core_esm_bundler_isVNode(options)) {
    options = {
      message: options
    };
  } else {
    callback = options.callback;
  }
  return new Promise((resolve, reject) => {
    const vm = showMessage(options);
    messageInstance.set(vm, {
      options,
      callback,
      resolve,
      reject
    });
  });
}
MessageBox.alert = (message, title, options) => {
  if (typeof title === "object") {
    options = title;
    title = "";
  } else if (title === void 0) {
    title = "";
  }
  return MessageBox(Object.assign({
    title,
    message,
    type: "",
    closeOnPressEscape: false,
    closeOnClickModal: false
  }, options, {
    boxType: "alert"
  }));
};
MessageBox.confirm = (message, title, options) => {
  if (typeof title === "object") {
    options = title;
    title = "";
  } else if (title === void 0) {
    title = "";
  }
  return MessageBox(Object.assign({
    title,
    message,
    type: "",
    showCancelButton: true
  }, options, {
    boxType: "confirm"
  }));
};
MessageBox.prompt = (message, title, options) => {
  if (typeof title === "object") {
    options = title;
    title = "";
  } else if (title === void 0) {
    title = "";
  }
  return MessageBox(Object.assign({
    title,
    message,
    showCancelButton: true,
    showInput: true,
    type: ""
  }, options, {
    boxType: "prompt"
  }));
};
MessageBox.close = () => {
  messageInstance.forEach((_, vm) => {
    vm.doClose();
  });
  messageInstance.clear();
};


//# sourceMappingURL=messageBox.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/message-box/index.mjs



const _MessageBox = MessageBox;
_MessageBox.install = (app) => {
  app.config.globalProperties.$msgbox = _MessageBox;
  app.config.globalProperties.$messageBox = _MessageBox;
  app.config.globalProperties.$alert = _MessageBox.alert;
  app.config.globalProperties.$confirm = _MessageBox.confirm;
  app.config.globalProperties.$prompt = _MessageBox.prompt;
};
const ElMessageBox = _MessageBox;


//# sourceMappingURL=index.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-message-box.css
var el_message_box = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-message-box.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-message-box.css

      
      
      
      
      
      
      
      
      

var el_message_box_options = {};

el_message_box_options.styleTagTransform = (styleTagTransform_default());
el_message_box_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_message_box_options.insert = insertBySelector_default().bind(null, "head");
    
el_message_box_options.domAPI = (styleDomAPI_default());
el_message_box_options.insertStyleElement = (insertStyleElement_default());

var el_message_box_update = injectStylesIntoStyleTag_default()(el_message_box/* default */.Z, el_message_box_options);




       /* harmony default export */ const theme_chalk_el_message_box = (el_message_box/* default */.Z && el_message_box/* default.locals */.Z.locals ? el_message_box/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-input.css
var el_input = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-input.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-input.css

      
      
      
      
      
      
      
      
      

var el_input_options = {};

el_input_options.styleTagTransform = (styleTagTransform_default());
el_input_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_input_options.insert = insertBySelector_default().bind(null, "head");
    
el_input_options.domAPI = (styleDomAPI_default());
el_input_options.insertStyleElement = (insertStyleElement_default());

var el_input_update = injectStylesIntoStyleTag_default()(el_input/* default */.Z, el_input_options);




       /* harmony default export */ const theme_chalk_el_input = (el_input/* default */.Z && el_input/* default.locals */.Z.locals ? el_input/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-overlay.css
var el_overlay = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-overlay.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-overlay.css

      
      
      
      
      
      
      
      
      

var el_overlay_options = {};

el_overlay_options.styleTagTransform = (styleTagTransform_default());
el_overlay_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_overlay_options.insert = insertBySelector_default().bind(null, "head");
    
el_overlay_options.domAPI = (styleDomAPI_default());
el_overlay_options.insertStyleElement = (insertStyleElement_default());

var el_overlay_update = injectStylesIntoStyleTag_default()(el_overlay/* default */.Z, el_overlay_options);




       /* harmony default export */ const theme_chalk_el_overlay = (el_overlay/* default */.Z && el_overlay/* default.locals */.Z.locals ? el_overlay/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/overlay/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/message-box/style/css.mjs





//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./src/ts/GetVersionInfo.ts



async function getVersionInfo() {
    Log(`current userscript version: ${Config.version}`);
    let content = SendRequest(Config.delivrJsonUrl, (obj) => {
        return JSON.parse(obj.querySelector("body").innerText).version;
    }, {
        cache: "no-cache",
    }).then((res) => {
        let weightLastest = 0;
        let weightNow = 0;
        res
            .split(".")
            .reverse()
            .forEach((value, index) => {
            weightLastest +=
                (index + 1) * Math.pow(10, index + 1) * parseInt(value);
        });
        Config.version.split(".")
            .reverse()
            .forEach((value, index) => {
            weightNow += (index + 1) * Math.pow(10, index + 1) * parseInt(value);
        });
        if (weightLastest > weightNow) {
            return { need: true, current: Config.version, lastest: res };
        }
        else {
            return { need: false, current: Config.version, lastest: res };
        }
    });
    return content;
}
/* harmony default export */ const GetVersionInfo = (getVersionInfo);

;// CONCATENATED MODULE: ./src/ts/CheckUpdate.ts


async function checkUpdate() {
    await GetVersionInfo().then((res) => {
        if (res.need) {
            let notify = ElNotification({
                title: "免Flash文件上传",
                type: "warning",
                message: `有新版本${res.lastest},当前版本${res.current}。请点击此处更新`,
                duration: 0,
                onClick: () => {
                    window.location.href = Config.delivrUpdateUrl;
                    notify.close();
                    ElMessageBox.alert(`请在弹出的网页中更新脚本,更新后点击“ OK ”重新加载此页面`, "提示", {
                        confirmButtonText: "OK",
                        callback: (action) => {
                            if (action === "confirm") {
                                window.location.reload();
                            }
                            else {
                                return false;
                            }
                        },
                    });
                },
            });
            return true; // need update
        }
        else {
            // if(localStorage.getItem("config-update") !== "true") return
            let notify = ElNotification({
                title: "免Flash文件上传",
                type: "success",
                message: `版本已是最新:${res.current}`,
                onClick: () => {
                    notify.close();
                },
            });
            return false; // don't need update
        }
    });
}
/* harmony default export */ const CheckUpdate = (checkUpdate);

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/HeadBar.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */



/* harmony default export */ const HeadBarvue_type_script_lang_js = ({
  data() {
    return {
      userInfo: {},
      needUpdate: false
    };
  },

  created() {
    this.getUserInfo();
    this.getVersionInfo();
  },

  methods: {
    async getUserInfo() {
      this.userInfo = await GetInfo.getUserInfo();
    },

    async getVersionInfo() {
      this.needUpdate = await GetVersionInfo().then(res => {
        return res.need;
      });
    },

    handleCommand(command) {
      if (command === "exit") {
        window.location.href = "http://cc.bjtu.edu.cn:81/meol/popups/logout.jsp";
      } else if (command === "old") {
        ConfigOperations.setUserConfig("back-to-old", true);
        window.location.reload();
      } else if (command === "sidebar") {
        let status = ConfigOperations.readUserConfig()["show-side-bar"].value;
        status ? document.querySelector(".el-aside").style.display = "none" : document.querySelector(".el-aside").style.display = "";
        ConfigOperations.setUserConfig("show-side-bar", !status);
      } else if (command === "check") {
        CheckUpdate();
      }
    }

  }
});
;// CONCATENATED MODULE: ./src/components/Common/HeadBar.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/HeadBar.vue?vue&type=style&index=0&id=7638b672&scoped=true&lang=css
var HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/HeadBar.vue?vue&type=style&index=0&id=7638b672&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Common/HeadBar.vue?vue&type=style&index=0&id=7638b672&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_options = {};

HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css/* default */.Z, HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css_options);




       /* harmony default export */ const Common_HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css = (HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css/* default */.Z && HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css/* default.locals */.Z.locals ? HeadBarvue_type_style_index_0_id_7638b672_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/Common/HeadBar.vue?vue&type=style&index=0&id=7638b672&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/Common/HeadBar.vue
/* unplugin-vue-components disabled */



;


const HeadBar_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(HeadBarvue_type_script_lang_js, [['render',HeadBarvue_type_template_id_7638b672_scoped_true_render],['__scopeId',"data-v-7638b672"]])

/* harmony default export */ const HeadBar = (HeadBar_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Main.vue?vue&type=template&id=b1b87b0a&scoped=true
/* unplugin-vue-components disabled */







function Mainvue_type_template_id_b1b87b0a_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_head_bar = HeadBar;

  const _component_el_header = ElHeader;

  const _component_side_bar = SideBar;

  const _component_el_aside = ElAside;

  const _component_router_view = resolveComponent("router-view");

  const _component_el_main = ElMain;

  const _component_el_scrollbar = ElScrollbar;

  const _component_el_container = ElContainer;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_container, null, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_header, null, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_head_bar)]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_container, {
      style: {
        "height": "calc(100vh - 100px)"
      }
    }, {
      default: withCtx(() => [withDirectives(runtime_core_esm_bundler_createVNode(_component_el_aside, null, {
        default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_side_bar)]),
        _: 1
        /* STABLE */

      }, 512
      /* NEED_PATCH */
      ), [[vShow, $data.status]]), runtime_core_esm_bundler_createVNode(_component_el_scrollbar, null, {
        default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_main, null, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_router_view)]),
          _: 1
          /* STABLE */

        })]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Main.vue?vue&type=template&id=b1b87b0a&scoped=true
/* unplugin-vue-components disabled */
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-card.css
var el_card = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-card.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-card.css

      
      
      
      
      
      
      
      
      

var el_card_options = {};

el_card_options.styleTagTransform = (styleTagTransform_default());
el_card_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_card_options.insert = insertBySelector_default().bind(null, "head");
    
el_card_options.domAPI = (styleDomAPI_default());
el_card_options.insertStyleElement = (insertStyleElement_default());

var el_card_update = injectStylesIntoStyleTag_default()(el_card/* default */.Z, el_card_options);




       /* harmony default export */ const theme_chalk_el_card = (el_card/* default */.Z && el_card/* default.locals */.Z.locals ? el_card/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/card/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-calendar.css
var el_calendar = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-calendar.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-calendar.css

      
      
      
      
      
      
      
      
      

var el_calendar_options = {};

el_calendar_options.styleTagTransform = (styleTagTransform_default());
el_calendar_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_calendar_options.insert = insertBySelector_default().bind(null, "head");
    
el_calendar_options.domAPI = (styleDomAPI_default());
el_calendar_options.insertStyleElement = (insertStyleElement_default());

var el_calendar_update = injectStylesIntoStyleTag_default()(el_calendar/* default */.Z, el_calendar_options);




       /* harmony default export */ const theme_chalk_el_calendar = (el_calendar/* default */.Z && el_calendar/* default.locals */.Z.locals ? el_calendar/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-button-group.css
var el_button_group = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-button-group.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-button-group.css

      
      
      
      
      
      
      
      
      

var el_button_group_options = {};

el_button_group_options.styleTagTransform = (styleTagTransform_default());
el_button_group_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_button_group_options.insert = insertBySelector_default().bind(null, "head");
    
el_button_group_options.domAPI = (styleDomAPI_default());
el_button_group_options.insertStyleElement = (insertStyleElement_default());

var el_button_group_update = injectStylesIntoStyleTag_default()(el_button_group/* default */.Z, el_button_group_options);




       /* harmony default export */ const theme_chalk_el_button_group = (el_button_group/* default */.Z && el_button_group/* default.locals */.Z.locals ? el_button_group/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/button-group/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/calendar/style/css.mjs




//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/card/src/card.mjs


const cardProps = buildProps({
  header: {
    type: String,
    default: ""
  },
  bodyStyle: {
    type: definePropType([String, Object, Array]),
    default: ""
  },
  shadow: {
    type: String,
    default: "always"
  }
});


//# sourceMappingURL=card.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/card/src/card2.mjs






const card2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElCard",
  props: cardProps,
  setup() {
    const ns = useNamespace("card");
    return {
      ns
    };
  }
});
function card2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass([_ctx.ns.b(), _ctx.ns.is(`${_ctx.shadow}-shadow`)])
  }, [
    _ctx.$slots.header || _ctx.header ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 0,
      class: normalizeClass(_ctx.ns.e("header"))
    }, [
      renderSlot(_ctx.$slots, "header", {}, () => [
        createTextVNode(toDisplayString(_ctx.header), 1)
      ])
    ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    createBaseVNode("div", {
      class: normalizeClass(_ctx.ns.e("body")),
      style: normalizeStyle(_ctx.bodyStyle)
    }, [
      renderSlot(_ctx.$slots, "default")
    ], 6)
  ], 2);
}
var Card = /* @__PURE__ */ _export_sfc(card2_sfc_main, [["render", card2_sfc_render]]);


//# sourceMappingURL=card2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/card/index.mjs




const ElCard = withInstall(Card);


//# sourceMappingURL=index.mjs.map

// EXTERNAL MODULE: ./node_modules/dayjs/dayjs.min.js
var dayjs_min = __webpack_require__("./node_modules/dayjs/dayjs.min.js");
// EXTERNAL MODULE: ./node_modules/dayjs/plugin/localeData.js
var localeData = __webpack_require__("./node_modules/dayjs/plugin/localeData.js");
;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/calendar/src/date-table.mjs




const dateTableProps = buildProps({
  selectedDay: {
    type: definePropType(Object)
  },
  range: {
    type: definePropType(Array)
  },
  date: {
    type: definePropType(Object),
    required: true
  },
  hideHeader: {
    type: Boolean
  }
});
const dateTableEmits = {
  pick: (value) => shared_esm_bundler_isObject(value)
};


//# sourceMappingURL=date-table.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/time-picker/src/common/date-utils.mjs
const rangeArr = (n) => Array.from(Array(n).keys());
const extractDateFormat = (format) => {
  return format.replace(/\W?m{1,2}|\W?ZZ/g, "").replace(/\W?h{1,2}|\W?s{1,3}|\W?a/gi, "").trim();
};
const extractTimeFormat = (format) => {
  return format.replace(/\W?D{1,2}|\W?Do|\W?d{1,4}|\W?M{1,4}|\W?Y{2,4}/g, "").trim();
};


//# sourceMappingURL=date-utils.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/calendar/src/date-table2.mjs











dayjs_min.extend(localeData);
const WEEK_DAYS = ["sun", "mon", "tue", "wed", "thu", "fri", "sat"];
const getPrevMonthLastDays = (date, count) => {
  const lastDay = date.subtract(1, "month").endOf("month").date();
  return rangeArr(count).map((_, index) => lastDay - (count - index - 1));
};
const getMonthDays = (date) => {
  const days = date.daysInMonth();
  return rangeArr(days).map((_, index) => index + 1);
};
const toNestedArr = (days) => rangeArr(days.length / 7).map((index) => {
  const start = index * 7;
  return days.slice(start, start + 7);
});
const date_table2_sfc_main = runtime_core_esm_bundler_defineComponent({
  props: dateTableProps,
  emits: dateTableEmits,
  setup(props, { emit }) {
    const { t, lang } = useLocale();
    const nsTable = useNamespace("calendar-table");
    const nsDay = useNamespace("calendar-day");
    const now = dayjs_min().locale(lang.value);
    const firstDayOfWeek = now.$locale().weekStart || 0;
    const isInRange = runtime_core_esm_bundler_computed(() => !!props.range && !!props.range.length);
    const rows = runtime_core_esm_bundler_computed(() => {
      let days = [];
      if (isInRange.value) {
        const [start, end] = props.range;
        const currentMonthRange = rangeArr(end.date() - start.date() + 1).map((index) => ({
          text: start.date() + index,
          type: "current"
        }));
        let remaining = currentMonthRange.length % 7;
        remaining = remaining === 0 ? 0 : 7 - remaining;
        const nextMonthRange = rangeArr(remaining).map((_, index) => ({
          text: index + 1,
          type: "next"
        }));
        days = currentMonthRange.concat(nextMonthRange);
      } else {
        const firstDay = props.date.startOf("month").day() || 7;
        const prevMonthDays = getPrevMonthLastDays(props.date, firstDay - firstDayOfWeek).map((day) => ({
          text: day,
          type: "prev"
        }));
        const currentMonthDays = getMonthDays(props.date).map((day) => ({
          text: day,
          type: "current"
        }));
        days = [...prevMonthDays, ...currentMonthDays];
        const nextMonthDays = rangeArr(42 - days.length).map((_, index) => ({
          text: index + 1,
          type: "next"
        }));
        days = days.concat(nextMonthDays);
      }
      return toNestedArr(days);
    });
    const weekDays = runtime_core_esm_bundler_computed(() => {
      const start = firstDayOfWeek;
      if (start === 0) {
        return WEEK_DAYS.map((_) => t(`el.datepicker.weeks.${_}`));
      } else {
        return WEEK_DAYS.slice(start).concat(WEEK_DAYS.slice(0, start)).map((_) => t(`el.datepicker.weeks.${_}`));
      }
    });
    const getFormattedDate = (day, type) => {
      switch (type) {
        case "prev":
          return props.date.startOf("month").subtract(1, "month").date(day);
        case "next":
          return props.date.startOf("month").add(1, "month").date(day);
        case "current":
          return props.date.date(day);
      }
    };
    const getCellClass = ({ text, type }) => {
      const classes = [type];
      if (type === "current") {
        const date = getFormattedDate(text, type);
        if (date.isSame(props.selectedDay, "day")) {
          classes.push("is-selected");
        }
        if (date.isSame(now, "day")) {
          classes.push("is-today");
        }
      }
      return classes;
    };
    const handlePickDay = ({ text, type }) => {
      const date = getFormattedDate(text, type);
      emit("pick", date);
    };
    const getSlotData = ({ text, type }) => {
      const day = getFormattedDate(text, type);
      return {
        isSelected: day.isSame(props.selectedDay),
        type: `${type}-month`,
        day: day.format("YYYY-MM-DD"),
        date: day.toDate()
      };
    };
    return {
      isInRange,
      weekDays,
      rows,
      getCellClass,
      handlePickDay,
      getSlotData,
      nsTable,
      nsDay
    };
  }
});
const date_table2_hoisted_1 = { key: 0 };
const date_table2_hoisted_2 = ["onClick"];
function date_table2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("table", {
    class: normalizeClass([_ctx.nsTable.b(), _ctx.nsTable.is("range", _ctx.isInRange)]),
    cellspacing: "0",
    cellpadding: "0"
  }, [
    !_ctx.hideHeader ? (runtime_core_esm_bundler_openBlock(), createElementBlock("thead", date_table2_hoisted_1, [
      (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.weekDays, (day) => {
        return runtime_core_esm_bundler_openBlock(), createElementBlock("th", { key: day }, toDisplayString(day), 1);
      }), 128))
    ])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    createBaseVNode("tbody", null, [
      (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.rows, (row, index) => {
        return runtime_core_esm_bundler_openBlock(), createElementBlock("tr", {
          key: index,
          class: normalizeClass({
            [_ctx.nsTable.e("row")]: true,
            [_ctx.nsTable.em("row", "hide-border")]: index === 0 && _ctx.hideHeader
          })
        }, [
          (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(row, (cell, key) => {
            return runtime_core_esm_bundler_openBlock(), createElementBlock("td", {
              key,
              class: normalizeClass(_ctx.getCellClass(cell)),
              onClick: ($event) => _ctx.handlePickDay(cell)
            }, [
              createBaseVNode("div", {
                class: normalizeClass(_ctx.nsDay.b())
              }, [
                renderSlot(_ctx.$slots, "dateCell", {
                  data: _ctx.getSlotData(cell)
                }, () => [
                  createBaseVNode("span", null, toDisplayString(cell.text), 1)
                ])
              ], 2)
            ], 10, date_table2_hoisted_2);
          }), 128))
        ], 2);
      }), 128))
    ])
  ], 2);
}
var DateTable = /* @__PURE__ */ _export_sfc(date_table2_sfc_main, [["render", date_table2_sfc_render]]);


//# sourceMappingURL=date-table2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/calendar/src/calendar.mjs



const calendarProps = buildProps({
  modelValue: {
    type: Date
  },
  range: {
    type: definePropType(Array),
    validator: (range) => Array.isArray(range) && range.length === 2 && range.every((item) => item instanceof Date)
  }
});
const calendarEmits = {
  [UPDATE_MODEL_EVENT]: (value) => value instanceof Date,
  input: (value) => value instanceof Date
};


//# sourceMappingURL=calendar.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/calendar/src/calendar2.mjs











const calendar2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElCalendar",
  components: {
    DateTable: DateTable,
    ElButton: ElButton,
    ElButtonGroup: ElButtonGroup
  },
  props: calendarProps,
  emits: calendarEmits,
  setup(props, { emit }) {
    const ns = useNamespace("calendar");
    const { t, lang } = useLocale();
    const selectedDay = reactivity_esm_bundler_ref();
    const now = dayjs_min().locale(lang.value);
    const prevMonthDayjs = runtime_core_esm_bundler_computed(() => {
      return date.value.subtract(1, "month").date(1);
    });
    const curMonthDatePrefix = runtime_core_esm_bundler_computed(() => {
      return dayjs_min(date.value).locale(lang.value).format("YYYY-MM");
    });
    const nextMonthDayjs = runtime_core_esm_bundler_computed(() => {
      return date.value.add(1, "month").date(1);
    });
    const prevYearDayjs = runtime_core_esm_bundler_computed(() => {
      return date.value.subtract(1, "year").date(1);
    });
    const nextYearDayjs = runtime_core_esm_bundler_computed(() => {
      return date.value.add(1, "year").date(1);
    });
    const i18nDate = runtime_core_esm_bundler_computed(() => {
      const pickedMonth = `el.datepicker.month${date.value.format("M")}`;
      return `${date.value.year()} ${t("el.datepicker.year")} ${t(pickedMonth)}`;
    });
    const realSelectedDay = runtime_core_esm_bundler_computed({
      get() {
        if (!props.modelValue)
          return selectedDay.value;
        return date.value;
      },
      set(val) {
        if (!val)
          return;
        selectedDay.value = val;
        const result = val.toDate();
        emit("input", result);
        emit("update:modelValue", result);
      }
    });
    const date = runtime_core_esm_bundler_computed(() => {
      if (!props.modelValue) {
        if (realSelectedDay.value) {
          return realSelectedDay.value;
        } else if (validatedRange.value.length) {
          return validatedRange.value[0][0];
        }
        return now;
      } else {
        return dayjs_min(props.modelValue).locale(lang.value);
      }
    });
    const calculateValidatedDateRange = (startDayjs, endDayjs) => {
      const firstDay = startDayjs.startOf("week");
      const lastDay = endDayjs.endOf("week");
      const firstMonth = firstDay.get("month");
      const lastMonth = lastDay.get("month");
      if (firstMonth === lastMonth) {
        return [[firstDay, lastDay]];
      } else if (firstMonth + 1 === lastMonth) {
        const firstMonthLastDay = firstDay.endOf("month");
        const lastMonthFirstDay = lastDay.startOf("month");
        const isSameWeek = firstMonthLastDay.isSame(lastMonthFirstDay, "week");
        const lastMonthStartDay = isSameWeek ? lastMonthFirstDay.add(1, "week") : lastMonthFirstDay;
        return [
          [firstDay, firstMonthLastDay],
          [lastMonthStartDay.startOf("week"), lastDay]
        ];
      } else if (firstMonth + 2 === lastMonth) {
        const firstMonthLastDay = firstDay.endOf("month");
        const secondMonthFirstDay = firstDay.add(1, "month").startOf("month");
        const secondMonthStartDay = firstMonthLastDay.isSame(secondMonthFirstDay, "week") ? secondMonthFirstDay.add(1, "week") : secondMonthFirstDay;
        const secondMonthLastDay = secondMonthStartDay.endOf("month");
        const lastMonthFirstDay = lastDay.startOf("month");
        const lastMonthStartDay = secondMonthLastDay.isSame(lastMonthFirstDay, "week") ? lastMonthFirstDay.add(1, "week") : lastMonthFirstDay;
        return [
          [firstDay, firstMonthLastDay],
          [secondMonthStartDay.startOf("week"), secondMonthLastDay],
          [lastMonthStartDay.startOf("week"), lastDay]
        ];
      } else {
        error_debugWarn("ElCalendar", "start time and end time interval must not exceed two months");
        return [];
      }
    };
    const validatedRange = runtime_core_esm_bundler_computed(() => {
      if (!props.range)
        return [];
      const rangeArrDayjs = props.range.map((_) => dayjs_min(_).locale(lang.value));
      const [startDayjs, endDayjs] = rangeArrDayjs;
      if (startDayjs.isAfter(endDayjs)) {
        error_debugWarn("ElCalendar", "end time should be greater than start time");
        return [];
      }
      if (startDayjs.isSame(endDayjs, "month")) {
        return calculateValidatedDateRange(startDayjs, endDayjs);
      } else {
        if (startDayjs.add(1, "month").month() !== endDayjs.month()) {
          error_debugWarn("ElCalendar", "start time and end time interval must not exceed two months");
          return [];
        }
        return calculateValidatedDateRange(startDayjs, endDayjs);
      }
    });
    const pickDay = (day) => {
      realSelectedDay.value = day;
    };
    const selectDate = (type) => {
      let day;
      if (type === "prev-month") {
        day = prevMonthDayjs.value;
      } else if (type === "next-month") {
        day = nextMonthDayjs.value;
      } else if (type === "prev-year") {
        day = prevYearDayjs.value;
      } else if (type === "next-year") {
        day = nextYearDayjs.value;
      } else {
        day = now;
      }
      if (day.isSame(date.value, "day"))
        return;
      pickDay(day);
    };
    return {
      selectedDay,
      curMonthDatePrefix,
      i18nDate,
      realSelectedDay,
      date,
      validatedRange,
      pickDay,
      selectDate,
      t,
      ns
    };
  }
});
function calendar2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_button = resolveComponent("el-button");
  const _component_el_button_group = resolveComponent("el-button-group");
  const _component_date_table = resolveComponent("date-table");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass(_ctx.ns.b())
  }, [
    createBaseVNode("div", {
      class: normalizeClass(_ctx.ns.e("header"))
    }, [
      renderSlot(_ctx.$slots, "header", { date: _ctx.i18nDate }, () => [
        createBaseVNode("div", {
          class: normalizeClass(_ctx.ns.e("title"))
        }, toDisplayString(_ctx.i18nDate), 3),
        _ctx.validatedRange.length === 0 ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
          key: 0,
          class: normalizeClass(_ctx.ns.e("button-group"))
        }, [
          runtime_core_esm_bundler_createVNode(_component_el_button_group, null, {
            default: withCtx(() => [
              runtime_core_esm_bundler_createVNode(_component_el_button, {
                size: "small",
                onClick: _cache[0] || (_cache[0] = ($event) => _ctx.selectDate("prev-month"))
              }, {
                default: withCtx(() => [
                  createTextVNode(toDisplayString(_ctx.t("el.datepicker.prevMonth")), 1)
                ]),
                _: 1
              }),
              runtime_core_esm_bundler_createVNode(_component_el_button, {
                size: "small",
                onClick: _cache[1] || (_cache[1] = ($event) => _ctx.selectDate("today"))
              }, {
                default: withCtx(() => [
                  createTextVNode(toDisplayString(_ctx.t("el.datepicker.today")), 1)
                ]),
                _: 1
              }),
              runtime_core_esm_bundler_createVNode(_component_el_button, {
                size: "small",
                onClick: _cache[2] || (_cache[2] = ($event) => _ctx.selectDate("next-month"))
              }, {
                default: withCtx(() => [
                  createTextVNode(toDisplayString(_ctx.t("el.datepicker.nextMonth")), 1)
                ]),
                _: 1
              })
            ]),
            _: 1
          })
        ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
      ])
    ], 2),
    _ctx.validatedRange.length === 0 ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 0,
      class: normalizeClass(_ctx.ns.e("body"))
    }, [
      runtime_core_esm_bundler_createVNode(_component_date_table, {
        date: _ctx.date,
        "selected-day": _ctx.realSelectedDay,
        onPick: _ctx.pickDay
      }, createSlots({ _: 2 }, [
        _ctx.$slots.dateCell ? {
          name: "dateCell",
          fn: withCtx((data) => [
            renderSlot(_ctx.$slots, "dateCell", normalizeProps(guardReactiveProps(data)))
          ])
        } : void 0
      ]), 1032, ["date", "selected-day", "onPick"])
    ], 2)) : (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 1,
      class: normalizeClass(_ctx.ns.e("body"))
    }, [
      (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.validatedRange, (range_, index) => {
        return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_date_table, {
          key: index,
          date: range_[0],
          "selected-day": _ctx.realSelectedDay,
          range: range_,
          "hide-header": index !== 0,
          onPick: _ctx.pickDay
        }, createSlots({ _: 2 }, [
          _ctx.$slots.dateCell ? {
            name: "dateCell",
            fn: withCtx((data) => [
              renderSlot(_ctx.$slots, "dateCell", normalizeProps(guardReactiveProps(data)))
            ])
          } : void 0
        ]), 1032, ["date", "selected-day", "range", "hide-header", "onPick"]);
      }), 128))
    ], 2))
  ], 2);
}
var Calendar = /* @__PURE__ */ _export_sfc(calendar2_sfc_main, [["render", calendar2_sfc_render]]);


//# sourceMappingURL=calendar2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/calendar/index.mjs




const ElCalendar = withInstall(Calendar);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/Calender.vue?vue&type=template&id=3a928dc6
/* unplugin-vue-components disabled */



const Calendervue_type_template_id_3a928dc6_hoisted_1 = /*#__PURE__*/createBaseVNode("div", {
  class: "card-header"
}, [/*#__PURE__*/createBaseVNode("span", null, "日历")], -1
/* HOISTED */
);

function Calendervue_type_template_id_3a928dc6_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_calendar = ElCalendar;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    class: "calender",
    shadow: "hover"
  }, {
    header: withCtx(() => [Calendervue_type_template_id_3a928dc6_hoisted_1]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_calendar, {
      modelValue: $data.currentDate,
      "onUpdate:modelValue": _cache[0] || (_cache[0] = $event => $data.currentDate = $event)
    }, {
      header: withCtx(() => [createBaseVNode("span", null, "今日:" + toDisplayString($data.currentDate.toLocaleDateString()), 1
      /* TEXT */
      )]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["modelValue"])]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/WelcomePage/Calender.vue?vue&type=template&id=3a928dc6
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/Calender.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled *//* harmony default export */ const Calendervue_type_script_lang_js = ({
  data() {
    return {
      currentDate: new Date()
    };
  }

});
;// CONCATENATED MODULE: ./src/components/WelcomePage/Calender.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/Calender.vue?vue&type=style&index=0&id=3a928dc6&lang=css
var Calendervue_type_style_index_0_id_3a928dc6_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/Calender.vue?vue&type=style&index=0&id=3a928dc6&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/Calender.vue?vue&type=style&index=0&id=3a928dc6&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var Calendervue_type_style_index_0_id_3a928dc6_lang_css_options = {};

Calendervue_type_style_index_0_id_3a928dc6_lang_css_options.styleTagTransform = (styleTagTransform_default());
Calendervue_type_style_index_0_id_3a928dc6_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      Calendervue_type_style_index_0_id_3a928dc6_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
Calendervue_type_style_index_0_id_3a928dc6_lang_css_options.domAPI = (styleDomAPI_default());
Calendervue_type_style_index_0_id_3a928dc6_lang_css_options.insertStyleElement = (insertStyleElement_default());

var Calendervue_type_style_index_0_id_3a928dc6_lang_css_update = injectStylesIntoStyleTag_default()(Calendervue_type_style_index_0_id_3a928dc6_lang_css/* default */.Z, Calendervue_type_style_index_0_id_3a928dc6_lang_css_options);




       /* harmony default export */ const WelcomePage_Calendervue_type_style_index_0_id_3a928dc6_lang_css = (Calendervue_type_style_index_0_id_3a928dc6_lang_css/* default */.Z && Calendervue_type_style_index_0_id_3a928dc6_lang_css/* default.locals */.Z.locals ? Calendervue_type_style_index_0_id_3a928dc6_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/WelcomePage/Calender.vue?vue&type=style&index=0&id=3a928dc6&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/WelcomePage/Calender.vue
/* unplugin-vue-components disabled */



;


const Calender_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(Calendervue_type_script_lang_js, [['render',Calendervue_type_template_id_3a928dc6_render]])

/* harmony default export */ const Calender = (Calender_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/UserInfo.vue?vue&type=template&id=79716d70
/* unplugin-vue-components disabled */


const UserInfovue_type_template_id_79716d70_hoisted_1 = /*#__PURE__*/createBaseVNode("div", {
  class: "card-header"
}, [/*#__PURE__*/createBaseVNode("span", null, "用户信息")], -1
/* HOISTED */
);

function UserInfovue_type_template_id_79716d70_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    class: "user-info",
    shadow: "hover"
  }, {
    header: withCtx(() => [UserInfovue_type_template_id_79716d70_hoisted_1]),
    default: withCtx(() => [createBaseVNode("p", null, "用户名:" + toDisplayString($data.userInfo.name), 1
    /* TEXT */
    ), createBaseVNode("p", null, "登录时间:" + toDisplayString($data.userInfo.loginTime), 1
    /* TEXT */
    ), createBaseVNode("p", null, "在线时间:" + toDisplayString($data.userInfo.onlineTime), 1
    /* TEXT */
    ), createBaseVNode("p", null, "登录次数:" + toDisplayString($data.userInfo.loginTimes), 1
    /* TEXT */
    )]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/WelcomePage/UserInfo.vue?vue&type=template&id=79716d70
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/UserInfo.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const UserInfovue_type_script_lang_js = ({
  data() {
    return {
      userInfo: {}
    };
  },

  created() {
    this.getUserInfo();
  },

  methods: {
    async getUserInfo() {
      this.userInfo = await GetInfo.getUserInfo();
    }

  }
});
;// CONCATENATED MODULE: ./src/components/WelcomePage/UserInfo.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/WelcomePage/UserInfo.vue
/* unplugin-vue-components disabled */



;
const UserInfo_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(UserInfovue_type_script_lang_js, [['render',UserInfovue_type_template_id_79716d70_render]])

/* harmony default export */ const UserInfo = (UserInfo_exports_);
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-table.css
var el_table = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-table.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-table.css

      
      
      
      
      
      
      
      
      

var el_table_options = {};

el_table_options.styleTagTransform = (styleTagTransform_default());
el_table_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_table_options.insert = insertBySelector_default().bind(null, "head");
    
el_table_options.domAPI = (styleDomAPI_default());
el_table_options.insertStyleElement = (insertStyleElement_default());

var el_table_update = injectStylesIntoStyleTag_default()(el_table/* default */.Z, el_table_options);




       /* harmony default export */ const theme_chalk_el_table = (el_table/* default */.Z && el_table/* default.locals */.Z.locals ? el_table/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-checkbox.css
var el_checkbox = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-checkbox.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-checkbox.css

      
      
      
      
      
      
      
      
      

var el_checkbox_options = {};

el_checkbox_options.styleTagTransform = (styleTagTransform_default());
el_checkbox_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_checkbox_options.insert = insertBySelector_default().bind(null, "head");
    
el_checkbox_options.domAPI = (styleDomAPI_default());
el_checkbox_options.insertStyleElement = (insertStyleElement_default());

var el_checkbox_update = injectStylesIntoStyleTag_default()(el_checkbox/* default */.Z, el_checkbox_options);




       /* harmony default export */ const theme_chalk_el_checkbox = (el_checkbox/* default */.Z && el_checkbox/* default.locals */.Z.locals ? el_checkbox/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/checkbox/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-tag.css
var el_tag = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-tag.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-tag.css

      
      
      
      
      
      
      
      
      

var el_tag_options = {};

el_tag_options.styleTagTransform = (styleTagTransform_default());
el_tag_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_tag_options.insert = insertBySelector_default().bind(null, "head");
    
el_tag_options.domAPI = (styleDomAPI_default());
el_tag_options.insertStyleElement = (insertStyleElement_default());

var el_tag_update = injectStylesIntoStyleTag_default()(el_tag/* default */.Z, el_tag_options);




       /* harmony default export */ const theme_chalk_el_tag = (el_tag/* default */.Z && el_tag/* default.locals */.Z.locals ? el_tag/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tag/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/style/css.mjs





//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-table-column.css
var el_table_column = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-table-column.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-table-column.css

      
      
      
      
      
      
      
      
      

var el_table_column_options = {};

el_table_column_options.styleTagTransform = (styleTagTransform_default());
el_table_column_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_table_column_options.insert = insertBySelector_default().bind(null, "head");
    
el_table_column_options.domAPI = (styleDomAPI_default());
el_table_column_options.insertStyleElement = (insertStyleElement_default());

var el_table_column_update = injectStylesIntoStyleTag_default()(el_table_column/* default */.Z, el_table_column_options);




       /* harmony default export */ const theme_chalk_el_table_column = (el_table_column/* default */.Z && el_table_column/* default.locals */.Z.locals ? el_table_column/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table-column/style/css.mjs




//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-link.css
var el_link = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-link.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-link.css

      
      
      
      
      
      
      
      
      

var el_link_options = {};

el_link_options.styleTagTransform = (styleTagTransform_default());
el_link_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_link_options.insert = insertBySelector_default().bind(null, "head");
    
el_link_options.domAPI = (styleDomAPI_default());
el_link_options.insertStyleElement = (insertStyleElement_default());

var el_link_update = injectStylesIntoStyleTag_default()(el_link/* default */.Z, el_link_options);




       /* harmony default export */ const theme_chalk_el_link = (el_link/* default */.Z && el_link/* default.locals */.Z.locals ? el_link/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/link/style/css.mjs


//# sourceMappingURL=css.mjs.map

// EXTERNAL MODULE: ./node_modules/lodash/debounce.js
var lodash_debounce = __webpack_require__("./node_modules/lodash/debounce.js");
;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/util.mjs






const getCell = function(event) {
  let cell = event.target;
  while (cell && cell.tagName.toUpperCase() !== "HTML") {
    if (cell.tagName.toUpperCase() === "TD") {
      return cell;
    }
    cell = cell.parentNode;
  }
  return null;
};
const util_isObject = function(obj) {
  return obj !== null && typeof obj === "object";
};
const orderBy = function(array, sortKey, reverse, sortMethod, sortBy) {
  if (!sortKey && !sortMethod && (!sortBy || Array.isArray(sortBy) && !sortBy.length)) {
    return array;
  }
  if (typeof reverse === "string") {
    reverse = reverse === "descending" ? -1 : 1;
  } else {
    reverse = reverse && reverse < 0 ? -1 : 1;
  }
  const getKey = sortMethod ? null : function(value, index) {
    if (sortBy) {
      if (!Array.isArray(sortBy)) {
        sortBy = [sortBy];
      }
      return sortBy.map(function(by) {
        if (typeof by === "string") {
          return getValueByPath(value, by);
        } else {
          return by(value, index, array);
        }
      });
    }
    if (sortKey !== "$key") {
      if (util_isObject(value) && "$value" in value)
        value = value.$value;
    }
    return [util_isObject(value) ? getValueByPath(value, sortKey) : value];
  };
  const compare = function(a, b) {
    if (sortMethod) {
      return sortMethod(a.value, b.value);
    }
    for (let i = 0, len = a.key.length; i < len; i++) {
      if (a.key[i] < b.key[i]) {
        return -1;
      }
      if (a.key[i] > b.key[i]) {
        return 1;
      }
    }
    return 0;
  };
  return array.map(function(value, index) {
    return {
      value,
      index,
      key: getKey ? getKey(value, index) : null
    };
  }).sort(function(a, b) {
    let order = compare(a, b);
    if (!order) {
      order = a.index - b.index;
    }
    return order * +reverse;
  }).map((item) => item.value);
};
const getColumnById = function(table, columnId) {
  let column = null;
  table.columns.forEach(function(item) {
    if (item.id === columnId) {
      column = item;
    }
  });
  return column;
};
const getColumnByKey = function(table, columnKey) {
  let column = null;
  for (let i = 0; i < table.columns.length; i++) {
    const item = table.columns[i];
    if (item.columnKey === columnKey) {
      column = item;
      break;
    }
  }
  return column;
};
const getColumnByCell = function(table, cell, namespace) {
  const matches = (cell.className || "").match(new RegExp(`${namespace}-table_[^\\s]+`, "gm"));
  if (matches) {
    return getColumnById(table, matches[0]);
  }
  return null;
};
const getRowIdentity = (row, rowKey) => {
  if (!row)
    throw new Error("Row is required when get row identity");
  if (typeof rowKey === "string") {
    if (rowKey.indexOf(".") < 0) {
      return `${row[rowKey]}`;
    }
    const key = rowKey.split(".");
    let current = row;
    for (let i = 0; i < key.length; i++) {
      current = current[key[i]];
    }
    return `${current}`;
  } else if (typeof rowKey === "function") {
    return rowKey.call(null, row);
  }
};
const getKeysMap = function(array, rowKey) {
  const arrayMap = {};
  (array || []).forEach((row, index) => {
    arrayMap[getRowIdentity(row, rowKey)] = { row, index };
  });
  return arrayMap;
};
function util_mergeOptions(defaults, config) {
  const options = {};
  let key;
  for (key in defaults) {
    options[key] = defaults[key];
  }
  for (key in config) {
    if (shared_esm_bundler_hasOwn(config, key)) {
      const value = config[key];
      if (typeof value !== "undefined") {
        options[key] = value;
      }
    }
  }
  return options;
}
function parseWidth(width) {
  if (width === "")
    return width;
  if (width !== void 0) {
    width = parseInt(width, 10);
    if (Number.isNaN(width)) {
      width = "";
    }
  }
  return width;
}
function parseMinWidth(minWidth) {
  if (minWidth === "")
    return minWidth;
  if (minWidth !== void 0) {
    minWidth = parseWidth(minWidth);
    if (Number.isNaN(minWidth)) {
      minWidth = 80;
    }
  }
  return minWidth;
}
function parseHeight(height) {
  if (typeof height === "number") {
    return height;
  }
  if (typeof height === "string") {
    if (/^\d+(?:px)?$/.test(height)) {
      return parseInt(height, 10);
    } else {
      return height;
    }
  }
  return null;
}
function compose(...funcs) {
  if (funcs.length === 0) {
    return (arg) => arg;
  }
  if (funcs.length === 1) {
    return funcs[0];
  }
  return funcs.reduce((a, b) => (...args) => a(b(...args)));
}
function toggleRowStatus(statusArr, row, newVal) {
  let changed = false;
  const index = statusArr.indexOf(row);
  const included = index !== -1;
  const addRow = () => {
    statusArr.push(row);
    changed = true;
  };
  const removeRow = () => {
    statusArr.splice(index, 1);
    changed = true;
  };
  if (typeof newVal === "boolean") {
    if (newVal && !included) {
      addRow();
    } else if (!newVal && included) {
      removeRow();
    }
  } else {
    if (included) {
      removeRow();
    } else {
      addRow();
    }
  }
  return changed;
}
function walkTreeNode(root, cb, childrenKey = "children", lazyKey = "hasChildren") {
  const isNil = (array) => !(Array.isArray(array) && array.length);
  function _walker(parent, children, level) {
    cb(parent, children, level);
    children.forEach((item) => {
      if (item[lazyKey]) {
        cb(item, null, level + 1);
        return;
      }
      const children2 = item[childrenKey];
      if (!isNil(children2)) {
        _walker(item, children2, level + 1);
      }
    });
  }
  root.forEach((item) => {
    if (item[lazyKey]) {
      cb(item, null, 0);
      return;
    }
    const children = item[childrenKey];
    if (!isNil(children)) {
      _walker(item, children, 0);
    }
  });
}
let removePopper;
function createTablePopper(trigger, popperContent, popperOptions, tooltipEffect) {
  function renderContent() {
    const isLight = tooltipEffect === "light";
    const content2 = document.createElement("div");
    content2.className = `el-popper ${isLight ? "is-light" : "is-dark"}`;
    content2.innerHTML = popperContent;
    content2.style.zIndex = String(PopupManager.nextZIndex());
    document.body.appendChild(content2);
    return content2;
  }
  function renderArrow() {
    const arrow2 = document.createElement("div");
    arrow2.className = "el-popper__arrow";
    return arrow2;
  }
  function showPopper() {
    popperInstance && popperInstance.update();
  }
  removePopper = function removePopper2() {
    try {
      popperInstance && popperInstance.destroy();
      content && document.body.removeChild(content);
      off(trigger, "mouseenter", showPopper);
      off(trigger, "mouseleave", removePopper2);
    } catch (e) {
    }
  };
  let popperInstance = null;
  const content = renderContent();
  const arrow = renderArrow();
  content.appendChild(arrow);
  popperInstance = popper_createPopper(trigger, content, {
    modifiers: [
      {
        name: "offset",
        options: {
          offset: [0, 8]
        }
      },
      {
        name: "arrow",
        options: {
          element: arrow,
          padding: 10
        }
      }
    ],
    ...popperOptions
  });
  dom_on(trigger, "mouseenter", showPopper);
  dom_on(trigger, "mouseleave", removePopper);
  return popperInstance;
}
const isFixedColumn = (index, fixed, store, realColumns) => {
  let start = 0;
  let after = index;
  if (realColumns) {
    for (let i = 0; i < index; i++) {
      start += realColumns[i].colSpan;
    }
    after = start + realColumns[index].colSpan - 1;
  } else {
    start = index;
  }
  let fixedLayout;
  const columns = store.states.columns;
  switch (fixed) {
    case "left":
      if (after < store.states.fixedLeafColumnsLength.value) {
        fixedLayout = "left";
      }
      break;
    case "right":
      if (start >= columns.value.length - store.states.rightFixedLeafColumnsLength.value) {
        fixedLayout = "right";
      }
      break;
    default:
      if (after < store.states.fixedLeafColumnsLength.value) {
        fixedLayout = "left";
      } else if (start >= columns.value.length - store.states.rightFixedLeafColumnsLength.value) {
        fixedLayout = "right";
      }
  }
  return fixedLayout ? {
    direction: fixedLayout,
    start,
    after
  } : {};
};
const getFixedColumnsClass = (namespace, index, fixed, store, realColumns) => {
  const classes = [];
  const { direction, start } = isFixedColumn(index, fixed, store, realColumns);
  if (direction) {
    const isLeft = direction === "left";
    classes.push(`${namespace}-fixed-column--${direction}`);
    if (isLeft && start === store.states.fixedLeafColumnsLength.value - 1) {
      classes.push("is-last-column");
    } else if (!isLeft && start === store.states.columns.value.length - store.states.rightFixedLeafColumnsLength.value) {
      classes.push("is-first-column");
    }
  }
  return classes;
};
function getOffset(offset, column) {
  return offset + (column.realWidth === null || Number.isNaN(column.realWidth) ? Number(column.width) : column.realWidth);
}
const getFixedColumnOffset = (index, fixed, store, realColumns) => {
  const { direction, start = 0 } = isFixedColumn(index, fixed, store, realColumns);
  if (!direction) {
    return;
  }
  const styles = {};
  const isLeft = direction === "left";
  const columns = store.states.columns.value;
  if (isLeft) {
    styles.left = columns.slice(0, index).reduce(getOffset, 0);
  } else {
    styles.right = columns.slice(start + 1).reverse().reduce(getOffset, 0);
  }
  return styles;
};
const ensurePosition = (style, key) => {
  if (!style)
    return;
  if (!Number.isNaN(style[key])) {
    style[key] = `${style[key]}px`;
  }
};


//# sourceMappingURL=util.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/store/expand.mjs



function useExpand(watcherData) {
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const defaultExpandAll = reactivity_esm_bundler_ref(false);
  const expandRows = reactivity_esm_bundler_ref([]);
  const updateExpandRows = () => {
    const data = watcherData.data.value || [];
    const rowKey = watcherData.rowKey.value;
    if (defaultExpandAll.value) {
      expandRows.value = data.slice();
    } else if (rowKey) {
      const expandRowsMap = getKeysMap(expandRows.value, rowKey);
      expandRows.value = data.reduce((prev, row) => {
        const rowId = getRowIdentity(row, rowKey);
        const rowInfo = expandRowsMap[rowId];
        if (rowInfo) {
          prev.push(row);
        }
        return prev;
      }, []);
    } else {
      expandRows.value = [];
    }
  };
  const toggleRowExpansion = (row, expanded) => {
    const changed = toggleRowStatus(expandRows.value, row, expanded);
    if (changed) {
      instance.emit("expand-change", row, expandRows.value.slice());
      instance.store.scheduleLayout();
    }
  };
  const setExpandRowKeys = (rowKeys) => {
    instance.store.assertRowKey();
    const data = watcherData.data.value || [];
    const rowKey = watcherData.rowKey.value;
    const keysMap = getKeysMap(data, rowKey);
    expandRows.value = rowKeys.reduce((prev, cur) => {
      const info = keysMap[cur];
      if (info) {
        prev.push(info.row);
      }
      return prev;
    }, []);
  };
  const isRowExpanded = (row) => {
    const rowKey = watcherData.rowKey.value;
    if (rowKey) {
      const expandMap = getKeysMap(expandRows.value, rowKey);
      return !!expandMap[getRowIdentity(row, rowKey)];
    }
    return expandRows.value.indexOf(row) !== -1;
  };
  return {
    updateExpandRows,
    toggleRowExpansion,
    setExpandRowKeys,
    isRowExpanded,
    states: {
      expandRows,
      defaultExpandAll
    }
  };
}


//# sourceMappingURL=expand.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/store/current.mjs



function useCurrent(watcherData) {
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const _currentRowKey = reactivity_esm_bundler_ref(null);
  const currentRow = reactivity_esm_bundler_ref(null);
  const setCurrentRowKey = (key) => {
    instance.store.assertRowKey();
    _currentRowKey.value = key;
    setCurrentRowByKey(key);
  };
  const restoreCurrentRowKey = () => {
    _currentRowKey.value = null;
  };
  const setCurrentRowByKey = (key) => {
    const { data, rowKey } = watcherData;
    let _currentRow = null;
    if (rowKey.value) {
      _currentRow = (reactivity_esm_bundler_unref(data) || []).find((item) => getRowIdentity(item, rowKey.value) === key);
    }
    currentRow.value = _currentRow;
  };
  const updateCurrentRow = (_currentRow) => {
    const oldCurrentRow = currentRow.value;
    if (_currentRow && _currentRow !== oldCurrentRow) {
      currentRow.value = _currentRow;
      instance.emit("current-change", currentRow.value, oldCurrentRow);
      return;
    }
    if (!_currentRow && oldCurrentRow) {
      currentRow.value = null;
      instance.emit("current-change", null, oldCurrentRow);
    }
  };
  const updateCurrentRowData = () => {
    const rowKey = watcherData.rowKey.value;
    const data = watcherData.data.value || [];
    const oldCurrentRow = currentRow.value;
    if (data.indexOf(oldCurrentRow) === -1 && oldCurrentRow) {
      if (rowKey) {
        const currentRowKey = getRowIdentity(oldCurrentRow, rowKey);
        setCurrentRowByKey(currentRowKey);
      } else {
        currentRow.value = null;
      }
      if (currentRow.value === null) {
        instance.emit("current-change", null, oldCurrentRow);
      }
    } else if (_currentRowKey.value) {
      setCurrentRowByKey(_currentRowKey.value);
      restoreCurrentRowKey();
    }
  };
  return {
    setCurrentRowKey,
    restoreCurrentRowKey,
    setCurrentRowByKey,
    updateCurrentRow,
    updateCurrentRowData,
    states: {
      _currentRowKey,
      currentRow
    }
  };
}


//# sourceMappingURL=current.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/store/tree.mjs



function useTree(watcherData) {
  const expandRowKeys = reactivity_esm_bundler_ref([]);
  const treeData = reactivity_esm_bundler_ref({});
  const indent = reactivity_esm_bundler_ref(16);
  const lazy = reactivity_esm_bundler_ref(false);
  const lazyTreeNodeMap = reactivity_esm_bundler_ref({});
  const lazyColumnIdentifier = reactivity_esm_bundler_ref("hasChildren");
  const childrenColumnName = reactivity_esm_bundler_ref("children");
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const normalizedData = runtime_core_esm_bundler_computed(() => {
    if (!watcherData.rowKey.value)
      return {};
    const data = watcherData.data.value || [];
    return normalize(data);
  });
  const normalizedLazyNode = runtime_core_esm_bundler_computed(() => {
    const rowKey = watcherData.rowKey.value;
    const keys = Object.keys(lazyTreeNodeMap.value);
    const res = {};
    if (!keys.length)
      return res;
    keys.forEach((key) => {
      if (lazyTreeNodeMap.value[key].length) {
        const item = { children: [] };
        lazyTreeNodeMap.value[key].forEach((row) => {
          const currentRowKey = getRowIdentity(row, rowKey);
          item.children.push(currentRowKey);
          if (row[lazyColumnIdentifier.value] && !res[currentRowKey]) {
            res[currentRowKey] = { children: [] };
          }
        });
        res[key] = item;
      }
    });
    return res;
  });
  const normalize = (data) => {
    const rowKey = watcherData.rowKey.value;
    const res = {};
    walkTreeNode(data, (parent, children, level) => {
      const parentId = getRowIdentity(parent, rowKey);
      if (Array.isArray(children)) {
        res[parentId] = {
          children: children.map((row) => getRowIdentity(row, rowKey)),
          level
        };
      } else if (lazy.value) {
        res[parentId] = {
          children: [],
          lazy: true,
          level
        };
      }
    }, childrenColumnName.value, lazyColumnIdentifier.value);
    return res;
  };
  const updateTreeData = (ifChangeExpandRowKeys = false, ifExpandAll = ((_a) => (_a = instance.store) == null ? void 0 : _a.states.defaultExpandAll.value)()) => {
    var _a2;
    const nested = normalizedData.value;
    const normalizedLazyNode_ = normalizedLazyNode.value;
    const keys = Object.keys(nested);
    const newTreeData = {};
    if (keys.length) {
      const oldTreeData = reactivity_esm_bundler_unref(treeData);
      const rootLazyRowKeys = [];
      const getExpanded = (oldValue, key) => {
        if (ifChangeExpandRowKeys) {
          if (expandRowKeys.value) {
            return ifExpandAll || expandRowKeys.value.includes(key);
          } else {
            return !!(ifExpandAll || (oldValue == null ? void 0 : oldValue.expanded));
          }
        } else {
          const included = ifExpandAll || expandRowKeys.value && expandRowKeys.value.includes(key);
          return !!((oldValue == null ? void 0 : oldValue.expanded) || included);
        }
      };
      keys.forEach((key) => {
        const oldValue = oldTreeData[key];
        const newValue = { ...nested[key] };
        newValue.expanded = getExpanded(oldValue, key);
        if (newValue.lazy) {
          const { loaded = false, loading = false } = oldValue || {};
          newValue.loaded = !!loaded;
          newValue.loading = !!loading;
          rootLazyRowKeys.push(key);
        }
        newTreeData[key] = newValue;
      });
      const lazyKeys = Object.keys(normalizedLazyNode_);
      if (lazy.value && lazyKeys.length && rootLazyRowKeys.length) {
        lazyKeys.forEach((key) => {
          const oldValue = oldTreeData[key];
          const lazyNodeChildren = normalizedLazyNode_[key].children;
          if (rootLazyRowKeys.indexOf(key) !== -1) {
            if (newTreeData[key].children.length !== 0) {
              throw new Error("[ElTable]children must be an empty array.");
            }
            newTreeData[key].children = lazyNodeChildren;
          } else {
            const { loaded = false, loading = false } = oldValue || {};
            newTreeData[key] = {
              lazy: true,
              loaded: !!loaded,
              loading: !!loading,
              expanded: getExpanded(oldValue, key),
              children: lazyNodeChildren,
              level: ""
            };
          }
        });
      }
    }
    treeData.value = newTreeData;
    (_a2 = instance.store) == null ? void 0 : _a2.updateTableScrollY();
  };
  runtime_core_esm_bundler_watch(() => expandRowKeys.value, () => {
    updateTreeData(true);
  });
  runtime_core_esm_bundler_watch(() => normalizedData.value, () => {
    updateTreeData();
  });
  runtime_core_esm_bundler_watch(() => normalizedLazyNode.value, () => {
    updateTreeData();
  });
  const updateTreeExpandKeys = (value) => {
    expandRowKeys.value = value;
    updateTreeData();
  };
  const toggleTreeExpansion = (row, expanded) => {
    instance.store.assertRowKey();
    const rowKey = watcherData.rowKey.value;
    const id = getRowIdentity(row, rowKey);
    const data = id && treeData.value[id];
    if (id && data && "expanded" in data) {
      const oldExpanded = data.expanded;
      expanded = typeof expanded === "undefined" ? !data.expanded : expanded;
      treeData.value[id].expanded = expanded;
      if (oldExpanded !== expanded) {
        instance.emit("expand-change", row, expanded);
      }
      instance.store.updateTableScrollY();
    }
  };
  const loadOrToggle = (row) => {
    instance.store.assertRowKey();
    const rowKey = watcherData.rowKey.value;
    const id = getRowIdentity(row, rowKey);
    const data = treeData.value[id];
    if (lazy.value && data && "loaded" in data && !data.loaded) {
      loadData(row, id, data);
    } else {
      toggleTreeExpansion(row, void 0);
    }
  };
  const loadData = (row, key, treeNode) => {
    const { load } = instance.props;
    if (load && !treeData.value[key].loaded) {
      treeData.value[key].loading = true;
      load(row, treeNode, (data) => {
        if (!Array.isArray(data)) {
          throw new Error("[ElTable] data must be an array");
        }
        treeData.value[key].loading = false;
        treeData.value[key].loaded = true;
        treeData.value[key].expanded = true;
        if (data.length) {
          lazyTreeNodeMap.value[key] = data;
        }
        instance.emit("expand-change", row, true);
      });
    }
  };
  return {
    loadData,
    loadOrToggle,
    toggleTreeExpansion,
    updateTreeExpandKeys,
    updateTreeData,
    normalize,
    states: {
      expandRowKeys,
      treeData,
      indent,
      lazy,
      lazyTreeNodeMap,
      lazyColumnIdentifier,
      childrenColumnName
    }
  };
}


//# sourceMappingURL=tree.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/store/watcher.mjs







const sortData = (data, states) => {
  const sortingColumn = states.sortingColumn;
  if (!sortingColumn || typeof sortingColumn.sortable === "string") {
    return data;
  }
  return orderBy(data, states.sortProp, states.sortOrder, sortingColumn.sortMethod, sortingColumn.sortBy);
};
const doFlattenColumns = (columns) => {
  const result = [];
  columns.forEach((column) => {
    if (column.children) {
      result.push.apply(result, doFlattenColumns(column.children));
    } else {
      result.push(column);
    }
  });
  return result;
};
function useWatcher() {
  var _a;
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const { size: tableSize } = reactivity_esm_bundler_toRefs((_a = instance.proxy) == null ? void 0 : _a.$props);
  const rowKey = reactivity_esm_bundler_ref(null);
  const data = reactivity_esm_bundler_ref([]);
  const _data = reactivity_esm_bundler_ref([]);
  const isComplex = reactivity_esm_bundler_ref(false);
  const _columns = reactivity_esm_bundler_ref([]);
  const originColumns = reactivity_esm_bundler_ref([]);
  const columns = reactivity_esm_bundler_ref([]);
  const fixedColumns = reactivity_esm_bundler_ref([]);
  const rightFixedColumns = reactivity_esm_bundler_ref([]);
  const leafColumns = reactivity_esm_bundler_ref([]);
  const fixedLeafColumns = reactivity_esm_bundler_ref([]);
  const rightFixedLeafColumns = reactivity_esm_bundler_ref([]);
  const leafColumnsLength = reactivity_esm_bundler_ref(0);
  const fixedLeafColumnsLength = reactivity_esm_bundler_ref(0);
  const rightFixedLeafColumnsLength = reactivity_esm_bundler_ref(0);
  const isAllSelected = reactivity_esm_bundler_ref(false);
  const selection = reactivity_esm_bundler_ref([]);
  const reserveSelection = reactivity_esm_bundler_ref(false);
  const selectOnIndeterminate = reactivity_esm_bundler_ref(false);
  const selectable = reactivity_esm_bundler_ref(null);
  const filters = reactivity_esm_bundler_ref({});
  const filteredData = reactivity_esm_bundler_ref(null);
  const sortingColumn = reactivity_esm_bundler_ref(null);
  const sortProp = reactivity_esm_bundler_ref(null);
  const sortOrder = reactivity_esm_bundler_ref(null);
  const hoverRow = reactivity_esm_bundler_ref(null);
  runtime_core_esm_bundler_watch(data, () => instance.state && scheduleLayout(false), {
    deep: true
  });
  const assertRowKey = () => {
    if (!rowKey.value)
      throw new Error("[ElTable] prop row-key is required");
  };
  const updateColumns = () => {
    fixedColumns.value = _columns.value.filter((column) => column.fixed === true || column.fixed === "left");
    rightFixedColumns.value = _columns.value.filter((column) => column.fixed === "right");
    if (fixedColumns.value.length > 0 && _columns.value[0] && _columns.value[0].type === "selection" && !_columns.value[0].fixed) {
      _columns.value[0].fixed = true;
      fixedColumns.value.unshift(_columns.value[0]);
    }
    const notFixedColumns = _columns.value.filter((column) => !column.fixed);
    originColumns.value = [].concat(fixedColumns.value).concat(notFixedColumns).concat(rightFixedColumns.value);
    const leafColumns2 = doFlattenColumns(notFixedColumns);
    const fixedLeafColumns2 = doFlattenColumns(fixedColumns.value);
    const rightFixedLeafColumns2 = doFlattenColumns(rightFixedColumns.value);
    leafColumnsLength.value = leafColumns2.length;
    fixedLeafColumnsLength.value = fixedLeafColumns2.length;
    rightFixedLeafColumnsLength.value = rightFixedLeafColumns2.length;
    columns.value = [].concat(fixedLeafColumns2).concat(leafColumns2).concat(rightFixedLeafColumns2);
    isComplex.value = fixedColumns.value.length > 0 || rightFixedColumns.value.length > 0;
  };
  const scheduleLayout = (needUpdateColumns, immediate = false) => {
    if (needUpdateColumns) {
      updateColumns();
    }
    if (immediate) {
      instance.state.doLayout();
    } else {
      instance.state.debouncedUpdateLayout();
    }
  };
  const isSelected = (row) => {
    return selection.value.indexOf(row) > -1;
  };
  const clearSelection = () => {
    isAllSelected.value = false;
    const oldSelection = selection.value;
    if (oldSelection.length) {
      selection.value = [];
      instance.emit("selection-change", []);
    }
  };
  const cleanSelection = () => {
    let deleted;
    if (rowKey.value) {
      deleted = [];
      const selectedMap = getKeysMap(selection.value, rowKey.value);
      const dataMap = getKeysMap(data.value, rowKey.value);
      for (const key in selectedMap) {
        if (shared_esm_bundler_hasOwn(selectedMap, key) && !dataMap[key]) {
          deleted.push(selectedMap[key].row);
        }
      }
    } else {
      deleted = selection.value.filter((item) => data.value.indexOf(item) === -1);
    }
    if (deleted.length) {
      const newSelection = selection.value.filter((item) => deleted.indexOf(item) === -1);
      selection.value = newSelection;
      instance.emit("selection-change", newSelection.slice());
    }
  };
  const toggleRowSelection = (row, selected = void 0, emitChange = true) => {
    const changed = toggleRowStatus(selection.value, row, selected);
    if (changed) {
      const newSelection = (selection.value || []).slice();
      if (emitChange) {
        instance.emit("select", newSelection, row);
      }
      instance.emit("selection-change", newSelection);
    }
  };
  const _toggleAllSelection = () => {
    var _a2, _b;
    const value = selectOnIndeterminate.value ? !isAllSelected.value : !(isAllSelected.value || selection.value.length);
    isAllSelected.value = value;
    let selectionChanged = false;
    let childrenCount = 0;
    const rowKey2 = (_b = (_a2 = instance == null ? void 0 : instance.store) == null ? void 0 : _a2.states) == null ? void 0 : _b.rowKey.value;
    data.value.forEach((row, index) => {
      const rowIndex = index + childrenCount;
      if (selectable.value) {
        if (selectable.value.call(null, row, rowIndex) && toggleRowStatus(selection.value, row, value)) {
          selectionChanged = true;
        }
      } else {
        if (toggleRowStatus(selection.value, row, value)) {
          selectionChanged = true;
        }
      }
      childrenCount += getChildrenCount(getRowIdentity(row, rowKey2));
    });
    if (selectionChanged) {
      instance.emit("selection-change", selection.value ? selection.value.slice() : []);
    }
    instance.emit("select-all", selection.value);
  };
  const updateSelectionByRowKey = () => {
    const selectedMap = getKeysMap(selection.value, rowKey.value);
    data.value.forEach((row) => {
      const rowId = getRowIdentity(row, rowKey.value);
      const rowInfo = selectedMap[rowId];
      if (rowInfo) {
        selection.value[rowInfo.index] = row;
      }
    });
  };
  const updateAllSelected = () => {
    var _a2, _b, _c;
    if (((_a2 = data.value) == null ? void 0 : _a2.length) === 0) {
      isAllSelected.value = false;
      return;
    }
    let selectedMap;
    if (rowKey.value) {
      selectedMap = getKeysMap(selection.value, rowKey.value);
    }
    const isSelected2 = function(row) {
      if (selectedMap) {
        return !!selectedMap[getRowIdentity(row, rowKey.value)];
      } else {
        return selection.value.indexOf(row) !== -1;
      }
    };
    let isAllSelected_ = true;
    let selectedCount = 0;
    let childrenCount = 0;
    for (let i = 0, j = (data.value || []).length; i < j; i++) {
      const keyProp = (_c = (_b = instance == null ? void 0 : instance.store) == null ? void 0 : _b.states) == null ? void 0 : _c.rowKey.value;
      const rowIndex = i + childrenCount;
      const item = data.value[i];
      const isRowSelectable = selectable.value && selectable.value.call(null, item, rowIndex);
      if (!isSelected2(item)) {
        if (!selectable.value || isRowSelectable) {
          isAllSelected_ = false;
          break;
        }
      } else {
        selectedCount++;
      }
      childrenCount += getChildrenCount(getRowIdentity(item, keyProp));
    }
    if (selectedCount === 0)
      isAllSelected_ = false;
    isAllSelected.value = isAllSelected_;
  };
  const getChildrenCount = (rowKey2) => {
    var _a2;
    if (!instance || !instance.store)
      return 0;
    const { treeData } = instance.store.states;
    let count = 0;
    const children = (_a2 = treeData.value[rowKey2]) == null ? void 0 : _a2.children;
    if (children) {
      count += children.length;
      children.forEach((childKey) => {
        count += getChildrenCount(childKey);
      });
    }
    return count;
  };
  const updateFilters = (columns2, values) => {
    if (!Array.isArray(columns2)) {
      columns2 = [columns2];
    }
    const filters_ = {};
    columns2.forEach((col) => {
      filters.value[col.id] = values;
      filters_[col.columnKey || col.id] = values;
    });
    return filters_;
  };
  const updateSort = (column, prop, order) => {
    if (sortingColumn.value && sortingColumn.value !== column) {
      sortingColumn.value.order = null;
    }
    sortingColumn.value = column;
    sortProp.value = prop;
    sortOrder.value = order;
  };
  const execFilter = () => {
    let sourceData = reactivity_esm_bundler_unref(_data);
    Object.keys(filters.value).forEach((columnId) => {
      const values = filters.value[columnId];
      if (!values || values.length === 0)
        return;
      const column = getColumnById({
        columns: columns.value
      }, columnId);
      if (column && column.filterMethod) {
        sourceData = sourceData.filter((row) => {
          return values.some((value) => column.filterMethod.call(null, value, row, column));
        });
      }
    });
    filteredData.value = sourceData;
  };
  const execSort = () => {
    data.value = sortData(filteredData.value, {
      sortingColumn: sortingColumn.value,
      sortProp: sortProp.value,
      sortOrder: sortOrder.value
    });
  };
  const execQuery = (ignore = void 0) => {
    if (!(ignore && ignore.filter)) {
      execFilter();
    }
    execSort();
  };
  const clearFilter = (columnKeys) => {
    const { tableHeader, fixedTableHeader, rightFixedTableHeader } = instance.refs;
    let panels = {};
    if (tableHeader)
      panels = Object.assign(panels, tableHeader.filterPanels);
    if (fixedTableHeader)
      panels = Object.assign(panels, fixedTableHeader.filterPanels);
    if (rightFixedTableHeader)
      panels = Object.assign(panels, rightFixedTableHeader.filterPanels);
    const keys = Object.keys(panels);
    if (!keys.length)
      return;
    if (typeof columnKeys === "string") {
      columnKeys = [columnKeys];
    }
    if (Array.isArray(columnKeys)) {
      const columns_ = columnKeys.map((key) => getColumnByKey({
        columns: columns.value
      }, key));
      keys.forEach((key) => {
        const column = columns_.find((col) => col.id === key);
        if (column) {
          column.filteredValue = [];
        }
      });
      instance.store.commit("filterChange", {
        column: columns_,
        values: [],
        silent: true,
        multi: true
      });
    } else {
      keys.forEach((key) => {
        const column = columns.value.find((col) => col.id === key);
        if (column) {
          column.filteredValue = [];
        }
      });
      filters.value = {};
      instance.store.commit("filterChange", {
        column: {},
        values: [],
        silent: true
      });
    }
  };
  const clearSort = () => {
    if (!sortingColumn.value)
      return;
    updateSort(null, null, null);
    instance.store.commit("changeSortCondition", {
      silent: true
    });
  };
  const {
    setExpandRowKeys,
    toggleRowExpansion,
    updateExpandRows,
    states: expandStates,
    isRowExpanded
  } = useExpand({
    data,
    rowKey
  });
  const {
    updateTreeExpandKeys,
    toggleTreeExpansion,
    updateTreeData,
    loadOrToggle,
    states: treeStates
  } = useTree({
    data,
    rowKey
  });
  const {
    updateCurrentRowData,
    updateCurrentRow,
    setCurrentRowKey,
    states: currentData
  } = useCurrent({
    data,
    rowKey
  });
  const setExpandRowKeysAdapter = (val) => {
    setExpandRowKeys(val);
    updateTreeExpandKeys(val);
  };
  const toggleRowExpansionAdapter = (row, expanded) => {
    const hasExpandColumn = columns.value.some(({ type }) => type === "expand");
    if (hasExpandColumn) {
      toggleRowExpansion(row, expanded);
    } else {
      toggleTreeExpansion(row, expanded);
    }
  };
  return {
    assertRowKey,
    updateColumns,
    scheduleLayout,
    isSelected,
    clearSelection,
    cleanSelection,
    toggleRowSelection,
    _toggleAllSelection,
    toggleAllSelection: null,
    updateSelectionByRowKey,
    updateAllSelected,
    updateFilters,
    updateCurrentRow,
    updateSort,
    execFilter,
    execSort,
    execQuery,
    clearFilter,
    clearSort,
    toggleRowExpansion,
    setExpandRowKeysAdapter,
    setCurrentRowKey,
    toggleRowExpansionAdapter,
    isRowExpanded,
    updateExpandRows,
    updateCurrentRowData,
    loadOrToggle,
    updateTreeData,
    states: {
      tableSize,
      rowKey,
      data,
      _data,
      isComplex,
      _columns,
      originColumns,
      columns,
      fixedColumns,
      rightFixedColumns,
      leafColumns,
      fixedLeafColumns,
      rightFixedLeafColumns,
      leafColumnsLength,
      fixedLeafColumnsLength,
      rightFixedLeafColumnsLength,
      isAllSelected,
      selection,
      reserveSelection,
      selectOnIndeterminate,
      selectable,
      filters,
      filteredData,
      sortingColumn,
      sortProp,
      sortOrder,
      hoverRow,
      ...expandStates,
      ...treeStates,
      ...currentData
    }
  };
}


//# sourceMappingURL=watcher.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/store/index.mjs





function replaceColumn(array, column) {
  return array.map((item) => {
    var _a;
    if (item.id === column.id) {
      return column;
    } else if ((_a = item.children) == null ? void 0 : _a.length) {
      item.children = replaceColumn(item.children, column);
    }
    return item;
  });
}
function sortColumn(array) {
  array.forEach((item) => {
    var _a, _b;
    item.no = (_a = item.getColumnIndex) == null ? void 0 : _a.call(item);
    if ((_b = item.children) == null ? void 0 : _b.length) {
      sortColumn(item.children);
    }
  });
  array.sort((cur, pre) => cur.no - pre.no);
}
function useStore() {
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const watcher = useWatcher();
  const ns = useNamespace("table");
  const mutations = {
    setData(states, data) {
      const dataInstanceChanged = reactivity_esm_bundler_unref(states._data) !== data;
      states.data.value = data;
      states._data.value = data;
      instance.store.execQuery();
      instance.store.updateCurrentRowData();
      instance.store.updateExpandRows();
      instance.store.updateTreeData(instance.store.states.defaultExpandAll.value);
      if (reactivity_esm_bundler_unref(states.reserveSelection)) {
        instance.store.assertRowKey();
        instance.store.updateSelectionByRowKey();
      } else {
        if (dataInstanceChanged) {
          instance.store.clearSelection();
        } else {
          instance.store.cleanSelection();
        }
      }
      instance.store.updateAllSelected();
      if (instance.$ready) {
        instance.store.scheduleLayout();
      }
    },
    insertColumn(states, column, parent) {
      const array = reactivity_esm_bundler_unref(states._columns);
      let newColumns = [];
      if (!parent) {
        array.push(column);
        newColumns = array;
      } else {
        if (parent && !parent.children) {
          parent.children = [];
        }
        parent.children.push(column);
        newColumns = replaceColumn(array, parent);
      }
      sortColumn(newColumns);
      states._columns.value = newColumns;
      if (column.type === "selection") {
        states.selectable.value = column.selectable;
        states.reserveSelection.value = column.reserveSelection;
      }
      if (instance.$ready) {
        instance.store.updateColumns();
        instance.store.scheduleLayout();
      }
    },
    removeColumn(states, column, parent) {
      const array = reactivity_esm_bundler_unref(states._columns) || [];
      if (parent) {
        parent.children.splice(parent.children.findIndex((item) => item.id === column.id), 1);
        if (parent.children.length === 0) {
          delete parent.children;
        }
        states._columns.value = replaceColumn(array, parent);
      } else {
        const index = array.indexOf(column);
        if (index > -1) {
          array.splice(index, 1);
          states._columns.value = array;
        }
      }
      if (instance.$ready) {
        instance.store.updateColumns();
        instance.store.scheduleLayout();
      }
    },
    sort(states, options) {
      const { prop, order, init } = options;
      if (prop) {
        const column = reactivity_esm_bundler_unref(states.columns).find((column2) => column2.property === prop);
        if (column) {
          column.order = order;
          instance.store.updateSort(column, prop, order);
          instance.store.commit("changeSortCondition", { init });
        }
      }
    },
    changeSortCondition(states, options) {
      const { sortingColumn: column, sortProp: prop, sortOrder: order } = states;
      if (reactivity_esm_bundler_unref(order) === null) {
        states.sortingColumn.value = null;
        states.sortProp.value = null;
      }
      const ingore = { filter: true };
      instance.store.execQuery(ingore);
      if (!options || !(options.silent || options.init)) {
        instance.emit("sort-change", {
          column: reactivity_esm_bundler_unref(column),
          prop: reactivity_esm_bundler_unref(prop),
          order: reactivity_esm_bundler_unref(order)
        });
      }
      instance.store.updateTableScrollY();
    },
    filterChange(_states, options) {
      const { column, values, silent } = options;
      const newFilters = instance.store.updateFilters(column, values);
      instance.store.execQuery();
      if (!silent) {
        instance.emit("filter-change", newFilters);
      }
      instance.store.updateTableScrollY();
    },
    toggleAllSelection() {
      instance.store.toggleAllSelection();
    },
    rowSelectedChanged(_states, row) {
      instance.store.toggleRowSelection(row);
      instance.store.updateAllSelected();
    },
    setHoverRow(states, row) {
      states.hoverRow.value = row;
    },
    setCurrentRow(_states, row) {
      instance.store.updateCurrentRow(row);
    }
  };
  const commit = function(name, ...args) {
    const mutations2 = instance.store.mutations;
    if (mutations2[name]) {
      mutations2[name].apply(instance, [instance.store.states].concat(args));
    } else {
      throw new Error(`Action not found: ${name}`);
    }
  };
  const updateTableScrollY = function() {
    runtime_core_esm_bundler_nextTick(() => instance.layout.updateScrollY.apply(instance.layout));
  };
  return {
    ns,
    ...watcher,
    mutations,
    commit,
    updateTableScrollY
  };
}
class HelperStore {
  constructor() {
    this.Return = useStore();
  }
}


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/store/helper.mjs




const InitialStateMap = {
  rowKey: "rowKey",
  defaultExpandAll: "defaultExpandAll",
  selectOnIndeterminate: "selectOnIndeterminate",
  indent: "indent",
  lazy: "lazy",
  data: "data",
  ["treeProps.hasChildren"]: {
    key: "lazyColumnIdentifier",
    default: "hasChildren"
  },
  ["treeProps.children"]: {
    key: "childrenColumnName",
    default: "children"
  }
};
function createStore(table, props) {
  if (!table) {
    throw new Error("Table is required.");
  }
  const store = useStore();
  store.toggleAllSelection = lodash_debounce(store._toggleAllSelection, 10);
  Object.keys(InitialStateMap).forEach((key) => {
    handleValue(getArrKeysValue(props, key), key, store);
  });
  proxyTableProps(store, props);
  return store;
}
function proxyTableProps(store, props) {
  Object.keys(InitialStateMap).forEach((key) => {
    runtime_core_esm_bundler_watch(() => getArrKeysValue(props, key), (value) => {
      handleValue(value, key, store);
    });
  });
}
function handleValue(value, propsKey, store) {
  let newVal = value;
  let storeKey = InitialStateMap[propsKey];
  if (typeof InitialStateMap[propsKey] === "object") {
    storeKey = storeKey.key;
    newVal = newVal || InitialStateMap[propsKey].default;
  }
  store.states[storeKey].value = newVal;
}
function getArrKeysValue(props, keys) {
  if (keys.includes(".")) {
    const keyList = keys.split(".");
    let value = props;
    keyList.forEach((key) => {
      value = value[key];
    });
    return value;
  } else {
    return props[keys];
  }
}


//# sourceMappingURL=helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-layout.mjs





class TableLayout {
  constructor(options) {
    this.observers = [];
    this.table = null;
    this.store = null;
    this.columns = [];
    this.fit = true;
    this.showHeader = true;
    this.height = reactivity_esm_bundler_ref(null);
    this.scrollX = reactivity_esm_bundler_ref(false);
    this.scrollY = reactivity_esm_bundler_ref(false);
    this.bodyWidth = reactivity_esm_bundler_ref(null);
    this.fixedWidth = reactivity_esm_bundler_ref(null);
    this.rightFixedWidth = reactivity_esm_bundler_ref(null);
    this.tableHeight = reactivity_esm_bundler_ref(null);
    this.headerHeight = reactivity_esm_bundler_ref(44);
    this.appendHeight = reactivity_esm_bundler_ref(0);
    this.footerHeight = reactivity_esm_bundler_ref(44);
    this.viewportHeight = reactivity_esm_bundler_ref(null);
    this.bodyHeight = reactivity_esm_bundler_ref(null);
    this.bodyScrollHeight = reactivity_esm_bundler_ref(0);
    this.fixedBodyHeight = reactivity_esm_bundler_ref(null);
    this.gutterWidth = 0;
    for (const name in options) {
      if (shared_esm_bundler_hasOwn(options, name)) {
        if (reactivity_esm_bundler_isRef(this[name])) {
          this[name].value = options[name];
        } else {
          this[name] = options[name];
        }
      }
    }
    if (!this.table) {
      throw new Error("Table is required for Table Layout");
    }
    if (!this.store) {
      throw new Error("Store is required for Table Layout");
    }
  }
  updateScrollY() {
    const height = this.height.value;
    if (height === null)
      return false;
    const bodyWrapper = this.table.refs.bodyWrapper;
    if (this.table.vnode.el && bodyWrapper) {
      let scrollY = true;
      const prevScrollY = this.scrollY.value;
      if (this.bodyHeight.value === null) {
        scrollY = false;
      } else {
        scrollY = bodyWrapper.scrollHeight > this.bodyHeight.value;
      }
      this.scrollY.value = scrollY;
      return prevScrollY !== scrollY;
    }
    return false;
  }
  setHeight(value, prop = "height") {
    if (!shared_isClient)
      return;
    const el = this.table.vnode.el;
    value = parseHeight(value);
    this.height.value = Number(value);
    if (!el && (value || value === 0))
      return runtime_core_esm_bundler_nextTick(() => this.setHeight(value, prop));
    if (typeof value === "number") {
      el.style[prop] = `${value}px`;
      this.updateElsHeight();
    } else if (typeof value === "string") {
      el.style[prop] = value;
      this.updateElsHeight();
    }
  }
  setMaxHeight(value) {
    this.setHeight(value, "max-height");
  }
  getFlattenColumns() {
    const flattenColumns = [];
    const columns = this.table.store.states.columns.value;
    columns.forEach((column) => {
      if (column.isColumnGroup) {
        flattenColumns.push.apply(flattenColumns, column.columns);
      } else {
        flattenColumns.push(column);
      }
    });
    return flattenColumns;
  }
  updateElsHeight() {
    var _a, _b;
    if (!this.table.$ready)
      return runtime_core_esm_bundler_nextTick(() => this.updateElsHeight());
    const {
      headerWrapper,
      appendWrapper,
      footerWrapper,
      tableHeader,
      tableBody
    } = this.table.refs;
    this.appendHeight.value = appendWrapper ? appendWrapper.offsetHeight : 0;
    if (this.showHeader && !headerWrapper)
      return;
    const headerTrElm = tableHeader ? tableHeader.$el : null;
    const noneHeader = this.headerDisplayNone(headerTrElm);
    const headerHeight = this.headerHeight.value = !this.showHeader ? 0 : headerWrapper.offsetHeight;
    if (this.showHeader && !noneHeader && headerWrapper.offsetWidth > 0 && (this.table.store.states.columns.value || []).length > 0 && headerHeight < 2) {
      return runtime_core_esm_bundler_nextTick(() => this.updateElsHeight());
    }
    const tableHeight = this.tableHeight.value = (_b = (_a = this.table) == null ? void 0 : _a.vnode.el) == null ? void 0 : _b.clientHeight;
    const footerHeight = this.footerHeight.value = footerWrapper ? footerWrapper.offsetHeight : 0;
    if (this.height.value !== null) {
      if (this.bodyHeight.value === null) {
        requestAnimationFrame(() => this.updateElsHeight());
      }
      this.bodyHeight.value = tableHeight - headerHeight - footerHeight + (footerWrapper ? 1 : 0);
      this.bodyScrollHeight.value = tableBody == null ? void 0 : tableBody.$el.scrollHeight;
    }
    this.fixedBodyHeight.value = this.scrollX.value ? this.bodyHeight.value - this.gutterWidth : this.bodyHeight.value;
    this.viewportHeight.value = this.scrollX.value ? tableHeight - this.gutterWidth : tableHeight;
    this.updateScrollY();
    this.notifyObservers("scrollable");
  }
  headerDisplayNone(elm) {
    if (!elm)
      return true;
    let headerChild = elm;
    while (headerChild.tagName !== "DIV") {
      if (getComputedStyle(headerChild).display === "none") {
        return true;
      }
      headerChild = headerChild.parentElement;
    }
    return false;
  }
  updateColumnsWidth() {
    if (!shared_isClient)
      return;
    const fit = this.fit;
    const bodyWidth = this.table.vnode.el.clientWidth;
    let bodyMinWidth = 0;
    const flattenColumns = this.getFlattenColumns();
    const flexColumns = flattenColumns.filter((column) => typeof column.width !== "number");
    flattenColumns.forEach((column) => {
      if (typeof column.width === "number" && column.realWidth)
        column.realWidth = null;
    });
    if (flexColumns.length > 0 && fit) {
      flattenColumns.forEach((column) => {
        bodyMinWidth += Number(column.width || column.minWidth || 80);
      });
      const scrollYWidth = this.scrollY.value ? this.gutterWidth : 0;
      if (bodyMinWidth <= bodyWidth - scrollYWidth) {
        this.scrollX.value = false;
        const totalFlexWidth = bodyWidth - scrollYWidth - bodyMinWidth;
        if (flexColumns.length === 1) {
          flexColumns[0].realWidth = Number(flexColumns[0].minWidth || 80) + totalFlexWidth;
        } else {
          const allColumnsWidth = flexColumns.reduce((prev, column) => prev + Number(column.minWidth || 80), 0);
          const flexWidthPerPixel = totalFlexWidth / allColumnsWidth;
          let noneFirstWidth = 0;
          flexColumns.forEach((column, index) => {
            if (index === 0)
              return;
            const flexWidth = Math.floor(Number(column.minWidth || 80) * flexWidthPerPixel);
            noneFirstWidth += flexWidth;
            column.realWidth = Number(column.minWidth || 80) + flexWidth;
          });
          flexColumns[0].realWidth = Number(flexColumns[0].minWidth || 80) + totalFlexWidth - noneFirstWidth;
        }
      } else {
        this.scrollX.value = true;
        flexColumns.forEach(function(column) {
          column.realWidth = Number(column.minWidth);
        });
      }
      this.bodyWidth.value = Math.max(bodyMinWidth, bodyWidth);
      this.table.state.resizeState.value.width = this.bodyWidth.value;
    } else {
      flattenColumns.forEach((column) => {
        if (!column.width && !column.minWidth) {
          column.realWidth = 80;
        } else {
          column.realWidth = Number(column.width || column.minWidth);
        }
        bodyMinWidth += column.realWidth;
      });
      this.scrollX.value = bodyMinWidth > bodyWidth;
      this.bodyWidth.value = bodyMinWidth;
    }
    const fixedColumns = this.store.states.fixedColumns.value;
    if (fixedColumns.length > 0) {
      let fixedWidth = 0;
      fixedColumns.forEach(function(column) {
        fixedWidth += Number(column.realWidth || column.width);
      });
      this.fixedWidth.value = fixedWidth;
    }
    const rightFixedColumns = this.store.states.rightFixedColumns.value;
    if (rightFixedColumns.length > 0) {
      let rightFixedWidth = 0;
      rightFixedColumns.forEach(function(column) {
        rightFixedWidth += Number(column.realWidth || column.width);
      });
      this.rightFixedWidth.value = rightFixedWidth;
    }
    this.notifyObservers("columns");
  }
  addObserver(observer) {
    this.observers.push(observer);
  }
  removeObserver(observer) {
    const index = this.observers.indexOf(observer);
    if (index !== -1) {
      this.observers.splice(index, 1);
    }
  }
  notifyObservers(event) {
    const observers = this.observers;
    observers.forEach((observer) => {
      var _a, _b;
      switch (event) {
        case "columns":
          (_a = observer.state) == null ? void 0 : _a.onColumnsChange(this);
          break;
        case "scrollable":
          (_b = observer.state) == null ? void 0 : _b.onScrollableChange(this);
          break;
        default:
          throw new Error(`Table Layout don't have event ${event}.`);
      }
    });
  }
}


//# sourceMappingURL=table-layout.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/checkbox/src/useCheckbox.mjs








const useCheckboxProps = {
  modelValue: {
    type: [Boolean, Number, String],
    default: () => void 0
  },
  label: {
    type: [String, Boolean, Number, Object]
  },
  indeterminate: Boolean,
  disabled: Boolean,
  checked: Boolean,
  name: {
    type: String,
    default: void 0
  },
  trueLabel: {
    type: [String, Number],
    default: void 0
  },
  falseLabel: {
    type: [String, Number],
    default: void 0
  },
  tabindex: [String, Number],
  size: String
};
const useCheckboxGroup = () => {
  const elForm = runtime_core_esm_bundler_inject(elFormKey, {});
  const elFormItem = runtime_core_esm_bundler_inject(elFormItemKey, {});
  const checkboxGroup = runtime_core_esm_bundler_inject("CheckboxGroup", {});
  const isGroup = runtime_core_esm_bundler_computed(() => checkboxGroup && (checkboxGroup == null ? void 0 : checkboxGroup.name) === "ElCheckboxGroup");
  const elFormItemSize = runtime_core_esm_bundler_computed(() => {
    return elFormItem.size;
  });
  return {
    isGroup,
    checkboxGroup,
    elForm,
    elFormItemSize,
    elFormItem
  };
};
const useModel = (props) => {
  const selfModel = reactivity_esm_bundler_ref(false);
  const { emit } = runtime_core_esm_bundler_getCurrentInstance();
  const { isGroup, checkboxGroup } = useCheckboxGroup();
  const isLimitExceeded = reactivity_esm_bundler_ref(false);
  const model = runtime_core_esm_bundler_computed({
    get() {
      var _a, _b;
      return isGroup.value ? (_a = checkboxGroup.modelValue) == null ? void 0 : _a.value : (_b = props.modelValue) != null ? _b : selfModel.value;
    },
    set(val) {
      var _a;
      if (isGroup.value && Array.isArray(val)) {
        isLimitExceeded.value = checkboxGroup.max !== void 0 && val.length > checkboxGroup.max.value;
        isLimitExceeded.value === false && ((_a = checkboxGroup == null ? void 0 : checkboxGroup.changeEvent) == null ? void 0 : _a.call(checkboxGroup, val));
      } else {
        emit(UPDATE_MODEL_EVENT, val);
        selfModel.value = val;
      }
    }
  });
  return {
    model,
    isLimitExceeded
  };
};
const useCheckboxStatus = (props, { model }) => {
  const { isGroup, checkboxGroup } = useCheckboxGroup();
  const focus = reactivity_esm_bundler_ref(false);
  const size = useSize(checkboxGroup == null ? void 0 : checkboxGroup.checkboxGroupSize, { prop: true });
  const isChecked = runtime_core_esm_bundler_computed(() => {
    const value = model.value;
    if (toTypeString(value) === "[object Boolean]") {
      return value;
    } else if (Array.isArray(value)) {
      return value.includes(props.label);
    } else if (value !== null && value !== void 0) {
      return value === props.trueLabel;
    } else {
      return !!value;
    }
  });
  const checkboxSize = useSize(runtime_core_esm_bundler_computed(() => {
    var _a;
    return isGroup.value ? (_a = checkboxGroup == null ? void 0 : checkboxGroup.checkboxGroupSize) == null ? void 0 : _a.value : void 0;
  }));
  return {
    isChecked,
    focus,
    size,
    checkboxSize
  };
};
const useCheckbox_useDisabled = (props, {
  model,
  isChecked
}) => {
  const { elForm, isGroup, checkboxGroup } = useCheckboxGroup();
  const isLimitDisabled = runtime_core_esm_bundler_computed(() => {
    var _a, _b;
    const max = (_a = checkboxGroup.max) == null ? void 0 : _a.value;
    const min = (_b = checkboxGroup.min) == null ? void 0 : _b.value;
    return !!(max || min) && model.value.length >= max && !isChecked.value || model.value.length <= min && isChecked.value;
  });
  const isDisabled = runtime_core_esm_bundler_computed(() => {
    var _a, _b;
    const disabled = props.disabled || elForm.disabled;
    return (_b = isGroup.value ? ((_a = checkboxGroup.disabled) == null ? void 0 : _a.value) || disabled || isLimitDisabled.value : props.disabled || elForm.disabled) != null ? _b : false;
  });
  return {
    isDisabled,
    isLimitDisabled
  };
};
const setStoreValue = (props, { model }) => {
  function addToStore() {
    if (Array.isArray(model.value) && !model.value.includes(props.label)) {
      model.value.push(props.label);
    } else {
      model.value = props.trueLabel || true;
    }
  }
  props.checked && addToStore();
};
const useEvent = (props, { isLimitExceeded }) => {
  const { elFormItem } = useCheckboxGroup();
  const { emit } = runtime_core_esm_bundler_getCurrentInstance();
  function handleChange(e) {
    var _a, _b;
    if (isLimitExceeded.value)
      return;
    const target = e.target;
    const value = target.checked ? (_a = props.trueLabel) != null ? _a : true : (_b = props.falseLabel) != null ? _b : false;
    emit("change", value, e);
  }
  runtime_core_esm_bundler_watch(() => props.modelValue, () => {
    var _a;
    (_a = elFormItem.validate) == null ? void 0 : _a.call(elFormItem, "change");
  });
  return {
    handleChange
  };
};
const useCheckbox = (props) => {
  const { model, isLimitExceeded } = useModel(props);
  const { focus, size, isChecked, checkboxSize } = useCheckboxStatus(props, {
    model
  });
  const { isDisabled } = useCheckbox_useDisabled(props, { model, isChecked });
  const { handleChange } = useEvent(props, { isLimitExceeded });
  setStoreValue(props, { model });
  return {
    isChecked,
    isDisabled,
    checkboxSize,
    model,
    handleChange,
    focus,
    size
  };
};


//# sourceMappingURL=useCheckbox.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/checkbox/src/checkbox.mjs








const checkbox_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElCheckbox",
  props: {
    modelValue: {
      type: [Boolean, Number, String],
      default: () => void 0
    },
    label: {
      type: [String, Boolean, Number, Object]
    },
    indeterminate: Boolean,
    disabled: Boolean,
    checked: Boolean,
    name: {
      type: String,
      default: void 0
    },
    trueLabel: {
      type: [String, Number],
      default: void 0
    },
    falseLabel: {
      type: [String, Number],
      default: void 0
    },
    id: {
      type: String,
      default: void 0
    },
    controls: {
      type: String,
      default: void 0
    },
    border: Boolean,
    size: {
      type: String,
      validator: isValidComponentSize
    },
    tabindex: [String, Number]
  },
  emits: [UPDATE_MODEL_EVENT, "change"],
  setup(props) {
    const ns = useNamespace("checkbox");
    return {
      ns,
      ...useCheckbox(props)
    };
  }
});
const checkbox_hoisted_1 = ["id", "aria-controls"];
const checkbox_hoisted_2 = ["tabindex", "role", "aria-checked"];
const checkbox_hoisted_3 = ["aria-hidden", "name", "tabindex", "disabled", "true-value", "false-value"];
const checkbox_hoisted_4 = ["aria-hidden", "disabled", "value", "name", "tabindex"];
function checkbox_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("label", {
    id: _ctx.id,
    class: normalizeClass([
      _ctx.ns.b(),
      _ctx.ns.m(_ctx.checkboxSize),
      _ctx.ns.is("disabled", _ctx.isDisabled),
      _ctx.ns.is("bordered", _ctx.border),
      _ctx.ns.is("checked", _ctx.isChecked)
    ]),
    "aria-controls": _ctx.indeterminate ? _ctx.controls : null
  }, [
    createBaseVNode("span", {
      class: normalizeClass([
        _ctx.ns.e("input"),
        _ctx.ns.is("disabled", _ctx.isDisabled),
        _ctx.ns.is("checked", _ctx.isChecked),
        _ctx.ns.is("indeterminate", _ctx.indeterminate),
        _ctx.ns.is("focus", _ctx.focus)
      ]),
      tabindex: _ctx.indeterminate ? 0 : void 0,
      role: _ctx.indeterminate ? "checkbox" : void 0,
      "aria-checked": _ctx.indeterminate ? "mixed" : false
    }, [
      createBaseVNode("span", {
        class: normalizeClass(_ctx.ns.e("inner"))
      }, null, 2),
      _ctx.trueLabel || _ctx.falseLabel ? withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("input", {
        key: 0,
        "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => _ctx.model = $event),
        class: normalizeClass(_ctx.ns.e("original")),
        type: "checkbox",
        "aria-hidden": _ctx.indeterminate ? "true" : "false",
        name: _ctx.name,
        tabindex: _ctx.tabindex,
        disabled: _ctx.isDisabled,
        "true-value": _ctx.trueLabel,
        "false-value": _ctx.falseLabel,
        onChange: _cache[1] || (_cache[1] = (...args) => _ctx.handleChange && _ctx.handleChange(...args)),
        onFocus: _cache[2] || (_cache[2] = ($event) => _ctx.focus = true),
        onBlur: _cache[3] || (_cache[3] = ($event) => _ctx.focus = false)
      }, null, 42, checkbox_hoisted_3)), [
        [vModelCheckbox, _ctx.model]
      ]) : withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("input", {
        key: 1,
        "onUpdate:modelValue": _cache[4] || (_cache[4] = ($event) => _ctx.model = $event),
        class: normalizeClass(_ctx.ns.e("original")),
        type: "checkbox",
        "aria-hidden": _ctx.indeterminate ? "true" : "false",
        disabled: _ctx.isDisabled,
        value: _ctx.label,
        name: _ctx.name,
        tabindex: _ctx.tabindex,
        onChange: _cache[5] || (_cache[5] = (...args) => _ctx.handleChange && _ctx.handleChange(...args)),
        onFocus: _cache[6] || (_cache[6] = ($event) => _ctx.focus = true),
        onBlur: _cache[7] || (_cache[7] = ($event) => _ctx.focus = false)
      }, null, 42, checkbox_hoisted_4)), [
        [vModelCheckbox, _ctx.model]
      ])
    ], 10, checkbox_hoisted_2),
    _ctx.$slots.default || _ctx.label ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
      key: 0,
      class: normalizeClass(_ctx.ns.e("label"))
    }, [
      renderSlot(_ctx.$slots, "default"),
      !_ctx.$slots.default ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 0 }, [
        createTextVNode(toDisplayString(_ctx.label), 1)
      ], 2112)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
    ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 10, checkbox_hoisted_1);
}
var Checkbox = /* @__PURE__ */ _export_sfc(checkbox_sfc_main, [["render", checkbox_sfc_render]]);


//# sourceMappingURL=checkbox.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/checkbox/src/checkbox-button.mjs







const checkbox_button_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElCheckboxButton",
  props: useCheckboxProps,
  emits: [UPDATE_MODEL_EVENT, "change"],
  setup(props) {
    const { focus, isChecked, isDisabled, size, model, handleChange } = useCheckbox(props);
    const { checkboxGroup } = useCheckboxGroup();
    const ns = useNamespace("checkbox");
    const activeStyle = runtime_core_esm_bundler_computed(() => {
      var _a, _b, _c, _d;
      const fillValue = (_b = (_a = checkboxGroup == null ? void 0 : checkboxGroup.fill) == null ? void 0 : _a.value) != null ? _b : "";
      return {
        backgroundColor: fillValue,
        borderColor: fillValue,
        color: (_d = (_c = checkboxGroup == null ? void 0 : checkboxGroup.textColor) == null ? void 0 : _c.value) != null ? _d : "",
        boxShadow: fillValue ? `-1px 0 0 0 ${fillValue}` : null
      };
    });
    return {
      focus,
      isChecked,
      isDisabled,
      model,
      handleChange,
      activeStyle,
      size,
      ns
    };
  }
});
const checkbox_button_hoisted_1 = ["aria-checked", "aria-disabled"];
const checkbox_button_hoisted_2 = ["name", "tabindex", "disabled", "true-value", "false-value"];
const checkbox_button_hoisted_3 = ["name", "tabindex", "disabled", "value"];
function checkbox_button_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("label", {
    class: normalizeClass([
      _ctx.ns.b("button"),
      _ctx.ns.bm("button", _ctx.size),
      _ctx.ns.is("disabled", _ctx.isDisabled),
      _ctx.ns.is("checked", _ctx.isChecked),
      _ctx.ns.is("focus", _ctx.focus)
    ]),
    role: "checkbox",
    "aria-checked": _ctx.isChecked,
    "aria-disabled": _ctx.isDisabled
  }, [
    _ctx.trueLabel || _ctx.falseLabel ? withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("input", {
      key: 0,
      "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => _ctx.model = $event),
      class: normalizeClass(_ctx.ns.be("button", "original")),
      type: "checkbox",
      name: _ctx.name,
      tabindex: _ctx.tabindex,
      disabled: _ctx.isDisabled,
      "true-value": _ctx.trueLabel,
      "false-value": _ctx.falseLabel,
      onChange: _cache[1] || (_cache[1] = (...args) => _ctx.handleChange && _ctx.handleChange(...args)),
      onFocus: _cache[2] || (_cache[2] = ($event) => _ctx.focus = true),
      onBlur: _cache[3] || (_cache[3] = ($event) => _ctx.focus = false)
    }, null, 42, checkbox_button_hoisted_2)), [
      [vModelCheckbox, _ctx.model]
    ]) : withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("input", {
      key: 1,
      "onUpdate:modelValue": _cache[4] || (_cache[4] = ($event) => _ctx.model = $event),
      class: normalizeClass(_ctx.ns.be("button", "original")),
      type: "checkbox",
      name: _ctx.name,
      tabindex: _ctx.tabindex,
      disabled: _ctx.isDisabled,
      value: _ctx.label,
      onChange: _cache[5] || (_cache[5] = (...args) => _ctx.handleChange && _ctx.handleChange(...args)),
      onFocus: _cache[6] || (_cache[6] = ($event) => _ctx.focus = true),
      onBlur: _cache[7] || (_cache[7] = ($event) => _ctx.focus = false)
    }, null, 42, checkbox_button_hoisted_3)), [
      [vModelCheckbox, _ctx.model]
    ]),
    _ctx.$slots.default || _ctx.label ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
      key: 2,
      class: normalizeClass(_ctx.ns.be("button", "inner")),
      style: normalizeStyle(_ctx.isChecked ? _ctx.activeStyle : null)
    }, [
      renderSlot(_ctx.$slots, "default", {}, () => [
        createTextVNode(toDisplayString(_ctx.label), 1)
      ])
    ], 6)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 10, checkbox_button_hoisted_1);
}
var CheckboxButton = /* @__PURE__ */ _export_sfc(checkbox_button_sfc_main, [["render", checkbox_button_sfc_render]]);


//# sourceMappingURL=checkbox-button.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/checkbox/src/checkbox-group.mjs








const checkbox_group_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElCheckboxGroup",
  props: {
    modelValue: {
      type: Array,
      default: () => []
    },
    disabled: Boolean,
    min: {
      type: Number,
      default: void 0
    },
    max: {
      type: Number,
      default: void 0
    },
    size: {
      type: String,
      validator: isValidComponentSize
    },
    fill: {
      type: String,
      default: void 0
    },
    textColor: {
      type: String,
      default: void 0
    },
    tag: {
      type: String,
      default: "div"
    }
  },
  emits: [UPDATE_MODEL_EVENT, "change"],
  setup(props, { emit, slots }) {
    const { elFormItem } = useCheckboxGroup();
    const checkboxGroupSize = useSize();
    const ns = useNamespace("checkbox");
    const changeEvent = (value) => {
      emit(UPDATE_MODEL_EVENT, value);
      runtime_core_esm_bundler_nextTick(() => {
        emit("change", value);
      });
    };
    const modelValue = runtime_core_esm_bundler_computed({
      get() {
        return props.modelValue;
      },
      set(val) {
        changeEvent(val);
      }
    });
    runtime_core_esm_bundler_provide("CheckboxGroup", {
      name: "ElCheckboxGroup",
      modelValue,
      ...reactivity_esm_bundler_toRefs(props),
      checkboxGroupSize,
      changeEvent
    });
    runtime_core_esm_bundler_watch(() => props.modelValue, () => {
      var _a;
      (_a = elFormItem.validate) == null ? void 0 : _a.call(elFormItem, "change");
    });
    return () => {
      return h(props.tag, {
        class: ns.b("group"),
        role: "group",
        "aria-label": "checkbox-group"
      }, [renderSlot(slots, "default")]);
    };
  }
});


//# sourceMappingURL=checkbox-group.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/checkbox/index.mjs





const ElCheckbox = withInstall(Checkbox, {
  CheckboxButton: CheckboxButton,
  CheckboxGroup: checkbox_group_sfc_main
});
const ElCheckboxButton = withNoopInstall(CheckboxButton);
const ElCheckboxGroup = withNoopInstall(checkbox_group_sfc_main);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/arrow-up.mjs



const arrow_up_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ArrowUp"
});
const arrow_up_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const arrow_up_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M488.832 344.32l-339.84 356.672a32 32 0 000 44.16l.384.384a29.44 29.44 0 0042.688 0l320-335.872 319.872 335.872a29.44 29.44 0 0042.688 0l.384-.384a32 32 0 000-44.16L535.168 344.32a32 32 0 00-46.336 0z"
}, null, -1);
const arrow_up_hoisted_3 = [
  arrow_up_hoisted_2
];
function arrow_up_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", arrow_up_hoisted_1, arrow_up_hoisted_3);
}
var arrowUp = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(arrow_up_sfc_main, [["render", arrow_up_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/element-plus/es/directives/click-outside/index.mjs



const nodeList = /* @__PURE__ */ new Map();
let startClick;
if (shared_isClient) {
  dom_on(document, "mousedown", (e) => startClick = e);
  dom_on(document, "mouseup", (e) => {
    for (const handlers of nodeList.values()) {
      for (const { documentHandler } of handlers) {
        documentHandler(e, startClick);
      }
    }
  });
}
function createDocumentHandler(el, binding) {
  let excludes = [];
  if (Array.isArray(binding.arg)) {
    excludes = binding.arg;
  } else if (binding.arg instanceof HTMLElement) {
    excludes.push(binding.arg);
  }
  return function(mouseup, mousedown) {
    const popperRef = binding.instance.popperRef;
    const mouseUpTarget = mouseup.target;
    const mouseDownTarget = mousedown == null ? void 0 : mousedown.target;
    const isBound = !binding || !binding.instance;
    const isTargetExists = !mouseUpTarget || !mouseDownTarget;
    const isContainedByEl = el.contains(mouseUpTarget) || el.contains(mouseDownTarget);
    const isSelf = el === mouseUpTarget;
    const isTargetExcluded = excludes.length && excludes.some((item) => item == null ? void 0 : item.contains(mouseUpTarget)) || excludes.length && excludes.includes(mouseDownTarget);
    const isContainedByPopper = popperRef && (popperRef.contains(mouseUpTarget) || popperRef.contains(mouseDownTarget));
    if (isBound || isTargetExists || isContainedByEl || isSelf || isTargetExcluded || isContainedByPopper) {
      return;
    }
    binding.value(mouseup, mousedown);
  };
}
const ClickOutside = {
  beforeMount(el, binding) {
    if (!nodeList.has(el)) {
      nodeList.set(el, []);
    }
    nodeList.get(el).push({
      documentHandler: createDocumentHandler(el, binding),
      bindingFn: binding.value
    });
  },
  updated(el, binding) {
    if (!nodeList.has(el)) {
      nodeList.set(el, []);
    }
    const handlers = nodeList.get(el);
    const oldHandlerIndex = handlers.findIndex((item) => item.bindingFn === binding.oldValue);
    const newHandler = {
      documentHandler: createDocumentHandler(el, binding),
      bindingFn: binding.value
    };
    if (oldHandlerIndex >= 0) {
      handlers.splice(oldHandlerIndex, 1, newHandler);
    } else {
      handlers.push(newHandler);
    }
  },
  unmounted(el) {
    nodeList.delete(el);
  }
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/filter-panel.mjs













const { CheckboxGroup: filter_panel_ElCheckboxGroup } = ElCheckbox;
const filter_panel_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElTableFilterPanel",
  components: {
    ElCheckbox: ElCheckbox,
    ElCheckboxGroup: filter_panel_ElCheckboxGroup,
    ElScrollbar: ElScrollbar,
    ElTooltip: ElTooltip,
    ElIcon: ElIcon,
    ArrowDown: arrowDown,
    ArrowUp: arrowUp
  },
  directives: { ClickOutside: ClickOutside },
  props: {
    placement: {
      type: String,
      default: "bottom-start"
    },
    store: {
      type: Object
    },
    column: {
      type: Object
    },
    upDataColumn: {
      type: Function
    }
  },
  setup(props) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const { t } = useLocale();
    const ns = useNamespace("table-filter");
    const parent = instance == null ? void 0 : instance.parent;
    if (!parent.filterPanels.value[props.column.id]) {
      parent.filterPanels.value[props.column.id] = instance;
    }
    const tooltipVisible = reactivity_esm_bundler_ref(false);
    const tooltip = reactivity_esm_bundler_ref(null);
    const filters = runtime_core_esm_bundler_computed(() => {
      return props.column && props.column.filters;
    });
    const filterValue = runtime_core_esm_bundler_computed({
      get: () => {
        var _a;
        return (((_a = props.column) == null ? void 0 : _a.filteredValue) || [])[0];
      },
      set: (value) => {
        if (filteredValue.value) {
          if (typeof value !== "undefined" && value !== null) {
            filteredValue.value.splice(0, 1, value);
          } else {
            filteredValue.value.splice(0, 1);
          }
        }
      }
    });
    const filteredValue = runtime_core_esm_bundler_computed({
      get() {
        if (props.column) {
          return props.column.filteredValue || [];
        }
        return [];
      },
      set(value) {
        if (props.column) {
          props.upDataColumn("filteredValue", value);
        }
      }
    });
    const multiple = runtime_core_esm_bundler_computed(() => {
      if (props.column) {
        return props.column.filterMultiple;
      }
      return true;
    });
    const isActive = (filter) => {
      return filter.value === filterValue.value;
    };
    const hidden = () => {
      tooltipVisible.value = false;
    };
    const showFilterPanel = (e) => {
      e.stopPropagation();
      tooltipVisible.value = !tooltipVisible.value;
    };
    const hideFilterPanel = () => {
      tooltipVisible.value = false;
    };
    const handleConfirm = () => {
      confirmFilter(filteredValue.value);
      hidden();
    };
    const handleReset = () => {
      filteredValue.value = [];
      confirmFilter(filteredValue.value);
      hidden();
    };
    const handleSelect = (_filterValue) => {
      filterValue.value = _filterValue;
      if (typeof _filterValue !== "undefined" && _filterValue !== null) {
        confirmFilter(filteredValue.value);
      } else {
        confirmFilter([]);
      }
      hidden();
    };
    const confirmFilter = (filteredValue2) => {
      props.store.commit("filterChange", {
        column: props.column,
        values: filteredValue2
      });
      props.store.updateAllSelected();
    };
    runtime_core_esm_bundler_watch(tooltipVisible, (value) => {
      if (props.column) {
        props.upDataColumn("filterOpened", value);
      }
    }, {
      immediate: true
    });
    const popperPaneRef = runtime_core_esm_bundler_computed(() => {
      var _a, _b;
      return (_b = (_a = tooltip.value) == null ? void 0 : _a.popperRef) == null ? void 0 : _b.contentRef;
    });
    return {
      tooltipVisible,
      multiple,
      filteredValue,
      filterValue,
      filters,
      handleConfirm,
      handleReset,
      handleSelect,
      isActive,
      t,
      ns,
      showFilterPanel,
      hideFilterPanel,
      popperPaneRef,
      tooltip
    };
  }
});
const filter_panel_hoisted_1 = { key: 0 };
const filter_panel_hoisted_2 = ["disabled"];
const filter_panel_hoisted_3 = ["label", "onClick"];
function filter_panel_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_checkbox = resolveComponent("el-checkbox");
  const _component_el_checkbox_group = resolveComponent("el-checkbox-group");
  const _component_el_scrollbar = resolveComponent("el-scrollbar");
  const _component_arrow_up = resolveComponent("arrow-up");
  const _component_arrow_down = resolveComponent("arrow-down");
  const _component_el_icon = resolveComponent("el-icon");
  const _component_el_tooltip = resolveComponent("el-tooltip");
  const _directive_click_outside = resolveDirective("click-outside");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_tooltip, {
    ref: "tooltip",
    visible: _ctx.tooltipVisible,
    "onUpdate:visible": _cache[5] || (_cache[5] = ($event) => _ctx.tooltipVisible = $event),
    offset: 0,
    placement: _ctx.placement,
    "show-arrow": false,
    "stop-popper-mouse-event": false,
    "append-to-body": "",
    effect: "light",
    pure: "",
    "popper-class": _ctx.ns.b(),
    persistent: ""
  }, {
    content: withCtx(() => [
      _ctx.multiple ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", filter_panel_hoisted_1, [
        createBaseVNode("div", {
          class: normalizeClass(_ctx.ns.e("content"))
        }, [
          runtime_core_esm_bundler_createVNode(_component_el_scrollbar, {
            "wrap-class": _ctx.ns.e("wrap")
          }, {
            default: withCtx(() => [
              runtime_core_esm_bundler_createVNode(_component_el_checkbox_group, {
                modelValue: _ctx.filteredValue,
                "onUpdate:modelValue": _cache[0] || (_cache[0] = ($event) => _ctx.filteredValue = $event),
                class: normalizeClass(_ctx.ns.e("checkbox-group"))
              }, {
                default: withCtx(() => [
                  (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.filters, (filter) => {
                    return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_checkbox, {
                      key: filter.value,
                      label: filter.value
                    }, {
                      default: withCtx(() => [
                        createTextVNode(toDisplayString(filter.text), 1)
                      ]),
                      _: 2
                    }, 1032, ["label"]);
                  }), 128))
                ]),
                _: 1
              }, 8, ["modelValue", "class"])
            ]),
            _: 1
          }, 8, ["wrap-class"])
        ], 2),
        createBaseVNode("div", {
          class: normalizeClass(_ctx.ns.e("bottom"))
        }, [
          createBaseVNode("button", {
            class: normalizeClass({ [_ctx.ns.is("disabled")]: _ctx.filteredValue.length === 0 }),
            disabled: _ctx.filteredValue.length === 0,
            type: "button",
            onClick: _cache[1] || (_cache[1] = (...args) => _ctx.handleConfirm && _ctx.handleConfirm(...args))
          }, toDisplayString(_ctx.t("el.table.confirmFilter")), 11, filter_panel_hoisted_2),
          createBaseVNode("button", {
            type: "button",
            onClick: _cache[2] || (_cache[2] = (...args) => _ctx.handleReset && _ctx.handleReset(...args))
          }, toDisplayString(_ctx.t("el.table.resetFilter")), 1)
        ], 2)
      ])) : (runtime_core_esm_bundler_openBlock(), createElementBlock("ul", {
        key: 1,
        class: normalizeClass(_ctx.ns.e("list"))
      }, [
        createBaseVNode("li", {
          class: normalizeClass([
            _ctx.ns.e("list-item"),
            {
              [_ctx.ns.is("active")]: _ctx.filterValue === void 0 || _ctx.filterValue === null
            }
          ]),
          onClick: _cache[3] || (_cache[3] = ($event) => _ctx.handleSelect(null))
        }, toDisplayString(_ctx.t("el.table.clearFilter")), 3),
        (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.filters, (filter) => {
          return runtime_core_esm_bundler_openBlock(), createElementBlock("li", {
            key: filter.value,
            class: normalizeClass([_ctx.ns.e("list-item"), _ctx.ns.is("active", _ctx.isActive(filter))]),
            label: filter.value,
            onClick: ($event) => _ctx.handleSelect(filter.value)
          }, toDisplayString(filter.text), 11, filter_panel_hoisted_3);
        }), 128))
      ], 2))
    ]),
    default: withCtx(() => [
      withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
        class: normalizeClass([
          `${_ctx.ns.namespace.value}-table__column-filter-trigger`,
          `${_ctx.ns.namespace.value}-none-outline`
        ]),
        onClick: _cache[4] || (_cache[4] = (...args) => _ctx.showFilterPanel && _ctx.showFilterPanel(...args))
      }, [
        runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
          default: withCtx(() => [
            _ctx.column.filterOpened ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_arrow_up, { key: 0 })) : (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_arrow_down, { key: 1 }))
          ]),
          _: 1
        })
      ], 2)), [
        [_directive_click_outside, _ctx.hideFilterPanel, _ctx.popperPaneRef]
      ])
    ]),
    _: 1
  }, 8, ["visible", "placement", "popper-class"]);
}
var FilterPanel = /* @__PURE__ */ _export_sfc(filter_panel_sfc_main, [["render", filter_panel_sfc_render]]);


//# sourceMappingURL=filter-panel.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/layout-observer.mjs


function useLayoutObserver(root) {
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  onBeforeMount(() => {
    tableLayout.value.addObserver(instance);
  });
  runtime_core_esm_bundler_onMounted(() => {
    onColumnsChange(tableLayout.value);
    onScrollableChange(tableLayout.value);
  });
  runtime_core_esm_bundler_onUpdated(() => {
    onColumnsChange(tableLayout.value);
    onScrollableChange(tableLayout.value);
  });
  runtime_core_esm_bundler_onUnmounted(() => {
    tableLayout.value.removeObserver(instance);
  });
  const tableLayout = runtime_core_esm_bundler_computed(() => {
    const layout = root.layout;
    if (!layout) {
      throw new Error("Can not find table layout.");
    }
    return layout;
  });
  const onColumnsChange = (layout) => {
    var _a;
    const cols = ((_a = root.vnode.el) == null ? void 0 : _a.querySelectorAll("colgroup > col")) || [];
    if (!cols.length)
      return;
    const flattenColumns = layout.getFlattenColumns();
    const columnsMap = {};
    flattenColumns.forEach((column) => {
      columnsMap[column.id] = column;
    });
    for (let i = 0, j = cols.length; i < j; i++) {
      const col = cols[i];
      const name = col.getAttribute("name");
      const column = columnsMap[name];
      if (column) {
        col.setAttribute("width", column.realWidth || column.width);
      }
    }
  };
  const onScrollableChange = (layout) => {
    var _a, _b;
    const cols = ((_a = root.vnode.el) == null ? void 0 : _a.querySelectorAll("colgroup > col[name=gutter]")) || [];
    for (let i = 0, j = cols.length; i < j; i++) {
      const col = cols[i];
      col.setAttribute("width", layout.scrollY.value ? layout.gutterWidth : "0");
    }
    const ths = ((_b = root.vnode.el) == null ? void 0 : _b.querySelectorAll("th.gutter")) || [];
    for (let i = 0, j = ths.length; i < j; i++) {
      const th = ths[i];
      th.style.width = layout.scrollY.value ? `${layout.gutterWidth}px` : "0";
      th.style.display = layout.scrollY.value ? "" : "none";
    }
  };
  return {
    tableLayout: tableLayout.value,
    onColumnsChange,
    onScrollableChange
  };
}


//# sourceMappingURL=layout-observer.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/h-helper.mjs


function hColgroup(columns) {
  return h("colgroup", {}, [
    ...columns.map((column) => h("col", {
      name: column.id,
      key: column.id
    }))
  ]);
}


//# sourceMappingURL=h-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/tokens.mjs
const TABLE_INJECTION_KEY = Symbol("ElTable");


//# sourceMappingURL=tokens.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-header/event-helper.mjs





function event_helper_useEvent(props, emit) {
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
  const handleFilterClick = (event) => {
    event.stopPropagation();
    return;
  };
  const handleHeaderClick = (event, column) => {
    if (!column.filters && column.sortable) {
      handleSortClick(event, column, false);
    } else if (column.filterable && !column.sortable) {
      handleFilterClick(event);
    }
    parent == null ? void 0 : parent.emit("header-click", column, event);
  };
  const handleHeaderContextMenu = (event, column) => {
    parent == null ? void 0 : parent.emit("header-contextmenu", column, event);
  };
  const draggingColumn = reactivity_esm_bundler_ref(null);
  const dragging = reactivity_esm_bundler_ref(false);
  const dragState = reactivity_esm_bundler_ref({});
  const handleMouseDown = (event, column) => {
    if (!shared_isClient)
      return;
    if (column.children && column.children.length > 0)
      return;
    if (draggingColumn.value && props.border) {
      dragging.value = true;
      const table = parent;
      emit("set-drag-visible", true);
      const tableEl = table == null ? void 0 : table.vnode.el;
      const tableLeft = tableEl.getBoundingClientRect().left;
      const columnEl = instance.vnode.el.querySelector(`th.${column.id}`);
      const columnRect = columnEl.getBoundingClientRect();
      const minLeft = columnRect.left - tableLeft + 30;
      dom_addClass(columnEl, "noclick");
      dragState.value = {
        startMouseLeft: event.clientX,
        startLeft: columnRect.right - tableLeft,
        startColumnLeft: columnRect.left - tableLeft,
        tableLeft
      };
      const resizeProxy = table == null ? void 0 : table.refs.resizeProxy;
      resizeProxy.style.left = `${dragState.value.startLeft}px`;
      document.onselectstart = function() {
        return false;
      };
      document.ondragstart = function() {
        return false;
      };
      const handleMouseMove2 = (event2) => {
        const deltaLeft = event2.clientX - dragState.value.startMouseLeft;
        const proxyLeft = dragState.value.startLeft + deltaLeft;
        resizeProxy.style.left = `${Math.max(minLeft, proxyLeft)}px`;
      };
      const handleMouseUp = () => {
        if (dragging.value) {
          const { startColumnLeft, startLeft } = dragState.value;
          const finalLeft = parseInt(resizeProxy.style.left, 10);
          const columnWidth = finalLeft - startColumnLeft;
          column.width = column.realWidth = columnWidth;
          table == null ? void 0 : table.emit("header-dragend", column.width, startLeft - startColumnLeft, column, event);
          requestAnimationFrame(() => {
            props.store.scheduleLayout(false, true);
          });
          document.body.style.cursor = "";
          dragging.value = false;
          draggingColumn.value = null;
          dragState.value = {};
          emit("set-drag-visible", false);
        }
        document.removeEventListener("mousemove", handleMouseMove2);
        document.removeEventListener("mouseup", handleMouseUp);
        document.onselectstart = null;
        document.ondragstart = null;
        setTimeout(function() {
          removeClass(columnEl, "noclick");
        }, 0);
      };
      document.addEventListener("mousemove", handleMouseMove2);
      document.addEventListener("mouseup", handleMouseUp);
    }
  };
  const handleMouseMove = (event, column) => {
    if (column.children && column.children.length > 0)
      return;
    let target = event.target;
    while (target && target.tagName !== "TH") {
      target = target.parentNode;
    }
    if (!column || !column.resizable)
      return;
    if (!dragging.value && props.border) {
      const rect = target.getBoundingClientRect();
      const bodyStyle = document.body.style;
      if (rect.width > 12 && rect.right - event.pageX < 8) {
        bodyStyle.cursor = "col-resize";
        if (hasClass(target, "is-sortable")) {
          target.style.cursor = "col-resize";
        }
        draggingColumn.value = column;
      } else if (!dragging.value) {
        bodyStyle.cursor = "";
        if (hasClass(target, "is-sortable")) {
          target.style.cursor = "pointer";
        }
        draggingColumn.value = null;
      }
    }
  };
  const handleMouseOut = () => {
    if (!shared_isClient)
      return;
    document.body.style.cursor = "";
  };
  const toggleOrder = ({ order, sortOrders }) => {
    if (order === "")
      return sortOrders[0];
    const index = sortOrders.indexOf(order || null);
    return sortOrders[index > sortOrders.length - 2 ? 0 : index + 1];
  };
  const handleSortClick = (event, column, givenOrder) => {
    event.stopPropagation();
    const order = column.order === givenOrder ? null : givenOrder || toggleOrder(column);
    let target = event.target;
    while (target && target.tagName !== "TH") {
      target = target.parentNode;
    }
    if (target && target.tagName === "TH") {
      if (hasClass(target, "noclick")) {
        removeClass(target, "noclick");
        return;
      }
    }
    if (!column.sortable)
      return;
    const states = props.store.states;
    let sortProp = states.sortProp.value;
    let sortOrder;
    const sortingColumn = states.sortingColumn.value;
    if (sortingColumn !== column || sortingColumn === column && sortingColumn.order === null) {
      if (sortingColumn) {
        sortingColumn.order = null;
      }
      states.sortingColumn.value = column;
      sortProp = column.property;
    }
    if (!order) {
      sortOrder = column.order = null;
    } else {
      sortOrder = column.order = order;
    }
    states.sortProp.value = sortProp;
    states.sortOrder.value = sortOrder;
    parent == null ? void 0 : parent.store.commit("changeSortCondition");
  };
  return {
    handleHeaderClick,
    handleHeaderContextMenu,
    handleMouseDown,
    handleMouseMove,
    handleMouseOut,
    handleSortClick,
    handleFilterClick
  };
}


//# sourceMappingURL=event-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-header/style.helper.mjs






function useStyle(props) {
  const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
  const ns = useNamespace("table");
  const getHeaderRowStyle = (rowIndex) => {
    const headerRowStyle = parent == null ? void 0 : parent.props.headerRowStyle;
    if (typeof headerRowStyle === "function") {
      return headerRowStyle.call(null, { rowIndex });
    }
    return headerRowStyle;
  };
  const getHeaderRowClass = (rowIndex) => {
    const classes = [];
    const headerRowClassName = parent == null ? void 0 : parent.props.headerRowClassName;
    if (typeof headerRowClassName === "string") {
      classes.push(headerRowClassName);
    } else if (typeof headerRowClassName === "function") {
      classes.push(headerRowClassName.call(null, { rowIndex }));
    }
    return classes.join(" ");
  };
  const getHeaderCellStyle = (rowIndex, columnIndex, row, column) => {
    var _a;
    let headerCellStyles = (_a = parent == null ? void 0 : parent.props.headerCellStyle) != null ? _a : {};
    if (typeof headerCellStyles === "function") {
      headerCellStyles = headerCellStyles.call(null, {
        rowIndex,
        columnIndex,
        row,
        column
      });
    }
    const fixedStyle = getFixedColumnOffset(columnIndex, column.fixed, props.store, row);
    ensurePosition(fixedStyle, "left");
    ensurePosition(fixedStyle, "right");
    return Object.assign({}, headerCellStyles, fixedStyle);
  };
  const getHeaderCellClass = (rowIndex, columnIndex, row, column) => {
    const fixedClasses = column.isSubColumn ? [] : getFixedColumnsClass(ns.b(), columnIndex, column.fixed, props.store, row);
    const classes = [
      column.id,
      column.order,
      column.headerAlign,
      column.className,
      column.labelClassName,
      ...fixedClasses
    ];
    if (!column.children) {
      classes.push("is-leaf");
    }
    if (column.sortable) {
      classes.push("is-sortable");
    }
    const headerCellClassName = parent == null ? void 0 : parent.props.headerCellClassName;
    if (typeof headerCellClassName === "string") {
      classes.push(headerCellClassName);
    } else if (typeof headerCellClassName === "function") {
      classes.push(headerCellClassName.call(null, {
        rowIndex,
        columnIndex,
        row,
        column
      }));
    }
    classes.push(ns.e("cell"));
    return classes.join(" ");
  };
  return {
    getHeaderRowStyle,
    getHeaderRowClass,
    getHeaderCellStyle,
    getHeaderCellClass
  };
}


//# sourceMappingURL=style.helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-header/utils-helper.mjs



const getAllColumns = (columns) => {
  const result = [];
  columns.forEach((column) => {
    if (column.children) {
      result.push(column);
      result.push.apply(result, getAllColumns(column.children));
    } else {
      result.push(column);
    }
  });
  return result;
};
const convertToRows = (originColumns) => {
  let maxLevel = 1;
  const traverse = (column, parent) => {
    if (parent) {
      column.level = parent.level + 1;
      if (maxLevel < column.level) {
        maxLevel = column.level;
      }
    }
    if (column.children) {
      let colSpan = 0;
      column.children.forEach((subColumn) => {
        traverse(subColumn, column);
        colSpan += subColumn.colSpan;
      });
      column.colSpan = colSpan;
    } else {
      column.colSpan = 1;
    }
  };
  originColumns.forEach((column) => {
    column.level = 1;
    traverse(column, void 0);
  });
  const rows = [];
  for (let i = 0; i < maxLevel; i++) {
    rows.push([]);
  }
  const allColumns = getAllColumns(originColumns);
  allColumns.forEach((column) => {
    if (!column.children) {
      column.rowSpan = maxLevel - column.level + 1;
    } else {
      column.rowSpan = 1;
      column.children.forEach((col) => col.isSubColumn = true);
    }
    rows[column.level - 1].push(column);
  });
  return rows;
};
function useUtils(props) {
  const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
  const columnRows = runtime_core_esm_bundler_computed(() => {
    return convertToRows(props.store.states.originColumns.value);
  });
  const isGroup = runtime_core_esm_bundler_computed(() => {
    const result = columnRows.value.length > 1;
    if (result && parent) {
      parent.state.isGroup.value = true;
    }
    return result;
  });
  const toggleAllSelection = (event) => {
    event.stopPropagation();
    parent == null ? void 0 : parent.store.commit("toggleAllSelection");
  };
  return {
    isGroup,
    toggleAllSelection,
    columnRows
  };
}


//# sourceMappingURL=utils-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-header/index.mjs












var TableHeader = runtime_core_esm_bundler_defineComponent({
  name: "ElTableHeader",
  components: {
    ElCheckbox: ElCheckbox
  },
  props: {
    fixed: {
      type: String,
      default: ""
    },
    store: {
      required: true,
      type: Object
    },
    border: Boolean,
    defaultSort: {
      type: Object,
      default: () => {
        return {
          prop: "",
          order: ""
        };
      }
    }
  },
  setup(props, { emit }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
    const ns = useNamespace("table");
    const storeData = parent == null ? void 0 : parent.store.states;
    const filterPanels = reactivity_esm_bundler_ref({});
    const { onColumnsChange, onScrollableChange } = useLayoutObserver(parent);
    runtime_core_esm_bundler_onMounted(() => {
      runtime_core_esm_bundler_nextTick(() => {
        const { prop, order } = props.defaultSort;
        const init = true;
        parent == null ? void 0 : parent.store.commit("sort", { prop, order, init });
      });
    });
    const {
      handleHeaderClick,
      handleHeaderContextMenu,
      handleMouseDown,
      handleMouseMove,
      handleMouseOut,
      handleSortClick,
      handleFilterClick
    } = event_helper_useEvent(props, emit);
    const {
      getHeaderRowStyle,
      getHeaderRowClass,
      getHeaderCellStyle,
      getHeaderCellClass
    } = useStyle(props);
    const { isGroup, toggleAllSelection, columnRows } = useUtils(props);
    instance.state = {
      onColumnsChange,
      onScrollableChange
    };
    instance.filterPanels = filterPanels;
    return {
      ns,
      columns: storeData.columns,
      filterPanels,
      onColumnsChange,
      onScrollableChange,
      columnRows,
      getHeaderRowClass,
      getHeaderRowStyle,
      getHeaderCellClass,
      getHeaderCellStyle,
      handleHeaderClick,
      handleHeaderContextMenu,
      handleMouseDown,
      handleMouseMove,
      handleMouseOut,
      handleSortClick,
      handleFilterClick,
      isGroup,
      toggleAllSelection
    };
  },
  render() {
    const {
      ns,
      columns,
      isGroup,
      columnRows,
      getHeaderCellStyle,
      getHeaderCellClass,
      getHeaderRowClass,
      getHeaderRowStyle,
      handleHeaderClick,
      handleHeaderContextMenu,
      handleMouseDown,
      handleMouseMove,
      handleSortClick,
      handleMouseOut,
      store,
      $parent
    } = this;
    let rowSpan = 1;
    return h("table", {
      border: "0",
      cellpadding: "0",
      cellspacing: "0",
      class: ns.e("header")
    }, [
      hColgroup(columns),
      h("thead", {
        class: { [ns.is("group")]: isGroup }
      }, columnRows.map((subColumns, rowIndex) => h("tr", {
        class: getHeaderRowClass(rowIndex),
        key: rowIndex,
        style: getHeaderRowStyle(rowIndex)
      }, subColumns.map((column, cellIndex) => {
        if (column.rowSpan > rowSpan) {
          rowSpan = column.rowSpan;
        }
        return h("th", {
          class: getHeaderCellClass(rowIndex, cellIndex, subColumns, column),
          colspan: column.colSpan,
          key: `${column.id}-thead`,
          rowSpan: column.rowSpan,
          style: getHeaderCellStyle(rowIndex, cellIndex, subColumns, column),
          onClick: ($event) => handleHeaderClick($event, column),
          onContextmenu: ($event) => handleHeaderContextMenu($event, column),
          onMousedown: ($event) => handleMouseDown($event, column),
          onMousemove: ($event) => handleMouseMove($event, column),
          onMouseout: handleMouseOut
        }, [
          h("div", {
            class: [
              "cell",
              column.filteredValue && column.filteredValue.length > 0 ? "highlight" : "",
              column.labelClassName
            ]
          }, [
            column.renderHeader ? column.renderHeader({
              column,
              $index: cellIndex,
              store,
              _self: $parent
            }) : column.label,
            column.sortable && h("span", {
              onClick: ($event) => handleSortClick($event, column),
              class: "caret-wrapper"
            }, [
              h("i", {
                onClick: ($event) => handleSortClick($event, column, "ascending"),
                class: "sort-caret ascending"
              }),
              h("i", {
                onClick: ($event) => handleSortClick($event, column, "descending"),
                class: "sort-caret descending"
              })
            ]),
            column.filterable && h(FilterPanel, {
              store: $parent.store,
              placement: column.filterPlacement || "bottom-start",
              column,
              upDataColumn: (key, value) => {
                column[key] = value;
              }
            })
          ])
        ]);
      }))))
    ]);
  }
});


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-body/events-helper.mjs






function useEvents(props) {
  const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
  const tooltipContent = reactivity_esm_bundler_ref("");
  const tooltipTrigger = reactivity_esm_bundler_ref(h("div"));
  const handleEvent = (event, row, name) => {
    var _a;
    const table = parent;
    const cell = getCell(event);
    let column;
    const namespace = (_a = table == null ? void 0 : table.vnode.el) == null ? void 0 : _a.dataset.prefix;
    if (cell) {
      column = getColumnByCell({
        columns: props.store.states.columns.value
      }, cell, namespace);
      if (column) {
        table == null ? void 0 : table.emit(`cell-${name}`, row, column, cell, event);
      }
    }
    table == null ? void 0 : table.emit(`row-${name}`, row, column, event);
  };
  const handleDoubleClick = (event, row) => {
    handleEvent(event, row, "dblclick");
  };
  const handleClick = (event, row) => {
    props.store.commit("setCurrentRow", row);
    handleEvent(event, row, "click");
  };
  const handleContextMenu = (event, row) => {
    handleEvent(event, row, "contextmenu");
  };
  const handleMouseEnter = lodash_debounce(function(index) {
    props.store.commit("setHoverRow", index);
  }, 30);
  const handleMouseLeave = lodash_debounce(function() {
    props.store.commit("setHoverRow", null);
  }, 30);
  const handleCellMouseEnter = (event, row) => {
    var _a;
    const table = parent;
    const cell = getCell(event);
    const namespace = (_a = table == null ? void 0 : table.vnode.el) == null ? void 0 : _a.dataset.prefix;
    if (cell) {
      const column = getColumnByCell({
        columns: props.store.states.columns.value
      }, cell, namespace);
      const hoverState = table.hoverState = { cell, column, row };
      table == null ? void 0 : table.emit("cell-mouse-enter", hoverState.row, hoverState.column, hoverState.cell, event);
    }
    const cellChild = event.target.querySelector(".cell");
    if (!(hasClass(cellChild, `${namespace}-tooltip`) && cellChild.childNodes.length)) {
      return;
    }
    const range = document.createRange();
    range.setStart(cellChild, 0);
    range.setEnd(cellChild, cellChild.childNodes.length);
    const rangeWidth = range.getBoundingClientRect().width;
    const padding = (parseInt(getStyle(cellChild, "paddingLeft"), 10) || 0) + (parseInt(getStyle(cellChild, "paddingRight"), 10) || 0);
    if (rangeWidth + padding > cellChild.offsetWidth || cellChild.scrollWidth > cellChild.offsetWidth) {
      createTablePopper(cell, cell.innerText || cell.textContent, {
        placement: "top",
        strategy: "fixed"
      }, row.tooltipEffect);
    }
  };
  const handleCellMouseLeave = (event) => {
    const cell = getCell(event);
    if (!cell)
      return;
    const oldHoverState = parent == null ? void 0 : parent.hoverState;
    parent == null ? void 0 : parent.emit("cell-mouse-leave", oldHoverState == null ? void 0 : oldHoverState.row, oldHoverState == null ? void 0 : oldHoverState.column, oldHoverState == null ? void 0 : oldHoverState.cell, event);
  };
  return {
    handleDoubleClick,
    handleClick,
    handleContextMenu,
    handleMouseEnter,
    handleMouseLeave,
    handleCellMouseEnter,
    handleCellMouseLeave,
    tooltipContent,
    tooltipTrigger
  };
}


//# sourceMappingURL=events-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-body/styles-helper.mjs






function useStyles(props) {
  const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
  const ns = useNamespace("table");
  const getRowStyle = (row, rowIndex) => {
    const rowStyle = parent == null ? void 0 : parent.props.rowStyle;
    if (typeof rowStyle === "function") {
      return rowStyle.call(null, {
        row,
        rowIndex
      });
    }
    return rowStyle || null;
  };
  const getRowClass = (row, rowIndex) => {
    const classes = [ns.e("row")];
    if ((parent == null ? void 0 : parent.props.highlightCurrentRow) && row === props.store.states.currentRow.value) {
      classes.push("current-row");
    }
    if (props.stripe && rowIndex % 2 === 1) {
      classes.push(ns.em("row", "striped"));
    }
    const rowClassName = parent == null ? void 0 : parent.props.rowClassName;
    if (typeof rowClassName === "string") {
      classes.push(rowClassName);
    } else if (typeof rowClassName === "function") {
      classes.push(rowClassName.call(null, {
        row,
        rowIndex
      }));
    }
    if (props.store.states.expandRows.value.indexOf(row) > -1) {
      classes.push("expanded");
    }
    return classes;
  };
  const getCellStyle = (rowIndex, columnIndex, row, column) => {
    const cellStyle = parent == null ? void 0 : parent.props.cellStyle;
    let cellStyles = cellStyle != null ? cellStyle : {};
    if (typeof cellStyle === "function") {
      cellStyles = cellStyle.call(null, {
        rowIndex,
        columnIndex,
        row,
        column
      });
    }
    const fixedStyle = getFixedColumnOffset(columnIndex, props == null ? void 0 : props.fixed, props.store);
    ensurePosition(fixedStyle, "left");
    ensurePosition(fixedStyle, "right");
    return Object.assign({}, cellStyles, fixedStyle);
  };
  const getCellClass = (rowIndex, columnIndex, row, column) => {
    const fixedClasses = column.isSubColumn ? [] : getFixedColumnsClass(ns.b(), columnIndex, props == null ? void 0 : props.fixed, props.store);
    const classes = [column.id, column.align, column.className, ...fixedClasses];
    const cellClassName = parent == null ? void 0 : parent.props.cellClassName;
    if (typeof cellClassName === "string") {
      classes.push(cellClassName);
    } else if (typeof cellClassName === "function") {
      classes.push(cellClassName.call(null, {
        rowIndex,
        columnIndex,
        row,
        column
      }));
    }
    classes.push(ns.e("cell"));
    return classes.join(" ");
  };
  const getSpan = (row, column, rowIndex, columnIndex) => {
    let rowspan = 1;
    let colspan = 1;
    const fn = parent == null ? void 0 : parent.props.spanMethod;
    if (typeof fn === "function") {
      const result = fn({
        row,
        column,
        rowIndex,
        columnIndex
      });
      if (Array.isArray(result)) {
        rowspan = result[0];
        colspan = result[1];
      } else if (typeof result === "object") {
        rowspan = result.rowspan;
        colspan = result.colspan;
      }
    }
    return { rowspan, colspan };
  };
  const getColspanRealWidth = (columns, colspan, index) => {
    if (colspan < 1) {
      return columns[index].realWidth;
    }
    const widthArr = columns.map(({ realWidth, width }) => realWidth || width).slice(index, index + colspan);
    return Number(widthArr.reduce((acc, width) => Number(acc) + Number(width), -1));
  };
  return {
    getRowStyle,
    getRowClass,
    getCellStyle,
    getCellClass,
    getSpan,
    getColspanRealWidth
  };
}


//# sourceMappingURL=styles-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-body/render-helper.mjs






function useRender(props) {
  const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
  const {
    handleDoubleClick,
    handleClick,
    handleContextMenu,
    handleMouseEnter,
    handleMouseLeave,
    handleCellMouseEnter,
    handleCellMouseLeave,
    tooltipContent,
    tooltipTrigger
  } = useEvents(props);
  const {
    getRowStyle,
    getRowClass,
    getCellStyle,
    getCellClass,
    getSpan,
    getColspanRealWidth
  } = useStyles(props);
  const firstDefaultColumnIndex = runtime_core_esm_bundler_computed(() => {
    return props.store.states.columns.value.findIndex(({ type }) => type === "default");
  });
  const getKeyOfRow = (row, index) => {
    const rowKey = parent.props.rowKey;
    if (rowKey) {
      return getRowIdentity(row, rowKey);
    }
    return index;
  };
  const rowRender = (row, $index, treeRowData) => {
    const { tooltipEffect, store } = props;
    const { indent, columns } = store.states;
    const rowClasses = getRowClass(row, $index);
    let display = true;
    if (treeRowData) {
      rowClasses.push(`el-table__row--level-${treeRowData.level}`);
      display = treeRowData.display;
    }
    const displayStyle = display ? null : {
      display: "none"
    };
    return h("tr", {
      style: [displayStyle, getRowStyle(row, $index)],
      class: rowClasses,
      key: getKeyOfRow(row, $index),
      onDblclick: ($event) => handleDoubleClick($event, row),
      onClick: ($event) => handleClick($event, row),
      onContextmenu: ($event) => handleContextMenu($event, row),
      onMouseenter: () => handleMouseEnter($index),
      onMouseleave: handleMouseLeave
    }, columns.value.map((column, cellIndex) => {
      const { rowspan, colspan } = getSpan(row, column, $index, cellIndex);
      if (!rowspan || !colspan) {
        return null;
      }
      const columnData = { ...column };
      columnData.realWidth = getColspanRealWidth(columns.value, colspan, cellIndex);
      const data = {
        store: props.store,
        _self: props.context || parent,
        column: columnData,
        row,
        $index
      };
      if (cellIndex === firstDefaultColumnIndex.value && treeRowData) {
        data.treeNode = {
          indent: treeRowData.level * indent.value,
          level: treeRowData.level
        };
        if (typeof treeRowData.expanded === "boolean") {
          data.treeNode.expanded = treeRowData.expanded;
          if ("loading" in treeRowData) {
            data.treeNode.loading = treeRowData.loading;
          }
          if ("noLazyChildren" in treeRowData) {
            data.treeNode.noLazyChildren = treeRowData.noLazyChildren;
          }
        }
      }
      const baseKey = `${$index},${cellIndex}`;
      const patchKey = columnData.columnKey || columnData.rawColumnKey || "";
      const tdChildren = cellChildren(cellIndex, column, data);
      return h("td", {
        style: getCellStyle($index, cellIndex, row, column),
        class: getCellClass($index, cellIndex, row, column),
        key: `${patchKey}${baseKey}`,
        rowspan,
        colspan,
        onMouseenter: ($event) => handleCellMouseEnter($event, { ...row, tooltipEffect }),
        onMouseleave: handleCellMouseLeave
      }, [tdChildren]);
    }));
  };
  const cellChildren = (cellIndex, column, data) => {
    return column.renderCell(data);
  };
  const wrappedRowRender = (row, $index) => {
    const store = props.store;
    const { isRowExpanded, assertRowKey } = store;
    const { treeData, lazyTreeNodeMap, childrenColumnName, rowKey } = store.states;
    const hasExpandColumn = store.states.columns.value.some(({ type }) => type === "expand");
    if (hasExpandColumn && isRowExpanded(row)) {
      const renderExpanded = parent.renderExpanded;
      const tr = rowRender(row, $index, void 0);
      if (!renderExpanded) {
        console.error("[Element Error]renderExpanded is required.");
        return tr;
      }
      return [
        [
          tr,
          h("tr", {
            key: `expanded-row__${tr.key}`
          }, [
            h("td", {
              colspan: store.states.columns.value.length,
              class: "el-table__cell el-table__expanded-cell"
            }, [renderExpanded({ row, $index, store })])
          ])
        ]
      ];
    } else if (Object.keys(treeData.value).length) {
      assertRowKey();
      const key = getRowIdentity(row, rowKey.value);
      let cur = treeData.value[key];
      let treeRowData = null;
      if (cur) {
        treeRowData = {
          expanded: cur.expanded,
          level: cur.level,
          display: true
        };
        if (typeof cur.lazy === "boolean") {
          if (typeof cur.loaded === "boolean" && cur.loaded) {
            treeRowData.noLazyChildren = !(cur.children && cur.children.length);
          }
          treeRowData.loading = cur.loading;
        }
      }
      const tmp = [rowRender(row, $index, treeRowData)];
      if (cur) {
        let i = 0;
        const traverse = (children, parent2) => {
          if (!(children && children.length && parent2))
            return;
          children.forEach((node) => {
            const innerTreeRowData = {
              display: parent2.display && parent2.expanded,
              level: parent2.level + 1,
              expanded: false,
              noLazyChildren: false,
              loading: false
            };
            const childKey = getRowIdentity(node, rowKey.value);
            if (childKey === void 0 || childKey === null) {
              throw new Error("For nested data item, row-key is required.");
            }
            cur = { ...treeData.value[childKey] };
            if (cur) {
              innerTreeRowData.expanded = cur.expanded;
              cur.level = cur.level || innerTreeRowData.level;
              cur.display = !!(cur.expanded && innerTreeRowData.display);
              if (typeof cur.lazy === "boolean") {
                if (typeof cur.loaded === "boolean" && cur.loaded) {
                  innerTreeRowData.noLazyChildren = !(cur.children && cur.children.length);
                }
                innerTreeRowData.loading = cur.loading;
              }
            }
            i++;
            tmp.push(rowRender(node, $index + i, innerTreeRowData));
            if (cur) {
              const nodes2 = lazyTreeNodeMap.value[childKey] || node[childrenColumnName.value];
              traverse(nodes2, cur);
            }
          });
        };
        cur.display = true;
        const nodes = lazyTreeNodeMap.value[key] || row[childrenColumnName.value];
        traverse(nodes, cur);
      }
      return tmp;
    } else {
      return rowRender(row, $index, void 0);
    }
  };
  return {
    wrappedRowRender,
    tooltipContent,
    tooltipTrigger
  };
}


//# sourceMappingURL=render-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-body/defaults.mjs
const defaultProps = {
  store: {
    required: true,
    type: Object
  },
  stripe: Boolean,
  tooltipEffect: String,
  context: {
    default: () => ({}),
    type: Object
  },
  rowClassName: [String, Function],
  rowStyle: [Object, Function],
  fixed: {
    type: String,
    default: ""
  },
  highlight: Boolean
};


//# sourceMappingURL=defaults.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-body/index.mjs












var TableBody = runtime_core_esm_bundler_defineComponent({
  name: "ElTableBody",
  props: defaultProps,
  setup(props) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const parent = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
    const ns = useNamespace("table");
    const { wrappedRowRender, tooltipContent, tooltipTrigger } = useRender(props);
    const { onColumnsChange, onScrollableChange } = useLayoutObserver(parent);
    runtime_core_esm_bundler_watch(props.store.states.hoverRow, (newVal, oldVal) => {
      if (!props.store.states.isComplex.value || !shared_isClient)
        return;
      let raf = window.requestAnimationFrame;
      if (!raf) {
        raf = (fn) => window.setTimeout(fn, 16);
      }
      raf(() => {
        var _a;
        const rows = (_a = instance == null ? void 0 : instance.vnode.el) == null ? void 0 : _a.querySelectorAll(`.${ns.e("row")}`);
        const oldRow = rows[oldVal];
        const newRow = rows[newVal];
        if (oldRow) {
          removeClass(oldRow, "hover-row");
        }
        if (newRow) {
          dom_addClass(newRow, "hover-row");
        }
      });
    });
    runtime_core_esm_bundler_onUnmounted(() => {
      var _a;
      (_a = removePopper) == null ? void 0 : _a();
    });
    runtime_core_esm_bundler_onUpdated(() => {
      var _a;
      (_a = removePopper) == null ? void 0 : _a();
    });
    return {
      ns,
      onColumnsChange,
      onScrollableChange,
      wrappedRowRender,
      tooltipContent,
      tooltipTrigger
    };
  },
  render() {
    const { ns, wrappedRowRender, store } = this;
    const data = store.states.data.value || [];
    const columns = store.states.columns.value;
    return h("table", {
      class: ns.e("body"),
      cellspacing: "0",
      cellpadding: "0",
      border: "0"
    }, [
      hColgroup(columns),
      h("tbody", {}, [
        data.reduce((acc, row) => {
          return acc.concat(wrappedRowRender(row, acc.length));
        }, [])
      ])
    ]);
  }
});


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-footer/mapState-helper.mjs



function useMapState() {
  const table = runtime_core_esm_bundler_inject(TABLE_INJECTION_KEY);
  const store = table == null ? void 0 : table.store;
  const leftFixedLeafCount = runtime_core_esm_bundler_computed(() => {
    return store.states.fixedLeafColumnsLength.value;
  });
  const rightFixedLeafCount = runtime_core_esm_bundler_computed(() => {
    return store.states.rightFixedColumns.value.length;
  });
  const columnsCount = runtime_core_esm_bundler_computed(() => {
    return store.states.columns.value.length;
  });
  const leftFixedCount = runtime_core_esm_bundler_computed(() => {
    return store.states.fixedColumns.value.length;
  });
  const rightFixedCount = runtime_core_esm_bundler_computed(() => {
    return store.states.rightFixedColumns.value.length;
  });
  return {
    leftFixedLeafCount,
    rightFixedLeafCount,
    columnsCount,
    leftFixedCount,
    rightFixedCount,
    columns: store.states.columns
  };
}


//# sourceMappingURL=mapState-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-footer/style-helper.mjs





function style_helper_useStyle(props) {
  const { columns } = useMapState();
  const ns = useNamespace("table");
  const getCellClasses = (columns2, cellIndex) => {
    const column = columns2[cellIndex];
    const classes = [
      ns.e("cell"),
      column.id,
      column.align,
      column.labelClassName,
      ...getFixedColumnsClass(ns.b(), cellIndex, column.fixed, props.store)
    ];
    if (column.className) {
      classes.push(column.className);
    }
    if (!column.children) {
      classes.push(ns.is("leaf"));
    }
    return classes;
  };
  const getCellStyles = (column, cellIndex) => {
    const fixedStyle = getFixedColumnOffset(cellIndex, column.fixed, props.store);
    ensurePosition(fixedStyle, "left");
    ensurePosition(fixedStyle, "right");
    return fixedStyle;
  };
  return {
    getCellClasses,
    getCellStyles,
    columns
  };
}


//# sourceMappingURL=style-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-footer/index.mjs






var TableFooter = runtime_core_esm_bundler_defineComponent({
  name: "ElTableFooter",
  props: {
    fixed: {
      type: String,
      default: ""
    },
    store: {
      required: true,
      type: Object
    },
    summaryMethod: Function,
    sumText: String,
    border: Boolean,
    defaultSort: {
      type: Object,
      default: () => {
        return {
          prop: "",
          order: ""
        };
      }
    }
  },
  setup(props) {
    const { getCellClasses, getCellStyles, columns } = style_helper_useStyle(props);
    const ns = useNamespace("table");
    return {
      ns,
      getCellClasses,
      getCellStyles,
      columns
    };
  },
  render() {
    const {
      columns,
      getCellStyles,
      getCellClasses,
      summaryMethod,
      sumText,
      ns
    } = this;
    const data = this.store.states.data.value;
    let sums = [];
    if (summaryMethod) {
      sums = summaryMethod({
        columns,
        data
      });
    } else {
      columns.forEach((column, index) => {
        if (index === 0) {
          sums[index] = sumText;
          return;
        }
        const values = data.map((item) => Number(item[column.property]));
        const precisions = [];
        let notNumber = true;
        values.forEach((value) => {
          if (!isNaN(value)) {
            notNumber = false;
            const decimal = `${value}`.split(".")[1];
            precisions.push(decimal ? decimal.length : 0);
          }
        });
        const precision = Math.max.apply(null, precisions);
        if (!notNumber) {
          sums[index] = values.reduce((prev, curr) => {
            const value = Number(curr);
            if (!isNaN(value)) {
              return parseFloat((prev + curr).toFixed(Math.min(precision, 20)));
            } else {
              return prev;
            }
          }, 0);
        } else {
          sums[index] = "";
        }
      });
    }
    return h("table", {
      class: ns.e("footer"),
      cellspacing: "0",
      cellpadding: "0",
      border: "0"
    }, [
      hColgroup(columns),
      h("tbody", [
        h("tr", {}, [
          ...columns.map((column, cellIndex) => h("td", {
            key: cellIndex,
            colspan: column.colSpan,
            rowspan: column.rowSpan,
            class: getCellClasses(columns, cellIndex),
            style: getCellStyles(column, cellIndex)
          }, [
            h("div", {
              class: ["cell", column.labelClassName]
            }, [sums[cellIndex]])
          ]))
        ])
      ])
    ]);
  }
});


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table/utils-helper.mjs
function utils_helper_useUtils(store) {
  const setCurrentRow = (row) => {
    store.commit("setCurrentRow", row);
  };
  const toggleRowSelection = (row, selected) => {
    store.toggleRowSelection(row, selected, false);
    store.updateAllSelected();
  };
  const clearSelection = () => {
    store.clearSelection();
  };
  const clearFilter = (columnKeys) => {
    store.clearFilter(columnKeys);
  };
  const toggleAllSelection = () => {
    store.commit("toggleAllSelection");
  };
  const toggleRowExpansion = (row, expanded) => {
    store.toggleRowExpansionAdapter(row, expanded);
  };
  const clearSort = () => {
    store.clearSort();
  };
  const sort = (prop, order) => {
    store.commit("sort", { prop, order });
  };
  return {
    setCurrentRow,
    toggleRowSelection,
    clearSelection,
    clearFilter,
    toggleAllSelection,
    toggleRowExpansion,
    clearSort,
    sort
  };
}


//# sourceMappingURL=utils-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table/style-helper.mjs







function table_style_helper_useStyle(props, layout, store, table) {
  const isHidden = reactivity_esm_bundler_ref(false);
  const renderExpanded = reactivity_esm_bundler_ref(null);
  const resizeProxyVisible = reactivity_esm_bundler_ref(false);
  const setDragVisible = (visible) => {
    resizeProxyVisible.value = visible;
  };
  const resizeState = reactivity_esm_bundler_ref({
    width: null,
    height: null
  });
  const isGroup = reactivity_esm_bundler_ref(false);
  runtime_core_esm_bundler_watchEffect(() => {
    layout.setHeight(props.height);
  });
  runtime_core_esm_bundler_watchEffect(() => {
    layout.setMaxHeight(props.maxHeight);
  });
  runtime_core_esm_bundler_watch(() => [props.currentRowKey, store.states.rowKey], ([currentRowKey, rowKey]) => {
    if (!reactivity_esm_bundler_unref(rowKey))
      return;
    store.setCurrentRowKey(`${currentRowKey}`);
  }, {
    immediate: true
  });
  runtime_core_esm_bundler_watch(() => props.data, (data) => {
    table.store.commit("setData", data);
  }, {
    immediate: true,
    deep: true
  });
  runtime_core_esm_bundler_watchEffect(() => {
    if (props.expandRowKeys) {
      store.setExpandRowKeysAdapter(props.expandRowKeys);
    }
  });
  const handleMouseLeave = () => {
    table.store.commit("setHoverRow", null);
    if (table.hoverState)
      table.hoverState = null;
  };
  const handleHeaderFooterMousewheel = (event, data) => {
    const { pixelX, pixelY } = data;
    if (Math.abs(pixelX) >= Math.abs(pixelY)) {
      table.refs.bodyWrapper.scrollLeft += data.pixelX / 5;
    }
  };
  const shouldUpdateHeight = runtime_core_esm_bundler_computed(() => {
    return props.height || props.maxHeight || store.states.fixedColumns.value.length > 0 || store.states.rightFixedColumns.value.length > 0;
  });
  const tableBodyStyles = runtime_core_esm_bundler_computed(() => {
    return {
      width: layout.bodyWidth.value ? `${layout.bodyWidth.value}px` : ""
    };
  });
  const doLayout = () => {
    if (shouldUpdateHeight.value) {
      layout.updateElsHeight();
    }
    layout.updateColumnsWidth();
    requestAnimationFrame(syncPostion);
  };
  runtime_core_esm_bundler_onMounted(async () => {
    setScrollClass("is-scrolling-left");
    store.updateColumns();
    await runtime_core_esm_bundler_nextTick();
    bindEvents();
    requestAnimationFrame(doLayout);
    resizeState.value = {
      width: table.vnode.el.offsetWidth,
      height: table.vnode.el.offsetHeight
    };
    store.states.columns.value.forEach((column) => {
      if (column.filteredValue && column.filteredValue.length) {
        table.store.commit("filterChange", {
          column,
          values: column.filteredValue,
          silent: true
        });
      }
    });
    table.$ready = true;
  });
  const setScrollClassByEl = (el, className) => {
    if (!el)
      return;
    const classList = Array.from(el.classList).filter((item) => !item.startsWith("is-scrolling-"));
    classList.push(layout.scrollX.value ? className : "is-scrolling-none");
    el.className = classList.join(" ");
  };
  const setScrollClass = (className) => {
    const { tableWrapper } = table.refs;
    setScrollClassByEl(tableWrapper, className);
  };
  const syncPostion = function() {
    if (!table.refs.scrollWrapper)
      return;
    const scrollContainer = table.refs.scrollWrapper.wrap$;
    if (!scrollContainer)
      return;
    const { scrollLeft, offsetWidth, scrollWidth } = scrollContainer;
    const { headerWrapper, footerWrapper } = table.refs;
    if (headerWrapper)
      headerWrapper.scrollLeft = scrollLeft;
    if (footerWrapper)
      footerWrapper.scrollLeft = scrollLeft;
    const maxScrollLeftPosition = scrollWidth - offsetWidth - 1;
    if (scrollLeft >= maxScrollLeftPosition) {
      setScrollClass("is-scrolling-right");
    } else if (scrollLeft === 0) {
      setScrollClass("is-scrolling-left");
    } else {
      setScrollClass("is-scrolling-middle");
    }
  };
  const bindEvents = () => {
    var _a;
    if (!table.refs.scrollWrapper)
      return;
    (_a = table.refs.scrollWrapper.wrap$) == null ? void 0 : _a.addEventListener("scroll", syncPostion, {
      passive: true
    });
    if (props.fit) {
      addResizeListener(table.vnode.el, resizeListener);
    } else {
      dom_on(window, "resize", doLayout);
    }
  };
  runtime_core_esm_bundler_onBeforeUnmount(() => {
    unbindEvents();
  });
  const unbindEvents = () => {
    var _a;
    (_a = table.refs.scrollWrapper.wrap$) == null ? void 0 : _a.removeEventListener("scroll", syncPostion, true);
    if (props.fit) {
      removeResizeListener(table.vnode.el, resizeListener);
    } else {
      off(window, "resize", doLayout);
    }
  };
  const resizeListener = () => {
    if (!table.$ready)
      return;
    let shouldUpdateLayout = false;
    const el = table.vnode.el;
    const { width: oldWidth, height: oldHeight } = resizeState.value;
    const width = el.offsetWidth;
    if (oldWidth !== width) {
      shouldUpdateLayout = true;
    }
    const height2 = el.offsetHeight;
    if ((props.height || shouldUpdateHeight.value) && oldHeight !== height2) {
      shouldUpdateLayout = true;
    }
    if (shouldUpdateLayout) {
      resizeState.value = {
        width,
        height: height2
      };
      doLayout();
    }
  };
  const tableSize = useSize();
  const bodyWidth = runtime_core_esm_bundler_computed(() => {
    const { bodyWidth: bodyWidth_, scrollY, gutterWidth } = layout;
    return bodyWidth_.value ? `${bodyWidth_.value - (scrollY.value ? gutterWidth : 0)}px` : "";
  });
  const height = runtime_core_esm_bundler_computed(() => {
    const headerHeight = layout.headerHeight.value || 0;
    const bodyHeight2 = layout.bodyHeight.value;
    const footerHeight = layout.footerHeight.value || 0;
    if (props.height) {
      return bodyHeight2 ? bodyHeight2 : void 0;
    } else if (props.maxHeight) {
      const maxHeight = parseHeight(props.maxHeight);
      return maxHeight - footerHeight - (props.showHeader ? headerHeight : 0);
    }
    return void 0;
  });
  const bodyHeight = runtime_core_esm_bundler_computed(() => {
    const headerHeight = layout.headerHeight.value || 0;
    const bodyHeight2 = layout.bodyHeight.value;
    const footerHeight = layout.footerHeight.value || 0;
    if (props.height) {
      return {
        height: bodyHeight2 ? `${bodyHeight2}px` : ""
      };
    } else if (props.maxHeight) {
      const maxHeight = parseHeight(props.maxHeight);
      if (typeof maxHeight === "number") {
        return {
          "max-height": `${maxHeight - footerHeight - (props.showHeader ? headerHeight : 0)}px`
        };
      }
    }
    return {};
  });
  const emptyBlockStyle = runtime_core_esm_bundler_computed(() => {
    if (props.data && props.data.length)
      return null;
    let height2 = "100%";
    if (layout.appendHeight.value) {
      height2 = `calc(100% - ${layout.appendHeight.value}px)`;
    }
    return {
      width: bodyWidth.value,
      height: height2
    };
  });
  const handleFixedMousewheel = (event, data) => {
    const bodyWrapper = table.refs.bodyWrapper;
    if (Math.abs(data.spinY) > 0) {
      const currentScrollTop = bodyWrapper.scrollTop;
      if (data.pixelY < 0 && currentScrollTop !== 0) {
        event.preventDefault();
      }
      if (data.pixelY > 0 && bodyWrapper.scrollHeight - bodyWrapper.clientHeight > currentScrollTop) {
        event.preventDefault();
      }
      bodyWrapper.scrollTop += Math.ceil(data.pixelY / 5);
    } else {
      bodyWrapper.scrollLeft += Math.ceil(data.pixelX / 5);
    }
  };
  const fixedHeight = runtime_core_esm_bundler_computed(() => {
    if (props.maxHeight) {
      if (props.showSummary) {
        return {
          bottom: 0
        };
      }
      return {
        bottom: layout.scrollX.value && props.data.length ? `${layout.gutterWidth}px` : ""
      };
    } else {
      if (props.showSummary) {
        return {
          height: layout.tableHeight.value ? `${layout.tableHeight.value}px` : ""
        };
      }
      return {
        height: layout.viewportHeight.value ? `${layout.viewportHeight.value}px` : ""
      };
    }
  });
  const fixedBodyHeight = runtime_core_esm_bundler_computed(() => {
    if (props.height) {
      return {
        height: layout.fixedBodyHeight.value ? `${layout.fixedBodyHeight.value}px` : ""
      };
    } else if (props.maxHeight) {
      let maxHeight = parseHeight(props.maxHeight);
      if (typeof maxHeight === "number") {
        maxHeight = layout.scrollX.value ? maxHeight - layout.gutterWidth : maxHeight;
        if (props.showHeader) {
          maxHeight -= layout.headerHeight.value;
        }
        maxHeight -= layout.footerHeight.value;
        return {
          "max-height": `${maxHeight}px`
        };
      }
    }
    return {};
  });
  return {
    isHidden,
    renderExpanded,
    setDragVisible,
    isGroup,
    handleMouseLeave,
    handleHeaderFooterMousewheel,
    tableSize,
    bodyHeight,
    height,
    emptyBlockStyle,
    handleFixedMousewheel,
    fixedHeight,
    fixedBodyHeight,
    resizeProxyVisible,
    bodyWidth,
    resizeState,
    doLayout,
    tableBodyStyles
  };
}


//# sourceMappingURL=style-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table/defaults.mjs
var defaults_defaultProps = {
  data: {
    type: Array,
    default: () => {
      return [];
    }
  },
  size: String,
  width: [String, Number],
  height: [String, Number],
  maxHeight: [String, Number],
  fit: {
    type: Boolean,
    default: true
  },
  stripe: Boolean,
  border: Boolean,
  rowKey: [String, Function],
  showHeader: {
    type: Boolean,
    default: true
  },
  showSummary: Boolean,
  sumText: String,
  summaryMethod: Function,
  rowClassName: [String, Function],
  rowStyle: [Object, Function],
  cellClassName: [String, Function],
  cellStyle: [Object, Function],
  headerRowClassName: [String, Function],
  headerRowStyle: [Object, Function],
  headerCellClassName: [String, Function],
  headerCellStyle: [Object, Function],
  highlightCurrentRow: Boolean,
  currentRowKey: [String, Number],
  emptyText: String,
  expandRowKeys: Array,
  defaultExpandAll: Boolean,
  defaultSort: Object,
  tooltipEffect: String,
  spanMethod: Function,
  selectOnIndeterminate: {
    type: Boolean,
    default: true
  },
  indent: {
    type: Number,
    default: 16
  },
  treeProps: {
    type: Object,
    default: () => {
      return {
        hasChildren: "hasChildren",
        children: "children"
      };
    }
  },
  lazy: Boolean,
  load: Function,
  style: {
    type: Object,
    default: () => ({})
  },
  className: {
    type: String,
    default: ""
  }
};


//# sourceMappingURL=defaults.mjs.map

;// CONCATENATED MODULE: ./node_modules/normalize-wheel-es/dist/index.mjs
var dist_h=!1,o,s,f,u,d,D,l,dist_p,m,w,N,E,x,A,M;function a(){if(!dist_h){dist_h=!0;var e=navigator.userAgent,n=/(?:MSIE.(\d+\.\d+))|(?:(?:Firefox|GranParadiso|Iceweasel).(\d+\.\d+))|(?:Opera(?:.+Version.|.)(\d+\.\d+))|(?:AppleWebKit.(\d+(?:\.\d+)?))|(?:Trident\/\d+\.\d+.*rv:(\d+\.\d+))/.exec(e),i=/(Mac OS X)|(Windows)|(Linux)/.exec(e);if(E=/\b(iPhone|iP[ao]d)/.exec(e),x=/\b(iP[ao]d)/.exec(e),w=/Android/i.exec(e),A=/FBAN\/\w+;/i.exec(e),M=/Mobile/i.exec(e),N=!!/Win64/.exec(e),n){o=n[1]?parseFloat(n[1]):n[5]?parseFloat(n[5]):NaN,o&&document&&document.documentMode&&(o=document.documentMode);var r=/(?:Trident\/(\d+.\d+))/.exec(e);D=r?parseFloat(r[1])+4:o,s=n[2]?parseFloat(n[2]):NaN,f=n[3]?parseFloat(n[3]):NaN,u=n[4]?parseFloat(n[4]):NaN,u?(n=/(?:Chrome\/(\d+\.\d+))/.exec(e),d=n&&n[1]?parseFloat(n[1]):NaN):d=NaN}else { o=s=f=d=u=NaN; }if(i){if(i[1]){var t=/(?:Mac OS X (\d+(?:[._]\d+)?))/.exec(e);l=t?parseFloat(t[1].replace("_",".")):!0}else { l=!1; }dist_p=!!i[2],m=!!i[3]}else { l=dist_p=m=!1 }}}var _={ie:function(){return a()||o},ieCompatibilityMode:function(){return a()||D>o},ie64:function(){return _.ie()&&N},firefox:function(){return a()||s},opera:function(){return a()||f},webkit:function(){return a()||u},safari:function(){return _.webkit()},chrome:function(){return a()||d},windows:function(){return a()||dist_p},osx:function(){return a()||l},linux:function(){return a()||m},iphone:function(){return a()||E},mobile:function(){return a()||E||x||w||M},nativeApp:function(){return a()||A},android:function(){return a()||w},ipad:function(){return a()||x}},F=_;var c=!!(typeof window!="undefined"&&window.document&&window.document.createElement),I={canUseDOM:c,canUseWorkers:typeof Worker!="undefined",canUseEventListeners:c&&!!(window.addEventListener||window.attachEvent),canUseViewport:c&&!!window.screen,isInWorker:!c},v=I;var X;v.canUseDOM&&(X=document.implementation&&document.implementation.hasFeature&&document.implementation.hasFeature("","")!==!0);function S(e,n){if(!v.canUseDOM||n&&!("addEventListener"in document)){ return!1; }var i="on"+e,r=i in document;if(!r){var t=document.createElement("div");t.setAttribute(i,"return;"),r=typeof t[i]=="function"}return!r&&X&&e==="wheel"&&(r=document.implementation.hasFeature("Events.wheel","3.0")),r}var b=S;var O=10,P=40,T=800;function U(e){var n=0,i=0,r=0,t=0;return"detail"in e&&(i=e.detail),"wheelDelta"in e&&(i=-e.wheelDelta/120),"wheelDeltaY"in e&&(i=-e.wheelDeltaY/120),"wheelDeltaX"in e&&(n=-e.wheelDeltaX/120),"axis"in e&&e.axis===e.HORIZONTAL_AXIS&&(n=i,i=0),r=n*O,t=i*O,"deltaY"in e&&(t=e.deltaY),"deltaX"in e&&(r=e.deltaX),(r||t)&&e.deltaMode&&(e.deltaMode==1?(r*=P,t*=P):(r*=T,t*=T)),r&&!n&&(n=r<1?-1:1),t&&!i&&(i=t<1?-1:1),{spinX:n,spinY:i,pixelX:r,pixelY:t}}U.getEventType=function(){return F.firefox()?"DOMMouseScroll":b("wheel")?"wheel":"mousewheel"};var W=U;
/**
 * Checks if an event is supported in the current execution environment.
 *
 * NOTE: This will not work correctly for non-generic events such as `change`,
 * `reset`, `load`, `error`, and `select`.
 *
 * Borrows from Modernizr.
 *
 * @param {string} eventNameSuffix Event name, e.g. "click".
 * @param {?boolean} capture Check if the capture phase is supported.
 * @return {boolean} True if the event is supported.
 * @internal
 * @license Modernizr 3.0.0pre (Custom Build) | MIT
 */
//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/directives/mousewheel/index.mjs



const mousewheel = function(element, callback) {
  if (element && element.addEventListener) {
    const fn = function(event) {
      const normalized = W(event);
      callback && callback.apply(this, [event, normalized]);
    };
    if (isFirefox()) {
      element.addEventListener("DOMMouseScroll", fn);
    } else {
      element.onmousewheel = fn;
    }
  }
};
const Mousewheel = {
  beforeMount(el, binding) {
    mousewheel(el, binding.value);
  }
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table.mjs



















let tableIdSeed = 1;
const table_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElTable",
  directives: {
    Mousewheel: Mousewheel
  },
  components: {
    TableHeader: TableHeader,
    TableBody: TableBody,
    TableFooter: TableFooter,
    ElScrollbar: ElScrollbar
  },
  props: defaults_defaultProps,
  emits: [
    "select",
    "select-all",
    "selection-change",
    "cell-mouse-enter",
    "cell-mouse-leave",
    "cell-contextmenu",
    "cell-click",
    "cell-dblclick",
    "row-click",
    "row-contextmenu",
    "row-dblclick",
    "header-click",
    "header-contextmenu",
    "sort-change",
    "filter-change",
    "current-change",
    "header-dragend",
    "expand-change"
  ],
  setup(props) {
    const { t } = useLocale();
    const ns = useNamespace("table");
    const table = runtime_core_esm_bundler_getCurrentInstance();
    runtime_core_esm_bundler_provide(TABLE_INJECTION_KEY, table);
    const store = createStore(table, props);
    table.store = store;
    const layout = new TableLayout({
      store: table.store,
      table,
      fit: props.fit,
      showHeader: props.showHeader
    });
    table.layout = layout;
    const isEmpty = runtime_core_esm_bundler_computed(() => (store.states.data.value || []).length === 0);
    const {
      setCurrentRow,
      toggleRowSelection,
      clearSelection,
      clearFilter,
      toggleAllSelection,
      toggleRowExpansion,
      clearSort,
      sort
    } = utils_helper_useUtils(store);
    const {
      isHidden,
      renderExpanded,
      setDragVisible,
      isGroup,
      handleMouseLeave,
      handleHeaderFooterMousewheel,
      tableSize,
      bodyHeight,
      height,
      emptyBlockStyle,
      handleFixedMousewheel,
      fixedHeight,
      fixedBodyHeight,
      resizeProxyVisible,
      bodyWidth,
      resizeState,
      doLayout,
      tableBodyStyles
    } = table_style_helper_useStyle(props, layout, store, table);
    const debouncedUpdateLayout = lodash_debounce(doLayout, 50);
    const tableId = `el-table_${tableIdSeed++}`;
    table.tableId = tableId;
    table.state = {
      isGroup,
      resizeState,
      doLayout,
      debouncedUpdateLayout
    };
    const computedSumText = runtime_core_esm_bundler_computed(() => props.sumText || t("el.table.sumText"));
    const computedEmptyText = runtime_core_esm_bundler_computed(() => {
      return props.emptyText || t("el.table.emptyText");
    });
    return {
      ns,
      layout,
      store,
      handleHeaderFooterMousewheel,
      handleMouseLeave,
      tableId,
      tableSize,
      isHidden,
      isEmpty,
      renderExpanded,
      resizeProxyVisible,
      resizeState,
      isGroup,
      bodyWidth,
      bodyHeight,
      height,
      tableBodyStyles,
      emptyBlockStyle,
      debouncedUpdateLayout,
      handleFixedMousewheel,
      fixedHeight,
      fixedBodyHeight,
      setCurrentRow,
      toggleRowSelection,
      clearSelection,
      clearFilter,
      toggleAllSelection,
      toggleRowExpansion,
      clearSort,
      doLayout,
      sort,
      t,
      setDragVisible,
      context: table,
      computedSumText,
      computedEmptyText
    };
  }
});
const table_hoisted_1 = ["data-prefix"];
const table_hoisted_2 = {
  ref: "hiddenColumns",
  class: "hidden-columns"
};
function table_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_table_header = resolveComponent("table-header");
  const _component_table_body = resolveComponent("table-body");
  const _component_el_scrollbar = resolveComponent("el-scrollbar");
  const _component_table_footer = resolveComponent("table-footer");
  const _directive_mousewheel = resolveDirective("mousewheel");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    ref: "tableWrapper",
    class: normalizeClass([
      {
        [_ctx.ns.m("fit")]: _ctx.fit,
        [_ctx.ns.m("striped")]: _ctx.stripe,
        [_ctx.ns.m("border")]: _ctx.border || _ctx.isGroup,
        [_ctx.ns.m("hidden")]: _ctx.isHidden,
        [_ctx.ns.m("group")]: _ctx.isGroup,
        [_ctx.ns.m("fluid-height")]: _ctx.maxHeight,
        [_ctx.ns.m("scrollable-x")]: _ctx.layout.scrollX.value,
        [_ctx.ns.m("scrollable-y")]: _ctx.layout.scrollY.value,
        [_ctx.ns.m("enable-row-hover")]: !_ctx.store.states.isComplex.value,
        [_ctx.ns.m("enable-row-transition")]: (_ctx.store.states.data.value || []).length !== 0 && (_ctx.store.states.data.value || []).length < 100,
        "has-footer": _ctx.showSummary
      },
      _ctx.ns.m(_ctx.tableSize),
      _ctx.className,
      _ctx.ns.b()
    ]),
    style: normalizeStyle(_ctx.style),
    "data-prefix": _ctx.ns.namespace.value,
    onMouseleave: _cache[0] || (_cache[0] = ($event) => _ctx.handleMouseLeave())
  }, [
    createBaseVNode("div", {
      class: normalizeClass(_ctx.ns.e("inner-wrapper"))
    }, [
      createBaseVNode("div", table_hoisted_2, [
        renderSlot(_ctx.$slots, "default")
      ], 512),
      _ctx.showHeader ? withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
        key: 0,
        ref: "headerWrapper",
        class: normalizeClass(_ctx.ns.e("header-wrapper"))
      }, [
        runtime_core_esm_bundler_createVNode(_component_table_header, {
          ref: "tableHeader",
          border: _ctx.border,
          "default-sort": _ctx.defaultSort,
          store: _ctx.store,
          style: normalizeStyle(_ctx.tableBodyStyles),
          onSetDragVisible: _ctx.setDragVisible
        }, null, 8, ["border", "default-sort", "store", "style", "onSetDragVisible"])
      ], 2)), [
        [_directive_mousewheel, _ctx.handleHeaderFooterMousewheel]
      ]) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
      createBaseVNode("div", {
        ref: "bodyWrapper",
        style: normalizeStyle(_ctx.bodyHeight),
        class: normalizeClass(_ctx.ns.e("body-wrapper"))
      }, [
        runtime_core_esm_bundler_createVNode(_component_el_scrollbar, {
          ref: "scrollWrapper",
          height: _ctx.maxHeight ? void 0 : _ctx.height,
          "max-height": _ctx.maxHeight ? _ctx.height : void 0
        }, {
          default: withCtx(() => [
            runtime_core_esm_bundler_createVNode(_component_table_body, {
              ref: "tableBody",
              context: _ctx.context,
              highlight: _ctx.highlightCurrentRow,
              "row-class-name": _ctx.rowClassName,
              "tooltip-effect": _ctx.tooltipEffect,
              "row-style": _ctx.rowStyle,
              store: _ctx.store,
              stripe: _ctx.stripe,
              style: normalizeStyle({
                width: _ctx.bodyWidth
              })
            }, null, 8, ["context", "highlight", "row-class-name", "tooltip-effect", "row-style", "store", "stripe", "style"]),
            _ctx.isEmpty ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
              key: 0,
              ref: "emptyBlock",
              style: normalizeStyle(_ctx.emptyBlockStyle),
              class: normalizeClass(_ctx.ns.e("empty-block"))
            }, [
              createBaseVNode("span", {
                class: normalizeClass(_ctx.ns.e("empty-text"))
              }, [
                renderSlot(_ctx.$slots, "empty", {}, () => [
                  createTextVNode(toDisplayString(_ctx.computedEmptyText), 1)
                ])
              ], 2)
            ], 6)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
            _ctx.$slots.append ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
              key: 1,
              ref: "appendWrapper",
              class: normalizeClass(_ctx.ns.e("append-wrapper"))
            }, [
              renderSlot(_ctx.$slots, "append")
            ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
          ]),
          _: 3
        }, 8, ["height", "max-height"])
      ], 6),
      _ctx.border || _ctx.isGroup ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
        key: 1,
        class: normalizeClass(_ctx.ns.e("border-left-patch"))
      }, null, 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
    ], 2),
    _ctx.showSummary ? withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 0,
      ref: "footerWrapper",
      class: normalizeClass(_ctx.ns.e("footer-wrapper"))
    }, [
      runtime_core_esm_bundler_createVNode(_component_table_footer, {
        border: _ctx.border,
        "default-sort": _ctx.defaultSort,
        store: _ctx.store,
        style: normalizeStyle(_ctx.tableBodyStyles),
        "sum-text": _ctx.computedSumText,
        "summary-method": _ctx.summaryMethod
      }, null, 8, ["border", "default-sort", "store", "style", "sum-text", "summary-method"])
    ], 2)), [
      [vShow, !_ctx.isEmpty],
      [_directive_mousewheel, _ctx.handleHeaderFooterMousewheel]
    ]) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    withDirectives(createBaseVNode("div", {
      ref: "resizeProxy",
      class: normalizeClass(_ctx.ns.e("column-resize-proxy"))
    }, null, 2), [
      [vShow, _ctx.resizeProxyVisible]
    ])
  ], 46, table_hoisted_1);
}
var Table = /* @__PURE__ */ _export_sfc(table_sfc_main, [["render", table_sfc_render]]);


//# sourceMappingURL=table.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/config.mjs






const defaultClassNames = {
  selection: "table-column--selection",
  expand: "table__expand-column"
};
const cellStarts = {
  default: {
    order: ""
  },
  selection: {
    width: 48,
    minWidth: 48,
    realWidth: 48,
    order: ""
  },
  expand: {
    width: 48,
    minWidth: 48,
    realWidth: 48,
    order: ""
  },
  index: {
    width: 48,
    minWidth: 48,
    realWidth: 48,
    order: ""
  }
};
const getDefaultClassName = (type) => {
  return defaultClassNames[type] || "";
};
const cellForced = {
  selection: {
    renderHeader({ store }) {
      function isDisabled() {
        return store.states.data.value && store.states.data.value.length === 0;
      }
      return h(ElCheckbox, {
        disabled: isDisabled(),
        size: store.states.tableSize.value,
        indeterminate: store.states.selection.value.length > 0 && !store.states.isAllSelected.value,
        "onUpdate:modelValue": store.toggleAllSelection,
        modelValue: store.states.isAllSelected.value
      });
    },
    renderCell({
      row,
      column,
      store,
      $index
    }) {
      return h(ElCheckbox, {
        disabled: column.selectable ? !column.selectable.call(null, row, $index) : false,
        size: store.states.tableSize.value,
        onChange: () => {
          store.commit("rowSelectedChanged", row);
        },
        onClick: (event) => event.stopPropagation(),
        modelValue: store.isSelected(row)
      });
    },
    sortable: false,
    resizable: false
  },
  index: {
    renderHeader({ column }) {
      return column.label || "#";
    },
    renderCell({
      column,
      $index
    }) {
      let i = $index + 1;
      const index = column.index;
      if (typeof index === "number") {
        i = $index + index;
      } else if (typeof index === "function") {
        i = index($index);
      }
      return h("div", {}, [i]);
    },
    sortable: false
  },
  expand: {
    renderHeader({ column }) {
      return column.label || "";
    },
    renderCell({ row, store }) {
      const { ns } = store;
      const classes = [ns.e("expand-icon")];
      if (store.states.expandRows.value.indexOf(row) > -1) {
        classes.push(ns.em("expand-icon", "expanded"));
      }
      const callback = function(e) {
        e.stopPropagation();
        store.toggleRowExpansion(row);
      };
      return h("div", {
        class: classes,
        onClick: callback
      }, {
        default: () => {
          return [
            h(ElIcon, null, {
              default: () => {
                return [h(arrowRight)];
              }
            })
          ];
        }
      });
    },
    sortable: false,
    resizable: false
  }
};
function defaultRenderCell({
  row,
  column,
  $index
}) {
  var _a;
  const property = column.property;
  const value = property && getPropByPath(row, property, false).v;
  if (column && column.formatter) {
    return column.formatter(row, column, value, $index);
  }
  return ((_a = value == null ? void 0 : value.toString) == null ? void 0 : _a.call(value)) || "";
}
function treeCellPrefix({
  row,
  treeNode,
  store
}) {
  if (!treeNode)
    return null;
  const ele = [];
  const callback = function(e) {
    e.stopPropagation();
    store.loadOrToggle(row);
  };
  const { ns } = store;
  if (treeNode.indent) {
    ele.push(h("span", {
      class: ns.e("indent"),
      style: { "padding-left": `${treeNode.indent}px` }
    }));
  }
  if (typeof treeNode.expanded === "boolean" && !treeNode.noLazyChildren) {
    const expandClasses = [
      ns.e("expand-icon"),
      treeNode.expanded ? ns.em("expand-icon", "expanded") : ""
    ];
    let icon = arrowRight;
    if (treeNode.loading) {
      icon = loading;
    }
    ele.push(h("div", {
      class: expandClasses,
      onClick: callback
    }, {
      default: () => {
        return [
          h(ElIcon, { class: { [ns.is("loading")]: treeNode.loading } }, {
            default: () => [h(icon)]
          })
        ];
      }
    }));
  } else {
    ele.push(h("span", {
      class: ns.e("placeholder")
    }));
  }
  return ele;
}


//# sourceMappingURL=config.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-column/watcher-helper.mjs




function watcher_helper_useWatcher(owner, props_) {
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const registerComplexWatchers = () => {
    const props = ["fixed"];
    const aliases = {
      realWidth: "width",
      realMinWidth: "minWidth"
    };
    const allAliases = props.reduce((prev, cur) => {
      prev[cur] = cur;
      return prev;
    }, aliases);
    Object.keys(allAliases).forEach((key) => {
      const columnKey = aliases[key];
      if (shared_esm_bundler_hasOwn(props_, columnKey)) {
        runtime_core_esm_bundler_watch(() => props_[columnKey], (newVal) => {
          let value = newVal;
          if (columnKey === "width" && key === "realWidth") {
            value = parseWidth(newVal);
          }
          if (columnKey === "minWidth" && key === "realMinWidth") {
            value = parseMinWidth(newVal);
          }
          instance.columnConfig.value[columnKey] = value;
          instance.columnConfig.value[key] = value;
          const updateColumns = columnKey === "fixed";
          owner.value.store.scheduleLayout(updateColumns);
        });
      }
    });
  };
  const registerNormalWatchers = () => {
    const props = [
      "label",
      "filters",
      "filterMultiple",
      "sortable",
      "index",
      "formatter",
      "className",
      "labelClassName",
      "showOverflowTooltip"
    ];
    const aliases = {
      property: "prop",
      align: "realAlign",
      headerAlign: "realHeaderAlign"
    };
    const allAliases = props.reduce((prev, cur) => {
      prev[cur] = cur;
      return prev;
    }, aliases);
    Object.keys(allAliases).forEach((key) => {
      const columnKey = aliases[key];
      if (shared_esm_bundler_hasOwn(props_, columnKey)) {
        runtime_core_esm_bundler_watch(() => props_[columnKey], (newVal) => {
          instance.columnConfig.value[key] = newVal;
        });
      }
    });
  };
  return {
    registerComplexWatchers,
    registerNormalWatchers
  };
}


//# sourceMappingURL=watcher-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-column/render-helper.mjs







function render_helper_useRender(props, slots, owner) {
  const instance = runtime_core_esm_bundler_getCurrentInstance();
  const columnId = reactivity_esm_bundler_ref("");
  const isSubColumn = reactivity_esm_bundler_ref(false);
  const realAlign = reactivity_esm_bundler_ref();
  const realHeaderAlign = reactivity_esm_bundler_ref();
  const ns = useNamespace("table");
  runtime_core_esm_bundler_watchEffect(() => {
    realAlign.value = props.align ? `is-${props.align}` : null;
    realAlign.value;
  });
  runtime_core_esm_bundler_watchEffect(() => {
    realHeaderAlign.value = props.headerAlign ? `is-${props.headerAlign}` : realAlign.value;
    realHeaderAlign.value;
  });
  const columnOrTableParent = runtime_core_esm_bundler_computed(() => {
    let parent = instance.vnode.vParent || instance.parent;
    while (parent && !parent.tableId && !parent.columnId) {
      parent = parent.vnode.vParent || parent.parent;
    }
    return parent;
  });
  const realWidth = reactivity_esm_bundler_ref(parseWidth(props.width));
  const realMinWidth = reactivity_esm_bundler_ref(parseMinWidth(props.minWidth));
  const setColumnWidth = (column) => {
    if (realWidth.value)
      column.width = realWidth.value;
    if (realMinWidth.value) {
      column.minWidth = realMinWidth.value;
    }
    if (!column.minWidth) {
      column.minWidth = 80;
    }
    column.realWidth = Number(column.width === void 0 ? column.minWidth : column.width);
    return column;
  };
  const setColumnForcedProps = (column) => {
    const type = column.type;
    const source = cellForced[type] || {};
    Object.keys(source).forEach((prop) => {
      const value = source[prop];
      if (prop !== "className" && value !== void 0) {
        column[prop] = value;
      }
    });
    const className = getDefaultClassName(type);
    if (className) {
      const forceClass = `${reactivity_esm_bundler_unref(ns.namespace)}-${className}`;
      column.className = column.className ? `${column.className} ${forceClass}` : forceClass;
    }
    return column;
  };
  const checkSubColumn = (children) => {
    if (children instanceof Array) {
      children.forEach((child) => check(child));
    } else {
      check(children);
    }
    function check(item) {
      var _a;
      if (((_a = item == null ? void 0 : item.type) == null ? void 0 : _a.name) === "ElTableColumn") {
        item.vParent = instance;
      }
    }
  };
  const setColumnRenders = (column) => {
    if (props.renderHeader) {
      error_debugWarn("TableColumn", "Comparing to render-header, scoped-slot header is easier to use. We recommend users to use scoped-slot header.");
    } else if (column.type !== "selection") {
      column.renderHeader = (scope) => {
        instance.columnConfig.value["label"];
        const renderHeader = slots.header;
        return renderHeader ? renderHeader(scope) : column.label;
      };
    }
    let originRenderCell = column.renderCell;
    if (column.type === "expand") {
      column.renderCell = (data) => h("div", {
        class: "cell"
      }, [originRenderCell(data)]);
      owner.value.renderExpanded = (data) => {
        return slots.default ? slots.default(data) : slots.default;
      };
    } else {
      originRenderCell = originRenderCell || defaultRenderCell;
      column.renderCell = (data) => {
        let children = null;
        if (slots.default) {
          children = slots.default(data);
        } else {
          children = originRenderCell(data);
        }
        const prefix = treeCellPrefix(data);
        const props2 = {
          class: "cell",
          style: {}
        };
        if (column.showOverflowTooltip) {
          props2.class = `${props2.class} ${reactivity_esm_bundler_unref(ns.namespace)}-tooltip`;
          props2.style = {
            width: `${(data.column.realWidth || Number(data.column.width)) - 1}px`
          };
        }
        checkSubColumn(children);
        return h("div", props2, [prefix, children]);
      };
    }
    return column;
  };
  const getPropsData = (...propsKey) => {
    return propsKey.reduce((prev, cur) => {
      if (Array.isArray(cur)) {
        cur.forEach((key) => {
          prev[key] = props[key];
        });
      }
      return prev;
    }, {});
  };
  const getColumnElIndex = (children, child) => {
    return [].indexOf.call(children, child);
  };
  return {
    columnId,
    realAlign,
    isSubColumn,
    realHeaderAlign,
    columnOrTableParent,
    setColumnWidth,
    setColumnForcedProps,
    setColumnRenders,
    getPropsData,
    getColumnElIndex
  };
}


//# sourceMappingURL=render-helper.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-column/defaults.mjs
var table_column_defaults_defaultProps = {
  type: {
    type: String,
    default: "default"
  },
  label: String,
  className: String,
  labelClassName: String,
  property: String,
  prop: String,
  width: {
    type: [String, Number],
    default: ""
  },
  minWidth: {
    type: [String, Number],
    default: ""
  },
  renderHeader: Function,
  sortable: {
    type: [Boolean, String],
    default: false
  },
  sortMethod: Function,
  sortBy: [String, Function, Array],
  resizable: {
    type: Boolean,
    default: true
  },
  columnKey: String,
  align: String,
  headerAlign: String,
  showTooltipWhenOverflow: Boolean,
  showOverflowTooltip: Boolean,
  fixed: [Boolean, String],
  formatter: Function,
  selectable: Function,
  reserveSelection: Boolean,
  filterMethod: Function,
  filteredValue: Array,
  filters: Array,
  filterPlacement: String,
  filterMultiple: {
    type: Boolean,
    default: true
  },
  index: [Number, Function],
  sortOrders: {
    type: Array,
    default: () => {
      return ["ascending", "descending", null];
    },
    validator: (val) => {
      return val.every((order) => ["ascending", "descending", null].indexOf(order) > -1);
    }
  }
};


//# sourceMappingURL=defaults.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/src/table-column/index.mjs








let columnIdSeed = 1;
var ElTableColumn = runtime_core_esm_bundler_defineComponent({
  name: "ElTableColumn",
  components: {
    ElCheckbox: ElCheckbox
  },
  props: table_column_defaults_defaultProps,
  setup(props, { slots }) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();
    const columnConfig = reactivity_esm_bundler_ref({});
    const owner = runtime_core_esm_bundler_computed(() => {
      let parent2 = instance.parent;
      while (parent2 && !parent2.tableId) {
        parent2 = parent2.parent;
      }
      return parent2;
    });
    const { registerNormalWatchers, registerComplexWatchers } = watcher_helper_useWatcher(owner, props);
    const {
      columnId,
      isSubColumn,
      realHeaderAlign,
      columnOrTableParent,
      setColumnWidth,
      setColumnForcedProps,
      setColumnRenders,
      getPropsData,
      getColumnElIndex,
      realAlign
    } = render_helper_useRender(props, slots, owner);
    const parent = columnOrTableParent.value;
    columnId.value = `${parent.tableId || parent.columnId}_column_${columnIdSeed++}`;
    onBeforeMount(() => {
      isSubColumn.value = owner.value !== parent;
      const type = props.type || "default";
      const sortable = props.sortable === "" ? true : props.sortable;
      const defaults = {
        ...cellStarts[type],
        id: columnId.value,
        type,
        property: props.prop || props.property,
        align: realAlign,
        headerAlign: realHeaderAlign,
        showOverflowTooltip: props.showOverflowTooltip || props.showTooltipWhenOverflow,
        filterable: props.filters || props.filterMethod,
        filteredValue: [],
        filterPlacement: "",
        isColumnGroup: false,
        isSubColumn: false,
        filterOpened: false,
        sortable,
        index: props.index,
        rawColumnKey: instance.vnode.key
      };
      const basicProps = [
        "columnKey",
        "label",
        "className",
        "labelClassName",
        "type",
        "renderHeader",
        "formatter",
        "fixed",
        "resizable"
      ];
      const sortProps = ["sortMethod", "sortBy", "sortOrders"];
      const selectProps = ["selectable", "reserveSelection"];
      const filterProps = [
        "filterMethod",
        "filters",
        "filterMultiple",
        "filterOpened",
        "filteredValue",
        "filterPlacement"
      ];
      let column = getPropsData(basicProps, sortProps, selectProps, filterProps);
      column = util_mergeOptions(defaults, column);
      const chains = compose(setColumnRenders, setColumnWidth, setColumnForcedProps);
      column = chains(column);
      columnConfig.value = column;
      registerNormalWatchers();
      registerComplexWatchers();
    });
    runtime_core_esm_bundler_onMounted(() => {
      var _a;
      const parent2 = columnOrTableParent.value;
      const children = isSubColumn.value ? parent2.vnode.el.children : (_a = parent2.refs.hiddenColumns) == null ? void 0 : _a.children;
      const getColumnIndex = () => getColumnElIndex(children || [], instance.vnode.el);
      columnConfig.value.getColumnIndex = getColumnIndex;
      const columnIndex = getColumnIndex();
      columnIndex > -1 && owner.value.store.commit("insertColumn", columnConfig.value, isSubColumn.value ? parent2.columnConfig.value : null);
    });
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      owner.value.store.commit("removeColumn", columnConfig.value, isSubColumn.value ? parent.columnConfig.value : null);
    });
    instance.columnId = columnId.value;
    instance.columnConfig = columnConfig;
    return;
  },
  render() {
    var _a, _b, _c;
    let children = [];
    try {
      const renderDefault = (_b = (_a = this.$slots).default) == null ? void 0 : _b.call(_a, {
        row: {},
        column: {},
        $index: -1
      });
      if (renderDefault instanceof Array) {
        for (const childNode of renderDefault) {
          if (((_c = childNode.type) == null ? void 0 : _c.name) === "ElTableColumn" || childNode.shapeFlag & 2) {
            children.push(childNode);
          } else if (childNode.type === runtime_core_esm_bundler_Fragment && childNode.children instanceof Array) {
            children.push(...childNode.children);
          }
        }
      }
    } catch (e) {
      children = [];
    }
    return h("div", children);
  }
});


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/table/index.mjs





const ElTable = withInstall(Table, {
  TableColumn: ElTableColumn
});
const table_ElTableColumn = withNoopInstall(ElTableColumn);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/link/src/link.mjs


const linkProps = buildProps({
  type: {
    type: String,
    values: ["primary", "success", "warning", "info", "danger", "default"],
    default: "default"
  },
  underline: {
    type: Boolean,
    default: true
  },
  disabled: { type: Boolean, default: false },
  href: { type: String, default: "" },
  icon: {
    type: definePropType([String, Object]),
    default: ""
  }
});
const linkEmits = {
  click: (evt) => evt instanceof MouseEvent
};


//# sourceMappingURL=link.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/link/src/link2.mjs







const link2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElLink",
  components: { ElIcon: ElIcon },
  props: linkProps,
  emits: linkEmits,
  setup(props, { emit }) {
    const ns = useNamespace("link");
    function handleClick(event) {
      if (!props.disabled)
        emit("click", event);
    }
    return {
      ns,
      handleClick
    };
  }
});
const link2_hoisted_1 = ["href"];
function link2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = resolveComponent("el-icon");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("a", {
    class: normalizeClass([
      _ctx.ns.b(),
      _ctx.type ? _ctx.ns.m(_ctx.type) : "",
      _ctx.ns.is("disabled", _ctx.disabled),
      _ctx.ns.is("underline", _ctx.underline && !_ctx.disabled)
    ]),
    href: _ctx.disabled || !_ctx.href ? void 0 : _ctx.href,
    onClick: _cache[0] || (_cache[0] = (...args) => _ctx.handleClick && _ctx.handleClick(...args))
  }, [
    _ctx.icon ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, { key: 0 }, {
      default: withCtx(() => [
        (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.icon)))
      ]),
      _: 1
    })) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    _ctx.$slots.default ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
      key: 1,
      class: normalizeClass(_ctx.ns.m("inner"))
    }, [
      renderSlot(_ctx.$slots, "default")
    ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    _ctx.$slots.icon ? renderSlot(_ctx.$slots, "icon", { key: 2 }) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 10, link2_hoisted_1);
}
var Link = /* @__PURE__ */ _export_sfc(link2_sfc_main, [["render", link2_sfc_render]]);


//# sourceMappingURL=link2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/link/index.mjs




const ElLink = withInstall(Link);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/InformList.vue?vue&type=template&id=9173446c
/* unplugin-vue-components disabled */






const InformListvue_type_template_id_9173446c_hoisted_1 = {
  class: "card-header"
};

const InformListvue_type_template_id_9173446c_hoisted_2 = /*#__PURE__*/createBaseVNode("span", null, "系统通知", -1
/* HOISTED */
);

const InformListvue_type_template_id_9173446c_hoisted_3 = /*#__PURE__*/createBaseVNode("svg", {
  t: "1645775950545",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21783",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M753.066667 270.933333A339.541333 339.541333 0 0 0 512 170.666667a341.333333 341.333333 0 0 0-341.333333 341.333333 341.333333 341.333333 0 0 0 341.333333 341.333333c159.146667 0 291.84-108.8 329.813333-256h-88.746666A255.573333 255.573333 0 0 1 512 768a256 256 0 0 1-256-256 256 256 0 0 1 256-256c70.826667 0 133.973333 29.44 180.053333 75.946667L554.666667 469.333333h298.666666V170.666667l-100.266666 100.266666z",
  fill: "",
  "p-id": "21784"
})], -1
/* HOISTED */
);

function InformListvue_type_template_id_9173446c_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = ElIcon;

  const _component_el_button = ElButton;

  const _component_el_link = ElLink;

  const _component_el_table_column = table_ElTableColumn;

  const _component_el_table = ElTable;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    class: "inform-list",
    shadow: "hover"
  }, {
    header: withCtx(() => [createBaseVNode("div", InformListvue_type_template_id_9173446c_hoisted_1, [InformListvue_type_template_id_9173446c_hoisted_2, runtime_core_esm_bundler_createVNode(_component_el_button, {
      loading: $data.loadingStatus,
      disabled: $data.loadingStatus,
      onClick: $options.getInformList,
      circle: ""
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
        default: withCtx(() => [InformListvue_type_template_id_9173446c_hoisted_3]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["loading", "disabled", "onClick"])])]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table, {
      data: $data.tableData,
      height: "400px",
      style: {
        "width": "100%"
      }
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "notifyName",
        label: "通知"
      }, {
        default: withCtx(scope => [runtime_core_esm_bundler_createVNode(_component_el_link, {
          underline: false,
          href: $data.informUrl + scope.row.id,
          target: "_blank"
        }, {
          default: withCtx(() => [createTextVNode(toDisplayString(scope.row.notifyName), 1
          /* TEXT */
          )]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["href"])]),
        _: 1
        /* STABLE */

      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "pubTime",
        label: "发布时间"
      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["data"])]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/WelcomePage/InformList.vue?vue&type=template&id=9173446c
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/InformList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const InformListvue_type_script_lang_js = ({
  data() {
    return {
      tableData: [],
      loadingStatus: true,
      informUrl: `http://cc.bjtu.edu.cn:81/meol/common/inform/message_content.jsp?nid=`
    };
  },

  created() {
    this.getInformList();
  },

  methods: {
    async getInformList() {
      this.tableData = [];
      this.loadingStatus = true;
      this.tableData = await GetInfo.getInformList().then(res => {
        this.loadingStatus = false;
        return res;
      });
    }

  }
});
;// CONCATENATED MODULE: ./src/components/WelcomePage/InformList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/WelcomePage/InformList.vue
/* unplugin-vue-components disabled */



;
const InformList_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(InformListvue_type_script_lang_js, [['render',InformListvue_type_template_id_9173446c_render]])

/* harmony default export */ const InformList = (InformList_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/LessonList.vue?vue&type=template&id=8151661c&scoped=true
/* unplugin-vue-components disabled */








const LessonListvue_type_template_id_8151661c_scoped_true_withScopeId = n => (pushScopeId("data-v-8151661c"), n = n(), popScopeId(), n);

const LessonListvue_type_template_id_8151661c_scoped_true_hoisted_1 = {
  class: "card-header"
};

const LessonListvue_type_template_id_8151661c_scoped_true_hoisted_2 = /*#__PURE__*/LessonListvue_type_template_id_8151661c_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("span", null, "课程列表", -1
/* HOISTED */
));

const LessonListvue_type_template_id_8151661c_scoped_true_hoisted_3 = /*#__PURE__*/LessonListvue_type_template_id_8151661c_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1645775950545",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21783",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M753.066667 270.933333A339.541333 339.541333 0 0 0 512 170.666667a341.333333 341.333333 0 0 0-341.333333 341.333333 341.333333 341.333333 0 0 0 341.333333 341.333333c159.146667 0 291.84-108.8 329.813333-256h-88.746666A255.573333 255.573333 0 0 1 512 768a256 256 0 0 1-256-256 256 256 0 0 1 256-256c70.826667 0 133.973333 29.44 180.053333 75.946667L554.666667 469.333333h298.666666V170.666667l-100.266666 100.266666z",
  fill: "",
  "p-id": "21784"
})], -1
/* HOISTED */
));

const LessonListvue_type_template_id_8151661c_scoped_true_hoisted_4 = /*#__PURE__*/LessonListvue_type_template_id_8151661c_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1645760757857",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21633",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M896 810.666667a85.333333 85.333333 0 0 1-85.333333 85.333333H213.333333a85.333333 85.333333 0 0 1-85.333333-85.333333V213.333333a85.333333 85.333333 0 0 1 85.333333-85.333333h597.333334a85.333333 85.333333 0 0 1 85.333333 85.333333v597.333334m-341.333333-42.666667V405.333333l149.333333 149.333334 60.586667-60.586667L512 241.493333l-252.586667 252.586667L320 554.666667 469.333333 405.333333V768h85.333334z",
  fill: "",
  "p-id": "21634"
})], -1
/* HOISTED */
));

const LessonListvue_type_template_id_8151661c_scoped_true_hoisted_5 = /*#__PURE__*/LessonListvue_type_template_id_8151661c_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1645760748848",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21483",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M128 213.333333a85.333333 85.333333 0 0 1 85.333333-85.333333h597.333334a85.333333 85.333333 0 0 1 85.333333 85.333333v597.333334a85.333333 85.333333 0 0 1-85.333333 85.333333H213.333333a85.333333 85.333333 0 0 1-85.333333-85.333333V213.333333m341.333333 42.666667v362.666667L320 469.333333l-60.586667 60.586667L512 782.506667l252.586667-252.586667L704 469.333333 554.666667 618.666667V256h-85.333334z",
  fill: "",
  "p-id": "21484"
})], -1
/* HOISTED */
));

function LessonListvue_type_template_id_8151661c_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = ElIcon;

  const _component_el_button = ElButton;

  const _component_el_link = ElLink;

  const _component_el_table_column = table_ElTableColumn;

  const _component_el_button_group = ElButtonGroup;

  const _component_el_table = ElTable;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    class: "lesson-list",
    shadow: "hover"
  }, {
    header: withCtx(() => [createBaseVNode("div", LessonListvue_type_template_id_8151661c_scoped_true_hoisted_1, [LessonListvue_type_template_id_8151661c_scoped_true_hoisted_2, runtime_core_esm_bundler_createVNode(_component_el_button, {
      loading: $data.loadingStatus,
      disabled: $data.loadingStatus,
      onClick: $options.updateLessonList,
      circle: ""
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
        default: withCtx(() => [LessonListvue_type_template_id_8151661c_scoped_true_hoisted_3]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["loading", "disabled", "onClick"])])]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table, {
      data: $data.lessonList,
      height: "400px",
      style: {
        "width": "100%"
      }
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "name",
        label: "课程名",
        "show-overflow-tooltip": true
      }, {
        default: withCtx(scope => [runtime_core_esm_bundler_createVNode(_component_el_link, {
          underline: false,
          href: $data.lessonPageUrl + scope.row.id,
          target: "_blank"
        }, {
          default: withCtx(() => [createTextVNode(toDisplayString(scope.row.name), 1
          /* TEXT */
          )]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["href"])]),
        _: 1
        /* STABLE */

      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "teacher",
        label: "教师",
        align: "center"
      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "academy",
        label: "学院",
        align: "center"
      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "id",
        label: "操作",
        align: "center",
        "min-width": "100px"
      }, {
        default: withCtx(scope => [runtime_core_esm_bundler_createVNode(_component_el_button_group, null, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_button, {
            type: "primary",
            plain: "",
            onClick: $event => $options.handleButtonClick(scope.row.id, 'up')
          }, {
            default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
              default: withCtx(() => [LessonListvue_type_template_id_8151661c_scoped_true_hoisted_4]),
              _: 1
              /* STABLE */

            })]),
            _: 2
            /* DYNAMIC */

          }, 1032
          /* PROPS, DYNAMIC_SLOTS */
          , ["onClick"]), runtime_core_esm_bundler_createVNode(_component_el_button, {
            type: "primary",
            plain: "",
            onClick: $event => $options.handleButtonClick(scope.row.id, 'down')
          }, {
            default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
              default: withCtx(() => [LessonListvue_type_template_id_8151661c_scoped_true_hoisted_5]),
              _: 1
              /* STABLE */

            })]),
            _: 2
            /* DYNAMIC */

          }, 1032
          /* PROPS, DYNAMIC_SLOTS */
          , ["onClick"])]),
          _: 2
          /* DYNAMIC */

        }, 1024
        /* DYNAMIC_SLOTS */
        )]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["data"])]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/WelcomePage/LessonList.vue?vue&type=template&id=8151661c&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/LessonList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const LessonListvue_type_script_lang_js = ({
  data() {
    return {
      lessonList: [],
      loadingStatus: true,
      lessonPageUrl: `http://cc.bjtu.edu.cn:81/meol/jpk/course/layout/newpage/index.jsp?courseId=`
    };
  },

  created() {
    this.updateLessonList();
  },

  methods: {
    async updateLessonList() {
      this.loadingStatus = true;
      this.lessonList = await API.getLessonList().then(res => {
        this.loadingStatus = false;
        return res;
      });
    },

    async handleButtonClick(courseId, action) {
      return await API.lessonOrderOperation(courseId, action).then(res => {
        return this.updateLessonList();
      });
    }

  }
});
;// CONCATENATED MODULE: ./src/components/WelcomePage/LessonList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/LessonList.vue?vue&type=style&index=0&id=8151661c&scoped=true&lang=css
var LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/LessonList.vue?vue&type=style&index=0&id=8151661c&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/LessonList.vue?vue&type=style&index=0&id=8151661c&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_options = {};

LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css/* default */.Z, LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css_options);




       /* harmony default export */ const WelcomePage_LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css = (LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css/* default */.Z && LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css/* default.locals */.Z.locals ? LessonListvue_type_style_index_0_id_8151661c_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/WelcomePage/LessonList.vue?vue&type=style&index=0&id=8151661c&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/WelcomePage/LessonList.vue
/* unplugin-vue-components disabled */



;


const LessonList_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonListvue_type_script_lang_js, [['render',LessonListvue_type_template_id_8151661c_scoped_true_render],['__scopeId',"data-v-8151661c"]])

/* harmony default export */ const LessonList = (LessonList_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/NotifyList.vue?vue&type=template&id=43ad0fc2&scoped=true
/* unplugin-vue-components disabled */







const NotifyListvue_type_template_id_43ad0fc2_scoped_true_withScopeId = n => (pushScopeId("data-v-43ad0fc2"), n = n(), popScopeId(), n);

const NotifyListvue_type_template_id_43ad0fc2_scoped_true_hoisted_1 = {
  class: "card-header"
};

const NotifyListvue_type_template_id_43ad0fc2_scoped_true_hoisted_2 = /*#__PURE__*/NotifyListvue_type_template_id_43ad0fc2_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("span", null, "未读通知", -1
/* HOISTED */
));

const NotifyListvue_type_template_id_43ad0fc2_scoped_true_hoisted_3 = /*#__PURE__*/NotifyListvue_type_template_id_43ad0fc2_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1645775950545",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21783",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M753.066667 270.933333A339.541333 339.541333 0 0 0 512 170.666667a341.333333 341.333333 0 0 0-341.333333 341.333333 341.333333 341.333333 0 0 0 341.333333 341.333333c159.146667 0 291.84-108.8 329.813333-256h-88.746666A255.573333 255.573333 0 0 1 512 768a256 256 0 0 1-256-256 256 256 0 0 1 256-256c70.826667 0 133.973333 29.44 180.053333 75.946667L554.666667 469.333333h298.666666V170.666667l-100.266666 100.266666z",
  fill: "",
  "p-id": "21784"
})], -1
/* HOISTED */
));

function NotifyListvue_type_template_id_43ad0fc2_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = ElIcon;

  const _component_el_button = ElButton;

  const _component_el_link = ElLink;

  const _component_el_table_column = table_ElTableColumn;

  const _component_el_table = ElTable;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    class: "notify-list",
    shadow: "hover"
  }, {
    header: withCtx(() => [createBaseVNode("div", NotifyListvue_type_template_id_43ad0fc2_scoped_true_hoisted_1, [NotifyListvue_type_template_id_43ad0fc2_scoped_true_hoisted_2, runtime_core_esm_bundler_createVNode(_component_el_button, {
      loading: $data.loadingStatus,
      disabled: $data.loadingStatus,
      onClick: $options.refreshNotifyList,
      circle: ""
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
        default: withCtx(() => [NotifyListvue_type_template_id_43ad0fc2_scoped_true_hoisted_3]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["loading", "disabled", "onClick"])])]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table, {
      data: $data.tableData,
      height: "400px",
      "default-sort": {
        prop: 'pubTime',
        order: 'descending'
      },
      style: {
        "width": "100%"
      }
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "notifyName",
        label: "通知名",
        width: "200px"
      }, {
        default: withCtx(scope => [runtime_core_esm_bundler_createVNode(_component_el_link, {
          href: `http://cc.bjtu.edu.cn:81/meol/jpk/course/layout/course_meswrap.jsp?courseId=${scope.row.lid}&nid=${scope.row.nid}`,
          underline: false,
          target: "_blank"
        }, {
          default: withCtx(() => [createTextVNode(toDisplayString(scope.row.notifyName), 1
          /* TEXT */
          )]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["href"])]),
        _: 1
        /* STABLE */

      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "lessonName",
        label: "课程名",
        align: "center"
      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "hadRead",
        label: "阅读状态",
        align: "center",
        formatter: $options.hadReadformatter,
        filters: [{
          text: '已阅读',
          value: 'true'
        }, {
          text: '未阅读',
          value: 'false'
        }],
        "filter-method": $options.hadReadfilterHandler,
        "filtered-value": $data.checkedFilters
      }, null, 8
      /* PROPS */
      , ["formatter", "filter-method", "filtered-value"]), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "pubTime",
        label: "发布时间",
        sortable: ""
      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["data"])]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/WelcomePage/NotifyList.vue?vue&type=template&id=43ad0fc2&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/NotifyList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const NotifyListvue_type_script_lang_js = ({
  created() {
    this.getRemindNotifies();
  },

  data() {
    return {
      notifies: [],
      tableData: [],
      checkedFilters: ["false"],
      loadingStatus: true
    };
  },

  methods: {
    async getRemindNotifies() {
      this.tableData = [];
      this.notifies = await GetInfo.getRemindInfo().then(async res => {
        this.loadingStatus = false;

        for (let lesson of res.notify) {
          await GetInfo.getNotifyList(lesson.id).then(notifies => {
            notifies.forEach(notify => {
              this.tableData.push({
                lid: lesson.id,
                lessonName: lesson.name,
                notifyName: notify.notifyName,
                pubTime: notify.pubTime,
                nid: notify.id,
                hadRead: notify.hadRead
              });
            });
          });
        }
      });
    },

    async refreshNotifyList() {
      this.loadingStatus = true;
      this.notifies = [];
      this.getRemindNotifies();
    },

    hadReadfilterHandler(value, row, column) {
      return row.hadRead.toString() === value;
    },

    hadReadformatter(row, column) {
      if (row.hadRead === true) {
        return "已阅读";
      } else {
        return "未阅读";
      }
    }

  }
});
;// CONCATENATED MODULE: ./src/components/WelcomePage/NotifyList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/NotifyList.vue?vue&type=style&index=0&id=43ad0fc2&scoped=true&lang=css
var NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/NotifyList.vue?vue&type=style&index=0&id=43ad0fc2&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/NotifyList.vue?vue&type=style&index=0&id=43ad0fc2&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_options = {};

NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css/* default */.Z, NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css_options);




       /* harmony default export */ const WelcomePage_NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css = (NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css/* default */.Z && NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css/* default.locals */.Z.locals ? NotifyListvue_type_style_index_0_id_43ad0fc2_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/WelcomePage/NotifyList.vue?vue&type=style&index=0&id=43ad0fc2&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/WelcomePage/NotifyList.vue
/* unplugin-vue-components disabled */



;


const NotifyList_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(NotifyListvue_type_script_lang_js, [['render',NotifyListvue_type_template_id_43ad0fc2_scoped_true_render],['__scopeId',"data-v-43ad0fc2"]])

/* harmony default export */ const NotifyList = (NotifyList_exports_);
;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tag/src/tag.mjs


const tagProps = buildProps({
  closable: Boolean,
  type: {
    type: String,
    values: ["success", "info", "warning", "danger", ""],
    default: ""
  },
  hit: Boolean,
  disableTransitions: Boolean,
  color: {
    type: String,
    default: ""
  },
  size: {
    type: String,
    values: ["large", "default", "small"]
  },
  effect: {
    type: String,
    values: ["dark", "light", "plain"],
    default: "light"
  }
});
const tagEmits = {
  close: (evt) => evt instanceof MouseEvent,
  click: (evt) => evt instanceof MouseEvent
};


//# sourceMappingURL=tag.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tag/src/tag2.mjs









const tag2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElTag",
  components: { ElIcon: ElIcon, Close: close_close },
  props: tagProps,
  emits: tagEmits,
  setup(props, { emit }) {
    const tagSize = useSize();
    const ns = useNamespace("tag");
    const classes = runtime_core_esm_bundler_computed(() => {
      const { type, hit, effect, closable } = props;
      return [
        ns.b(),
        ns.is("closable", closable),
        ns.m(type),
        ns.m(tagSize.value),
        ns.m(effect),
        ns.is("hit", hit)
      ];
    });
    const handleClose = (event) => {
      event.stopPropagation();
      emit("close", event);
    };
    const handleClick = (event) => {
      emit("click", event);
    };
    return {
      ns,
      classes,
      handleClose,
      handleClick
    };
  }
});
function tag2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_close = resolveComponent("close");
  const _component_el_icon = resolveComponent("el-icon");
  return !_ctx.disableTransitions ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
    key: 0,
    class: normalizeClass(_ctx.classes),
    style: normalizeStyle({ backgroundColor: _ctx.color }),
    onClick: _cache[0] || (_cache[0] = (...args) => _ctx.handleClick && _ctx.handleClick(...args))
  }, [
    createBaseVNode("span", {
      class: normalizeClass(_ctx.ns.e("content"))
    }, [
      renderSlot(_ctx.$slots, "default")
    ], 2),
    _ctx.closable ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
      key: 0,
      class: normalizeClass(_ctx.ns.e("close")),
      onClick: _ctx.handleClose
    }, {
      default: withCtx(() => [
        runtime_core_esm_bundler_createVNode(_component_close)
      ]),
      _: 1
    }, 8, ["class", "onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 6)) : (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(Transition, {
    key: 1,
    name: `${_ctx.ns.namespace.value}-zoom-in-center`
  }, {
    default: withCtx(() => [
      createBaseVNode("span", {
        class: normalizeClass(_ctx.classes),
        style: normalizeStyle({ backgroundColor: _ctx.color }),
        onClick: _cache[1] || (_cache[1] = (...args) => _ctx.handleClick && _ctx.handleClick(...args))
      }, [
        createBaseVNode("span", {
          class: normalizeClass(_ctx.ns.e("content"))
        }, [
          renderSlot(_ctx.$slots, "default")
        ], 2),
        _ctx.closable ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
          key: 0,
          class: normalizeClass(_ctx.ns.e("close")),
          onClick: _ctx.handleClose
        }, {
          default: withCtx(() => [
            runtime_core_esm_bundler_createVNode(_component_close)
          ]),
          _: 1
        }, 8, ["class", "onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
      ], 6)
    ]),
    _: 3
  }, 8, ["name"]));
}
var Tag = /* @__PURE__ */ _export_sfc(tag2_sfc_main, [["render", tag2_sfc_render]]);


//# sourceMappingURL=tag2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/tag/index.mjs




const ElTag = withInstall(Tag);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/HwtList.vue?vue&type=template&id=3a6bf793
/* unplugin-vue-components disabled */







const HwtListvue_type_template_id_3a6bf793_hoisted_1 = {
  class: "card-header"
};

const HwtListvue_type_template_id_3a6bf793_hoisted_2 = /*#__PURE__*/createBaseVNode("span", null, "作业列表", -1
/* HOISTED */
);

const HwtListvue_type_template_id_3a6bf793_hoisted_3 = /*#__PURE__*/createBaseVNode("svg", {
  t: "1645775950545",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21783",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M753.066667 270.933333A339.541333 339.541333 0 0 0 512 170.666667a341.333333 341.333333 0 0 0-341.333333 341.333333 341.333333 341.333333 0 0 0 341.333333 341.333333c159.146667 0 291.84-108.8 329.813333-256h-88.746666A255.573333 255.573333 0 0 1 512 768a256 256 0 0 1-256-256 256 256 0 0 1 256-256c70.826667 0 133.973333 29.44 180.053333 75.946667L554.666667 469.333333h298.666666V170.666667l-100.266666 100.266666z",
  fill: "",
  "p-id": "21784"
})], -1
/* HOISTED */
);

const HwtListvue_type_template_id_3a6bf793_hoisted_4 = /*#__PURE__*/createTextVNode("交作业 ");

const HwtListvue_type_template_id_3a6bf793_hoisted_5 = /*#__PURE__*/createTextVNode("看作业 ");

function HwtListvue_type_template_id_3a6bf793_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = ElIcon;

  const _component_el_button = ElButton;

  const _component_el_table_column = table_ElTableColumn;

  const _component_el_link = ElLink;

  const _component_el_tag = ElTag;

  const _component_el_table = ElTable;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    class: "hwt-list",
    shadow: "hover"
  }, {
    header: withCtx(() => [createBaseVNode("div", HwtListvue_type_template_id_3a6bf793_hoisted_1, [HwtListvue_type_template_id_3a6bf793_hoisted_2, runtime_core_esm_bundler_createVNode(_component_el_button, {
      loading: $data.loadingStatus,
      disabled: $data.loadingStatus,
      onClick: $options.refreshHwtList,
      circle: ""
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
        default: withCtx(() => [HwtListvue_type_template_id_3a6bf793_hoisted_3]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["loading", "disabled", "onClick"])])]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table, {
      ref: "tableRef",
      height: "400px",
      data: $data.tableData,
      "default-sort": {
        prop: 'date',
        order: 'descending'
      },
      "row-class-name": $options.tableRowClassName,
      style: {
        "width": "100%"
      }
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "remain",
        label: "剩余时间",
        align: "center",
        filters: [{
          text: '今日截止',
          value: '今日截止'
        }, {
          text: '近期截止',
          value: '近期截止'
        }, {
          text: '未过期',
          value: '未过期'
        }, {
          text: '已过期',
          value: '已过期'
        }],
        "filter-method": $options.filterRemain,
        "filtered-value": $data.checkedFilters,
        formatter: $options.remainDayFormatter
      }, null, 8
      /* PROPS */
      , ["filter-method", "filtered-value", "formatter"]), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "name",
        label: "作业标题",
        align: "center"
      }, {
        default: withCtx(scope => [runtime_core_esm_bundler_createVNode(_component_el_link, {
          href: $data.taskAnswerUrl + scope.row.hwtID,
          underline: false,
          target: "_blank"
        }, {
          default: withCtx(() => [createTextVNode(toDisplayString(scope.row.name), 1
          /* TEXT */
          )]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["href"])]),
        _: 1
        /* STABLE */

      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "date",
        label: "截止日期",
        align: "center",
        sortable: ""
      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        prop: "lesson",
        label: "课程名",
        align: "center",
        filters: $options.toFilterArray($data.lessonList),
        "filter-method": $options.filterLesson
      }, {
        default: withCtx(scope => [runtime_core_esm_bundler_createVNode(_component_el_tag, {
          class: "lesson-tag",
          title: scope.row.lesson,
          type: "success",
          onClick: $event => $options.handleTagClick(scope.row.lid),
          "disable-transitions": ""
        }, {
          default: withCtx(() => [createTextVNode(toDisplayString(scope.row.lesson), 1
          /* TEXT */
          )]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["title", "onClick"])]),
        _: 1
        /* STABLE */

      }, 8
      /* PROPS */
      , ["filters", "filter-method"]), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        label: "允许提交",
        align: "center"
      }, {
        default: withCtx(scope => [runtime_core_esm_bundler_createVNode(_component_el_tag, {
          type: $options.ableFormatter(scope.row.able).tag,
          "disable-transitions": ""
        }, {
          default: withCtx(() => [createTextVNode(toDisplayString($options.ableFormatter(scope.row.able).text), 1
          /* TEXT */
          )]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["type"])]),
        _: 1
        /* STABLE */

      }), runtime_core_esm_bundler_createVNode(_component_el_table_column, {
        label: "操作",
        align: "center"
      }, {
        default: withCtx(scope => [scope.row.able ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_button, {
          key: 0,
          size: "small",
          onClick: $event => $options.handleSubmitClick(scope.$index, scope.row)
        }, {
          default: withCtx(() => [HwtListvue_type_template_id_3a6bf793_hoisted_4]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true), !scope.row.able ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_button, {
          key: 1,
          size: "small",
          onClick: $event => $options.handleReviewClick(scope.$index, scope.row)
        }, {
          default: withCtx(() => [HwtListvue_type_template_id_3a6bf793_hoisted_5]),
          _: 2
          /* DYNAMIC */

        }, 1032
        /* PROPS, DYNAMIC_SLOTS */
        , ["onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["data", "row-class-name"])]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/WelcomePage/HwtList.vue?vue&type=template&id=3a6bf793
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/HwtList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const HwtListvue_type_script_lang_js = ({
  created() {
    this.getLessonList();
  },

  data() {
    return {
      lessonList: [],
      tableData: [],
      checkedFilters: ["近期截止"],
      loadingStatus: true,
      lessonPageUrl: `http://cc.bjtu.edu.cn:81/meol/jpk/course/layout/newpage/index.jsp?courseId=`,
      taskAnswerUrl: `http://cc.bjtu.edu.cn:81/meol/common/hw/student/taskanswer.jsp?hwtid=`,
      hwtWriteUrl: `http://cc.bjtu.edu.cn:81/meol/common/hw/student/write.jsp?hwtid=`
    };
  },

  watch: {
    lessonList: async function (val) {
      // Async Trap: cannot async in forEach
      for (let lesson of this.lessonList) {
        await API.getHwtList(lesson.id).then(hwtList => {
          for (let hwt of hwtList) {
            this.hwtObj2TableObj(lesson, hwt).then(tableObject => {
              this.appendTableData(tableObject);
            });
          }
        });
      }

      this.loadingStatus = false;
    }
  },
  methods: {
    filterLesson(value, row) {
      return row.lesson === value;
    },

    filterRemain(value, row) {
      switch (value) {
        case "今日截止":
          return row.remain === 0;

        case "近期截止":
          return row.remain <= 25 && row.remain >= -5;

        case "未过期":
          return row.remain > 0;

        case "已过期":
          return row.remain < 0;
      } // return row.lesson === value;

    },

    toFilterArray(hwtArray) {
      let rtnArray = [];
      hwtArray.forEach(item => {
        let obj = {
          text: "",
          value: ""
        };
        obj.text = item.name;
        obj.value = item.name;
        rtnArray.push(obj);
      });
      return rtnArray;
    },

    tableDataFilter(tableObj, start, end) {
      // start: larger, end: smaller
      // won't add to tableData
      if (tableObj.remain < start && tableObj.remain > end) return true;else false;
    },

    tableRowClassName({
      row,
      rowIndex
    }) {
      if (row.able === false) {
        return "info-row";
      } else {
        if (row.remain <= 3 && row.remain > 0) {
          return "warning-row";
        } else if (row.remain === 0) {
          return "danger-row";
        } else {
          return "success-row";
        }
      }
    },

    remainDayFormatter(row, column) {
      if (row.remain < 0) {
        return `已过期${Math.abs(row.remain).toString()}天`;
      } else if (row.remain === 0) {
        return `今日截止`;
      } else if (row.remain > 0) {
        return `还有${row.remain}天截止`;
      }
    },

    ableFormatter(able) {
      if (able === true) {
        return {
          text: "允许提交",
          tag: "success"
        };
      } else {
        return {
          text: "禁止提交",
          tag: "info"
        };
      }
    },

    async getLessonList() {
      this.lessonList = await API.getLessonList();
    },

    async handleSubmitClick(index, row) {
      this.$router.push(`/lesson/${row.lid}/submit/${row.hwtID}?able=true`);
    },

    async handleReviewClick(index, row) {
      this.$router.push(`/lesson/${row.lid}/submit/${row.hwtID}?able=false`);
    },

    async handleTagClick(lid) {
      let url = `${this.lessonPageUrl}${lid}`;
      window.open(url);
    },

    async hwtObj2TableObj(lesson, hwt) {
      return {
        lid: lesson.id,
        lesson: lesson.name,
        hwtID: hwt.id,
        name: hwt.title,
        date: hwt.deadLine,
        remain: hwt.remain,
        able: hwt.able,
        publisher: hwt.publisher,
        mutualTask: hwt.mutualTask,
        answerStatus: hwt.answerStatus,
        showGrade: hwt.showGrade // answerStatus == true || submitStruts == false

      };
    },

    async appendTableData(tableObject) {
      if (this.tableDataFilter(tableObject, 365, -365)) {
        this.tableData.push(tableObject);
      } else {// do nothing
      }
    },

    async refreshHwtList() {
      this.loadingStatus = true;
      this.tableData = [];
      this.getLessonList();
    }

  }
});
;// CONCATENATED MODULE: ./src/components/WelcomePage/HwtList.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/HwtList.vue?vue&type=style&index=0&id=3a6bf793&lang=css
var HwtListvue_type_style_index_0_id_3a6bf793_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/HwtList.vue?vue&type=style&index=0&id=3a6bf793&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/HwtList.vue?vue&type=style&index=0&id=3a6bf793&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var HwtListvue_type_style_index_0_id_3a6bf793_lang_css_options = {};

HwtListvue_type_style_index_0_id_3a6bf793_lang_css_options.styleTagTransform = (styleTagTransform_default());
HwtListvue_type_style_index_0_id_3a6bf793_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      HwtListvue_type_style_index_0_id_3a6bf793_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
HwtListvue_type_style_index_0_id_3a6bf793_lang_css_options.domAPI = (styleDomAPI_default());
HwtListvue_type_style_index_0_id_3a6bf793_lang_css_options.insertStyleElement = (insertStyleElement_default());

var HwtListvue_type_style_index_0_id_3a6bf793_lang_css_update = injectStylesIntoStyleTag_default()(HwtListvue_type_style_index_0_id_3a6bf793_lang_css/* default */.Z, HwtListvue_type_style_index_0_id_3a6bf793_lang_css_options);




       /* harmony default export */ const WelcomePage_HwtListvue_type_style_index_0_id_3a6bf793_lang_css = (HwtListvue_type_style_index_0_id_3a6bf793_lang_css/* default */.Z && HwtListvue_type_style_index_0_id_3a6bf793_lang_css/* default.locals */.Z.locals ? HwtListvue_type_style_index_0_id_3a6bf793_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/WelcomePage/HwtList.vue?vue&type=style&index=0&id=3a6bf793&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/WelcomePage/HwtList.vue
/* unplugin-vue-components disabled */



;


const HwtList_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(HwtListvue_type_script_lang_js, [['render',HwtListvue_type_template_id_3a6bf793_render]])

/* harmony default export */ const HwtList = (HwtList_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/WelcomeIndex.vue?vue&type=template&id=0ae504a8
/* unplugin-vue-components disabled */








function WelcomeIndexvue_type_template_id_0ae504a8_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_hwt_list = HwtList;

  const _component_el_col = ElCol;

  const _component_notify_list = NotifyList;

  const _component_lesson_list = LessonList;

  const _component_inform_list = InformList;

  const _component_user_info = UserInfo;

  const _component_calender = Calender;

  const _component_el_row = ElRow;

  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", null, [runtime_core_esm_bundler_createVNode(_component_el_row, null, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: this.userConfig['hwt-list-card-size'].value
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_hwt_list)]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["span"]), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: this.userConfig['notify-list-card-size'].value
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_notify_list)]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["span"]), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: this.userConfig['notify-list-card-size'].value
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_lesson_list)]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["span"]), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: this.userConfig['inform-list-card-size'].value
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_inform_list)]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["span"]), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: this.userConfig['user-info-card-size'].value
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_user_info)]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["span"]), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: this.userConfig['calender-card-size'].value
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_calender)]),
      _: 1
      /* STABLE */

    }, 8
    /* PROPS */
    , ["span"])]),
    _: 1
    /* STABLE */

  })]);
}
;// CONCATENATED MODULE: ./src/components/WelcomePage/WelcomeIndex.vue?vue&type=template&id=0ae504a8
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/WelcomeIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */






/* harmony default export */ const WelcomeIndexvue_type_script_lang_js = ({
  components: {
    HwtList: HwtList,
    UserInfo: UserInfo,
    Calender: Calender,
    InformList: InformList,
    NotifyList: NotifyList,
    LessonList: LessonList
  },

  created() {
    this.userConfig = ConfigOperations.readUserConfig();
  },

  data() {
    return {
      userConfig: ConfigOperations.readUserConfig()
    };
  }

});
;// CONCATENATED MODULE: ./src/components/WelcomePage/WelcomeIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/WelcomeIndex.vue?vue&type=style&index=0&id=0ae504a8&lang=css
var WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/WelcomeIndex.vue?vue&type=style&index=0&id=0ae504a8&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/WelcomePage/WelcomeIndex.vue?vue&type=style&index=0&id=0ae504a8&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_options = {};

WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_options.styleTagTransform = (styleTagTransform_default());
WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_options.domAPI = (styleDomAPI_default());
WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_options.insertStyleElement = (insertStyleElement_default());

var WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_update = injectStylesIntoStyleTag_default()(WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css/* default */.Z, WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css_options);




       /* harmony default export */ const WelcomePage_WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css = (WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css/* default */.Z && WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css/* default.locals */.Z.locals ? WelcomeIndexvue_type_style_index_0_id_0ae504a8_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/WelcomePage/WelcomeIndex.vue?vue&type=style&index=0&id=0ae504a8&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/WelcomePage/WelcomeIndex.vue
/* unplugin-vue-components disabled */



;


const WelcomeIndex_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(WelcomeIndexvue_type_script_lang_js, [['render',WelcomeIndexvue_type_template_id_0ae504a8_render]])

/* harmony default export */ const WelcomeIndex = (WelcomeIndex_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Main.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */



/* harmony default export */ const Mainvue_type_script_lang_js = ({
  components: {
    HeadBar: HeadBar,
    SideBar: SideBar,
    WelcomeMain: WelcomeIndex
  },

  data() {
    return {
      status: true
    };
  },

  created() {
    this.status = ConfigOperations.readUserConfig()["show-side-bar"].value;
  }

});
;// CONCATENATED MODULE: ./src/components/Main.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Main.vue?vue&type=style&index=0&id=b1b87b0a&scoped=true&lang=css
var Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Main.vue?vue&type=style&index=0&id=b1b87b0a&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Main.vue?vue&type=style&index=0&id=b1b87b0a&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_options = {};

Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css/* default */.Z, Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css_options);




       /* harmony default export */ const components_Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css = (Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css/* default */.Z && Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css/* default.locals */.Z.locals ? Mainvue_type_style_index_0_id_b1b87b0a_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/Main.vue?vue&type=style&index=0&id=b1b87b0a&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/Main.vue
/* unplugin-vue-components disabled */



;


const Main_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(Mainvue_type_script_lang_js, [['render',Mainvue_type_template_id_b1b87b0a_scoped_true_render],['__scopeId',"data-v-b1b87b0a"]])

/* harmony default export */ const components_Main = (Main_exports_);
;// CONCATENATED MODULE: ./node_modules/@vue/devtools-api/lib/esm/env.js
function getDevtoolsGlobalHook() {
  return getTarget().__VUE_DEVTOOLS_GLOBAL_HOOK__;
}
function getTarget() {
  // @ts-ignore
  return typeof navigator !== 'undefined' && typeof window !== 'undefined' ? window : typeof __webpack_require__.g !== 'undefined' ? __webpack_require__.g : {};
}
const isProxyAvailable = typeof Proxy === 'function';
;// CONCATENATED MODULE: ./node_modules/@vue/devtools-api/lib/esm/const.js
const HOOK_SETUP = 'devtools-plugin:setup';
const HOOK_PLUGIN_SETTINGS_SET = 'plugin:settings:set';
;// CONCATENATED MODULE: ./node_modules/@vue/devtools-api/lib/esm/proxy.js

class ApiProxy {
  constructor(plugin, hook) {
    this.target = null;
    this.targetQueue = [];
    this.onQueue = [];
    this.plugin = plugin;
    this.hook = hook;
    const defaultSettings = {};

    if (plugin.settings) {
      for (const id in plugin.settings) {
        const item = plugin.settings[id];
        defaultSettings[id] = item.defaultValue;
      }
    }

    const localSettingsSaveId = `__vue-devtools-plugin-settings__${plugin.id}`;
    let currentSettings = Object.assign({}, defaultSettings);

    try {
      const raw = localStorage.getItem(localSettingsSaveId);
      const data = JSON.parse(raw);
      Object.assign(currentSettings, data);
    } catch (e) {// noop
    }

    this.fallbacks = {
      getSettings() {
        return currentSettings;
      },

      setSettings(value) {
        try {
          localStorage.setItem(localSettingsSaveId, JSON.stringify(value));
        } catch (e) {// noop
        }

        currentSettings = value;
      }

    };

    if (hook) {
      hook.on(HOOK_PLUGIN_SETTINGS_SET, (pluginId, value) => {
        if (pluginId === this.plugin.id) {
          this.fallbacks.setSettings(value);
        }
      });
    }

    this.proxiedOn = new Proxy({}, {
      get: (_target, prop) => {
        if (this.target) {
          return this.target.on[prop];
        } else {
          return (...args) => {
            this.onQueue.push({
              method: prop,
              args
            });
          };
        }
      }
    });
    this.proxiedTarget = new Proxy({}, {
      get: (_target, prop) => {
        if (this.target) {
          return this.target[prop];
        } else if (prop === 'on') {
          return this.proxiedOn;
        } else if (Object.keys(this.fallbacks).includes(prop)) {
          return (...args) => {
            this.targetQueue.push({
              method: prop,
              args,
              resolve: () => {}
            });
            return this.fallbacks[prop](...args);
          };
        } else {
          return (...args) => {
            return new Promise(resolve => {
              this.targetQueue.push({
                method: prop,
                args,
                resolve
              });
            });
          };
        }
      }
    });
  }

  async setRealTarget(target) {
    this.target = target;

    for (const item of this.onQueue) {
      this.target.on[item.method](...item.args);
    }

    for (const item of this.targetQueue) {
      item.resolve(await this.target[item.method](...item.args));
    }
  }

}
;// CONCATENATED MODULE: ./node_modules/@vue/devtools-api/lib/esm/index.js





function setupDevtoolsPlugin(pluginDescriptor, setupFn) {
  const target = getTarget();
  const hook = getDevtoolsGlobalHook();
  const enableProxy = isProxyAvailable && pluginDescriptor.enableEarlyProxy;

  if (hook && (target.__VUE_DEVTOOLS_PLUGIN_API_AVAILABLE__ || !enableProxy)) {
    hook.emit(HOOK_SETUP, pluginDescriptor, setupFn);
  } else {
    const proxy = enableProxy ? new ApiProxy(pluginDescriptor, hook) : null;
    const list = target.__VUE_DEVTOOLS_PLUGINS__ = target.__VUE_DEVTOOLS_PLUGINS__ || [];
    list.push({
      pluginDescriptor,
      setupFn,
      proxy
    });
    if (proxy) setupFn(proxy.proxiedTarget);
  }
}
;// CONCATENATED MODULE: ./node_modules/vue-router/dist/vue-router.esm-bundler.js
/*!
  * vue-router v4.0.12
  * (c) 2021 Eduardo San Martin Morote
  * @license MIT
  */


const hasSymbol = typeof Symbol === 'function' && typeof Symbol.toStringTag === 'symbol';

const PolySymbol = name => // vr = vue router
hasSymbol ? Symbol( false ? 0 : name) : ( false ? 0 : '_vr_') + name; // rvlm = Router View Location Matched

/**
 * RouteRecord being rendered by the closest ancestor Router View. Used for
 * `onBeforeRouteUpdate` and `onBeforeRouteLeave`. rvlm stands for Router View
 * Location Matched
 *
 * @internal
 */


const matchedRouteKey = /*#__PURE__*/PolySymbol( false ? 0 : 'rvlm');
/**
 * Allows overriding the router view depth to control which component in
 * `matched` is rendered. rvd stands for Router View Depth
 *
 * @internal
 */

const viewDepthKey = /*#__PURE__*/PolySymbol( false ? 0 : 'rvd');
/**
 * Allows overriding the router instance returned by `useRouter` in tests. r
 * stands for router
 *
 * @internal
 */

const routerKey = /*#__PURE__*/PolySymbol( false ? 0 : 'r');
/**
 * Allows overriding the current route returned by `useRoute` in tests. rl
 * stands for route location
 *
 * @internal
 */

const routeLocationKey = /*#__PURE__*/PolySymbol( false ? 0 : 'rl');
/**
 * Allows overriding the current route used by router-view. Internally this is
 * used when the `route` prop is passed.
 *
 * @internal
 */

const routerViewLocationKey = /*#__PURE__*/PolySymbol( false ? 0 : 'rvl');
const isBrowser = typeof window !== 'undefined';

function isESModule(obj) {
  return obj.__esModule || hasSymbol && obj[Symbol.toStringTag] === 'Module';
}

const vue_router_esm_bundler_assign = Object.assign;

function applyToParams(fn, params) {
  const newParams = {};

  for (const key in params) {
    const value = params[key];
    newParams[key] = Array.isArray(value) ? value.map(fn) : fn(value);
  }

  return newParams;
}

const vue_router_esm_bundler_noop = () => {};

function vue_router_esm_bundler_warn(msg) {
  // avoid using ...args as it breaks in older Edge builds
  const args = Array.from(arguments).slice(1);
  console.warn.apply(console, ['[Vue Router warn]: ' + msg].concat(args));
}

const TRAILING_SLASH_RE = /\/$/;

const removeTrailingSlash = path => path.replace(TRAILING_SLASH_RE, '');
/**
 * Transforms an URI into a normalized history location
 *
 * @param parseQuery
 * @param location - URI to normalize
 * @param currentLocation - current absolute location. Allows resolving relative
 * paths. Must start with `/`. Defaults to `/`
 * @returns a normalized history location
 */


function parseURL(parseQuery, location, currentLocation = '/') {
  let path,
      query = {},
      searchString = '',
      hash = ''; // Could use URL and URLSearchParams but IE 11 doesn't support it

  const searchPos = location.indexOf('?');
  const hashPos = location.indexOf('#', searchPos > -1 ? searchPos : 0);

  if (searchPos > -1) {
    path = location.slice(0, searchPos);
    searchString = location.slice(searchPos + 1, hashPos > -1 ? hashPos : location.length);
    query = parseQuery(searchString);
  }

  if (hashPos > -1) {
    path = path || location.slice(0, hashPos); // keep the # character

    hash = location.slice(hashPos, location.length);
  } // no search and no query


  path = resolveRelativePath(path != null ? path : location, currentLocation); // empty path means a relative query or hash `?foo=f`, `#thing`

  return {
    fullPath: path + (searchString && '?') + searchString + hash,
    path,
    query,
    hash
  };
}
/**
 * Stringifies a URL object
 *
 * @param stringifyQuery
 * @param location
 */


function stringifyURL(stringifyQuery, location) {
  const query = location.query ? stringifyQuery(location.query) : '';
  return location.path + (query && '?') + query + (location.hash || '');
}
/**
 * Strips off the base from the beginning of a location.pathname in a non
 * case-sensitive way.
 *
 * @param pathname - location.pathname
 * @param base - base to strip off
 */


function stripBase(pathname, base) {
  // no base or base is not found at the beginning
  if (!base || !pathname.toLowerCase().startsWith(base.toLowerCase())) return pathname;
  return pathname.slice(base.length) || '/';
}
/**
 * Checks if two RouteLocation are equal. This means that both locations are
 * pointing towards the same {@link RouteRecord} and that all `params`, `query`
 * parameters and `hash` are the same
 *
 * @param a - first {@link RouteLocation}
 * @param b - second {@link RouteLocation}
 */


function isSameRouteLocation(stringifyQuery, a, b) {
  const aLastIndex = a.matched.length - 1;
  const bLastIndex = b.matched.length - 1;
  return aLastIndex > -1 && aLastIndex === bLastIndex && isSameRouteRecord(a.matched[aLastIndex], b.matched[bLastIndex]) && isSameRouteLocationParams(a.params, b.params) && stringifyQuery(a.query) === stringifyQuery(b.query) && a.hash === b.hash;
}
/**
 * Check if two `RouteRecords` are equal. Takes into account aliases: they are
 * considered equal to the `RouteRecord` they are aliasing.
 *
 * @param a - first {@link RouteRecord}
 * @param b - second {@link RouteRecord}
 */


function isSameRouteRecord(a, b) {
  // since the original record has an undefined value for aliasOf
  // but all aliases point to the original record, this will always compare
  // the original record
  return (a.aliasOf || a) === (b.aliasOf || b);
}

function isSameRouteLocationParams(a, b) {
  if (Object.keys(a).length !== Object.keys(b).length) return false;

  for (const key in a) {
    if (!isSameRouteLocationParamsValue(a[key], b[key])) return false;
  }

  return true;
}

function isSameRouteLocationParamsValue(a, b) {
  return Array.isArray(a) ? isEquivalentArray(a, b) : Array.isArray(b) ? isEquivalentArray(b, a) : a === b;
}
/**
 * Check if two arrays are the same or if an array with one single entry is the
 * same as another primitive value. Used to check query and parameters
 *
 * @param a - array of values
 * @param b - array of values or a single value
 */


function isEquivalentArray(a, b) {
  return Array.isArray(b) ? a.length === b.length && a.every((value, i) => value === b[i]) : a.length === 1 && a[0] === b;
}
/**
 * Resolves a relative path that starts with `.`.
 *
 * @param to - path location we are resolving
 * @param from - currentLocation.path, should start with `/`
 */


function resolveRelativePath(to, from) {
  if (to.startsWith('/')) return to;

  if (false) {}

  if (!to) return from;
  const fromSegments = from.split('/');
  const toSegments = to.split('/');
  let position = fromSegments.length - 1;
  let toPosition;
  let segment;

  for (toPosition = 0; toPosition < toSegments.length; toPosition++) {
    segment = toSegments[toPosition]; // can't go below zero

    if (position === 1 || segment === '.') continue;
    if (segment === '..') position--; // found something that is not relative path
    else break;
  }

  return fromSegments.slice(0, position).join('/') + '/' + toSegments.slice(toPosition - (toPosition === toSegments.length ? 1 : 0)).join('/');
}

var NavigationType;

(function (NavigationType) {
  NavigationType["pop"] = "pop";
  NavigationType["push"] = "push";
})(NavigationType || (NavigationType = {}));

var NavigationDirection;

(function (NavigationDirection) {
  NavigationDirection["back"] = "back";
  NavigationDirection["forward"] = "forward";
  NavigationDirection["unknown"] = "";
})(NavigationDirection || (NavigationDirection = {}));
/**
 * Starting location for Histories
 */


const START = ''; // Generic utils

/**
 * Normalizes a base by removing any trailing slash and reading the base tag if
 * present.
 *
 * @param base - base to normalize
 */

function normalizeBase(base) {
  if (!base) {
    if (isBrowser) {
      // respect <base> tag
      const baseEl = document.querySelector('base');
      base = baseEl && baseEl.getAttribute('href') || '/'; // strip full URL origin

      base = base.replace(/^\w+:\/\/[^\/]+/, '');
    } else {
      base = '/';
    }
  } // ensure leading slash when it was removed by the regex above avoid leading
  // slash with hash because the file could be read from the disk like file://
  // and the leading slash would cause problems


  if (base[0] !== '/' && base[0] !== '#') base = '/' + base; // remove the trailing slash so all other method can just do `base + fullPath`
  // to build an href

  return removeTrailingSlash(base);
} // remove any character before the hash


const BEFORE_HASH_RE = /^[^#]+#/;

function createHref(base, location) {
  return base.replace(BEFORE_HASH_RE, '#') + location;
}

function getElementPosition(el, offset) {
  const docRect = document.documentElement.getBoundingClientRect();
  const elRect = el.getBoundingClientRect();
  return {
    behavior: offset.behavior,
    left: elRect.left - docRect.left - (offset.left || 0),
    top: elRect.top - docRect.top - (offset.top || 0)
  };
}

const computeScrollPosition = () => ({
  left: window.pageXOffset,
  top: window.pageYOffset
});

function scrollToPosition(position) {
  let scrollToOptions;

  if ('el' in position) {
    const positionEl = position.el;
    const isIdSelector = typeof positionEl === 'string' && positionEl.startsWith('#');
    /**
     * `id`s can accept pretty much any characters, including CSS combinators
     * like `>` or `~`. It's still possible to retrieve elements using
     * `document.getElementById('~')` but it needs to be escaped when using
     * `document.querySelector('#\\~')` for it to be valid. The only
     * requirements for `id`s are them to be unique on the page and to not be
     * empty (`id=""`). Because of that, when passing an id selector, it should
     * be properly escaped for it to work with `querySelector`. We could check
     * for the id selector to be simple (no CSS combinators `+ >~`) but that
     * would make things inconsistent since they are valid characters for an
     * `id` but would need to be escaped when using `querySelector`, breaking
     * their usage and ending up in no selector returned. Selectors need to be
     * escaped:
     *
     * - `#1-thing` becomes `#\31 -thing`
     * - `#with~symbols` becomes `#with\\~symbols`
     *
     * - More information about  the topic can be found at
     *   https://mathiasbynens.be/notes/html5-id-class.
     * - Practical example: https://mathiasbynens.be/demo/html5-id
     */

    if (false) {}

    const el = typeof positionEl === 'string' ? isIdSelector ? document.getElementById(positionEl.slice(1)) : document.querySelector(positionEl) : positionEl;

    if (!el) {
       false && 0;
      return;
    }

    scrollToOptions = getElementPosition(el, position);
  } else {
    scrollToOptions = position;
  }

  if ('scrollBehavior' in document.documentElement.style) window.scrollTo(scrollToOptions);else {
    window.scrollTo(scrollToOptions.left != null ? scrollToOptions.left : window.pageXOffset, scrollToOptions.top != null ? scrollToOptions.top : window.pageYOffset);
  }
}

function getScrollKey(path, delta) {
  const position = history.state ? history.state.position - delta : -1;
  return position + path;
}

const scrollPositions = new Map();

function saveScrollPosition(key, scrollPosition) {
  scrollPositions.set(key, scrollPosition);
}

function getSavedScrollPosition(key) {
  const scroll = scrollPositions.get(key); // consume it so it's not used again

  scrollPositions.delete(key);
  return scroll;
} // TODO: RFC about how to save scroll position

/**
 * ScrollBehavior instance used by the router to compute and restore the scroll
 * position when navigating.
 */
// export interface ScrollHandler<ScrollPositionEntry extends HistoryStateValue, ScrollPosition extends ScrollPositionEntry> {
//   // returns a scroll position that can be saved in history
//   compute(): ScrollPositionEntry
//   // can take an extended ScrollPositionEntry
//   scroll(position: ScrollPosition): void
// }
// export const scrollHandler: ScrollHandler<ScrollPosition> = {
//   compute: computeScroll,
//   scroll: scrollToPosition,
// }


let createBaseLocation = () => location.protocol + '//' + location.host;
/**
 * Creates a normalized history location from a window.location object
 * @param location -
 */


function createCurrentLocation(base, location) {
  const {
    pathname,
    search,
    hash
  } = location; // allows hash bases like #, /#, #/, #!, #!/, /#!/, or even /folder#end

  const hashPos = base.indexOf('#');

  if (hashPos > -1) {
    let slicePos = hash.includes(base.slice(hashPos)) ? base.slice(hashPos).length : 1;
    let pathFromHash = hash.slice(slicePos); // prepend the starting slash to hash so the url starts with /#

    if (pathFromHash[0] !== '/') pathFromHash = '/' + pathFromHash;
    return stripBase(pathFromHash, '');
  }

  const path = stripBase(pathname, base);
  return path + search + hash;
}

function useHistoryListeners(base, historyState, currentLocation, replace) {
  let listeners = [];
  let teardowns = []; // TODO: should it be a stack? a Dict. Check if the popstate listener
  // can trigger twice

  let pauseState = null;

  const popStateHandler = ({
    state
  }) => {
    const to = createCurrentLocation(base, location);
    const from = currentLocation.value;
    const fromState = historyState.value;
    let delta = 0;

    if (state) {
      currentLocation.value = to;
      historyState.value = state; // ignore the popstate and reset the pauseState

      if (pauseState && pauseState === from) {
        pauseState = null;
        return;
      }

      delta = fromState ? state.position - fromState.position : 0;
    } else {
      replace(to);
    } // console.log({ deltaFromCurrent })
    // Here we could also revert the navigation by calling history.go(-delta)
    // this listener will have to be adapted to not trigger again and to wait for the url
    // to be updated before triggering the listeners. Some kind of validation function would also
    // need to be passed to the listeners so the navigation can be accepted
    // call all listeners


    listeners.forEach(listener => {
      listener(currentLocation.value, from, {
        delta,
        type: NavigationType.pop,
        direction: delta ? delta > 0 ? NavigationDirection.forward : NavigationDirection.back : NavigationDirection.unknown
      });
    });
  };

  function pauseListeners() {
    pauseState = currentLocation.value;
  }

  function listen(callback) {
    // setup the listener and prepare teardown callbacks
    listeners.push(callback);

    const teardown = () => {
      const index = listeners.indexOf(callback);
      if (index > -1) listeners.splice(index, 1);
    };

    teardowns.push(teardown);
    return teardown;
  }

  function beforeUnloadListener() {
    const {
      history
    } = window;
    if (!history.state) return;
    history.replaceState(vue_router_esm_bundler_assign({}, history.state, {
      scroll: computeScrollPosition()
    }), '');
  }

  function destroy() {
    for (const teardown of teardowns) teardown();

    teardowns = [];
    window.removeEventListener('popstate', popStateHandler);
    window.removeEventListener('beforeunload', beforeUnloadListener);
  } // setup the listeners and prepare teardown callbacks


  window.addEventListener('popstate', popStateHandler);
  window.addEventListener('beforeunload', beforeUnloadListener);
  return {
    pauseListeners,
    listen,
    destroy
  };
}
/**
 * Creates a state object
 */


function buildState(back, current, forward, replaced = false, computeScroll = false) {
  return {
    back,
    current,
    forward,
    replaced,
    position: window.history.length,
    scroll: computeScroll ? computeScrollPosition() : null
  };
}

function useHistoryStateNavigation(base) {
  const {
    history,
    location
  } = window; // private variables

  const currentLocation = {
    value: createCurrentLocation(base, location)
  };
  const historyState = {
    value: history.state
  }; // build current history entry as this is a fresh navigation

  if (!historyState.value) {
    changeLocation(currentLocation.value, {
      back: null,
      current: currentLocation.value,
      forward: null,
      // the length is off by one, we need to decrease it
      position: history.length - 1,
      replaced: true,
      // don't add a scroll as the user may have an anchor and we want
      // scrollBehavior to be triggered without a saved position
      scroll: null
    }, true);
  }

  function changeLocation(to, state, replace) {
    /**
     * if a base tag is provided and we are on a normal domain, we have to
     * respect the provided `base` attribute because pushState() will use it and
     * potentially erase anything before the `#` like at
     * https://github.com/vuejs/vue-router-next/issues/685 where a base of
     * `/folder/#` but a base of `/` would erase the `/folder/` section. If
     * there is no host, the `<base>` tag makes no sense and if there isn't a
     * base tag we can just use everything after the `#`.
     */
    const hashIndex = base.indexOf('#');
    const url = hashIndex > -1 ? (location.host && document.querySelector('base') ? base : base.slice(hashIndex)) + to : createBaseLocation() + base + to;

    try {
      // BROWSER QUIRK
      // NOTE: Safari throws a SecurityError when calling this function 100 times in 30 seconds
      history[replace ? 'replaceState' : 'pushState'](state, '', url);
      historyState.value = state;
    } catch (err) {
      if (false) {} else {
        console.error(err);
      } // Force the navigation, this also resets the call count


      location[replace ? 'replace' : 'assign'](url);
    }
  }

  function replace(to, data) {
    const state = vue_router_esm_bundler_assign({}, history.state, buildState(historyState.value.back, // keep back and forward entries but override current position
    to, historyState.value.forward, true), data, {
      position: historyState.value.position
    });
    changeLocation(to, state, true);
    currentLocation.value = to;
  }

  function push(to, data) {
    // Add to current entry the information of where we are going
    // as well as saving the current position
    const currentState = vue_router_esm_bundler_assign({}, // use current history state to gracefully handle a wrong call to
    // history.replaceState
    // https://github.com/vuejs/vue-router-next/issues/366
    historyState.value, history.state, {
      forward: to,
      scroll: computeScrollPosition()
    });

    if (false) {}

    changeLocation(currentState.current, currentState, true);
    const state = vue_router_esm_bundler_assign({}, buildState(currentLocation.value, to, null), {
      position: currentState.position + 1
    }, data);
    changeLocation(to, state, false);
    currentLocation.value = to;
  }

  return {
    location: currentLocation,
    state: historyState,
    push,
    replace
  };
}
/**
 * Creates an HTML5 history. Most common history for single page applications.
 *
 * @param base -
 */


function createWebHistory(base) {
  base = normalizeBase(base);
  const historyNavigation = useHistoryStateNavigation(base);
  const historyListeners = useHistoryListeners(base, historyNavigation.state, historyNavigation.location, historyNavigation.replace);

  function go(delta, triggerListeners = true) {
    if (!triggerListeners) historyListeners.pauseListeners();
    history.go(delta);
  }

  const routerHistory = vue_router_esm_bundler_assign({
    // it's overridden right after
    location: '',
    base,
    go,
    createHref: createHref.bind(null, base)
  }, historyNavigation, historyListeners);
  Object.defineProperty(routerHistory, 'location', {
    enumerable: true,
    get: () => historyNavigation.location.value
  });
  Object.defineProperty(routerHistory, 'state', {
    enumerable: true,
    get: () => historyNavigation.state.value
  });
  return routerHistory;
}
/**
 * Creates a in-memory based history. The main purpose of this history is to handle SSR. It starts in a special location that is nowhere.
 * It's up to the user to replace that location with the starter location by either calling `router.push` or `router.replace`.
 *
 * @param base - Base applied to all urls, defaults to '/'
 * @returns a history object that can be passed to the router constructor
 */


function createMemoryHistory(base = '') {
  let listeners = [];
  let queue = [START];
  let position = 0;
  base = normalizeBase(base);

  function setLocation(location) {
    position++;

    if (position === queue.length) {
      // we are at the end, we can simply append a new entry
      queue.push(location);
    } else {
      // we are in the middle, we remove everything from here in the queue
      queue.splice(position);
      queue.push(location);
    }
  }

  function triggerListeners(to, from, {
    direction,
    delta
  }) {
    const info = {
      direction,
      delta,
      type: NavigationType.pop
    };

    for (const callback of listeners) {
      callback(to, from, info);
    }
  }

  const routerHistory = {
    // rewritten by Object.defineProperty
    location: START,
    // TODO: should be kept in queue
    state: {},
    base,
    createHref: createHref.bind(null, base),

    replace(to) {
      // remove current entry and decrement position
      queue.splice(position--, 1);
      setLocation(to);
    },

    push(to, data) {
      setLocation(to);
    },

    listen(callback) {
      listeners.push(callback);
      return () => {
        const index = listeners.indexOf(callback);
        if (index > -1) listeners.splice(index, 1);
      };
    },

    destroy() {
      listeners = [];
      queue = [START];
      position = 0;
    },

    go(delta, shouldTrigger = true) {
      const from = this.location;
      const direction = // we are considering delta === 0 going forward, but in abstract mode
      // using 0 for the delta doesn't make sense like it does in html5 where
      // it reloads the page
      delta < 0 ? NavigationDirection.back : NavigationDirection.forward;
      position = Math.max(0, Math.min(position + delta, queue.length - 1));

      if (shouldTrigger) {
        triggerListeners(this.location, from, {
          direction,
          delta
        });
      }
    }

  };
  Object.defineProperty(routerHistory, 'location', {
    enumerable: true,
    get: () => queue[position]
  });
  return routerHistory;
}
/**
 * Creates a hash history. Useful for web applications with no host (e.g.
 * `file://`) or when configuring a server to handle any URL is not possible.
 *
 * @param base - optional base to provide. Defaults to `location.pathname +
 * location.search` If there is a `<base>` tag in the `head`, its value will be
 * ignored in favor of this parameter **but note it affects all the
 * history.pushState() calls**, meaning that if you use a `<base>` tag, it's
 * `href` value **has to match this parameter** (ignoring anything after the
 * `#`).
 *
 * @example
 * ```js
 * // at https://example.com/folder
 * createWebHashHistory() // gives a url of `https://example.com/folder#`
 * createWebHashHistory('/folder/') // gives a url of `https://example.com/folder/#`
 * // if the `#` is provided in the base, it won't be added by `createWebHashHistory`
 * createWebHashHistory('/folder/#/app/') // gives a url of `https://example.com/folder/#/app/`
 * // you should avoid doing this because it changes the original url and breaks copying urls
 * createWebHashHistory('/other-folder/') // gives a url of `https://example.com/other-folder/#`
 *
 * // at file:///usr/etc/folder/index.html
 * // for locations with no `host`, the base is ignored
 * createWebHashHistory('/iAmIgnored') // gives a url of `file:///usr/etc/folder/index.html#`
 * ```
 */


function createWebHashHistory(base) {
  // Make sure this implementation is fine in terms of encoding, specially for IE11
  // for `file://`, directly use the pathname and ignore the base
  // location.pathname contains an initial `/` even at the root: `https://example.com`
  base = location.host ? base || location.pathname + location.search : ''; // allow the user to provide a `#` in the middle: `/base/#/app`

  if (!base.includes('#')) base += '#';

  if (false) {}

  return createWebHistory(base);
}

function isRouteLocation(route) {
  return typeof route === 'string' || route && typeof route === 'object';
}

function isRouteName(name) {
  return typeof name === 'string' || typeof name === 'symbol';
}
/**
 * Initial route location where the router is. Can be used in navigation guards
 * to differentiate the initial navigation.
 *
 * @example
 * ```js
 * import { START_LOCATION } from 'vue-router'
 *
 * router.beforeEach((to, from) => {
 *   if (from === START_LOCATION) {
 *     // initial navigation
 *   }
 * })
 * ```
 */


const START_LOCATION_NORMALIZED = {
  path: '/',
  name: undefined,
  params: {},
  query: {},
  hash: '',
  fullPath: '/',
  matched: [],
  meta: {},
  redirectedFrom: undefined
};
const NavigationFailureSymbol = /*#__PURE__*/PolySymbol( false ? 0 : 'nf');
/**
 * Enumeration with all possible types for navigation failures. Can be passed to
 * {@link isNavigationFailure} to check for specific failures.
 */

var NavigationFailureType;

(function (NavigationFailureType) {
  /**
   * An aborted navigation is a navigation that failed because a navigation
   * guard returned `false` or called `next(false)`
   */
  NavigationFailureType[NavigationFailureType["aborted"] = 4] = "aborted";
  /**
   * A cancelled navigation is a navigation that failed because a more recent
   * navigation finished started (not necessarily finished).
   */

  NavigationFailureType[NavigationFailureType["cancelled"] = 8] = "cancelled";
  /**
   * A duplicated navigation is a navigation that failed because it was
   * initiated while already being at the exact same location.
   */

  NavigationFailureType[NavigationFailureType["duplicated"] = 16] = "duplicated";
})(NavigationFailureType || (NavigationFailureType = {})); // DEV only debug messages


const ErrorTypeMessages = {
  [1
  /* MATCHER_NOT_FOUND */
  ]({
    location,
    currentLocation
  }) {
    return `No match for\n ${JSON.stringify(location)}${currentLocation ? '\nwhile being at\n' + JSON.stringify(currentLocation) : ''}`;
  },

  [2
  /* NAVIGATION_GUARD_REDIRECT */
  ]({
    from,
    to
  }) {
    return `Redirected from "${from.fullPath}" to "${stringifyRoute(to)}" via a navigation guard.`;
  },

  [4
  /* NAVIGATION_ABORTED */
  ]({
    from,
    to
  }) {
    return `Navigation aborted from "${from.fullPath}" to "${to.fullPath}" via a navigation guard.`;
  },

  [8
  /* NAVIGATION_CANCELLED */
  ]({
    from,
    to
  }) {
    return `Navigation cancelled from "${from.fullPath}" to "${to.fullPath}" with a new navigation.`;
  },

  [16
  /* NAVIGATION_DUPLICATED */
  ]({
    from,
    to
  }) {
    return `Avoided redundant navigation to current location: "${from.fullPath}".`;
  }

};

function createRouterError(type, params) {
  // keep full error messages in cjs versions
  if (false) {} else {
    return vue_router_esm_bundler_assign(new Error(), {
      type,
      [NavigationFailureSymbol]: true
    }, params);
  }
}

function isNavigationFailure(error, type) {
  return error instanceof Error && NavigationFailureSymbol in error && (type == null || !!(error.type & type));
}

const propertiesToLog = ['params', 'query', 'hash'];

function stringifyRoute(to) {
  if (typeof to === 'string') return to;
  if ('path' in to) return to.path;
  const location = {};

  for (const key of propertiesToLog) {
    if (key in to) location[key] = to[key];
  }

  return JSON.stringify(location, null, 2);
} // default pattern for a param: non greedy everything but /


const BASE_PARAM_PATTERN = '[^/]+?';
const BASE_PATH_PARSER_OPTIONS = {
  sensitive: false,
  strict: false,
  start: true,
  end: true
}; // Special Regex characters that must be escaped in static tokens

const REGEX_CHARS_RE = /[.+*?^${}()[\]/\\]/g;
/**
 * Creates a path parser from an array of Segments (a segment is an array of Tokens)
 *
 * @param segments - array of segments returned by tokenizePath
 * @param extraOptions - optional options for the regexp
 * @returns a PathParser
 */

function tokensToParser(segments, extraOptions) {
  const options = vue_router_esm_bundler_assign({}, BASE_PATH_PARSER_OPTIONS, extraOptions); // the amount of scores is the same as the length of segments except for the root segment "/"

  const score = []; // the regexp as a string

  let pattern = options.start ? '^' : ''; // extracted keys

  const keys = [];

  for (const segment of segments) {
    // the root segment needs special treatment
    const segmentScores = segment.length ? [] : [90
    /* Root */
    ]; // allow trailing slash

    if (options.strict && !segment.length) pattern += '/';

    for (let tokenIndex = 0; tokenIndex < segment.length; tokenIndex++) {
      const token = segment[tokenIndex]; // resets the score if we are inside a sub segment /:a-other-:b

      let subSegmentScore = 40
      /* Segment */
      + (options.sensitive ? 0.25
      /* BonusCaseSensitive */
      : 0);

      if (token.type === 0
      /* Static */
      ) {
        // prepend the slash if we are starting a new segment
        if (!tokenIndex) pattern += '/';
        pattern += token.value.replace(REGEX_CHARS_RE, '\\$&');
        subSegmentScore += 40
        /* Static */
        ;
      } else if (token.type === 1
      /* Param */
      ) {
        const {
          value,
          repeatable,
          optional,
          regexp
        } = token;
        keys.push({
          name: value,
          repeatable,
          optional
        });
        const re = regexp ? regexp : BASE_PARAM_PATTERN; // the user provided a custom regexp /:id(\\d+)

        if (re !== BASE_PARAM_PATTERN) {
          subSegmentScore += 10
          /* BonusCustomRegExp */
          ; // make sure the regexp is valid before using it

          try {
            new RegExp(`(${re})`);
          } catch (err) {
            throw new Error(`Invalid custom RegExp for param "${value}" (${re}): ` + err.message);
          }
        } // when we repeat we must take care of the repeating leading slash


        let subPattern = repeatable ? `((?:${re})(?:/(?:${re}))*)` : `(${re})`; // prepend the slash if we are starting a new segment

        if (!tokenIndex) subPattern = // avoid an optional / if there are more segments e.g. /:p?-static
        // or /:p?-:p2
        optional && segment.length < 2 ? `(?:/${subPattern})` : '/' + subPattern;
        if (optional) subPattern += '?';
        pattern += subPattern;
        subSegmentScore += 20
        /* Dynamic */
        ;
        if (optional) subSegmentScore += -8
        /* BonusOptional */
        ;
        if (repeatable) subSegmentScore += -20
        /* BonusRepeatable */
        ;
        if (re === '.*') subSegmentScore += -50
        /* BonusWildcard */
        ;
      }

      segmentScores.push(subSegmentScore);
    } // an empty array like /home/ -> [[{home}], []]
    // if (!segment.length) pattern += '/'


    score.push(segmentScores);
  } // only apply the strict bonus to the last score


  if (options.strict && options.end) {
    const i = score.length - 1;
    score[i][score[i].length - 1] += 0.7000000000000001
    /* BonusStrict */
    ;
  } // TODO: dev only warn double trailing slash


  if (!options.strict) pattern += '/?';
  if (options.end) pattern += '$'; // allow paths like /dynamic to only match dynamic or dynamic/... but not dynamic_something_else
  else if (options.strict) pattern += '(?:/|$)';
  const re = new RegExp(pattern, options.sensitive ? '' : 'i');

  function parse(path) {
    const match = path.match(re);
    const params = {};
    if (!match) return null;

    for (let i = 1; i < match.length; i++) {
      const value = match[i] || '';
      const key = keys[i - 1];
      params[key.name] = value && key.repeatable ? value.split('/') : value;
    }

    return params;
  }

  function stringify(params) {
    let path = ''; // for optional parameters to allow to be empty

    let avoidDuplicatedSlash = false;

    for (const segment of segments) {
      if (!avoidDuplicatedSlash || !path.endsWith('/')) path += '/';
      avoidDuplicatedSlash = false;

      for (const token of segment) {
        if (token.type === 0
        /* Static */
        ) {
          path += token.value;
        } else if (token.type === 1
        /* Param */
        ) {
          const {
            value,
            repeatable,
            optional
          } = token;
          const param = value in params ? params[value] : '';
          if (Array.isArray(param) && !repeatable) throw new Error(`Provided param "${value}" is an array but it is not repeatable (* or + modifiers)`);
          const text = Array.isArray(param) ? param.join('/') : param;

          if (!text) {
            if (optional) {
              // if we have more than one optional param like /:a?-static we
              // don't need to care about the optional param
              if (segment.length < 2) {
                // remove the last slash as we could be at the end
                if (path.endsWith('/')) path = path.slice(0, -1); // do not append a slash on the next iteration
                else avoidDuplicatedSlash = true;
              }
            } else throw new Error(`Missing required param "${value}"`);
          }

          path += text;
        }
      }
    }

    return path;
  }

  return {
    re,
    score,
    keys,
    parse,
    stringify
  };
}
/**
 * Compares an array of numbers as used in PathParser.score and returns a
 * number. This function can be used to `sort` an array
 *
 * @param a - first array of numbers
 * @param b - second array of numbers
 * @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
 * should be sorted first
 */


function compareScoreArray(a, b) {
  let i = 0;

  while (i < a.length && i < b.length) {
    const diff = b[i] - a[i]; // only keep going if diff === 0

    if (diff) return diff;
    i++;
  } // if the last subsegment was Static, the shorter segments should be sorted first
  // otherwise sort the longest segment first


  if (a.length < b.length) {
    return a.length === 1 && a[0] === 40
    /* Static */
    + 40
    /* Segment */
    ? -1 : 1;
  } else if (a.length > b.length) {
    return b.length === 1 && b[0] === 40
    /* Static */
    + 40
    /* Segment */
    ? 1 : -1;
  }

  return 0;
}
/**
 * Compare function that can be used with `sort` to sort an array of PathParser
 *
 * @param a - first PathParser
 * @param b - second PathParser
 * @returns 0 if both are equal, < 0 if a should be sorted first, > 0 if b
 */


function comparePathParserScore(a, b) {
  let i = 0;
  const aScore = a.score;
  const bScore = b.score;

  while (i < aScore.length && i < bScore.length) {
    const comp = compareScoreArray(aScore[i], bScore[i]); // do not return if both are equal

    if (comp) return comp;
    i++;
  } // if a and b share the same score entries but b has more, sort b first


  return bScore.length - aScore.length; // this is the ternary version
  // return aScore.length < bScore.length
  //   ? 1
  //   : aScore.length > bScore.length
  //   ? -1
  //   : 0
}

const ROOT_TOKEN = {
  type: 0
  /* Static */
  ,
  value: ''
};
const VALID_PARAM_RE = /[a-zA-Z0-9_]/; // After some profiling, the cache seems to be unnecessary because tokenizePath
// (the slowest part of adding a route) is very fast
// const tokenCache = new Map<string, Token[][]>()

function tokenizePath(path) {
  if (!path) return [[]];
  if (path === '/') return [[ROOT_TOKEN]];

  if (!path.startsWith('/')) {
    throw new Error( false ? 0 : `Invalid path "${path}"`);
  } // if (tokenCache.has(path)) return tokenCache.get(path)!


  function crash(message) {
    throw new Error(`ERR (${state})/"${buffer}": ${message}`);
  }

  let state = 0
  /* Static */
  ;
  let previousState = state;
  const tokens = []; // the segment will always be valid because we get into the initial state
  // with the leading /

  let segment;

  function finalizeSegment() {
    if (segment) tokens.push(segment);
    segment = [];
  } // index on the path


  let i = 0; // char at index

  let char; // buffer of the value read

  let buffer = ''; // custom regexp for a param

  let customRe = '';

  function consumeBuffer() {
    if (!buffer) return;

    if (state === 0
    /* Static */
    ) {
      segment.push({
        type: 0
        /* Static */
        ,
        value: buffer
      });
    } else if (state === 1
    /* Param */
    || state === 2
    /* ParamRegExp */
    || state === 3
    /* ParamRegExpEnd */
    ) {
      if (segment.length > 1 && (char === '*' || char === '+')) crash(`A repeatable param (${buffer}) must be alone in its segment. eg: '/:ids+.`);
      segment.push({
        type: 1
        /* Param */
        ,
        value: buffer,
        regexp: customRe,
        repeatable: char === '*' || char === '+',
        optional: char === '*' || char === '?'
      });
    } else {
      crash('Invalid state to consume buffer');
    }

    buffer = '';
  }

  function addCharToBuffer() {
    buffer += char;
  }

  while (i < path.length) {
    char = path[i++];

    if (char === '\\' && state !== 2
    /* ParamRegExp */
    ) {
      previousState = state;
      state = 4
      /* EscapeNext */
      ;
      continue;
    }

    switch (state) {
      case 0
      /* Static */
      :
        if (char === '/') {
          if (buffer) {
            consumeBuffer();
          }

          finalizeSegment();
        } else if (char === ':') {
          consumeBuffer();
          state = 1
          /* Param */
          ;
        } else {
          addCharToBuffer();
        }

        break;

      case 4
      /* EscapeNext */
      :
        addCharToBuffer();
        state = previousState;
        break;

      case 1
      /* Param */
      :
        if (char === '(') {
          state = 2
          /* ParamRegExp */
          ;
        } else if (VALID_PARAM_RE.test(char)) {
          addCharToBuffer();
        } else {
          consumeBuffer();
          state = 0
          /* Static */
          ; // go back one character if we were not modifying

          if (char !== '*' && char !== '?' && char !== '+') i--;
        }

        break;

      case 2
      /* ParamRegExp */
      :
        // TODO: is it worth handling nested regexp? like :p(?:prefix_([^/]+)_suffix)
        // it already works by escaping the closing )
        // https://paths.esm.dev/?p=AAMeJbiAwQEcDKbAoAAkP60PG2R6QAvgNaA6AFACM2ABuQBB#
        // is this really something people need since you can also write
        // /prefix_:p()_suffix
        if (char === ')') {
          // handle the escaped )
          if (customRe[customRe.length - 1] == '\\') customRe = customRe.slice(0, -1) + char;else state = 3
          /* ParamRegExpEnd */
          ;
        } else {
          customRe += char;
        }

        break;

      case 3
      /* ParamRegExpEnd */
      :
        // same as finalizing a param
        consumeBuffer();
        state = 0
        /* Static */
        ; // go back one character if we were not modifying

        if (char !== '*' && char !== '?' && char !== '+') i--;
        customRe = '';
        break;

      default:
        crash('Unknown state');
        break;
    }
  }

  if (state === 2
  /* ParamRegExp */
  ) crash(`Unfinished custom RegExp for param "${buffer}"`);
  consumeBuffer();
  finalizeSegment(); // tokenCache.set(path, tokens)

  return tokens;
}

function createRouteRecordMatcher(record, parent, options) {
  const parser = tokensToParser(tokenizePath(record.path), options); // warn against params with the same name

  if (false) {}

  const matcher = vue_router_esm_bundler_assign(parser, {
    record,
    parent,
    // these needs to be populated by the parent
    children: [],
    alias: []
  });

  if (parent) {
    // both are aliases or both are not aliases
    // we don't want to mix them because the order is used when
    // passing originalRecord in Matcher.addRoute
    if (!matcher.record.aliasOf === !parent.record.aliasOf) parent.children.push(matcher);
  }

  return matcher;
}
/**
 * Creates a Router Matcher.
 *
 * @internal
 * @param routes - array of initial routes
 * @param globalOptions - global route options
 */


function createRouterMatcher(routes, globalOptions) {
  // normalized ordered array of matchers
  const matchers = [];
  const matcherMap = new Map();
  globalOptions = vue_router_esm_bundler_mergeOptions({
    strict: false,
    end: true,
    sensitive: false
  }, globalOptions);

  function getRecordMatcher(name) {
    return matcherMap.get(name);
  }

  function addRoute(record, parent, originalRecord) {
    // used later on to remove by name
    const isRootAdd = !originalRecord;
    const mainNormalizedRecord = normalizeRouteRecord(record); // we might be the child of an alias

    mainNormalizedRecord.aliasOf = originalRecord && originalRecord.record;
    const options = vue_router_esm_bundler_mergeOptions(globalOptions, record); // generate an array of records to correctly handle aliases

    const normalizedRecords = [mainNormalizedRecord];

    if ('alias' in record) {
      const aliases = typeof record.alias === 'string' ? [record.alias] : record.alias;

      for (const alias of aliases) {
        normalizedRecords.push(vue_router_esm_bundler_assign({}, mainNormalizedRecord, {
          // this allows us to hold a copy of the `components` option
          // so that async components cache is hold on the original record
          components: originalRecord ? originalRecord.record.components : mainNormalizedRecord.components,
          path: alias,
          // we might be the child of an alias
          aliasOf: originalRecord ? originalRecord.record : mainNormalizedRecord // the aliases are always of the same kind as the original since they
          // are defined on the same record

        }));
      }
    }

    let matcher;
    let originalMatcher;

    for (const normalizedRecord of normalizedRecords) {
      const {
        path
      } = normalizedRecord; // Build up the path for nested routes if the child isn't an absolute
      // route. Only add the / delimiter if the child path isn't empty and if the
      // parent path doesn't have a trailing slash

      if (parent && path[0] !== '/') {
        const parentPath = parent.record.path;
        const connectingSlash = parentPath[parentPath.length - 1] === '/' ? '' : '/';
        normalizedRecord.path = parent.record.path + (path && connectingSlash + path);
      }

      if (false) {} // create the object before hand so it can be passed to children


      matcher = createRouteRecordMatcher(normalizedRecord, parent, options);
      if (false) {} // if we are an alias we must tell the original record that we exist
      // so we can be removed

      if (originalRecord) {
        originalRecord.alias.push(matcher);

        if (false) {}
      } else {
        // otherwise, the first record is the original and others are aliases
        originalMatcher = originalMatcher || matcher;
        if (originalMatcher !== matcher) originalMatcher.alias.push(matcher); // remove the route if named and only for the top record (avoid in nested calls)
        // this works because the original record is the first one

        if (isRootAdd && record.name && !isAliasRecord(matcher)) removeRoute(record.name);
      }

      if ('children' in mainNormalizedRecord) {
        const children = mainNormalizedRecord.children;

        for (let i = 0; i < children.length; i++) {
          addRoute(children[i], matcher, originalRecord && originalRecord.children[i]);
        }
      } // if there was no original record, then the first one was not an alias and all
      // other alias (if any) need to reference this record when adding children


      originalRecord = originalRecord || matcher; // TODO: add normalized records for more flexibility
      // if (parent && isAliasRecord(originalRecord)) {
      //   parent.children.push(originalRecord)
      // }

      insertMatcher(matcher);
    }

    return originalMatcher ? () => {
      // since other matchers are aliases, they should be removed by the original matcher
      removeRoute(originalMatcher);
    } : vue_router_esm_bundler_noop;
  }

  function removeRoute(matcherRef) {
    if (isRouteName(matcherRef)) {
      const matcher = matcherMap.get(matcherRef);

      if (matcher) {
        matcherMap.delete(matcherRef);
        matchers.splice(matchers.indexOf(matcher), 1);
        matcher.children.forEach(removeRoute);
        matcher.alias.forEach(removeRoute);
      }
    } else {
      const index = matchers.indexOf(matcherRef);

      if (index > -1) {
        matchers.splice(index, 1);
        if (matcherRef.record.name) matcherMap.delete(matcherRef.record.name);
        matcherRef.children.forEach(removeRoute);
        matcherRef.alias.forEach(removeRoute);
      }
    }
  }

  function getRoutes() {
    return matchers;
  }

  function insertMatcher(matcher) {
    let i = 0; // console.log('i is', { i })

    while (i < matchers.length && comparePathParserScore(matcher, matchers[i]) >= 0) i++; // console.log('END i is', { i })
    // while (i < matchers.length && matcher.score <= matchers[i].score) i++


    matchers.splice(i, 0, matcher); // only add the original record to the name map

    if (matcher.record.name && !isAliasRecord(matcher)) matcherMap.set(matcher.record.name, matcher);
  }

  function resolve(location, currentLocation) {
    let matcher;
    let params = {};
    let path;
    let name;

    if ('name' in location && location.name) {
      matcher = matcherMap.get(location.name);
      if (!matcher) throw createRouterError(1
      /* MATCHER_NOT_FOUND */
      , {
        location
      });
      name = matcher.record.name;
      params = vue_router_esm_bundler_assign( // paramsFromLocation is a new object
      paramsFromLocation(currentLocation.params, // only keep params that exist in the resolved location
      // TODO: only keep optional params coming from a parent record
      matcher.keys.filter(k => !k.optional).map(k => k.name)), location.params); // throws if cannot be stringified

      path = matcher.stringify(params);
    } else if ('path' in location) {
      // no need to resolve the path with the matcher as it was provided
      // this also allows the user to control the encoding
      path = location.path;

      if (false) {}

      matcher = matchers.find(m => m.re.test(path)); // matcher should have a value after the loop

      if (matcher) {
        // TODO: dev warning of unused params if provided
        // we know the matcher works because we tested the regexp
        params = matcher.parse(path);
        name = matcher.record.name;
      } // location is a relative path

    } else {
      // match by name or path of current route
      matcher = currentLocation.name ? matcherMap.get(currentLocation.name) : matchers.find(m => m.re.test(currentLocation.path));
      if (!matcher) throw createRouterError(1
      /* MATCHER_NOT_FOUND */
      , {
        location,
        currentLocation
      });
      name = matcher.record.name; // since we are navigating to the same location, we don't need to pick the
      // params like when `name` is provided

      params = vue_router_esm_bundler_assign({}, currentLocation.params, location.params);
      path = matcher.stringify(params);
    }

    const matched = [];
    let parentMatcher = matcher;

    while (parentMatcher) {
      // reversed order so parents are at the beginning
      matched.unshift(parentMatcher.record);
      parentMatcher = parentMatcher.parent;
    }

    return {
      name,
      path,
      params,
      matched,
      meta: mergeMetaFields(matched)
    };
  } // add initial routes


  routes.forEach(route => addRoute(route));
  return {
    addRoute,
    resolve,
    removeRoute,
    getRoutes,
    getRecordMatcher
  };
}

function paramsFromLocation(params, keys) {
  const newParams = {};

  for (const key of keys) {
    if (key in params) newParams[key] = params[key];
  }

  return newParams;
}
/**
 * Normalizes a RouteRecordRaw. Creates a copy
 *
 * @param record
 * @returns the normalized version
 */


function normalizeRouteRecord(record) {
  return {
    path: record.path,
    redirect: record.redirect,
    name: record.name,
    meta: record.meta || {},
    aliasOf: undefined,
    beforeEnter: record.beforeEnter,
    props: normalizeRecordProps(record),
    children: record.children || [],
    instances: {},
    leaveGuards: new Set(),
    updateGuards: new Set(),
    enterCallbacks: {},
    components: 'components' in record ? record.components || {} : {
      default: record.component
    }
  };
}
/**
 * Normalize the optional `props` in a record to always be an object similar to
 * components. Also accept a boolean for components.
 * @param record
 */


function normalizeRecordProps(record) {
  const propsObject = {}; // props does not exist on redirect records but we can set false directly

  const props = record.props || false;

  if ('component' in record) {
    propsObject.default = props;
  } else {
    // NOTE: we could also allow a function to be applied to every component.
    // Would need user feedback for use cases
    for (const name in record.components) propsObject[name] = typeof props === 'boolean' ? props : props[name];
  }

  return propsObject;
}
/**
 * Checks if a record or any of its parent is an alias
 * @param record
 */


function isAliasRecord(record) {
  while (record) {
    if (record.record.aliasOf) return true;
    record = record.parent;
  }

  return false;
}
/**
 * Merge meta fields of an array of records
 *
 * @param matched - array of matched records
 */


function mergeMetaFields(matched) {
  return matched.reduce((meta, record) => vue_router_esm_bundler_assign(meta, record.meta), {});
}

function vue_router_esm_bundler_mergeOptions(defaults, partialOptions) {
  const options = {};

  for (const key in defaults) {
    options[key] = key in partialOptions ? partialOptions[key] : defaults[key];
  }

  return options;
}

function isSameParam(a, b) {
  return a.name === b.name && a.optional === b.optional && a.repeatable === b.repeatable;
}
/**
 * Check if a path and its alias have the same required params
 *
 * @param a - original record
 * @param b - alias record
 */


function checkSameParams(a, b) {
  for (const key of a.keys) {
    if (!key.optional && !b.keys.find(isSameParam.bind(null, key))) return vue_router_esm_bundler_warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" should have the exact same param named "${key.name}"`);
  }

  for (const key of b.keys) {
    if (!key.optional && !a.keys.find(isSameParam.bind(null, key))) return vue_router_esm_bundler_warn(`Alias "${b.record.path}" and the original record: "${a.record.path}" should have the exact same param named "${key.name}"`);
  }
}

function checkMissingParamsInAbsolutePath(record, parent) {
  for (const key of parent.keys) {
    if (!record.keys.find(isSameParam.bind(null, key))) return vue_router_esm_bundler_warn(`Absolute path "${record.record.path}" should have the exact same param named "${key.name}" as its parent "${parent.record.path}".`);
  }
}
/**
 * Encoding Rules ␣ = Space Path: ␣ " < > # ? { } Query: ␣ " < > # & = Hash: ␣ "
 * < > `
 *
 * On top of that, the RFC3986 (https://tools.ietf.org/html/rfc3986#section-2.2)
 * defines some extra characters to be encoded. Most browsers do not encode them
 * in encodeURI https://github.com/whatwg/url/issues/369, so it may be safer to
 * also encode `!'()*`. Leaving unencoded only ASCII alphanumeric(`a-zA-Z0-9`)
 * plus `-._~`. This extra safety should be applied to query by patching the
 * string returned by encodeURIComponent encodeURI also encodes `[\]^`. `\`
 * should be encoded to avoid ambiguity. Browsers (IE, FF, C) transform a `\`
 * into a `/` if directly typed in. The _backtick_ (`````) should also be
 * encoded everywhere because some browsers like FF encode it when directly
 * written while others don't. Safari and IE don't encode ``"<>{}``` in hash.
 */
// const EXTRA_RESERVED_RE = /[!'()*]/g
// const encodeReservedReplacer = (c: string) => '%' + c.charCodeAt(0).toString(16)


const HASH_RE = /#/g; // %23

const AMPERSAND_RE = /&/g; // %26

const SLASH_RE = /\//g; // %2F

const EQUAL_RE = /=/g; // %3D

const IM_RE = /\?/g; // %3F

const PLUS_RE = /\+/g; // %2B

/**
 * NOTE: It's not clear to me if we should encode the + symbol in queries, it
 * seems to be less flexible than not doing so and I can't find out the legacy
 * systems requiring this for regular requests like text/html. In the standard,
 * the encoding of the plus character is only mentioned for
 * application/x-www-form-urlencoded
 * (https://url.spec.whatwg.org/#urlencoded-parsing) and most browsers seems lo
 * leave the plus character as is in queries. To be more flexible, we allow the
 * plus character on the query but it can also be manually encoded by the user.
 *
 * Resources:
 * - https://url.spec.whatwg.org/#urlencoded-parsing
 * - https://stackoverflow.com/questions/1634271/url-encoding-the-space-character-or-20
 */

const ENC_BRACKET_OPEN_RE = /%5B/g; // [

const ENC_BRACKET_CLOSE_RE = /%5D/g; // ]

const ENC_CARET_RE = /%5E/g; // ^

const ENC_BACKTICK_RE = /%60/g; // `

const ENC_CURLY_OPEN_RE = /%7B/g; // {

const ENC_PIPE_RE = /%7C/g; // |

const ENC_CURLY_CLOSE_RE = /%7D/g; // }

const ENC_SPACE_RE = /%20/g; // }

/**
 * Encode characters that need to be encoded on the path, search and hash
 * sections of the URL.
 *
 * @internal
 * @param text - string to encode
 * @returns encoded string
 */

function commonEncode(text) {
  return encodeURI('' + text).replace(ENC_PIPE_RE, '|').replace(ENC_BRACKET_OPEN_RE, '[').replace(ENC_BRACKET_CLOSE_RE, ']');
}
/**
 * Encode characters that need to be encoded on the hash section of the URL.
 *
 * @param text - string to encode
 * @returns encoded string
 */


function encodeHash(text) {
  return commonEncode(text).replace(ENC_CURLY_OPEN_RE, '{').replace(ENC_CURLY_CLOSE_RE, '}').replace(ENC_CARET_RE, '^');
}
/**
 * Encode characters that need to be encoded query values on the query
 * section of the URL.
 *
 * @param text - string to encode
 * @returns encoded string
 */


function encodeQueryValue(text) {
  return commonEncode(text) // Encode the space as +, encode the + to differentiate it from the space
  .replace(PLUS_RE, '%2B').replace(ENC_SPACE_RE, '+').replace(HASH_RE, '%23').replace(AMPERSAND_RE, '%26').replace(ENC_BACKTICK_RE, '`').replace(ENC_CURLY_OPEN_RE, '{').replace(ENC_CURLY_CLOSE_RE, '}').replace(ENC_CARET_RE, '^');
}
/**
 * Like `encodeQueryValue` but also encodes the `=` character.
 *
 * @param text - string to encode
 */


function encodeQueryKey(text) {
  return encodeQueryValue(text).replace(EQUAL_RE, '%3D');
}
/**
 * Encode characters that need to be encoded on the path section of the URL.
 *
 * @param text - string to encode
 * @returns encoded string
 */


function encodePath(text) {
  return commonEncode(text).replace(HASH_RE, '%23').replace(IM_RE, '%3F');
}
/**
 * Encode characters that need to be encoded on the path section of the URL as a
 * param. This function encodes everything {@link encodePath} does plus the
 * slash (`/`) character. If `text` is `null` or `undefined`, returns an empty
 * string instead.
 *
 * @param text - string to encode
 * @returns encoded string
 */


function encodeParam(text) {
  return text == null ? '' : encodePath(text).replace(SLASH_RE, '%2F');
}
/**
 * Decode text using `decodeURIComponent`. Returns the original text if it
 * fails.
 *
 * @param text - string to decode
 * @returns decoded string
 */


function decode(text) {
  try {
    return decodeURIComponent('' + text);
  } catch (err) {
     false && 0;
  }

  return '' + text;
}
/**
 * Transforms a queryString into a {@link LocationQuery} object. Accept both, a
 * version with the leading `?` and without Should work as URLSearchParams

 * @internal
 *
 * @param search - search string to parse
 * @returns a query object
 */


function parseQuery(search) {
  const query = {}; // avoid creating an object with an empty key and empty value
  // because of split('&')

  if (search === '' || search === '?') return query;
  const hasLeadingIM = search[0] === '?';
  const searchParams = (hasLeadingIM ? search.slice(1) : search).split('&');

  for (let i = 0; i < searchParams.length; ++i) {
    // pre decode the + into space
    const searchParam = searchParams[i].replace(PLUS_RE, ' '); // allow the = character

    const eqPos = searchParam.indexOf('=');
    const key = decode(eqPos < 0 ? searchParam : searchParam.slice(0, eqPos));
    const value = eqPos < 0 ? null : decode(searchParam.slice(eqPos + 1));

    if (key in query) {
      // an extra variable for ts types
      let currentValue = query[key];

      if (!Array.isArray(currentValue)) {
        currentValue = query[key] = [currentValue];
      }

      currentValue.push(value);
    } else {
      query[key] = value;
    }
  }

  return query;
}
/**
 * Stringifies a {@link LocationQueryRaw} object. Like `URLSearchParams`, it
 * doesn't prepend a `?`
 *
 * @internal
 *
 * @param query - query object to stringify
 * @returns string version of the query without the leading `?`
 */


function stringifyQuery(query) {
  let search = '';

  for (let key in query) {
    const value = query[key];
    key = encodeQueryKey(key);

    if (value == null) {
      // only null adds the value
      if (value !== undefined) {
        search += (search.length ? '&' : '') + key;
      }

      continue;
    } // keep null values


    const values = Array.isArray(value) ? value.map(v => v && encodeQueryValue(v)) : [value && encodeQueryValue(value)];
    values.forEach(value => {
      // skip undefined values in arrays as if they were not present
      // smaller code than using filter
      if (value !== undefined) {
        // only append & with non-empty search
        search += (search.length ? '&' : '') + key;
        if (value != null) search += '=' + value;
      }
    });
  }

  return search;
}
/**
 * Transforms a {@link LocationQueryRaw} into a {@link LocationQuery} by casting
 * numbers into strings, removing keys with an undefined value and replacing
 * undefined with null in arrays
 *
 * @param query - query object to normalize
 * @returns a normalized query object
 */


function normalizeQuery(query) {
  const normalizedQuery = {};

  for (const key in query) {
    const value = query[key];

    if (value !== undefined) {
      normalizedQuery[key] = Array.isArray(value) ? value.map(v => v == null ? null : '' + v) : value == null ? value : '' + value;
    }
  }

  return normalizedQuery;
}
/**
 * Create a list of callbacks that can be reset. Used to create before and after navigation guards list
 */


function useCallbacks() {
  let handlers = [];

  function add(handler) {
    handlers.push(handler);
    return () => {
      const i = handlers.indexOf(handler);
      if (i > -1) handlers.splice(i, 1);
    };
  }

  function reset() {
    handlers = [];
  }

  return {
    add,
    list: () => handlers,
    reset
  };
}

function registerGuard(record, name, guard) {
  const removeFromList = () => {
    record[name].delete(guard);
  };

  onUnmounted(removeFromList);
  onDeactivated(removeFromList);
  onActivated(() => {
    record[name].add(guard);
  });
  record[name].add(guard);
}
/**
 * Add a navigation guard that triggers whenever the component for the current
 * location is about to be left. Similar to {@link beforeRouteLeave} but can be
 * used in any component. The guard is removed when the component is unmounted.
 *
 * @param leaveGuard - {@link NavigationGuard}
 */


function onBeforeRouteLeave(leaveGuard) {
  if (false) {}

  const activeRecord = inject(matchedRouteKey, // to avoid warning
  {}).value;

  if (!activeRecord) {
     false && 0;
    return;
  }

  registerGuard(activeRecord, 'leaveGuards', leaveGuard);
}
/**
 * Add a navigation guard that triggers whenever the current location is about
 * to be updated. Similar to {@link beforeRouteUpdate} but can be used in any
 * component. The guard is removed when the component is unmounted.
 *
 * @param updateGuard - {@link NavigationGuard}
 */


function onBeforeRouteUpdate(updateGuard) {
  if (false) {}

  const activeRecord = inject(matchedRouteKey, // to avoid warning
  {}).value;

  if (!activeRecord) {
     false && 0;
    return;
  }

  registerGuard(activeRecord, 'updateGuards', updateGuard);
}

function guardToPromiseFn(guard, to, from, record, name) {
  // keep a reference to the enterCallbackArray to prevent pushing callbacks if a new navigation took place
  const enterCallbackArray = record && ( // name is defined if record is because of the function overload
  record.enterCallbacks[name] = record.enterCallbacks[name] || []);
  return () => new Promise((resolve, reject) => {
    const next = valid => {
      if (valid === false) reject(createRouterError(4
      /* NAVIGATION_ABORTED */
      , {
        from,
        to
      }));else if (valid instanceof Error) {
        reject(valid);
      } else if (isRouteLocation(valid)) {
        reject(createRouterError(2
        /* NAVIGATION_GUARD_REDIRECT */
        , {
          from: to,
          to: valid
        }));
      } else {
        if (enterCallbackArray && // since enterCallbackArray is truthy, both record and name also are
        record.enterCallbacks[name] === enterCallbackArray && typeof valid === 'function') enterCallbackArray.push(valid);
        resolve();
      }
    }; // wrapping with Promise.resolve allows it to work with both async and sync guards


    const guardReturn = guard.call(record && record.instances[name], to, from,  false ? 0 : next);
    let guardCall = Promise.resolve(guardReturn);
    if (guard.length < 3) guardCall = guardCall.then(next);

    if (false) {}

    guardCall.catch(err => reject(err));
  });
}

function canOnlyBeCalledOnce(next, to, from) {
  let called = 0;
  return function () {
    if (called++ === 1) vue_router_esm_bundler_warn(`The "next" callback was called more than once in one navigation guard when going from "${from.fullPath}" to "${to.fullPath}". It should be called exactly one time in each navigation guard. This will fail in production.`); // @ts-expect-error: we put it in the original one because it's easier to check

    next._called = true;
    if (called === 1) next.apply(null, arguments);
  };
}

function extractComponentsGuards(matched, guardType, to, from) {
  const guards = [];

  for (const record of matched) {
    for (const name in record.components) {
      let rawComponent = record.components[name];

      if (false) {} // skip update and leave guards if the route component is not mounted


      if (guardType !== 'beforeRouteEnter' && !record.instances[name]) continue;

      if (isRouteComponent(rawComponent)) {
        // __vccOpts is added by vue-class-component and contain the regular options
        const options = rawComponent.__vccOpts || rawComponent;
        const guard = options[guardType];
        guard && guards.push(guardToPromiseFn(guard, to, from, record, name));
      } else {
        // start requesting the chunk already
        let componentPromise = rawComponent();

        if (false) {}

        guards.push(() => componentPromise.then(resolved => {
          if (!resolved) return Promise.reject(new Error(`Couldn't resolve component "${name}" at "${record.path}"`));
          const resolvedComponent = isESModule(resolved) ? resolved.default : resolved; // replace the function with the resolved component

          record.components[name] = resolvedComponent; // __vccOpts is added by vue-class-component and contain the regular options

          const options = resolvedComponent.__vccOpts || resolvedComponent;
          const guard = options[guardType];
          return guard && guardToPromiseFn(guard, to, from, record, name)();
        }));
      }
    }
  }

  return guards;
}
/**
 * Allows differentiating lazy components from functional components and vue-class-component
 *
 * @param component
 */


function isRouteComponent(component) {
  return typeof component === 'object' || 'displayName' in component || 'props' in component || '__vccOpts' in component;
} // TODO: we could allow currentRoute as a prop to expose `isActive` and
// `isExactActive` behavior should go through an RFC


function useLink(props) {
  const router = runtime_core_esm_bundler_inject(routerKey);
  const currentRoute = runtime_core_esm_bundler_inject(routeLocationKey);
  const route = runtime_core_esm_bundler_computed(() => router.resolve(reactivity_esm_bundler_unref(props.to)));
  const activeRecordIndex = runtime_core_esm_bundler_computed(() => {
    const {
      matched
    } = route.value;
    const {
      length
    } = matched;
    const routeMatched = matched[length - 1];
    const currentMatched = currentRoute.matched;
    if (!routeMatched || !currentMatched.length) return -1;
    const index = currentMatched.findIndex(isSameRouteRecord.bind(null, routeMatched));
    if (index > -1) return index; // possible parent record

    const parentRecordPath = getOriginalPath(matched[length - 2]);
    return (// we are dealing with nested routes
      length > 1 && // if the parent and matched route have the same path, this link is
      // referring to the empty child. Or we currently are on a different
      // child of the same parent
      getOriginalPath(routeMatched) === parentRecordPath && // avoid comparing the child with its parent
      currentMatched[currentMatched.length - 1].path !== parentRecordPath ? currentMatched.findIndex(isSameRouteRecord.bind(null, matched[length - 2])) : index
    );
  });
  const isActive = runtime_core_esm_bundler_computed(() => activeRecordIndex.value > -1 && includesParams(currentRoute.params, route.value.params));
  const isExactActive = runtime_core_esm_bundler_computed(() => activeRecordIndex.value > -1 && activeRecordIndex.value === currentRoute.matched.length - 1 && isSameRouteLocationParams(currentRoute.params, route.value.params));

  function navigate(e = {}) {
    if (guardEvent(e)) {
      return router[reactivity_esm_bundler_unref(props.replace) ? 'replace' : 'push'](reactivity_esm_bundler_unref(props.to) // avoid uncaught errors are they are logged anyway
      ).catch(vue_router_esm_bundler_noop);
    }

    return Promise.resolve();
  } // devtools only


  if (( false || __VUE_PROD_DEVTOOLS__) && isBrowser) {
    const instance = runtime_core_esm_bundler_getCurrentInstance();

    if (instance) {
      const linkContextDevtools = {
        route: route.value,
        isActive: isActive.value,
        isExactActive: isExactActive.value
      }; // @ts-expect-error: this is internal

      instance.__vrl_devtools = instance.__vrl_devtools || []; // @ts-expect-error: this is internal

      instance.__vrl_devtools.push(linkContextDevtools);

      runtime_core_esm_bundler_watchEffect(() => {
        linkContextDevtools.route = route.value;
        linkContextDevtools.isActive = isActive.value;
        linkContextDevtools.isExactActive = isExactActive.value;
      }, {
        flush: 'post'
      });
    }
  }

  return {
    route,
    href: runtime_core_esm_bundler_computed(() => route.value.href),
    isActive,
    isExactActive,
    navigate
  };
}

const RouterLinkImpl = /*#__PURE__*/runtime_core_esm_bundler_defineComponent({
  name: 'RouterLink',
  props: {
    to: {
      type: [String, Object],
      required: true
    },
    replace: Boolean,
    activeClass: String,
    // inactiveClass: String,
    exactActiveClass: String,
    custom: Boolean,
    ariaCurrentValue: {
      type: String,
      default: 'page'
    }
  },
  useLink,

  setup(props, {
    slots
  }) {
    const link = reactivity_esm_bundler_reactive(useLink(props));
    const {
      options
    } = runtime_core_esm_bundler_inject(routerKey);
    const elClass = runtime_core_esm_bundler_computed(() => ({
      [getLinkClass(props.activeClass, options.linkActiveClass, 'router-link-active')]: link.isActive,
      // [getLinkClass(
      //   props.inactiveClass,
      //   options.linkInactiveClass,
      //   'router-link-inactive'
      // )]: !link.isExactActive,
      [getLinkClass(props.exactActiveClass, options.linkExactActiveClass, 'router-link-exact-active')]: link.isExactActive
    }));
    return () => {
      const children = slots.default && slots.default(link);
      return props.custom ? children : h('a', {
        'aria-current': link.isExactActive ? props.ariaCurrentValue : null,
        href: link.href,
        // this would override user added attrs but Vue will still add
        // the listener so we end up triggering both
        onClick: link.navigate,
        class: elClass.value
      }, children);
    };
  }

}); // export the public type for h/tsx inference
// also to avoid inline import() in generated d.ts files

/**
 * Component to render a link that triggers a navigation on click.
 */

const RouterLink = RouterLinkImpl;

function guardEvent(e) {
  // don't redirect with control keys
  if (e.metaKey || e.altKey || e.ctrlKey || e.shiftKey) return; // don't redirect when preventDefault called

  if (e.defaultPrevented) return; // don't redirect on right click

  if (e.button !== undefined && e.button !== 0) return; // don't redirect if `target="_blank"`
  // @ts-expect-error getAttribute does exist

  if (e.currentTarget && e.currentTarget.getAttribute) {
    // @ts-expect-error getAttribute exists
    const target = e.currentTarget.getAttribute('target');
    if (/\b_blank\b/i.test(target)) return;
  } // this may be a Weex event which doesn't have this method


  if (e.preventDefault) e.preventDefault();
  return true;
}

function includesParams(outer, inner) {
  for (const key in inner) {
    const innerValue = inner[key];
    const outerValue = outer[key];

    if (typeof innerValue === 'string') {
      if (innerValue !== outerValue) return false;
    } else {
      if (!Array.isArray(outerValue) || outerValue.length !== innerValue.length || innerValue.some((value, i) => value !== outerValue[i])) return false;
    }
  }

  return true;
}
/**
 * Get the original path value of a record by following its aliasOf
 * @param record
 */


function getOriginalPath(record) {
  return record ? record.aliasOf ? record.aliasOf.path : record.path : '';
}
/**
 * Utility class to get the active class based on defaults.
 * @param propClass
 * @param globalClass
 * @param defaultClass
 */


const getLinkClass = (propClass, globalClass, defaultClass) => propClass != null ? propClass : globalClass != null ? globalClass : defaultClass;

const RouterViewImpl = /*#__PURE__*/runtime_core_esm_bundler_defineComponent({
  name: 'RouterView',
  // #674 we manually inherit them
  inheritAttrs: false,
  props: {
    name: {
      type: String,
      default: 'default'
    },
    route: Object
  },

  setup(props, {
    attrs,
    slots
  }) {
     false && 0;
    const injectedRoute = runtime_core_esm_bundler_inject(routerViewLocationKey);
    const routeToDisplay = runtime_core_esm_bundler_computed(() => props.route || injectedRoute.value);
    const depth = runtime_core_esm_bundler_inject(viewDepthKey, 0);
    const matchedRouteRef = runtime_core_esm_bundler_computed(() => routeToDisplay.value.matched[depth]);
    runtime_core_esm_bundler_provide(viewDepthKey, depth + 1);
    runtime_core_esm_bundler_provide(matchedRouteKey, matchedRouteRef);
    runtime_core_esm_bundler_provide(routerViewLocationKey, routeToDisplay);
    const viewRef = reactivity_esm_bundler_ref(); // watch at the same time the component instance, the route record we are
    // rendering, and the name

    runtime_core_esm_bundler_watch(() => [viewRef.value, matchedRouteRef.value, props.name], ([instance, to, name], [oldInstance, from, oldName]) => {
      // copy reused instances
      if (to) {
        // this will update the instance for new instances as well as reused
        // instances when navigating to a new route
        to.instances[name] = instance; // the component instance is reused for a different route or name so
        // we copy any saved update or leave guards. With async setup, the
        // mounting component will mount before the matchedRoute changes,
        // making instance === oldInstance, so we check if guards have been
        // added before. This works because we remove guards when
        // unmounting/deactivating components

        if (from && from !== to && instance && instance === oldInstance) {
          if (!to.leaveGuards.size) {
            to.leaveGuards = from.leaveGuards;
          }

          if (!to.updateGuards.size) {
            to.updateGuards = from.updateGuards;
          }
        }
      } // trigger beforeRouteEnter next callbacks


      if (instance && to && ( // if there is no instance but to and from are the same this might be
      // the first visit
      !from || !isSameRouteRecord(to, from) || !oldInstance)) {
        (to.enterCallbacks[name] || []).forEach(callback => callback(instance));
      }
    }, {
      flush: 'post'
    });
    return () => {
      const route = routeToDisplay.value;
      const matchedRoute = matchedRouteRef.value;
      const ViewComponent = matchedRoute && matchedRoute.components[props.name]; // we need the value at the time we render because when we unmount, we
      // navigated to a different location so the value is different

      const currentName = props.name;

      if (!ViewComponent) {
        return vue_router_esm_bundler_normalizeSlot(slots.default, {
          Component: ViewComponent,
          route
        });
      } // props from route configuration


      const routePropsOption = matchedRoute.props[props.name];
      const routeProps = routePropsOption ? routePropsOption === true ? route.params : typeof routePropsOption === 'function' ? routePropsOption(route) : routePropsOption : null;

      const onVnodeUnmounted = vnode => {
        // remove the instance reference to prevent leak
        if (vnode.component.isUnmounted) {
          matchedRoute.instances[currentName] = null;
        }
      };

      const component = h(ViewComponent, vue_router_esm_bundler_assign({}, routeProps, attrs, {
        onVnodeUnmounted,
        ref: viewRef
      }));

      if (( false || __VUE_PROD_DEVTOOLS__) && isBrowser && component.ref) {
        // TODO: can display if it's an alias, its props
        const info = {
          depth,
          name: matchedRoute.name,
          path: matchedRoute.path,
          meta: matchedRoute.meta
        };
        const internalInstances = Array.isArray(component.ref) ? component.ref.map(r => r.i) : [component.ref.i];
        internalInstances.forEach(instance => {
          // @ts-expect-error
          instance.__vrv_devtools = info;
        });
      }

      return (// pass the vnode to the slot as a prop.
        // h and <component :is="..."> both accept vnodes
        vue_router_esm_bundler_normalizeSlot(slots.default, {
          Component: component,
          route
        }) || component
      );
    };
  }

});

function vue_router_esm_bundler_normalizeSlot(slot, data) {
  if (!slot) return null;
  const slotContent = slot(data);
  return slotContent.length === 1 ? slotContent[0] : slotContent;
} // export the public type for h/tsx inference
// also to avoid inline import() in generated d.ts files

/**
 * Component to display the current route the user is at.
 */


const RouterView = RouterViewImpl; // warn against deprecated usage with <transition> & <keep-alive>
// due to functional component being no longer eager in Vue 3

function warnDeprecatedUsage() {
  const instance = getCurrentInstance();
  const parentName = instance.parent && instance.parent.type.name;

  if (parentName && (parentName === 'KeepAlive' || parentName.includes('Transition'))) {
    const comp = parentName === 'KeepAlive' ? 'keep-alive' : 'transition';
    vue_router_esm_bundler_warn(`<router-view> can no longer be used directly inside <transition> or <keep-alive>.\n` + `Use slot props instead:\n\n` + `<router-view v-slot="{ Component }">\n` + `  <${comp}>\n` + `    <component :is="Component" />\n` + `  </${comp}>\n` + `</router-view>`);
  }
}

function formatRouteLocation(routeLocation, tooltip) {
  const copy = vue_router_esm_bundler_assign({}, routeLocation, {
    // remove variables that can contain vue instances
    matched: routeLocation.matched.map(matched => omit(matched, ['instances', 'children', 'aliasOf']))
  });
  return {
    _custom: {
      type: null,
      readOnly: true,
      display: routeLocation.fullPath,
      tooltip,
      value: copy
    }
  };
}

function formatDisplay(display) {
  return {
    _custom: {
      display
    }
  };
} // to support multiple router instances


let routerId = 0;

function addDevtools(app, router, matcher) {
  // Take over router.beforeEach and afterEach
  // make sure we are not registering the devtool twice
  if (router.__hasDevtools) return;
  router.__hasDevtools = true; // increment to support multiple router instances

  const id = routerId++;
  setupDevtoolsPlugin({
    id: 'org.vuejs.router' + (id ? '.' + id : ''),
    label: 'Vue Router',
    packageName: 'vue-router',
    homepage: 'https://next.router.vuejs.org/',
    logo: 'https://vuejs.org/images/icons/favicon-96x96.png',
    componentStateTypes: ['Routing'],
    app
  }, api => {
    // display state added by the router
    api.on.inspectComponent((payload, ctx) => {
      if (payload.instanceData) {
        payload.instanceData.state.push({
          type: 'Routing',
          key: '$route',
          editable: false,
          value: formatRouteLocation(router.currentRoute.value, 'Current Route')
        });
      }
    }); // mark router-link as active and display tags on router views

    api.on.visitComponentTree(({
      treeNode: node,
      componentInstance
    }) => {
      if (componentInstance.__vrv_devtools) {
        const info = componentInstance.__vrv_devtools;
        node.tags.push({
          label: (info.name ? `${info.name.toString()}: ` : '') + info.path,
          textColor: 0,
          tooltip: 'This component is rendered by &lt;router-view&gt;',
          backgroundColor: PINK_500
        });
      } // if multiple useLink are used


      if (Array.isArray(componentInstance.__vrl_devtools)) {
        componentInstance.__devtoolsApi = api;

        componentInstance.__vrl_devtools.forEach(devtoolsData => {
          let backgroundColor = ORANGE_400;
          let tooltip = '';

          if (devtoolsData.isExactActive) {
            backgroundColor = LIME_500;
            tooltip = 'This is exactly active';
          } else if (devtoolsData.isActive) {
            backgroundColor = BLUE_600;
            tooltip = 'This link is active';
          }

          node.tags.push({
            label: devtoolsData.route.path,
            textColor: 0,
            tooltip,
            backgroundColor
          });
        });
      }
    });
    runtime_core_esm_bundler_watch(router.currentRoute, () => {
      // refresh active state
      refreshRoutesView();
      api.notifyComponentUpdate();
      api.sendInspectorTree(routerInspectorId);
      api.sendInspectorState(routerInspectorId);
    });
    const navigationsLayerId = 'router:navigations:' + id;
    api.addTimelineLayer({
      id: navigationsLayerId,
      label: `Router${id ? ' ' + id : ''} Navigations`,
      color: 0x40a8c4
    }); // const errorsLayerId = 'router:errors'
    // api.addTimelineLayer({
    //   id: errorsLayerId,
    //   label: 'Router Errors',
    //   color: 0xea5455,
    // })

    router.onError((error, to) => {
      api.addTimelineEvent({
        layerId: navigationsLayerId,
        event: {
          title: 'Error during Navigation',
          subtitle: to.fullPath,
          logType: 'error',
          time: Date.now(),
          data: {
            error
          },
          groupId: to.meta.__navigationId
        }
      });
    }); // attached to `meta` and used to group events

    let navigationId = 0;
    router.beforeEach((to, from) => {
      const data = {
        guard: formatDisplay('beforeEach'),
        from: formatRouteLocation(from, 'Current Location during this navigation'),
        to: formatRouteLocation(to, 'Target location')
      }; // Used to group navigations together, hide from devtools

      Object.defineProperty(to.meta, '__navigationId', {
        value: navigationId++
      });
      api.addTimelineEvent({
        layerId: navigationsLayerId,
        event: {
          time: Date.now(),
          title: 'Start of navigation',
          subtitle: to.fullPath,
          data,
          groupId: to.meta.__navigationId
        }
      });
    });
    router.afterEach((to, from, failure) => {
      const data = {
        guard: formatDisplay('afterEach')
      };

      if (failure) {
        data.failure = {
          _custom: {
            type: Error,
            readOnly: true,
            display: failure ? failure.message : '',
            tooltip: 'Navigation Failure',
            value: failure
          }
        };
        data.status = formatDisplay('❌');
      } else {
        data.status = formatDisplay('✅');
      } // we set here to have the right order


      data.from = formatRouteLocation(from, 'Current Location during this navigation');
      data.to = formatRouteLocation(to, 'Target location');
      api.addTimelineEvent({
        layerId: navigationsLayerId,
        event: {
          title: 'End of navigation',
          subtitle: to.fullPath,
          time: Date.now(),
          data,
          logType: failure ? 'warning' : 'default',
          groupId: to.meta.__navigationId
        }
      });
    });
    /**
     * Inspector of Existing routes
     */

    const routerInspectorId = 'router-inspector:' + id;
    api.addInspector({
      id: routerInspectorId,
      label: 'Routes' + (id ? ' ' + id : ''),
      icon: 'book',
      treeFilterPlaceholder: 'Search routes'
    });

    function refreshRoutesView() {
      // the routes view isn't active
      if (!activeRoutesPayload) return;
      const payload = activeRoutesPayload; // children routes will appear as nested

      let routes = matcher.getRoutes().filter(route => !route.parent); // reset match state to false

      routes.forEach(resetMatchStateOnRouteRecord); // apply a match state if there is a payload

      if (payload.filter) {
        routes = routes.filter(route => // save matches state based on the payload
        isRouteMatching(route, payload.filter.toLowerCase()));
      } // mark active routes


      routes.forEach(route => markRouteRecordActive(route, router.currentRoute.value));
      payload.rootNodes = routes.map(formatRouteRecordForInspector);
    }

    let activeRoutesPayload;
    api.on.getInspectorTree(payload => {
      activeRoutesPayload = payload;

      if (payload.app === app && payload.inspectorId === routerInspectorId) {
        refreshRoutesView();
      }
    });
    /**
     * Display information about the currently selected route record
     */

    api.on.getInspectorState(payload => {
      if (payload.app === app && payload.inspectorId === routerInspectorId) {
        const routes = matcher.getRoutes();
        const route = routes.find(route => route.record.__vd_id === payload.nodeId);

        if (route) {
          payload.state = {
            options: formatRouteRecordMatcherForStateInspector(route)
          };
        }
      }
    });
    api.sendInspectorTree(routerInspectorId);
    api.sendInspectorState(routerInspectorId);
  });
}

function modifierForKey(key) {
  if (key.optional) {
    return key.repeatable ? '*' : '?';
  } else {
    return key.repeatable ? '+' : '';
  }
}

function formatRouteRecordMatcherForStateInspector(route) {
  const {
    record
  } = route;
  const fields = [{
    editable: false,
    key: 'path',
    value: record.path
  }];

  if (record.name != null) {
    fields.push({
      editable: false,
      key: 'name',
      value: record.name
    });
  }

  fields.push({
    editable: false,
    key: 'regexp',
    value: route.re
  });

  if (route.keys.length) {
    fields.push({
      editable: false,
      key: 'keys',
      value: {
        _custom: {
          type: null,
          readOnly: true,
          display: route.keys.map(key => `${key.name}${modifierForKey(key)}`).join(' '),
          tooltip: 'Param keys',
          value: route.keys
        }
      }
    });
  }

  if (record.redirect != null) {
    fields.push({
      editable: false,
      key: 'redirect',
      value: record.redirect
    });
  }

  if (route.alias.length) {
    fields.push({
      editable: false,
      key: 'aliases',
      value: route.alias.map(alias => alias.record.path)
    });
  }

  fields.push({
    key: 'score',
    editable: false,
    value: {
      _custom: {
        type: null,
        readOnly: true,
        display: route.score.map(score => score.join(', ')).join(' | '),
        tooltip: 'Score used to sort routes',
        value: route.score
      }
    }
  });
  return fields;
}
/**
 * Extracted from tailwind palette
 */


const PINK_500 = 0xec4899;
const BLUE_600 = 0x2563eb;
const LIME_500 = 0x84cc16;
const CYAN_400 = 0x22d3ee;
const ORANGE_400 = 0xfb923c; // const GRAY_100 = 0xf4f4f5

const DARK = 0x666666;

function formatRouteRecordForInspector(route) {
  const tags = [];
  const {
    record
  } = route;

  if (record.name != null) {
    tags.push({
      label: String(record.name),
      textColor: 0,
      backgroundColor: CYAN_400
    });
  }

  if (record.aliasOf) {
    tags.push({
      label: 'alias',
      textColor: 0,
      backgroundColor: ORANGE_400
    });
  }

  if (route.__vd_match) {
    tags.push({
      label: 'matches',
      textColor: 0,
      backgroundColor: PINK_500
    });
  }

  if (route.__vd_exactActive) {
    tags.push({
      label: 'exact',
      textColor: 0,
      backgroundColor: LIME_500
    });
  }

  if (route.__vd_active) {
    tags.push({
      label: 'active',
      textColor: 0,
      backgroundColor: BLUE_600
    });
  }

  if (record.redirect) {
    tags.push({
      label: 'redirect: ' + (typeof record.redirect === 'string' ? record.redirect : 'Object'),
      textColor: 0xffffff,
      backgroundColor: DARK
    });
  } // add an id to be able to select it. Using the `path` is not possible because
  // empty path children would collide with their parents


  let id = record.__vd_id;

  if (id == null) {
    id = String(routeRecordId++);
    record.__vd_id = id;
  }

  return {
    id,
    label: record.path,
    tags,
    children: route.children.map(formatRouteRecordForInspector)
  };
} //  incremental id for route records and inspector state


let routeRecordId = 0;
const EXTRACT_REGEXP_RE = /^\/(.*)\/([a-z]*)$/;

function markRouteRecordActive(route, currentRoute) {
  // no route will be active if matched is empty
  // reset the matching state
  const isExactActive = currentRoute.matched.length && isSameRouteRecord(currentRoute.matched[currentRoute.matched.length - 1], route.record);
  route.__vd_exactActive = route.__vd_active = isExactActive;

  if (!isExactActive) {
    route.__vd_active = currentRoute.matched.some(match => isSameRouteRecord(match, route.record));
  }

  route.children.forEach(childRoute => markRouteRecordActive(childRoute, currentRoute));
}

function resetMatchStateOnRouteRecord(route) {
  route.__vd_match = false;
  route.children.forEach(resetMatchStateOnRouteRecord);
}

function isRouteMatching(route, filter) {
  const found = String(route.re).match(EXTRACT_REGEXP_RE);
  route.__vd_match = false;

  if (!found || found.length < 3) {
    return false;
  } // use a regexp without $ at the end to match nested routes better


  const nonEndingRE = new RegExp(found[1].replace(/\$$/, ''), found[2]);

  if (nonEndingRE.test(filter)) {
    // mark children as matches
    route.children.forEach(child => isRouteMatching(child, filter)); // exception case: `/`

    if (route.record.path !== '/' || filter === '/') {
      route.__vd_match = route.re.test(filter);
      return true;
    } // hide the / route


    return false;
  }

  const path = route.record.path.toLowerCase();
  const decodedPath = decode(path); // also allow partial matching on the path

  if (!filter.startsWith('/') && (decodedPath.includes(filter) || path.includes(filter))) return true;
  if (decodedPath.startsWith(filter) || path.startsWith(filter)) return true;
  if (route.record.name && String(route.record.name).includes(filter)) return true;
  return route.children.some(child => isRouteMatching(child, filter));
}

function omit(obj, keys) {
  const ret = {};

  for (const key in obj) {
    if (!keys.includes(key)) {
      // @ts-expect-error
      ret[key] = obj[key];
    }
  }

  return ret;
}
/**
 * Creates a Router instance that can be used by a Vue app.
 *
 * @param options - {@link RouterOptions}
 */


function createRouter(options) {
  const matcher = createRouterMatcher(options.routes, options);
  const parseQuery$1 = options.parseQuery || parseQuery;
  const stringifyQuery$1 = options.stringifyQuery || stringifyQuery;
  const routerHistory = options.history;
  if (false) {}
  const beforeGuards = useCallbacks();
  const beforeResolveGuards = useCallbacks();
  const afterGuards = useCallbacks();
  const currentRoute = reactivity_esm_bundler_shallowRef(START_LOCATION_NORMALIZED);
  let pendingLocation = START_LOCATION_NORMALIZED; // leave the scrollRestoration if no scrollBehavior is provided

  if (isBrowser && options.scrollBehavior && 'scrollRestoration' in history) {
    history.scrollRestoration = 'manual';
  }

  const normalizeParams = applyToParams.bind(null, paramValue => '' + paramValue);
  const encodeParams = applyToParams.bind(null, encodeParam);
  const decodeParams = // @ts-expect-error: intentionally avoid the type check
  applyToParams.bind(null, decode);

  function addRoute(parentOrRoute, route) {
    let parent;
    let record;

    if (isRouteName(parentOrRoute)) {
      parent = matcher.getRecordMatcher(parentOrRoute);
      record = route;
    } else {
      record = parentOrRoute;
    }

    return matcher.addRoute(record, parent);
  }

  function removeRoute(name) {
    const recordMatcher = matcher.getRecordMatcher(name);

    if (recordMatcher) {
      matcher.removeRoute(recordMatcher);
    } else if (false) {}
  }

  function getRoutes() {
    return matcher.getRoutes().map(routeMatcher => routeMatcher.record);
  }

  function hasRoute(name) {
    return !!matcher.getRecordMatcher(name);
  }

  function resolve(rawLocation, currentLocation) {
    // const objectLocation = routerLocationAsObject(rawLocation)
    // we create a copy to modify it later
    currentLocation = vue_router_esm_bundler_assign({}, currentLocation || currentRoute.value);

    if (typeof rawLocation === 'string') {
      const locationNormalized = parseURL(parseQuery$1, rawLocation, currentLocation.path);
      const matchedRoute = matcher.resolve({
        path: locationNormalized.path
      }, currentLocation);
      const href = routerHistory.createHref(locationNormalized.fullPath);

      if (false) {} // locationNormalized is always a new object


      return vue_router_esm_bundler_assign(locationNormalized, matchedRoute, {
        params: decodeParams(matchedRoute.params),
        hash: decode(locationNormalized.hash),
        redirectedFrom: undefined,
        href
      });
    }

    let matcherLocation; // path could be relative in object as well

    if ('path' in rawLocation) {
      if (false) {}

      matcherLocation = vue_router_esm_bundler_assign({}, rawLocation, {
        path: parseURL(parseQuery$1, rawLocation.path, currentLocation.path).path
      });
    } else {
      // remove any nullish param
      const targetParams = vue_router_esm_bundler_assign({}, rawLocation.params);

      for (const key in targetParams) {
        if (targetParams[key] == null) {
          delete targetParams[key];
        }
      } // pass encoded values to the matcher so it can produce encoded path and fullPath


      matcherLocation = vue_router_esm_bundler_assign({}, rawLocation, {
        params: encodeParams(rawLocation.params)
      }); // current location params are decoded, we need to encode them in case the
      // matcher merges the params

      currentLocation.params = encodeParams(currentLocation.params);
    }

    const matchedRoute = matcher.resolve(matcherLocation, currentLocation);
    const hash = rawLocation.hash || '';

    if (false) {} // decoding them) the matcher might have merged current location params so
    // we need to run the decoding again


    matchedRoute.params = normalizeParams(decodeParams(matchedRoute.params));
    const fullPath = stringifyURL(stringifyQuery$1, vue_router_esm_bundler_assign({}, rawLocation, {
      hash: encodeHash(hash),
      path: matchedRoute.path
    }));
    const href = routerHistory.createHref(fullPath);

    if (false) {}

    return vue_router_esm_bundler_assign({
      fullPath,
      // keep the hash encoded so fullPath is effectively path + encodedQuery +
      // hash
      hash,
      query: // if the user is using a custom query lib like qs, we might have
      // nested objects, so we keep the query as is, meaning it can contain
      // numbers at `$route.query`, but at the point, the user will have to
      // use their own type anyway.
      // https://github.com/vuejs/vue-router-next/issues/328#issuecomment-649481567
      stringifyQuery$1 === stringifyQuery ? normalizeQuery(rawLocation.query) : rawLocation.query || {}
    }, matchedRoute, {
      redirectedFrom: undefined,
      href
    });
  }

  function locationAsObject(to) {
    return typeof to === 'string' ? parseURL(parseQuery$1, to, currentRoute.value.path) : vue_router_esm_bundler_assign({}, to);
  }

  function checkCanceledNavigation(to, from) {
    if (pendingLocation !== to) {
      return createRouterError(8
      /* NAVIGATION_CANCELLED */
      , {
        from,
        to
      });
    }
  }

  function push(to) {
    return pushWithRedirect(to);
  }

  function replace(to) {
    return push(vue_router_esm_bundler_assign(locationAsObject(to), {
      replace: true
    }));
  }

  function handleRedirectRecord(to) {
    const lastMatched = to.matched[to.matched.length - 1];

    if (lastMatched && lastMatched.redirect) {
      const {
        redirect
      } = lastMatched;
      let newTargetLocation = typeof redirect === 'function' ? redirect(to) : redirect;

      if (typeof newTargetLocation === 'string') {
        newTargetLocation = newTargetLocation.includes('?') || newTargetLocation.includes('#') ? newTargetLocation = locationAsObject(newTargetLocation) : // force empty params
        {
          path: newTargetLocation
        }; // @ts-expect-error: force empty params when a string is passed to let
        // the router parse them again

        newTargetLocation.params = {};
      }

      if (false) {}

      return vue_router_esm_bundler_assign({
        query: to.query,
        hash: to.hash,
        params: to.params
      }, newTargetLocation);
    }
  }

  function pushWithRedirect(to, redirectedFrom) {
    const targetLocation = pendingLocation = resolve(to);
    const from = currentRoute.value;
    const data = to.state;
    const force = to.force; // to could be a string where `replace` is a function

    const replace = to.replace === true;
    const shouldRedirect = handleRedirectRecord(targetLocation);
    if (shouldRedirect) return pushWithRedirect(vue_router_esm_bundler_assign(locationAsObject(shouldRedirect), {
      state: data,
      force,
      replace
    }), // keep original redirectedFrom if it exists
    redirectedFrom || targetLocation); // if it was a redirect we already called `pushWithRedirect` above

    const toLocation = targetLocation;
    toLocation.redirectedFrom = redirectedFrom;
    let failure;

    if (!force && isSameRouteLocation(stringifyQuery$1, from, targetLocation)) {
      failure = createRouterError(16
      /* NAVIGATION_DUPLICATED */
      , {
        to: toLocation,
        from
      }); // trigger scroll to allow scrolling to the same anchor

      handleScroll(from, from, // this is a push, the only way for it to be triggered from a
      // history.listen is with a redirect, which makes it become a push
      true, // This cannot be the first navigation because the initial location
      // cannot be manually navigated to
      false);
    }

    return (failure ? Promise.resolve(failure) : navigate(toLocation, from)).catch(error => isNavigationFailure(error) ? error : // reject any unknown error
    triggerError(error, toLocation, from)).then(failure => {
      if (failure) {
        if (isNavigationFailure(failure, 2
        /* NAVIGATION_GUARD_REDIRECT */
        )) {
          if (false) {}

          return pushWithRedirect( // keep options
          vue_router_esm_bundler_assign(locationAsObject(failure.to), {
            state: data,
            force,
            replace
          }), // preserve the original redirectedFrom if any
          redirectedFrom || toLocation);
        }
      } else {
        // if we fail we don't finalize the navigation
        failure = finalizeNavigation(toLocation, from, true, replace, data);
      }

      triggerAfterEach(toLocation, from, failure);
      return failure;
    });
  }
  /**
   * Helper to reject and skip all navigation guards if a new navigation happened
   * @param to
   * @param from
   */


  function checkCanceledNavigationAndReject(to, from) {
    const error = checkCanceledNavigation(to, from);
    return error ? Promise.reject(error) : Promise.resolve();
  } // TODO: refactor the whole before guards by internally using router.beforeEach


  function navigate(to, from) {
    let guards;
    const [leavingRecords, updatingRecords, enteringRecords] = extractChangingRecords(to, from); // all components here have been resolved once because we are leaving

    guards = extractComponentsGuards(leavingRecords.reverse(), 'beforeRouteLeave', to, from); // leavingRecords is already reversed

    for (const record of leavingRecords) {
      record.leaveGuards.forEach(guard => {
        guards.push(guardToPromiseFn(guard, to, from));
      });
    }

    const canceledNavigationCheck = checkCanceledNavigationAndReject.bind(null, to, from);
    guards.push(canceledNavigationCheck); // run the queue of per route beforeRouteLeave guards

    return runGuardQueue(guards).then(() => {
      // check global guards beforeEach
      guards = [];

      for (const guard of beforeGuards.list()) {
        guards.push(guardToPromiseFn(guard, to, from));
      }

      guards.push(canceledNavigationCheck);
      return runGuardQueue(guards);
    }).then(() => {
      // check in components beforeRouteUpdate
      guards = extractComponentsGuards(updatingRecords, 'beforeRouteUpdate', to, from);

      for (const record of updatingRecords) {
        record.updateGuards.forEach(guard => {
          guards.push(guardToPromiseFn(guard, to, from));
        });
      }

      guards.push(canceledNavigationCheck); // run the queue of per route beforeEnter guards

      return runGuardQueue(guards);
    }).then(() => {
      // check the route beforeEnter
      guards = [];

      for (const record of to.matched) {
        // do not trigger beforeEnter on reused views
        if (record.beforeEnter && !from.matched.includes(record)) {
          if (Array.isArray(record.beforeEnter)) {
            for (const beforeEnter of record.beforeEnter) guards.push(guardToPromiseFn(beforeEnter, to, from));
          } else {
            guards.push(guardToPromiseFn(record.beforeEnter, to, from));
          }
        }
      }

      guards.push(canceledNavigationCheck); // run the queue of per route beforeEnter guards

      return runGuardQueue(guards);
    }).then(() => {
      // NOTE: at this point to.matched is normalized and does not contain any () => Promise<Component>
      // clear existing enterCallbacks, these are added by extractComponentsGuards
      to.matched.forEach(record => record.enterCallbacks = {}); // check in-component beforeRouteEnter

      guards = extractComponentsGuards(enteringRecords, 'beforeRouteEnter', to, from);
      guards.push(canceledNavigationCheck); // run the queue of per route beforeEnter guards

      return runGuardQueue(guards);
    }).then(() => {
      // check global guards beforeResolve
      guards = [];

      for (const guard of beforeResolveGuards.list()) {
        guards.push(guardToPromiseFn(guard, to, from));
      }

      guards.push(canceledNavigationCheck);
      return runGuardQueue(guards);
    }) // catch any navigation canceled
    .catch(err => isNavigationFailure(err, 8
    /* NAVIGATION_CANCELLED */
    ) ? err : Promise.reject(err));
  }

  function triggerAfterEach(to, from, failure) {
    // navigation is confirmed, call afterGuards
    // TODO: wrap with error handlers
    for (const guard of afterGuards.list()) guard(to, from, failure);
  }
  /**
   * - Cleans up any navigation guards
   * - Changes the url if necessary
   * - Calls the scrollBehavior
   */


  function finalizeNavigation(toLocation, from, isPush, replace, data) {
    // a more recent navigation took place
    const error = checkCanceledNavigation(toLocation, from);
    if (error) return error; // only consider as push if it's not the first navigation

    const isFirstNavigation = from === START_LOCATION_NORMALIZED;
    const state = !isBrowser ? {} : history.state; // change URL only if the user did a push/replace and if it's not the initial navigation because
    // it's just reflecting the url

    if (isPush) {
      // on the initial navigation, we want to reuse the scroll position from
      // history state if it exists
      if (replace || isFirstNavigation) routerHistory.replace(toLocation.fullPath, vue_router_esm_bundler_assign({
        scroll: isFirstNavigation && state && state.scroll
      }, data));else routerHistory.push(toLocation.fullPath, data);
    } // accept current navigation


    currentRoute.value = toLocation;
    handleScroll(toLocation, from, isPush, isFirstNavigation);
    markAsReady();
  }

  let removeHistoryListener; // attach listener to history to trigger navigations

  function setupListeners() {
    removeHistoryListener = routerHistory.listen((to, _from, info) => {
      // cannot be a redirect route because it was in history
      const toLocation = resolve(to); // due to dynamic routing, and to hash history with manual navigation
      // (manually changing the url or calling history.hash = '#/somewhere'),
      // there could be a redirect record in history

      const shouldRedirect = handleRedirectRecord(toLocation);

      if (shouldRedirect) {
        pushWithRedirect(vue_router_esm_bundler_assign(shouldRedirect, {
          replace: true
        }), toLocation).catch(vue_router_esm_bundler_noop);
        return;
      }

      pendingLocation = toLocation;
      const from = currentRoute.value; // TODO: should be moved to web history?

      if (isBrowser) {
        saveScrollPosition(getScrollKey(from.fullPath, info.delta), computeScrollPosition());
      }

      navigate(toLocation, from).catch(error => {
        if (isNavigationFailure(error, 4
        /* NAVIGATION_ABORTED */
        | 8
        /* NAVIGATION_CANCELLED */
        )) {
          return error;
        }

        if (isNavigationFailure(error, 2
        /* NAVIGATION_GUARD_REDIRECT */
        )) {
          // Here we could call if (info.delta) routerHistory.go(-info.delta,
          // false) but this is bug prone as we have no way to wait the
          // navigation to be finished before calling pushWithRedirect. Using
          // a setTimeout of 16ms seems to work but there is not guarantee for
          // it to work on every browser. So Instead we do not restore the
          // history entry and trigger a new navigation as requested by the
          // navigation guard.
          // the error is already handled by router.push we just want to avoid
          // logging the error
          pushWithRedirect(error.to, toLocation // avoid an uncaught rejection, let push call triggerError
          ).then(failure => {
            // manual change in hash history #916 ending up in the URL not
            // changing but it was changed by the manual url change, so we
            // need to manually change it ourselves
            if (isNavigationFailure(failure, 4
            /* NAVIGATION_ABORTED */
            | 16
            /* NAVIGATION_DUPLICATED */
            ) && !info.delta && info.type === NavigationType.pop) {
              routerHistory.go(-1, false);
            }
          }).catch(vue_router_esm_bundler_noop); // avoid the then branch

          return Promise.reject();
        } // do not restore history on unknown direction


        if (info.delta) routerHistory.go(-info.delta, false); // unrecognized error, transfer to the global handler

        return triggerError(error, toLocation, from);
      }).then(failure => {
        failure = failure || finalizeNavigation( // after navigation, all matched components are resolved
        toLocation, from, false); // revert the navigation

        if (failure) {
          if (info.delta) {
            routerHistory.go(-info.delta, false);
          } else if (info.type === NavigationType.pop && isNavigationFailure(failure, 4
          /* NAVIGATION_ABORTED */
          | 16
          /* NAVIGATION_DUPLICATED */
          )) {
            // manual change in hash history #916
            // it's like a push but lacks the information of the direction
            routerHistory.go(-1, false);
          }
        }

        triggerAfterEach(toLocation, from, failure);
      }).catch(vue_router_esm_bundler_noop);
    });
  } // Initialization and Errors


  let readyHandlers = useCallbacks();
  let errorHandlers = useCallbacks();
  let ready;
  /**
   * Trigger errorHandlers added via onError and throws the error as well
   *
   * @param error - error to throw
   * @param to - location we were navigating to when the error happened
   * @param from - location we were navigating from when the error happened
   * @returns the error as a rejected promise
   */

  function triggerError(error, to, from) {
    markAsReady(error);
    const list = errorHandlers.list();

    if (list.length) {
      list.forEach(handler => handler(error, to, from));
    } else {
      if (false) {}

      console.error(error);
    }

    return Promise.reject(error);
  }

  function isReady() {
    if (ready && currentRoute.value !== START_LOCATION_NORMALIZED) return Promise.resolve();
    return new Promise((resolve, reject) => {
      readyHandlers.add([resolve, reject]);
    });
  }
  /**
   * Mark the router as ready, resolving the promised returned by isReady(). Can
   * only be called once, otherwise does nothing.
   * @param err - optional error
   */


  function markAsReady(err) {
    if (ready) return;
    ready = true;
    setupListeners();
    readyHandlers.list().forEach(([resolve, reject]) => err ? reject(err) : resolve());
    readyHandlers.reset();
  } // Scroll behavior


  function handleScroll(to, from, isPush, isFirstNavigation) {
    const {
      scrollBehavior
    } = options;
    if (!isBrowser || !scrollBehavior) return Promise.resolve();
    const scrollPosition = !isPush && getSavedScrollPosition(getScrollKey(to.fullPath, 0)) || (isFirstNavigation || !isPush) && history.state && history.state.scroll || null;
    return runtime_core_esm_bundler_nextTick().then(() => scrollBehavior(to, from, scrollPosition)).then(position => position && scrollToPosition(position)).catch(err => triggerError(err, to, from));
  }

  const go = delta => routerHistory.go(delta);

  let started;
  const installedApps = new Set();
  const router = {
    currentRoute,
    addRoute,
    removeRoute,
    hasRoute,
    getRoutes,
    resolve,
    options,
    push,
    replace,
    go,
    back: () => go(-1),
    forward: () => go(1),
    beforeEach: beforeGuards.add,
    beforeResolve: beforeResolveGuards.add,
    afterEach: afterGuards.add,
    onError: errorHandlers.add,
    isReady,

    install(app) {
      const router = this;
      app.component('RouterLink', RouterLink);
      app.component('RouterView', RouterView);
      app.config.globalProperties.$router = router;
      Object.defineProperty(app.config.globalProperties, '$route', {
        enumerable: true,
        get: () => reactivity_esm_bundler_unref(currentRoute)
      }); // this initial navigation is only necessary on client, on server it doesn't
      // make sense because it will create an extra unnecessary navigation and could
      // lead to problems

      if (isBrowser && // used for the initial navigation client side to avoid pushing
      // multiple times when the router is used in multiple apps
      !started && currentRoute.value === START_LOCATION_NORMALIZED) {
        // see above
        started = true;
        push(routerHistory.location).catch(err => {
          if (false) {}
        });
      }

      const reactiveRoute = {};

      for (const key in START_LOCATION_NORMALIZED) {
        // @ts-expect-error: the key matches
        reactiveRoute[key] = runtime_core_esm_bundler_computed(() => currentRoute.value[key]);
      }

      app.provide(routerKey, router);
      app.provide(routeLocationKey, reactivity_esm_bundler_reactive(reactiveRoute));
      app.provide(routerViewLocationKey, currentRoute);
      const unmountApp = app.unmount;
      installedApps.add(app);

      app.unmount = function () {
        installedApps.delete(app); // the router is not attached to an app anymore

        if (installedApps.size < 1) {
          // invalidate the current navigation
          pendingLocation = START_LOCATION_NORMALIZED;
          removeHistoryListener && removeHistoryListener();
          currentRoute.value = START_LOCATION_NORMALIZED;
          started = false;
          ready = false;
        }

        unmountApp();
      };

      if (( false || __VUE_PROD_DEVTOOLS__) && isBrowser) {
        addDevtools(app, router, matcher);
      }
    }

  };
  return router;
}

function runGuardQueue(guards) {
  return guards.reduce((promise, guard) => promise.then(() => guard()), Promise.resolve());
}

function extractChangingRecords(to, from) {
  const leavingRecords = [];
  const updatingRecords = [];
  const enteringRecords = [];
  const len = Math.max(from.matched.length, to.matched.length);

  for (let i = 0; i < len; i++) {
    const recordFrom = from.matched[i];

    if (recordFrom) {
      if (to.matched.find(record => isSameRouteRecord(record, recordFrom))) updatingRecords.push(recordFrom);else leavingRecords.push(recordFrom);
    }

    const recordTo = to.matched[i];

    if (recordTo) {
      // the type doesn't matter because we are comparing per reference
      if (!from.matched.find(record => isSameRouteRecord(record, recordTo))) {
        enteringRecords.push(recordTo);
      }
    }
  }

  return [leavingRecords, updatingRecords, enteringRecords];
}
/**
 * Returns the router instance. Equivalent to using `$router` inside
 * templates.
 */


function useRouter() {
  return inject(routerKey);
}
/**
 * Returns the current route location. Equivalent to using `$route` inside
 * templates.
 */


function useRoute() {
  return inject(routeLocationKey);
}


;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonIndex.vue?vue&type=template&id=f0af1e7e
/* unplugin-vue-components disabled */
function LessonIndexvue_type_template_id_f0af1e7e_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_router_view = resolveComponent("router-view");

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_router_view);
}
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled *//* harmony default export */ const LessonIndexvue_type_script_lang_js = ({
  components: {},

  data() {
    return {};
  },

  methods: {}
});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/Lesson/LessonIndex.vue
/* unplugin-vue-components disabled */



;
const LessonIndex_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonIndexvue_type_script_lang_js, [['render',LessonIndexvue_type_template_id_f0af1e7e_render]])

/* harmony default export */ const LessonIndex = (LessonIndex_exports_);
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-empty.css
var el_empty = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-empty.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-empty.css

      
      
      
      
      
      
      
      
      

var el_empty_options = {};

el_empty_options.styleTagTransform = (styleTagTransform_default());
el_empty_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_empty_options.insert = insertBySelector_default().bind(null, "head");
    
el_empty_options.domAPI = (styleDomAPI_default());
el_empty_options.insertStyleElement = (insertStyleElement_default());

var el_empty_update = injectStylesIntoStyleTag_default()(el_empty/* default */.Z, el_empty_options);




       /* harmony default export */ const theme_chalk_el_empty = (el_empty/* default */.Z && el_empty/* default.locals */.Z.locals ? el_empty/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/empty/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/empty/src/img-empty.mjs



let id = 0;
const img_empty_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ImgEmpty",
  setup() {
    return {
      id: ++id
    };
  }
});
const img_empty_hoisted_1 = {
  viewBox: "0 0 79 86",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "xmlns:xlink": "http://www.w3.org/1999/xlink"
};
const img_empty_hoisted_2 = ["id"];
const img_empty_hoisted_3 = /* @__PURE__ */ createBaseVNode("stop", {
  "stop-color": "var(--el-empty-fill-color-1)",
  offset: "0%"
}, null, -1);
const img_empty_hoisted_4 = /* @__PURE__ */ createBaseVNode("stop", {
  "stop-color": "var(--el-empty-fill-color-4)",
  offset: "100%"
}, null, -1);
const img_empty_hoisted_5 = [
  img_empty_hoisted_3,
  img_empty_hoisted_4
];
const img_empty_hoisted_6 = ["id"];
const img_empty_hoisted_7 = /* @__PURE__ */ createBaseVNode("stop", {
  "stop-color": "var(--el-empty-fill-color-1)",
  offset: "0%"
}, null, -1);
const img_empty_hoisted_8 = /* @__PURE__ */ createBaseVNode("stop", {
  "stop-color": "var(--el-empty-fill-color-6)",
  offset: "100%"
}, null, -1);
const img_empty_hoisted_9 = [
  img_empty_hoisted_7,
  img_empty_hoisted_8
];
const img_empty_hoisted_10 = ["id"];
const _hoisted_11 = {
  id: "Illustrations",
  stroke: "none",
  "stroke-width": "1",
  fill: "none",
  "fill-rule": "evenodd"
};
const _hoisted_12 = {
  id: "B-type",
  transform: "translate(-1268.000000, -535.000000)"
};
const _hoisted_13 = {
  id: "Group-2",
  transform: "translate(1268.000000, 535.000000)"
};
const _hoisted_14 = /* @__PURE__ */ createBaseVNode("path", {
  id: "Oval-Copy-2",
  d: "M39.5,86 C61.3152476,86 79,83.9106622 79,81.3333333 C79,78.7560045 57.3152476,78 35.5,78 C13.6847524,78 0,78.7560045 0,81.3333333 C0,83.9106622 17.6847524,86 39.5,86 Z",
  fill: "var(--el-empty-fill-color-3)"
}, null, -1);
const _hoisted_15 = /* @__PURE__ */ createBaseVNode("polygon", {
  id: "Rectangle-Copy-14",
  fill: "var(--el-empty-fill-color-7)",
  transform: "translate(27.500000, 51.500000) scale(1, -1) translate(-27.500000, -51.500000) ",
  points: "13 58 53 58 42 45 2 45"
}, null, -1);
const _hoisted_16 = {
  id: "Group-Copy",
  transform: "translate(34.500000, 31.500000) scale(-1, 1) rotate(-25.000000) translate(-34.500000, -31.500000) translate(7.000000, 10.000000)"
};
const _hoisted_17 = /* @__PURE__ */ createBaseVNode("polygon", {
  id: "Rectangle-Copy-10",
  fill: "var(--el-empty-fill-color-7)",
  transform: "translate(11.500000, 5.000000) scale(1, -1) translate(-11.500000, -5.000000) ",
  points: "2.84078316e-14 3 18 3 23 7 5 7"
}, null, -1);
const _hoisted_18 = /* @__PURE__ */ createBaseVNode("polygon", {
  id: "Rectangle-Copy-11",
  fill: "var(--el-empty-fill-color-5)",
  points: "-3.69149156e-15 7 38 7 38 43 -3.69149156e-15 43"
}, null, -1);
const _hoisted_19 = ["fill"];
const _hoisted_20 = /* @__PURE__ */ createBaseVNode("polygon", {
  id: "Rectangle-Copy-13",
  fill: "var(--el-empty-fill-color-2)",
  transform: "translate(39.500000, 3.500000) scale(-1, 1) translate(-39.500000, -3.500000) ",
  points: "24 7 41 7 55 -3.63806207e-12 38 -3.63806207e-12"
}, null, -1);
const _hoisted_21 = ["fill"];
const _hoisted_22 = {
  id: "Rectangle-Copy-17",
  transform: "translate(53.000000, 45.000000)"
};
const _hoisted_23 = ["id"];
const _hoisted_24 = ["xlink:href"];
const _hoisted_25 = ["xlink:href"];
const _hoisted_26 = ["mask"];
const _hoisted_27 = /* @__PURE__ */ createBaseVNode("polygon", {
  id: "Rectangle-Copy-18",
  fill: "var(--el-empty-fill-color-2)",
  transform: "translate(66.000000, 51.500000) scale(-1, 1) translate(-66.000000, -51.500000) ",
  points: "62 45 79 45 70 58 53 58"
}, null, -1);
function img_empty_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", img_empty_hoisted_1, [
    createBaseVNode("defs", null, [
      createBaseVNode("linearGradient", {
        id: `linearGradient-1-${_ctx.id}`,
        x1: "38.8503086%",
        y1: "0%",
        x2: "61.1496914%",
        y2: "100%"
      }, img_empty_hoisted_5, 8, img_empty_hoisted_2),
      createBaseVNode("linearGradient", {
        id: `linearGradient-2-${_ctx.id}`,
        x1: "0%",
        y1: "9.5%",
        x2: "100%",
        y2: "90.5%"
      }, img_empty_hoisted_9, 8, img_empty_hoisted_6),
      createBaseVNode("rect", {
        id: `path-3-${_ctx.id}`,
        x: "0",
        y: "0",
        width: "17",
        height: "36"
      }, null, 8, img_empty_hoisted_10)
    ]),
    createBaseVNode("g", _hoisted_11, [
      createBaseVNode("g", _hoisted_12, [
        createBaseVNode("g", _hoisted_13, [
          _hoisted_14,
          _hoisted_15,
          createBaseVNode("g", _hoisted_16, [
            _hoisted_17,
            _hoisted_18,
            createBaseVNode("rect", {
              id: "Rectangle-Copy-12",
              fill: `url(#linearGradient-1-${_ctx.id})`,
              transform: "translate(46.500000, 25.000000) scale(-1, 1) translate(-46.500000, -25.000000) ",
              x: "38",
              y: "7",
              width: "17",
              height: "36"
            }, null, 8, _hoisted_19),
            _hoisted_20
          ]),
          createBaseVNode("rect", {
            id: "Rectangle-Copy-15",
            fill: `url(#linearGradient-2-${_ctx.id})`,
            x: "13",
            y: "45",
            width: "40",
            height: "36"
          }, null, 8, _hoisted_21),
          createBaseVNode("g", _hoisted_22, [
            createBaseVNode("mask", {
              id: `mask-4-${_ctx.id}`,
              fill: "var(--el-empty-fill-color-0)"
            }, [
              createBaseVNode("use", {
                "xlink:href": `#path-3-${_ctx.id}`
              }, null, 8, _hoisted_24)
            ], 8, _hoisted_23),
            createBaseVNode("use", {
              id: "Mask",
              fill: "var(--el-empty-fill-color-8)",
              transform: "translate(8.500000, 18.000000) scale(-1, 1) translate(-8.500000, -18.000000) ",
              "xlink:href": `#path-3-${_ctx.id}`
            }, null, 8, _hoisted_25),
            createBaseVNode("polygon", {
              id: "Rectangle-Copy",
              fill: "var(--el-empty-fill-color-9)",
              mask: `url(#mask-4-${_ctx.id})`,
              transform: "translate(12.000000, 9.000000) scale(-1, 1) translate(-12.000000, -9.000000) ",
              points: "7 0 24 0 20 18 -1.70530257e-13 16"
            }, null, 8, _hoisted_26)
          ]),
          _hoisted_27
        ])
      ])
    ])
  ]);
}
var ImgEmpty = /* @__PURE__ */ _export_sfc(img_empty_sfc_main, [["render", img_empty_sfc_render]]);


//# sourceMappingURL=img-empty.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/empty/src/empty.mjs
const emptyProps = {
  image: {
    type: String,
    default: ""
  },
  imageSize: Number,
  description: {
    type: String,
    default: ""
  }
};


//# sourceMappingURL=empty.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/empty/src/empty2.mjs








const empty2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElEmpty",
  components: {
    ImgEmpty: ImgEmpty
  },
  props: emptyProps,
  setup(props) {
    const { t } = useLocale();
    const ns = useNamespace("empty");
    const emptyDescription = runtime_core_esm_bundler_computed(() => props.description || t("el.table.emptyText"));
    const imageStyle = runtime_core_esm_bundler_computed(() => ({
      width: props.imageSize ? `${props.imageSize}px` : ""
    }));
    return {
      ns,
      emptyDescription,
      imageStyle
    };
  }
});
const empty2_hoisted_1 = ["src"];
const empty2_hoisted_2 = { key: 1 };
function empty2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_img_empty = resolveComponent("img-empty");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass(_ctx.ns.b())
  }, [
    createBaseVNode("div", {
      class: normalizeClass(_ctx.ns.e("image")),
      style: normalizeStyle(_ctx.imageStyle)
    }, [
      _ctx.image ? (runtime_core_esm_bundler_openBlock(), createElementBlock("img", {
        key: 0,
        src: _ctx.image,
        ondragstart: "return false"
      }, null, 8, empty2_hoisted_1)) : renderSlot(_ctx.$slots, "image", { key: 1 }, () => [
        runtime_core_esm_bundler_createVNode(_component_img_empty)
      ])
    ], 6),
    createBaseVNode("div", {
      class: normalizeClass(_ctx.ns.e("description"))
    }, [
      _ctx.$slots.description ? renderSlot(_ctx.$slots, "description", { key: 0 }) : (runtime_core_esm_bundler_openBlock(), createElementBlock("p", empty2_hoisted_2, toDisplayString(_ctx.emptyDescription), 1))
    ], 2),
    _ctx.$slots.default ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 0,
      class: normalizeClass(_ctx.ns.e("bottom"))
    }, [
      renderSlot(_ctx.$slots, "default")
    ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 2);
}
var Empty = /* @__PURE__ */ _export_sfc(empty2_sfc_main, [["render", empty2_sfc_render]]);


//# sourceMappingURL=empty2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/empty/index.mjs




const ElEmpty = withInstall(Empty);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonMain.vue?vue&type=template&id=db88e92e
/* unplugin-vue-components disabled */



const LessonMainvue_type_template_id_db88e92e_hoisted_1 = /*#__PURE__*/createBaseVNode("div", {
  class: "card-header"
}, [/*#__PURE__*/createBaseVNode("span", null, "课程主页")], -1
/* HOISTED */
);

function LessonMainvue_type_template_id_db88e92e_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_empty = ElEmpty;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    shadow: "hover"
  }, {
    header: withCtx(() => [LessonMainvue_type_template_id_db88e92e_hoisted_1]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_empty, {
      description: "当前页面施工中..."
    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonMain.vue?vue&type=template&id=db88e92e
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonMain.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const LessonMainvue_type_script_lang_js = ({
  data() {
    return {
      lid: "",
      lessonDetail: {}
    };
  },

  methods: {
    async getLessonDetail(lid) {
      this.lessonDetail = await GetInfo.getLessonPageInfo(lid).then(res => {
        return res;
      }).then(res => {
        return res;
      });
    }

  }
});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonMain.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonMain.vue
/* unplugin-vue-components disabled */



;
const LessonMain_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonMainvue_type_script_lang_js, [['render',LessonMainvue_type_template_id_db88e92e_render]])

/* harmony default export */ const LessonMain = (LessonMain_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonResource.vue?vue&type=template&id=1a6d818a
/* unplugin-vue-components disabled */



const LessonResourcevue_type_template_id_1a6d818a_hoisted_1 = /*#__PURE__*/createBaseVNode("div", {
  class: "card-header"
}, [/*#__PURE__*/createBaseVNode("span", null, "课程资源")], -1
/* HOISTED */
);

function LessonResourcevue_type_template_id_1a6d818a_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_empty = ElEmpty;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    shadow: "hover"
  }, {
    header: withCtx(() => [LessonResourcevue_type_template_id_1a6d818a_hoisted_1]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_empty, {
      description: "当前页面施工中..."
    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonResource.vue?vue&type=template&id=1a6d818a
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonResource.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled *//* harmony default export */ const LessonResourcevue_type_script_lang_js = ({});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonResource.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonResource.vue
/* unplugin-vue-components disabled */



;
const LessonResource_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonResourcevue_type_script_lang_js, [['render',LessonResourcevue_type_template_id_1a6d818a_render]])

/* harmony default export */ const LessonResource = (LessonResource_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonNotify.vue?vue&type=template&id=22b96304
/* unplugin-vue-components disabled */



const LessonNotifyvue_type_template_id_22b96304_hoisted_1 = /*#__PURE__*/createBaseVNode("div", {
  class: "card-header"
}, [/*#__PURE__*/createBaseVNode("span", null, "课程通知")], -1
/* HOISTED */
);

function LessonNotifyvue_type_template_id_22b96304_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_empty = ElEmpty;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    shadow: "hover"
  }, {
    header: withCtx(() => [LessonNotifyvue_type_template_id_22b96304_hoisted_1]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_empty, {
      description: "当前页面施工中..."
    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonNotify.vue?vue&type=template&id=22b96304
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonNotify.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled *//* harmony default export */ const LessonNotifyvue_type_script_lang_js = ({});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonNotify.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonNotify.vue
/* unplugin-vue-components disabled */



;
const LessonNotify_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonNotifyvue_type_script_lang_js, [['render',LessonNotifyvue_type_template_id_22b96304_render]])

/* harmony default export */ const LessonNotify = (LessonNotify_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonHomework.vue?vue&type=template&id=06337d5e
/* unplugin-vue-components disabled */



const LessonHomeworkvue_type_template_id_06337d5e_hoisted_1 = /*#__PURE__*/createBaseVNode("div", {
  class: "card-header"
}, [/*#__PURE__*/createBaseVNode("span", null, "课程作业")], -1
/* HOISTED */
);

function LessonHomeworkvue_type_template_id_06337d5e_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_empty = ElEmpty;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, {
    shadow: "hover"
  }, {
    header: withCtx(() => [LessonHomeworkvue_type_template_id_06337d5e_hoisted_1]),
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_empty, {
      description: "当前页面施工中..."
    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonHomework.vue?vue&type=template&id=06337d5e
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonHomework.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled *//* harmony default export */ const LessonHomeworkvue_type_script_lang_js = ({});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonHomework.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonHomework.vue
/* unplugin-vue-components disabled */



;
const LessonHomework_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonHomeworkvue_type_script_lang_js, [['render',LessonHomeworkvue_type_template_id_06337d5e_render]])

/* harmony default export */ const LessonHomework = (LessonHomework_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=template&id=8515f78e&scoped=true
/* unplugin-vue-components disabled */






function LessonInfovue_type_template_id_8515f78e_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_lesson_homework = LessonHomework;

  const _component_el_col = ElCol;

  const _component_lesson_notify = LessonNotify;

  const _component_el_row = ElRow;

  const _component_lesson_resource = LessonResource;

  const _component_lesson_main = LessonMain;

  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", null, [runtime_core_esm_bundler_createVNode(_component_el_row, null, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 16
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_lesson_homework)]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 8
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_lesson_notify)]),
      _: 1
      /* STABLE */

    })]),
    _: 1
    /* STABLE */

  }), runtime_core_esm_bundler_createVNode(_component_el_row, null, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 16
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_lesson_resource)]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 8
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_lesson_main)]),
      _: 1
      /* STABLE */

    })]),
    _: 1
    /* STABLE */

  })]);
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=template&id=8515f78e&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */



/* harmony default export */ const LessonInfovue_type_script_lang_js = ({
  components: {
    LessonMain: LessonMain,
    LessonHomework: LessonHomework,
    LessonNotify: LessonNotify,
    LessonResource: LessonResource
  },

  data() {
    return {};
  },

  methods: {}
});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=style&index=0&id=8515f78e&scoped=true&lang=css
var LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=style&index=0&id=8515f78e&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=style&index=0&id=8515f78e&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_options = {};

LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css/* default */.Z, LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css_options);




       /* harmony default export */ const LessonInfo_LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css = (LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css/* default */.Z && LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css/* default.locals */.Z.locals ? LessonInfovue_type_style_index_0_id_8515f78e_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonInfo.vue?vue&type=style&index=0&id=8515f78e&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/Lesson/LessonInfo/LessonInfo.vue
/* unplugin-vue-components disabled */



;


const LessonInfo_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonInfovue_type_script_lang_js, [['render',LessonInfovue_type_template_id_8515f78e_scoped_true_render],['__scopeId',"data-v-8515f78e"]])

/* harmony default export */ const LessonInfo = (LessonInfo_exports_);
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-upload.css
var el_upload = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-upload.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-upload.css

      
      
      
      
      
      
      
      
      

var el_upload_options = {};

el_upload_options.styleTagTransform = (styleTagTransform_default());
el_upload_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_upload_options.insert = insertBySelector_default().bind(null, "head");
    
el_upload_options.domAPI = (styleDomAPI_default());
el_upload_options.insertStyleElement = (insertStyleElement_default());

var el_upload_update = injectStylesIntoStyleTag_default()(el_upload/* default */.Z, el_upload_options);




       /* harmony default export */ const theme_chalk_el_upload = (el_upload/* default */.Z && el_upload/* default.locals */.Z.locals ? el_upload/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-progress.css
var el_progress = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-progress.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-progress.css

      
      
      
      
      
      
      
      
      

var el_progress_options = {};

el_progress_options.styleTagTransform = (styleTagTransform_default());
el_progress_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_progress_options.insert = insertBySelector_default().bind(null, "head");
    
el_progress_options.domAPI = (styleDomAPI_default());
el_progress_options.insertStyleElement = (insertStyleElement_default());

var el_progress_update = injectStylesIntoStyleTag_default()(el_progress/* default */.Z, el_progress_options);




       /* harmony default export */ const theme_chalk_el_progress = (el_progress/* default */.Z && el_progress/* default.locals */.Z.locals ? el_progress/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/progress/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/style/css.mjs



//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/src/ajax.mjs


function getError(action, option, xhr) {
  let msg;
  if (xhr.response) {
    msg = `${xhr.response.error || xhr.response}`;
  } else if (xhr.responseText) {
    msg = `${xhr.responseText}`;
  } else {
    msg = `fail to ${option.method} ${action} ${xhr.status}`;
  }
  const err = new Error(msg);
  err.status = xhr.status;
  err.method = option.method;
  err.url = action;
  return err;
}
function getBody(xhr) {
  const text = xhr.responseText || xhr.response;
  if (!text) {
    return text;
  }
  try {
    return JSON.parse(text);
  } catch (e) {
    return text;
  }
}
function upload(option) {
  if (typeof XMLHttpRequest === "undefined") {
    return;
  }
  const xhr = new XMLHttpRequest();
  const action = option.action;
  if (xhr.upload) {
    xhr.upload.onprogress = function progress(e) {
      if (e.total > 0) {
        ;
        e.percent = e.loaded / e.total * 100;
      }
      option.onProgress(e);
    };
  }
  const formData = new FormData();
  if (option.data) {
    Object.keys(option.data).forEach((key) => {
      formData.append(key, option.data[key]);
    });
  }
  formData.append(option.filename, option.file, option.file.name);
  xhr.onerror = function error() {
    option.onError(getError(action, option, xhr));
  };
  xhr.onload = function onload() {
    if (xhr.status < 200 || xhr.status >= 300) {
      return option.onError(getError(action, option, xhr));
    }
    option.onSuccess(getBody(xhr));
  };
  xhr.open(option.method, action, true);
  if (option.withCredentials && "withCredentials" in xhr) {
    xhr.withCredentials = true;
  }
  const headers = option.headers || {};
  for (const item in headers) {
    if (shared_esm_bundler_hasOwn(headers, item) && headers[item] !== null) {
      xhr.setRequestHeader(item, headers[item]);
    }
  }
  if (headers instanceof Headers) {
    headers.forEach((value, key) => {
      xhr.setRequestHeader(key, value);
    });
  }
  xhr.send(formData);
  return xhr;
}


//# sourceMappingURL=ajax.mjs.map

;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/document.mjs



const document_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "Document"
});
const document_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const document_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M832 384H576V128H192v768h640V384zm-26.496-64L640 154.496V320h165.504zM160 64h480l256 256v608a32 32 0 01-32 32H160a32 32 0 01-32-32V96a32 32 0 0132-32zm160 448h384v64H320v-64zm0-192h160v64H320v-64zm0 384h384v64H320v-64z"
}, null, -1);
const document_hoisted_3 = [
  document_hoisted_2
];
function document_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", document_hoisted_1, document_hoisted_3);
}
var document_document = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(document_sfc_main, [["render", document_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/delete.mjs



const delete_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "Delete"
});
const delete_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const delete_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M160 256H96a32 32 0 010-64h256V95.936a32 32 0 0132-32h256a32 32 0 0132 32V192h256a32 32 0 110 64h-64v672a32 32 0 01-32 32H192a32 32 0 01-32-32V256zm448-64v-64H416v64h192zM224 896h576V256H224v640zm192-128a32 32 0 01-32-32V416a32 32 0 0164 0v320a32 32 0 01-32 32zm192 0a32 32 0 01-32-32V416a32 32 0 0164 0v320a32 32 0 01-32 32z"
}, null, -1);
const delete_hoisted_3 = [
  delete_hoisted_2
];
function delete_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", delete_hoisted_1, delete_hoisted_3);
}
var _delete = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(delete_sfc_main, [["render", delete_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/zoom-in.mjs



const zoom_in_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ZoomIn"
});
const zoom_in_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const zoom_in_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M795.904 750.72l124.992 124.928a32 32 0 01-45.248 45.248L750.656 795.904a416 416 0 1145.248-45.248zM480 832a352 352 0 100-704 352 352 0 000 704zm-32-384v-96a32 32 0 0164 0v96h96a32 32 0 010 64h-96v96a32 32 0 01-64 0v-96h-96a32 32 0 010-64h96z"
}, null, -1);
const zoom_in_hoisted_3 = [
  zoom_in_hoisted_2
];
function zoom_in_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", zoom_in_hoisted_1, zoom_in_hoisted_3);
}
var zoomIn = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(zoom_in_sfc_main, [["render", zoom_in_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/check.mjs



const check_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "Check"
});
const check_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const check_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M406.656 706.944L195.84 496.256a32 32 0 10-45.248 45.248l256 256 512-512a32 32 0 00-45.248-45.248L406.592 706.944z"
}, null, -1);
const check_hoisted_3 = [
  check_hoisted_2
];
function check_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", check_hoisted_1, check_hoisted_3);
}
var check = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(check_sfc_main, [["render", check_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/progress/src/progress.mjs


const progressProps = buildProps({
  type: {
    type: String,
    default: "line",
    values: ["line", "circle", "dashboard"]
  },
  percentage: {
    type: Number,
    default: 0,
    validator: (val) => val >= 0 && val <= 100
  },
  status: {
    type: String,
    default: "",
    values: ["", "success", "exception", "warning"]
  },
  indeterminate: {
    type: Boolean,
    default: false
  },
  duration: {
    type: Number,
    default: 3
  },
  strokeWidth: {
    type: Number,
    default: 6
  },
  strokeLinecap: {
    type: definePropType(String),
    default: "round"
  },
  textInside: {
    type: Boolean,
    default: false
  },
  width: {
    type: Number,
    default: 126
  },
  showText: {
    type: Boolean,
    default: true
  },
  color: {
    type: definePropType([
      String,
      Array,
      Function
    ]),
    default: ""
  },
  format: {
    type: definePropType(Function),
    default: (percentage) => `${percentage}%`
  }
});


//# sourceMappingURL=progress.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/progress/src/progress2.mjs






const progress2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElProgress",
  components: {
    ElIcon: ElIcon,
    CircleCheck: circleCheck,
    CircleClose: circleClose,
    Check: check,
    Close: close_close,
    WarningFilled: warningFilled
  },
  props: progressProps,
  setup(props) {
    const barStyle = runtime_core_esm_bundler_computed(() => ({
      width: `${props.percentage}%`,
      animationDuration: `${props.duration}s`,
      backgroundColor: getCurrentColor(props.percentage)
    }));
    const relativeStrokeWidth = runtime_core_esm_bundler_computed(() => (props.strokeWidth / props.width * 100).toFixed(1));
    const radius = runtime_core_esm_bundler_computed(() => {
      if (props.type === "circle" || props.type === "dashboard") {
        return parseInt(`${50 - parseFloat(relativeStrokeWidth.value) / 2}`, 10);
      } else {
        return 0;
      }
    });
    const trackPath = runtime_core_esm_bundler_computed(() => {
      const r = radius.value;
      const isDashboard = props.type === "dashboard";
      return `
          M 50 50
          m 0 ${isDashboard ? "" : "-"}${r}
          a ${r} ${r} 0 1 1 0 ${isDashboard ? "-" : ""}${r * 2}
          a ${r} ${r} 0 1 1 0 ${isDashboard ? "" : "-"}${r * 2}
          `;
    });
    const perimeter = runtime_core_esm_bundler_computed(() => 2 * Math.PI * radius.value);
    const rate = runtime_core_esm_bundler_computed(() => props.type === "dashboard" ? 0.75 : 1);
    const strokeDashoffset = runtime_core_esm_bundler_computed(() => {
      const offset = -1 * perimeter.value * (1 - rate.value) / 2;
      return `${offset}px`;
    });
    const trailPathStyle = runtime_core_esm_bundler_computed(() => ({
      strokeDasharray: `${perimeter.value * rate.value}px, ${perimeter.value}px`,
      strokeDashoffset: strokeDashoffset.value
    }));
    const circlePathStyle = runtime_core_esm_bundler_computed(() => ({
      strokeDasharray: `${perimeter.value * rate.value * (props.percentage / 100)}px, ${perimeter.value}px`,
      strokeDashoffset: strokeDashoffset.value,
      transition: "stroke-dasharray 0.6s ease 0s, stroke 0.6s ease"
    }));
    const stroke = runtime_core_esm_bundler_computed(() => {
      let ret;
      if (props.color) {
        ret = getCurrentColor(props.percentage);
      } else {
        switch (props.status) {
          case "success":
            ret = "#13ce66";
            break;
          case "exception":
            ret = "#ff4949";
            break;
          case "warning":
            ret = "#e6a23c";
            break;
          default:
            ret = "#20a0ff";
        }
      }
      return ret;
    });
    const statusIcon = runtime_core_esm_bundler_computed(() => {
      if (props.status === "warning") {
        return warningFilled;
      }
      if (props.type === "line") {
        return props.status === "success" ? circleCheck : circleClose;
      } else {
        return props.status === "success" ? check : close_close;
      }
    });
    const progressTextSize = runtime_core_esm_bundler_computed(() => {
      return props.type === "line" ? 12 + props.strokeWidth * 0.4 : props.width * 0.111111 + 2;
    });
    const content = runtime_core_esm_bundler_computed(() => props.format(props.percentage));
    const getCurrentColor = (percentage) => {
      var _a;
      const { color } = props;
      if (typeof color === "function") {
        return color(percentage);
      } else if (typeof color === "string") {
        return color;
      } else {
        const span = 100 / color.length;
        const seriesColors = color.map((seriesColor, index) => {
          if (typeof seriesColor === "string") {
            return {
              color: seriesColor,
              percentage: (index + 1) * span
            };
          }
          return seriesColor;
        });
        const colors = seriesColors.sort((a, b) => a.percentage - b.percentage);
        for (const color2 of colors) {
          if (color2.percentage > percentage)
            return color2.color;
        }
        return (_a = colors[colors.length - 1]) == null ? void 0 : _a.color;
      }
    };
    const slotData = runtime_core_esm_bundler_computed(() => {
      return {
        percentage: props.percentage
      };
    });
    return {
      barStyle,
      relativeStrokeWidth,
      radius,
      trackPath,
      perimeter,
      rate,
      strokeDashoffset,
      trailPathStyle,
      circlePathStyle,
      stroke,
      statusIcon,
      progressTextSize,
      content,
      slotData
    };
  }
});
const progress2_hoisted_1 = ["aria-valuenow"];
const progress2_hoisted_2 = {
  key: 0,
  class: "el-progress-bar"
};
const progress2_hoisted_3 = {
  key: 0,
  class: "el-progress-bar__innerText"
};
const progress2_hoisted_4 = { viewBox: "0 0 100 100" };
const progress2_hoisted_5 = ["d", "stroke-width"];
const progress2_hoisted_6 = ["d", "stroke", "stroke-linecap", "stroke-width"];
const progress2_hoisted_7 = { key: 0 };
function progress2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = resolveComponent("el-icon");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass(["el-progress", [
      `el-progress--${_ctx.type}`,
      _ctx.status ? `is-${_ctx.status}` : "",
      {
        "el-progress--without-text": !_ctx.showText,
        "el-progress--text-inside": _ctx.textInside
      }
    ]]),
    role: "progressbar",
    "aria-valuenow": _ctx.percentage,
    "aria-valuemin": "0",
    "aria-valuemax": "100"
  }, [
    _ctx.type === "line" ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", progress2_hoisted_2, [
      createBaseVNode("div", {
        class: "el-progress-bar__outer",
        style: normalizeStyle({ height: `${_ctx.strokeWidth}px` })
      }, [
        createBaseVNode("div", {
          class: normalizeClass([
            "el-progress-bar__inner",
            { "el-progress-bar__inner--indeterminate": _ctx.indeterminate }
          ]),
          style: normalizeStyle(_ctx.barStyle)
        }, [
          (_ctx.showText || _ctx.$slots.default) && _ctx.textInside ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", progress2_hoisted_3, [
            renderSlot(_ctx.$slots, "default", normalizeProps(guardReactiveProps(_ctx.slotData)), () => [
              createBaseVNode("span", null, toDisplayString(_ctx.content), 1)
            ])
          ])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
        ], 6)
      ], 4)
    ])) : (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 1,
      class: "el-progress-circle",
      style: normalizeStyle({ height: `${_ctx.width}px`, width: `${_ctx.width}px` })
    }, [
      (runtime_core_esm_bundler_openBlock(), createElementBlock("svg", progress2_hoisted_4, [
        createBaseVNode("path", {
          class: "el-progress-circle__track",
          d: _ctx.trackPath,
          stroke: "#e5e9f2",
          "stroke-width": _ctx.relativeStrokeWidth,
          fill: "none",
          style: normalizeStyle(_ctx.trailPathStyle)
        }, null, 12, progress2_hoisted_5),
        createBaseVNode("path", {
          class: "el-progress-circle__path",
          d: _ctx.trackPath,
          stroke: _ctx.stroke,
          fill: "none",
          "stroke-linecap": _ctx.strokeLinecap,
          "stroke-width": _ctx.percentage ? _ctx.relativeStrokeWidth : 0,
          style: normalizeStyle(_ctx.circlePathStyle)
        }, null, 12, progress2_hoisted_6)
      ]))
    ], 4)),
    (_ctx.showText || _ctx.$slots.default) && !_ctx.textInside ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 2,
      class: "el-progress__text",
      style: normalizeStyle({ fontSize: `${_ctx.progressTextSize}px` })
    }, [
      renderSlot(_ctx.$slots, "default", normalizeProps(guardReactiveProps(_ctx.slotData)), () => [
        !_ctx.status ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", progress2_hoisted_7, toDisplayString(_ctx.content), 1)) : (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, { key: 1 }, {
          default: withCtx(() => [
            (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(resolveDynamicComponent(_ctx.statusIcon)))
          ]),
          _: 1
        }))
      ])
    ], 4)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 10, progress2_hoisted_1);
}
var Progress = /* @__PURE__ */ _export_sfc(progress2_sfc_main, [["render", progress2_sfc_render]]);


//# sourceMappingURL=progress2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/progress/index.mjs




const ElProgress = withInstall(Progress);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/src/upload-list.mjs









const upload_list_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElUploadList",
  components: {
    ElProgress: ElProgress,
    ElIcon: ElIcon,
    Document: document_document,
    Delete: _delete,
    Close: close_close,
    ZoomIn: zoomIn,
    Check: check,
    CircleCheck: circleCheck
  },
  props: {
    files: {
      type: Array,
      default: () => []
    },
    disabled: {
      type: Boolean,
      default: false
    },
    handlePreview: {
      type: Function,
      default: () => shared_esm_bundler_NOOP
    },
    listType: {
      type: String,
      default: "text"
    }
  },
  emits: ["remove"],
  setup(props, { emit }) {
    const { t } = useLocale();
    const handleClick = (file) => {
      props.handlePreview(file);
    };
    const onFileClicked = (e) => {
      ;
      e.target.focus();
    };
    const handleRemove = (file) => {
      emit("remove", file);
    };
    return {
      focusing: reactivity_esm_bundler_ref(false),
      handleClick,
      handleRemove,
      onFileClicked,
      t
    };
  }
});
const upload_list_hoisted_1 = ["onKeydown"];
const upload_list_hoisted_2 = ["src"];
const upload_list_hoisted_3 = ["onClick"];
const upload_list_hoisted_4 = { class: "el-upload-list__item-status-label" };
const upload_list_hoisted_5 = {
  key: 2,
  class: "el-icon--close-tip"
};
const upload_list_hoisted_6 = {
  key: 4,
  class: "el-upload-list__item-actions"
};
const upload_list_hoisted_7 = ["onClick"];
const upload_list_hoisted_8 = ["onClick"];
function upload_list_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_document = resolveComponent("document");
  const _component_el_icon = resolveComponent("el-icon");
  const _component_circle_check = resolveComponent("circle-check");
  const _component_check = resolveComponent("check");
  const _component_close = resolveComponent("close");
  const _component_el_progress = resolveComponent("el-progress");
  const _component_zoom_in = resolveComponent("zoom-in");
  const _component_delete = resolveComponent("delete");
  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(TransitionGroup, {
    tag: "ul",
    class: normalizeClass([
      "el-upload-list",
      "el-upload-list--" + _ctx.listType,
      { "is-disabled": _ctx.disabled }
    ]),
    name: "el-list"
  }, {
    default: withCtx(() => [
      (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.files, (file) => {
        return runtime_core_esm_bundler_openBlock(), createElementBlock("li", {
          key: file.uid || file,
          class: normalizeClass([
            "el-upload-list__item",
            "is-" + file.status,
            _ctx.focusing ? "focusing" : ""
          ]),
          tabindex: "0",
          onKeydown: withKeys(($event) => !_ctx.disabled && _ctx.handleRemove(file), ["delete"]),
          onFocus: _cache[0] || (_cache[0] = ($event) => _ctx.focusing = true),
          onBlur: _cache[1] || (_cache[1] = ($event) => _ctx.focusing = false),
          onClick: _cache[2] || (_cache[2] = (...args) => _ctx.onFileClicked && _ctx.onFileClicked(...args))
        }, [
          renderSlot(_ctx.$slots, "default", { file }, () => [
            file.status !== "uploading" && ["picture-card", "picture"].includes(_ctx.listType) ? (runtime_core_esm_bundler_openBlock(), createElementBlock("img", {
              key: 0,
              class: "el-upload-list__item-thumbnail",
              src: file.url,
              alt: ""
            }, null, 8, upload_list_hoisted_2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
            createBaseVNode("a", {
              class: "el-upload-list__item-name",
              onClick: ($event) => _ctx.handleClick(file)
            }, [
              runtime_core_esm_bundler_createVNode(_component_el_icon, { class: "el-icon--document" }, {
                default: withCtx(() => [
                  runtime_core_esm_bundler_createVNode(_component_document)
                ]),
                _: 1
              }),
              createTextVNode(" " + toDisplayString(file.name), 1)
            ], 8, upload_list_hoisted_3),
            createBaseVNode("label", upload_list_hoisted_4, [
              _ctx.listType === "text" ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
                key: 0,
                class: "el-icon--upload-success el-icon--circle-check"
              }, {
                default: withCtx(() => [
                  runtime_core_esm_bundler_createVNode(_component_circle_check)
                ]),
                _: 1
              })) : ["picture-card", "picture"].includes(_ctx.listType) ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
                key: 1,
                class: "el-icon--upload-success el-icon--check"
              }, {
                default: withCtx(() => [
                  runtime_core_esm_bundler_createVNode(_component_check)
                ]),
                _: 1
              })) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
            ]),
            !_ctx.disabled ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_icon, {
              key: 1,
              class: "el-icon--close",
              onClick: ($event) => _ctx.handleRemove(file)
            }, {
              default: withCtx(() => [
                runtime_core_esm_bundler_createVNode(_component_close)
              ]),
              _: 2
            }, 1032, ["onClick"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
            runtime_core_esm_bundler_createCommentVNode(" Due to close btn only appears when li gets focused disappears after li gets blurred, thus keyboard navigation can never reach close btn"),
            runtime_core_esm_bundler_createCommentVNode(" This is a bug which needs to be fixed "),
            runtime_core_esm_bundler_createCommentVNode(" TODO: Fix the incorrect navigation interaction "),
            !_ctx.disabled ? (runtime_core_esm_bundler_openBlock(), createElementBlock("i", upload_list_hoisted_5, toDisplayString(_ctx.t("el.upload.deleteTip")), 1)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
            file.status === "uploading" ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_progress, {
              key: 3,
              type: _ctx.listType === "picture-card" ? "circle" : "line",
              "stroke-width": _ctx.listType === "picture-card" ? 6 : 2,
              percentage: +file.percentage,
              style: { "margin-top": "0.5rem" }
            }, null, 8, ["type", "stroke-width", "percentage"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
            _ctx.listType === "picture-card" ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", upload_list_hoisted_6, [
              createBaseVNode("span", {
                class: "el-upload-list__item-preview",
                onClick: ($event) => _ctx.handlePreview(file)
              }, [
                runtime_core_esm_bundler_createVNode(_component_el_icon, { class: "el-icon--zoom-in" }, {
                  default: withCtx(() => [
                    runtime_core_esm_bundler_createVNode(_component_zoom_in)
                  ]),
                  _: 1
                })
              ], 8, upload_list_hoisted_7),
              !_ctx.disabled ? (runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
                key: 0,
                class: "el-upload-list__item-delete",
                onClick: ($event) => _ctx.handleRemove(file)
              }, [
                runtime_core_esm_bundler_createVNode(_component_el_icon, { class: "el-icon--delete" }, {
                  default: withCtx(() => [
                    runtime_core_esm_bundler_createVNode(_component_delete)
                  ]),
                  _: 1
                })
              ], 8, upload_list_hoisted_8)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
            ])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
          ])
        ], 42, upload_list_hoisted_1);
      }), 128))
    ]),
    _: 3
  }, 8, ["class"]);
}
var UploadList = /* @__PURE__ */ _export_sfc(upload_list_sfc_main, [["render", upload_list_sfc_render]]);


//# sourceMappingURL=upload-list.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/src/upload-dragger.mjs



const upload_dragger_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElUploadDrag",
  props: {
    disabled: {
      type: Boolean,
      default: false
    }
  },
  emits: ["file"],
  setup(props, { emit }) {
    const uploader = runtime_core_esm_bundler_inject("uploader", {});
    const dragover = reactivity_esm_bundler_ref(false);
    function onDrop(e) {
      var _a;
      if (props.disabled || !uploader)
        return;
      const accept = ((_a = uploader.props) == null ? void 0 : _a.accept) || uploader.accept;
      dragover.value = false;
      if (!accept) {
        emit("file", e.dataTransfer.files);
        return;
      }
      emit("file", Array.from(e.dataTransfer.files).filter((file) => {
        const { type, name } = file;
        const extension = name.indexOf(".") > -1 ? `.${name.split(".").pop()}` : "";
        const baseType = type.replace(/\/.*$/, "");
        return accept.split(",").map((type2) => type2.trim()).filter((type2) => type2).some((acceptedType) => {
          if (acceptedType.startsWith(".")) {
            return extension === acceptedType;
          }
          if (/\/\*$/.test(acceptedType)) {
            return baseType === acceptedType.replace(/\/\*$/, "");
          }
          if (/^[^/]+\/[^/]+$/.test(acceptedType)) {
            return type === acceptedType;
          }
          return false;
        });
      }));
    }
    function onDragover() {
      if (!props.disabled)
        dragover.value = true;
    }
    return {
      dragover,
      onDrop,
      onDragover
    };
  }
});
function upload_dragger_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass({
      "el-upload-dragger": true,
      "is-dragover": _ctx.dragover
    }),
    onDrop: _cache[0] || (_cache[0] = withModifiers((...args) => _ctx.onDrop && _ctx.onDrop(...args), ["prevent"])),
    onDragover: _cache[1] || (_cache[1] = withModifiers((...args) => _ctx.onDragover && _ctx.onDragover(...args), ["prevent"])),
    onDragleave: _cache[2] || (_cache[2] = withModifiers(($event) => _ctx.dragover = false, ["prevent"]))
  }, [
    renderSlot(_ctx.$slots, "default")
  ], 34);
}
var UploadDragger = /* @__PURE__ */ _export_sfc(upload_dragger_sfc_main, [["render", upload_dragger_sfc_render]]);


//# sourceMappingURL=upload-dragger.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/src/upload.mjs






const upload_sfc_main = runtime_core_esm_bundler_defineComponent({
  components: {
    UploadDragger: UploadDragger
  },
  props: {
    type: {
      type: String,
      default: ""
    },
    action: {
      type: String,
      required: true
    },
    name: {
      type: String,
      default: "file"
    },
    data: {
      type: Object,
      default: () => null
    },
    headers: {
      type: Object,
      default: () => null
    },
    method: {
      type: String,
      default: "post"
    },
    withCredentials: {
      type: Boolean,
      default: false
    },
    multiple: {
      type: Boolean,
      default: null
    },
    accept: {
      type: String,
      default: ""
    },
    onStart: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onProgress: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onSuccess: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onError: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    beforeUpload: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    drag: {
      type: Boolean,
      default: false
    },
    onPreview: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onRemove: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    fileList: {
      type: Array,
      default: () => []
    },
    autoUpload: {
      type: Boolean,
      default: true
    },
    listType: {
      type: String,
      default: "text"
    },
    httpRequest: {
      type: Function,
      default: () => upload
    },
    disabled: Boolean,
    limit: {
      type: Number,
      default: null
    },
    onExceed: {
      type: Function,
      default: shared_esm_bundler_NOOP
    }
  },
  setup(props) {
    const reqs = reactivity_esm_bundler_ref({});
    const mouseover = reactivity_esm_bundler_ref(false);
    const inputRef = reactivity_esm_bundler_ref(null);
    function uploadFiles(files) {
      if (props.limit && props.fileList.length + files.length > props.limit) {
        props.onExceed(files, props.fileList);
        return;
      }
      let postFiles = Array.from(files);
      if (!props.multiple) {
        postFiles = postFiles.slice(0, 1);
      }
      if (postFiles.length === 0) {
        return;
      }
      postFiles.forEach((rawFile) => {
        props.onStart(rawFile);
        if (props.autoUpload)
          upload(rawFile);
      });
    }
    function upload(rawFile) {
      inputRef.value.value = null;
      if (!props.beforeUpload) {
        return post(rawFile);
      }
      const before = props.beforeUpload(rawFile);
      if (before instanceof Promise) {
        before.then((processedFile) => {
          const fileType = Object.prototype.toString.call(processedFile);
          if (fileType === "[object File]" || fileType === "[object Blob]") {
            if (fileType === "[object Blob]") {
              processedFile = new File([processedFile], rawFile.name, {
                type: rawFile.type
              });
            }
            for (const p in rawFile) {
              if (shared_esm_bundler_hasOwn(rawFile, p)) {
                processedFile[p] = rawFile[p];
              }
            }
            post(processedFile);
          } else {
            post(rawFile);
          }
        }).catch(() => {
          props.onRemove(null, rawFile);
        });
      } else if (before !== false) {
        post(rawFile);
      } else {
        props.onRemove(null, rawFile);
      }
    }
    function abort(file) {
      const _reqs = reqs.value;
      if (file) {
        let uid = file;
        if (file.uid)
          uid = file.uid;
        if (_reqs[uid]) {
          ;
          _reqs[uid].abort();
        }
      } else {
        Object.keys(_reqs).forEach((uid) => {
          if (_reqs[uid])
            _reqs[uid].abort();
          delete _reqs[uid];
        });
      }
    }
    function post(rawFile) {
      const { uid } = rawFile;
      const options = {
        headers: props.headers,
        withCredentials: props.withCredentials,
        file: rawFile,
        data: props.data,
        method: props.method,
        filename: props.name,
        action: props.action,
        onProgress: (e) => {
          props.onProgress(e, rawFile);
        },
        onSuccess: (res) => {
          props.onSuccess(res, rawFile);
          delete reqs.value[uid];
        },
        onError: (err) => {
          props.onError(err, rawFile);
          delete reqs.value[uid];
        }
      };
      const req = props.httpRequest(options);
      reqs.value[uid] = req;
      if (req instanceof Promise) {
        req.then(options.onSuccess, options.onError);
      }
    }
    function handleChange(e) {
      const files = e.target.files;
      if (!files)
        return;
      uploadFiles(files);
    }
    function handleClick() {
      if (!props.disabled) {
        inputRef.value.value = null;
        inputRef.value.click();
      }
    }
    function handleKeydown() {
      handleClick();
    }
    return {
      reqs,
      mouseover,
      inputRef,
      abort,
      post,
      handleChange,
      handleClick,
      handleKeydown,
      upload,
      uploadFiles
    };
  }
});
const upload_hoisted_1 = ["name", "multiple", "accept"];
function upload_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_upload_dragger = resolveComponent("upload-dragger");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass(["el-upload", `el-upload--${_ctx.listType}`]),
    tabindex: "0",
    onClick: _cache[1] || (_cache[1] = (...args) => _ctx.handleClick && _ctx.handleClick(...args)),
    onKeydown: _cache[2] || (_cache[2] = withKeys(withModifiers((...args) => _ctx.handleKeydown && _ctx.handleKeydown(...args), ["self"]), ["enter", "space"]))
  }, [
    _ctx.drag ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_upload_dragger, {
      key: 0,
      disabled: _ctx.disabled,
      onFile: _ctx.uploadFiles
    }, {
      default: withCtx(() => [
        renderSlot(_ctx.$slots, "default")
      ]),
      _: 3
    }, 8, ["disabled", "onFile"])) : renderSlot(_ctx.$slots, "default", { key: 1 }),
    createBaseVNode("input", {
      ref: "inputRef",
      class: "el-upload__input",
      type: "file",
      name: _ctx.name,
      multiple: _ctx.multiple,
      accept: _ctx.accept,
      onChange: _cache[0] || (_cache[0] = (...args) => _ctx.handleChange && _ctx.handleChange(...args))
    }, null, 40, upload_hoisted_1)
  ], 34);
}
var Upload = /* @__PURE__ */ _export_sfc(upload_sfc_main, [["render", upload_sfc_render]]);


//# sourceMappingURL=upload.mjs.map

// EXTERNAL MODULE: ./node_modules/lodash/cloneDeep.js
var cloneDeep = __webpack_require__("./node_modules/lodash/cloneDeep.js");
;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/src/useHandlers.mjs




function getFile(rawFile, uploadFiles) {
  return uploadFiles.find((file) => file.uid === rawFile.uid);
}
function genUid(seed) {
  return Date.now() + seed;
}
var useHandlers = (props) => {
  const uploadFiles = reactivity_esm_bundler_ref([]);
  const uploadRef = reactivity_esm_bundler_ref(null);
  let tempIndex = 1;
  function abort(file) {
    uploadRef.value.abort(file);
  }
  function clearFiles(status = ["ready", "uploading", "success", "fail"]) {
    uploadFiles.value = uploadFiles.value.filter((row) => {
      return !status.includes(row.status);
    });
  }
  function handleError(err, rawFile) {
    const file = getFile(rawFile, uploadFiles.value);
    file.status = "fail";
    uploadFiles.value.splice(uploadFiles.value.indexOf(file), 1);
    props.onError(err, file, uploadFiles.value);
    props.onChange(file, uploadFiles.value);
  }
  function handleProgress(ev, rawFile) {
    const file = getFile(rawFile, uploadFiles.value);
    props.onProgress(ev, file, uploadFiles.value);
    file.status = "uploading";
    file.percentage = ev.percent || 0;
  }
  function handleSuccess(res, rawFile) {
    const file = getFile(rawFile, uploadFiles.value);
    if (file) {
      file.status = "success";
      file.response = res;
      props.onSuccess(res, file, uploadFiles.value);
      props.onChange(file, uploadFiles.value);
    }
  }
  function handleStart(rawFile) {
    const uid = genUid(tempIndex++);
    rawFile.uid = uid;
    const file = {
      name: rawFile.name,
      percentage: 0,
      status: "ready",
      size: rawFile.size,
      raw: rawFile,
      uid
    };
    if (props.listType === "picture-card" || props.listType === "picture") {
      try {
        file.url = URL.createObjectURL(rawFile);
      } catch (err) {
        console.error("[Element Error][Upload]", err);
        props.onError(err, file, uploadFiles.value);
      }
    }
    uploadFiles.value.push(file);
    props.onChange(file, uploadFiles.value);
  }
  function handleRemove(file, raw) {
    if (raw) {
      file = getFile(raw, uploadFiles.value);
    }
    const revokeObjectURL = () => {
      if (file.url && file.url.indexOf("blob:") === 0) {
        URL.revokeObjectURL(file.url);
      }
    };
    const doRemove = () => {
      abort(file);
      const fileList = uploadFiles.value;
      fileList.splice(fileList.indexOf(file), 1);
      props.onRemove(file, fileList);
      revokeObjectURL();
    };
    if (!props.beforeRemove) {
      doRemove();
    } else if (typeof props.beforeRemove === "function") {
      const before = props.beforeRemove(file, uploadFiles.value);
      if (before instanceof Promise) {
        before.then(() => {
          doRemove();
        }).catch(shared_esm_bundler_NOOP);
      } else if (before !== false) {
        doRemove();
      }
    }
  }
  function submit() {
    uploadFiles.value.filter((file) => file.status === "ready").forEach((file) => {
      uploadRef.value.upload(file.raw);
    });
  }
  runtime_core_esm_bundler_watch(() => props.listType, (val) => {
    if (val === "picture-card" || val === "picture") {
      uploadFiles.value = uploadFiles.value.map((file) => {
        if (!file.url && file.raw) {
          try {
            file.url = URL.createObjectURL(file.raw);
          } catch (err) {
            props.onError(err, file, uploadFiles.value);
          }
        }
        return file;
      });
    }
  });
  runtime_core_esm_bundler_watch(() => props.fileList, (fileList) => {
    uploadFiles.value = fileList.map((file) => {
      const cloneFile = cloneDeep(file);
      return {
        ...cloneFile,
        uid: file.uid || genUid(tempIndex++),
        status: file.status || "success"
      };
    });
  }, {
    immediate: true,
    deep: true
  });
  return {
    abort,
    clearFiles,
    handleError,
    handleProgress,
    handleStart,
    handleSuccess,
    handleRemove,
    submit,
    uploadFiles,
    uploadRef
  };
};


//# sourceMappingURL=useHandlers.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/src/index.mjs









const upload_src_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElUpload",
  components: {
    Upload: Upload,
    UploadList: UploadList
  },
  props: {
    action: {
      type: String,
      required: true
    },
    headers: {
      type: Object,
      default: () => ({})
    },
    method: {
      type: String,
      default: "post"
    },
    data: {
      type: Object,
      default: () => ({})
    },
    multiple: {
      type: Boolean,
      default: false
    },
    name: {
      type: String,
      default: "file"
    },
    drag: {
      type: Boolean,
      default: false
    },
    withCredentials: Boolean,
    showFileList: {
      type: Boolean,
      default: true
    },
    accept: {
      type: String,
      default: ""
    },
    type: {
      type: String,
      default: "select"
    },
    beforeUpload: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    beforeRemove: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onRemove: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onChange: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onPreview: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onSuccess: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onProgress: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    onError: {
      type: Function,
      default: shared_esm_bundler_NOOP
    },
    fileList: {
      type: Array,
      default: () => {
        return [];
      }
    },
    autoUpload: {
      type: Boolean,
      default: true
    },
    listType: {
      type: String,
      default: "text"
    },
    httpRequest: {
      type: Function,
      default: upload
    },
    disabled: Boolean,
    limit: {
      type: Number,
      default: null
    },
    onExceed: {
      type: Function,
      default: () => shared_esm_bundler_NOOP
    }
  },
  setup(props) {
    const elForm = runtime_core_esm_bundler_inject(elFormKey, {});
    const uploadDisabled = runtime_core_esm_bundler_computed(() => {
      return props.disabled || elForm.disabled;
    });
    const {
      abort,
      clearFiles,
      handleError,
      handleProgress,
      handleStart,
      handleSuccess,
      handleRemove,
      submit,
      uploadRef,
      uploadFiles
    } = useHandlers(props);
    runtime_core_esm_bundler_provide("uploader", runtime_core_esm_bundler_getCurrentInstance());
    runtime_core_esm_bundler_onBeforeUnmount(() => {
      uploadFiles.value.forEach((file) => {
        if (file.url && file.url.indexOf("blob:") === 0) {
          URL.revokeObjectURL(file.url);
        }
      });
    });
    return {
      abort,
      dragOver: reactivity_esm_bundler_ref(false),
      draging: reactivity_esm_bundler_ref(false),
      handleError,
      handleProgress,
      handleRemove,
      handleStart,
      handleSuccess,
      uploadDisabled,
      uploadFiles,
      uploadRef,
      submit,
      clearFiles
    };
  },
  render() {
    var _a, _b;
    let uploadList;
    if (this.showFileList) {
      uploadList = h(UploadList, {
        disabled: this.uploadDisabled,
        listType: this.listType,
        files: this.uploadFiles,
        onRemove: this.handleRemove,
        handlePreview: this.onPreview
      }, this.$slots.file ? {
        default: (props) => {
          return this.$slots.file({
            file: props.file
          });
        }
      } : null);
    } else {
      uploadList = null;
    }
    const uploadData = {
      type: this.type,
      drag: this.drag,
      action: this.action,
      multiple: this.multiple,
      "before-upload": this.beforeUpload,
      "with-credentials": this.withCredentials,
      headers: this.headers,
      method: this.method,
      name: this.name,
      data: this.data,
      accept: this.accept,
      fileList: this.uploadFiles,
      autoUpload: this.autoUpload,
      listType: this.listType,
      disabled: this.uploadDisabled,
      limit: this.limit,
      "on-exceed": this.onExceed,
      "on-start": this.handleStart,
      "on-progress": this.handleProgress,
      "on-success": this.handleSuccess,
      "on-error": this.handleError,
      "on-preview": this.onPreview,
      "on-remove": this.handleRemove,
      "http-request": this.httpRequest,
      ref: "uploadRef"
    };
    const trigger = this.$slots.trigger || this.$slots.default;
    const uploadComponent = h(Upload, uploadData, {
      default: () => trigger == null ? void 0 : trigger()
    });
    return h("div", [
      this.listType === "picture-card" ? uploadList : null,
      this.$slots.trigger ? [uploadComponent, this.$slots.default()] : uploadComponent,
      (_b = (_a = this.$slots).tip) == null ? void 0 : _b.call(_a),
      this.listType !== "picture-card" ? uploadList : null
    ]);
  }
});


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/upload/index.mjs


upload_src_sfc_main.install = (app) => {
  app.component(upload_src_sfc_main.name, upload_src_sfc_main);
};
const _Upload = upload_src_sfc_main;
const ElUpload = _Upload;


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=template&id=2d5a5eff&scoped=true
/* unplugin-vue-components disabled */


const HwtEditorvue_type_template_id_2d5a5eff_scoped_true_withScopeId = n => (pushScopeId("data-v-2d5a5eff"), n = n(), popScopeId(), n);

const HwtEditorvue_type_template_id_2d5a5eff_scoped_true_hoisted_1 = /*#__PURE__*/HwtEditorvue_type_template_id_2d5a5eff_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("div", {
  id: "editor"
}, null, -1
/* HOISTED */
));

function HwtEditorvue_type_template_id_2d5a5eff_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_upload = ElUpload;

  return runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, null, [runtime_core_esm_bundler_createVNode(_component_el_upload, {
    class: "upload-trigger",
    action: "http://cc.bjtu.edu.cn:81/meol/servlet/SerUpload",
    "on-success": $options.handleUploadSuccess,
    multiple: ""
  }, null, 8
  /* PROPS */
  , ["on-success"]), HwtEditorvue_type_template_id_2d5a5eff_scoped_true_hoisted_1], 64
  /* STABLE_FRAGMENT */
  );
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=template&id=2d5a5eff&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */

const HwtEditorvue_type_script_lang_js_E = window.wangEditor;
const {
  BtnMenu
} = HwtEditorvue_type_script_lang_js_E;
let editor = null;

class AlertMenu extends BtnMenu {
  constructor(editor) {
    const $elem = HwtEditorvue_type_script_lang_js_E.$(`<div class="w-e-menu" data-title="上传附件">
                <i title="上传附件" class="w-e-icon-upload2"></i>
            </div>`);
    super($elem, editor);
  }

  clickHandler() {
    document.querySelector(".upload-trigger input").click();
  }

  tryChangeActive() {} // Keep it, don't delete


}

const menuKey = "alertMenuKey";
HwtEditorvue_type_script_lang_js_E.registerMenu(menuKey, AlertMenu); // register menu

/* harmony default export */ const HwtEditorvue_type_script_lang_js = ({
  data() {
    return {
      hwtContent: {},
      // dont assign this.propHwtContent directly
      hwtContentWithId: {},
      submitContent: "",
      editorObj: {}
    };
  },

  watch: {
    propHwtContents: "watchCallBack"
  },
  props: ["propHwtContents"],
  methods: {
    async handleUploadSuccess(response, file, fileList) {
      editor.txt.append(`<p><a data-cke-saved-href="/meol/${response}" href="/meol/${response}">${file.name}</a><br/></p>`);
    },

    async getSubmitContent(hwtid) {
      return await GetInfo.getHwtSubmitContent(hwtid);
    },

    async watchCallBack(val) {
      this.hwtContent = val.hwtContent;
      this.hwtContentWithId = val.hwtContentWithId;
      this.submitContent = this.hwtContent.answer;
      this.initEditor();
      editor.txt.html(this.submitContent);
    },

    initEditor() {
      if (editor !== null) {
        editor.destroy();
        editor = null;
      }

      editor = new HwtEditorvue_type_script_lang_js_E("#editor");
      editor.config.menus = ["head", "bold", "fontSize", "fontName", "italic", "underline", "strikeThrough", "indent", "lineHeight", "foreColor", "backColor", "link", "list", "justify", "image", "video", "table", "code", "splitLine", "undo", "redo"];
      editor.config.height = 240;
      editor.config.zIndex = 99;
      editor.config.uploadImgServer = "/upload-img";

      editor.config.customUploadImg = function (resultFiles, insertImgFn) {
        let formData = new FormData();
        formData.append("Filename", resultFiles[0].name);
        formData.append("Filedata", resultFiles[0]);
        SendRequest(`http://cc.bjtu.edu.cn:81/meol/servlet/SerUpload`, undefined, {
          method: "POST",
          body: formData
        }).then(res => {
          if (res.ok === true) {
            res.text().then(resURL => {
              console.log(resURL);
              insertImgFn("/meol/" + resURL);
            });
          }
        });
      };

      editor.config.customUploadVideo = function (resultFiles, insertVideoFn) {
        let formData = new FormData();
        formData.append("Filename", resultFiles[0].name);
        formData.append("Filedata", resultFiles[0]);
        SendRequest(`http://cc.bjtu.edu.cn:81/meol/servlet/SerUpload`, undefined, {
          method: "POST",
          body: formData
        }).then(res => {
          if (res.ok === true) {
            res.text().then(resURL => {
              insertVideoFn("/meol/" + resURL);
            });
          }
        });
      };

      editor.create();
      this.editorObj = editor;
    }

  }
});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=style&index=0&id=2d5a5eff&scoped=true&lang=css
var HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=style&index=0&id=2d5a5eff&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=style&index=0&id=2d5a5eff&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_options = {};

HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css/* default */.Z, HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css_options);




       /* harmony default export */ const LessonSubmit_HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css = (HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css/* default */.Z && HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css/* default.locals */.Z.locals ? HwtEditorvue_type_style_index_0_id_2d5a5eff_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/HwtEditor.vue?vue&type=style&index=0&id=2d5a5eff&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/HwtEditor.vue
/* unplugin-vue-components disabled */



;


const HwtEditor_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(HwtEditorvue_type_script_lang_js, [['render',HwtEditorvue_type_template_id_2d5a5eff_scoped_true_render],['__scopeId',"data-v-2d5a5eff"]])

/* harmony default export */ const HwtEditor = (HwtEditor_exports_);
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-descriptions.css
var el_descriptions = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-descriptions.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-descriptions.css

      
      
      
      
      
      
      
      
      

var el_descriptions_options = {};

el_descriptions_options.styleTagTransform = (styleTagTransform_default());
el_descriptions_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_descriptions_options.insert = insertBySelector_default().bind(null, "head");
    
el_descriptions_options.domAPI = (styleDomAPI_default());
el_descriptions_options.insertStyleElement = (insertStyleElement_default());

var el_descriptions_update = injectStylesIntoStyleTag_default()(el_descriptions/* default */.Z, el_descriptions_options);




       /* harmony default export */ const theme_chalk_el_descriptions = (el_descriptions/* default */.Z && el_descriptions/* default.locals */.Z.locals ? el_descriptions/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-descriptions-item.css
var el_descriptions_item = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-descriptions-item.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-descriptions-item.css

      
      
      
      
      
      
      
      
      

var el_descriptions_item_options = {};

el_descriptions_item_options.styleTagTransform = (styleTagTransform_default());
el_descriptions_item_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_descriptions_item_options.insert = insertBySelector_default().bind(null, "head");
    
el_descriptions_item_options.domAPI = (styleDomAPI_default());
el_descriptions_item_options.insertStyleElement = (insertStyleElement_default());

var el_descriptions_item_update = injectStylesIntoStyleTag_default()(el_descriptions_item/* default */.Z, el_descriptions_item_options);




       /* harmony default export */ const theme_chalk_el_descriptions_item = (el_descriptions_item/* default */.Z && el_descriptions_item/* default.locals */.Z.locals ? el_descriptions_item/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions-item/style/css.mjs


//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions/style/css.mjs



//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions/src/token.mjs
const elDescriptionsKey = "elDescriptions";


//# sourceMappingURL=token.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions/src/descriptions-cell.mjs







var DescriptionsCell = runtime_core_esm_bundler_defineComponent({
  name: "ElDescriptionsCell",
  props: {
    cell: {
      type: Object
    },
    tag: {
      type: String
    },
    type: {
      type: String
    }
  },
  setup() {
    const descriptions = runtime_core_esm_bundler_inject(elDescriptionsKey, {});
    return {
      descriptions
    };
  },
  render() {
    var _a, _b, _c, _d, _e, _f;
    const item = getNormalizedProps(this.cell);
    const { border, direction } = this.descriptions;
    const isVertical = direction === "vertical";
    const label = ((_c = (_b = (_a = this.cell) == null ? void 0 : _a.children) == null ? void 0 : _b.label) == null ? void 0 : _c.call(_b)) || item.label;
    const content = (_f = (_e = (_d = this.cell) == null ? void 0 : _d.children) == null ? void 0 : _e.default) == null ? void 0 : _f.call(_e);
    const span = item.span;
    const align = item.align ? `is-${item.align}` : "";
    const labelAlign = item.labelAlign ? `is-${item.labelAlign}` : align;
    const className = item.className;
    const labelClassName = item.labelClassName;
    const style = {
      width: addUnit(item.width),
      minWidth: addUnit(item.minWidth)
    };
    const ns = useNamespace("descriptions");
    switch (this.type) {
      case "label":
        return h(this.tag, {
          style,
          class: [
            ns.e("cell"),
            ns.e("label"),
            ns.is("bordered-label", border),
            ns.is("vertical-label", isVertical),
            labelAlign,
            labelClassName
          ],
          colSpan: isVertical ? span : 1
        }, label);
      case "content":
        return h(this.tag, {
          style,
          class: [
            ns.e("cell"),
            ns.e("content"),
            ns.is("bordered-content", border),
            ns.is("vertical-content", isVertical),
            align,
            className
          ],
          colSpan: isVertical ? span : span * 2 - 1
        }, content);
      default:
        return h("td", {
          style,
          class: [ns.e("cell"), align],
          colSpan: span
        }, [
          h("span", {
            class: [ns.e("label"), labelClassName]
          }, label),
          h("span", {
            class: [ns.e("content"), className]
          }, content)
        ]);
    }
  }
});


//# sourceMappingURL=descriptions-cell.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions/src/descriptions-row.mjs





const descriptions_row_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElDescriptionsRow",
  components: {
    [DescriptionsCell.name]: DescriptionsCell
  },
  props: {
    row: {
      type: Array
    }
  },
  setup() {
    const descriptions = runtime_core_esm_bundler_inject(elDescriptionsKey, {});
    return {
      descriptions
    };
  }
});
const descriptions_row_hoisted_1 = { key: 1 };
function descriptions_row_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_descriptions_cell = resolveComponent("el-descriptions-cell");
  return _ctx.descriptions.direction === "vertical" ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 0 }, [
    createBaseVNode("tr", null, [
      (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.row, (cell, index) => {
        return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_descriptions_cell, {
          key: `tr1-${index}`,
          cell,
          tag: "th",
          type: "label"
        }, null, 8, ["cell"]);
      }), 128))
    ]),
    createBaseVNode("tr", null, [
      (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.row, (cell, index) => {
        return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_descriptions_cell, {
          key: `tr2-${index}`,
          cell,
          tag: "td",
          type: "content"
        }, null, 8, ["cell"]);
      }), 128))
    ])
  ], 64)) : (runtime_core_esm_bundler_openBlock(), createElementBlock("tr", descriptions_row_hoisted_1, [
    (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.row, (cell, index) => {
      return runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, {
        key: `tr3-${index}`
      }, [
        _ctx.descriptions.border ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 0 }, [
          runtime_core_esm_bundler_createVNode(_component_el_descriptions_cell, {
            cell,
            tag: "td",
            type: "label"
          }, null, 8, ["cell"]),
          runtime_core_esm_bundler_createVNode(_component_el_descriptions_cell, {
            cell,
            tag: "td",
            type: "content"
          }, null, 8, ["cell"])
        ], 64)) : (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_descriptions_cell, {
          key: 1,
          cell,
          tag: "td",
          type: "both"
        }, null, 8, ["cell"]))
      ], 64);
    }), 128))
  ]));
}
var DescriptionsRow = /* @__PURE__ */ _export_sfc(descriptions_row_sfc_main, [["render", descriptions_row_sfc_render]]);


//# sourceMappingURL=descriptions-row.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions/src/index.mjs









const descriptions_src_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElDescriptions",
  components: {
    [DescriptionsRow.name]: DescriptionsRow
  },
  props: {
    border: {
      type: Boolean,
      default: false
    },
    column: {
      type: Number,
      default: 3
    },
    direction: {
      type: String,
      default: "horizontal"
    },
    size: {
      type: String,
      validator: isValidComponentSize
    },
    title: {
      type: String,
      default: ""
    },
    extra: {
      type: String,
      default: ""
    }
  },
  setup(props, { slots }) {
    runtime_core_esm_bundler_provide(elDescriptionsKey, props);
    const descriptionsSize = useSize();
    const ns = useNamespace("descriptions");
    const descriptionKls = runtime_core_esm_bundler_computed(() => [
      ns.b(),
      ns.is(ns.m(descriptionsSize.value), !!descriptionsSize.value)
    ]);
    const flattedChildren = (children) => {
      const temp = Array.isArray(children) ? children : [children];
      const res = [];
      temp.forEach((child) => {
        if (Array.isArray(child.children)) {
          res.push(...flattedChildren(child.children));
        } else {
          res.push(child);
        }
      });
      return res;
    };
    const filledNode = (node, span, count, isLast = false) => {
      if (!node.props) {
        node.props = {};
      }
      if (span > count) {
        node.props.span = count;
      }
      if (isLast) {
        node.props.span = span;
      }
      return node;
    };
    const getRows = () => {
      var _a;
      const children = flattedChildren((_a = slots.default) == null ? void 0 : _a.call(slots)).filter((node) => {
        var _a2;
        return ((_a2 = node == null ? void 0 : node.type) == null ? void 0 : _a2.name) === "ElDescriptionsItem";
      });
      const rows = [];
      let temp = [];
      let count = props.column;
      let totalSpan = 0;
      children.forEach((node, index) => {
        var _a2;
        const span = ((_a2 = node.props) == null ? void 0 : _a2.span) || 1;
        if (index < children.length - 1) {
          totalSpan += span > count ? count : span;
        }
        if (index === children.length - 1) {
          const lastSpan = props.column - totalSpan % props.column;
          temp.push(filledNode(node, lastSpan, count, true));
          rows.push(temp);
          return;
        }
        if (span < count) {
          count -= span;
          temp.push(node);
        } else {
          temp.push(filledNode(node, span, count));
          rows.push(temp);
          count = props.column;
          temp = [];
        }
      });
      return rows;
    };
    return {
      descriptionKls,
      getRows,
      ns
    };
  }
});
function descriptions_src_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_descriptions_row = resolveComponent("el-descriptions-row");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass(_ctx.descriptionKls)
  }, [
    _ctx.title || _ctx.extra || _ctx.$slots.title || _ctx.$slots.extra ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
      key: 0,
      class: normalizeClass(_ctx.ns.e("header"))
    }, [
      createBaseVNode("div", {
        class: normalizeClass(_ctx.ns.e("title"))
      }, [
        renderSlot(_ctx.$slots, "title", {}, () => [
          createTextVNode(toDisplayString(_ctx.title), 1)
        ])
      ], 2),
      createBaseVNode("div", {
        class: normalizeClass(_ctx.ns.e("extra"))
      }, [
        renderSlot(_ctx.$slots, "extra", {}, () => [
          createTextVNode(toDisplayString(_ctx.extra), 1)
        ])
      ], 2)
    ], 2)) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    createBaseVNode("div", {
      class: normalizeClass(_ctx.ns.e("body"))
    }, [
      createBaseVNode("table", {
        class: normalizeClass([_ctx.ns.e("table"), _ctx.ns.is("bordered", _ctx.border)])
      }, [
        createBaseVNode("tbody", null, [
          (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.getRows(), (row, index) => {
            return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_descriptions_row, {
              key: index,
              row
            }, null, 8, ["row"]);
          }), 128))
        ])
      ], 2)
    ], 2)
  ], 2);
}
var Descriptions = /* @__PURE__ */ _export_sfc(descriptions_src_sfc_main, [["render", descriptions_src_sfc_render]]);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions/src/description-item.mjs


var DescriptionsItem = runtime_core_esm_bundler_defineComponent({
  name: "ElDescriptionsItem",
  props: {
    label: {
      type: String,
      default: ""
    },
    span: {
      type: Number,
      default: 1
    },
    width: {
      type: [String, Number],
      default: ""
    },
    minWidth: {
      type: [String, Number],
      default: ""
    },
    align: {
      type: String,
      default: "left"
    },
    labelAlign: {
      type: String,
      default: ""
    },
    className: {
      type: String,
      default: ""
    },
    labelClassName: {
      type: String,
      default: ""
    }
  }
});


//# sourceMappingURL=description-item.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/descriptions/index.mjs




const ElDescriptions = withInstall(Descriptions, {
  DescriptionsItem: DescriptionsItem
});
const ElDescriptionsItem = withNoopInstall(DescriptionsItem);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtInfo.vue?vue&type=template&id=3d2207de
/* unplugin-vue-components disabled */


const HwtInfovue_type_template_id_3d2207de_hoisted_1 = ["innerHTML"];
const HwtInfovue_type_template_id_3d2207de_hoisted_2 = ["innerHTML"];
function HwtInfovue_type_template_id_3d2207de_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_descriptions_item = ElDescriptionsItem;

  const _component_el_descriptions = ElDescriptions;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_descriptions, {
    column: 3,
    size: "default",
    direction: "vertical",
    border: ""
  }, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_descriptions_item, {
      label: "作业名",
      span: 2
    }, {
      default: withCtx(() => [createTextVNode(toDisplayString($props.propHwtContent.title), 1
      /* TEXT */
      )]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_descriptions_item, {
      label: "截止日期"
    }, {
      default: withCtx(() => [createTextVNode(toDisplayString($props.propHwtContent.deadline), 1
      /* TEXT */
      )]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_descriptions_item, {
      label: "总分"
    }, {
      default: withCtx(() => [createTextVNode(toDisplayString($props.propHwtContent.score), 1
      /* TEXT */
      )]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_descriptions_item, {
      label: "取得分数"
    }, {
      default: withCtx(() => [createTextVNode(toDisplayString($props.propHwtContent.getscore), 1
      /* TEXT */
      )]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_descriptions_item, {
      label: "评语",
      span: 2
    }, {
      default: withCtx(() => [createTextVNode(toDisplayString($props.propHwtContent.comments), 1
      /* TEXT */
      )]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_descriptions_item, {
      label: "作业内容",
      span: 3
    }, {
      default: withCtx(() => [createBaseVNode("div", {
        innerHTML: $props.propHwtContent.content
      }, null, 8
      /* PROPS */
      , HwtInfovue_type_template_id_3d2207de_hoisted_1)]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_descriptions_item, {
      label: "回答内容",
      span: 3
    }, {
      default: withCtx(() => [createBaseVNode("div", {
        innerHTML: $props.propHwtContent.answer
      }, null, 8
      /* PROPS */
      , HwtInfovue_type_template_id_3d2207de_hoisted_2)]),
      _: 1
      /* STABLE */

    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/HwtInfo.vue?vue&type=template&id=3d2207de
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/HwtInfo.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled *//* harmony default export */ const HwtInfovue_type_script_lang_js = ({
  data() {
    return {
      hwtContent: {} // dont assign this.propHwtContent directly

    };
  },

  watch: {
    propHwtContent: function (val) {
      this.hwtContent = val;
    }
  },
  props: ["propHwtContent"]
});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/HwtInfo.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/HwtInfo.vue
/* unplugin-vue-components disabled */



;
const HwtInfo_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(HwtInfovue_type_script_lang_js, [['render',HwtInfovue_type_template_id_3d2207de_render]])

/* harmony default export */ const HwtInfo = (HwtInfo_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=template&id=3203cb20&scoped=true
/* unplugin-vue-components disabled */










const LessonSubmitvue_type_template_id_3203cb20_scoped_true_withScopeId = n => (pushScopeId("data-v-3203cb20"), n = n(), popScopeId(), n);

const LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_1 = {
  class: "card-header"
};

const LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_2 = /*#__PURE__*/LessonSubmitvue_type_template_id_3203cb20_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("span", null, "提交作业", -1
/* HOISTED */
));

const LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_3 = /*#__PURE__*/LessonSubmitvue_type_template_id_3203cb20_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1645775950545",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21783",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M753.066667 270.933333A339.541333 339.541333 0 0 0 512 170.666667a341.333333 341.333333 0 0 0-341.333333 341.333333 341.333333 341.333333 0 0 0 341.333333 341.333333c159.146667 0 291.84-108.8 329.813333-256h-88.746666A255.573333 255.573333 0 0 1 512 768a256 256 0 0 1-256-256 256 256 0 0 1 256-256c70.826667 0 133.973333 29.44 180.053333 75.946667L554.666667 469.333333h298.666666V170.666667l-100.266666 100.266666z",
  fill: "",
  "p-id": "21784"
})], -1
/* HOISTED */
));

const LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_4 = {
  key: 1,
  class: "operation"
};

const LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_5 = /*#__PURE__*/createTextVNode("提交");

const LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_6 = /*#__PURE__*/createTextVNode("返回");

const LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_7 = /*#__PURE__*/createTextVNode("查看效果");

function LessonSubmitvue_type_template_id_3203cb20_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_icon = ElIcon;

  const _component_el_button = ElButton;

  const _component_hwt_info = HwtInfo;

  const _component_hwt_editor = HwtEditor;

  const _component_el_tooltip = ElTooltip;

  const _component_el_card = ElCard;

  const _component_el_col = ElCol;

  const _component_hwt_list = HwtList;

  const _component_el_row = ElRow;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_row, null, {
    default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 14
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_card, {
        shadow: "hover"
      }, {
        header: withCtx(() => [createBaseVNode("div", LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_1, [LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_2, runtime_core_esm_bundler_createVNode(_component_el_button, {
          loading: $data.loadingStatus,
          disabled: $data.loadingStatus,
          onClick: $options.refreshTable,
          circle: ""
        }, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
            default: withCtx(() => [LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_3]),
            _: 1
            /* STABLE */

          })]),
          _: 1
          /* STABLE */

        }, 8
        /* PROPS */
        , ["loading", "disabled", "onClick"])])]),
        default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_hwt_info, {
          propHwtContent: $data.hwtContent
        }, null, 8
        /* PROPS */
        , ["propHwtContent"]), this.$route.query.able === 'true' ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_hwt_editor, {
          key: 0,
          ref: "editorObj",
          propHwtContents: {
            hwtContent: $data.hwtContent,
            hwtContentWithId: $data.hwtContentWithId
          }
        }, null, 8
        /* PROPS */
        , ["propHwtContents"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true), this.$route.query.able === 'true' ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_4, [runtime_core_esm_bundler_createVNode(_component_el_button, {
          onClick: $options.handleButtonSubmit
        }, {
          default: withCtx(() => [LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_5]),
          _: 1
          /* STABLE */

        }, 8
        /* PROPS */
        , ["onClick"]), runtime_core_esm_bundler_createVNode(_component_el_button, {
          onClick: $options.handleButtonReturn
        }, {
          default: withCtx(() => [LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_6]),
          _: 1
          /* STABLE */

        }, 8
        /* PROPS */
        , ["onClick"]), runtime_core_esm_bundler_createVNode(_component_el_tooltip, {
          class: "box-item",
          effect: "dark",
          content: "查看提交效果,此按钮将在未来被删除",
          placement: "right-start"
        }, {
          default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_button, {
            onClick: $options.handleButtonDebug
          }, {
            default: withCtx(() => [LessonSubmitvue_type_template_id_3203cb20_scoped_true_hoisted_7]),
            _: 1
            /* STABLE */

          }, 8
          /* PROPS */
          , ["onClick"])]),
          _: 1
          /* STABLE */

        })])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)]),
        _: 1
        /* STABLE */

      })]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_col, {
      span: 10
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_hwt_list)]),
      _: 1
      /* STABLE */

    })]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=template&id=3203cb20&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */






/* harmony default export */ const LessonSubmitvue_type_script_lang_js = ({
  components: {
    HwtInfo: HwtInfo,
    HwtEditor: HwtEditor,
    HwtList: HwtList
  },

  data() {
    return {
      lid: "",
      hwtid: "",
      hwtContent: {},
      hwtContentWithId: {},
      // hwtid & hwaid
      manySubmitStatus: false,
      loadingStatus: true
    };
  },

  created() {
    this.lid = this.$route.params.lid;
    this.hwtid = this.$route.params.hwtid;
    this.dataInit(this.hwtid);
  },

  watch: {
    $route(to) {
      // if (to.path.indexOf("review") !== -1) return;
      if (this.$route.params.hwtid === undefined) return;
      this.hwtContent = {};
      this.hwtContentWithId = {};
      this.dataInit(this.$route.params.hwtid);
    }

  },
  methods: {
    async dataInit(hwtid) {
      await API.getHwtReview(this.lid, this.hwtid).then(res => {
        res.json().then(res => {
          this.manySubmitStatus = res.datas.manySubmitStatus;

          if (res.datas.manySubmitStatus === false) {
            let notify = ElNotification({
              title: "免Flash文件上传",
              type: "warning",
              message: `注意,该作业不允许重复提交`,
              onClick: () => {
                notify.close();
              }
            });
          }
        });
      });
      await GetInfo.getHwtReviewContent(hwtid).then(res => {
        this.hwtContent = res;
        this.loadingStatus = false;
        return res;
      });

      if (this.$route.query.able === "true") {
        await GetInfo.getHwtContent(hwtid).then(res => {
          this.hwtContentWithId = res;
          return res;
        });
      }
    },

    refreshTable() {
      this.loadingStatus = true;
      this.dataInit(this.$route.params.hwtid);
    },

    getEditorContent() {
      let editor = this.$refs.editorObj.editorObj;
      return editor.txt.html();
    },

    hwtSubmit() {
      Log("submit confirmed");
      let url = `http://cc.bjtu.edu.cn:81/meol/common/hw/student/write.do.jsp`;
      const GBK = window.GBK;
      var details = {
        hwtid: this.hwtContentWithId.hwtid,
        hwaid: this.hwtContentWithId.hwaid,
        IPT_BODY: this.getEditorContent()
      };
      var formBody = [];

      for (var property in details) {
        var encodedKey = GBK.URI.encodeURIComponent(property);
        var encodedValue = GBK.URI.encodeURIComponent(details[property]);
        formBody.push(encodedKey + "=" + encodedValue);
      }

      formBody = formBody.join("&");
      SendRequest(url, undefined, {
        method: "POST",
        headers: {
          "Content-Type": "application/x-www-form-urlencoded"
        },
        body: formBody
      }).then(res => {
        if (res.ok === true) {
          Log("hwt submit successfully");
          this.refreshTable();
          let notify = ElNotification({
            title: "免Flash文件上传",
            type: "success",
            message: `作业已成功提交`,
            onClick: () => {
              notify.close();
            }
          });
        }
      });
    },

    handleButtonSubmit() {
      Log("hwt submit trigger");

      if (this.manySubmitStatus === false) {
        ElMessageBox.confirm(`该作业不允许重复提交,确定提交作业吗?`, "警告", {
          confirmButtonText: "OK",
          cancelButtonText: "Cancel"
        }).then(res => {
          this.hwtSubmit();
        }).catch(res => {
          Log("submit canceled");
        });
      } else {
        this.hwtSubmit();
      }
    },

    handleButtonReturn() {
      this.$router.go(-1);
    },

    handleButtonDebug() {
      window.open(`http://cc.bjtu.edu.cn:81/meol/common/hw/student/taskanswer.jsp?hwtid=${this.hwtContentWithId.hwtid}`);
    }

  }
});
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=style&index=0&id=3203cb20&scoped=true&lang=css
var LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=style&index=0&id=3203cb20&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=style&index=0&id=3203cb20&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_options = {};

LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css/* default */.Z, LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css_options);




       /* harmony default export */ const LessonSubmit_LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css = (LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css/* default */.Z && LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css/* default.locals */.Z.locals ? LessonSubmitvue_type_style_index_0_id_3203cb20_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/LessonSubmit.vue?vue&type=style&index=0&id=3203cb20&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/Lesson/LessonSubmit/LessonSubmit.vue
/* unplugin-vue-components disabled */



;


const LessonSubmit_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(LessonSubmitvue_type_script_lang_js, [['render',LessonSubmitvue_type_template_id_3203cb20_scoped_true_render],['__scopeId',"data-v-3203cb20"]])

/* harmony default export */ const LessonSubmit = (LessonSubmit_exports_);
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-slider.css
var el_slider = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-slider.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-slider.css

      
      
      
      
      
      
      
      
      

var el_slider_options = {};

el_slider_options.styleTagTransform = (styleTagTransform_default());
el_slider_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_slider_options.insert = insertBySelector_default().bind(null, "head");
    
el_slider_options.domAPI = (styleDomAPI_default());
el_slider_options.insertStyleElement = (insertStyleElement_default());

var el_slider_update = injectStylesIntoStyleTag_default()(el_slider/* default */.Z, el_slider_options);




       /* harmony default export */ const theme_chalk_el_slider = (el_slider/* default */.Z && el_slider/* default.locals */.Z.locals ? el_slider/* default.locals */.Z.locals : undefined);

// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-input-number.css
var el_input_number = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/element-plus/theme-chalk/el-input-number.css");
;// CONCATENATED MODULE: ./node_modules/element-plus/theme-chalk/el-input-number.css

      
      
      
      
      
      
      
      
      

var el_input_number_options = {};

el_input_number_options.styleTagTransform = (styleTagTransform_default());
el_input_number_options.setAttributes = (setAttributesWithoutAttributes_default());

      el_input_number_options.insert = insertBySelector_default().bind(null, "head");
    
el_input_number_options.domAPI = (styleDomAPI_default());
el_input_number_options.insertStyleElement = (insertStyleElement_default());

var el_input_number_update = injectStylesIntoStyleTag_default()(el_input_number/* default */.Z, el_input_number_options);




       /* harmony default export */ const theme_chalk_el_input_number = (el_input_number/* default */.Z && el_input_number/* default.locals */.Z.locals ? el_input_number/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input-number/style/css.mjs



//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/style/css.mjs




//# sourceMappingURL=css.mjs.map

;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/plus.mjs



const plus_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "Plus"
});
const plus_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const plus_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M480 480V128a32 32 0 0164 0v352h352a32 32 0 110 64H544v352a32 32 0 11-64 0V544H128a32 32 0 010-64h352z"
}, null, -1);
const plus_hoisted_3 = [
  plus_hoisted_2
];
function plus_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", plus_hoisted_1, plus_hoisted_3);
}
var plus = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(plus_sfc_main, [["render", plus_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/@element-plus/icons-vue/dist/es/minus.mjs



const minus_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "Minus"
});
const minus_hoisted_1 = {
  class: "icon",
  width: "200",
  height: "200",
  viewBox: "0 0 1024 1024",
  xmlns: "http://www.w3.org/2000/svg"
};
const minus_hoisted_2 = /* @__PURE__ */ createBaseVNode("path", {
  fill: "currentColor",
  d: "M128 544h768a32 32 0 100-64H128a32 32 0 000 64z"
}, null, -1);
const minus_hoisted_3 = [
  minus_hoisted_2
];
function minus_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  return runtime_core_esm_bundler_openBlock(), createElementBlock("svg", minus_hoisted_1, minus_hoisted_3);
}
var minus = /* @__PURE__ */ plugin_vue_export_helper_export_sfc(minus_sfc_main, [["render", minus_sfc_render]]);



;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input-number/src/input-number.mjs



const inputNumberProps = buildProps({
  step: {
    type: Number,
    default: 1
  },
  stepStrictly: {
    type: Boolean,
    default: false
  },
  max: {
    type: Number,
    default: Infinity
  },
  min: {
    type: Number,
    default: -Infinity
  },
  modelValue: {
    type: Number
  },
  disabled: {
    type: Boolean,
    default: false
  },
  size: {
    type: String,
    values: componentSize
  },
  controls: {
    type: Boolean,
    default: true
  },
  controlsPosition: {
    type: String,
    default: "",
    values: ["", "right"]
  },
  name: String,
  label: String,
  placeholder: String,
  precision: {
    type: Number,
    validator: (val) => val >= 0 && val === parseInt(`${val}`, 10)
  }
});
const inputNumberEmits = {
  change: (prev, cur) => prev !== cur,
  blur: (e) => e instanceof FocusEvent,
  focus: (e) => e instanceof FocusEvent,
  input: (val) => util_isNumber(val),
  "update:modelValue": (val) => util_isNumber(val) || val === void 0
};


//# sourceMappingURL=input-number.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/directives/repeat-click/index.mjs


var RepeatClick = {
  beforeMount(el, binding) {
    let interval = null;
    let startTime;
    const handler = () => binding.value && binding.value();
    const clear = () => {
      if (Date.now() - startTime < 100) {
        handler();
      }
      clearInterval(interval);
      interval = null;
    };
    dom_on(el, "mousedown", (e) => {
      if (e.button !== 0)
        return;
      startTime = Date.now();
      once(document, "mouseup", clear);
      clearInterval(interval);
      interval = setInterval(handler, 100);
    });
  }
};


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input-number/src/input-number2.mjs















const input_number2_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElInputNumber",
  components: {
    ElInput: ElInput,
    ElIcon: ElIcon,
    ArrowUp: arrowUp,
    ArrowDown: arrowDown,
    Plus: plus,
    Minus: minus
  },
  directives: {
    RepeatClick: RepeatClick
  },
  props: inputNumberProps,
  emits: inputNumberEmits,
  setup(props, { emit }) {
    const input = reactivity_esm_bundler_ref();
    const data = reactivity_esm_bundler_reactive({
      currentValue: props.modelValue,
      userInput: null
    });
    const { formItem } = useFormItem();
    const ns = useNamespace("input-number");
    const minDisabled = runtime_core_esm_bundler_computed(() => _decrease(props.modelValue) < props.min);
    const maxDisabled = runtime_core_esm_bundler_computed(() => _increase(props.modelValue) > props.max);
    const numPrecision = runtime_core_esm_bundler_computed(() => {
      const stepPrecision = getPrecision(props.step);
      if (props.precision !== void 0) {
        if (stepPrecision > props.precision) {
          error_debugWarn("InputNumber", "precision should not be less than the decimal places of step");
        }
        return props.precision;
      } else {
        return Math.max(getPrecision(props.modelValue), stepPrecision);
      }
    });
    const controlsAtRight = runtime_core_esm_bundler_computed(() => {
      return props.controls && props.controlsPosition === "right";
    });
    const inputNumberSize = useSize();
    const inputNumberDisabled = useDisabled();
    const displayValue = runtime_core_esm_bundler_computed(() => {
      if (data.userInput !== null) {
        return data.userInput;
      }
      let currentValue = data.currentValue;
      if (util_isNumber(currentValue)) {
        if (Number.isNaN(currentValue))
          return "";
        if (props.precision !== void 0) {
          currentValue = currentValue.toFixed(props.precision);
        }
      }
      return currentValue;
    });
    const toPrecision = (num, pre) => {
      if (pre === void 0)
        pre = numPrecision.value;
      return parseFloat(`${Math.round(num * Math.pow(10, pre)) / Math.pow(10, pre)}`);
    };
    const getPrecision = (value) => {
      if (value === void 0)
        return 0;
      const valueString = value.toString();
      const dotPosition = valueString.indexOf(".");
      let precision = 0;
      if (dotPosition !== -1) {
        precision = valueString.length - dotPosition - 1;
      }
      return precision;
    };
    const _increase = (val) => {
      if (!util_isNumber(val))
        return data.currentValue;
      const precisionFactor = Math.pow(10, numPrecision.value);
      val = util_isNumber(val) ? val : NaN;
      return toPrecision((precisionFactor * val + precisionFactor * props.step) / precisionFactor);
    };
    const _decrease = (val) => {
      if (!util_isNumber(val))
        return data.currentValue;
      const precisionFactor = Math.pow(10, numPrecision.value);
      val = util_isNumber(val) ? val : NaN;
      return toPrecision((precisionFactor * val - precisionFactor * props.step) / precisionFactor);
    };
    const increase = () => {
      if (inputNumberDisabled.value || maxDisabled.value)
        return;
      const value = props.modelValue || 0;
      const newVal = _increase(value);
      setCurrentValue(newVal);
    };
    const decrease = () => {
      if (inputNumberDisabled.value || minDisabled.value)
        return;
      const value = props.modelValue || 0;
      const newVal = _decrease(value);
      setCurrentValue(newVal);
    };
    const setCurrentValue = (newVal) => {
      var _a;
      const oldVal = data.currentValue;
      if (typeof newVal === "number" && props.precision !== void 0) {
        newVal = toPrecision(newVal, props.precision);
      }
      if (newVal !== void 0 && newVal >= props.max)
        newVal = props.max;
      if (newVal !== void 0 && newVal <= props.min)
        newVal = props.min;
      if (oldVal === newVal)
        return;
      if (!util_isNumber(newVal)) {
        newVal = void 0;
      }
      data.userInput = null;
      emit("update:modelValue", newVal);
      emit("input", newVal);
      emit("change", newVal, oldVal);
      (_a = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a.call(formItem, "change");
      data.currentValue = newVal;
    };
    const handleInput = (value) => {
      return data.userInput = value;
    };
    const handleInputChange = (value) => {
      const newVal = value !== "" ? Number(value) : "";
      if (util_isNumber(newVal) && !Number.isNaN(newVal) || value === "") {
        setCurrentValue(newVal);
      }
      data.userInput = null;
    };
    const focus = () => {
      var _a, _b;
      (_b = (_a = input.value) == null ? void 0 : _a.focus) == null ? void 0 : _b.call(_a);
    };
    const blur = () => {
      var _a, _b;
      (_b = (_a = input.value) == null ? void 0 : _a.blur) == null ? void 0 : _b.call(_a);
    };
    const handleFocus = (event) => {
      emit("focus", event);
    };
    const handleBlur = (event) => {
      var _a;
      emit("blur", event);
      (_a = formItem == null ? void 0 : formItem.validate) == null ? void 0 : _a.call(formItem, "blur");
    };
    runtime_core_esm_bundler_watch(() => props.modelValue, (value) => {
      let newVal = Number(value);
      if (value === null) {
        newVal = Number.NaN;
      }
      if (!isNaN(newVal)) {
        if (props.stepStrictly) {
          const stepPrecision = getPrecision(props.step);
          const precisionFactor = Math.pow(10, stepPrecision);
          newVal = Math.round(newVal / props.step) * precisionFactor * props.step / precisionFactor;
        }
        if (props.precision !== void 0) {
          newVal = toPrecision(newVal, props.precision);
        }
        if (newVal > props.max) {
          newVal = props.max;
          emit("update:modelValue", newVal);
        }
        if (newVal < props.min) {
          newVal = props.min;
          emit("update:modelValue", newVal);
        }
      }
      data.currentValue = newVal;
      data.userInput = null;
    }, { immediate: true });
    runtime_core_esm_bundler_onMounted(() => {
      var _a;
      const innerInput = (_a = input.value) == null ? void 0 : _a.input;
      innerInput.setAttribute("role", "spinbutton");
      innerInput.setAttribute("aria-valuemax", String(props.max));
      innerInput.setAttribute("aria-valuemin", String(props.min));
      innerInput.setAttribute("aria-valuenow", String(data.currentValue));
      innerInput.setAttribute("aria-disabled", String(inputNumberDisabled.value));
      if (!util_isNumber(props.modelValue)) {
        let val = Number(props.modelValue);
        if (isNaN(val)) {
          val = void 0;
        }
        emit("update:modelValue", val);
      }
    });
    runtime_core_esm_bundler_onUpdated(() => {
      var _a;
      const innerInput = (_a = input.value) == null ? void 0 : _a.input;
      innerInput.setAttribute("aria-valuenow", data.currentValue);
    });
    return {
      input,
      displayValue,
      handleInput,
      handleInputChange,
      controlsAtRight,
      decrease,
      increase,
      inputNumberSize,
      inputNumberDisabled,
      maxDisabled,
      minDisabled,
      focus,
      blur,
      handleFocus,
      handleBlur,
      ns
    };
  }
});
function input_number2_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_arrow_down = resolveComponent("arrow-down");
  const _component_minus = resolveComponent("minus");
  const _component_el_icon = resolveComponent("el-icon");
  const _component_arrow_up = resolveComponent("arrow-up");
  const _component_plus = resolveComponent("plus");
  const _component_el_input = resolveComponent("el-input");
  const _directive_repeat_click = resolveDirective("repeat-click");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    class: normalizeClass([
      _ctx.ns.b(),
      _ctx.ns.m(_ctx.inputNumberSize),
      _ctx.ns.is("disabled", _ctx.inputNumberDisabled),
      _ctx.ns.is("without-controls", !_ctx.controls),
      _ctx.ns.is("controls-right", _ctx.controlsAtRight)
    ]),
    onDragstart: _cache[2] || (_cache[2] = withModifiers(() => {
    }, ["prevent"]))
  }, [
    _ctx.controls ? withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
      key: 0,
      role: "button",
      class: normalizeClass([_ctx.ns.e("decrease"), _ctx.ns.is("disabled", _ctx.minDisabled)]),
      onKeydown: _cache[0] || (_cache[0] = withKeys((...args) => _ctx.decrease && _ctx.decrease(...args), ["enter"]))
    }, [
      runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
        default: withCtx(() => [
          _ctx.controlsAtRight ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_arrow_down, { key: 0 })) : (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_minus, { key: 1 }))
        ]),
        _: 1
      })
    ], 34)), [
      [_directive_repeat_click, _ctx.decrease]
    ]) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    _ctx.controls ? withDirectives((runtime_core_esm_bundler_openBlock(), createElementBlock("span", {
      key: 1,
      role: "button",
      class: normalizeClass([_ctx.ns.e("increase"), _ctx.ns.is("disabled", _ctx.maxDisabled)]),
      onKeydown: _cache[1] || (_cache[1] = withKeys((...args) => _ctx.increase && _ctx.increase(...args), ["enter"]))
    }, [
      runtime_core_esm_bundler_createVNode(_component_el_icon, null, {
        default: withCtx(() => [
          _ctx.controlsAtRight ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_arrow_up, { key: 0 })) : (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_plus, { key: 1 }))
        ]),
        _: 1
      })
    ], 34)), [
      [_directive_repeat_click, _ctx.increase]
    ]) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
    runtime_core_esm_bundler_createVNode(_component_el_input, {
      ref: "input",
      type: "number",
      step: _ctx.step,
      "model-value": _ctx.displayValue,
      placeholder: _ctx.placeholder,
      disabled: _ctx.inputNumberDisabled,
      size: _ctx.inputNumberSize,
      max: _ctx.max,
      min: _ctx.min,
      name: _ctx.name,
      label: _ctx.label,
      "validate-event": false,
      onKeydown: [
        withKeys(withModifiers(_ctx.increase, ["prevent"]), ["up"]),
        withKeys(withModifiers(_ctx.decrease, ["prevent"]), ["down"])
      ],
      onBlur: _ctx.handleBlur,
      onFocus: _ctx.handleFocus,
      onInput: _ctx.handleInput,
      onChange: _ctx.handleInputChange
    }, null, 8, ["step", "model-value", "placeholder", "disabled", "size", "max", "min", "name", "label", "onKeydown", "onBlur", "onFocus", "onInput", "onChange"])
  ], 34);
}
var InputNumber = /* @__PURE__ */ _export_sfc(input_number2_sfc_main, [["render", input_number2_sfc_render]]);


//# sourceMappingURL=input-number2.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/input-number/index.mjs




const ElInputNumber = withInstall(InputNumber);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/src/useSliderButton.mjs





const useTooltip = (props, formatTooltip, showTooltip) => {
  const tooltip = reactivity_esm_bundler_ref(null);
  const tooltipVisible = reactivity_esm_bundler_ref(false);
  const enableFormat = runtime_core_esm_bundler_computed(() => {
    return formatTooltip.value instanceof Function;
  });
  const formatValue = runtime_core_esm_bundler_computed(() => {
    return enableFormat.value && formatTooltip.value(props.modelValue) || props.modelValue;
  });
  const displayTooltip = lodash_debounce(() => {
    showTooltip.value && (tooltipVisible.value = true);
  }, 50);
  const hideTooltip = lodash_debounce(() => {
    showTooltip.value && (tooltipVisible.value = false);
  }, 50);
  return {
    tooltip,
    tooltipVisible,
    formatValue,
    displayTooltip,
    hideTooltip
  };
};
const useSliderButton = (props, initData, emit) => {
  const {
    disabled,
    min,
    max,
    step,
    showTooltip,
    precision,
    sliderSize,
    formatTooltip,
    emitChange,
    resetSize,
    updateDragging
  } = runtime_core_esm_bundler_inject("SliderProvider");
  const { tooltip, tooltipVisible, formatValue, displayTooltip, hideTooltip } = useTooltip(props, formatTooltip, showTooltip);
  const currentPosition = runtime_core_esm_bundler_computed(() => {
    return `${(props.modelValue - min.value) / (max.value - min.value) * 100}%`;
  });
  const wrapperStyle = runtime_core_esm_bundler_computed(() => {
    return props.vertical ? { bottom: currentPosition.value } : { left: currentPosition.value };
  });
  const handleMouseEnter = () => {
    initData.hovering = true;
    displayTooltip();
  };
  const handleMouseLeave = () => {
    initData.hovering = false;
    if (!initData.dragging) {
      hideTooltip();
    }
  };
  const onButtonDown = (event) => {
    if (disabled.value)
      return;
    event.preventDefault();
    onDragStart(event);
    dom_on(window, "mousemove", onDragging);
    dom_on(window, "touchmove", onDragging);
    dom_on(window, "mouseup", onDragEnd);
    dom_on(window, "touchend", onDragEnd);
    dom_on(window, "contextmenu", onDragEnd);
  };
  const onLeftKeyDown = () => {
    if (disabled.value)
      return;
    initData.newPosition = parseFloat(currentPosition.value) - step.value / (max.value - min.value) * 100;
    setPosition(initData.newPosition);
    emitChange();
  };
  const onRightKeyDown = () => {
    if (disabled.value)
      return;
    initData.newPosition = parseFloat(currentPosition.value) + step.value / (max.value - min.value) * 100;
    setPosition(initData.newPosition);
    emitChange();
  };
  const getClientXY = (event) => {
    let clientX;
    let clientY;
    if (event.type.startsWith("touch")) {
      clientY = event.touches[0].clientY;
      clientX = event.touches[0].clientX;
    } else {
      clientY = event.clientY;
      clientX = event.clientX;
    }
    return {
      clientX,
      clientY
    };
  };
  const onDragStart = (event) => {
    initData.dragging = true;
    initData.isClick = true;
    const { clientX, clientY } = getClientXY(event);
    if (props.vertical) {
      initData.startY = clientY;
    } else {
      initData.startX = clientX;
    }
    initData.startPosition = parseFloat(currentPosition.value);
    initData.newPosition = initData.startPosition;
  };
  const onDragging = (event) => {
    if (initData.dragging) {
      initData.isClick = false;
      displayTooltip();
      resetSize();
      let diff;
      const { clientX, clientY } = getClientXY(event);
      if (props.vertical) {
        initData.currentY = clientY;
        diff = (initData.startY - initData.currentY) / sliderSize.value * 100;
      } else {
        initData.currentX = clientX;
        diff = (initData.currentX - initData.startX) / sliderSize.value * 100;
      }
      initData.newPosition = initData.startPosition + diff;
      setPosition(initData.newPosition);
    }
  };
  const onDragEnd = () => {
    if (initData.dragging) {
      setTimeout(() => {
        initData.dragging = false;
        if (!initData.hovering) {
          hideTooltip();
        }
        if (!initData.isClick) {
          setPosition(initData.newPosition);
          emitChange();
        }
      }, 0);
      off(window, "mousemove", onDragging);
      off(window, "touchmove", onDragging);
      off(window, "mouseup", onDragEnd);
      off(window, "touchend", onDragEnd);
      off(window, "contextmenu", onDragEnd);
    }
  };
  const setPosition = async (newPosition) => {
    if (newPosition === null || isNaN(newPosition))
      return;
    if (newPosition < 0) {
      newPosition = 0;
    } else if (newPosition > 100) {
      newPosition = 100;
    }
    const lengthPerStep = 100 / ((max.value - min.value) / step.value);
    const steps = Math.round(newPosition / lengthPerStep);
    let value = steps * lengthPerStep * (max.value - min.value) * 0.01 + min.value;
    value = parseFloat(value.toFixed(precision.value));
    emit(UPDATE_MODEL_EVENT, value);
    if (!initData.dragging && props.modelValue !== initData.oldValue) {
      initData.oldValue = props.modelValue;
    }
    await runtime_core_esm_bundler_nextTick();
    initData.dragging && displayTooltip();
    tooltip.value.updatePopper();
  };
  runtime_core_esm_bundler_watch(() => initData.dragging, (val) => {
    updateDragging(val);
  });
  return {
    tooltip,
    tooltipVisible,
    showTooltip,
    wrapperStyle,
    formatValue,
    handleMouseEnter,
    handleMouseLeave,
    onButtonDown,
    onLeftKeyDown,
    onRightKeyDown,
    setPosition
  };
};


//# sourceMappingURL=useSliderButton.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/src/button.mjs






const button_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElSliderButton",
  components: {
    ElTooltip: ElTooltip
  },
  props: {
    modelValue: {
      type: Number,
      default: 0
    },
    vertical: {
      type: Boolean,
      default: false
    },
    tooltipClass: {
      type: String,
      default: ""
    }
  },
  emits: [UPDATE_MODEL_EVENT],
  setup(props, { emit }) {
    const initData = reactivity_esm_bundler_reactive({
      hovering: false,
      dragging: false,
      isClick: false,
      startX: 0,
      currentX: 0,
      startY: 0,
      currentY: 0,
      startPosition: 0,
      newPosition: 0,
      oldValue: props.modelValue
    });
    const {
      tooltip,
      showTooltip,
      tooltipVisible,
      wrapperStyle,
      formatValue,
      handleMouseEnter,
      handleMouseLeave,
      onButtonDown,
      onLeftKeyDown,
      onRightKeyDown,
      setPosition
    } = useSliderButton(props, initData, emit);
    const { hovering, dragging } = reactivity_esm_bundler_toRefs(initData);
    return {
      tooltip,
      tooltipVisible,
      showTooltip,
      wrapperStyle,
      formatValue,
      handleMouseEnter,
      handleMouseLeave,
      onButtonDown,
      onLeftKeyDown,
      onRightKeyDown,
      setPosition,
      hovering,
      dragging
    };
  }
});
function button_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_tooltip = resolveComponent("el-tooltip");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    ref: "button",
    class: normalizeClass(["el-slider__button-wrapper", { hover: _ctx.hovering, dragging: _ctx.dragging }]),
    style: normalizeStyle(_ctx.wrapperStyle),
    tabindex: "0",
    onMouseenter: _cache[1] || (_cache[1] = (...args) => _ctx.handleMouseEnter && _ctx.handleMouseEnter(...args)),
    onMouseleave: _cache[2] || (_cache[2] = (...args) => _ctx.handleMouseLeave && _ctx.handleMouseLeave(...args)),
    onMousedown: _cache[3] || (_cache[3] = (...args) => _ctx.onButtonDown && _ctx.onButtonDown(...args)),
    onTouchstart: _cache[4] || (_cache[4] = (...args) => _ctx.onButtonDown && _ctx.onButtonDown(...args)),
    onFocus: _cache[5] || (_cache[5] = (...args) => _ctx.handleMouseEnter && _ctx.handleMouseEnter(...args)),
    onBlur: _cache[6] || (_cache[6] = (...args) => _ctx.handleMouseLeave && _ctx.handleMouseLeave(...args)),
    onKeydown: [
      _cache[7] || (_cache[7] = withKeys((...args) => _ctx.onLeftKeyDown && _ctx.onLeftKeyDown(...args), ["left"])),
      _cache[8] || (_cache[8] = withKeys((...args) => _ctx.onRightKeyDown && _ctx.onRightKeyDown(...args), ["right"])),
      _cache[9] || (_cache[9] = withKeys(withModifiers((...args) => _ctx.onLeftKeyDown && _ctx.onLeftKeyDown(...args), ["prevent"]), ["down"])),
      _cache[10] || (_cache[10] = withKeys(withModifiers((...args) => _ctx.onRightKeyDown && _ctx.onRightKeyDown(...args), ["prevent"]), ["up"]))
    ]
  }, [
    runtime_core_esm_bundler_createVNode(_component_el_tooltip, {
      ref: "tooltip",
      visible: _ctx.tooltipVisible,
      "onUpdate:visible": _cache[0] || (_cache[0] = ($event) => _ctx.tooltipVisible = $event),
      placement: "top",
      "stop-popper-mouse-event": false,
      "popper-class": _ctx.tooltipClass,
      disabled: !_ctx.showTooltip,
      persistent: ""
    }, {
      content: withCtx(() => [
        createBaseVNode("span", null, toDisplayString(_ctx.formatValue), 1)
      ]),
      default: withCtx(() => [
        createBaseVNode("div", {
          class: normalizeClass(["el-slider__button", { hover: _ctx.hovering, dragging: _ctx.dragging }])
        }, null, 2)
      ]),
      _: 1
    }, 8, ["visible", "popper-class", "disabled"])
  ], 38);
}
var SliderButton = /* @__PURE__ */ _export_sfc(button_sfc_main, [["render", button_sfc_render]]);


//# sourceMappingURL=button.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/src/marker.mjs


const marker_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElMarker",
  props: {
    mark: {
      type: [String, Object],
      default: () => void 0
    }
  },
  setup(props) {
    const label = runtime_core_esm_bundler_computed(() => {
      return typeof props.mark === "string" ? props.mark : props.mark.label;
    });
    return {
      label
    };
  },
  render() {
    var _a;
    return h("div", {
      class: "el-slider__marks-text",
      style: (_a = this.mark) == null ? void 0 : _a.style
    }, this.label);
  }
});


//# sourceMappingURL=marker.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/src/useMarks.mjs


const useMarks = (props) => {
  return runtime_core_esm_bundler_computed(() => {
    if (!props.marks) {
      return [];
    }
    const marksKeys = Object.keys(props.marks);
    return marksKeys.map(parseFloat).sort((a, b) => a - b).filter((point) => point <= props.max && point >= props.min).map((point) => ({
      point,
      position: (point - props.min) * 100 / (props.max - props.min),
      mark: props.marks[point]
    }));
  });
};


//# sourceMappingURL=useMarks.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/src/useSlide.mjs





const useSlide = (props, initData, emit) => {
  const elForm = runtime_core_esm_bundler_inject(elFormKey, {});
  const elFormItem = runtime_core_esm_bundler_inject(elFormItemKey, {});
  const slider = reactivity_esm_bundler_shallowRef(null);
  const firstButton = reactivity_esm_bundler_ref(null);
  const secondButton = reactivity_esm_bundler_ref(null);
  const buttonRefs = {
    firstButton,
    secondButton
  };
  const sliderDisabled = runtime_core_esm_bundler_computed(() => {
    return props.disabled || elForm.disabled || false;
  });
  const minValue = runtime_core_esm_bundler_computed(() => {
    return Math.min(initData.firstValue, initData.secondValue);
  });
  const maxValue = runtime_core_esm_bundler_computed(() => {
    return Math.max(initData.firstValue, initData.secondValue);
  });
  const barSize = runtime_core_esm_bundler_computed(() => {
    return props.range ? `${100 * (maxValue.value - minValue.value) / (props.max - props.min)}%` : `${100 * (initData.firstValue - props.min) / (props.max - props.min)}%`;
  });
  const barStart = runtime_core_esm_bundler_computed(() => {
    return props.range ? `${100 * (minValue.value - props.min) / (props.max - props.min)}%` : "0%";
  });
  const runwayStyle = runtime_core_esm_bundler_computed(() => {
    return props.vertical ? { height: props.height } : {};
  });
  const barStyle = runtime_core_esm_bundler_computed(() => {
    return props.vertical ? {
      height: barSize.value,
      bottom: barStart.value
    } : {
      width: barSize.value,
      left: barStart.value
    };
  });
  const resetSize = () => {
    if (slider.value) {
      initData.sliderSize = slider.value[`client${props.vertical ? "Height" : "Width"}`];
    }
  };
  const setPosition = (percent) => {
    const targetValue = props.min + percent * (props.max - props.min) / 100;
    if (!props.range) {
      firstButton.value.setPosition(percent);
      return;
    }
    let buttonRefName;
    if (Math.abs(minValue.value - targetValue) < Math.abs(maxValue.value - targetValue)) {
      buttonRefName = initData.firstValue < initData.secondValue ? "firstButton" : "secondButton";
    } else {
      buttonRefName = initData.firstValue > initData.secondValue ? "firstButton" : "secondButton";
    }
    buttonRefs[buttonRefName].value.setPosition(percent);
  };
  const setFirstValue = (firstValue) => {
    initData.firstValue = firstValue;
    _emit(props.range ? [minValue.value, maxValue.value] : firstValue);
  };
  const setSecondValue = (secondValue) => {
    initData.secondValue = secondValue;
    if (props.range) {
      _emit([minValue.value, maxValue.value]);
    }
  };
  const _emit = (val) => {
    emit(UPDATE_MODEL_EVENT, val);
    emit(INPUT_EVENT, val);
  };
  const emitChange = async () => {
    await runtime_core_esm_bundler_nextTick();
    emit(CHANGE_EVENT, props.range ? [minValue.value, maxValue.value] : props.modelValue);
  };
  const onSliderClick = (event) => {
    if (sliderDisabled.value || initData.dragging)
      return;
    resetSize();
    if (props.vertical) {
      const sliderOffsetBottom = slider.value.getBoundingClientRect().bottom;
      setPosition((sliderOffsetBottom - event.clientY) / initData.sliderSize * 100);
    } else {
      const sliderOffsetLeft = slider.value.getBoundingClientRect().left;
      setPosition((event.clientX - sliderOffsetLeft) / initData.sliderSize * 100);
    }
    emitChange();
  };
  return {
    elFormItem,
    slider,
    firstButton,
    secondButton,
    sliderDisabled,
    minValue,
    maxValue,
    runwayStyle,
    barStyle,
    resetSize,
    setPosition,
    emitChange,
    onSliderClick,
    setFirstValue,
    setSecondValue
  };
};


//# sourceMappingURL=useSlide.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/src/useStops.mjs



const useStops = (props, initData, minValue, maxValue) => {
  const stops = runtime_core_esm_bundler_computed(() => {
    if (!props.showStops || props.min > props.max)
      return [];
    if (props.step === 0) {
      error_debugWarn("Slider", "step should not be 0.");
      return [];
    }
    const stopCount = (props.max - props.min) / props.step;
    const stepWidth = 100 * props.step / (props.max - props.min);
    const result = Array.from({ length: stopCount - 1 }).map((_, index) => (index + 1) * stepWidth);
    if (props.range) {
      return result.filter((step) => {
        return step < 100 * (minValue.value - props.min) / (props.max - props.min) || step > 100 * (maxValue.value - props.min) / (props.max - props.min);
      });
    } else {
      return result.filter((step) => step > 100 * (initData.firstValue - props.min) / (props.max - props.min));
    }
  });
  const getStopStyle = (position) => {
    return props.vertical ? { bottom: `${position}%` } : { left: `${position}%` };
  };
  return {
    stops,
    getStopStyle
  };
};


//# sourceMappingURL=useStops.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/src/index.mjs















const slider_src_sfc_main = runtime_core_esm_bundler_defineComponent({
  name: "ElSlider",
  components: {
    ElInputNumber: ElInputNumber,
    SliderButton: SliderButton,
    SliderMarker: marker_sfc_main
  },
  props: {
    modelValue: {
      type: [Number, Array],
      default: 0
    },
    min: {
      type: Number,
      default: 0
    },
    max: {
      type: Number,
      default: 100
    },
    step: {
      type: Number,
      default: 1
    },
    showInput: {
      type: Boolean,
      default: false
    },
    showInputControls: {
      type: Boolean,
      default: true
    },
    size: {
      type: String,
      validator: isValidComponentSize
    },
    inputSize: {
      type: String,
      validator: isValidComponentSize
    },
    showStops: {
      type: Boolean,
      default: false
    },
    showTooltip: {
      type: Boolean,
      default: true
    },
    formatTooltip: {
      type: Function,
      default: void 0
    },
    disabled: {
      type: Boolean,
      default: false
    },
    range: {
      type: Boolean,
      default: false
    },
    vertical: {
      type: Boolean,
      default: false
    },
    height: {
      type: String,
      default: ""
    },
    debounce: {
      type: Number,
      default: 300
    },
    label: {
      type: String,
      default: void 0
    },
    tooltipClass: {
      type: String,
      default: void 0
    },
    marks: Object
  },
  emits: [UPDATE_MODEL_EVENT, CHANGE_EVENT, INPUT_EVENT],
  setup(props, { emit }) {
    const initData = reactivity_esm_bundler_reactive({
      firstValue: 0,
      secondValue: 0,
      oldValue: 0,
      dragging: false,
      sliderSize: 1
    });
    const {
      elFormItem,
      slider,
      firstButton,
      secondButton,
      sliderDisabled,
      minValue,
      maxValue,
      runwayStyle,
      barStyle,
      resetSize,
      emitChange,
      onSliderClick,
      setFirstValue,
      setSecondValue
    } = useSlide(props, initData, emit);
    const { stops, getStopStyle } = useStops(props, initData, minValue, maxValue);
    const sliderWrapperSize = useSize();
    const sliderInputSize = runtime_core_esm_bundler_computed(() => props.inputSize || sliderWrapperSize.value);
    const prefix = "el-slider";
    const sliderKls = runtime_core_esm_bundler_computed(() => [
      prefix,
      `${prefix}--${sliderWrapperSize.value}`,
      props.vertical ? "is-vertical" : "",
      props.showInput ? "el-slider--with-input" : ""
    ]);
    const markList = useMarks(props);
    useWatch(props, initData, minValue, maxValue, emit, elFormItem);
    const precision = runtime_core_esm_bundler_computed(() => {
      const precisions = [props.min, props.max, props.step].map((item) => {
        const decimal = `${item}`.split(".")[1];
        return decimal ? decimal.length : 0;
      });
      return Math.max.apply(null, precisions);
    });
    const { sliderWrapper } = useLifecycle(props, initData, resetSize);
    const { firstValue, secondValue, oldValue, dragging, sliderSize } = reactivity_esm_bundler_toRefs(initData);
    const updateDragging = (val) => {
      initData.dragging = val;
    };
    runtime_core_esm_bundler_provide("SliderProvider", {
      ...reactivity_esm_bundler_toRefs(props),
      sliderSize,
      disabled: sliderDisabled,
      precision,
      emitChange,
      resetSize,
      updateDragging
    });
    return {
      firstValue,
      secondValue,
      oldValue,
      dragging,
      sliderSize,
      slider,
      firstButton,
      secondButton,
      sliderDisabled,
      runwayStyle,
      barStyle,
      emitChange,
      onSliderClick,
      getStopStyle,
      setFirstValue,
      setSecondValue,
      stops,
      markList,
      sliderWrapper,
      sliderWrapperSize,
      sliderInputSize,
      sliderKls
    };
  }
});
const useWatch = (props, initData, minValue, maxValue, emit, elFormItem) => {
  const _emit = (val) => {
    emit(UPDATE_MODEL_EVENT, val);
    emit(INPUT_EVENT, val);
  };
  const valueChanged = () => {
    if (props.range) {
      return ![minValue.value, maxValue.value].every((item, index) => item === initData.oldValue[index]);
    } else {
      return props.modelValue !== initData.oldValue;
    }
  };
  const setValues = () => {
    var _a, _b;
    if (props.min > props.max) {
      throwError("Slider", "min should not be greater than max.");
      return;
    }
    const val = props.modelValue;
    if (props.range && Array.isArray(val)) {
      if (val[1] < props.min) {
        _emit([props.min, props.min]);
      } else if (val[0] > props.max) {
        _emit([props.max, props.max]);
      } else if (val[0] < props.min) {
        _emit([props.min, val[1]]);
      } else if (val[1] > props.max) {
        _emit([val[0], props.max]);
      } else {
        initData.firstValue = val[0];
        initData.secondValue = val[1];
        if (valueChanged()) {
          (_a = elFormItem.validate) == null ? void 0 : _a.call(elFormItem, "change");
          initData.oldValue = val.slice();
        }
      }
    } else if (!props.range && typeof val === "number" && !isNaN(val)) {
      if (val < props.min) {
        _emit(props.min);
      } else if (val > props.max) {
        _emit(props.max);
      } else {
        initData.firstValue = val;
        if (valueChanged()) {
          (_b = elFormItem.validate) == null ? void 0 : _b.call(elFormItem, "change");
          initData.oldValue = val;
        }
      }
    }
  };
  setValues();
  runtime_core_esm_bundler_watch(() => initData.dragging, (val) => {
    if (!val) {
      setValues();
    }
  });
  runtime_core_esm_bundler_watch(() => props.modelValue, (val, oldVal) => {
    if (initData.dragging || Array.isArray(val) && Array.isArray(oldVal) && val.every((item, index) => item === oldVal[index])) {
      return;
    }
    setValues();
  });
  runtime_core_esm_bundler_watch(() => [props.min, props.max], () => {
    setValues();
  });
};
const useLifecycle = (props, initData, resetSize) => {
  const sliderWrapper = reactivity_esm_bundler_ref(null);
  runtime_core_esm_bundler_onMounted(async () => {
    let valuetext;
    if (props.range) {
      if (Array.isArray(props.modelValue)) {
        initData.firstValue = Math.max(props.min, props.modelValue[0]);
        initData.secondValue = Math.min(props.max, props.modelValue[1]);
      } else {
        initData.firstValue = props.min;
        initData.secondValue = props.max;
      }
      initData.oldValue = [initData.firstValue, initData.secondValue];
      valuetext = `${initData.firstValue}-${initData.secondValue}`;
    } else {
      if (typeof props.modelValue !== "number" || isNaN(props.modelValue)) {
        initData.firstValue = props.min;
      } else {
        initData.firstValue = Math.min(props.max, Math.max(props.min, props.modelValue));
      }
      initData.oldValue = initData.firstValue;
      valuetext = initData.firstValue;
    }
    sliderWrapper.value.setAttribute("aria-valuetext", valuetext);
    sliderWrapper.value.setAttribute("aria-label", props.label ? props.label : `slider between ${props.min} and ${props.max}`);
    dom_on(window, "resize", resetSize);
    await runtime_core_esm_bundler_nextTick();
    resetSize();
  });
  runtime_core_esm_bundler_onBeforeUnmount(() => {
    off(window, "resize", resetSize);
  });
  return {
    sliderWrapper
  };
};
const slider_src_hoisted_1 = ["aria-valuemin", "aria-valuemax", "aria-orientation", "aria-disabled"];
const slider_src_hoisted_2 = { key: 1 };
const slider_src_hoisted_3 = { class: "el-slider__marks" };
function slider_src_sfc_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_slider_button = resolveComponent("slider-button");
  const _component_slider_marker = resolveComponent("slider-marker");
  const _component_el_input_number = resolveComponent("el-input-number");
  return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
    ref: "sliderWrapper",
    class: normalizeClass(_ctx.sliderKls),
    role: "slider",
    "aria-valuemin": _ctx.min,
    "aria-valuemax": _ctx.max,
    "aria-orientation": _ctx.vertical ? "vertical" : "horizontal",
    "aria-disabled": _ctx.sliderDisabled
  }, [
    createBaseVNode("div", {
      ref: "slider",
      class: normalizeClass(["el-slider__runway", { "show-input": _ctx.showInput && !_ctx.range, disabled: _ctx.sliderDisabled }]),
      style: normalizeStyle(_ctx.runwayStyle),
      onClick: _cache[0] || (_cache[0] = (...args) => _ctx.onSliderClick && _ctx.onSliderClick(...args))
    }, [
      createBaseVNode("div", {
        class: "el-slider__bar",
        style: normalizeStyle(_ctx.barStyle)
      }, null, 4),
      runtime_core_esm_bundler_createVNode(_component_slider_button, {
        ref: "firstButton",
        "model-value": _ctx.firstValue,
        vertical: _ctx.vertical,
        "tooltip-class": _ctx.tooltipClass,
        "onUpdate:modelValue": _ctx.setFirstValue
      }, null, 8, ["model-value", "vertical", "tooltip-class", "onUpdate:modelValue"]),
      _ctx.range ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_slider_button, {
        key: 0,
        ref: "secondButton",
        "model-value": _ctx.secondValue,
        vertical: _ctx.vertical,
        "tooltip-class": _ctx.tooltipClass,
        "onUpdate:modelValue": _ctx.setSecondValue
      }, null, 8, ["model-value", "vertical", "tooltip-class", "onUpdate:modelValue"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
      _ctx.showStops ? (runtime_core_esm_bundler_openBlock(), createElementBlock("div", slider_src_hoisted_2, [
        (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.stops, (item, key) => {
          return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
            key,
            class: "el-slider__stop",
            style: normalizeStyle(_ctx.getStopStyle(item))
          }, null, 4);
        }), 128))
      ])) : runtime_core_esm_bundler_createCommentVNode("v-if", true),
      _ctx.markList.length > 0 ? (runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, { key: 2 }, [
        createBaseVNode("div", null, [
          (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.markList, (item, key) => {
            return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
              key,
              style: normalizeStyle(_ctx.getStopStyle(item.position)),
              class: "el-slider__stop el-slider__marks-stop"
            }, null, 4);
          }), 128))
        ]),
        createBaseVNode("div", slider_src_hoisted_3, [
          (runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList(_ctx.markList, (item, key) => {
            return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_slider_marker, {
              key,
              mark: item.mark,
              style: normalizeStyle(_ctx.getStopStyle(item.position))
            }, null, 8, ["mark", "style"]);
          }), 128))
        ])
      ], 64)) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
    ], 6),
    _ctx.showInput && !_ctx.range ? (runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_input_number, {
      key: 0,
      ref: "input",
      "model-value": _ctx.firstValue,
      class: "el-slider__input",
      step: _ctx.step,
      disabled: _ctx.sliderDisabled,
      controls: _ctx.showInputControls,
      min: _ctx.min,
      max: _ctx.max,
      debounce: _ctx.debounce,
      size: _ctx.sliderInputSize,
      "onUpdate:modelValue": _ctx.setFirstValue,
      onChange: _ctx.emitChange
    }, null, 8, ["model-value", "step", "disabled", "controls", "min", "max", "debounce", "size", "onUpdate:modelValue", "onChange"])) : runtime_core_esm_bundler_createCommentVNode("v-if", true)
  ], 10, slider_src_hoisted_1);
}
var Slider = /* @__PURE__ */ _export_sfc(slider_src_sfc_main, [["render", slider_src_sfc_render]]);


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/element-plus/es/components/slider/index.mjs



Slider.install = (app) => {
  app.component(Slider.name, Slider);
};
const _Slider = Slider;
const ElSlider = _Slider;


//# sourceMappingURL=index.mjs.map

;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Profile/ProfileIndex.vue?vue&type=template&id=496da70e&scoped=true
/* unplugin-vue-components disabled */




const ProfileIndexvue_type_template_id_496da70e_scoped_true_withScopeId = n => (pushScopeId("data-v-496da70e"), n = n(), popScopeId(), n);

const ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_1 = /*#__PURE__*/ProfileIndexvue_type_template_id_496da70e_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("div", {
  class: "card-header"
}, [/*#__PURE__*/createBaseVNode("span", null, "主页卡片显示设置")], -1
/* HOISTED */
));

const ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_2 = {
  class: "demonstration"
};
const ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_3 = {
  class: "button-div"
};

const ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_4 = /*#__PURE__*/createTextVNode("保存");

const ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_5 = /*#__PURE__*/createTextVNode("重置");

function ProfileIndexvue_type_template_id_496da70e_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_slider = ElSlider;

  const _component_el_card = ElCard;

  const _component_el_button = ElButton;

  return runtime_core_esm_bundler_openBlock(), createElementBlock(runtime_core_esm_bundler_Fragment, null, [runtime_core_esm_bundler_createVNode(_component_el_card, {
    class: "box-card",
    shadow: "hover"
  }, {
    header: withCtx(() => [ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_1]),
    default: withCtx(() => [(runtime_core_esm_bundler_openBlock(true), createElementBlock(runtime_core_esm_bundler_Fragment, null, renderList($data.cardSizeConfigs, key => {
      return runtime_core_esm_bundler_openBlock(), createElementBlock("div", {
        class: "slider-demo-block",
        key: key.id
      }, [createBaseVNode("span", ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_2, toDisplayString($options.cardNameformatter(key.id)), 1
      /* TEXT */
      ), runtime_core_esm_bundler_createVNode(_component_el_slider, {
        modelValue: key.value,
        "onUpdate:modelValue": $event => key.value = $event,
        min: 0,
        max: 24,
        step: 1,
        "show-stops": "",
        marks: $data.marks
      }, null, 8
      /* PROPS */
      , ["modelValue", "onUpdate:modelValue", "marks"])]);
    }), 128
    /* KEYED_FRAGMENT */
    ))]),
    _: 1
    /* STABLE */

  }), createBaseVNode("div", ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_3, [runtime_core_esm_bundler_createVNode(_component_el_button, {
    onClick: $options.saveConfig
  }, {
    default: withCtx(() => [ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_4]),
    _: 1
    /* STABLE */

  }, 8
  /* PROPS */
  , ["onClick"]), runtime_core_esm_bundler_createVNode(_component_el_button, {
    onClick: $options.restoreConfig
  }, {
    default: withCtx(() => [ProfileIndexvue_type_template_id_496da70e_scoped_true_hoisted_5]),
    _: 1
    /* STABLE */

  }, 8
  /* PROPS */
  , ["onClick"])])], 64
  /* STABLE_FRAGMENT */
  );
}
;// CONCATENATED MODULE: ./src/components/Profile/ProfileIndex.vue?vue&type=template&id=496da70e&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Profile/ProfileIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const ProfileIndexvue_type_script_lang_js = ({
  data() {
    return {
      marks: {
        0: "不显示",
        6: "6",
        12: "12",
        18: "18",
        24: "24"
      },
      userConfig: ConfigOperations.readUserConfig(),
      cardSizeConfigs: ConfigOperations.readUserConfigWithFilter("card-size") // Array

    };
  },

  methods: {
    saveConfig() {
      this.cardSizeConfigs.forEach(config => {
        ConfigOperations.setUserConfig(config.id, config.value);
      });
      let notify = ElNotification({
        title: "免Flash文件上传",
        type: "success",
        message: `设置已更新`,
        onClick: () => {
          notify.close();
        }
      });
    },

    restoreConfig() {
      this.cardSizeConfigs.forEach((config, index) => {
        this.cardSizeConfigs[index].value = config.default;
        ConfigOperations.setUserConfig(config.id, config.default);
      });
      this.saveConfig();
    },

    cardNameformatter(id) {
      switch (id) {
        case "hwt-list-card-size":
          return "作业列表";

        case "notify-list-card-size":
          return "通知列表";

        case "lesson-list-card-size":
          return "课程列表";

        case "inform-list-card-size":
          return "系统通知";

        case "user-info-card-size":
          return "用户信息";

        case "calender-card-size":
          return "日历";
      }
    }

  }
});
;// CONCATENATED MODULE: ./src/components/Profile/ProfileIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Profile/ProfileIndex.vue?vue&type=style&index=0&id=496da70e&scoped=true&lang=css
var ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Profile/ProfileIndex.vue?vue&type=style&index=0&id=496da70e&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/Profile/ProfileIndex.vue?vue&type=style&index=0&id=496da70e&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_options = {};

ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css/* default */.Z, ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css_options);




       /* harmony default export */ const Profile_ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css = (ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css/* default */.Z && ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css/* default.locals */.Z.locals ? ProfileIndexvue_type_style_index_0_id_496da70e_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/Profile/ProfileIndex.vue?vue&type=style&index=0&id=496da70e&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/Profile/ProfileIndex.vue
/* unplugin-vue-components disabled */



;


const ProfileIndex_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(ProfileIndexvue_type_script_lang_js, [['render',ProfileIndexvue_type_template_id_496da70e_scoped_true_render],['__scopeId',"data-v-496da70e"]])

/* harmony default export */ const ProfileIndex = (ProfileIndex_exports_);
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/templateLoader.js??ruleSet[1].rules[4]!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/About/AboutIndex.vue?vue&type=template&id=4feba1a2&scoped=true
/* unplugin-vue-components disabled */





const AboutIndexvue_type_template_id_4feba1a2_scoped_true_withScopeId = n => (pushScopeId("data-v-4feba1a2"), n = n(), popScopeId(), n);

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_1 = {
  class: "title",
  align: "center"
};

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_2 = /*#__PURE__*/createTextVNode(" 免Flash文件上传");

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_3 = {
  class: "description",
  align: "center"
};

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_4 = /*#__PURE__*/AboutIndexvue_type_template_id_4feba1a2_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("div", {
  class: "badges"
}, [/*#__PURE__*/createBaseVNode("a", {
  href: "https://github.com/ZiuChen/NO-FLASH-Upload"
}, [/*#__PURE__*/createBaseVNode("img", {
  src: "https://img.shields.io/badge/Github-black?logo=github",
  alt: ""
})]), /*#__PURE__*/createBaseVNode("a", {
  href: "https://gitee.com/ziuc/NO-FLASH-Upload"
}, [/*#__PURE__*/createBaseVNode("img", {
  src: "https://img.shields.io/static/v1?label=Gitee&message=%E9%95%9C%E5%83%8F&color=c71d23&style=flat-square&logo=gitee&logoColor=c71d23",
  alt: ""
})]), /*#__PURE__*/createBaseVNode("img", {
  src: "https://img.shields.io/static/v1?label=Node.js&message=v14.16&color=339933&style=flat-square&logo=node.js&logoColor=ffffff",
  alt: ""
}), /*#__PURE__*/createBaseVNode("img", {
  src: "https://img.shields.io/static/v1?label=Vue.js&message=v3.2&color=4FC08D&style=flat-square&logo=vue.js&logoColor=ffffff",
  alt: ""
}), /*#__PURE__*/createBaseVNode("img", {
  src: "https://img.shields.io/badge/%20License-MIT-yellow?style=flat-square&labelColor=black",
  alt: ""
})], -1
/* HOISTED */
));

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_5 = {
  class: "button-block",
  align: "center"
};

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_6 = /*#__PURE__*/AboutIndexvue_type_template_id_4feba1a2_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1646098546718",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21783",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M170.666667 85.333333h682.666666a85.333333 85.333333 0 0 1 85.333334 85.333334v682.666666a85.333333 85.333333 0 0 1-85.333334 85.333334h-219.733333c-14.933333-3.413333-14.933333-32.426667-14.933333-42.666667v-116.906667c0-39.68-14.08-65.706667-29.44-78.933333 95.146667-10.666667 194.986667-46.506667 194.986666-209.493333 0-47.36-16.213333-85.333333-43.946666-115.626667 4.266667-10.666667 19.2-55.04-4.266667-112.64 0 0-35.84-11.52-117.333333 43.52-33.706667-9.386667-70.4-14.08-106.666667-14.08-36.266667 0-72.96 4.693333-106.666667 14.08-81.493333-55.04-117.333333-43.52-117.333333-43.52-23.466667 57.6-8.533333 101.973333-4.266667 112.64-27.733333 30.293333-43.946667 68.266667-43.946666 115.626667 0 162.56 99.413333 199.253333 194.133333 209.92-11.946667 10.666667-23.04 29.44-26.88 57.173333-24.32 10.24-87.04 29.44-124.16-35.413333 0 0-22.613333-40.96-65.28-43.946667 0 0-41.813333-0.853333-4.266667 25.6 0 0 29.013333 13.226667 48.64 62.72 0 0 25.173333 82.773333 143.36 57.173333V896c0 10.24 0 39.253333-15.36 42.666667H170.666667a85.333333 85.333333 0 0 1-85.333334-85.333334V170.666667a85.333333 85.333333 0 0 1 85.333334-85.333334z",
  fill: "",
  "p-id": "21784"
})], -1
/* HOISTED */
));

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_7 = /*#__PURE__*/createTextVNode("主页");

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_8 = /*#__PURE__*/AboutIndexvue_type_template_id_4feba1a2_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1646098492774",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21633",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M853.333333 85.333333H170.666667a85.333333 85.333333 0 0 0-85.333334 85.333334v768l170.666667-170.666667h597.333333a85.333333 85.333333 0 0 0 85.333334-85.333333V170.666667a85.333333 85.333333 0 0 0-85.333334-85.333334M256 384h512v85.333333H256m341.333333 128H256v-85.333333h341.333333m170.666667-170.666667H256V256h512",
  fill: "",
  "p-id": "21634"
})], -1
/* HOISTED */
));

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_9 = /*#__PURE__*/createTextVNode(" 反馈");

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_10 = /*#__PURE__*/AboutIndexvue_type_template_id_4feba1a2_scoped_true_withScopeId(() => /*#__PURE__*/createBaseVNode("svg", {
  t: "1646098584201",
  class: "icon",
  viewBox: "0 0 1024 1024",
  version: "1.1",
  xmlns: "http://www.w3.org/2000/svg",
  "p-id": "21933",
  width: "200",
  height: "200"
}, [/*#__PURE__*/createBaseVNode("path", {
  d: "M512 910.933333l-61.866667-56.32C230.4 655.36 85.333333 523.52 85.333333 362.666667 85.333333 230.826667 188.586667 128 320 128c74.24 0 145.493333 34.56 192 88.746667C558.506667 162.56 629.76 128 704 128 835.413333 128 938.666667 230.826667 938.666667 362.666667c0 160.853333-145.066667 292.693333-364.8 491.946666L512 910.933333z",
  fill: "",
  "p-id": "21934"
})], -1
/* HOISTED */
));

const AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_11 = /*#__PURE__*/createTextVNode(" 捐赠");

function AboutIndexvue_type_template_id_4feba1a2_scoped_true_render(_ctx, _cache, $props, $setup, $data, $options) {
  const _component_el_tag = ElTag;

  const _component_el_icon = ElIcon;

  const _component_el_button = ElButton;

  const _component_el_card = ElCard;

  return runtime_core_esm_bundler_openBlock(), runtime_core_esm_bundler_createBlock(_component_el_card, null, {
    default: withCtx(() => [createBaseVNode("div", AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_1, [createBaseVNode("h2", null, [AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_2, runtime_core_esm_bundler_createVNode(_component_el_tag, {
      type: "success"
    }, {
      default: withCtx(() => [createTextVNode(toDisplayString($data.config.version), 1
      /* TEXT */
      )]),
      _: 1
      /* STABLE */

    })])]), createBaseVNode("div", AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_3, [createBaseVNode("span", null, toDisplayString($data.config.description), 1
    /* TEXT */
    )]), AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_4, createBaseVNode("div", AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_5, [runtime_core_esm_bundler_createVNode(_component_el_button, {
      onClick: _cache[0] || (_cache[0] = $event => $options.handleButtonClick($data.config.githubUrl))
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, {
        size: $data.iconSize
      }, {
        default: withCtx(() => [AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_6]),
        _: 1
        /* STABLE */

      }, 8
      /* PROPS */
      , ["size"]), AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_7]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_button, {
      onClick: _cache[1] || (_cache[1] = $event => $options.handleButtonClick($data.config.tencentUrl))
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, {
        size: $data.iconSize
      }, {
        default: withCtx(() => [AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_8]),
        _: 1
        /* STABLE */

      }, 8
      /* PROPS */
      , ["size"]), AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_9]),
      _: 1
      /* STABLE */

    }), runtime_core_esm_bundler_createVNode(_component_el_button, {
      onClick: _cache[2] || (_cache[2] = $event => $options.handleButtonClick(this.donateUrl))
    }, {
      default: withCtx(() => [runtime_core_esm_bundler_createVNode(_component_el_icon, {
        size: $data.iconSize
      }, {
        default: withCtx(() => [AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_10]),
        _: 1
        /* STABLE */

      }, 8
      /* PROPS */
      , ["size"]), AboutIndexvue_type_template_id_4feba1a2_scoped_true_hoisted_11]),
      _: 1
      /* STABLE */

    })])]),
    _: 1
    /* STABLE */

  });
}
;// CONCATENATED MODULE: ./src/components/About/AboutIndex.vue?vue&type=template&id=4feba1a2&scoped=true
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/babel-loader/lib/index.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/About/AboutIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */
/* harmony default export */ const AboutIndexvue_type_script_lang_js = ({
  data() {
    return {
      config: Config,
      iconSize: 18,
      donateUrl: `https://fastly.jsdelivr.net/gh/ZiuChen/NO-FLASH-Upload@master/doc/img/Buy%20me%20a%20coffee.png`
    };
  },

  methods: {
    handleButtonClick(url) {
      window.open(url);
    }

  }
});
;// CONCATENATED MODULE: ./src/components/About/AboutIndex.vue?vue&type=script&lang=js
/* unplugin-vue-components disabled */ 
// EXTERNAL MODULE: ./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/About/AboutIndex.vue?vue&type=style&index=0&id=4feba1a2&scoped=true&lang=css
var AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css = __webpack_require__("./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/About/AboutIndex.vue?vue&type=style&index=0&id=4feba1a2&scoped=true&lang=css");
;// CONCATENATED MODULE: ./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[14].use[0]!./node_modules/unplugin/dist/webpack/loaders/transform.js??ruleSet[1].rules[15].use[0]!./node_modules/style-loader/dist/cjs.js!./node_modules/css-loader/dist/cjs.js!./node_modules/vue-loader/dist/stylePostLoader.js!./node_modules/vue-loader/dist/index.js??ruleSet[1].rules[9].use[0]!./src/components/About/AboutIndex.vue?vue&type=style&index=0&id=4feba1a2&scoped=true&lang=css
/* unplugin-vue-components disabled */
      
      
      
      
      
      
      
      
      

var AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_options = {};

AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_options.styleTagTransform = (styleTagTransform_default());
AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_options.setAttributes = (setAttributesWithoutAttributes_default());

      AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_options.insert = insertBySelector_default().bind(null, "head");
    
AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_options.domAPI = (styleDomAPI_default());
AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_options.insertStyleElement = (insertStyleElement_default());

var AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_update = injectStylesIntoStyleTag_default()(AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css/* default */.Z, AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css_options);




       /* harmony default export */ const About_AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css = (AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css/* default */.Z && AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css/* default.locals */.Z.locals ? AboutIndexvue_type_style_index_0_id_4feba1a2_scoped_true_lang_css/* default.locals */.Z.locals : undefined);

;// CONCATENATED MODULE: ./src/components/About/AboutIndex.vue?vue&type=style&index=0&id=4feba1a2&scoped=true&lang=css
/* unplugin-vue-components disabled */
;// CONCATENATED MODULE: ./src/components/About/AboutIndex.vue
/* unplugin-vue-components disabled */



;


const AboutIndex_exports_ = /*#__PURE__*/(0,exportHelper/* default */.Z)(AboutIndexvue_type_script_lang_js, [['render',AboutIndexvue_type_template_id_4feba1a2_scoped_true_render],['__scopeId',"data-v-4feba1a2"]])

/* harmony default export */ const AboutIndex = (AboutIndex_exports_);
;// CONCATENATED MODULE: ./src/route/index.ts







const router = createRouter({
    history: createWebHashHistory(),
    routes: [
        { path: "/", redirect: "/welcome" },
        {
            path: "/welcome",
            component: WelcomeIndex,
        },
        {
            path: "/lesson/:lid",
            component: LessonIndex,
            redirect: (to) => {
                console.log(to);
                return `${to.path}/info`;
            },
            children: [
                {
                    path: "info",
                    component: LessonInfo,
                },
                {
                    path: "submit/:hwtid",
                    component: LessonSubmit,
                },
            ],
        },
        {
            path: "/profile",
            component: ProfileIndex,
        },
        {
            path: "/about",
            component: AboutIndex,
        },
    ],
});
router.beforeEach((to, from, next) => {
    if (to.matched.length === 0) {
        // no match
        from.name ? next({ name: from.name }) : next("/");
        let notify = ElNotification({
            title: "免Flash文件上传",
            type: "warning",
            message: `未找到页面,已重定向。`,
            onClick: () => {
                notify.close();
            },
        });
    }
    else {
        // matched
        next();
    }
});
/* harmony default export */ const route = (router);

;// CONCATENATED MODULE: ./src/style/MainStyle.ts
const style = /* css */ `
body {
    margin: 0;
    overflow-x: hidden;
    overflow-y: hidden;
    font-family: Helvetica, Tahoma, Arial, 'Heiti SC', 'Microsoft YaHei', 'WenQuanYi Micro Hei';
    font-weight: lighter;
    text-shadow: 0px 1px 1px #cccccc;
  }
`;
/* harmony default export */ const MainStyle = (style);

;// CONCATENATED MODULE: ./src/ts/LoadResource.ts
function loadJS(url) {
    document
        .querySelectorAll("head")[0]
        .append(DOMParse(`<script type="text/javascript" src="${url}"></script>`));
}
function loadLINK(link) {
    document
        .querySelectorAll("head")[0]
        .append(DOMParse(`<link class="append-style" type="text/css" rel="stylesheet" href="${link}"></link>`));
}
function loadCSS(css) {
    document
        .querySelectorAll("head")[0]
        .append(DOMParse(`<style class="append-style">${css}</style>`));
}
function DOMParse(string) {
    let div = document.createElement("div");
    div.innerHTML = string;
    return div.firstChild;
}
/* harmony default export */ const LoadResource = ({ loadCSS: loadCSS, loadJS: loadJS, loadLINK: loadLINK });

;// CONCATENATED MODULE: ./src/ts/CheckUsingOld.ts

function checkUsingOld() {
    if (ConfigOperations.readUserConfig()["back-to-old"].value) {
        // true
        let notify = ElNotification({
            title: "免Flash文件上传",
            type: "warning",
            message: `正在使用旧版,点此回到新版界面`,
            duration: 0,
            onClick: () => {
                ConfigOperations.setUserConfig("back-to-old", false);
                window.location.reload();
                notify.close();
            },
        });
        return true;
    }
    else {
        return false;
    }
}
/* harmony default export */ const CheckUsingOld = (checkUsingOld);

;// CONCATENATED MODULE: ./src/index.ts









ConfigOperations.initConfig();
src_main();
function src_main() {
    const href = window.location.href;
    if (ConfigOperations.readUserConfig()["back-to-old"].value === false) {
        Log("vue version enabled");
        if (href.indexOf("personal.do") !== -1) {
            Log("enter page personal.do");
            CheckUpdate();
            removeTags();
            LoadResource.loadLINK(`https://fastly.jsdelivr.net/npm/[email protected]/dist/css/mdui.min.css`);
            LoadResource.loadCSS(MainStyle);
            createApp(components_Main).use(route).mount("body");
        }
    }
    else {
        Log("script version enabled");
        if (href.indexOf("personal.do") !== -1) {
            CheckUpdate();
            CheckUsingOld();
        }
    }
}
function removeTags() {
    Log("tags removed");
    document.querySelectorAll("head link, head script").forEach((n) => {
        n.remove();
    });
}

})();

/******/ })()
;